{
// 获取包含Hugging Face文本的span元素
const spans = link.querySelectorAll('span.whitespace-nowrap, span.hidden.whitespace-nowrap');
spans.forEach(span => {
if (span.textContent && span.textContent.trim().match(/Hugging\s*Face/i)) {
span.textContent = 'AI快站';
}
});
});
// 替换logo图片的alt属性
document.querySelectorAll('img[alt*="Hugging"], img[alt*="Face"]').forEach(img => {
if (img.alt.match(/Hugging\s*Face/i)) {
img.alt = 'AI快站 logo';
}
});
}
// 替换导航栏中的链接
function replaceNavigationLinks() {
// 已替换标记，防止重复运行
if (window._navLinksReplaced) {
return;
}
// 已经替换过的链接集合，防止重复替换
const replacedLinks = new Set();
// 只在导航栏区域查找和替换链接
const headerArea = document.querySelector('header') || document.querySelector('nav');
if (!headerArea) {
return;
}
// 在导航区域内查找链接
const navLinks = headerArea.querySelectorAll('a');
navLinks.forEach(link => {
// 如果已经替换过，跳过
if (replacedLinks.has(link)) return;
const linkText = link.textContent.trim();
const linkHref = link.getAttribute('href') || '';
// 替换Spaces链接 - 仅替换一次
if (
(linkHref.includes('/spaces') || linkHref === '/spaces' ||
linkText === 'Spaces' || linkText.match(/^s*Spacess*$/i)) &&
linkText !== 'OCR模型免费转Markdown' &&
linkText !== 'OCR模型免费转Markdown'
) {
link.textContent = 'OCR模型免费转Markdown';
link.href = 'https://fast360.xyz';
link.setAttribute('target', '_blank');
link.setAttribute('rel', 'noopener noreferrer');
replacedLinks.add(link);
}
// 删除Posts链接
else if (
(linkHref.includes('/posts') || linkHref === '/posts' ||
linkText === 'Posts' || linkText.match(/^s*Postss*$/i))
) {
if (link.parentNode) {
link.parentNode.removeChild(link);
}
replacedLinks.add(link);
}
// 替换Docs链接 - 仅替换一次
else if (
(linkHref.includes('/docs') || linkHref === '/docs' ||
linkText === 'Docs' || linkText.match(/^s*Docss*$/i)) &&
linkText !== '模型下载攻略'
) {
link.textContent = '模型下载攻略';
link.href = '/';
replacedLinks.add(link);
}
// 删除Enterprise链接
else if (
(linkHref.includes('/enterprise') || linkHref === '/enterprise' ||
linkText === 'Enterprise' || linkText.match(/^s*Enterprises*$/i))
) {
if (link.parentNode) {
link.parentNode.removeChild(link);
}
replacedLinks.add(link);
}
});
// 查找可能嵌套的Spaces和Posts文本
const textNodes = [];
function findTextNodes(element) {
if (element.nodeType === Node.TEXT_NODE) {
const text = element.textContent.trim();
if (text === 'Spaces' || text === 'Posts' || text === 'Enterprise') {
textNodes.push(element);
}
} else {
for (const child of element.childNodes) {
findTextNodes(child);
}
}
}
// 只在导航区域内查找文本节点
findTextNodes(headerArea);
// 替换找到的文本节点
textNodes.forEach(node => {
const text = node.textContent.trim();
if (text === 'Spaces') {
node.textContent = node.textContent.replace(/Spaces/g, 'OCR模型免费转Markdown');
} else if (text === 'Posts') {
// 删除Posts文本节点
if (node.parentNode) {
node.parentNode.removeChild(node);
}
} else if (text === 'Enterprise') {
// 删除Enterprise文本节点
if (node.parentNode) {
node.parentNode.removeChild(node);
}
}
});
// 标记已替换完成
window._navLinksReplaced = true;
}
// 替换代码区域中的域名
function replaceCodeDomains() {
// 特别处理span.hljs-string和span.njs-string元素
document.querySelectorAll('span.hljs-string, span.njs-string, span[class*="hljs-string"], span[class*="njs-string"]').forEach(span => {
if (span.textContent && span.textContent.includes('huggingface.co')) {
span.textContent = span.textContent.replace(/huggingface.co/g, 'aifasthub.com');
}
});
// 替换hljs-string类的span中的域名（移除多余的转义符号）
document.querySelectorAll('span.hljs-string, span[class*="hljs-string"]').forEach(span => {
if (span.textContent && span.textContent.includes('huggingface.co')) {
span.textContent = span.textContent.replace(/huggingface.co/g, 'aifasthub.com');
}
});
// 替换pre和code标签中包含git clone命令的域名
document.querySelectorAll('pre, code').forEach(element => {
if (element.textContent && element.textContent.includes('git clone')) {
const text = element.innerHTML;
if (text.includes('huggingface.co')) {
element.innerHTML = text.replace(/huggingface.co/g, 'aifasthub.com');
}
}
});
// 处理特定的命令行示例
document.querySelectorAll('pre, code').forEach(element => {
const text = element.innerHTML;
if (text.includes('huggingface.co')) {
// 针对git clone命令的专门处理
if (text.includes('git clone') || text.includes('GIT_LFS_SKIP_SMUDGE=1')) {
element.innerHTML = text.replace(/huggingface.co/g, 'aifasthub.com');
}
}
});
// 特别处理模型下载页面上的代码片段
document.querySelectorAll('.flex.border-t, .svelte_hydrator, .inline-block').forEach(container => {
const content = container.innerHTML;
if (content && content.includes('huggingface.co')) {
container.innerHTML = content.replace(/huggingface.co/g, 'aifasthub.com');
}
});
// 特别处理模型仓库克隆对话框中的代码片段
try {
// 查找包含"Clone this model repository"标题的对话框
const cloneDialog = document.querySelector('.svelte_hydration_boundary, [data-target="MainHeader"]');
if (cloneDialog) {
// 查找对话框中所有的代码片段和命令示例
const codeElements = cloneDialog.querySelectorAll('pre, code, span');
codeElements.forEach(element => {
if (element.textContent && element.textContent.includes('huggingface.co')) {
if (element.innerHTML.includes('huggingface.co')) {
element.innerHTML = element.innerHTML.replace(/huggingface.co/g, 'aifasthub.com');
} else {
element.textContent = element.textContent.replace(/huggingface.co/g, 'aifasthub.com');
}
}
});
}
// 更精确地定位克隆命令中的域名
document.querySelectorAll('[data-target]').forEach(container => {
const codeBlocks = container.querySelectorAll('pre, code, span.hljs-string');
codeBlocks.forEach(block => {
if (block.textContent && block.textContent.includes('huggingface.co')) {
if (block.innerHTML.includes('huggingface.co')) {
block.innerHTML = block.innerHTML.replace(/huggingface.co/g, 'aifasthub.com');
} else {
block.textContent = block.textContent.replace(/huggingface.co/g, 'aifasthub.com');
}
}
});
});
} catch (e) {
// 错误处理但不打印日志
}
}
// 当DOM加载完成后执行替换
if (document.readyState === 'loading') {
document.addEventListener('DOMContentLoaded', () => {
replaceHeaderBranding();
replaceNavigationLinks();
replaceCodeDomains();
// 只在必要时执行替换 - 3秒后再次检查
setTimeout(() => {
if (!window._navLinksReplaced) {
console.log('[Client] 3秒后重新检查导航链接');
replaceNavigationLinks();
}
}, 3000);
});
} else {
replaceHeaderBranding();
replaceNavigationLinks();
replaceCodeDomains();
// 只在必要时执行替换 - 3秒后再次检查
setTimeout(() => {
if (!window._navLinksReplaced) {
console.log('[Client] 3秒后重新检查导航链接');
replaceNavigationLinks();
}
}, 3000);
}
// 增加一个MutationObserver来处理可能的动态元素加载
const observer = new MutationObserver(mutations => {
// 检查是否导航区域有变化
const hasNavChanges = mutations.some(mutation => {
// 检查是否存在header或nav元素变化
return Array.from(mutation.addedNodes).some(node => {
if (node.nodeType === Node.ELEMENT_NODE) {
// 检查是否是导航元素或其子元素
if (node.tagName === 'HEADER' || node.tagName === 'NAV' ||
node.querySelector('header, nav')) {
return true;
}
// 检查是否在导航元素内部
let parent = node.parentElement;
while (parent) {
if (parent.tagName === 'HEADER' || parent.tagName === 'NAV') {
return true;
}
parent = parent.parentElement;
}
}
return false;
});
});
// 只在导航区域有变化时执行替换
if (hasNavChanges) {
// 重置替换状态，允许再次替换
window._navLinksReplaced = false;
replaceHeaderBranding();
replaceNavigationLinks();
}
});
// 开始观察document.body的变化，包括子节点
if (document.body) {
observer.observe(document.body, { childList: true, subtree: true });
} else {
document.addEventListener('DOMContentLoaded', () => {
observer.observe(document.body, { childList: true, subtree: true });
});
}
})();
repo_name
stringlengths 6
112
| path
stringlengths 4
204
| copies
stringlengths 1
3
| size
stringlengths 4
6
| content
stringlengths 714
810k
| license
stringclasses 15
values |
|---|---|---|---|---|---|
abimannans/scikit-learn
|
examples/calibration/plot_calibration_curve.py
|
225
|
5903
|
"""
==============================
Probability Calibration curves
==============================
When performing classification one often wants to predict not only the class
label, but also the associated probability. This probability gives some
kind of confidence on the prediction. This example demonstrates how to display
how well calibrated the predicted probabilities are and how to calibrate an
uncalibrated classifier.
The experiment is performed on an artificial dataset for binary classification
with 100.000 samples (1.000 of them are used for model fitting) with 20
features. Of the 20 features, only 2 are informative and 10 are redundant. The
first figure shows the estimated probabilities obtained with logistic
regression, Gaussian naive Bayes, and Gaussian naive Bayes with both isotonic
calibration and sigmoid calibration. The calibration performance is evaluated
with Brier score, reported in the legend (the smaller the better). One can
observe here that logistic regression is well calibrated while raw Gaussian
naive Bayes performs very badly. This is because of the redundant features
which violate the assumption of feature-independence and result in an overly
confident classifier, which is indicated by the typical transposed-sigmoid
curve.
Calibration of the probabilities of Gaussian naive Bayes with isotonic
regression can fix this issue as can be seen from the nearly diagonal
calibration curve. Sigmoid calibration also improves the brier score slightly,
albeit not as strongly as the non-parametric isotonic regression. This can be
attributed to the fact that we have plenty of calibration data such that the
greater flexibility of the non-parametric model can be exploited.
The second figure shows the calibration curve of a linear support-vector
classifier (LinearSVC). LinearSVC shows the opposite behavior as Gaussian
naive Bayes: the calibration curve has a sigmoid curve, which is typical for
an under-confident classifier. In the case of LinearSVC, this is caused by the
margin property of the hinge loss, which lets the model focus on hard samples
that are close to the decision boundary (the support vectors).
Both kinds of calibration can fix this issue and yield nearly identical
results. This shows that sigmoid calibration can deal with situations where
the calibration curve of the base classifier is sigmoid (e.g., for LinearSVC)
but not where it is transposed-sigmoid (e.g., Gaussian naive Bayes).
"""
print(__doc__)
# Author: Alexandre Gramfort <[email protected]>
# Jan Hendrik Metzen <[email protected]>
# License: BSD Style.
import matplotlib.pyplot as plt
from sklearn import datasets
from sklearn.naive_bayes import GaussianNB
from sklearn.svm import LinearSVC
from sklearn.linear_model import LogisticRegression
from sklearn.metrics import (brier_score_loss, precision_score, recall_score,
f1_score)
from sklearn.calibration import CalibratedClassifierCV, calibration_curve
from sklearn.cross_validation import train_test_split
# Create dataset of classification task with many redundant and few
# informative features
X, y = datasets.make_classification(n_samples=100000, n_features=20,
n_informative=2, n_redundant=10,
random_state=42)
X_train, X_test, y_train, y_test = train_test_split(X, y, test_size=0.99,
random_state=42)
def plot_calibration_curve(est, name, fig_index):
"""Plot calibration curve for est w/o and with calibration. """
# Calibrated with isotonic calibration
isotonic = CalibratedClassifierCV(est, cv=2, method='isotonic')
# Calibrated with sigmoid calibration
sigmoid = CalibratedClassifierCV(est, cv=2, method='sigmoid')
# Logistic regression with no calibration as baseline
lr = LogisticRegression(C=1., solver='lbfgs')
fig = plt.figure(fig_index, figsize=(10, 10))
ax1 = plt.subplot2grid((3, 1), (0, 0), rowspan=2)
ax2 = plt.subplot2grid((3, 1), (2, 0))
ax1.plot([0, 1], [0, 1], "k:", label="Perfectly calibrated")
for clf, name in [(lr, 'Logistic'),
(est, name),
(isotonic, name + ' + Isotonic'),
(sigmoid, name + ' + Sigmoid')]:
clf.fit(X_train, y_train)
y_pred = clf.predict(X_test)
if hasattr(clf, "predict_proba"):
prob_pos = clf.predict_proba(X_test)[:, 1]
else: # use decision function
prob_pos = clf.decision_function(X_test)
prob_pos = \
(prob_pos - prob_pos.min()) / (prob_pos.max() - prob_pos.min())
clf_score = brier_score_loss(y_test, prob_pos, pos_label=y.max())
print("%s:" % name)
print("\tBrier: %1.3f" % (clf_score))
print("\tPrecision: %1.3f" % precision_score(y_test, y_pred))
print("\tRecall: %1.3f" % recall_score(y_test, y_pred))
print("\tF1: %1.3f\n" % f1_score(y_test, y_pred))
fraction_of_positives, mean_predicted_value = \
calibration_curve(y_test, prob_pos, n_bins=10)
ax1.plot(mean_predicted_value, fraction_of_positives, "s-",
label="%s (%1.3f)" % (name, clf_score))
ax2.hist(prob_pos, range=(0, 1), bins=10, label=name,
histtype="step", lw=2)
ax1.set_ylabel("Fraction of positives")
ax1.set_ylim([-0.05, 1.05])
ax1.legend(loc="lower right")
ax1.set_title('Calibration plots (reliability curve)')
ax2.set_xlabel("Mean predicted value")
ax2.set_ylabel("Count")
ax2.legend(loc="upper center", ncol=2)
plt.tight_layout()
# Plot calibration cuve for Gaussian Naive Bayes
plot_calibration_curve(GaussianNB(), "Naive Bayes", 1)
# Plot calibration cuve for Linear SVC
plot_calibration_curve(LinearSVC(), "SVC", 2)
plt.show()
|
bsd-3-clause
|
suiyuan2009/tensorflow
|
tensorflow/contrib/learn/python/learn/estimators/kmeans.py
|
34
|
10130
|
# Copyright 2016 The TensorFlow Authors. All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
# ==============================================================================
"""Implementation of k-means clustering on top of tf.learn API."""
from __future__ import absolute_import
from __future__ import division
from __future__ import print_function
import time
import numpy as np
from tensorflow.contrib.factorization.python.ops import clustering_ops
from tensorflow.contrib.framework.python.ops import variables
from tensorflow.contrib.learn.python.learn.estimators import estimator
from tensorflow.contrib.learn.python.learn.estimators.model_fn import ModelFnOps
from tensorflow.python.framework import ops
from tensorflow.python.ops import array_ops
from tensorflow.python.ops import math_ops
from tensorflow.python.ops import state_ops
from tensorflow.python.summary import summary
from tensorflow.python.ops.control_flow_ops import with_dependencies
from tensorflow.python.platform import tf_logging as logging
from tensorflow.python.summary import summary
from tensorflow.python.training import session_run_hook
from tensorflow.python.training.session_run_hook import SessionRunArgs
class _LossRelativeChangeHook(session_run_hook.SessionRunHook):
"""Stops when the change in loss goes below a tolerance."""
def __init__(self, tolerance):
"""Initializes _LossRelativeChangeHook.
Args:
tolerance: A relative tolerance of change between iterations.
"""
self._tolerance = tolerance
self._prev_loss = None
def begin(self):
self._loss_tensor = ops.get_default_graph().get_tensor_by_name(
KMeansClustering.LOSS_OP_NAME + ':0')
assert self._loss_tensor is not None
def before_run(self, run_context):
del run_context
return SessionRunArgs(
fetches={KMeansClustering.LOSS_OP_NAME: self._loss_tensor})
def after_run(self, run_context, run_values):
loss = run_values.results[KMeansClustering.LOSS_OP_NAME]
assert loss is not None
if self._prev_loss is not None:
relative_change = (abs(loss - self._prev_loss) /
(1 + abs(self._prev_loss)))
if relative_change < self._tolerance:
run_context.request_stop()
self._prev_loss = loss
class _InitializeClustersHook(session_run_hook.SessionRunHook):
"""Initializes clusters or waits for cluster initialization."""
def __init__(self, init_op, is_initialized_op, is_chief):
self._init_op = init_op
self._is_chief = is_chief
self._is_initialized_op = is_initialized_op
def after_create_session(self, session, _):
assert self._init_op.graph == ops.get_default_graph()
assert self._is_initialized_op.graph == self._init_op.graph
while True:
try:
if session.run(self._is_initialized_op):
break
elif self._is_chief:
session.run(self._init_op)
else:
time.sleep(1)
except RuntimeError as e:
logging.info(e)
def _parse_tensor_or_dict(features):
"""Helper function to parse features."""
if isinstance(features, dict):
keys = sorted(features.keys())
with ops.colocate_with(features[keys[0]]):
features = array_ops.concat([features[k] for k in keys], 1)
return features
def _kmeans_clustering_model_fn(features, labels, mode, params, config):
"""Model function for KMeansClustering estimator."""
assert labels is None, labels
(all_scores, model_predictions, losses,
is_initialized, init_op, training_op) = clustering_ops.KMeans(
_parse_tensor_or_dict(features),
params.get('num_clusters'),
initial_clusters=params.get('training_initial_clusters'),
distance_metric=params.get('distance_metric'),
use_mini_batch=params.get('use_mini_batch'),
mini_batch_steps_per_iteration=params.get(
'mini_batch_steps_per_iteration'),
random_seed=params.get('random_seed'),
kmeans_plus_plus_num_retries=params.get(
'kmeans_plus_plus_num_retries')).training_graph()
incr_step = state_ops.assign_add(variables.get_global_step(), 1)
loss = math_ops.reduce_sum(losses, name=KMeansClustering.LOSS_OP_NAME)
summary.scalar('loss/raw', loss)
training_op = with_dependencies([training_op, incr_step], loss)
predictions = {
KMeansClustering.ALL_SCORES: all_scores[0],
KMeansClustering.CLUSTER_IDX: model_predictions[0],
}
eval_metric_ops = {KMeansClustering.SCORES: loss}
training_hooks = [_InitializeClustersHook(
init_op, is_initialized, config.is_chief)]
relative_tolerance = params.get('relative_tolerance')
if relative_tolerance is not None:
training_hooks.append(_LossRelativeChangeHook(relative_tolerance))
return ModelFnOps(
mode=mode,
predictions=predictions,
eval_metric_ops=eval_metric_ops,
loss=loss,
train_op=training_op,
training_hooks=training_hooks)
# TODO(agarwal,ands): support sharded input.
class KMeansClustering(estimator.Estimator):
"""An Estimator for K-Means clustering."""
SQUARED_EUCLIDEAN_DISTANCE = clustering_ops.SQUARED_EUCLIDEAN_DISTANCE
COSINE_DISTANCE = clustering_ops.COSINE_DISTANCE
RANDOM_INIT = clustering_ops.RANDOM_INIT
KMEANS_PLUS_PLUS_INIT = clustering_ops.KMEANS_PLUS_PLUS_INIT
SCORES = 'scores'
CLUSTER_IDX = 'cluster_idx'
CLUSTERS = 'clusters'
ALL_SCORES = 'all_scores'
LOSS_OP_NAME = 'kmeans_loss'
def __init__(self,
num_clusters,
model_dir=None,
initial_clusters=RANDOM_INIT,
distance_metric=SQUARED_EUCLIDEAN_DISTANCE,
random_seed=0,
use_mini_batch=True,
mini_batch_steps_per_iteration=1,
kmeans_plus_plus_num_retries=2,
relative_tolerance=None,
config=None):
"""Creates a model for running KMeans training and inference.
Args:
num_clusters: number of clusters to train.
model_dir: the directory to save the model results and log files.
initial_clusters: specifies how to initialize the clusters for training.
See clustering_ops.kmeans for the possible values.
distance_metric: the distance metric used for clustering.
See clustering_ops.kmeans for the possible values.
random_seed: Python integer. Seed for PRNG used to initialize centers.
use_mini_batch: If true, use the mini-batch k-means algorithm. Else assume
full batch.
mini_batch_steps_per_iteration: number of steps after which the updated
cluster centers are synced back to a master copy. See clustering_ops.py
for more details.
kmeans_plus_plus_num_retries: For each point that is sampled during
kmeans++ initialization, this parameter specifies the number of
additional points to draw from the current distribution before selecting
the best. If a negative value is specified, a heuristic is used to
sample O(log(num_to_sample)) additional points.
relative_tolerance: A relative tolerance of change in the loss between
iterations. Stops learning if the loss changes less than this amount.
Note that this may not work correctly if use_mini_batch=True.
config: See Estimator
"""
params = {}
params['num_clusters'] = num_clusters
params['training_initial_clusters'] = initial_clusters
params['distance_metric'] = distance_metric
params['random_seed'] = random_seed
params['use_mini_batch'] = use_mini_batch
params['mini_batch_steps_per_iteration'] = mini_batch_steps_per_iteration
params['kmeans_plus_plus_num_retries'] = kmeans_plus_plus_num_retries
params['relative_tolerance'] = relative_tolerance
super(KMeansClustering, self).__init__(
model_fn=_kmeans_clustering_model_fn,
params=params,
model_dir=model_dir,
config=config)
def predict_cluster_idx(self, input_fn=None):
"""Yields predicted cluster indices."""
key = KMeansClustering.CLUSTER_IDX
results = super(KMeansClustering, self).predict(
input_fn=input_fn, outputs=[key])
for result in results:
yield result[key]
def score(self, input_fn=None, steps=None):
"""Predict total sum of distances to nearest clusters.
Note that this function is different from the corresponding one in sklearn
which returns the negative of the sum of distances.
Args:
input_fn: see predict.
steps: see predict.
Returns:
Total sum of distances to nearest clusters.
"""
return np.sum(
self.evaluate(
input_fn=input_fn, steps=steps)[KMeansClustering.SCORES])
def transform(self, input_fn=None, as_iterable=False):
"""Transforms each element to distances to cluster centers.
Note that this function is different from the corresponding one in sklearn.
For SQUARED_EUCLIDEAN distance metric, sklearn transform returns the
EUCLIDEAN distance, while this function returns the SQUARED_EUCLIDEAN
distance.
Args:
input_fn: see predict.
as_iterable: see predict
Returns:
Array with same number of rows as x, and num_clusters columns, containing
distances to the cluster centers.
"""
key = KMeansClustering.ALL_SCORES
results = super(KMeansClustering, self).predict(
input_fn=input_fn,
outputs=[key],
as_iterable=as_iterable)
if not as_iterable:
return results[key]
else:
return results
def clusters(self):
"""Returns cluster centers."""
return super(KMeansClustering, self).get_variable_value(self.CLUSTERS)
|
apache-2.0
|
EliHar/Pattern_recognition
|
openface1/util/tsne.py
|
11
|
1261
|
#!/usr/bin/env python2
import numpy as np
import pandas as pd
from sklearn.decomposition import PCA
from sklearn.manifold import TSNE
import matplotlib as mpl
mpl.use('Agg')
import matplotlib.pyplot as plt
import matplotlib.cm as cm
plt.style.use('bmh')
import argparse
print("""
Note: This example assumes that `name i` corresponds to `label i`
in `labels.csv`.
""")
parser = argparse.ArgumentParser()
parser.add_argument('workDir', type=str)
parser.add_argument('--names', type=str, nargs='+', required=True)
args = parser.parse_args()
y = pd.read_csv("{}/labels.csv".format(args.workDir)).as_matrix()[:, 0]
X = pd.read_csv("{}/reps.csv".format(args.workDir)).as_matrix()
target_names = np.array(args.names)
colors = cm.Dark2(np.linspace(0, 1, len(target_names)))
X_pca = PCA(n_components=50).fit_transform(X, X)
tsne = TSNE(n_components=2, init='random', random_state=0)
X_r = tsne.fit_transform(X_pca)
for c, i, target_name in zip(colors,
list(range(1, len(target_names) + 1)),
target_names):
plt.scatter(X_r[y == i, 0], X_r[y == i, 1],
c=c, label=target_name)
plt.legend()
out = "{}/tsne.pdf".format(args.workDir)
plt.savefig(out)
print("Saved to: {}".format(out))
|
mit
|
ishanic/scikit-learn
|
sklearn/covariance/graph_lasso_.py
|
127
|
25626
|
"""GraphLasso: sparse inverse covariance estimation with an l1-penalized
estimator.
"""
# Author: Gael Varoquaux <[email protected]>
# License: BSD 3 clause
# Copyright: INRIA
import warnings
import operator
import sys
import time
import numpy as np
from scipy import linalg
from .empirical_covariance_ import (empirical_covariance, EmpiricalCovariance,
log_likelihood)
from ..utils import ConvergenceWarning
from ..utils.extmath import pinvh
from ..utils.validation import check_random_state, check_array
from ..linear_model import lars_path
from ..linear_model import cd_fast
from ..cross_validation import check_cv, cross_val_score
from ..externals.joblib import Parallel, delayed
import collections
# Helper functions to compute the objective and dual objective functions
# of the l1-penalized estimator
def _objective(mle, precision_, alpha):
"""Evaluation of the graph-lasso objective function
the objective function is made of a shifted scaled version of the
normalized log-likelihood (i.e. its empirical mean over the samples) and a
penalisation term to promote sparsity
"""
p = precision_.shape[0]
cost = - 2. * log_likelihood(mle, precision_) + p * np.log(2 * np.pi)
cost += alpha * (np.abs(precision_).sum()
- np.abs(np.diag(precision_)).sum())
return cost
def _dual_gap(emp_cov, precision_, alpha):
"""Expression of the dual gap convergence criterion
The specific definition is given in Duchi "Projected Subgradient Methods
for Learning Sparse Gaussians".
"""
gap = np.sum(emp_cov * precision_)
gap -= precision_.shape[0]
gap += alpha * (np.abs(precision_).sum()
- np.abs(np.diag(precision_)).sum())
return gap
def alpha_max(emp_cov):
"""Find the maximum alpha for which there are some non-zeros off-diagonal.
