Dataset Viewer
Auto-converted to Parquet
problem
stringlengths
353
1.09k
answer
stringlengths
65
284
Using Cc1c(C(=O)Nc2ccc(C3CCN(C(=O)OC(C)(C)C)CC3)nc2)cnn1-c1ccc(C(F)(F)F)cn1 to manulfacture Cc1c(C(=O)Nc2ccc(C3CCNCC3)nc2)cnn1-c1ccc(C(F)(F)F)cn1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["O=C(O)C(F)(F)F", "ClCCl"], "temperature": ["25.0"], "agent": ["[OH-]", "[Na+]"], "time": ["2.5"]}
Using CN1C(=O)C(Br)=C(c2c(CCCCc3cc4ccccc4[nH]3)[nH]c3ccccc23)C1=O to manulfacture CN1C(=O)CC(c2c(CCCCc3cc4ccccc4[nH]3)[nH]c3ccccc23)C1=O, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CO"], "temperature": [], "agent": ["[OH-]", "[Pd+2]"], "time": []}
Using COC(=O)[C@H](C(C)C)N(C)C(=O)c1ccc(-c2ccc([N+](=O)[O-])cc2)cc1 to manulfacture COC(=O)[C@H](C(C)C)N(C)C(=O)c1ccc(-c2ccc(N)cc2)cc1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CCO"], "temperature": [], "agent": ["[Fe]", "Cl"], "time": []}
Using BrC(Br)(Br)Br, OCc1cc2ccccc2cc1I to manulfacture BrCc1cc2ccccc2cc1I, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["ClCCl"], "temperature": ["25.0"], "agent": ["c1ccc(P(c2ccccc2)c2ccccc2)cc1"], "time": ["4.0"]}
Using CC(C)(C)OC(=O)NCCO, COC(=O)c1cccc(OC)c1O to manulfacture COC(=O)c1cccc(OC)c1OCCNC(=O)OC(C)(C)C, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["C1CCOC1"], "temperature": [], "agent": ["c1ccc(P(c2ccccc2)c2ccccc2)cc1", "CC(C)OC(=O)/N=N/C(=O)OC(C)C"], "time": ["0.5"]}
Using O=Cc1ccc(OC(F)F)c(OCC2CC2)c1, O=[Mn](=O)(=O)[O-] to manulfacture O=C(O)c1ccc(OC(F)F)c(OCC2CC2)c1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["O", "CC(C)=O"], "temperature": ["60.0"], "agent": ["O=C([O-])[O-]", "[K+]"], "time": []}
Using CC(C)[N-]C(C)C, CN1C(=O)C[C@@](C)(c2cccc([N+](=O)[O-])c2)N=C1NC(=O)OC(C)(C)C to manulfacture CC[C@H]1C(=O)N(C)C(NC(=O)OC(C)(C)C)=N[C@]1(C)c1cccc([N+](=O)[O-])c1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["C1CCOC1", "CCI"], "temperature": [], "agent": ["[Li+]"], "time": ["1.0"]}
Using CC(C)(C)OC(=O)N1CCC(c2ncnc3cc(OCCCC#N)ccc23)CC1, [N-]=[N+]=[N-] to manulfacture CC(C)(C)OC(=O)N1CCC(c2ncnc3cc(OCCCc4nnn[nH]4)ccc23)CC1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["Cc1ccccc1"], "temperature": ["100.0"], "agent": ["[Na+]", "Cl"], "time": ["6.5"]}
Using COc1ccc2c(c1)[C@]1(C[C@H]1c1ccc3c(-c4ccc(N5CCOCC5)nc4)nn(COCC[Si](C)(C)C)c3c1)C(=O)N2 to manulfacture COc1ccc2c(c1)[C@]1(C[C@H]1c1ccc3c(-c4ccc(N5CCOCC5)nc4)n[nH]c3c1)C(=O)N2, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["C1CCOC1", "CCOC(C)=O"], "temperature": [], "agent": ["CCCC[N+](CCCC)(CCCC)CCCC", "[F-]"], "time": []}
Using CN1C(=O)NC2CCCC21, Clc1ccc(C#Cc2ccccc2)nn1 to manulfacture CN1C(=O)N(c2ccc(C#Cc3ccccc3)nn2)C2CCCC21, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CN(C)C=O"], "temperature": ["25.0"], "agent": ["[Na+]", "[H-]"], "time": ["0.5"]}
Using CC(C)(C)OC(=O)N1C(=O)CCc2ccc(OCc3cccc(Cl)c3)cc21, CCOC(=O)CBr to manulfacture CCOC(=O)CC1Cc2ccc(OCc3cccc(Cl)c3)cc2N(C(=O)OC(C)(C)C)C1=O, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["C1CCOC1"], "temperature": ["25.0"], "agent": ["C[Si](C)(C)[N-][Si](C)(C)C", "[Li+]"], "time": ["8.0"]}
Using CC(=O)OC(C)=O, CCOC(=O)CC#N to manulfacture CCOC(=O)C(C#N)=C(C)O, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["O", "CN(C)C=O"], "temperature": ["25.0"], "agent": ["O=C([O-])[O-]", "[K+]"], "time": ["0.25"]}