Parameters
----------
emp_cov : 2D array, (n_features, n_features)
The sample covariance matrix
Notes
-----
This results from the bound for the all the Lasso that are solved
in GraphLasso: each time, the row of cov corresponds to Xy. As the
bound for alpha is given by `max(abs(Xy))`, the result follows.
"""
A = np.copy(emp_cov)
A.flat[::A.shape[0] + 1] = 0
return np.max(np.abs(A))
# The g-lasso algorithm
def graph_lasso(emp_cov, alpha, cov_init=None, mode='cd', tol=1e-4,
enet_tol=1e-4, max_iter=100, verbose=False,
return_costs=False, eps=np.finfo(np.float64).eps,
return_n_iter=False):
"""l1-penalized covariance estimator
Read more in the :ref:`User Guide <sparse_inverse_covariance>`.
Parameters
----------
emp_cov : 2D ndarray, shape (n_features, n_features)
Empirical covariance from which to compute the covariance estimate.
alpha : positive float
The regularization parameter: the higher alpha, the more
regularization, the sparser the inverse covariance.
cov_init : 2D array (n_features, n_features), optional
The initial guess for the covariance.
mode : {'cd', 'lars'}
The Lasso solver to use: coordinate descent or LARS. Use LARS for
very sparse underlying graphs, where p > n. Elsewhere prefer cd
which is more numerically stable.
tol : positive float, optional
The tolerance to declare convergence: if the dual gap goes below
this value, iterations are stopped.
enet_tol : positive float, optional
The tolerance for the elastic net solver used to calculate the descent
direction. This parameter controls the accuracy of the search direction
for a given column update, not of the overall parameter estimate. Only
used for mode='cd'.
max_iter : integer, optional
The maximum number of iterations.
verbose : boolean, optional
If verbose is True, the objective function and dual gap are
printed at each iteration.
return_costs : boolean, optional
If return_costs is True, the objective function and dual gap
at each iteration are returned.
eps : float, optional
The machine-precision regularization in the computation of the
Cholesky diagonal factors. Increase this for very ill-conditioned
systems.
return_n_iter : bool, optional
Whether or not to return the number of iterations.
Returns
-------
covariance : 2D ndarray, shape (n_features, n_features)
The estimated covariance matrix.
precision : 2D ndarray, shape (n_features, n_features)
The estimated (sparse) precision matrix.
costs : list of (objective, dual_gap) pairs
The list of values of the objective function and the dual gap at
each iteration. Returned only if return_costs is True.
n_iter : int
Number of iterations. Returned only if `return_n_iter` is set to True.
See Also
--------
GraphLasso, GraphLassoCV
Notes
-----
The algorithm employed to solve this problem is the GLasso algorithm,
from the Friedman 2008 Biostatistics paper. It is the same algorithm
as in the R `glasso` package.
One possible difference with the `glasso` R package is that the
diagonal coefficients are not penalized.
"""
_, n_features = emp_cov.shape
if alpha == 0:
if return_costs:
precision_ = linalg.inv(emp_cov)
cost = - 2. * log_likelihood(emp_cov, precision_)
cost += n_features * np.log(2 * np.pi)
d_gap = np.sum(emp_cov * precision_) - n_features
if return_n_iter:
return emp_cov, precision_, (cost, d_gap), 0
else:
return emp_cov, precision_, (cost, d_gap)
else:
if return_n_iter:
return emp_cov, linalg.inv(emp_cov), 0
else:
return emp_cov, linalg.inv(emp_cov)
if cov_init is None:
covariance_ = emp_cov.copy()
else:
covariance_ = cov_init.copy()
# As a trivial regularization (Tikhonov like), we scale down the
# off-diagonal coefficients of our starting point: This is needed, as
# in the cross-validation the cov_init can easily be
# ill-conditioned, and the CV loop blows. Beside, this takes
# conservative stand-point on the initial conditions, and it tends to
# make the convergence go faster.
covariance_ *= 0.95
diagonal = emp_cov.flat[::n_features + 1]
covariance_.flat[::n_features + 1] = diagonal
precision_ = pinvh(covariance_)
indices = np.arange(n_features)
costs = list()
# The different l1 regression solver have different numerical errors
if mode == 'cd':
errors = dict(over='raise', invalid='ignore')
else:
errors = dict(invalid='raise')
try:
# be robust to the max_iter=0 edge case, see:
# https://github.com/scikit-learn/scikit-learn/issues/4134
d_gap = np.inf
for i in range(max_iter):
for idx in range(n_features):
sub_covariance = covariance_[indices != idx].T[indices != idx]
row = emp_cov[idx, indices != idx]
with np.errstate(**errors):
if mode == 'cd':
# Use coordinate descent
coefs = -(precision_[indices != idx, idx]
/ (precision_[idx, idx] + 1000 * eps))
coefs, _, _, _ = cd_fast.enet_coordinate_descent_gram(
coefs, alpha, 0, sub_covariance, row, row,
max_iter, enet_tol, check_random_state(None), False)
else:
# Use LARS
_, _, coefs = lars_path(
sub_covariance, row, Xy=row, Gram=sub_covariance,
alpha_min=alpha / (n_features - 1), copy_Gram=True,
method='lars', return_path=False)
# Update the precision matrix
precision_[idx, idx] = (
1. / (covariance_[idx, idx]
- np.dot(covariance_[indices != idx, idx], coefs)))
precision_[indices != idx, idx] = (- precision_[idx, idx]
* coefs)
precision_[idx, indices != idx] = (- precision_[idx, idx]
* coefs)
coefs = np.dot(sub_covariance, coefs)
covariance_[idx, indices != idx] = coefs
covariance_[indices != idx, idx] = coefs
d_gap = _dual_gap(emp_cov, precision_, alpha)
cost = _objective(emp_cov, precision_, alpha)
if verbose:
print(
'[graph_lasso] Iteration % 3i, cost % 3.2e, dual gap %.3e'
% (i, cost, d_gap))
if return_costs:
costs.append((cost, d_gap))
if np.abs(d_gap) < tol:
break
if not np.isfinite(cost) and i > 0:
raise FloatingPointError('Non SPD result: the system is '
'too ill-conditioned for this solver')
else:
warnings.warn('graph_lasso: did not converge after %i iteration:'
' dual gap: %.3e' % (max_iter, d_gap),
ConvergenceWarning)
except FloatingPointError as e:
e.args = (e.args[0]
+ '. The system is too ill-conditioned for this solver',)
raise e
if return_costs:
if return_n_iter:
return covariance_, precision_, costs, i + 1
else:
return covariance_, precision_, costs
else:
if return_n_iter:
return covariance_, precision_, i + 1
else:
return covariance_, precision_
class GraphLasso(EmpiricalCovariance):
"""Sparse inverse covariance estimation with an l1-penalized estimator.
Read more in the :ref:`User Guide <sparse_inverse_covariance>`.
Parameters
----------
alpha : positive float, default 0.01
The regularization parameter: the higher alpha, the more
regularization, the sparser the inverse covariance.
mode : {'cd', 'lars'}, default 'cd'
The Lasso solver to use: coordinate descent or LARS. Use LARS for
very sparse underlying graphs, where p > n. Elsewhere prefer cd
which is more numerically stable.
tol : positive float, default 1e-4
The tolerance to declare convergence: if the dual gap goes below
this value, iterations are stopped.
enet_tol : positive float, optional
The tolerance for the elastic net solver used to calculate the descent
direction. This parameter controls the accuracy of the search direction
for a given column update, not of the overall parameter estimate. Only
used for mode='cd'.
max_iter : integer, default 100
The maximum number of iterations.
verbose : boolean, default False
If verbose is True, the objective function and dual gap are
plotted at each iteration.
assume_centered : boolean, default False
If True, data are not centered before computation.
Useful when working with data whose mean is almost, but not exactly
zero.
If False, data are centered before computation.
Attributes
----------
covariance_ : array-like, shape (n_features, n_features)
Estimated covariance matrix
precision_ : array-like, shape (n_features, n_features)
Estimated pseudo inverse matrix.
n_iter_ : int
Number of iterations run.
See Also
--------
graph_lasso, GraphLassoCV
"""
def __init__(self, alpha=.01, mode='cd', tol=1e-4, enet_tol=1e-4,
max_iter=100, verbose=False, assume_centered=False):
self.alpha = alpha
self.mode = mode
self.tol = tol
self.enet_tol = enet_tol
self.max_iter = max_iter
self.verbose = verbose
self.assume_centered = assume_centered
# The base class needs this for the score method
self.store_precision = True
def fit(self, X, y=None):
X = check_array(X)
if self.assume_centered:
self.location_ = np.zeros(X.shape[1])
else:
self.location_ = X.mean(0)
emp_cov = empirical_covariance(
X, assume_centered=self.assume_centered)
self.covariance_, self.precision_, self.n_iter_ = graph_lasso(
emp_cov, alpha=self.alpha, mode=self.mode, tol=self.tol,
enet_tol=self.enet_tol, max_iter=self.max_iter,
verbose=self.verbose, return_n_iter=True)
return self
# Cross-validation with GraphLasso
def graph_lasso_path(X, alphas, cov_init=None, X_test=None, mode='cd',
tol=1e-4, enet_tol=1e-4, max_iter=100, verbose=False):
"""l1-penalized covariance estimator along a path of decreasing alphas
Read more in the :ref:`User Guide <sparse_inverse_covariance>`.
Parameters
----------
X : 2D ndarray, shape (n_samples, n_features)
Data from which to compute the covariance estimate.
alphas : list of positive floats
The list of regularization parameters, decreasing order.
X_test : 2D array, shape (n_test_samples, n_features), optional
Optional test matrix to measure generalisation error.
mode : {'cd', 'lars'}
The Lasso solver to use: coordinate descent or LARS. Use LARS for
very sparse underlying graphs, where p > n. Elsewhere prefer cd
which is more numerically stable.
tol : positive float, optional
The tolerance to declare convergence: if the dual gap goes below
this value, iterations are stopped.
enet_tol : positive float, optional
The tolerance for the elastic net solver used to calculate the descent
direction. This parameter controls the accuracy of the search direction
for a given column update, not of the overall parameter estimate. Only
used for mode='cd'.
max_iter : integer, optional
The maximum number of iterations.
verbose : integer, optional
The higher the verbosity flag, the more information is printed
during the fitting.
Returns
-------
covariances_ : List of 2D ndarray, shape (n_features, n_features)
The estimated covariance matrices.
precisions_ : List of 2D ndarray, shape (n_features, n_features)
The estimated (sparse) precision matrices.
scores_ : List of float
The generalisation error (log-likelihood) on the test data.
Returned only if test data is passed.
"""
inner_verbose = max(0, verbose - 1)
emp_cov = empirical_covariance(X)
if cov_init is None:
covariance_ = emp_cov.copy()
else:
covariance_ = cov_init
covariances_ = list()
precisions_ = list()
scores_ = list()
if X_test is not None:
test_emp_cov = empirical_covariance(X_test)
for alpha in alphas:
try:
# Capture the errors, and move on
covariance_, precision_ = graph_lasso(
emp_cov, alpha=alpha, cov_init=covariance_, mode=mode, tol=tol,
enet_tol=enet_tol, max_iter=max_iter, verbose=inner_verbose)
covariances_.append(covariance_)
precisions_.append(precision_)
if X_test is not None:
this_score = log_likelihood(test_emp_cov, precision_)
except FloatingPointError:
this_score = -np.inf
covariances_.append(np.nan)
precisions_.append(np.nan)
if X_test is not None:
if not np.isfinite(this_score):
this_score = -np.inf
scores_.append(this_score)
if verbose == 1:
sys.stderr.write('.')
elif verbose > 1:
if X_test is not None:
print('[graph_lasso_path] alpha: %.2e, score: %.2e'
% (alpha, this_score))
else:
print('[graph_lasso_path] alpha: %.2e' % alpha)
if X_test is not None:
return covariances_, precisions_, scores_
return covariances_, precisions_
class GraphLassoCV(GraphLasso):
"""Sparse inverse covariance w/ cross-validated choice of the l1 penalty
Read more in the :ref:`User Guide <sparse_inverse_covariance>`.
Parameters
----------
alphas : integer, or list positive float, optional
If an integer is given, it fixes the number of points on the
grids of alpha to be used. If a list is given, it gives the
grid to be used. See the notes in the class docstring for
more details.
n_refinements: strictly positive integer
The number of times the grid is refined. Not used if explicit
values of alphas are passed.
cv : cross-validation generator, optional
see sklearn.cross_validation module. If None is passed, defaults to
a 3-fold strategy
tol: positive float, optional
The tolerance to declare convergence: if the dual gap goes below
this value, iterations are stopped.
enet_tol : positive float, optional
The tolerance for the elastic net solver used to calculate the descent
direction. This parameter controls the accuracy of the search direction
for a given column update, not of the overall parameter estimate. Only
used for mode='cd'.
max_iter: integer, optional
Maximum number of iterations.
mode: {'cd', 'lars'}
The Lasso solver to use: coordinate descent or LARS. Use LARS for
very sparse underlying graphs, where number of features is greater
than number of samples. Elsewhere prefer cd which is more numerically
stable.
n_jobs: int, optional
number of jobs to run in parallel (default 1).
verbose: boolean, optional
If verbose is True, the objective function and duality gap are
printed at each iteration.
assume_centered : Boolean
If True, data are not centered before computation.
Useful when working with data whose mean is almost, but not exactly
zero.
If False, data are centered before computation.
Attributes
----------
covariance_ : numpy.ndarray, shape (n_features, n_features)
Estimated covariance matrix.
precision_ : numpy.ndarray, shape (n_features, n_features)
Estimated precision matrix (inverse covariance).
alpha_ : float
Penalization parameter selected.
cv_alphas_ : list of float
All penalization parameters explored.
`grid_scores`: 2D numpy.ndarray (n_alphas, n_folds)
Log-likelihood score on left-out data across folds.
n_iter_ : int
Number of iterations run for the optimal alpha.
See Also
--------
graph_lasso, GraphLasso
Notes
-----
The search for the optimal penalization parameter (alpha) is done on an
iteratively refined grid: first the cross-validated scores on a grid are
computed, then a new refined grid is centered around the maximum, and so
on.
One of the challenges which is faced here is that the solvers can
fail to converge to a well-conditioned estimate. The corresponding
values of alpha then come out as missing values, but the optimum may
be close to these missing values.
"""
def __init__(self, alphas=4, n_refinements=4, cv=None, tol=1e-4,
enet_tol=1e-4, max_iter=100, mode='cd', n_jobs=1,
verbose=False, assume_centered=False):
self.alphas = alphas
self.n_refinements = n_refinements
self.mode = mode
self.tol = tol
self.enet_tol = enet_tol
self.max_iter = max_iter
self.verbose = verbose
self.cv = cv
self.n_jobs = n_jobs
self.assume_centered = assume_centered
# The base class needs this for the score method
self.store_precision = True
def fit(self, X, y=None):
"""Fits the GraphLasso covariance model to X.
Parameters
----------
X : ndarray, shape (n_samples, n_features)
Data from which to compute the covariance estimate
"""
X = check_array(X)
if self.assume_centered:
self.location_ = np.zeros(X.shape[1])
else:
self.location_ = X.mean(0)
emp_cov = empirical_covariance(
X, assume_centered=self.assume_centered)
cv = check_cv(self.cv, X, y, classifier=False)
# List of (alpha, scores, covs)
path = list()
n_alphas = self.alphas
inner_verbose = max(0, self.verbose - 1)
if isinstance(n_alphas, collections.Sequence):
alphas = self.alphas
n_refinements = 1
else:
n_refinements = self.n_refinements
alpha_1 = alpha_max(emp_cov)
alpha_0 = 1e-2 * alpha_1
alphas = np.logspace(np.log10(alpha_0), np.log10(alpha_1),
n_alphas)[::-1]
t0 = time.time()
for i in range(n_refinements):
with warnings.catch_warnings():
# No need to see the convergence warnings on this grid:
# they will always be points that will not converge
# during the cross-validation
warnings.simplefilter('ignore', ConvergenceWarning)
# Compute the cross-validated loss on the current grid
# NOTE: Warm-restarting graph_lasso_path has been tried, and
# this did not allow to gain anything (same execution time with
# or without).
this_path = Parallel(
n_jobs=self.n_jobs,
verbose=self.verbose
)(
delayed(graph_lasso_path)(
X[train], alphas=alphas,
X_test=X[test], mode=self.mode,
tol=self.tol, enet_tol=self.enet_tol,
max_iter=int(.1 * self.max_iter),
verbose=inner_verbose)
for train, test in cv)
# Little danse to transform the list in what we need
covs, _, scores = zip(*this_path)
covs = zip(*covs)
scores = zip(*scores)
path.extend(zip(alphas, scores, covs))
path = sorted(path, key=operator.itemgetter(0), reverse=True)
# Find the maximum (avoid using built in 'max' function to
# have a fully-reproducible selection of the smallest alpha
# in case of equality)
best_score = -np.inf
last_finite_idx = 0
for index, (alpha, scores, _) in enumerate(path):
this_score = np.mean(scores)
if this_score >= .1 / np.finfo(np.float64).eps:
this_score = np.nan
if np.isfinite(this_score):
last_finite_idx = index
if this_score >= best_score:
best_score = this_score
best_index = index
# Refine the grid
if best_index == 0:
# We do not need to go back: we have chosen
# the highest value of alpha for which there are
# non-zero coefficients
alpha_1 = path[0][0]
alpha_0 = path[1][0]
elif (best_index == last_finite_idx
and not best_index == len(path) - 1):
# We have non-converged models on the upper bound of the
# grid, we need to refine the grid there
alpha_1 = path[best_index][0]
alpha_0 = path[best_index + 1][0]
elif best_index == len(path) - 1:
alpha_1 = path[best_index][0]
alpha_0 = 0.01 * path[best_index][0]
else:
alpha_1 = path[best_index - 1][0]
alpha_0 = path[best_index + 1][0]
if not isinstance(n_alphas, collections.Sequence):
alphas = np.logspace(np.log10(alpha_1), np.log10(alpha_0),
n_alphas + 2)
alphas = alphas[1:-1]
if self.verbose and n_refinements > 1:
print('[GraphLassoCV] Done refinement % 2i out of %i: % 3is'
% (i + 1, n_refinements, time.time() - t0))
path = list(zip(*path))
grid_scores = list(path[1])
alphas = list(path[0])
# Finally, compute the score with alpha = 0
alphas.append(0)
grid_scores.append(cross_val_score(EmpiricalCovariance(), X,
cv=cv, n_jobs=self.n_jobs,
verbose=inner_verbose))
self.grid_scores = np.array(grid_scores)
best_alpha = alphas[best_index]
self.alpha_ = best_alpha
self.cv_alphas_ = alphas
# Finally fit the model with the selected alpha
self.covariance_, self.precision_, self.n_iter_ = graph_lasso(
emp_cov, alpha=best_alpha, mode=self.mode, tol=self.tol,
enet_tol=self.enet_tol, max_iter=self.max_iter,
verbose=inner_verbose, return_n_iter=True)
return self
|
bsd-3-clause
|
BryanCutler/spark
|
python/pyspark/pandas/tests/test_frame_spark.py
|
1
|
6247
|
#
# Licensed to the Apache Software Foundation (ASF) under one or more
# contributor license agreements. See the NOTICE file distributed with
# this work for additional information regarding copyright ownership.
# The ASF licenses this file to You under the Apache License, Version 2.0
# (the "License"); you may not use this file except in compliance with
# the License. You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
#
from distutils.version import LooseVersion
import os
import pandas as pd
import pyspark
from pyspark import pandas as pp
from pyspark.pandas.testing.utils import ReusedSQLTestCase, SQLTestUtils, TestUtils
class SparkFrameMethodsTest(ReusedSQLTestCase, SQLTestUtils, TestUtils):
def test_frame_apply_negative(self):
with self.assertRaisesRegex(
ValueError, "The output of the function.* pyspark.sql.DataFrame.*int"
):
pp.range(10).spark.apply(lambda scol: 1)
def test_hint(self):
pdf1 = pd.DataFrame(
{"lkey": ["foo", "bar", "baz", "foo"], "value": [1, 2, 3, 5]}
).set_index("lkey")
pdf2 = pd.DataFrame(
{"rkey": ["foo", "bar", "baz", "foo"], "value": [5, 6, 7, 8]}
).set_index("rkey")
kdf1 = pp.from_pandas(pdf1)
kdf2 = pp.from_pandas(pdf2)
if LooseVersion(pyspark.__version__) >= LooseVersion("3.0"):
hints = ["broadcast", "merge", "shuffle_hash", "shuffle_replicate_nl"]
else:
hints = ["broadcast"]
for hint in hints:
self.assert_eq(
pdf1.merge(pdf2, left_index=True, right_index=True).sort_values(
["value_x", "value_y"]
),
kdf1.merge(kdf2.spark.hint(hint), left_index=True, right_index=True).sort_values(
["value_x", "value_y"]
),
almost=True,
)
self.assert_eq(
pdf1.merge(pdf2 + 1, left_index=True, right_index=True).sort_values(
["value_x", "value_y"]
),
kdf1.merge(
(kdf2 + 1).spark.hint(hint), left_index=True, right_index=True
).sort_values(["value_x", "value_y"]),
almost=True,
)
def test_repartition(self):
kdf = pp.DataFrame({"age": [5, 5, 2, 2], "name": ["Bob", "Bob", "Alice", "Alice"]})
num_partitions = kdf.to_spark().rdd.getNumPartitions() + 1
num_partitions += 1
new_kdf = kdf.spark.repartition(num_partitions)
self.assertEqual(new_kdf.to_spark().rdd.getNumPartitions(), num_partitions)
self.assert_eq(kdf.sort_index(), new_kdf.sort_index())
# Reserves Index
kdf = kdf.set_index("age")
num_partitions += 1
new_kdf = kdf.spark.repartition(num_partitions)
self.assertEqual(new_kdf.to_spark().rdd.getNumPartitions(), num_partitions)
self.assert_eq(kdf.sort_index(), new_kdf.sort_index())
# Reflects internal changes
kdf = kdf.reset_index()
kdf = kdf.set_index("name")
kdf2 = kdf + 1
num_partitions += 1
self.assert_eq(kdf2.sort_index(), (kdf + 1).spark.repartition(num_partitions).sort_index())
# Reserves MultiIndex
kdf = pp.DataFrame({"a": ["a", "b", "c"]}, index=[[1, 2, 3], [4, 5, 6]])
num_partitions = kdf.to_spark().rdd.getNumPartitions() + 1
new_kdf = kdf.spark.repartition(num_partitions)
self.assertEqual(new_kdf.to_spark().rdd.getNumPartitions(), num_partitions)
self.assert_eq(kdf.sort_index(), new_kdf.sort_index())
def test_coalesce(self):
num_partitions = 10
kdf = pp.DataFrame({"age": [5, 5, 2, 2], "name": ["Bob", "Bob", "Alice", "Alice"]})
kdf = kdf.spark.repartition(num_partitions)
num_partitions -= 1
new_kdf = kdf.spark.coalesce(num_partitions)
self.assertEqual(new_kdf.to_spark().rdd.getNumPartitions(), num_partitions)
self.assert_eq(kdf.sort_index(), new_kdf.sort_index())
# Reserves Index
kdf = kdf.set_index("age")
num_partitions -= 1
new_kdf = kdf.spark.coalesce(num_partitions)
self.assertEqual(new_kdf.to_spark().rdd.getNumPartitions(), num_partitions)
self.assert_eq(kdf.sort_index(), new_kdf.sort_index())
# Reflects internal changes
kdf = kdf.reset_index()
kdf = kdf.set_index("name")
kdf2 = kdf + 1
num_partitions -= 1
self.assert_eq(kdf2.sort_index(), (kdf + 1).spark.coalesce(num_partitions).sort_index())
# Reserves MultiIndex
kdf = pp.DataFrame({"a": ["a", "b", "c"]}, index=[[1, 2, 3], [4, 5, 6]])
num_partitions -= 1
kdf = kdf.spark.repartition(num_partitions)
num_partitions -= 1
new_kdf = kdf.spark.coalesce(num_partitions)
self.assertEqual(new_kdf.to_spark().rdd.getNumPartitions(), num_partitions)
self.assert_eq(kdf.sort_index(), new_kdf.sort_index())
def test_checkpoint(self):
with self.temp_dir() as tmp:
self.spark.sparkContext.setCheckpointDir(tmp)
kdf = pp.DataFrame({"a": ["a", "b", "c"]})
new_kdf = kdf.spark.checkpoint()
self.assertIsNotNone(os.listdir(tmp))
self.assert_eq(kdf, new_kdf)
def test_local_checkpoint(self):
kdf = pp.DataFrame({"a": ["a", "b", "c"]})
new_kdf = kdf.spark.local_checkpoint()
self.assert_eq(kdf, new_kdf)
if __name__ == "__main__":
import unittest
from pyspark.pandas.tests.test_frame_spark import * # noqa: F401
try:
import xmlrunner # type: ignore[import]
testRunner = xmlrunner.XMLTestRunner(output='target/test-reports', verbosity=2)
except ImportError:
testRunner = None
unittest.main(testRunner=testRunner, verbosity=2)
|
apache-2.0
|
codekansas/spykes
|
examples/plot_neuropixels_example.py
|
2
|
7803
|
"""
===================
Neuropixels Example
===================
Use spykes to analyze data from UCL's Neuropixels
"""
# Authors: Mayank Agrawal <[email protected]>
#
# License: MIT
########################################################
import numpy as np
import pandas as pd
from spykes.plot.neurovis import NeuroVis
from spykes.plot.popvis import PopVis
import matplotlib.pyplot as plt
from spykes.io.datasets import load_neuropixels_data
plt.style.use('seaborn-ticks')
########################################################
# Neuropixels
# -----------------------------
# Neuropixels is a new recording technique by UCL's `Cortex Lab
# <http://www.ucl.ac.uk/neuropixels>`__ that is able to measure data from
# hundreds of neurons. Below we show how this data can be worked with in Spykes
#
# 0 Download Data
# -----------------------------
#
# Download all data `here <http://data.cortexlab.net/dualPhase3/data/>`__.
#
# 1 Read In Data
# -----------------------------
folder_names = ['posterior', 'frontal']
Fs = 30000.0
striatum = list()
motor_ctx = list()
thalamus = list()
hippocampus = list()
visual_ctx = list()
# a lot of this code is adapted from Cortex Lab's MATLAB script
# see here: http://data.cortexlab.net/dualPhase3/data/script_dualPhase3.m
data_dict = load_neuropixels_data()
for name in folder_names:
clusters = np.squeeze(data_dict[name + '/spike_clusters.npy'])
spike_times = (np.squeeze(data_dict[(name + '/spike_times.npy')])) / Fs
spike_templates = (np.squeeze(data_dict[(name + '/spike_templates.npy')]))
temps = (np.squeeze(data_dict[(name + '/templates.npy')]))
winv = (np.squeeze(data_dict[(name + '/whitening_mat_inv.npy')]))
y_coords = (np.squeeze(data_dict[(name + '/channel_positions.npy')]))[:, 1]
# frontal times need to align with posterior
if (name == 'frontal'):
time_correction = data_dict[('timeCorrection.npy')]
spike_times *= time_correction[0]
spike_times += time_correction[1]
data = data_dict[(name + '/cluster_groups.csv')]
cids = np.array([x[0] for x in data])
cfg = np.array([x[1] for x in data])
# find good clusters and only use those spikes
good_clusters = cids[cfg == 'good']
good_indices = (np.in1d(clusters, good_clusters))
real_spikes = spike_times[good_indices]
real_clusters = clusters[good_indices]
real_spike_templates = spike_templates[good_indices]
# find how many spikes per cluster and then order spikes by which cluster
# they are in
counts_per_cluster = np.bincount(real_clusters)
sort_idx = np.argsort(real_clusters)
sorted_clusters = real_clusters[sort_idx]
sorted_spikes = real_spikes[sort_idx]
sorted_spike_templates = real_spike_templates[sort_idx]
# find depth for each spike
# this is translated from Cortex Lab's MATLAB code
# for more details, check out the original code here:
# https://github.com/cortex-lab/spikes/blob/master/analysis/templatePositionsAmplitudes.m
temps_unw = np.zeros(temps.shape)
for t in range(temps.shape[0]):
temps_unw[t, :, :] = np.dot(temps[t, :, :], winv)
temp_chan_amps = np.ptp(temps_unw, axis=1)
temps_amps = np.max(temp_chan_amps, axis=1)
thresh_vals = temps_amps * 0.3
thresh_vals = [thresh_vals for i in range(temp_chan_amps.shape[1])]
thresh_vals = np.stack(thresh_vals, axis=1)
temp_chan_amps[temp_chan_amps < thresh_vals] = 0
y_coords = np.reshape(y_coords, (y_coords.shape[0], 1))
temp_depths = np.sum(
np.dot(temp_chan_amps, y_coords), axis=1) / (np.sum(temp_chan_amps,
axis=1))
sorted_spike_depths = temp_depths[sorted_spike_templates]
# create neurons and find region
accumulator = 0
for idx, count in enumerate(counts_per_cluster):
if count > 0:
spike_times = sorted_spikes[accumulator:accumulator + count]
neuron = NeuroVis(spiketimes=spike_times, name='%d' % (idx))
cluster_depth = np.mean(
sorted_spike_depths[accumulator:accumulator + count])
if name == 'frontal':
if (cluster_depth > 0 and cluster_depth < 1550):
striatum.append(neuron)
elif (cluster_depth > 1550 and cluster_depth < 3840):
motor_ctx.append(neuron)
elif name == 'posterior':
if (cluster_depth > 0 and cluster_depth < 1634):
thalamus.append(neuron)
elif (cluster_depth > 1634 and cluster_depth < 2797):
hippocampus.append(neuron)
elif (cluster_depth > 2797 and cluster_depth < 3840):
visual_ctx.append(neuron)
accumulator += count
print("Striatum (n = %d)" % len(striatum))
print("Motor Cortex (n = %d)" % len(motor_ctx))
print("Thalamus (n = %d)" % len(thalamus))
print("Hippocampus (n = %d)" % len(hippocampus))
print("Visual Cortex (n = %d)" % len(visual_ctx))
########################################################
# 2 Create Data Frame
# -----------------------------
df = pd.DataFrame()
raw_data = data_dict['experiment1stimInfo.mat']
df['start'] = np.squeeze(raw_data['stimStarts'])
df['stop'] = np.squeeze(raw_data['stimStops'])
df['stimulus'] = np.squeeze(raw_data['stimIDs'])
print(df.head())
########################################################
# 3 Start Plotting
# -----------------------------
# 3.1 Striatum
# ~~~~~~~~~~~~
pop = PopVis(striatum, name='Striatum')
fig = plt.figure(figsize=(30, 20))
all_psth = pop.get_all_psth(
event='start', df=df, conditions='stimulus', plot=False, binsize=100,
window=[-500, 2000])
pop.plot_heat_map(all_psth, cond_id=[
2, 7, 13], sortorder='descend', neuron_names=False)
########################################################
pop.plot_population_psth(all_psth=all_psth, cond_id=[1, 7, 12])
########################################################
# 3.2 Frontal
# ~~~~~~~~~~~~
pop = PopVis(striatum + motor_ctx, name='Frontal')
fig = plt.figure(figsize=(30, 20))
all_psth = pop.get_all_psth(
event='start', df=df, conditions='stimulus', plot=False, binsize=100,
window=[-500, 2000])
pop.plot_heat_map(
all_psth, cond_id=[2, 7, 13], sortorder='descend', neuron_names=False)
########################################################
pop.plot_population_psth(all_psth=all_psth, cond_id=[1, 7, 12])
########################################################
# 3.3 All Neurons
# ~~~~~~~~~~~~
pop = PopVis(striatum + motor_ctx + thalamus + hippocampus + visual_ctx)
fig = plt.figure(figsize=(30, 20))
all_psth = pop.get_all_psth(
event='start', df=df, conditions='stimulus', plot=False, binsize=100,
window=[-500, 2000])
pop.plot_heat_map(
all_psth, cond_id=[2, 7, 13], sortorder='descend', neuron_names=False)
########################################################
pop.plot_population_psth(all_psth=all_psth, cond_id=[1, 7, 12])
########################################################
# 3.4 Striatum vs. Motor Cortex
# ~~~~~~~~~~~~
striatum_pop = PopVis(striatum, name='Striatum')
motor_ctx_pop = PopVis(motor_ctx, name='Motor Cortex')
striatum_psth = striatum_pop.get_all_psth(
event='start', df=df, conditions='stimulus', plot=False, binsize=100,
window=[-500, 2000])
motor_ctx_psth = motor_ctx_pop.get_all_psth(
event='start', df=df, conditions='stimulus', plot=False, binsize=100,
window=[-500, 2000])
########################################################
striatum_pop.plot_population_psth(all_psth=striatum_psth, cond_id=[1, 7, 12])
########################################################
motor_ctx_pop.plot_population_psth(all_psth=motor_ctx_psth, cond_id=[1, 7, 12])
|
mit
|
bobwalker99/Pydev
|
plugins/org.python.pydev/pysrc/pydevd.py
|
1
|
61172
|
'''
Entry point module (keep at root):
This module starts the debugger.
'''
from __future__ import nested_scopes # Jython 2.1 support
import atexit
import os
import sys
import traceback
from _pydevd_bundle.pydevd_constants import IS_JYTH_LESS25, IS_PY3K, IS_PY34_OLDER, get_thread_id, dict_keys, dict_pop, dict_contains, \
dict_iter_items, DebugInfoHolder, PYTHON_SUSPEND, STATE_SUSPEND, STATE_RUN, get_frame, xrange, \
clear_cached_thread_id
from _pydev_bundle import fix_getpass
from _pydev_bundle import pydev_imports, pydev_log
from _pydev_bundle._pydev_filesystem_encoding import getfilesystemencoding
from _pydev_bundle.pydev_is_thread_alive import is_thread_alive
from _pydev_imps._pydev_saved_modules import threading
from _pydev_imps._pydev_saved_modules import time
from _pydev_imps._pydev_saved_modules import thread
from _pydevd_bundle import pydevd_io, pydevd_vm_type, pydevd_tracing
from _pydevd_bundle import pydevd_utils
from _pydevd_bundle import pydevd_vars
from _pydevd_bundle.pydevd_additional_thread_info import PyDBAdditionalThreadInfo
from _pydevd_bundle.pydevd_breakpoints import ExceptionBreakpoint, update_exception_hook
from _pydevd_bundle.pydevd_comm import CMD_SET_BREAK, CMD_SET_NEXT_STATEMENT, CMD_STEP_INTO, CMD_STEP_OVER, \
CMD_STEP_RETURN, CMD_STEP_INTO_MY_CODE, CMD_THREAD_SUSPEND, CMD_RUN_TO_LINE, \
CMD_ADD_EXCEPTION_BREAK, CMD_SMART_STEP_INTO, InternalConsoleExec, NetCommandFactory, \
PyDBDaemonThread, _queue, ReaderThread, GetGlobalDebugger, get_global_debugger, \
set_global_debugger, WriterThread, pydevd_find_thread_by_id, pydevd_log, \
start_client, start_server, InternalGetBreakpointException, InternalSendCurrExceptionTrace, \
InternalSendCurrExceptionTraceProceeded
from _pydevd_bundle.pydevd_custom_frames import CustomFramesContainer, custom_frames_container_init
from _pydevd_bundle.pydevd_frame_utils import add_exception_to_frame
from _pydevd_bundle.pydevd_kill_all_pydevd_threads import kill_all_pydev_threads
from _pydevd_bundle.pydevd_trace_dispatch import trace_dispatch as _trace_dispatch
from _pydevd_bundle.pydevd_utils import save_main_module
from pydevd_concurrency_analyser.pydevd_concurrency_logger import ThreadingLogger, AsyncioLogger, send_message, cur_time
from pydevd_concurrency_analyser.pydevd_thread_wrappers import wrap_threads
__version_info__ = (0, 0, 6)
__version_info_str__ = []
for v in __version_info__:
__version_info_str__.append(str(v))
__version__ = '.'.join(__version_info_str__)
#IMPORTANT: pydevd_constants must be the 1st thing defined because it'll keep a reference to the original sys._getframe
SUPPORT_PLUGINS = not IS_JYTH_LESS25
PluginManager = None
if SUPPORT_PLUGINS:
from _pydevd_bundle.pydevd_plugin_utils import PluginManager
threadingEnumerate = threading.enumerate
threadingCurrentThread = threading.currentThread
try:
'dummy'.encode('utf-8') # Added because otherwise Jython 2.2.1 wasn't finding the encoding (if it wasn't loaded in the main thread).
except:
pass
connected = False
bufferStdOutToServer = False
bufferStdErrToServer = False
remote = False
file_system_encoding = getfilesystemencoding()
#=======================================================================================================================
# PyDBCommandThread
#=======================================================================================================================
class PyDBCommandThread(PyDBDaemonThread):
def __init__(self, py_db):
PyDBDaemonThread.__init__(self)
self._py_db_command_thread_event = py_db._py_db_command_thread_event
self.py_db = py_db
self.setName('pydevd.CommandThread')
def _on_run(self):
for i in xrange(1, 10):
time.sleep(0.5) #this one will only start later on (because otherwise we may not have any non-daemon threads
if self.killReceived:
return
if self.dontTraceMe:
self.py_db.SetTrace(None) # no debugging on this thread
try:
while not self.killReceived:
try:
self.py_db.process_internal_commands()
except:
pydevd_log(0, 'Finishing debug communication...(2)')
self._py_db_command_thread_event.clear()
self._py_db_command_thread_event.wait(0.5)
except:
pydev_log.debug(sys.exc_info()[0])
#only got this error in interpreter shutdown
#pydevd_log(0, 'Finishing debug communication...(3)')
#=======================================================================================================================
# CheckOutputThread
# Non-daemonic thread guaranties that all data is written even if program is finished
#=======================================================================================================================
class CheckOutputThread(PyDBDaemonThread):
def __init__(self, py_db):
PyDBDaemonThread.__init__(self)
self.py_db = py_db
self.setName('pydevd.CheckAliveThread')
self.daemon = False
py_db.output_checker = self
def _on_run(self):
if self.dontTraceMe:
disable_tracing = True
if pydevd_vm_type.get_vm_type() == pydevd_vm_type.PydevdVmType.JYTHON and sys.hexversion <= 0x020201f0:
# don't run untraced threads if we're in jython 2.2.1 or lower
# jython bug: if we start a thread and another thread changes the tracing facility
# it affects other threads (it's not set only for the thread but globally)
# Bug: http://sourceforge.net/tracker/index.php?func=detail&aid=1870039&group_id=12867&atid=112867
disable_tracing = False
if disable_tracing:
pydevd_tracing.SetTrace(None) # no debugging on this thread
while not self.killReceived:
time.sleep(0.3)
if not self.py_db.has_threads_alive() and self.py_db.writer.empty() \
and not has_data_to_redirect():
try:
pydev_log.debug("No alive threads, finishing debug session")
self.py_db.finish_debugging_session()
kill_all_pydev_threads()
except:
traceback.print_exc()
self.killReceived = True
self.py_db.check_output_redirect()
def do_kill_pydev_thread(self):
self.killReceived = True
#=======================================================================================================================
# PyDB
#=======================================================================================================================
class PyDB:
""" Main debugging class
Lots of stuff going on here:
PyDB starts two threads on startup that connect to remote debugger (RDB)
The threads continuously read & write commands to RDB.
PyDB communicates with these threads through command queues.
Every RDB command is processed by calling process_net_command.
Every PyDB net command is sent to the net by posting NetCommand to WriterThread queue
Some commands need to be executed on the right thread (suspend/resume & friends)
These are placed on the internal command queue.
"""
def __init__(self):
set_global_debugger(self)
pydevd_tracing.replace_sys_set_trace_func()
self.reader = None
self.writer = None
self.output_checker = None
self.quitting = None
self.cmd_factory = NetCommandFactory()
self._cmd_queue = {} # the hash of Queues. Key is thread id, value is thread
self.breakpoints = {}
self.file_to_id_to_line_breakpoint = {}
self.file_to_id_to_plugin_breakpoint = {}
# Note: breakpoints dict should not be mutated: a copy should be created
# and later it should be assigned back (to prevent concurrency issues).
self.break_on_uncaught_exceptions = {}
self.break_on_caught_exceptions = {}
self.ready_to_run = False
self._main_lock = thread.allocate_lock()
self._lock_running_thread_ids = thread.allocate_lock()
self._py_db_command_thread_event = threading.Event()
CustomFramesContainer._py_db_command_thread_event = self._py_db_command_thread_event
self._finish_debugging_session = False
self._termination_event_set = False
self.signature_factory = None
self.SetTrace = pydevd_tracing.SetTrace
self.break_on_exceptions_thrown_in_same_context = False
self.ignore_exceptions_thrown_in_lines_with_ignore_exception = True
# Suspend debugger even if breakpoint condition raises an exception
SUSPEND_ON_BREAKPOINT_EXCEPTION = True
self.suspend_on_breakpoint_exception = SUSPEND_ON_BREAKPOINT_EXCEPTION
# By default user can step into properties getter/setter/deleter methods
self.disable_property_trace = False
self.disable_property_getter_trace = False
self.disable_property_setter_trace = False
self.disable_property_deleter_trace = False
#this is a dict of thread ids pointing to thread ids. Whenever a command is passed to the java end that
#acknowledges that a thread was created, the thread id should be passed here -- and if at some time we do not
#find that thread alive anymore, we must remove it from this list and make the java side know that the thread
#was killed.
self._running_thread_ids = {}
self._set_breakpoints_with_id = False
# This attribute holds the file-> lines which have an @IgnoreException.
self.filename_to_lines_where_exceptions_are_ignored = {}
#working with plugins (lazily initialized)
self.plugin = None
self.has_plugin_line_breaks = False
self.has_plugin_exception_breaks = False
self.thread_analyser = None
self.asyncio_analyser = None
# matplotlib support in debugger and debug console
self.mpl_in_use = False
self.mpl_hooks_in_debug_console = False
self.mpl_modules_for_patching = {}
self._filename_to_not_in_scope = {}
self.first_breakpoint_reached = False
self.is_filter_enabled = pydevd_utils.is_filter_enabled()
self.is_filter_libraries = pydevd_utils.is_filter_libraries()
def get_plugin_lazy_init(self):
if self.plugin is None and SUPPORT_PLUGINS:
self.plugin = PluginManager(self)
return self.plugin
def not_in_scope(self, filename):
return pydevd_utils.not_in_project_roots(filename)
def is_ignored_by_filters(self, filename):
return pydevd_utils.is_ignored_by_filter(filename)
def first_appearance_in_scope(self, trace):
if trace is None or self.not_in_scope(trace.tb_frame.f_code.co_filename):
return False
else:
trace = trace.tb_next
while trace is not None:
frame = trace.tb_frame
if not self.not_in_scope(frame.f_code.co_filename):
return False
trace = trace.tb_next
return True
def has_threads_alive(self):
for t in threadingEnumerate():
if getattr(t, 'is_pydev_daemon_thread', False):
#Important: Jython 2.5rc4 has a bug where a thread created with thread.start_new_thread won't be
#set as a daemon thread, so, we also have to check for the 'is_pydev_daemon_thread' flag.
#See: https://github.com/fabioz/PyDev.Debugger/issues/11
continue
if isinstance(t, PyDBDaemonThread):
pydev_log.error_once(
'Error in debugger: Found PyDBDaemonThread not marked with is_pydev_daemon_thread=True.\n')
if is_thread_alive(t):
if not t.isDaemon() or hasattr(t, "__pydevd_main_thread"):
return True
return False
def finish_debugging_session(self):
self._finish_debugging_session = True
def initialize_network(self, sock):
try:
sock.settimeout(None) # infinite, no timeouts from now on - jython does not have it
except:
pass
self.writer = WriterThread(sock)
self.reader = ReaderThread(sock)
self.writer.start()
self.reader.start()
time.sleep(0.1) # give threads time to start
def connect(self, host, port):
if host:
s = start_client(host, port)
else:
s = start_server(port)
self.initialize_network(s)
def get_internal_queue(self, thread_id):
""" returns internal command queue for a given thread.
if new queue is created, notify the RDB about it """
if thread_id.startswith('__frame__'):
thread_id = thread_id[thread_id.rfind('|') + 1:]
try:
return self._cmd_queue[thread_id]
except KeyError:
return self._cmd_queue.setdefault(thread_id, _queue.Queue()) #@UndefinedVariable
def post_internal_command(self, int_cmd, thread_id):
""" if thread_id is *, post to all """
if thread_id == "*":
threads = threadingEnumerate()
for t in threads:
thread_id = get_thread_id(t)
queue = self.get_internal_queue(thread_id)
queue.put(int_cmd)
else:
queue = self.get_internal_queue(thread_id)
queue.put(int_cmd)
def check_output_redirect(self):
global bufferStdOutToServer
global bufferStdErrToServer
if bufferStdOutToServer:
init_stdout_redirect()
self.check_output(sys.stdoutBuf, 1) #@UndefinedVariable
if bufferStdErrToServer:
init_stderr_redirect()
self.check_output(sys.stderrBuf, 2) #@UndefinedVariable
def check_output(self, out, outCtx):
'''Checks the output to see if we have to send some buffered output to the debug server
@param out: sys.stdout or sys.stderr
@param outCtx: the context indicating: 1=stdout and 2=stderr (to know the colors to write it)
'''
try:
v = out.getvalue()
if v:
self.cmd_factory.make_io_message(v, outCtx, self)
except:
traceback.print_exc()
def init_matplotlib_in_debug_console(self):
# import hook and patches for matplotlib support in debug console
from _pydev_bundle.pydev_import_hook import import_hook_manager
for module in dict_keys(self.mpl_modules_for_patching):
import_hook_manager.add_module_name(module, dict_pop(self.mpl_modules_for_patching, module))
def init_matplotlib_support(self):
# prepare debugger for integration with matplotlib GUI event loop
from pydev_ipython.matplotlibtools import activate_matplotlib, activate_pylab, activate_pyplot, do_enable_gui
# enable_gui_function in activate_matplotlib should be called in main thread. Unlike integrated console,
# in the debug console we have no interpreter instance with exec_queue, but we run this code in the main
# thread and can call it directly.
class _MatplotlibHelper:
_return_control_osc = False
def return_control():
# Some of the input hooks (e.g. Qt4Agg) check return control without doing
# a single operation, so we don't return True on every
# call when the debug hook is in place to allow the GUI to run
_MatplotlibHelper._return_control_osc = not _MatplotlibHelper._return_control_osc
return _MatplotlibHelper._return_control_osc
from pydev_ipython.inputhook import set_return_control_callback
set_return_control_callback(return_control)
self.mpl_modules_for_patching = {"matplotlib": lambda: activate_matplotlib(do_enable_gui),
"matplotlib.pyplot": activate_pyplot,
"pylab": activate_pylab }
def process_internal_commands(self):
'''This function processes internal commands
'''
self._main_lock.acquire()
try:
self.check_output_redirect()
curr_thread_id = get_thread_id(threadingCurrentThread())
program_threads_alive = {}
all_threads = threadingEnumerate()
program_threads_dead = []
self._lock_running_thread_ids.acquire()
try:
for t in all_threads:
if getattr(t, 'is_pydev_daemon_thread', False):
pass # I.e.: skip the DummyThreads created from pydev daemon threads
elif isinstance(t, PyDBDaemonThread):
pydev_log.error_once('Error in debugger: Found PyDBDaemonThread not marked with is_pydev_daemon_thread=True.\n')
elif is_thread_alive(t):
if not self._running_thread_ids:
# Fix multiprocessing debug with breakpoints in both main and child processes
# (https://youtrack.jetbrains.com/issue/PY-17092) When the new process is created, the main
# thread in the new process already has the attribute 'pydevd_id', so the new thread doesn't
# get new id with its process number and the debugger loses access to both threads.
# Therefore we should update thread_id for every main thread in the new process.
# TODO: Investigate: should we do this for all threads in threading.enumerate()?
# (i.e.: if a fork happens on Linux, this seems likely).
old_thread_id = get_thread_id(t)
clear_cached_thread_id(t)
clear_cached_thread_id(threadingCurrentThread())
thread_id = get_thread_id(t)
curr_thread_id = get_thread_id(threadingCurrentThread())
if pydevd_vars.has_additional_frames_by_id(old_thread_id):
frames_by_id = pydevd_vars.get_additional_frames_by_id(old_thread_id)
pydevd_vars.add_additional_frame_by_id(thread_id, frames_by_id)
else:
thread_id = get_thread_id(t)
program_threads_alive[thread_id] = t
if not dict_contains(self._running_thread_ids, thread_id):
if not hasattr(t, 'additional_info'):
# see http://sourceforge.net/tracker/index.php?func=detail&aid=1955428&group_id=85796&atid=577329
# Let's create the additional info right away!
t.additional_info = PyDBAdditionalThreadInfo()
self._running_thread_ids[thread_id] = t
self.writer.add_command(self.cmd_factory.make_thread_created_message(t))
queue = self.get_internal_queue(thread_id)
cmdsToReadd = [] # some commands must be processed by the thread itself... if that's the case,
# we will re-add the commands to the queue after executing.
try:
while True:
int_cmd = queue.get(False)
if not self.mpl_hooks_in_debug_console and isinstance(int_cmd, InternalConsoleExec):
# add import hooks for matplotlib patches if only debug console was started
try:
self.init_matplotlib_in_debug_console()
self.mpl_in_use = True
except:
pydevd_log(2, "Matplotlib support in debug console failed", traceback.format_exc())
self.mpl_hooks_in_debug_console = True
if int_cmd.can_be_executed_by(curr_thread_id):
pydevd_log(2, "processing internal command ", str(int_cmd))
int_cmd.do_it(self)
else:
pydevd_log(2, "NOT processing internal command ", str(int_cmd))
cmdsToReadd.append(int_cmd)
except _queue.Empty: #@UndefinedVariable
for int_cmd in cmdsToReadd:
queue.put(int_cmd)
# this is how we exit
thread_ids = list(self._running_thread_ids.keys())
for tId in thread_ids:
if not dict_contains(program_threads_alive, tId):
program_threads_dead.append(tId)
finally:
self._lock_running_thread_ids.release()
for tId in program_threads_dead:
try:
self._process_thread_not_alive(tId)
except:
sys.stderr.write('Error iterating through %s (%s) - %s\n' % (
program_threads_alive, program_threads_alive.__class__, dir(program_threads_alive)))
raise
if len(program_threads_alive) == 0:
self.finish_debugging_session()
for t in all_threads:
if hasattr(t, 'do_kill_pydev_thread'):
t.do_kill_pydev_thread()
finally:
self._main_lock.release()
def set_tracing_for_untraced_contexts(self, ignore_frame=None, overwrite_prev_trace=False):
# Enable the tracing for existing threads (because there may be frames being executed that
# are currently untraced).
threads = threadingEnumerate()
try:
for t in threads:
if getattr(t, 'is_pydev_daemon_thread', False):
continue
# TODO: optimize so that we only actually add that tracing if it's in
# the new breakpoint context.
additional_info = None
try:
additional_info = t.additional_info
except AttributeError:
pass # that's ok, no info currently set
if additional_info is not None:
for frame in additional_info.iter_frames(t):
if frame is not ignore_frame:
self.set_trace_for_frame_and_parents(frame, overwrite_prev_trace=overwrite_prev_trace)
finally:
frame = None
t = None
threads = None
additional_info = None
def consolidate_breakpoints(self, file, id_to_breakpoint, breakpoints):
break_dict = {}
for breakpoint_id, pybreakpoint in dict_iter_items(id_to_breakpoint):
break_dict[pybreakpoint.line] = pybreakpoint
breakpoints[file] = break_dict
def add_break_on_exception(
self,
exception,
notify_always,
notify_on_terminate,
notify_on_first_raise_only,
ignore_libraries=False
):
try:
eb = ExceptionBreakpoint(
exception,
notify_always,
notify_on_terminate,
notify_on_first_raise_only,
ignore_libraries
)
except ImportError:
pydev_log.error("Error unable to add break on exception for: %s (exception could not be imported)\n" % (exception,))
return None
if eb.notify_on_terminate:
cp = self.break_on_uncaught_exceptions.copy()
cp[exception] = eb
if DebugInfoHolder.DEBUG_TRACE_BREAKPOINTS > 0:
pydev_log.error("Exceptions to hook on terminate: %s\n" % (cp,))
self.break_on_uncaught_exceptions = cp
if eb.notify_always:
cp = self.break_on_caught_exceptions.copy()
cp[exception] = eb
if DebugInfoHolder.DEBUG_TRACE_BREAKPOINTS > 0:
pydev_log.error("Exceptions to hook always: %s\n" % (cp,))
self.break_on_caught_exceptions = cp
return eb
def update_after_exceptions_added(self, added):
updated_on_caught = False
updated_on_uncaught = False
for eb in added:
if not updated_on_uncaught and eb.notify_on_terminate:
updated_on_uncaught = True
update_exception_hook(self)
if not updated_on_caught and eb.notify_always:
updated_on_caught = True
self.set_tracing_for_untraced_contexts()
def _process_thread_not_alive(self, threadId):
""" if thread is not alive, cancel trace_dispatch processing """
self._lock_running_thread_ids.acquire()
try:
thread = self._running_thread_ids.pop(threadId, None)
if thread is None:
return
wasNotified = thread.additional_info.pydev_notify_kill
if not wasNotified:
thread.additional_info.pydev_notify_kill = True
finally:
self._lock_running_thread_ids.release()
cmd = self.cmd_factory.make_thread_killed_message(threadId)
self.writer.add_command(cmd)
def set_suspend(self, thread, stop_reason):
thread.additional_info.suspend_type = PYTHON_SUSPEND
thread.additional_info.pydev_state = STATE_SUSPEND
thread.stop_reason = stop_reason
# If conditional breakpoint raises any exception during evaluation send details to Java
if stop_reason == CMD_SET_BREAK and self.suspend_on_breakpoint_exception:
self._send_breakpoint_condition_exception(thread)
def _send_breakpoint_condition_exception(self, thread):
"""If conditional breakpoint raises an exception during evaluation
send exception details to java
"""
thread_id = get_thread_id(thread)
conditional_breakpoint_exception_tuple = thread.additional_info.conditional_breakpoint_exception
# conditional_breakpoint_exception_tuple - should contain 2 values (exception_type, stacktrace)
if conditional_breakpoint_exception_tuple and len(conditional_breakpoint_exception_tuple) == 2:
exc_type, stacktrace = conditional_breakpoint_exception_tuple
int_cmd = InternalGetBreakpointException(thread_id, exc_type, stacktrace)
# Reset the conditional_breakpoint_exception details to None
thread.additional_info.conditional_breakpoint_exception = None
self.post_internal_command(int_cmd, thread_id)
def send_caught_exception_stack(self, thread, arg, curr_frame_id):
"""Sends details on the exception which was caught (and where we stopped) to the java side.
arg is: exception type, description, traceback object
"""
thread_id = get_thread_id(thread)
int_cmd = InternalSendCurrExceptionTrace(thread_id, arg, curr_frame_id)
self.post_internal_command(int_cmd, thread_id)
def send_caught_exception_stack_proceeded(self, thread):
"""Sends that some thread was resumed and is no longer showing an exception trace.