Using BrCc1ncccc1Br, [C-]#N to manulfacture N#CCc1ncccc1Br, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["O", "C1COCCO1"], "temperature": ["25.0"], "agent": ["[Na+]"], "time": ["16.0"]}
Using CCNC(=O)Nc1cccc2c1ccc(=O)n2CCN1CCC(N(Cc2ccc3c(c2)OCCO3)C(=O)OC(C)(C)C)CC1 to manulfacture CCNC(=O)Nc1cccc2c1ccc(=O)n2CCN1CCC(NCc2ccc3c(c2)OCCO3)CC1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["C1COCCO1"], "temperature": ["25.0"], "agent": ["Cl"], "time": ["3.0"]}
Using CCCN(CCC)C(=O)c1cc2cc(OC)ccc2n1Cc1ccccc1 to manulfacture CCCN(CCC)C(=O)C1Cc2cc(OC)ccc2N1Cc1ccccc1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CO", "CCOC(C)=O"], "temperature": ["25.0"], "agent": ["[Mg]"], "time": ["12.0"]}
Using COCCCN1CCCc2ccc(CO[C@H]3CN(C(=O)OC(C)(C)C)CC[C@@H]3c3ccc(OCCCOCc4ccccc4OC)cc3)cc21 to manulfacture COCCCN1CCCc2ccc(CO[C@H]3CNCC[C@@H]3c3ccc(OCCCOCc4ccccc4OC)cc3)cc21, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CO"], "temperature": [], "agent": ["Cl"], "time": []}
Using CCC1(CC)C(=O)NC1Oc1ccc(C(=O)CCC#N)cc1, C=CC[C@@H](N=C=O)c1ccc(C)cc1 to manulfacture C=CC[C@@H](NC(=O)N1C(=O)C(CC)(CC)[C@@H]1Oc1ccc(C(=O)CCC#N)cc1)c1ccc(C)cc1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CN(C)C=O"], "temperature": [], "agent": ["O=C([O-])[O-]", "[K+]"], "time": []}
Using CC(=O)O[C@H](C)[C@H](NC(=O)OCc1ccccc1)C(=O)OC[C@H](NC(=O)C(F)(F)F)C(=O)OCc1ccccc1 to manulfacture CC(=O)O[C@H](C)[C@H](N)C(=O)OC[C@H](NC(=O)C(F)(F)F)C(=O)O, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CC(=O)O"], "temperature": [], "agent": ["[Pd]"], "time": ["2.0"]}
Using COc1ccc(CCCOc2ccc(CCC3(NC(=O)OC(C)(C)C)COC(C)(C)OC3)cc2C(F)(F)F)c(OC)c1 to manulfacture COc1ccc(CCCOc2ccc(CCC(N)(CO)CO)cc2C(F)(F)F)c(OC)c1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CCO"], "temperature": ["80.0"], "agent": ["Cl"], "time": ["1.5"]}
Using Oc1ccc2ccccc2c1, COC(=O)[C@@H]1C[C@@H](O)CN1C(=O)OC(C)(C)C to manulfacture COC(=O)[C@@H]1C[C@H](Oc2ccc3ccccc3c2)CN1C(=O)OC(C)(C)C, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["C1CCOC1"], "temperature": [], "agent": ["c1ccc(P(c2ccccc2)c2ccccc2)cc1", "CC(C)OC(=O)/N=N/C(=O)OC(C)C"], "time": []}
Using CCOC(=O)c1cn[nH]c1, BrCc1ccccc1 to manulfacture CCOC(=O)c1cnn(Cc2ccccc2)c1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CN(C)C=O"], "temperature": ["25.0"], "agent": ["[Na+]", "[H-]"], "time": ["0.5"]}
Using CCCC(c1ccc(C(=O)OC)cc1)C(C(=O)OC(C)(C)C)c1ccc(Cl)cc1 to manulfacture CCCC(c1ccc(C(=O)O)cc1)C(C(=O)OC(C)(C)C)c1ccc(Cl)cc1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CO"], "temperature": [], "agent": ["[OH-]", "[Na+]"], "time": []}
Using CSc1ncc2c(n1)CCN(c1cccc(C(=O)Nc3ccc(C(C)C)cc3)n1)C2, O=S([O-])OO to manulfacture CC(C)c1ccc(NC(=O)c2cccc(N3CCc4nc(S(C)=O)ncc4C3)n2)cc1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["C1CCOC1", "O"], "temperature": ["25.0"], "agent": ["[K+]"], "time": ["3.0"]}
Using Cc1cc(C[C@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(C)(C)N2C(=O)OC(C)(C)C)cc(Cl)n1 to manulfacture Cc1cc(C[C@H]2[C@@H](CO)OC(C)(C)N2C(=O)OC(C)(C)C)cc(Cl)n1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["C1CCOC1"], "temperature": ["0.0"], "agent": ["CCCC[N+](CCCC)(CCCC)CCCC", "[F-]"], "time": ["1.0"]}
Using COc1ccc2c(ccn2C)c1 to manulfacture COc1ccc2c(c1)CCN2C, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["O=C(O)C(F)(F)F", "CC(=O)O"], "temperature": [], "agent": ["[OH-]", "[Na+]", "[BH3-]C#N"], "time": ["2.0"]}