"""
thread_id = get_thread_id(thread)
int_cmd = InternalSendCurrExceptionTraceProceeded(thread_id)
self.post_internal_command(int_cmd, thread_id)
self.process_internal_commands()
def do_wait_suspend(self, thread, frame, event, arg): #@UnusedVariable
""" busy waits until the thread state changes to RUN
it expects thread's state as attributes of the thread.
Upon running, processes any outstanding Stepping commands.
"""
self.process_internal_commands()
message = thread.additional_info.pydev_message
cmd = self.cmd_factory.make_thread_suspend_message(get_thread_id(thread), frame, thread.stop_reason, message)
self.writer.add_command(cmd)
CustomFramesContainer.custom_frames_lock.acquire() # @UndefinedVariable
try:
from_this_thread = []
for frame_id, custom_frame in dict_iter_items(CustomFramesContainer.custom_frames):
if custom_frame.thread_id == thread.ident:
# print >> sys.stderr, 'Frame created: ', frame_id
self.writer.add_command(self.cmd_factory.make_custom_frame_created_message(frame_id, custom_frame.name))
self.writer.add_command(self.cmd_factory.make_thread_suspend_message(frame_id, custom_frame.frame, CMD_THREAD_SUSPEND, ""))
from_this_thread.append(frame_id)
finally:
CustomFramesContainer.custom_frames_lock.release() # @UndefinedVariable
imported = False
info = thread.additional_info
if info.pydev_state == STATE_SUSPEND and not self._finish_debugging_session:
# before every stop check if matplotlib modules were imported inside script code
if len(self.mpl_modules_for_patching) > 0:
for module in dict_keys(self.mpl_modules_for_patching):
if module in sys.modules:
activate_function = dict_pop(self.mpl_modules_for_patching, module)
activate_function()
self.mpl_in_use = True
while info.pydev_state == STATE_SUSPEND and not self._finish_debugging_session:
if self.mpl_in_use:
# call input hooks if only matplotlib is in use
try:
if not imported:
from pydev_ipython.inputhook import get_inputhook
imported = True
inputhook = get_inputhook()
if inputhook:
inputhook()
except:
pass
self.process_internal_commands()
time.sleep(0.01)
# process any stepping instructions
if info.pydev_step_cmd == CMD_STEP_INTO or info.pydev_step_cmd == CMD_STEP_INTO_MY_CODE:
info.pydev_step_stop = None
info.pydev_smart_step_stop = None
elif info.pydev_step_cmd == CMD_STEP_OVER:
info.pydev_step_stop = frame
info.pydev_smart_step_stop = None
self.set_trace_for_frame_and_parents(frame)
elif info.pydev_step_cmd == CMD_SMART_STEP_INTO:
self.set_trace_for_frame_and_parents(frame)
info.pydev_step_stop = None
info.pydev_smart_step_stop = frame
elif info.pydev_step_cmd == CMD_RUN_TO_LINE or info.pydev_step_cmd == CMD_SET_NEXT_STATEMENT :
self.set_trace_for_frame_and_parents(frame)
if event == 'line' or event == 'exception':
#If we're already in the correct context, we have to stop it now, because we can act only on
#line events -- if a return was the next statement it wouldn't work (so, we have this code
#repeated at pydevd_frame).
stop = False
curr_func_name = frame.f_code.co_name
#global context is set with an empty name
if curr_func_name in ('?', '<module>'):
curr_func_name = ''
if curr_func_name == info.pydev_func_name:
line = info.pydev_next_line
if frame.f_lineno == line:
stop = True
else :
if frame.f_trace is None:
frame.f_trace = self.trace_dispatch
frame.f_lineno = line
frame.f_trace = None
stop = True
if stop:
info.pydev_state = STATE_SUSPEND
self.do_wait_suspend(thread, frame, event, arg)
return
elif info.pydev_step_cmd == CMD_STEP_RETURN:
back_frame = frame.f_back
if back_frame is not None:
# steps back to the same frame (in a return call it will stop in the 'back frame' for the user)
info.pydev_step_stop = frame
self.set_trace_for_frame_and_parents(frame)
else:
# No back frame?!? -- this happens in jython when we have some frame created from an awt event
# (the previous frame would be the awt event, but this doesn't make part of 'jython', only 'java')
# so, if we're doing a step return in this situation, it's the same as just making it run
info.pydev_step_stop = None
info.pydev_step_cmd = -1
info.pydev_state = STATE_RUN
del frame
cmd = self.cmd_factory.make_thread_run_message(get_thread_id(thread), info.pydev_step_cmd)
self.writer.add_command(cmd)
CustomFramesContainer.custom_frames_lock.acquire() # @UndefinedVariable
try:
# The ones that remained on last_running must now be removed.
for frame_id in from_this_thread:
# print >> sys.stderr, 'Removing created frame: ', frame_id
self.writer.add_command(self.cmd_factory.make_thread_killed_message(frame_id))
finally:
CustomFramesContainer.custom_frames_lock.release() # @UndefinedVariable
def handle_post_mortem_stop(self, thread, frame, frames_byid, exception):
pydev_log.debug("We are stopping in post-mortem\n")
thread_id = get_thread_id(thread)
pydevd_vars.add_additional_frame_by_id(thread_id, frames_byid)
try:
try:
add_exception_to_frame(frame, exception)
self.set_suspend(thread, CMD_ADD_EXCEPTION_BREAK)
self.do_wait_suspend(thread, frame, 'exception', None)
except:
pydev_log.error("We've got an error while stopping in post-mortem: %s\n"%sys.exc_info()[0])
finally:
pydevd_vars.remove_additional_frame_by_id(thread_id)
def set_trace_for_frame_and_parents(self, frame, also_add_to_passed_frame=True, overwrite_prev_trace=False, dispatch_func=None):
if dispatch_func is None:
dispatch_func = self.trace_dispatch
if also_add_to_passed_frame:
self.update_trace(frame, dispatch_func, overwrite_prev_trace)
frame = frame.f_back
while frame:
self.update_trace(frame, dispatch_func, overwrite_prev_trace)
frame = frame.f_back
del frame
def update_trace(self, frame, dispatch_func, overwrite_prev):
if frame.f_trace is None:
frame.f_trace = dispatch_func
else:
if overwrite_prev:
frame.f_trace = dispatch_func
else:
try:
#If it's the trace_exception, go back to the frame trace dispatch!
if frame.f_trace.im_func.__name__ == 'trace_exception':
frame.f_trace = frame.f_trace.im_self.trace_dispatch
except AttributeError:
pass
frame = frame.f_back
del frame
def prepare_to_run(self):
''' Shared code to prepare debugging by installing traces and registering threads '''
self.patch_threads()
pydevd_tracing.SetTrace(self.trace_dispatch)
PyDBCommandThread(self).start()
if self.signature_factory is not None or self.thread_analyser is not None:
# we need all data to be sent to IDE even after program finishes
CheckOutputThread(self).start()
def patch_threads(self):
try:
# not available in jython!
threading.settrace(self.trace_dispatch) # for all future threads
except:
pass
from _pydev_bundle.pydev_monkey import patch_thread_modules
patch_thread_modules()
def get_fullname(self, mod_name):
if IS_PY3K:
import pkgutil
else:
from _pydev_imps import _pydev_pkgutil_old as pkgutil
try:
loader = pkgutil.get_loader(mod_name)
except:
return None
if loader is not None:
for attr in ("get_filename", "_get_filename"):
meth = getattr(loader, attr, None)
if meth is not None:
return meth(mod_name)
return None
def run(self, file, globals=None, locals=None, module=False, set_trace=True):
if module:
filename = self.get_fullname(file)
if filename is None:
sys.stderr.write("No module named %s\n" % file)
return
else:
file = filename
if os.path.isdir(file):
new_target = os.path.join(file, '__main__.py')
if os.path.isfile(new_target):
file = new_target
if globals is None:
m = save_main_module(file, 'pydevd')
globals = m.__dict__
try:
globals['__builtins__'] = __builtins__
except NameError:
pass # Not there on Jython...
if locals is None:
locals = globals
if set_trace:
# Predefined (writable) attributes: __name__ is the module's name;
# __doc__ is the module's documentation string, or None if unavailable;
# __file__ is the pathname of the file from which the module was loaded,
# if it was loaded from a file. The __file__ attribute is not present for
# C modules that are statically linked into the interpreter; for extension modules
# loaded dynamically from a shared library, it is the pathname of the shared library file.
# I think this is an ugly hack, bug it works (seems to) for the bug that says that sys.path should be the same in
# debug and run.
if m.__file__.startswith(sys.path[0]):
# print >> sys.stderr, 'Deleting: ', sys.path[0]
del sys.path[0]
# now, the local directory has to be added to the pythonpath
# sys.path.insert(0, os.getcwd())
# Changed: it's not the local directory, but the directory of the file launched
# The file being run ust be in the pythonpath (even if it was not before)
sys.path.insert(0, os.path.split(file)[0])
self.prepare_to_run()
while not self.ready_to_run:
time.sleep(0.1) # busy wait until we receive run command
if self.thread_analyser is not None:
wrap_threads()
t = threadingCurrentThread()
self.thread_analyser.set_start_time(cur_time())
send_message("threading_event", 0, t.getName(), get_thread_id(t), "thread", "start", file, 1, None, parent=get_thread_id(t))
if self.asyncio_analyser is not None:
# we don't have main thread in asyncio graph, so we should add a fake event
send_message("asyncio_event", 0, "Task", "Task", "thread", "stop", file, 1, frame=None, parent=None)
try:
self.init_matplotlib_support()
except:
sys.stderr.write("Matplotlib support in debugger failed\n")
traceback.print_exc()
pydev_imports.execfile(file, globals, locals) # execute the script
def exiting(self):
sys.stdout.flush()
sys.stderr.flush()
self.check_output_redirect()
cmd = self.cmd_factory.make_exit_message()
self.writer.add_command(cmd)
def wait_for_commands(self, globals):
thread = threading.currentThread()
from _pydevd_bundle import pydevd_frame_utils
frame = pydevd_frame_utils.Frame(None, -1, pydevd_frame_utils.FCode("Console",
os.path.abspath(os.path.dirname(__file__))), globals, globals)
thread_id = get_thread_id(thread)
from _pydevd_bundle import pydevd_vars
pydevd_vars.add_additional_frame_by_id(thread_id, {id(frame): frame})
cmd = self.cmd_factory.make_show_console_message(thread_id, frame)
self.writer.add_command(cmd)
while True:
self.process_internal_commands()
time.sleep(0.01)
trace_dispatch = _trace_dispatch
def set_debug(setup):
setup['DEBUG_RECORD_SOCKET_READS'] = True
setup['DEBUG_TRACE_BREAKPOINTS'] = 1
setup['DEBUG_TRACE_LEVEL'] = 3
def enable_qt_support():
from _pydev_bundle import pydev_monkey_qt
pydev_monkey_qt.patch_qt()
def process_command_line(argv):
""" parses the arguments.
removes our arguments from the command line """
setup = {}
setup['client'] = ''
setup['server'] = False
setup['port'] = 0
setup['file'] = ''
setup['multiproc'] = False #Used by PyCharm (reuses connection: ssh tunneling)
setup['multiprocess'] = False # Used by PyDev (creates new connection to ide)
setup['save-signatures'] = False
setup['save-threading'] = False
setup['save-asyncio'] = False
setup['qt-support'] = False
setup['print-in-debugger-startup'] = False
setup['cmd-line'] = False
setup['module'] = False
i = 0
del argv[0]
while (i < len(argv)):
if argv[i] == '--port':
del argv[i]
setup['port'] = int(argv[i])
del argv[i]
elif argv[i] == '--vm_type':
del argv[i]
setup['vm_type'] = argv[i]
del argv[i]
elif argv[i] == '--client':
del argv[i]
setup['client'] = argv[i]
del argv[i]
elif argv[i] == '--server':
del argv[i]
setup['server'] = True
elif argv[i] == '--file':
del argv[i]
setup['file'] = argv[i]
i = len(argv) # pop out, file is our last argument
elif argv[i] == '--DEBUG_RECORD_SOCKET_READS':
del argv[i]
setup['DEBUG_RECORD_SOCKET_READS'] = True
elif argv[i] == '--DEBUG':
del argv[i]
set_debug(setup)
elif argv[i] == '--multiproc':
del argv[i]
setup['multiproc'] = True
elif argv[i] == '--multiprocess':
del argv[i]
setup['multiprocess'] = True
elif argv[i] == '--save-signatures':
del argv[i]
setup['save-signatures'] = True
elif argv[i] == '--save-threading':
del argv[i]
setup['save-threading'] = True
elif argv[i] == '--save-asyncio':
del argv[i]
setup['save-asyncio'] = True
elif argv[i] == '--qt-support':
del argv[i]
setup['qt-support'] = True
elif argv[i] == '--print-in-debugger-startup':
del argv[i]
setup['print-in-debugger-startup'] = True
elif (argv[i] == '--cmd-line'):
del argv[i]
setup['cmd-line'] = True
elif (argv[i] == '--module'):
del argv[i]
setup['module'] = True
else:
raise ValueError("unexpected option " + argv[i])
return setup
def usage(doExit=0):
sys.stdout.write('Usage:\n')
sys.stdout.write('pydevd.py --port=N [(--client hostname) | --server] --file executable [file_options]\n')
if doExit:
sys.exit(0)
def init_stdout_redirect():
if not getattr(sys, 'stdoutBuf', None):
sys.stdoutBuf = pydevd_io.IOBuf()
sys.stdout_original = sys.stdout
sys.stdout = pydevd_io.IORedirector(sys.stdout, sys.stdoutBuf) #@UndefinedVariable
def init_stderr_redirect():
if not getattr(sys, 'stderrBuf', None):
sys.stderrBuf = pydevd_io.IOBuf()
sys.stderr_original = sys.stderr
sys.stderr = pydevd_io.IORedirector(sys.stderr, sys.stderrBuf) #@UndefinedVariable
def has_data_to_redirect():
if getattr(sys, 'stdoutBuf', None):
if not sys.stdoutBuf.empty():
return True
if getattr(sys, 'stderrBuf', None):
if not sys.stderrBuf.empty():
return True
return False
#=======================================================================================================================
# settrace
#=======================================================================================================================
def settrace(
host=None,
stdoutToServer=False,
stderrToServer=False,
port=5678,
suspend=True,
trace_only_current_thread=False,
overwrite_prev_trace=False,
patch_multiprocessing=False,
):
'''Sets the tracing function with the pydev debug function and initializes needed facilities.
@param host: the user may specify another host, if the debug server is not in the same machine (default is the local
host)
@param stdoutToServer: when this is true, the stdout is passed to the debug server
@param stderrToServer: when this is true, the stderr is passed to the debug server
so that they are printed in its console and not in this process console.
@param port: specifies which port to use for communicating with the server (note that the server must be started
in the same port). @note: currently it's hard-coded at 5678 in the client
@param suspend: whether a breakpoint should be emulated as soon as this function is called.
@param trace_only_current_thread: determines if only the current thread will be traced or all current and future
threads will also have the tracing enabled.
@param overwrite_prev_trace: if True we'll reset the frame.f_trace of frames which are already being traced
@param patch_multiprocessing: if True we'll patch the functions which create new processes so that launched
processes are debugged.
'''
_set_trace_lock.acquire()
try:
_locked_settrace(
host,
stdoutToServer,
stderrToServer,
port,
suspend,
trace_only_current_thread,
overwrite_prev_trace,
patch_multiprocessing,
)
finally:
_set_trace_lock.release()
_set_trace_lock = thread.allocate_lock()
def _locked_settrace(
host,
stdoutToServer,
stderrToServer,
port,
suspend,
trace_only_current_thread,
overwrite_prev_trace,
patch_multiprocessing,
):
if patch_multiprocessing:
try:
from _pydev_bundle import pydev_monkey
except:
pass
else:
pydev_monkey.patch_new_process_functions()
if host is None:
from _pydev_bundle import pydev_localhost
host = pydev_localhost.get_localhost()
global connected
global bufferStdOutToServer
global bufferStdErrToServer
if not connected :
pydevd_vm_type.setup_type()
debugger = PyDB()
debugger.connect(host, port) # Note: connect can raise error.
# Mark connected only if it actually succeeded.
connected = True
bufferStdOutToServer = stdoutToServer
bufferStdErrToServer = stderrToServer
if bufferStdOutToServer:
init_stdout_redirect()
if bufferStdErrToServer:
init_stderr_redirect()
debugger.set_trace_for_frame_and_parents(get_frame(), False, overwrite_prev_trace=overwrite_prev_trace)
CustomFramesContainer.custom_frames_lock.acquire() # @UndefinedVariable
try:
for _frameId, custom_frame in dict_iter_items(CustomFramesContainer.custom_frames):
debugger.set_trace_for_frame_and_parents(custom_frame.frame, False)
finally:
CustomFramesContainer.custom_frames_lock.release() # @UndefinedVariable
t = threadingCurrentThread()
try:
additional_info = t.additional_info
except AttributeError:
additional_info = PyDBAdditionalThreadInfo()
t.additional_info = additional_info
while not debugger.ready_to_run:
time.sleep(0.1) # busy wait until we receive run command
# note that we do that through pydevd_tracing.SetTrace so that the tracing
# is not warned to the user!
pydevd_tracing.SetTrace(debugger.trace_dispatch)
if not trace_only_current_thread:
# Trace future threads?
debugger.patch_threads()
# As this is the first connection, also set tracing for any untraced threads
debugger.set_tracing_for_untraced_contexts(ignore_frame=get_frame(), overwrite_prev_trace=overwrite_prev_trace)
# Stop the tracing as the last thing before the actual shutdown for a clean exit.
atexit.register(stoptrace)
PyDBCommandThread(debugger).start()
CheckOutputThread(debugger).start()
#Suspend as the last thing after all tracing is in place.
if suspend:
debugger.set_suspend(t, CMD_THREAD_SUSPEND)
else:
# ok, we're already in debug mode, with all set, so, let's just set the break
debugger = get_global_debugger()
debugger.set_trace_for_frame_and_parents(get_frame(), False)
t = threadingCurrentThread()
try:
additional_info = t.additional_info
except AttributeError:
additional_info = PyDBAdditionalThreadInfo()
t.additional_info = additional_info
pydevd_tracing.SetTrace(debugger.trace_dispatch)
if not trace_only_current_thread:
# Trace future threads?
debugger.patch_threads()
if suspend:
debugger.set_suspend(t, CMD_THREAD_SUSPEND)
def stoptrace():
global connected
if connected:
pydevd_tracing.restore_sys_set_trace_func()
sys.settrace(None)
try:
#not available in jython!
threading.settrace(None) # for all future threads
except:
pass
from _pydev_bundle.pydev_monkey import undo_patch_thread_modules
undo_patch_thread_modules()
debugger = get_global_debugger()
if debugger:
debugger.set_trace_for_frame_and_parents(
get_frame(), also_add_to_passed_frame=True, overwrite_prev_trace=True, dispatch_func=lambda *args:None)
debugger.exiting()
kill_all_pydev_threads()
connected = False
class Dispatcher(object):
def __init__(self):
self.port = None
def connect(self, host, port):
self.host = host
self.port = port
self.client = start_client(self.host, self.port)
self.reader = DispatchReader(self)
self.reader.dontTraceMe = False #we run reader in the same thread so we don't want to loose tracing
self.reader.run()
def close(self):
try:
self.reader.do_kill_pydev_thread()
except :
pass
class DispatchReader(ReaderThread):
def __init__(self, dispatcher):
self.dispatcher = dispatcher
ReaderThread.__init__(self, self.dispatcher.client)
def _on_run(self):
dummy_thread = threading.currentThread()
dummy_thread.is_pydev_daemon_thread = False
return ReaderThread._on_run(self)
def handle_except(self):
ReaderThread.handle_except(self)
def process_command(self, cmd_id, seq, text):
if cmd_id == 99:
self.dispatcher.port = int(text)
self.killReceived = True
DISPATCH_APPROACH_NEW_CONNECTION = 1 # Used by PyDev
DISPATCH_APPROACH_EXISTING_CONNECTION = 2 # Used by PyCharm
DISPATCH_APPROACH = DISPATCH_APPROACH_NEW_CONNECTION
def dispatch():
setup = SetupHolder.setup
host = setup['client']
port = setup['port']
if DISPATCH_APPROACH == DISPATCH_APPROACH_EXISTING_CONNECTION:
dispatcher = Dispatcher()
try:
dispatcher.connect(host, port)
port = dispatcher.port
finally:
dispatcher.close()
return host, port
def settrace_forked():
'''
When creating a fork from a process in the debugger, we need to reset the whole debugger environment!
'''
host, port = dispatch()
from _pydevd_bundle import pydevd_tracing
pydevd_tracing.restore_sys_set_trace_func()
if port is not None:
global connected
connected = False
custom_frames_container_init()
settrace(
host,
port=port,
suspend=False,
trace_only_current_thread=False,
overwrite_prev_trace=True,
patch_multiprocessing=True,
)
#=======================================================================================================================
# SetupHolder
#=======================================================================================================================
class SetupHolder:
setup = None
#=======================================================================================================================
# main
#=======================================================================================================================
if __name__ == '__main__':
# parse the command line. --file is our last argument that is required
try:
sys.original_argv = sys.argv[:]
setup = process_command_line(sys.argv)
SetupHolder.setup = setup
except ValueError:
traceback.print_exc()
usage(1)
if setup['print-in-debugger-startup']:
try:
pid = ' (pid: %s)' % os.getpid()
except:
pid = ''
sys.stderr.write("pydev debugger: starting%s\n" % pid)
fix_getpass.fix_getpass()
pydev_log.debug("Executing file %s" % setup['file'])
pydev_log.debug("arguments: %s"% str(sys.argv))
pydevd_vm_type.setup_type(setup.get('vm_type', None))
if os.getenv('PYCHARM_DEBUG') or os.getenv('PYDEV_DEBUG'):
set_debug(setup)
DebugInfoHolder.DEBUG_RECORD_SOCKET_READS = setup.get('DEBUG_RECORD_SOCKET_READS', DebugInfoHolder.DEBUG_RECORD_SOCKET_READS)
DebugInfoHolder.DEBUG_TRACE_BREAKPOINTS = setup.get('DEBUG_TRACE_BREAKPOINTS', DebugInfoHolder.DEBUG_TRACE_BREAKPOINTS)
DebugInfoHolder.DEBUG_TRACE_LEVEL = setup.get('DEBUG_TRACE_LEVEL', DebugInfoHolder.DEBUG_TRACE_LEVEL)
port = setup['port']
host = setup['client']
f = setup['file']
fix_app_engine_debug = False
debugger = PyDB()
try:
from _pydev_bundle import pydev_monkey
except:
pass #Not usable on jython 2.1
else:
if setup['multiprocess']: # PyDev
pydev_monkey.patch_new_process_functions()
elif setup['multiproc']: # PyCharm
pydev_log.debug("Started in multiproc mode\n")
# Note: we're not inside method, so, no need for 'global'
DISPATCH_APPROACH = DISPATCH_APPROACH_EXISTING_CONNECTION
dispatcher = Dispatcher()
try:
dispatcher.connect(host, port)
if dispatcher.port is not None:
port = dispatcher.port
pydev_log.debug("Received port %d\n" %port)
pydev_log.info("pydev debugger: process %d is connecting\n"% os.getpid())
try:
pydev_monkey.patch_new_process_functions()
except:
pydev_log.error("Error patching process functions\n")
traceback.print_exc()
else:
pydev_log.error("pydev debugger: couldn't get port for new debug process\n")
finally:
dispatcher.close()
else:
pydev_log.info("pydev debugger: starting\n")
try:
pydev_monkey.patch_new_process_functions_with_warning()
except:
pydev_log.error("Error patching process functions\n")
traceback.print_exc()
# Only do this patching if we're not running with multiprocess turned on.
if f.find('dev_appserver.py') != -1:
if os.path.basename(f).startswith('dev_appserver.py'):
appserver_dir = os.path.dirname(f)
version_file = os.path.join(appserver_dir, 'VERSION')
if os.path.exists(version_file):
try:
stream = open(version_file, 'r')
try:
for line in stream.read().splitlines():
line = line.strip()
if line.startswith('release:'):
line = line[8:].strip()
version = line.replace('"', '')
version = version.split('.')
if int(version[0]) > 1:
fix_app_engine_debug = True
elif int(version[0]) == 1:
if int(version[1]) >= 7:
# Only fix from 1.7 onwards
fix_app_engine_debug = True
break
finally:
stream.close()
except:
traceback.print_exc()
try:
# In the default run (i.e.: run directly on debug mode), we try to patch stackless as soon as possible
# on a run where we have a remote debug, we may have to be more careful because patching stackless means
# that if the user already had a stackless.set_schedule_callback installed, he'd loose it and would need
# to call it again (because stackless provides no way of getting the last function which was registered
# in set_schedule_callback).
#
# So, ideally, if there's an application using stackless and the application wants to use the remote debugger
# and benefit from stackless debugging, the application itself must call:
#
# import pydevd_stackless
# pydevd_stackless.patch_stackless()
#
# itself to be able to benefit from seeing the tasklets created before the remote debugger is attached.
from _pydevd_bundle import pydevd_stackless
pydevd_stackless.patch_stackless()
except:
pass # It's ok not having stackless there...
is_module = setup['module']
if fix_app_engine_debug:
sys.stderr.write("pydev debugger: google app engine integration enabled\n")
curr_dir = os.path.dirname(__file__)
app_engine_startup_file = os.path.join(curr_dir, 'pydev_app_engine_debug_startup.py')
sys.argv.insert(1, '--python_startup_script=' + app_engine_startup_file)
import json
setup['pydevd'] = __file__
sys.argv.insert(2, '--python_startup_args=%s' % json.dumps(setup),)
sys.argv.insert(3, '--automatic_restart=no')
sys.argv.insert(4, '--max_module_instances=1')
# Run the dev_appserver
debugger.run(setup['file'], None, None, is_module, set_trace=False)
else:
if setup['save-signatures']:
if pydevd_vm_type.get_vm_type() == pydevd_vm_type.PydevdVmType.JYTHON:
sys.stderr.write("Collecting run-time type information is not supported for Jython\n")
else:
# Only import it if we're going to use it!
from _pydevd_bundle.pydevd_signature import SignatureFactory
debugger.signature_factory = SignatureFactory()
if setup['qt-support']:
enable_qt_support()
if setup['save-threading']:
debugger.thread_analyser = ThreadingLogger()
if setup['save-asyncio']:
if IS_PY34_OLDER:
debugger.asyncio_analyser = AsyncioLogger()
try:
debugger.connect(host, port)
except:
sys.stderr.write("Could not connect to %s: %s\n" % (host, port))
traceback.print_exc()
sys.exit(1)
connected = True # Mark that we're connected when started from inside ide.
globals = debugger.run(setup['file'], None, None, is_module)
if setup['cmd-line']:
debugger.wait_for_commands(globals)
|
epl-1.0
|
moutai/scikit-learn
|
examples/gaussian_process/plot_gpr_prior_posterior.py
|
104
|
2878
|
"""
==========================================================================
Illustration of prior and posterior Gaussian process for different kernels
==========================================================================
This example illustrates the prior and posterior of a GPR with different
kernels. Mean, standard deviation, and 10 samples are shown for both prior
and posterior.
"""
print(__doc__)
# Authors: Jan Hendrik Metzen <[email protected]>
#
# License: BSD 3 clause
import numpy as np
from matplotlib import pyplot as plt
from sklearn.gaussian_process import GaussianProcessRegressor
from sklearn.gaussian_process.kernels import (RBF, Matern, RationalQuadratic,
ExpSineSquared, DotProduct,
ConstantKernel)
kernels = [1.0 * RBF(length_scale=1.0, length_scale_bounds=(1e-1, 10.0)),
1.0 * RationalQuadratic(length_scale=1.0, alpha=0.1),
1.0 * ExpSineSquared(length_scale=1.0, periodicity=3.0,
length_scale_bounds=(0.1, 10.0),
periodicity_bounds=(1.0, 10.0)),
ConstantKernel(0.1, (0.01, 10.0))
* (DotProduct(sigma_0=1.0, sigma_0_bounds=(0.0, 10.0)) ** 2),
1.0 * Matern(length_scale=1.0, length_scale_bounds=(1e-1, 10.0),
nu=1.5)]
for fig_index, kernel in enumerate(kernels):
# Specify Gaussian Process
gp = GaussianProcessRegressor(kernel=kernel)
# Plot prior
plt.figure(fig_index, figsize=(8, 8))
plt.subplot(2, 1, 1)
X_ = np.linspace(0, 5, 100)
y_mean, y_std = gp.predict(X_[:, np.newaxis], return_std=True)
plt.plot(X_, y_mean, 'k', lw=3, zorder=9)
plt.fill_between(X_, y_mean - y_std, y_mean + y_std,
alpha=0.5, color='k')
y_samples = gp.sample_y(X_[:, np.newaxis], 10)
plt.plot(X_, y_samples, lw=1)
plt.xlim(0, 5)
plt.ylim(-3, 3)
plt.title("Prior (kernel: %s)" % kernel, fontsize=12)
# Generate data and fit GP
rng = np.random.RandomState(4)
X = rng.uniform(0, 5, 10)[:, np.newaxis]
y = np.sin((X[:, 0] - 2.5) ** 2)
gp.fit(X, y)
# Plot posterior
plt.subplot(2, 1, 2)
X_ = np.linspace(0, 5, 100)
y_mean, y_std = gp.predict(X_[:, np.newaxis], return_std=True)
plt.plot(X_, y_mean, 'k', lw=3, zorder=9)
plt.fill_between(X_, y_mean - y_std, y_mean + y_std,
alpha=0.5, color='k')
y_samples = gp.sample_y(X_[:, np.newaxis], 10)
plt.plot(X_, y_samples, lw=1)
plt.scatter(X[:, 0], y, c='r', s=50, zorder=10)
plt.xlim(0, 5)
plt.ylim(-3, 3)
plt.title("Posterior (kernel: %s)\n Log-Likelihood: %.3f"
% (gp.kernel_, gp.log_marginal_likelihood(gp.kernel_.theta)),
fontsize=12)
plt.tight_layout()
plt.show()
|
bsd-3-clause
|
jkthompson/nupic
|
external/linux32/lib/python2.6/site-packages/matplotlib/_mathtext_data.py
|
69
|
57988
|
"""
font data tables for truetype and afm computer modern fonts
"""
# this dict maps symbol names to fontnames, glyphindex. To get the
# glyph index from the character code, you have to use get_charmap
"""
from matplotlib.ft2font import FT2Font
font = FT2Font('/usr/local/share/matplotlib/cmr10.ttf')
items = font.get_charmap().items()
items.sort()
for charcode, glyphind in items:
print charcode, glyphind
"""