Using Cc1ccc2c(c1C)C(=O)CC2, [BH3-]C#N to manulfacture Cc1ccc2c(c1C)C(N)CC2, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CC(C)O"], "temperature": [], "agent": ["[Na+]"], "time": []}
Using Cc1cn2c(nc1=O)O[C@H]1[C@H](O)[C@@H](CO)O[C@H]12, CS to manulfacture CS[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1n1cc(C)c(=O)[nH]c1=O, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CN(C)C=O"], "temperature": [], "agent": ["CN(C)C(=N)N(C)C"], "time": ["12.0"]}
Using CCOC(=O)c1cc2c(OCc3csc(C)n3)cccc2n1C(=O)OC(C)(C)C to manulfacture Cc1nc(COc2cccc3[nH]c(C(=O)O)cc23)cs1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CCO"], "temperature": ["60.0"], "agent": ["[OH-]", "[Na+]"], "time": ["18.0"]}
Using CCOC(=O)c1nc(O)c(CCCOCc2ccccc2)nc1C to manulfacture CCOC(=O)c1nc(O)c(CCCO)nc1C, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CCO"], "temperature": ["25.0"], "agent": ["[OH-]", "[Pd+2]"], "time": []}
Using CC[C@]12CC[C@@H]3c4ccc(OC)cc4CC[C@H]3[C@@H]1CC[C@@H]2O, CN(C)CCCl to manulfacture CC[C@]12CC[C@@H]3c4ccc(OC)cc4CC[C@H]3[C@@H]1CC[C@@H]2OCCN(C)C, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["c1ccccc1"], "temperature": ["25.0"], "agent": ["[Na+]", "[NH2-]", "Cl"], "time": []}
Using Oc1ccc(C(=C2CCCCCCC2)c2ccc(Br)cc2)cc1, OB(O)c1ccoc1 to manulfacture Oc1ccc(C(=C2CCCCCCC2)c2ccc(-c3ccoc3)cc2)cc1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["C1CCOC1", "O"], "temperature": [], "agent": ["[Na+]", "O=C([O-])[O-]", "Cl[Pd](Cl)([P](c1ccccc1)(c1ccccc1)c1ccccc1)[P](c1ccccc1)(c1ccccc1)c1ccccc1"], "time": []}
Using O=S1(=O)c2ccccc2Oc2cc(F)ccc21, OCC(F)(F)F to manulfacture O=S1(=O)c2ccccc2Oc2cc(OCC(F)(F)F)ccc21, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CN(C)C=O"], "temperature": ["25.0"], "agent": ["[H-]", "[K+]"], "time": ["1.0"]}
Using CC(C)(C)OC(=O)OC(=O)OC(C)(C)C, O=C1CCCCN1 to manulfacture CC(C)(C)OC(=O)N1CCCCC1=O, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CCN(CC)CC", "CC#N"], "temperature": [], "agent": ["CN(C)c1ccncc1"], "time": ["0.17"]}
Using CCOC(=O)C1CCCC(NC(=O)c2c(-c3ccncc3F)noc2C)C1 to manulfacture CCOC(=O)C1CCCC(n2c(=O)c3c(C)onc3c3ccncc32)C1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CN(C)C=O"], "temperature": ["25.0"], "agent": ["C[Si](C)(C)[N-][Si](C)(C)C"], "time": ["0.33"]}
Using CN(C)C(=O)CN, Cn1c(Nc2nc3ccc(OC(F)(F)F)cc3s2)nc2cc(C(=O)O)cnc21 to manulfacture CN(C)C(=O)CNC(=O)c1cnc2c(c1)nc(Nc1nc3ccc(OC(F)(F)F)cc3s1)n2C, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CC(=O)O", "CCN(C(C)C)C(C)C"], "temperature": [], "agent": ["F[P-](F)(F)(F)(F)F", "CN(C)C(On1nnc2ccccc21)=[N+](C)C"], "time": []}
Using CCOC(=O)c1cc2cccc(F)c2[nH]1, CI to manulfacture CCOC(=O)c1cc2cccc(F)c2n1C, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["C1CCOC1"], "temperature": [], "agent": ["[Na+]", "[H-]"], "time": ["1.0"]}
Using CCc1cc(C(=O)NNC(=O)c2sc(C)c3c2CC2C3C2(C)C)cc(C)n1 to manulfacture CCc1cc(-c2nnc(-c3sc(C)c4c3C[C@@H]3[C@H]4C3(C)C)o2)cc(C)n1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["C1CCOC1", "CCOC(C)=O"], "temperature": ["110.0"], "agent": ["CC[N+](CC)(CC)S(=O)(=O)N=C([O-])OC"], "time": []}
Using C1CCOC1, Cc1cc(C2(c3cc(C)c(O[Si](C)(C)C(C)(C)C)c(C)c3)C(=O)N(c3ccnc(Cl)n3)c3ccccc32)cc(C)c1O[Si](C)(C)C(C)(C)C to manulfacture COc1nccc(N2C(=O)C(c3cc(C)c(O)c(C)c3)(c3cc(C)c(O)c(C)c3)c3ccccc32)n1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CO"], "temperature": [], "agent": ["[Na+]", "C[O-]"], "time": []}