latex_to_bakoma = {
r'\oint' : ('cmex10', 45),
r'\bigodot' : ('cmex10', 50),
r'\bigoplus' : ('cmex10', 55),
r'\bigotimes' : ('cmex10', 59),
r'\sum' : ('cmex10', 51),
r'\prod' : ('cmex10', 24),
r'\int' : ('cmex10', 56),
r'\bigcup' : ('cmex10', 28),
r'\bigcap' : ('cmex10', 60),
r'\biguplus' : ('cmex10', 32),
r'\bigwedge' : ('cmex10', 4),
r'\bigvee' : ('cmex10', 37),
r'\coprod' : ('cmex10', 42),
r'\__sqrt__' : ('cmex10', 48),
r'\leftbrace' : ('cmex10', 92),
r'{' : ('cmex10', 92),
r'\{' : ('cmex10', 92),
r'\rightbrace' : ('cmex10', 130),
r'}' : ('cmex10', 130),
r'\}' : ('cmex10', 130),
r'\leftangle' : ('cmex10', 97),
r'\rightangle' : ('cmex10', 64),
r'\langle' : ('cmex10', 97),
r'\rangle' : ('cmex10', 64),
r'\widehat' : ('cmex10', 15),
r'\widetilde' : ('cmex10', 52),
r'\omega' : ('cmmi10', 29),
r'\varepsilon' : ('cmmi10', 20),
r'\vartheta' : ('cmmi10', 22),
r'\varrho' : ('cmmi10', 61),
r'\varsigma' : ('cmmi10', 41),
r'\varphi' : ('cmmi10', 6),
r'\leftharpoonup' : ('cmmi10', 108),
r'\leftharpoondown' : ('cmmi10', 68),
r'\rightharpoonup' : ('cmmi10', 117),
r'\rightharpoondown' : ('cmmi10', 77),
r'\triangleright' : ('cmmi10', 130),
r'\triangleleft' : ('cmmi10', 89),
r'.' : ('cmmi10', 51),
r',' : ('cmmi10', 44),
r'<' : ('cmmi10', 99),
r'/' : ('cmmi10', 98),
r'>' : ('cmmi10', 107),
r'\flat' : ('cmmi10', 131),
r'\natural' : ('cmmi10', 90),
r'\sharp' : ('cmmi10', 50),
r'\smile' : ('cmmi10', 97),
r'\frown' : ('cmmi10', 58),
r'\ell' : ('cmmi10', 102),
r'\imath' : ('cmmi10', 8),
r'\jmath' : ('cmmi10', 65),
r'\wp' : ('cmmi10', 14),
r'\alpha' : ('cmmi10', 13),
r'\beta' : ('cmmi10', 35),
r'\gamma' : ('cmmi10', 24),
r'\delta' : ('cmmi10', 38),
r'\epsilon' : ('cmmi10', 54),
r'\zeta' : ('cmmi10', 10),
r'\eta' : ('cmmi10', 5),
r'\theta' : ('cmmi10', 18),
r'\iota' : ('cmmi10', 28),
r'\lambda' : ('cmmi10', 9),
r'\mu' : ('cmmi10', 32),
r'\nu' : ('cmmi10', 34),
r'\xi' : ('cmmi10', 7),
r'\pi' : ('cmmi10', 36),
r'\kappa' : ('cmmi10', 30),
r'\rho' : ('cmmi10', 39),
r'\sigma' : ('cmmi10', 21),
r'\tau' : ('cmmi10', 43),
r'\upsilon' : ('cmmi10', 25),
r'\phi' : ('cmmi10', 42),
r'\chi' : ('cmmi10', 17),
r'\psi' : ('cmmi10', 31),
r'|' : ('cmsy10', 47),
r'\|' : ('cmsy10', 47),
r'(' : ('cmr10', 119),
r'\leftparen' : ('cmr10', 119),
r'\rightparen' : ('cmr10', 68),
r')' : ('cmr10', 68),
r'+' : ('cmr10', 76),
r'0' : ('cmr10', 40),
r'1' : ('cmr10', 100),
r'2' : ('cmr10', 49),
r'3' : ('cmr10', 110),
r'4' : ('cmr10', 59),
r'5' : ('cmr10', 120),
r'6' : ('cmr10', 69),
r'7' : ('cmr10', 127),
r'8' : ('cmr10', 77),
r'9' : ('cmr10', 22),
r':' : ('cmr10', 85),
r';' : ('cmr10', 31),
r'=' : ('cmr10', 41),
r'\leftbracket' : ('cmr10', 62),
r'[' : ('cmr10', 62),
r'\rightbracket' : ('cmr10', 72),
r']' : ('cmr10', 72),
r'\%' : ('cmr10', 48),
r'%' : ('cmr10', 48),
r'\$' : ('cmr10', 99),
r'@' : ('cmr10', 111),
r'\_' : ('cmtt10', 79),
r'\Gamma' : ('cmr10', 19),
r'\Delta' : ('cmr10', 6),
r'\Theta' : ('cmr10', 7),
r'\Lambda' : ('cmr10', 14),
r'\Xi' : ('cmr10', 3),
r'\Pi' : ('cmr10', 17),
r'\Sigma' : ('cmr10', 10),
r'\Upsilon' : ('cmr10', 11),
r'\Phi' : ('cmr10', 9),
r'\Psi' : ('cmr10', 15),
r'\Omega' : ('cmr10', 12),
# these are mathml names, I think. I'm just using them for the
# tex methods noted
r'\circumflexaccent' : ('cmr10', 124), # for \hat
r'\combiningbreve' : ('cmr10', 81), # for \breve
r'\combiningoverline' : ('cmr10', 131), # for \bar
r'\combininggraveaccent' : ('cmr10', 114), # for \grave
r'\combiningacuteaccent' : ('cmr10', 63), # for \accute
r'\combiningdiaeresis' : ('cmr10', 91), # for \ddot
r'\combiningtilde' : ('cmr10', 75), # for \tilde
r'\combiningrightarrowabove' : ('cmmi10', 110), # for \vec
r'\combiningdotabove' : ('cmr10', 26), # for \dot
r'\leftarrow' : ('cmsy10', 10),
r'\uparrow' : ('cmsy10', 25),
r'\downarrow' : ('cmsy10', 28),
r'\leftrightarrow' : ('cmsy10', 24),
r'\nearrow' : ('cmsy10', 99),
r'\searrow' : ('cmsy10', 57),
r'\simeq' : ('cmsy10', 108),
r'\Leftarrow' : ('cmsy10', 104),
r'\Rightarrow' : ('cmsy10', 112),
r'\Uparrow' : ('cmsy10', 60),
r'\Downarrow' : ('cmsy10', 68),
r'\Leftrightarrow' : ('cmsy10', 51),
r'\nwarrow' : ('cmsy10', 65),
r'\swarrow' : ('cmsy10', 116),
r'\propto' : ('cmsy10', 15),
r'\prime' : ('cmsy10', 73),
r"'" : ('cmsy10', 73),
r'\infty' : ('cmsy10', 32),
r'\in' : ('cmsy10', 59),
r'\ni' : ('cmsy10', 122),
r'\bigtriangleup' : ('cmsy10', 80),
r'\bigtriangledown' : ('cmsy10', 132),
r'\slash' : ('cmsy10', 87),
r'\forall' : ('cmsy10', 21),
r'\exists' : ('cmsy10', 5),
r'\neg' : ('cmsy10', 20),
r'\emptyset' : ('cmsy10', 33),
r'\Re' : ('cmsy10', 95),
r'\Im' : ('cmsy10', 52),
r'\top' : ('cmsy10', 100),
r'\bot' : ('cmsy10', 11),
r'\aleph' : ('cmsy10', 26),
r'\cup' : ('cmsy10', 6),
r'\cap' : ('cmsy10', 19),
r'\uplus' : ('cmsy10', 58),
r'\wedge' : ('cmsy10', 43),
r'\vee' : ('cmsy10', 96),
r'\vdash' : ('cmsy10', 109),
r'\dashv' : ('cmsy10', 66),
r'\lfloor' : ('cmsy10', 117),
r'\rfloor' : ('cmsy10', 74),
r'\lceil' : ('cmsy10', 123),
r'\rceil' : ('cmsy10', 81),
r'\lbrace' : ('cmsy10', 92),
r'\rbrace' : ('cmsy10', 105),
r'\mid' : ('cmsy10', 47),
r'\vert' : ('cmsy10', 47),
r'\Vert' : ('cmsy10', 44),
r'\updownarrow' : ('cmsy10', 94),
r'\Updownarrow' : ('cmsy10', 53),
r'\backslash' : ('cmsy10', 126),
r'\wr' : ('cmsy10', 101),
r'\nabla' : ('cmsy10', 110),
r'\sqcup' : ('cmsy10', 67),
r'\sqcap' : ('cmsy10', 118),
r'\sqsubseteq' : ('cmsy10', 75),
r'\sqsupseteq' : ('cmsy10', 124),
r'\S' : ('cmsy10', 129),
r'\dag' : ('cmsy10', 71),
r'\ddag' : ('cmsy10', 127),
r'\P' : ('cmsy10', 130),
r'\clubsuit' : ('cmsy10', 18),
r'\diamondsuit' : ('cmsy10', 34),
r'\heartsuit' : ('cmsy10', 22),
r'-' : ('cmsy10', 17),
r'\cdot' : ('cmsy10', 78),
r'\times' : ('cmsy10', 13),
r'*' : ('cmsy10', 9),
r'\ast' : ('cmsy10', 9),
r'\div' : ('cmsy10', 31),
r'\diamond' : ('cmsy10', 48),
r'\pm' : ('cmsy10', 8),
r'\mp' : ('cmsy10', 98),
r'\oplus' : ('cmsy10', 16),
r'\ominus' : ('cmsy10', 56),
r'\otimes' : ('cmsy10', 30),
r'\oslash' : ('cmsy10', 107),
r'\odot' : ('cmsy10', 64),
r'\bigcirc' : ('cmsy10', 115),
r'\circ' : ('cmsy10', 72),
r'\bullet' : ('cmsy10', 84),
r'\asymp' : ('cmsy10', 121),
r'\equiv' : ('cmsy10', 35),
r'\subseteq' : ('cmsy10', 103),
r'\supseteq' : ('cmsy10', 42),
r'\leq' : ('cmsy10', 14),
r'\geq' : ('cmsy10', 29),
r'\preceq' : ('cmsy10', 79),
r'\succeq' : ('cmsy10', 131),
r'\sim' : ('cmsy10', 27),
r'\approx' : ('cmsy10', 23),
r'\subset' : ('cmsy10', 50),
r'\supset' : ('cmsy10', 86),
r'\ll' : ('cmsy10', 85),
r'\gg' : ('cmsy10', 40),
r'\prec' : ('cmsy10', 93),
r'\succ' : ('cmsy10', 49),
r'\rightarrow' : ('cmsy10', 12),
r'\to' : ('cmsy10', 12),
r'\spadesuit' : ('cmsy10', 7),
}
latex_to_cmex = {
r'\__sqrt__' : 112,
r'\bigcap' : 92,
r'\bigcup' : 91,
r'\bigodot' : 75,
r'\bigoplus' : 77,
r'\bigotimes' : 79,
r'\biguplus' : 93,
r'\bigvee' : 95,
r'\bigwedge' : 94,
r'\coprod' : 97,
r'\int' : 90,
r'\leftangle' : 173,
r'\leftbrace' : 169,
r'\oint' : 73,
r'\prod' : 89,
r'\rightangle' : 174,
r'\rightbrace' : 170,
r'\sum' : 88,
r'\widehat' : 98,
r'\widetilde' : 101,
}
latex_to_standard = {
r'\cong' : ('psyr', 64),
r'\Delta' : ('psyr', 68),
r'\Phi' : ('psyr', 70),
r'\Gamma' : ('psyr', 89),
r'\alpha' : ('psyr', 97),
r'\beta' : ('psyr', 98),
r'\chi' : ('psyr', 99),
r'\delta' : ('psyr', 100),
r'\varepsilon' : ('psyr', 101),
r'\phi' : ('psyr', 102),
r'\gamma' : ('psyr', 103),
r'\eta' : ('psyr', 104),
r'\iota' : ('psyr', 105),
r'\varpsi' : ('psyr', 106),
r'\kappa' : ('psyr', 108),
r'\nu' : ('psyr', 110),
r'\pi' : ('psyr', 112),
r'\theta' : ('psyr', 113),
r'\rho' : ('psyr', 114),
r'\sigma' : ('psyr', 115),
r'\tau' : ('psyr', 116),
r'\upsilon' : ('psyr', 117),
r'\varpi' : ('psyr', 118),
r'\omega' : ('psyr', 119),
r'\xi' : ('psyr', 120),
r'\psi' : ('psyr', 121),
r'\zeta' : ('psyr', 122),
r'\sim' : ('psyr', 126),
r'\leq' : ('psyr', 163),
r'\infty' : ('psyr', 165),
r'\clubsuit' : ('psyr', 167),
r'\diamondsuit' : ('psyr', 168),
r'\heartsuit' : ('psyr', 169),
r'\spadesuit' : ('psyr', 170),
r'\leftrightarrow' : ('psyr', 171),
r'\leftarrow' : ('psyr', 172),
r'\uparrow' : ('psyr', 173),
r'\rightarrow' : ('psyr', 174),
r'\downarrow' : ('psyr', 175),
r'\pm' : ('psyr', 176),
r'\geq' : ('psyr', 179),
r'\times' : ('psyr', 180),
r'\propto' : ('psyr', 181),
r'\partial' : ('psyr', 182),
r'\bullet' : ('psyr', 183),
r'\div' : ('psyr', 184),
r'\neq' : ('psyr', 185),
r'\equiv' : ('psyr', 186),
r'\approx' : ('psyr', 187),
r'\ldots' : ('psyr', 188),
r'\aleph' : ('psyr', 192),
r'\Im' : ('psyr', 193),
r'\Re' : ('psyr', 194),
r'\wp' : ('psyr', 195),
r'\otimes' : ('psyr', 196),
r'\oplus' : ('psyr', 197),
r'\oslash' : ('psyr', 198),
r'\cap' : ('psyr', 199),
r'\cup' : ('psyr', 200),
r'\supset' : ('psyr', 201),
r'\supseteq' : ('psyr', 202),
r'\subset' : ('psyr', 204),
r'\subseteq' : ('psyr', 205),
r'\in' : ('psyr', 206),
r'\notin' : ('psyr', 207),
r'\angle' : ('psyr', 208),
r'\nabla' : ('psyr', 209),
r'\textregistered' : ('psyr', 210),
r'\copyright' : ('psyr', 211),
r'\texttrademark' : ('psyr', 212),
r'\Pi' : ('psyr', 213),
r'\prod' : ('psyr', 213),
r'\surd' : ('psyr', 214),
r'\__sqrt__' : ('psyr', 214),
r'\cdot' : ('psyr', 215),
r'\urcorner' : ('psyr', 216),
r'\vee' : ('psyr', 217),
r'\wedge' : ('psyr', 218),
r'\Leftrightarrow' : ('psyr', 219),
r'\Leftarrow' : ('psyr', 220),
r'\Uparrow' : ('psyr', 221),
r'\Rightarrow' : ('psyr', 222),
r'\Downarrow' : ('psyr', 223),
r'\Diamond' : ('psyr', 224),
r'\langle' : ('psyr', 225),
r'\Sigma' : ('psyr', 229),
r'\sum' : ('psyr', 229),
r'\forall' : ('psyr', 34),
r'\exists' : ('psyr', 36),
r'\lceil' : ('psyr', 233),
r'\lbrace' : ('psyr', 123),
r'\Psi' : ('psyr', 89),
r'\bot' : ('psyr', 0136),
r'\Omega' : ('psyr', 0127),
r'\leftbracket' : ('psyr', 0133),
r'\rightbracket' : ('psyr', 0135),
r'\leftbrace' : ('psyr', 123),
r'\leftparen' : ('psyr', 050),
r'\prime' : ('psyr', 0242),
r'\sharp' : ('psyr', 043),
r'\slash' : ('psyr', 057),
r'\Lamda' : ('psyr', 0114),
r'\neg' : ('psyr', 0330),
r'\Upsilon' : ('psyr', 0241),
r'\rightbrace' : ('psyr', 0175),
r'\rfloor' : ('psyr', 0373),
r'\lambda' : ('psyr', 0154),
r'\to' : ('psyr', 0256),
r'\Xi' : ('psyr', 0130),
r'\emptyset' : ('psyr', 0306),
r'\lfloor' : ('psyr', 0353),
r'\rightparen' : ('psyr', 051),
r'\rceil' : ('psyr', 0371),
r'\ni' : ('psyr', 047),
r'\epsilon' : ('psyr', 0145),
r'\Theta' : ('psyr', 0121),
r'\langle' : ('psyr', 0341),
r'\leftangle' : ('psyr', 0341),
r'\rangle' : ('psyr', 0361),
r'\rightangle' : ('psyr', 0361),
r'\rbrace' : ('psyr', 0175),
r'\circ' : ('psyr', 0260),
r'\diamond' : ('psyr', 0340),
r'\mu' : ('psyr', 0155),
r'\mid' : ('psyr', 0352),
r'\imath' : ('pncri8a', 105),
r'\%' : ('pncr8a', 37),
r'\$' : ('pncr8a', 36),
r'\{' : ('pncr8a', 123),
r'\}' : ('pncr8a', 125),
r'\backslash' : ('pncr8a', 92),
r'\ast' : ('pncr8a', 42),
r'\circumflexaccent' : ('pncri8a', 124), # for \hat
r'\combiningbreve' : ('pncri8a', 81), # for \breve
r'\combininggraveaccent' : ('pncri8a', 114), # for \grave
r'\combiningacuteaccent' : ('pncri8a', 63), # for \accute
r'\combiningdiaeresis' : ('pncri8a', 91), # for \ddot
r'\combiningtilde' : ('pncri8a', 75), # for \tilde
r'\combiningrightarrowabove' : ('pncri8a', 110), # for \vec
r'\combiningdotabove' : ('pncri8a', 26), # for \dot
}
# Automatically generated.
type12uni = {'uni24C8': 9416,
'aring': 229,
'uni22A0': 8864,
'uni2292': 8850,
'quotedblright': 8221,
'uni03D2': 978,
'uni2215': 8725,
'uni03D0': 976,
'V': 86,
'dollar': 36,
'uni301E': 12318,
'uni03D5': 981,
'four': 52,
'uni25A0': 9632,
'uni013C': 316,
'uni013B': 315,
'uni013E': 318,
'Yacute': 221,
'uni25DE': 9694,
'uni013F': 319,
'uni255A': 9562,
'uni2606': 9734,
'uni0180': 384,
'uni22B7': 8887,
'uni044F': 1103,
'uni22B5': 8885,
'uni22B4': 8884,
'uni22AE': 8878,
'uni22B2': 8882,
'uni22B1': 8881,
'uni22B0': 8880,
'uni25CD': 9677,
'uni03CE': 974,
'uni03CD': 973,
'uni03CC': 972,
'uni03CB': 971,
'uni03CA': 970,
'uni22B8': 8888,
'uni22C9': 8905,
'uni0449': 1097,
'uni20DD': 8413,
'uni20DC': 8412,
'uni20DB': 8411,
'uni2231': 8753,
'uni25CF': 9679,
'uni306E': 12398,
'uni03D1': 977,
'uni01A1': 417,
'uni20D7': 8407,
'uni03D6': 982,
'uni2233': 8755,
'uni20D2': 8402,
'uni20D1': 8401,
'uni20D0': 8400,
'P': 80,
'uni22BE': 8894,
'uni22BD': 8893,
'uni22BC': 8892,
'uni22BB': 8891,
'underscore': 95,
'uni03C8': 968,
'uni03C7': 967,
'uni0328': 808,
'uni03C5': 965,
'uni03C4': 964,
'uni03C3': 963,
'uni03C2': 962,
'uni03C1': 961,
'uni03C0': 960,
'uni2010': 8208,
'uni0130': 304,
'uni0133': 307,
'uni0132': 306,
'uni0135': 309,
'uni0134': 308,
'uni0137': 311,
'uni0136': 310,
'uni0139': 313,
'uni0138': 312,
'uni2244': 8772,
'uni229A': 8858,
'uni2571': 9585,
'uni0278': 632,
'uni2239': 8761,
'p': 112,
'uni3019': 12313,
'uni25CB': 9675,
'uni03DB': 987,
'uni03DC': 988,
'uni03DA': 986,
'uni03DF': 991,
'uni03DD': 989,
'uni013D': 317,
'uni220A': 8714,
'uni220C': 8716,
'uni220B': 8715,
'uni220E': 8718,
'uni220D': 8717,
'uni220F': 8719,
'uni22CC': 8908,
'Otilde': 213,
'uni25E5': 9701,
'uni2736': 10038,
'perthousand': 8240,
'zero': 48,
'uni279B': 10139,
'dotlessi': 305,
'uni2279': 8825,
'Scaron': 352,
'zcaron': 382,
'uni21D8': 8664,
'egrave': 232,
'uni0271': 625,
'uni01AA': 426,
'uni2332': 9010,
'section': 167,
'uni25E4': 9700,
'Icircumflex': 206,
'ntilde': 241,
'uni041E': 1054,
'ampersand': 38,
'uni041C': 1052,
'uni041A': 1050,
'uni22AB': 8875,
'uni21DB': 8667,
'dotaccent': 729,
'uni0416': 1046,
'uni0417': 1047,
'uni0414': 1044,
'uni0415': 1045,
'uni0412': 1042,
'uni0413': 1043,
'degree': 176,
'uni0411': 1041,
'K': 75,
'uni25EB': 9707,
'uni25EF': 9711,
'uni0418': 1048,
'uni0419': 1049,
'uni2263': 8803,
'uni226E': 8814,
'uni2251': 8785,
'uni02C8': 712,
'uni2262': 8802,
'acircumflex': 226,
'uni22B3': 8883,
'uni2261': 8801,
'uni2394': 9108,
'Aring': 197,
'uni2260': 8800,
'uni2254': 8788,
'uni0436': 1078,
'uni2267': 8807,
'k': 107,
'uni22C8': 8904,
'uni226A': 8810,
'uni231F': 8991,
'smalltilde': 732,
'uni2201': 8705,
'uni2200': 8704,
'uni2203': 8707,
'uni02BD': 701,
'uni2205': 8709,
'uni2204': 8708,
'Agrave': 192,
'uni2206': 8710,
'uni2209': 8713,
'uni2208': 8712,
'uni226D': 8813,
'uni2264': 8804,
'uni263D': 9789,
'uni2258': 8792,
'uni02D3': 723,
'uni02D2': 722,
'uni02D1': 721,
'uni02D0': 720,
'uni25E1': 9697,
'divide': 247,
'uni02D5': 725,
'uni02D4': 724,
'ocircumflex': 244,
'uni2524': 9508,
'uni043A': 1082,
'uni24CC': 9420,
'asciitilde': 126,
'uni22B9': 8889,
'uni24D2': 9426,
'uni211E': 8478,
'uni211D': 8477,
'uni24DD': 9437,
'uni211A': 8474,
'uni211C': 8476,
'uni211B': 8475,
'uni25C6': 9670,
'uni017F': 383,
'uni017A': 378,
'uni017C': 380,
'uni017B': 379,
'uni0346': 838,
'uni22F1': 8945,
'uni22F0': 8944,
'two': 50,
'uni2298': 8856,
'uni24D1': 9425,
'E': 69,
'uni025D': 605,
'scaron': 353,
'uni2322': 8994,
'uni25E3': 9699,
'uni22BF': 8895,
'F': 70,
'uni0440': 1088,
'uni255E': 9566,
'uni22BA': 8890,
'uni0175': 373,
'uni0174': 372,
'uni0177': 375,
'uni0176': 374,
'bracketleft': 91,
'uni0170': 368,
'uni0173': 371,
'uni0172': 370,
'asciicircum': 94,
'uni0179': 377,
'uni2590': 9616,
'uni25E2': 9698,
'uni2119': 8473,
'uni2118': 8472,
'uni25CC': 9676,
'f': 102,
'ordmasculine': 186,
'uni229B': 8859,
'uni22A1': 8865,
'uni2111': 8465,
'uni2110': 8464,
'uni2113': 8467,
'uni2112': 8466,
'mu': 181,
'uni2281': 8833,
'paragraph': 182,
'nine': 57,
'uni25EC': 9708,
'v': 118,
'uni040C': 1036,
'uni0113': 275,
'uni22D0': 8912,
'uni21CC': 8652,
'uni21CB': 8651,
'uni21CA': 8650,
'uni22A5': 8869,
'uni21CF': 8655,
'uni21CE': 8654,
'uni21CD': 8653,
'guilsinglleft': 8249,
'backslash': 92,
'uni2284': 8836,
'uni224E': 8782,
'uni224D': 8781,
'uni224F': 8783,
'uni224A': 8778,
'uni2287': 8839,
'uni224C': 8780,
'uni224B': 8779,
'uni21BD': 8637,
'uni2286': 8838,
'uni030F': 783,
'uni030D': 781,
'uni030E': 782,
'uni030B': 779,
'uni030C': 780,
'uni030A': 778,
'uni026E': 622,
'uni026D': 621,
'six': 54,
'uni026A': 618,
'uni026C': 620,
'uni25C1': 9665,
'uni20D6': 8406,
'uni045B': 1115,
'uni045C': 1116,
'uni256B': 9579,
'uni045A': 1114,
'uni045F': 1119,
'uni045E': 1118,
'A': 65,
'uni2569': 9577,
'uni0458': 1112,
'uni0459': 1113,
'uni0452': 1106,
'uni0453': 1107,
'uni2562': 9570,
'uni0451': 1105,
'uni0456': 1110,
'uni0457': 1111,
'uni0454': 1108,
'uni0455': 1109,
'icircumflex': 238,
'uni0307': 775,
'uni0304': 772,
'uni0305': 773,
'uni0269': 617,
'uni0268': 616,
'uni0300': 768,
'uni0301': 769,
'uni0265': 613,
'uni0264': 612,
'uni0267': 615,
'uni0266': 614,
'uni0261': 609,
'uni0260': 608,
'uni0263': 611,
'uni0262': 610,
'a': 97,
'uni2207': 8711,
'uni2247': 8775,
'uni2246': 8774,
'uni2241': 8769,
'uni2240': 8768,
'uni2243': 8771,
'uni2242': 8770,
'uni2312': 8978,
'ogonek': 731,
'uni2249': 8777,
'uni2248': 8776,
'uni3030': 12336,
'q': 113,
'uni21C2': 8642,
'uni21C1': 8641,
'uni21C0': 8640,
'uni21C7': 8647,
'uni21C6': 8646,
'uni21C5': 8645,
'uni21C4': 8644,
'uni225F': 8799,
'uni212C': 8492,
'uni21C8': 8648,
'uni2467': 9319,
'oacute': 243,
'uni028F': 655,
'uni028E': 654,
'uni026F': 623,
'uni028C': 652,
'uni028B': 651,
'uni028A': 650,
'uni2510': 9488,
'ograve': 242,
'edieresis': 235,
'uni22CE': 8910,
'uni22CF': 8911,
'uni219F': 8607,
'comma': 44,
'uni22CA': 8906,
'uni0429': 1065,
'uni03C6': 966,
'uni0427': 1063,
'uni0426': 1062,
'uni0425': 1061,
'uni0424': 1060,
'uni0423': 1059,
'uni0422': 1058,
'uni0421': 1057,
'uni0420': 1056,
'uni2465': 9317,
'uni24D0': 9424,
'uni2464': 9316,
'uni0430': 1072,
'otilde': 245,
'uni2661': 9825,
'uni24D6': 9430,
'uni2466': 9318,
'uni24D5': 9429,
'uni219A': 8602,
'uni2518': 9496,
'uni22B6': 8886,
'uni2461': 9313,
'uni24D4': 9428,
'uni2460': 9312,
'uni24EA': 9450,
'guillemotright': 187,
'ecircumflex': 234,
'greater': 62,
'uni2011': 8209,
'uacute': 250,
'uni2462': 9314,
'L': 76,
'bullet': 8226,
'uni02A4': 676,
'uni02A7': 679,
'cedilla': 184,
'uni02A2': 674,
'uni2015': 8213,
'uni22C4': 8900,
'uni22C5': 8901,
'uni22AD': 8877,
'uni22C7': 8903,
'uni22C0': 8896,
'uni2016': 8214,
'uni22C2': 8898,
'uni22C3': 8899,
'uni24CF': 9423,
'uni042F': 1071,
'uni042E': 1070,
'uni042D': 1069,
'ydieresis': 255,
'l': 108,
'logicalnot': 172,
'uni24CA': 9418,
'uni0287': 647,
'uni0286': 646,
'uni0285': 645,
'uni0284': 644,
'uni0283': 643,
'uni0282': 642,
'uni0281': 641,
'uni027C': 636,
'uni2664': 9828,
'exclamdown': 161,
'uni25C4': 9668,
'uni0289': 649,
'uni0288': 648,
'uni039A': 922,
'endash': 8211,
'uni2640': 9792,
'uni20E4': 8420,
'uni0473': 1139,
'uni20E1': 8417,
'uni2642': 9794,
'uni03B8': 952,
'uni03B9': 953,
'agrave': 224,
'uni03B4': 948,
'uni03B5': 949,
'uni03B6': 950,
'uni03B7': 951,
'uni03B0': 944,
'uni03B1': 945,
'uni03B2': 946,
'uni03B3': 947,
'uni2555': 9557,
'Adieresis': 196,
'germandbls': 223,
'Odieresis': 214,
'space': 32,
'uni0126': 294,
'uni0127': 295,
'uni0124': 292,
'uni0125': 293,
'uni0122': 290,
'uni0123': 291,
'uni0120': 288,
'uni0121': 289,
'quoteright': 8217,
'uni2560': 9568,
'uni2556': 9558,
'ucircumflex': 251,
'uni2561': 9569,
'uni2551': 9553,
'uni25B2': 9650,
'uni2550': 9552,
'uni2563': 9571,
'uni2553': 9555,
'G': 71,
'uni2564': 9572,
'uni2552': 9554,
'quoteleft': 8216,
'uni2565': 9573,
'uni2572': 9586,
'uni2568': 9576,
'uni2566': 9574,
'W': 87,
'uni214A': 8522,
'uni012F': 303,
'uni012D': 301,
'uni012E': 302,
'uni012B': 299,
'uni012C': 300,
'uni255C': 9564,
'uni012A': 298,
'uni2289': 8841,
'Q': 81,
'uni2320': 8992,
'uni2321': 8993,
'g': 103,
'uni03BD': 957,
'uni03BE': 958,
'uni03BF': 959,
'uni2282': 8834,
'uni2285': 8837,
'uni03BA': 954,
'uni03BB': 955,
'uni03BC': 956,
'uni2128': 8488,
'uni25B7': 9655,
'w': 119,
'uni0302': 770,
'uni03DE': 990,
'uni25DA': 9690,
'uni0303': 771,
'uni0463': 1123,
'uni0462': 1122,
'uni3018': 12312,
'uni2514': 9492,
'question': 63,
'uni25B3': 9651,
'uni24E1': 9441,
'one': 49,
'uni200A': 8202,
'uni2278': 8824,
'ring': 730,
'uni0195': 405,
'figuredash': 8210,
'uni22EC': 8940,
'uni0339': 825,
'uni0338': 824,
'uni0337': 823,
'uni0336': 822,
'uni0335': 821,
'uni0333': 819,
'uni0332': 818,
'uni0331': 817,
'uni0330': 816,
'uni01C1': 449,
'uni01C0': 448,
'uni01C3': 451,
'uni01C2': 450,
'uni2353': 9043,
'uni0308': 776,
'uni2218': 8728,
'uni2219': 8729,
'uni2216': 8726,
'uni2217': 8727,
'uni2214': 8724,
'uni0309': 777,
'uni2609': 9737,
'uni2213': 8723,
'uni2210': 8720,
'uni2211': 8721,
'uni2245': 8773,
'B': 66,
'uni25D6': 9686,
'iacute': 237,
'uni02E6': 742,
'uni02E7': 743,
'uni02E8': 744,
'uni02E9': 745,
'uni221D': 8733,
'uni221E': 8734,
'Ydieresis': 376,
'uni221C': 8732,
'uni22D7': 8919,
'uni221A': 8730,
'R': 82,
'uni24DC': 9436,
'uni033F': 831,
'uni033E': 830,
'uni033C': 828,
'uni033B': 827,
'uni033A': 826,
'b': 98,
'uni228A': 8842,
'uni22DB': 8923,
'uni2554': 9556,
'uni046B': 1131,
'uni046A': 1130,
'r': 114,
'uni24DB': 9435,
'Ccedilla': 199,
'minus': 8722,
'uni24DA': 9434,
'uni03F0': 1008,
'uni03F1': 1009,
'uni20AC': 8364,
'uni2276': 8822,
'uni24C0': 9408,
'uni0162': 354,
'uni0163': 355,
'uni011E': 286,
'uni011D': 285,
'uni011C': 284,
'uni011B': 283,
'uni0164': 356,
'uni0165': 357,
'Lslash': 321,
'uni0168': 360,
'uni0169': 361,
'uni25C9': 9673,
'uni02E5': 741,
'uni21C3': 8643,
'uni24C4': 9412,
'uni24E2': 9442,
'uni2277': 8823,
'uni013A': 314,
'uni2102': 8450,
'Uacute': 218,
'uni2317': 8983,
'uni2107': 8455,
'uni221F': 8735,
'yacute': 253,
'uni3012': 12306,
'Ucircumflex': 219,
'uni015D': 349,
'quotedbl': 34,
'uni25D9': 9689,
'uni2280': 8832,
'uni22AF': 8879,
'onehalf': 189,
'uni221B': 8731,
'Thorn': 222,
'uni2226': 8742,
'M': 77,
'uni25BA': 9658,
'uni2463': 9315,
'uni2336': 9014,
'eight': 56,
'uni2236': 8758,
'multiply': 215,
'uni210C': 8460,
'uni210A': 8458,
'uni21C9': 8649,
'grave': 96,
'uni210E': 8462,
'uni0117': 279,
'uni016C': 364,
'uni0115': 277,
'uni016A': 362,
'uni016F': 367,
'uni0112': 274,
'uni016D': 365,
'uni016E': 366,
'Ocircumflex': 212,
'uni2305': 8965,
'm': 109,
'uni24DF': 9439,
'uni0119': 281,
'uni0118': 280,
'uni20A3': 8355,
'uni20A4': 8356,
'uni20A7': 8359,
'uni2288': 8840,
'uni24C3': 9411,
'uni251C': 9500,
'uni228D': 8845,
'uni222F': 8751,
'uni222E': 8750,
'uni222D': 8749,
'uni222C': 8748,
'uni222B': 8747,
'uni222A': 8746,
'uni255B': 9563,
'Ugrave': 217,
'uni24DE': 9438,
'guilsinglright': 8250,
'uni250A': 9482,
'Ntilde': 209,
'uni0279': 633,
'questiondown': 191,
'uni256C': 9580,
'Atilde': 195,
'uni0272': 626,
'uni0273': 627,
'uni0270': 624,
'ccedilla': 231,
'uni0276': 630,
'uni0277': 631,
'uni0274': 628,
'uni0275': 629,
'uni2252': 8786,
'uni041F': 1055,
'uni2250': 8784,
'Z': 90,
'uni2256': 8790,
'uni2257': 8791,
'copyright': 169,
'uni2255': 8789,
'uni043D': 1085,
'uni043E': 1086,
'uni043F': 1087,
'yen': 165,
'uni041D': 1053,
'uni043B': 1083,
'uni043C': 1084,
'uni21B0': 8624,
'uni21B1': 8625,
'uni21B2': 8626,
'uni21B3': 8627,
'uni21B4': 8628,
'uni21B5': 8629,
'uni21B6': 8630,
'uni21B7': 8631,
'uni21B8': 8632,
'Eacute': 201,
'uni2311': 8977,
'uni2310': 8976,
'uni228F': 8847,
'uni25DB': 9691,
'uni21BA': 8634,
'uni21BB': 8635,
'uni21BC': 8636,
'uni2017': 8215,
'uni21BE': 8638,
'uni21BF': 8639,
'uni231C': 8988,
'H': 72,
'uni0293': 659,
'uni2202': 8706,
'uni22A4': 8868,
'uni231E': 8990,
'uni2232': 8754,
'uni225B': 8795,
'uni225C': 8796,
'uni24D9': 9433,
'uni225A': 8794,
'uni0438': 1080,
'uni0439': 1081,
'uni225D': 8797,
'uni225E': 8798,
'uni0434': 1076,
'X': 88,
'uni007F': 127,
'uni0437': 1079,
'Idieresis': 207,
'uni0431': 1073,
'uni0432': 1074,
'uni0433': 1075,
'uni22AC': 8876,
'uni22CD': 8909,
'uni25A3': 9635,
'bar': 124,
'uni24BB': 9403,
'uni037E': 894,
'uni027B': 635,
'h': 104,
'uni027A': 634,
'uni027F': 639,
'uni027D': 637,
'uni027E': 638,
'uni2227': 8743,
'uni2004': 8196,
'uni2225': 8741,
'uni2224': 8740,
'uni2223': 8739,
'uni2222': 8738,
'uni2221': 8737,
'uni2220': 8736,
'x': 120,
'uni2323': 8995,
'uni2559': 9561,
'uni2558': 9560,
'uni2229': 8745,
'uni2228': 8744,
'udieresis': 252,
'uni029D': 669,
'ordfeminine': 170,
'uni22CB': 8907,
'uni233D': 9021,
'uni0428': 1064,
'uni24C6': 9414,
'uni22DD': 8925,
'uni24C7': 9415,
'uni015C': 348,
'uni015B': 347,
'uni015A': 346,
'uni22AA': 8874,
'uni015F': 351,
'uni015E': 350,
'braceleft': 123,
'uni24C5': 9413,
'uni0410': 1040,
'uni03AA': 938,
'uni24C2': 9410,
'uni03AC': 940,
'uni03AB': 939,
'macron': 175,
'uni03AD': 941,
'uni03AF': 943,
'uni0294': 660,
'uni0295': 661,
'uni0296': 662,
'uni0297': 663,
'uni0290': 656,
'uni0291': 657,
'uni0292': 658,