Using O=C1OC(=O)c2ccccc21, CCOC(=O)CCCCCCCCCc1ccccc1 to manulfacture CCOC(=O)CCCCCCCCCc1ccc(C(=O)c2ccccc2C(=O)O)cc1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["ClCCCl"], "temperature": ["25.0"], "agent": ["[Al+3]", "[Cl-]"], "time": ["20.0"]}
Using O=C(O)c1sc(-c2ccccc2)cc1N1C(=O)CNC[C@H]1C1CCCCC1, O=Cc1cccc(F)c1N1CCOCC1 to manulfacture O=C(O)c1sc(-c2ccccc2)cc1N1C(=O)CN(Cc2cccc(F)c2N2CCOCC2)C[C@H]1C1CCCCC1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CO", "CC(=O)O"], "temperature": ["75.0"], "agent": ["CC(=O)O[BH-](OC(C)=O)OC(C)=O", "[Na+]"], "time": ["3.0"]}
Using CC(C)(C)OC(=O)Oc1ccc([C@H](CN(CCCCCCOCCCCc2ccc([N+](=O)[O-])cc2)C(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C)c2ccc(=O)[nH]c12 to manulfacture CC(C)(C)OC(=O)Oc1ccc([C@H](CN(CCCCCCOCCCCc2ccc(N)cc2)C(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C)c2ccc(=O)[nH]c12, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CO"], "temperature": [], "agent": ["[H][H]", "[Pd]"], "time": []}
Using CC(C)(C)OC(=O)Nc1cnn(C(C)(C)COS(C)(=O)=O)c1, CS(=O)[O-] to manulfacture CC(C)(C)OC(=O)Nc1cnn(C(C)(C)CS(C)(=O)=O)c1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["O", "CN(C)C=O"], "temperature": ["140.0"], "agent": ["[Na+]", "[I-]"], "time": ["8.0"]}
Using COc1ccc2c(c1)C(COS(C)(=O)=O)CN(C(=O)OC(C)(C)C)C2, [C-]#N to manulfacture COc1ccc2c(c1)C(CC#N)CN(C(=O)OC(C)(C)C)C2, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["O", "CS(C)=O"], "temperature": ["80.0"], "agent": ["[K+]"], "time": []}
Using CCOC(=S)[S-], Nc1ccc(O)cc1O to manulfacture Oc1ccc2nc(S)oc2c1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CCO"], "temperature": ["25.0"], "agent": ["[OH-]", "Cl", "[K+]"], "time": ["16.0"]}
Using Cc1cc([N+](=O)[O-])cc(C)c1NC(=O)CC1CCCC1 to manulfacture Cc1cc(N)cc(C)c1NC(=O)CC1CCCC1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["C1CCOC1", "CC(=O)O"], "temperature": ["0.0"], "agent": ["[Na+]", "O=C([O-])[O-]", "[Zn]"], "time": ["2.0"]}
Using CCCCCCCCCCCC(C)=O, OCC(O)CO to manulfacture CCCCCCCCCCCC1(C)OCC(CO)O1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["O", "c1ccccc1"], "temperature": ["25.0"], "agent": ["Cc1ccc(S(=O)(=O)O)cc1"], "time": []}
Using Cc1ccc(S(=O)(=O)Cl)cc1, CS(=O)(=O)c1ccc2c(c1)O[C@@H](CO)CO2 to manulfacture Cc1ccc(S(=O)(=O)OC[C@H]2COc3ccc(S(C)(=O)=O)cc3O2)cc1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["ClCCl"], "temperature": [], "agent": ["CN(C)c1ccncc1"], "time": []}
Using CCOc1ccc(Cl)cc1-c1cc(Cl)nc(N)n1, Cc1ccc(N)cc1 to manulfacture CCOc1ccc(Cl)cc1-c1cc(Nc2ccc(C)cc2)nc(N)n1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CCO", "C1COCCO1"], "temperature": [], "agent": ["Cl"], "time": ["8.0"]}
Using CC(C)I, Oc1ccc(Oc2ccc(O)cc2)cc1 to manulfacture CC(C)Oc1ccc(Oc2ccc(O)cc2)cc1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["O", "CCO"], "temperature": [], "agent": ["[OH-]", "[K+]"], "time": []}
Using NC(=O)CNc1ncccc1[N+](=O)[O-] to manulfacture NC(=O)CNc1ncccc1N, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CC#N", "CCOC(C)=O"], "temperature": [], "agent": ["[Pd]"], "time": []}
Using OCc1c(F)cccc1I, C=CCBr to manulfacture C=CCOCc1c(F)cccc1I, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["C1CCOC1"], "temperature": ["25.0"], "agent": ["[Na+]", "[H-]"], "time": ["16.0"]}
Using Nc1nc2cc(Cl)c(Cl)cc2[nH]1, BrCc1ccccc1 to manulfacture Nc1nc2cc(Cl)c(Cl)cc2n1Cc1ccccc1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CC#N"], "temperature": ["25.0"], "agent": ["[OH-]", "[Na+]"], "time": ["1.0"]}
Using COc1ccc2[nH]ncc2c1 to manulfacture Oc1ccc2[nH]ncc2c1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["O", "ClCCl"], "temperature": ["0.0"], "agent": ["BrB(Br)Br", "[Na+]", "O=C([O-])O"], "time": []}
Using CC(C)(C)OC(=O)NCCOc1cc(C#N)ccc1I, C=C(NC(C)=O)C(=O)OC to manulfacture COC(=O)C(=Cc1ccc(C#N)cc1OCCNC(=O)OC(C)(C)C)NC(C)=O, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CCN(CC)CC", "CC#N"], "temperature": [], "agent": ["[Pd+2]", "Cc1ccccc1P(c1ccccc1C)c1ccccc1C", "CC(=O)[O-]"], "time": []}
Using CCc1cc(NC(=O)N2CCCc3cc(C=O)c(C(OC)OC)nc32)ncc1C#N to manulfacture CCc1cc(NC(=O)N2CCCc3cc(C=O)c(C=O)nc32)ncc1C#N, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["C1CCOC1", "O"], "temperature": ["25.0"], "agent": ["[Na+]", "O=C([O-])O", "Cl"], "time": ["48.0"]}
Using COCCO, O=C(Nc1cccc2c(Cl)ccnc12)c1c(Cl)cccc1Cl to manulfacture COCCOc1ccnc2c(NC(=O)c3c(Cl)cccc3Cl)cccc12, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CN1CCCC1=O", "CCOC(C)=O"], "temperature": ["25.0"], "agent": ["CC(C)(C)[O-]", "[K+]"], "time": ["0.5"]}
Using Cc1nccn1-c1nc(-c2ccc(Cl)cc2)c(CCCOS(C)(=O)=O)o1, CCOP(=O)(Cc1ccc(O)cc1)OCC to manulfacture CCOP(=O)(Cc1ccc(OCCCc2oc(-n3ccnc3C)nc2-c2ccc(Cl)cc2)cc1)OCC, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["O", "CN(C)C=O"], "temperature": [], "agent": ["O=C([O-])[O-]", "[K+]"], "time": []}
Using O=C1CSC(=S)N1, CCCc1c(OCc2ccc(C=O)cc2)ccc(C(C)=O)c1OC(C)=O to manulfacture CCCc1c(OCc2ccc(C=C3SC(=S)NC3=O)cc2)ccc(C(C)=O)c1OC(C)=O, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CC(=O)O"], "temperature": [], "agent": ["[Na+]", "CC(=O)[O-]"], "time": []}
Using CCCCc1cc2ccccc2c(Oc2ccc(/C=C/C(=O)O)cc2)c1-c1ccc(OC)cc1 to manulfacture CCCCc1cc2ccccc2c(Oc2ccc(/C=C/C(=O)O)cc2)c1-c1ccc(O)cc1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["ClCCl"], "temperature": [], "agent": ["BrB(Br)Br"], "time": []}
Using N#CC1CCNCC1, Cc1cc(C(=O)N(C)[C@H](C=O)C(C)C)ccc1F to manulfacture Cc1cc(C(=O)N(C)[C@H](CN2CCC(C#N)CC2)C(C)C)ccc1F, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["ClCCl", "CCO"], "temperature": [], "agent": ["[Na+]", "[BH4-]", "[Na]"], "time": ["1.0"]}
Using CCOC(=O)[C@H]1CCCN(C[C@@H](O)c2ccc(-c3noc(-c4onc(-c5ccccc5)c4C(F)(F)F)n3)cc2)C1 to manulfacture O=C(O)[C@H]1CCCN(C[C@@H](O)c2ccc(-c3noc(-c4onc(-c5ccccc5)c4C(F)(F)F)n3)cc2)C1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CC#N"], "temperature": [], "agent": ["Cl"], "time": ["8.0"]}
Using C[C@H](NC(=O)OC(C)(C)C)c1cccc(NCc2cccnc2)c1 to manulfacture C[C@H](N)c1cccc(NCc2cccnc2)c1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["C1COCCO1"], "temperature": [], "agent": ["Cl"], "time": []}
Using COC(=O)Cc1nn(-c2ccccn2)c2[nH]c3ccccc3c(=O)c12 to manulfacture O=C(O)Cc1nn(-c2ccccn2)c2[nH]c3ccccc3c(=O)c12, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CO"], "temperature": ["25.0"], "agent": ["[OH-]", "[Na+]", "Cl"], "time": ["2.0"]}