'atilde': 227,
'Acircumflex': 194,
'uni2370': 9072,
'uni24C1': 9409,
'uni0298': 664,
'uni0299': 665,
'Oslash': 216,
'uni029E': 670,
'C': 67,
'quotedblleft': 8220,
'uni029B': 667,
'uni029C': 668,
'uni03A9': 937,
'uni03A8': 936,
'S': 83,
'uni24C9': 9417,
'uni03A1': 929,
'uni03A0': 928,
'exclam': 33,
'uni03A5': 933,
'uni03A4': 932,
'uni03A7': 935,
'Zcaron': 381,
'uni2133': 8499,
'uni2132': 8498,
'uni0159': 345,
'uni0158': 344,
'uni2137': 8503,
'uni2005': 8197,
'uni2135': 8501,
'uni2134': 8500,
'uni02BA': 698,
'uni2033': 8243,
'uni0151': 337,
'uni0150': 336,
'uni0157': 343,
'equal': 61,
'uni0155': 341,
'uni0154': 340,
's': 115,
'uni233F': 9023,
'eth': 240,
'uni24BE': 9406,
'uni21E9': 8681,
'uni2060': 8288,
'Egrave': 200,
'uni255D': 9565,
'uni24CD': 9421,
'uni21E1': 8673,
'uni21B9': 8633,
'hyphen': 45,
'uni01BE': 446,
'uni01BB': 443,
'period': 46,
'igrave': 236,
'uni01BA': 442,
'uni2296': 8854,
'uni2297': 8855,
'uni2294': 8852,
'uni2295': 8853,
'colon': 58,
'uni2293': 8851,
'uni2290': 8848,
'uni2291': 8849,
'uni032D': 813,
'uni032E': 814,
'uni032F': 815,
'uni032A': 810,
'uni032B': 811,
'uni032C': 812,
'uni231D': 8989,
'Ecircumflex': 202,
'uni24D7': 9431,
'uni25DD': 9693,
'trademark': 8482,
'Aacute': 193,
'cent': 162,
'uni0445': 1093,
'uni266E': 9838,
'uni266D': 9837,
'uni266B': 9835,
'uni03C9': 969,
'uni2003': 8195,
'uni2047': 8263,
'lslash': 322,
'uni03A6': 934,
'uni2043': 8259,
'uni250C': 9484,
'uni2040': 8256,
'uni255F': 9567,
'uni24CB': 9419,
'uni0472': 1138,
'uni0446': 1094,
'uni0474': 1140,
'uni0475': 1141,
'uni2508': 9480,
'uni2660': 9824,
'uni2506': 9478,
'uni2502': 9474,
'c': 99,
'uni2500': 9472,
'N': 78,
'uni22A6': 8870,
'uni21E7': 8679,
'uni2130': 8496,
'uni2002': 8194,
'breve': 728,
'uni0442': 1090,
'Oacute': 211,
'uni229F': 8863,
'uni25C7': 9671,
'uni229D': 8861,
'uni229E': 8862,
'guillemotleft': 171,
'uni0329': 809,
'uni24E5': 9445,
'uni011F': 287,
'uni0324': 804,
'uni0325': 805,
'uni0326': 806,
'uni0327': 807,
'uni0321': 801,
'uni0322': 802,
'n': 110,
'uni2032': 8242,
'uni2269': 8809,
'uni2268': 8808,
'uni0306': 774,
'uni226B': 8811,
'uni21EA': 8682,
'uni0166': 358,
'uni203B': 8251,
'uni01B5': 437,
'idieresis': 239,
'uni02BC': 700,
'uni01B0': 432,
'braceright': 125,
'seven': 55,
'uni02BB': 699,
'uni011A': 282,
'uni29FB': 10747,
'brokenbar': 166,
'uni2036': 8246,
'uni25C0': 9664,
'uni0156': 342,
'uni22D5': 8917,
'uni0258': 600,
'ugrave': 249,
'uni22D6': 8918,
'uni22D1': 8913,
'uni2034': 8244,
'uni22D3': 8915,
'uni22D2': 8914,
'uni203C': 8252,
'uni223E': 8766,
'uni02BF': 703,
'uni22D9': 8921,
'uni22D8': 8920,
'uni25BD': 9661,
'uni25BE': 9662,
'uni25BF': 9663,
'uni041B': 1051,
'periodcentered': 183,
'uni25BC': 9660,
'uni019E': 414,
'uni019B': 411,
'uni019A': 410,
'uni2007': 8199,
'uni0391': 913,
'uni0390': 912,
'uni0393': 915,
'uni0392': 914,
'uni0395': 917,
'uni0394': 916,
'uni0397': 919,
'uni0396': 918,
'uni0399': 921,
'uni0398': 920,
'uni25C8': 9672,
'uni2468': 9320,
'sterling': 163,
'uni22EB': 8939,
'uni039C': 924,
'uni039B': 923,
'uni039E': 926,
'uni039D': 925,
'uni039F': 927,
'I': 73,
'uni03E1': 993,
'uni03E0': 992,
'uni2319': 8985,
'uni228B': 8843,
'uni25B5': 9653,
'uni25B6': 9654,
'uni22EA': 8938,
'uni24B9': 9401,
'uni044E': 1102,
'uni0199': 409,
'uni2266': 8806,
'Y': 89,
'uni22A2': 8866,
'Eth': 208,
'uni266F': 9839,
'emdash': 8212,
'uni263B': 9787,
'uni24BD': 9405,
'uni22DE': 8926,
'uni0360': 864,
'uni2557': 9559,
'uni22DF': 8927,
'uni22DA': 8922,
'uni22DC': 8924,
'uni0361': 865,
'i': 105,
'uni24BF': 9407,
'uni0362': 866,
'uni263E': 9790,
'uni028D': 653,
'uni2259': 8793,
'uni0323': 803,
'uni2265': 8805,
'daggerdbl': 8225,
'y': 121,
'uni010A': 266,
'plusminus': 177,
'less': 60,
'uni21AE': 8622,
'uni0315': 789,
'uni230B': 8971,
'uni21AF': 8623,
'uni21AA': 8618,
'uni21AC': 8620,
'uni21AB': 8619,
'uni01FB': 507,
'uni01FC': 508,
'uni223A': 8762,
'uni01FA': 506,
'uni01FF': 511,
'uni01FD': 509,
'uni01FE': 510,
'uni2567': 9575,
'uni25E0': 9696,
'uni0104': 260,
'uni0105': 261,
'uni0106': 262,
'uni0107': 263,
'uni0100': 256,
'uni0101': 257,
'uni0102': 258,
'uni0103': 259,
'uni2038': 8248,
'uni2009': 8201,
'uni2008': 8200,
'uni0108': 264,
'uni0109': 265,
'uni02A1': 673,
'uni223B': 8763,
'uni226C': 8812,
'uni25AC': 9644,
'uni24D3': 9427,
'uni21E0': 8672,
'uni21E3': 8675,
'Udieresis': 220,
'uni21E2': 8674,
'D': 68,
'uni21E5': 8677,
'uni2621': 9761,
'uni21D1': 8657,
'uni203E': 8254,
'uni22C6': 8902,
'uni21E4': 8676,
'uni010D': 269,
'uni010E': 270,
'uni010F': 271,
'five': 53,
'T': 84,
'uni010B': 267,
'uni010C': 268,
'uni2605': 9733,
'uni2663': 9827,
'uni21E6': 8678,
'uni24B6': 9398,
'uni22C1': 8897,
'oslash': 248,
'acute': 180,
'uni01F0': 496,
'd': 100,
'OE': 338,
'uni22E3': 8931,
'Igrave': 204,
'uni2308': 8968,
'uni2309': 8969,
'uni21A9': 8617,
't': 116,
'uni2313': 8979,
'uni03A3': 931,
'uni21A4': 8612,
'uni21A7': 8615,
'uni21A6': 8614,
'uni21A1': 8609,
'uni21A0': 8608,
'uni21A3': 8611,
'uni21A2': 8610,
'parenright': 41,
'uni256A': 9578,
'uni25DC': 9692,
'uni24CE': 9422,
'uni042C': 1068,
'uni24E0': 9440,
'uni042B': 1067,
'uni0409': 1033,
'uni0408': 1032,
'uni24E7': 9447,
'uni25B4': 9652,
'uni042A': 1066,
'uni228E': 8846,
'uni0401': 1025,
'adieresis': 228,
'uni0403': 1027,
'quotesingle': 39,
'uni0405': 1029,
'uni0404': 1028,
'uni0407': 1031,
'uni0406': 1030,
'uni229C': 8860,
'uni2306': 8966,
'uni2253': 8787,
'twodotenleader': 8229,
'uni2131': 8497,
'uni21DA': 8666,
'uni2234': 8756,
'uni2235': 8757,
'uni01A5': 421,
'uni2237': 8759,
'uni2230': 8752,
'uni02CC': 716,
'slash': 47,
'uni01A0': 416,
'ellipsis': 8230,
'uni2299': 8857,
'uni2238': 8760,
'numbersign': 35,
'uni21A8': 8616,
'uni223D': 8765,
'uni01AF': 431,
'uni223F': 8767,
'uni01AD': 429,
'uni01AB': 427,
'odieresis': 246,
'uni223C': 8764,
'uni227D': 8829,
'uni0280': 640,
'O': 79,
'uni227E': 8830,
'uni21A5': 8613,
'uni22D4': 8916,
'uni25D4': 9684,
'uni227F': 8831,
'uni0435': 1077,
'uni2302': 8962,
'uni2669': 9833,
'uni24E3': 9443,
'uni2720': 10016,
'uni22A8': 8872,
'uni22A9': 8873,
'uni040A': 1034,
'uni22A7': 8871,
'oe': 339,
'uni040B': 1035,
'uni040E': 1038,
'uni22A3': 8867,
'o': 111,
'uni040F': 1039,
'Edieresis': 203,
'uni25D5': 9685,
'plus': 43,
'uni044D': 1101,
'uni263C': 9788,
'uni22E6': 8934,
'uni2283': 8835,
'uni258C': 9612,
'uni219E': 8606,
'uni24E4': 9444,
'uni2136': 8502,
'dagger': 8224,
'uni24B7': 9399,
'uni219B': 8603,
'uni22E5': 8933,
'three': 51,
'uni210B': 8459,
'uni2534': 9524,
'uni24B8': 9400,
'uni230A': 8970,
'hungarumlaut': 733,
'parenleft': 40,
'uni0148': 328,
'uni0149': 329,
'uni2124': 8484,
'uni2125': 8485,
'uni2126': 8486,
'uni2127': 8487,
'uni0140': 320,
'uni2129': 8489,
'uni25C5': 9669,
'uni0143': 323,
'uni0144': 324,
'uni0145': 325,
'uni0146': 326,
'uni0147': 327,
'uni210D': 8461,
'fraction': 8260,
'uni2031': 8241,
'uni2196': 8598,
'uni2035': 8245,
'uni24E6': 9446,
'uni016B': 363,
'uni24BA': 9402,
'uni266A': 9834,
'uni0116': 278,
'uni2115': 8469,
'registered': 174,
'J': 74,
'uni25DF': 9695,
'uni25CE': 9678,
'uni273D': 10045,
'dieresis': 168,
'uni212B': 8491,
'uni0114': 276,
'uni212D': 8493,
'uni212E': 8494,
'uni212F': 8495,
'uni014A': 330,
'uni014B': 331,
'uni014C': 332,
'uni014D': 333,
'uni014E': 334,
'uni014F': 335,
'uni025E': 606,
'uni24E8': 9448,
'uni0111': 273,
'uni24E9': 9449,
'Ograve': 210,
'j': 106,
'uni2195': 8597,
'uni2194': 8596,
'uni2197': 8599,
'uni2037': 8247,
'uni2191': 8593,
'uni2190': 8592,
'uni2193': 8595,
'uni2192': 8594,
'uni29FA': 10746,
'uni2713': 10003,
'z': 122,
'uni2199': 8601,
'uni2198': 8600,
'uni2667': 9831,
'ae': 230,
'uni0448': 1096,
'semicolon': 59,
'uni2666': 9830,
'uni038F': 911,
'uni0444': 1092,
'uni0447': 1095,
'uni038E': 910,
'uni0441': 1089,
'uni038C': 908,
'uni0443': 1091,
'uni038A': 906,
'uni0250': 592,
'uni0251': 593,
'uni0252': 594,
'uni0253': 595,
'uni0254': 596,
'at': 64,
'uni0256': 598,
'uni0257': 599,
'uni0167': 359,
'uni0259': 601,
'uni228C': 8844,
'uni2662': 9826,
'uni0319': 793,
'uni0318': 792,
'uni24BC': 9404,
'uni0402': 1026,
'uni22EF': 8943,
'Iacute': 205,
'uni22ED': 8941,
'uni22EE': 8942,
'uni0311': 785,
'uni0310': 784,
'uni21E8': 8680,
'uni0312': 786,
'percent': 37,
'uni0317': 791,
'uni0316': 790,
'uni21D6': 8662,
'uni21D7': 8663,
'uni21D4': 8660,
'uni21D5': 8661,
'uni21D2': 8658,
'uni21D3': 8659,
'uni21D0': 8656,
'uni2138': 8504,
'uni2270': 8816,
'uni2271': 8817,
'uni2272': 8818,
'uni2273': 8819,
'uni2274': 8820,
'uni2275': 8821,
'bracketright': 93,
'uni21D9': 8665,
'uni21DF': 8671,
'uni21DD': 8669,
'uni21DE': 8670,
'AE': 198,
'uni03AE': 942,
'uni227A': 8826,
'uni227B': 8827,
'uni227C': 8828,
'asterisk': 42,
'aacute': 225,
'uni226F': 8815,
'uni22E2': 8930,
'uni0386': 902,
'uni22E0': 8928,
'uni22E1': 8929,
'U': 85,
'uni22E7': 8935,
'uni22E4': 8932,
'uni0387': 903,
'uni031A': 794,
'eacute': 233,
'uni22E8': 8936,
'uni22E9': 8937,
'uni24D8': 9432,
'uni025A': 602,
'uni025B': 603,
'uni025C': 604,
'e': 101,
'uni0128': 296,
'uni025F': 607,
'uni2665': 9829,
'thorn': 254,
'uni0129': 297,
'uni253C': 9532,
'uni25D7': 9687,
'u': 117,
'uni0388': 904,
'uni0389': 905,
'uni0255': 597,
'uni0171': 369,
'uni0384': 900,
'uni0385': 901,
'uni044A': 1098,
'uni252C': 9516,
'uni044C': 1100,
'uni044B': 1099}
uni2type1 = dict([(v,k) for k,v in type12uni.items()])
tex2uni = {
'widehat': 0x0302,
'widetilde': 0x0303,
'langle': 0x27e8,
'rangle': 0x27e9,
'perp': 0x27c2,
'neq': 0x2260,
'Join': 0x2a1d,
'leqslant': 0x2a7d,
'geqslant': 0x2a7e,
'lessapprox': 0x2a85,
'gtrapprox': 0x2a86,
'lesseqqgtr': 0x2a8b,
'gtreqqless': 0x2a8c,
'triangleeq': 0x225c,
'eqslantless': 0x2a95,
'eqslantgtr': 0x2a96,
'backepsilon': 0x03f6,
'precapprox': 0x2ab7,
'succapprox': 0x2ab8,
'fallingdotseq': 0x2252,
'subseteqq': 0x2ac5,
'supseteqq': 0x2ac6,
'varpropto': 0x221d,
'precnapprox': 0x2ab9,
'succnapprox': 0x2aba,
'subsetneqq': 0x2acb,
'supsetneqq': 0x2acc,
'lnapprox': 0x2ab9,
'gnapprox': 0x2aba,
'longleftarrow': 0x27f5,
'longrightarrow': 0x27f6,
'longleftrightarrow': 0x27f7,
'Longleftarrow': 0x27f8,
'Longrightarrow': 0x27f9,
'Longleftrightarrow': 0x27fa,
'longmapsto': 0x27fc,
'leadsto': 0x21dd,
'dashleftarrow': 0x290e,
'dashrightarrow': 0x290f,
'circlearrowleft': 0x21ba,
'circlearrowright': 0x21bb,
'leftrightsquigarrow': 0x21ad,
'leftsquigarrow': 0x219c,
'rightsquigarrow': 0x219d,
'Game': 0x2141,
'hbar': 0x0127,
'hslash': 0x210f,
'ldots': 0x22ef,
'vdots': 0x22ee,
'doteqdot': 0x2251,
'doteq': 8784,
'partial': 8706,
'gg': 8811,
'asymp': 8781,
'blacktriangledown': 9662,
'otimes': 8855,
'nearrow': 8599,
'varpi': 982,
'vee': 8744,
'vec': 8407,
'smile': 8995,
'succnsim': 8937,
'gimel': 8503,
'vert': 124,
'|': 124,
'varrho': 1009,
'P': 182,
'approxident': 8779,
'Swarrow': 8665,
'textasciicircum': 94,
'imageof': 8887,
'ntriangleleft': 8938,
'nleq': 8816,
'div': 247,
'nparallel': 8742,
'Leftarrow': 8656,
'lll': 8920,
'oiint': 8751,
'ngeq': 8817,
'Theta': 920,
'origof': 8886,
'blacksquare': 9632,
'solbar': 9023,
'neg': 172,
'sum': 8721,
'Vdash': 8873,
'coloneq': 8788,
'degree': 176,
'bowtie': 8904,
'blacktriangleright': 9654,
'varsigma': 962,
'leq': 8804,
'ggg': 8921,
'lneqq': 8808,
'scurel': 8881,
'stareq': 8795,
'BbbN': 8469,
'nLeftarrow': 8653,
'nLeftrightarrow': 8654,
'k': 808,
'bot': 8869,
'BbbC': 8450,
'Lsh': 8624,
'leftleftarrows': 8647,
'BbbZ': 8484,
'digamma': 989,
'BbbR': 8477,
'BbbP': 8473,
'BbbQ': 8474,
'vartriangleright': 8883,
'succsim': 8831,
'wedge': 8743,
'lessgtr': 8822,
'veebar': 8891,
'mapsdown': 8615,
'Rsh': 8625,
'chi': 967,
'prec': 8826,
'nsubseteq': 8840,
'therefore': 8756,
'eqcirc': 8790,
'textexclamdown': 161,
'nRightarrow': 8655,
'flat': 9837,
'notin': 8713,
'llcorner': 8990,
'varepsilon': 949,
'bigtriangleup': 9651,
'aleph': 8501,
'dotminus': 8760,
'upsilon': 965,
'Lambda': 923,
'cap': 8745,
'barleftarrow': 8676,
'mu': 956,
'boxplus': 8862,
'mp': 8723,
'circledast': 8859,
'tau': 964,
'in': 8712,
'backslash': 92,
'varnothing': 8709,
'sharp': 9839,
'eqsim': 8770,
'gnsim': 8935,
'Searrow': 8664,
'updownarrows': 8645,
'heartsuit': 9825,
'trianglelefteq': 8884,
'ddag': 8225,
'sqsubseteq': 8849,
'mapsfrom': 8612,
'boxbar': 9707,
'sim': 8764,
'Nwarrow': 8662,
'nequiv': 8802,
'succ': 8827,
'vdash': 8866,
'Leftrightarrow': 8660,
'parallel': 8741,
'invnot': 8976,
'natural': 9838,
'ss': 223,
'uparrow': 8593,
'nsim': 8769,
'hookrightarrow': 8618,
'Equiv': 8803,
'approx': 8776,
'Vvdash': 8874,
'nsucc': 8833,
'leftrightharpoons': 8651,
'Re': 8476,
'boxminus': 8863,
'equiv': 8801,
'Lleftarrow': 8666,
'thinspace': 8201,
'll': 8810,
'Cup': 8915,
'measeq': 8798,
'upharpoonleft': 8639,
'lq': 8216,
'Upsilon': 933,
'subsetneq': 8842,
'greater': 62,
'supsetneq': 8843,
'Cap': 8914,
'L': 321,
'spadesuit': 9824,
'lrcorner': 8991,
'not': 824,
'bar': 772,
'rightharpoonaccent': 8401,
'boxdot': 8865,
'l': 322,
'leftharpoondown': 8637,
'bigcup': 8899,
'iint': 8748,
'bigwedge': 8896,
'downharpoonleft': 8643,
'textasciitilde': 126,
'subset': 8834,
'leqq': 8806,
'mapsup': 8613,
'nvDash': 8877,
'looparrowleft': 8619,
'nless': 8814,
'rightarrowbar': 8677,
'Vert': 8214,
'downdownarrows': 8650,
'uplus': 8846,
'simeq': 8771,
'napprox': 8777,
'ast': 8727,
'twoheaduparrow': 8607,
'doublebarwedge': 8966,
'Sigma': 931,
'leftharpoonaccent': 8400,
'ntrianglelefteq': 8940,
'nexists': 8708,
'times': 215,
'measuredangle': 8737,
'bumpeq': 8783,
'carriagereturn': 8629,
'adots': 8944,
'checkmark': 10003,
'lambda': 955,
'xi': 958,
'rbrace': 125,
'rbrack': 93,
'Nearrow': 8663,
'maltese': 10016,
'clubsuit': 9827,
'top': 8868,
'overarc': 785,
'varphi': 966,
'Delta': 916,
'iota': 953,
'nleftarrow': 8602,
'candra': 784,
'supset': 8835,
'triangleleft': 9665,
'gtreqless': 8923,
'ntrianglerighteq': 8941,
'quad': 8195,
'Xi': 926,
'gtrdot': 8919,
'leftthreetimes': 8907,
'minus': 8722,
'preccurlyeq': 8828,
'nleftrightarrow': 8622,
'lambdabar': 411,
'blacktriangle': 9652,
'kernelcontraction': 8763,
'Phi': 934,
'angle': 8736,
'spadesuitopen': 9828,
'eqless': 8924,
'mid': 8739,
'varkappa': 1008,
'Ldsh': 8626,
'updownarrow': 8597,
'beta': 946,
'textquotedblleft': 8220,
'rho': 961,
'alpha': 945,
'intercal': 8890,
'beth': 8502,
'grave': 768,
'acwopencirclearrow': 8634,
'nmid': 8740,
'nsupset': 8837,
'sigma': 963,
'dot': 775,
'Rightarrow': 8658,
'turnednot': 8985,
'backsimeq': 8909,
'leftarrowtail': 8610,
'approxeq': 8778,
'curlyeqsucc': 8927,
'rightarrowtail': 8611,
'Psi': 936,
'copyright': 169,
'yen': 165,
'vartriangleleft': 8882,
'rasp': 700,
'triangleright': 9655,
'precsim': 8830,
'infty': 8734,
'geq': 8805,
'updownarrowbar': 8616,
'precnsim': 8936,
'H': 779,
'ulcorner': 8988,
'looparrowright': 8620,
'ncong': 8775,
'downarrow': 8595,
'circeq': 8791,
'subseteq': 8838,
'bigstar': 9733,
'prime': 8242,
'lceil': 8968,
'Rrightarrow': 8667,
'oiiint': 8752,
'curlywedge': 8911,
'vDash': 8872,
'lfloor': 8970,
'ddots': 8945,
'exists': 8707,
'underbar': 817,
'Pi': 928,
'leftrightarrows': 8646,
'sphericalangle': 8738,
'coprod': 8720,
'circledcirc': 8858,
'gtrsim': 8819,
'gneqq': 8809,
'between': 8812,
'theta': 952,
'complement': 8705,
'arceq': 8792,
'nVdash': 8878,
'S': 167,
'wr': 8768,
'wp': 8472,
'backcong': 8780,
'lasp': 701,
'c': 807,
'nabla': 8711,
'dotplus': 8724,
'eta': 951,
'forall': 8704,
'eth': 240,
'colon': 58,
'sqcup': 8852,
'rightrightarrows': 8649,
'sqsupset': 8848,
'mapsto': 8614,
'bigtriangledown': 9661,
'sqsupseteq': 8850,
'propto': 8733,
'pi': 960,
'pm': 177,
'dots': 8230,
'nrightarrow': 8603,
'textasciiacute': 180,
'Doteq': 8785,
'breve': 774,
'sqcap': 8851,
'twoheadrightarrow': 8608,
'kappa': 954,
'vartriangle': 9653,
'diamondsuit': 9826,
'pitchfork': 8916,
'blacktriangleleft': 9664,
'nprec': 8832,
'vdots': 8942,
'curvearrowright': 8631,
'barwedge': 8892,
'multimap': 8888,
'textquestiondown': 191,
'cong': 8773,
'rtimes': 8906,
'rightzigzagarrow': 8669,
'rightarrow': 8594,
'leftarrow': 8592,
'__sqrt__': 8730,
'twoheaddownarrow': 8609,
'oint': 8750,
'bigvee': 8897,
'eqdef': 8797,
'sterling': 163,
'phi': 981,
'Updownarrow': 8661,
'backprime': 8245,
'emdash': 8212,
'Gamma': 915,
'i': 305,
'rceil': 8969,
'leftharpoonup': 8636,
'Im': 8465,
'curvearrowleft': 8630,
'wedgeq': 8793,
'fallingdotseq': 8786,
'curlyeqprec': 8926,
'questeq': 8799,
'less': 60,
'upuparrows': 8648,
'tilde': 771,
'textasciigrave': 96,
'smallsetminus': 8726,
'ell': 8467,
'cup': 8746,
'danger': 9761,
'nVDash': 8879,
'cdotp': 183,
'cdots': 8943,
'hat': 770,
'eqgtr': 8925,
'enspace': 8194,
'psi': 968,
'frown': 8994,
'acute': 769,
'downzigzagarrow': 8623,
'ntriangleright': 8939,
'cupdot': 8845,
'circleddash': 8861,
'oslash': 8856,
'mho': 8487,
'd': 803,
'sqsubset': 8847,
'cdot': 8901,
'Omega': 937,
'OE': 338,
'veeeq': 8794,
'Finv': 8498,
't': 865,
'leftrightarrow': 8596,
'swarrow': 8601,
'rightthreetimes': 8908,
'rightleftharpoons': 8652,
'lesssim': 8818,
'searrow': 8600,
'because': 8757,
'gtrless': 8823,
'star': 8902,
'nsubset': 8836,
'zeta': 950,
'dddot': 8411,
'bigcirc': 9675,
'Supset': 8913,
'circ': 8728,
'slash': 8725,
'ocirc': 778,
'prod': 8719,
'twoheadleftarrow': 8606,
'daleth': 8504,
'upharpoonright': 8638,
'odot': 8857,
'Uparrow': 8657,
'O': 216,
'hookleftarrow': 8617,
'trianglerighteq': 8885,
'nsime': 8772,
'oe': 339,
'nwarrow': 8598,
'o': 248,
'ddddot': 8412,
'downharpoonright': 8642,
'succcurlyeq': 8829,
'gamma': 947,
'scrR': 8475,
'dag': 8224,
'thickspace': 8197,
'frakZ': 8488,
'lessdot': 8918,
'triangledown': 9663,
'ltimes': 8905,
'scrB': 8492,
'endash': 8211,
'scrE': 8496,
'scrF': 8497,
'scrH': 8459,
'scrI': 8464,
'rightharpoondown': 8641,
'scrL': 8466,
'scrM': 8499,
'frakC': 8493,
'nsupseteq': 8841,
'circledR': 174,
'circledS': 9416,
'ngtr': 8815,
'bigcap': 8898,
'scre': 8495,
'Downarrow': 8659,
'scrg': 8458,
'overleftrightarrow': 8417,
'scro': 8500,
'lnsim': 8934,
'eqcolon': 8789,
'curlyvee': 8910,
'urcorner': 8989,
'lbrace': 123,
'Bumpeq': 8782,
'delta': 948,
'boxtimes': 8864,
'overleftarrow': 8406,
'prurel': 8880,
'clubsuitopen': 9831,
'cwopencirclearrow': 8635,
'geqq': 8807,
'rightleftarrows': 8644,
'ac': 8766,
'ae': 230,
'int': 8747,
'rfloor': 8971,
'risingdotseq': 8787,
'nvdash': 8876,
'diamond': 8900,
'ddot': 776,
'backsim': 8765,
'oplus': 8853,
'triangleq': 8796,
'check': 780,
'ni': 8715,
'iiint': 8749,
'ne': 8800,
'lesseqgtr': 8922,
'obar': 9021,
'supseteq': 8839,
'nu': 957,
'AA': 8491,
'AE': 198,
'models': 8871,
'ominus': 8854,
'dashv': 8867,
'omega': 969,
'rq': 8217,
'Subset': 8912,
'rightharpoonup': 8640,
'Rdsh': 8627,
'bullet': 8729,
'divideontimes': 8903,
'lbrack': 91,
'textquotedblright': 8221,
'Colon': 8759,
'%': 37,
'$': 36,
'{': 123,
'}': 125,
'_': 95,
'imath': 0x131,
'circumflexaccent' : 770,
'combiningbreve' : 774,
'combiningoverline' : 772,
'combininggraveaccent' : 768,
'combiningacuteaccent' : 769,
'combiningdiaeresis' : 776,
'combiningtilde' : 771,
'combiningrightarrowabove' : 8407,
'combiningdotabove' : 775,
'to': 8594,
'succeq': 8829,
'emptyset': 8709,
'leftparen': 40,
'rightparen': 41,
'bigoplus': 10753,
'leftangle': 10216,
'rightangle': 10217,
'leftbrace': 124,
'rightbrace': 125,
'jmath': 567,
'bigodot': 10752,
'preceq': 8828,
'biguplus': 10756,
'epsilon': 949,
'vartheta': 977,
'bigotimes': 10754
}
# Each element is a 4-tuple of the form:
# src_start, src_end, dst_font, dst_start
#
stix_virtual_fonts = {
'bb':
{
'rm':
[
(0x0030, 0x0039, 'rm', 0x1d7d8), # 0-9
(0x0041, 0x0042, 'rm', 0x1d538), # A-B
(0x0043, 0x0043, 'rm', 0x2102), # C
(0x0044, 0x0047, 'rm', 0x1d53b), # D-G
(0x0048, 0x0048, 'rm', 0x210d), # H
(0x0049, 0x004d, 'rm', 0x1d540), # I-M
(0x004e, 0x004e, 'rm', 0x2115), # N
(0x004f, 0x004f, 'rm', 0x1d546), # O
(0x0050, 0x0051, 'rm', 0x2119), # P-Q
(0x0052, 0x0052, 'rm', 0x211d), # R
(0x0053, 0x0059, 'rm', 0x1d54a), # S-Y
(0x005a, 0x005a, 'rm', 0x2124), # Z
(0x0061, 0x007a, 'rm', 0x1d552), # a-z
(0x0393, 0x0393, 'rm', 0x213e), # \Gamma
(0x03a0, 0x03a0, 'rm', 0x213f), # \Pi
(0x03a3, 0x03a3, 'rm', 0x2140), # \Sigma
(0x03b3, 0x03b3, 'rm', 0x213d), # \gamma
(0x03c0, 0x03c0, 'rm', 0x213c), # \pi
],
'it':
[
(0x0030, 0x0039, 'rm', 0x1d7d8), # 0-9
(0x0041, 0x0042, 'it', 0xe154), # A-B
(0x0043, 0x0043, 'it', 0x2102), # C (missing in beta STIX fonts)
(0x0044, 0x0044, 'it', 0x2145), # D
(0x0045, 0x0047, 'it', 0xe156), # E-G
(0x0048, 0x0048, 'it', 0x210d), # H (missing in beta STIX fonts)
(0x0049, 0x004d, 'it', 0xe159), # I-M
(0x004e, 0x004e, 'it', 0x2115), # N (missing in beta STIX fonts)
(0x004f, 0x004f, 'it', 0xe15e), # O
(0x0050, 0x0051, 'it', 0x2119), # P-Q (missing in beta STIX fonts)
(0x0052, 0x0052, 'it', 0x211d), # R (missing in beta STIX fonts)
(0x0053, 0x0059, 'it', 0xe15f), # S-Y
(0x005a, 0x005a, 'it', 0x2124), # Z (missing in beta STIX fonts)
(0x0061, 0x0063, 'it', 0xe166), # a-c
(0x0064, 0x0065, 'it', 0x2146), # d-e
(0x0066, 0x0068, 'it', 0xe169), # f-h
(0x0069, 0x006a, 'it', 0x2148), # i-j
(0x006b, 0x007a, 'it', 0xe16c), # k-z
(0x0393, 0x0393, 'it', 0x213e), # \Gamma (missing in beta STIX fonts)
(0x03a0, 0x03a0, 'it', 0x213f), # \Pi
(0x03a3, 0x03a3, 'it', 0x2140), # \Sigma (missing in beta STIX fonts)
(0x03b3, 0x03b3, 'it', 0x213d), # \gamma (missing in beta STIX fonts)
(0x03c0, 0x03c0, 'it', 0x213c), # \pi
],
'bf':
[
(0x0030, 0x0039, 'rm', 0x1d7d8), # 0-9
(0x0041, 0x005a, 'bf', 0xe38a), # A-Z
(0x0061, 0x007a, 'bf', 0xe39d), # a-z
(0x0393, 0x0393, 'bf', 0x213e), # \Gamma
(0x03a0, 0x03a0, 'bf', 0x213f), # \Pi
(0x03a3, 0x03a3, 'bf', 0x2140), # \Sigma
(0x03b3, 0x03b3, 'bf', 0x213d), # \gamma
(0x03c0, 0x03c0, 'bf', 0x213c), # \pi
],
},
'cal':
[
(0x0041, 0x005a, 'it', 0xe22d), # A-Z
],
'circled':
{
'rm':
[
(0x0030, 0x0030, 'rm', 0x24ea), # 0
(0x0031, 0x0039, 'rm', 0x2460), # 1-9
(0x0041, 0x005a, 'rm', 0x24b6), # A-Z
(0x0061, 0x007a, 'rm', 0x24d0) # a-z
],
'it':
[
(0x0030, 0x0030, 'rm', 0x24ea), # 0
(0x0031, 0x0039, 'rm', 0x2460), # 1-9
(0x0041, 0x005a, 'it', 0x24b6), # A-Z
(0x0061, 0x007a, 'it', 0x24d0) # a-z
],
'bf':
[
(0x0030, 0x0030, 'bf', 0x24ea), # 0
(0x0031, 0x0039, 'bf', 0x2460), # 1-9
(0x0041, 0x005a, 'bf', 0x24b6), # A-Z
(0x0061, 0x007a, 'bf', 0x24d0) # a-z
],
},
'frak':
{
'rm':
[
(0x0041, 0x0042, 'rm', 0x1d504), # A-B
(0x0043, 0x0043, 'rm', 0x212d), # C
(0x0044, 0x0047, 'rm', 0x1d507), # D-G
(0x0048, 0x0048, 'rm', 0x210c), # H
(0x0049, 0x0049, 'rm', 0x2111), # I
(0x004a, 0x0051, 'rm', 0x1d50d), # J-Q
(0x0052, 0x0052, 'rm', 0x211c), # R
(0x0053, 0x0059, 'rm', 0x1d516), # S-Y
(0x005a, 0x005a, 'rm', 0x2128), # Z
(0x0061, 0x007a, 'rm', 0x1d51e), # a-z
],
'it':
[
(0x0041, 0x0042, 'rm', 0x1d504), # A-B
(0x0043, 0x0043, 'rm', 0x212d), # C
(0x0044, 0x0047, 'rm', 0x1d507), # D-G
(0x0048, 0x0048, 'rm', 0x210c), # H
(0x0049, 0x0049, 'rm', 0x2111), # I
(0x004a, 0x0051, 'rm', 0x1d50d), # J-Q
(0x0052, 0x0052, 'rm', 0x211c), # R
(0x0053, 0x0059, 'rm', 0x1d516), # S-Y
(0x005a, 0x005a, 'rm', 0x2128), # Z
(0x0061, 0x007a, 'rm', 0x1d51e), # a-z
],
'bf':
[
(0x0041, 0x005a, 'bf', 0x1d56c), # A-Z
(0x0061, 0x007a, 'bf', 0x1d586), # a-z
],
},
'scr':
[
(0x0041, 0x0041, 'it', 0x1d49c), # A
(0x0042, 0x0042, 'it', 0x212c), # B
(0x0043, 0x0044, 'it', 0x1d49e), # C-D
(0x0045, 0x0046, 'it', 0x2130), # E-F
(0x0047, 0x0047, 'it', 0x1d4a2), # G
(0x0048, 0x0048, 'it', 0x210b), # H
(0x0049, 0x0049, 'it', 0x2110), # I
(0x004a, 0x004b, 'it', 0x1d4a5), # J-K
(0x004c, 0x004c, 'it', 0x2112), # L
(0x004d, 0x003d, 'it', 0x2113), # M
(0x004e, 0x0051, 'it', 0x1d4a9), # N-Q
(0x0052, 0x0052, 'it', 0x211b), # R
(0x0053, 0x005a, 'it', 0x1d4ae), # S-Z
(0x0061, 0x0064, 'it', 0x1d4b6), # a-d
(0x0065, 0x0065, 'it', 0x212f), # e
(0x0066, 0x0066, 'it', 0x1d4bb), # f
(0x0067, 0x0067, 'it', 0x210a), # g
(0x0068, 0x006e, 'it', 0x1d4bd), # h-n
(0x006f, 0x006f, 'it', 0x2134), # o
(0x0070, 0x007a, 'it', 0x1d4c5), # p-z
],
'sf':
{
'rm':
[
(0x0030, 0x0039, 'rm', 0x1d7e2), # 0-9
(0x0041, 0x005a, 'rm', 0x1d5a0), # A-Z
(0x0061, 0x007a, 'rm', 0x1d5ba), # a-z
(0x0391, 0x03a9, 'rm', 0xe17d), # \Alpha-\Omega
(0x03b1, 0x03c9, 'rm', 0xe196), # \alpha-\omega
(0x03d1, 0x03d1, 'rm', 0xe1b0), # theta variant
(0x03d5, 0x03d5, 'rm', 0xe1b1), # phi variant
(0x03d6, 0x03d6, 'rm', 0xe1b3), # pi variant
(0x03f1, 0x03f1, 'rm', 0xe1b2), # rho variant
(0x03f5, 0x03f5, 'rm', 0xe1af), # lunate epsilon
(0x2202, 0x2202, 'rm', 0xe17c), # partial differential
],
'it':