Using C=CCN1CCOc2ccc(-c3c([C@H](OC(C)(C)C)C(=O)OC)c(C)nc4cc(-c5cccc(Br)c5)nn34)c(Cl)c21, C=CCCc1ccccc1B(O)O to manulfacture C=CCCc1ccccc1-c1cccc(-c2cc3nc(C)c([C@H](OC(C)(C)C)C(=O)OC)c(-c4ccc5c(c4Cl)N(CC=C)CCO5)n3n2)c1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CN(C)C=O"], "temperature": ["90.0"], "agent": ["[Na+]", "c1ccc([P](c2ccccc2)(c2ccccc2)[Pd]([P](c2ccccc2)(c2ccccc2)c2ccccc2)([P](c2ccccc2)(c2ccccc2)c2ccccc2)[P](c2ccccc2)(c2ccccc2)c2ccccc2)cc1", "O=C([O-])[O-]"], "time": []}
Using CCOC(=O)c1cc2cc(OC3CCN(C(C)C)CC3)cnc2n1C(=O)OC(C)(C)C to manulfacture CC(C)N1CCC(Oc2cnc3[nH]c(C(=O)O)cc3c2)CC1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["C1COCCO1"], "temperature": [], "agent": ["Cl"], "time": ["16.0"]}
Using C1COCCN1, C[C@H](Nc1ncnc2c1ncn2C1CCCCO1)c1nc2ccc(F)c(C(=O)O)c2n1C1CC1 to manulfacture C[C@H](Nc1ncnc2[nH]cnc12)c1nc2ccc(F)c(C(=O)N3CCOCC3)c2n1C1CC1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["ClCCl", "CCN(C(C)C)C(C)C"], "temperature": ["25.0"], "agent": ["F[P-](F)(F)(F)(F)F", "CN(C)C(On1nnc2cccnc21)=[N+](C)C"], "time": ["1.0"]}
Using Fc1ccc(S)cc1, C[Si](C)(C)C#CC(=Nc1ccccc1)SCC1CC1 to manulfacture Fc1ccc(SC=CC(=Nc2ccccc2)SCC2CC2)cc1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CO"], "temperature": ["25.0"], "agent": ["O=C([O-])[O-]", "[K+]"], "time": ["1.0"]}
Using COC(=O)c1cnc(O)cn1, O=C([O-])C(F)(F)Cl to manulfacture COC(=O)c1cnc(OC(F)F)cn1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CN(C)C=O"], "temperature": ["100.0"], "agent": ["[Na+]", "O=C([O-])[O-]", "[K+]"], "time": ["0.5"]}
Using O=C(OCC(F)F)c1ccc(OCC(F)F)nc1Cl, C[O-] to manulfacture COC(=O)c1ccc(OCC(F)F)nc1OC, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["C1CCOC1", "O"], "temperature": ["25.0"], "agent": ["[Na+]"], "time": ["15.0"]}
Using Cn1c(S)nc2ccsc2c1=O, CC(=O)Oc1ccc(C(=O)c2ccc(CBr)cc2)cc1 to manulfacture CC(=O)Oc1ccc(C(=O)c2ccc(CSc3nc4ccsc4c(=O)n3C)cc2)cc1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["O", "CCO"], "temperature": ["60.0"], "agent": ["[OH-]", "[Na+]"], "time": ["1.0"]}
Using CCOC(=O)C(C)=O, NNc1cccc([N+](=O)[O-])c1 to manulfacture CCOC(=O)/C(C)=N/Nc1cccc([N+](=O)[O-])c1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CCO"], "temperature": ["25.0"], "agent": ["Cl"], "time": ["4.0"]}
Using CC[C@@H]1C[C@H](NS(=O)(=O)C2CC2)CN1C(=O)OC(C)(C)C to manulfacture CC[C@@H]1C[C@H](NS(=O)(=O)C2CC2)CN1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["C1COCCO1"], "temperature": ["60.0"], "agent": ["Cl"], "time": ["4.0"]}
Using Oc1cccc(Cc2c(Cc3ccccc3)cnc3c(C(F)(F)F)cccc23)c1, COC(=O)c1cccc(CBr)c1 to manulfacture COC(=O)c1cccc(COc2cccc(Cc3c(Cc4ccccc4)cnc4c(C(F)(F)F)cccc34)c2)c1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CC#N"], "temperature": [], "agent": ["O=C([O-])[O-]", "[Cs+]"], "time": []}
Using Clc1ccnc(Cl)n1, CCOC(=O)CC1OB(O)c2cc(O)cc(C)c21 to manulfacture CCOC(=O)CC1OB(O)c2cc(Oc3ccnc(Cl)n3)cc(C)c21, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CN(C)C=O"], "temperature": ["25.0"], "agent": ["O=C([O-])[O-]", "[Cs+]"], "time": ["24.0"]}
Using CCN=C=NCCCN(C)C, COc1ccc(Nc2nc(-c3cccc(C(=O)O)c3)nc3scnc23)cc1OC to manulfacture COc1ccc(Nc2nc(-c3cccc(C(N)=O)c3)nc3scnc23)cc1OC, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["ClCCl", "CCN(CC)CC"], "temperature": ["25.0"], "agent": ["On1nnc2ccccc21"], "time": ["3.0"]}
Using CCCOB(OCCC)OCCC, CCc1nn(-c2ccccc2)c2cc(Br)ccc12 to manulfacture CCc1nn(-c2ccccc2)c2cc(B(O)O)ccc12, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["C1CCOC1"], "temperature": ["-78.0"], "agent": ["[Li]CCCC"], "time": ["0.08"]}
Using COc1ccc(N2CCCn3c2nc2c(Cl)ccc(CO)c23)c(Cl)c1 to manulfacture COc1ccc(N2CCCn3c2nc2c(Cl)ccc(C=O)c23)c(Cl)c1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CS(C)=O"], "temperature": ["25.0"], "agent": ["CC(=O)OI1(OC(C)=O)(OC(C)=O)OC(=O)c2ccccc21"], "time": ["2.0"]}
Using C[C@H](NC(=O)OCc1ccccc1)C(=O)O[C@H]1c2cc(C#N)ccc2OC(C)(C)[C@@H]1Br to manulfacture CC1(C)Oc2ccc(C#N)cc2[C@@H]2O[C@@H]21, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["O", "C1COCCO1"], "temperature": ["25.0"], "agent": ["[OH-]", "[Na+]"], "time": ["1.0"]}
Using CS(=O)(=O)OCCc1ccc(OS(C)(=O)=O)cc1, CCOC(=O)C(Cc1ccc(O)c(NC(=O)OC(C)(C)C)c1)OCC to manulfacture CCOC(=O)C(Cc1ccc(OCCc2ccc(OS(C)(=O)=O)cc2)c(NC(=O)OC(C)(C)C)c1)OCC, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CCC(C)=O"], "temperature": [], "agent": ["O=C([O-])[O-]", "[K+]"], "time": []}
Using CCCc1nc2ncccc2[nH]1, BrCc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 to manulfacture CCCc1nc2cccnc2n1Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CCOC(C)=O"], "temperature": [], "agent": ["[Na+]", "[H-]"], "time": []}
Using O=Cc1cccc2ccccc12, CN1CCCC1CCN to manulfacture CN1CCCC1CCNCc1cccc2ccccc12, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["ClCCl"], "temperature": [], "agent": ["[Na]"], "time": []}
Using Cc1ccc(Sc2c(Cl)c(C(=O)O)c(C(O)=NCCO)c(Cl)c2Sc2ccc(C)cc2)cc1, CCCCCCCCCCS to manulfacture CCCCCCCCCCSc1c(Sc2ccc(C)cc2)c(Sc2ccc(C)cc2)c(SCCCCCCCCCC)c(C(O)=NCCO)c1C(=O)O, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CN(C)C=O"], "temperature": [], "agent": ["O=C([O-])[O-]", "[K+]"], "time": []}
Using CC(C)(C)CC1NC(C(=O)O)C(c2cccc(Cl)c2F)C1(C#N)c1ccc(Cl)cc1F, NC(=O)c1cccc(N)c1 to manulfacture CC(C)(C)CC1NC(C(=O)Nc2cccc(C(N)=O)c2)C(c2cccc(Cl)c2F)C1(C#N)c1ccc(Cl)cc1F, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["ClCCl", "CCN(C(C)C)C(C)C"], "temperature": ["25.0"], "agent": ["F[P-](F)(F)(F)(F)F", "CN(C)C(On1nnc2cccnc21)=[N+](C)C"], "time": ["8.0"]}
Using [OH-], CC1(C)N=C(c2ccccn2)c2cc(C#N)ccc2O1 to manulfacture CC1(C)N=C(c2ccccn2)c2cc(C(N)=O)ccc2O1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["C1CCOC1"], "temperature": ["25.0"], "agent": ["OO", "[Na+]"], "time": ["0.67"]}
Using C=CC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@H](O)CC[C@]4(C)[C@H]3C(=O)C[C@]12C, CCO to manulfacture CCOCCC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@H](O)CC[C@]4(C)[C@H]3C(=O)C[C@]12C, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["O"], "temperature": [], "agent": ["O=C([O-])O", "[K+]"], "time": []}
Using CCCCCCCCCBr, COc1cc(C)nc(N(C)C)n1 to manulfacture CCCCCCCCCCc1cc(OC)nc(N(C)C)n1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["C1CCOC1"], "temperature": ["23.0"], "agent": ["[Li]CCCC"], "time": ["0.33"]}
Using CC(C)(C)OC(=O)N1CCC(Nc2ncnc3ccc(Cl)nc23)CC1, CC1(C)OB(c2cnc(Cl)c(NS(=O)(=O)c3ccc(F)cc3F)c2)OC1(C)C to manulfacture CC(C)(C)OC(=O)N1CCC(Nc2ncnc3ccc(-c4cnc(Cl)c(NS(=O)(=O)c5ccc(F)cc5F)c4)nc23)CC1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["C1COCCO1"], "temperature": ["25.0"], "agent": ["[Na+]", "O=C([O-])O"], "time": []}
Using CCCCCCCCCCCCc1cnn(C(C(=O)OCC)c2ccccc2)n1 to manulfacture CCCCCCCCCCCCc1cnn(C(C(=O)O)c2ccccc2)n1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CCO"], "temperature": [], "agent": ["[OH-]", "[Na+]"], "time": ["1.0"]}
Using O=CC1CCN(Cc2ccc(C(F)(F)F)cc2C(F)(F)F)CC1, O=C1N=C(N[C@@H]2COCC[C@H]2O)CS1 to manulfacture O=C1N=C(N[C@@H]2COCC[C@H]2O)/C(=C/C2CCN(Cc3ccc(C(F)(F)F)cc3C(F)(F)F)CC2)S1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CC(C)O"], "temperature": ["75.0"], "agent": ["C1CC[NH2+]CC1", "CC(=O)[O-]"], "time": ["8.0"]}
Using Clc1ccc2c(c1)CCNC2, Cc1cc(Br)cc(C)c1NC(=O)CC(C)(C)C to manulfacture Cc1cc(N2CCc3cc(Cl)ccc3C2)cc(C)c1NC(=O)CC(C)(C)C, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["Cc1ccccc1"], "temperature": ["25.0"], "agent": ["Cl", "CC(C)(C)[O-]", "[K+]"], "time": ["0.25"]}
Using COc1cc(/C=C/c2ccc(C#N)cc2)ccc1C(OC)OC to manulfacture COc1cc(/C=C/c2ccc(C#N)cc2)ccc1C=O, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["C1CCOC1"], "temperature": [], "agent": ["Cc1ccc(S(=O)(=O)O)cc1"], "time": []}
Using O=C1OCCCCC1Br, Cc1[nH]nc(C(F)(F)F)c1Cl to manulfacture Cc1c(Cl)c(C(F)(F)F)nn1C1CCCCOC1=O, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CN(C)C=O"], "temperature": ["65.0"], "agent": ["O=C([O-])[O-]", "[K+]"], "time": []}
Using COC(=O)C1CC(=O)N(Cc2ccc(OC)cc2OC)C1, CI to manulfacture COC(=O)C1(C)CC(=O)N(Cc2ccc(OC)cc2OC)C1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["C1CCOC1", "O"], "temperature": ["25.0"], "agent": ["[Na+]", "[H-]"], "time": ["2.0"]}
Using Oc1cccc(Cl)n1, Cc1ccc(S(=O)(=O)OCC2COC(C)(C)O2)cc1 to manulfacture CC1(C)OCC(COc2cccc(Cl)n2)O1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CN(C)C=O"], "temperature": ["85.0"], "agent": ["O=C([O-])[O-]", "[Cs+]"], "time": ["18.0"]}
Using CCOC(=O)[C@@H]1OC(C)(C)N(C(=O)c2ccccc2)[C@H]1c1ccccc1 to manulfacture CC1(C)O[C@@H](C(=O)O)[C@H](c2ccccc2)N1C(=O)c1ccccc1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["C1CCOC1"], "temperature": [], "agent": ["[OH-]", "[Li+]"], "time": ["0.08"]}
Using NCc1ccccc1, COC(=O)[C@](C)(Cc1cccc(OCC(=O)c2ccccc2)c1)NC(=O)OC(C)(C)C to manulfacture COC(=O)[C@](C)(Cc1cccc(OCC(NCc2ccccc2)c2ccccc2)c1)NC(=O)OC(C)(C)C, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CC(=O)O", "CC(Cl)Cl"], "temperature": ["50.0"], "agent": ["CC(=O)O[BH-](OC(C)=O)OC(C)=O", "[Na+]"], "time": ["16.0"]}
Using O=c1[nH]c2cc(Cl)c([N+](=O)[O-])c(Cl)c2[nH]c1=O to manulfacture Nc1c(Cl)cc2[nH]c(=O)c(=O)[nH]c2c1Cl, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CCO"], "temperature": ["90.0"], "agent": ["Cl[Sn]Cl"], "time": ["0.5"]}
Using C=CCOC(=O)N(CC(=O)OC)C(=O)Nc1ccc(C(C)=NO)cc1 to manulfacture C=CCOC(=O)N1CC(=O)N(c2ccc(C(C)=NO)cc2)C1=O, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["CO"], "temperature": [], "agent": ["CO[Na]"], "time": []}
Using Cc1ccc(S(=O)(=O)n2ccc3nc(CNC(=O)OC(C)(C)C)cnc32)cc1 to manulfacture CC(C)(C)OC(=O)NCc1cnc2[nH]ccc2n1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["O", "C1COCCO1"], "temperature": ["85.0"], "agent": ["[OH-]", "[Na+]"], "time": []}
Using Cc1nc(-c2ccc(CBr)c([N+](=O)[O-])c2)no1, O=C1NC(=O)c2ccccc21 to manulfacture Cc1nc(-c2ccc(CN3C(=O)c4ccccc4C3=O)c([N+](=O)[O-])c2)no1, please predict the condition, including solvent, temperature, agent and time, in json format like: ``` { "solvent": [ "CCN(CC)CC", "CCOC(C)=O" ], "temperature": ["25.0"], "agent": [ "On1nnc2ccccc21", "C(=NC1CCCCC1)=NC1CCCCC1", "Cl" ], "time": ["24.0"] } ```
{"solvent": ["O", "CN(C)C=O"], "temperature": ["25.0"], "agent": ["[K]"], "time": []}
README.md exists but content is empty.
Downloads last month
9