[
# These numerals are actually upright. We don't actually
# want italic numerals ever.
(0x0030, 0x0039, 'rm', 0x1d7e2), # 0-9
(0x0041, 0x005a, 'it', 0x1d608), # A-Z
(0x0061, 0x007a, 'it', 0x1d622), # a-z
(0x0391, 0x03a9, 'rm', 0xe17d), # \Alpha-\Omega
(0x03b1, 0x03c9, 'it', 0xe1d8), # \alpha-\omega
(0x03d1, 0x03d1, 'it', 0xe1f2), # theta variant
(0x03d5, 0x03d5, 'it', 0xe1f3), # phi variant
(0x03d6, 0x03d6, 'it', 0xe1f5), # pi variant
(0x03f1, 0x03f1, 'it', 0xe1f4), # rho variant
(0x03f5, 0x03f5, 'it', 0xe1f1), # lunate epsilon
],
'bf':
[
(0x0030, 0x0039, 'bf', 0x1d7ec), # 0-9
(0x0041, 0x005a, 'bf', 0x1d5d4), # A-Z
(0x0061, 0x007a, 'bf', 0x1d5ee), # a-z
(0x0391, 0x03a9, 'bf', 0x1d756), # \Alpha-\Omega
(0x03b1, 0x03c9, 'bf', 0x1d770), # \alpha-\omega
(0x03d1, 0x03d1, 'bf', 0x1d78b), # theta variant
(0x03d5, 0x03d5, 'bf', 0x1d78d), # phi variant
(0x03d6, 0x03d6, 'bf', 0x1d78f), # pi variant
(0x03f0, 0x03f0, 'bf', 0x1d78c), # kappa variant
(0x03f1, 0x03f1, 'bf', 0x1d78e), # rho variant
(0x03f5, 0x03f5, 'bf', 0x1d78a), # lunate epsilon
(0x2202, 0x2202, 'bf', 0x1d789), # partial differential
(0x2207, 0x2207, 'bf', 0x1d76f), # \Nabla
],
},
'tt':
[
(0x0030, 0x0039, 'rm', 0x1d7f6), # 0-9
(0x0041, 0x005a, 'rm', 0x1d670), # A-Z
(0x0061, 0x007a, 'rm', 0x1d68a) # a-z
],
}
|
gpl-3.0
|
nishantsbi/Data-Science-45min-Intros
|
choosing-k-in-kmeans/3d-example.py
|
25
|
2925
|
#!/usr/bin/env python
# -*- coding: UTF-8 -*-
__author__="Josh Montague"
__license__="MIT License"
"""
This script is designed to run inline (%run 3d-example.py) in
the corresponding IPython notebook. It generates a 3d scatter
plot using scikit-learn data generation and with a number of
samples and clusters determined by the variables near the top.
"""
import argparse
import matplotlib.pyplot as plt
from mpl_toolkits.mplot3d import Axes3D
from sklearn.datasets import make_blobs
import seaborn as sns
from gap_stats import gap_statistics
from gap_stats import plot_gap_statistics
def make_example_plot(args):
"""
Create artificial data (blobs) and color them according to the
appropriate blob center.
"""
# read args
samples = args.samples
clusters = args.clusters
# create some data
X, y = make_blobs(n_samples=samples,
centers=clusters,
n_features=3,
# increase variance for illustration
cluster_std=1.5,
# fix random_state if you believe in determinism
#random_state=42
)
# seaborn display settings
sns.set(style='whitegrid', palette=sns.color_palette("Set2", clusters))
fig = plt.figure()
ax = fig.add_subplot(111, projection='3d')
for i in range(clusters):
# for each center, add data to the figure w/ appropriate label
ax.plot(X[y==i,0],
X[y==i,1],
X[y==i,2],
'o',
alpha=0.6,
label='cluster {}'.format(i)
)
ax.set_title('{} labeled clusters (ground truth)'.format(clusters))
ax.legend(loc='upper left')
# seaborn settings - no, really set these things this time, please
sns.set(style='whitegrid', palette=sns.color_palette("Set2", clusters))
#plt.show()
# potentially return the data for later use
data = None
if args.gap:
data = (X, y)
return data
if __name__ == "__main__":
parser = argparse.ArgumentParser()
parser.add_argument("-s","--samples"
, dest="samples"
, type=int
, default=100
)
parser.add_argument("-c","--clusters"
, dest="clusters"
, type=int
, default=5
)
parser.add_argument("-g","--gap"
, dest="gap"
, type=bool
, default=False
)
args = parser.parse_args()
data = make_example_plot(args)
if args.gap:
# i just really prefer the dark theme
sns.set(style='darkgrid', palette='deep')
# unpack
X, y = data
# run the gap statistic algorithm
gaps, errs, difs = gap_statistics(X, ks=range(1, args.clusters+5))
# plot (intended for %matplotlib inline)
plot_gap_statistics(gaps, errs, difs)
|
unlicense
|
planetarymike/IDL-Colorbars
|
IDL_py_test/009_GRN-WHT_EXPONENTIAL.py
|
1
|
8787
|
from matplotlib.colors import LinearSegmentedColormap
from numpy import nan, inf
cm_data = [[0.00392157, 0., 0.],
[0.00392157, 0., 0.],
[0.00392157, 0.00392157, 0.],
[0.00784314, 0.00784314, 0.],
[0.00784314, 0.00784314, 0.00392157],
[0.00784314, 0.0117647, 0.00392157],
[0.0117647, 0.0156863, 0.00392157],
[0.0117647, 0.0156863, 0.00392157],
[0.0156863, 0.0196078, 0.00784314],
[0.0156863, 0.0235294, 0.00784314],
[0.0156863, 0.0235294, 0.00784314],
[0.0196078, 0.027451, 0.00784314],
[0.0196078, 0.0313725, 0.0117647],
[0.0196078, 0.0313725, 0.0117647],
[0.0235294, 0.0352941, 0.0117647],
[0.0235294, 0.0392157, 0.0117647],
[0.027451, 0.0392157, 0.0156863],
[0.027451, 0.0431373, 0.0156863],
[0.027451, 0.0470588, 0.0156863],
[0.0313725, 0.0470588, 0.0196078],
[0.0313725, 0.0509804, 0.0196078],
[0.0352941, 0.054902, 0.0196078],
[0.0352941, 0.054902, 0.0196078],
[0.0352941, 0.0588235, 0.0235294],
[0.0392157, 0.0627451, 0.0235294],
[0.0392157, 0.0627451, 0.0235294],
[0.0392157, 0.0666667, 0.0235294],
[0.0431373, 0.0705882, 0.027451],
[0.0431373, 0.0705882, 0.027451],
[0.0470588, 0.0745098, 0.027451],
[0.0470588, 0.0784314, 0.027451],
[0.0470588, 0.0784314, 0.0313725],
[0.0509804, 0.0823529, 0.0313725],
[0.0509804, 0.0862745, 0.0313725],
[0.0509804, 0.0862745, 0.0313725],
[0.054902, 0.0901961, 0.0352941],
[0.054902, 0.0941176, 0.0352941],
[0.0588235, 0.0941176, 0.0352941],
[0.0588235, 0.0980392, 0.0392157],
[0.0588235, 0.101961, 0.0392157],
[0.0627451, 0.101961, 0.0392157],
[0.0627451, 0.105882, 0.0392157],
[0.0666667, 0.109804, 0.0431373],
[0.0666667, 0.109804, 0.0431373],
[0.0666667, 0.113725, 0.0431373],
[0.0705882, 0.117647, 0.0431373],
[0.0705882, 0.117647, 0.0470588],
[0.0705882, 0.121569, 0.0470588],
[0.0745098, 0.12549, 0.0470588],
[0.0745098, 0.12549, 0.0470588],
[0.0784314, 0.129412, 0.0509804],
[0.0784314, 0.133333, 0.0509804],
[0.0784314, 0.133333, 0.0509804],
[0.0823529, 0.137255, 0.0509804],
[0.0823529, 0.141176, 0.054902],
[0.0823529, 0.141176, 0.054902],
[0.0862745, 0.145098, 0.054902],
[0.0862745, 0.14902, 0.0588235],
[0.0901961, 0.14902, 0.0588235],
[0.0901961, 0.152941, 0.0588235],
[0.0901961, 0.156863, 0.0588235],
[0.0941176, 0.156863, 0.0627451],
[0.0941176, 0.160784, 0.0627451],
[0.0980392, 0.164706, 0.0627451],
[0.0980392, 0.164706, 0.0627451],
[0.0980392, 0.168627, 0.0666667],
[0.101961, 0.172549, 0.0666667],
[0.101961, 0.172549, 0.0666667],
[0.101961, 0.176471, 0.0666667],
[0.105882, 0.180392, 0.0705882],
[0.105882, 0.180392, 0.0705882],
[0.109804, 0.184314, 0.0705882],
[0.109804, 0.188235, 0.0705882],
[0.109804, 0.188235, 0.0745098],
[0.113725, 0.192157, 0.0745098],
[0.113725, 0.196078, 0.0745098],
[0.113725, 0.196078, 0.0784314],
[0.117647, 0.2, 0.0784314],
[0.117647, 0.203922, 0.0784314],
[0.121569, 0.203922, 0.0784314],
[0.121569, 0.207843, 0.0823529],
[0.121569, 0.211765, 0.0823529],
[0.12549, 0.211765, 0.0823529],
[0.12549, 0.215686, 0.0823529],
[0.129412, 0.219608, 0.0862745],
[0.129412, 0.219608, 0.0862745],
[0.129412, 0.223529, 0.0862745],
[0.133333, 0.227451, 0.0862745],
[0.133333, 0.227451, 0.0901961],
[0.133333, 0.231373, 0.0901961],
[0.137255, 0.235294, 0.0901961],
[0.137255, 0.235294, 0.0901961],
[0.141176, 0.239216, 0.0941176],
[0.141176, 0.243137, 0.0941176],
[0.141176, 0.243137, 0.0941176],
[0.145098, 0.247059, 0.0980392],
[0.145098, 0.25098, 0.0980392],
[0.145098, 0.25098, 0.0980392],
[0.14902, 0.254902, 0.0980392],
[0.14902, 0.258824, 0.101961],
[0.152941, 0.258824, 0.101961],
[0.152941, 0.262745, 0.101961],
[0.152941, 0.266667, 0.101961],
[0.156863, 0.266667, 0.105882],
[0.156863, 0.270588, 0.105882],
[0.160784, 0.27451, 0.105882],
[0.160784, 0.27451, 0.105882],
[0.160784, 0.278431, 0.109804],
[0.164706, 0.282353, 0.109804],
[0.164706, 0.282353, 0.109804],
[0.164706, 0.286275, 0.109804],
[0.168627, 0.290196, 0.113725],
[0.168627, 0.290196, 0.113725],
[0.172549, 0.294118, 0.113725],
[0.172549, 0.298039, 0.117647],
[0.172549, 0.298039, 0.117647],
[0.176471, 0.301961, 0.117647],
[0.176471, 0.305882, 0.117647],
[0.176471, 0.305882, 0.121569],
[0.180392, 0.309804, 0.121569],
[0.180392, 0.313725, 0.121569],
[0.184314, 0.313725, 0.121569],
[0.184314, 0.317647, 0.12549],
[0.184314, 0.321569, 0.12549],
[0.188235, 0.321569, 0.12549],
[0.188235, 0.32549, 0.12549],
[0.192157, 0.329412, 0.129412],
[0.192157, 0.329412, 0.129412],
[0.192157, 0.333333, 0.129412],
[0.196078, 0.337255, 0.129412],
[0.196078, 0.341176, 0.133333],
[0.196078, 0.345098, 0.133333],
[0.2, 0.352941, 0.133333],
[0.2, 0.356863, 0.137255],
[0.203922, 0.360784, 0.137255],
[0.203922, 0.368627, 0.137255],
[0.203922, 0.372549, 0.137255],
[0.211765, 0.376471, 0.141176],
[0.211765, 0.384314, 0.141176],
[0.215686, 0.388235, 0.141176],
[0.219608, 0.392157, 0.141176],
[0.219608, 0.4, 0.145098],
[0.223529, 0.403922, 0.145098],
[0.227451, 0.407843, 0.145098],
[0.227451, 0.415686, 0.145098],
[0.231373, 0.419608, 0.14902],
[0.235294, 0.423529, 0.14902],
[0.235294, 0.431373, 0.14902],
[0.239216, 0.435294, 0.14902],
[0.243137, 0.439216, 0.152941],
[0.243137, 0.447059, 0.152941],
[0.247059, 0.45098, 0.152941],
[0.25098, 0.454902, 0.156863],
[0.25098, 0.462745, 0.156863],
[0.258824, 0.466667, 0.156863],
[0.266667, 0.470588, 0.156863],
[0.27451, 0.478431, 0.160784],
[0.278431, 0.482353, 0.160784],
[0.286275, 0.486275, 0.160784],
[0.294118, 0.494118, 0.160784],
[0.301961, 0.498039, 0.164706],
[0.309804, 0.501961, 0.164706],
[0.317647, 0.509804, 0.164706],
[0.32549, 0.513725, 0.164706],
[0.333333, 0.517647, 0.168627],
[0.337255, 0.52549, 0.168627],
[0.345098, 0.529412, 0.168627],
[0.352941, 0.533333, 0.168627],
[0.360784, 0.541176, 0.172549],
[0.368627, 0.545098, 0.172549],
[0.376471, 0.54902, 0.172549],
[0.384314, 0.556863, 0.176471],
[0.388235, 0.560784, 0.176471],
[0.396078, 0.568627, 0.176471],
[0.403922, 0.572549, 0.176471],
[0.411765, 0.576471, 0.180392],
[0.419608, 0.584314, 0.180392],
[0.427451, 0.588235, 0.180392],
[0.435294, 0.592157, 0.180392],
[0.443137, 0.6, 0.184314],
[0.447059, 0.603922, 0.184314],
[0.454902, 0.607843, 0.184314],
[0.462745, 0.615686, 0.184314],
[0.470588, 0.619608, 0.188235],
[0.478431, 0.623529, 0.184314],
[0.486275, 0.631373, 0.192157],
[0.494118, 0.635294, 0.203922],
[0.498039, 0.639216, 0.215686],
[0.505882, 0.647059, 0.227451],
[0.513725, 0.65098, 0.239216],
[0.521569, 0.654902, 0.25098],
[0.529412, 0.662745, 0.262745],
[0.537255, 0.666667, 0.27451],
[0.545098, 0.670588, 0.286275],
[0.552941, 0.678431, 0.298039],
[0.556863, 0.682353, 0.309804],
[0.564706, 0.686275, 0.321569],
[0.572549, 0.694118, 0.333333],
[0.580392, 0.698039, 0.345098],
[0.588235, 0.701961, 0.352941],
[0.596078, 0.709804, 0.364706],
[0.603922, 0.713725, 0.376471],
[0.611765, 0.717647, 0.388235],
[0.615686, 0.72549, 0.4],
[0.623529, 0.729412, 0.411765],
[0.631373, 0.733333, 0.423529],
[0.639216, 0.741176, 0.435294],
[0.647059, 0.745098, 0.447059],
[0.654902, 0.74902, 0.458824],
[0.662745, 0.756863, 0.470588],
[0.666667, 0.760784, 0.482353],
[0.67451, 0.764706, 0.494118],
[0.682353, 0.772549, 0.505882],
[0.690196, 0.776471, 0.513725],
[0.698039, 0.784314, 0.52549],
[0.705882, 0.788235, 0.537255],
[0.713725, 0.792157, 0.54902],
[0.721569, 0.8, 0.560784],
[0.72549, 0.803922, 0.572549],
[0.733333, 0.807843, 0.584314],
[0.741176, 0.815686, 0.596078],
[0.74902, 0.819608, 0.607843],
[0.756863, 0.823529, 0.619608],
[0.764706, 0.831373, 0.631373],
[0.772549, 0.835294, 0.643137],
[0.776471, 0.839216, 0.654902],
[0.784314, 0.847059, 0.666667],
[0.792157, 0.85098, 0.67451],
[0.8, 0.854902, 0.686275],
[0.807843, 0.862745, 0.698039],
[0.815686, 0.866667, 0.709804],
[0.823529, 0.870588, 0.721569],
[0.831373, 0.878431, 0.733333],
[0.835294, 0.882353, 0.745098],
[0.843137, 0.886275, 0.756863],
[0.85098, 0.894118, 0.768627],
[0.858824, 0.898039, 0.780392],
[0.866667, 0.901961, 0.792157],
[0.87451, 0.909804, 0.803922],
[0.882353, 0.913725, 0.815686],
[0.886275, 0.917647, 0.827451],
[0.894118, 0.92549, 0.835294],
[0.901961, 0.929412, 0.847059],
[0.909804, 0.933333, 0.858824],
[0.917647, 0.941176, 0.870588],
[0.92549, 0.945098, 0.882353],
[0.933333, 0.94902, 0.894118],
[0.941176, 0.956863, 0.905882],
[0.945098, 0.960784, 0.917647],
[0.952941, 0.964706, 0.929412],
[0.960784, 0.972549, 0.941176],
[0.968627, 0.976471, 0.952941],
[0.976471, 0.980392, 0.964706],
[0.984314, 0.988235, 0.976471],
[0.992157, 0.992157, 0.988235],
[1., 1., 1.]]
test_cm = LinearSegmentedColormap.from_list(__file__, cm_data)
if __name__ == "__main__":
import matplotlib.pyplot as plt
import numpy as np
try:
from pycam02ucs.cm.viscm import viscm
viscm(test_cm)
except ImportError:
print("pycam02ucs not found, falling back on simple display")
plt.imshow(np.linspace(0, 100, 256)[None, :], aspect='auto',
cmap=test_cm)
plt.show()
|
gpl-2.0
|
ryfeus/lambda-packs
|
Sklearn_scipy_numpy/source/sklearn/utils/testing.py
|
6
|
26970
|
"""Testing utilities."""
# Copyright (c) 2011, 2012
# Authors: Pietro Berkes,
# Andreas Muller
# Mathieu Blondel
# Olivier Grisel
# Arnaud Joly
# Denis Engemann
# Giorgio Patrini
# License: BSD 3 clause
import os
import inspect
import pkgutil
import warnings
import sys
import re
import platform
import struct
import scipy as sp
import scipy.io
from functools import wraps
try:
# Python 2
from urllib2 import urlopen
from urllib2 import HTTPError
except ImportError:
# Python 3+
from urllib.request import urlopen
from urllib.error import HTTPError
import tempfile
import shutil
import os.path as op
import atexit
# WindowsError only exist on Windows
try:
WindowsError
except NameError:
WindowsError = None
import sklearn
from sklearn.base import BaseEstimator
from sklearn.externals import joblib
# Conveniently import all assertions in one place.
from nose.tools import assert_equal
from nose.tools import assert_not_equal
from nose.tools import assert_true
from nose.tools import assert_false
from nose.tools import assert_raises
from nose.tools import raises
from nose import SkipTest
from nose import with_setup
from numpy.testing import assert_almost_equal
from numpy.testing import assert_array_equal
from numpy.testing import assert_array_almost_equal
from numpy.testing import assert_array_less
from numpy.testing import assert_approx_equal
import numpy as np
from sklearn.base import (ClassifierMixin, RegressorMixin, TransformerMixin,
ClusterMixin)
from sklearn.cluster import DBSCAN
__all__ = ["assert_equal", "assert_not_equal", "assert_raises",
"assert_raises_regexp", "raises", "with_setup", "assert_true",
"assert_false", "assert_almost_equal", "assert_array_equal",
"assert_array_almost_equal", "assert_array_less",
"assert_less", "assert_less_equal",
"assert_greater", "assert_greater_equal",
"assert_approx_equal"]
try:
from nose.tools import assert_in, assert_not_in
except ImportError:
# Nose < 1.0.0
def assert_in(x, container):
assert_true(x in container, msg="%r in %r" % (x, container))
def assert_not_in(x, container):
assert_false(x in container, msg="%r in %r" % (x, container))
try:
from nose.tools import assert_raises_regex
except ImportError:
# for Python 2
def assert_raises_regex(expected_exception, expected_regexp,
callable_obj=None, *args, **kwargs):
"""Helper function to check for message patterns in exceptions"""
not_raised = False
try:
callable_obj(*args, **kwargs)
not_raised = True
except expected_exception as e:
error_message = str(e)
if not re.compile(expected_regexp).search(error_message):
raise AssertionError("Error message should match pattern "
"%r. %r does not." %
(expected_regexp, error_message))
if not_raised:
raise AssertionError("%s not raised by %s" %
(expected_exception.__name__,
callable_obj.__name__))
# assert_raises_regexp is deprecated in Python 3.4 in favor of
# assert_raises_regex but lets keep the bacward compat in scikit-learn with
# the old name for now
assert_raises_regexp = assert_raises_regex
def _assert_less(a, b, msg=None):
message = "%r is not lower than %r" % (a, b)
if msg is not None:
message += ": " + msg
assert a < b, message
def _assert_greater(a, b, msg=None):
message = "%r is not greater than %r" % (a, b)
if msg is not None:
message += ": " + msg
assert a > b, message
def assert_less_equal(a, b, msg=None):
message = "%r is not lower than or equal to %r" % (a, b)
if msg is not None:
message += ": " + msg
assert a <= b, message
def assert_greater_equal(a, b, msg=None):
message = "%r is not greater than or equal to %r" % (a, b)
if msg is not None:
message += ": " + msg
assert a >= b, message
def assert_warns(warning_class, func, *args, **kw):
"""Test that a certain warning occurs.
Parameters
----------
warning_class : the warning class
The class to test for, e.g. UserWarning.
func : callable
Calable object to trigger warnings.
*args : the positional arguments to `func`.
**kw : the keyword arguments to `func`
Returns
-------
result : the return value of `func`
"""
# very important to avoid uncontrolled state propagation
clean_warning_registry()
with warnings.catch_warnings(record=True) as w:
# Cause all warnings to always be triggered.
warnings.simplefilter("always")
# Trigger a warning.
result = func(*args, **kw)
if hasattr(np, 'VisibleDeprecationWarning'):
# Filter out numpy-specific warnings in numpy >= 1.9
w = [e for e in w
if e.category is not np.VisibleDeprecationWarning]
# Verify some things
if not len(w) > 0:
raise AssertionError("No warning raised when calling %s"
% func.__name__)
found = any(warning.category is warning_class for warning in w)
if not found:
raise AssertionError("%s did not give warning: %s( is %s)"
% (func.__name__, warning_class, w))
return result
def assert_warns_message(warning_class, message, func, *args, **kw):
# very important to avoid uncontrolled state propagation
"""Test that a certain warning occurs and with a certain message.
Parameters
----------
warning_class : the warning class
The class to test for, e.g. UserWarning.
message : str | callable
The entire message or a substring to test for. If callable,
it takes a string as argument and will trigger an assertion error
if it returns `False`.
func : callable
Calable object to trigger warnings.
*args : the positional arguments to `func`.
**kw : the keyword arguments to `func`.
Returns
-------
result : the return value of `func`
"""
clean_warning_registry()
with warnings.catch_warnings(record=True) as w:
# Cause all warnings to always be triggered.
warnings.simplefilter("always")
if hasattr(np, 'VisibleDeprecationWarning'):
# Let's not catch the numpy internal DeprecationWarnings
warnings.simplefilter('ignore', np.VisibleDeprecationWarning)
# Trigger a warning.
result = func(*args, **kw)
# Verify some things
if not len(w) > 0:
raise AssertionError("No warning raised when calling %s"
% func.__name__)
found = [issubclass(warning.category, warning_class) for warning in w]
if not any(found):
raise AssertionError("No warning raised for %s with class "
"%s"
% (func.__name__, warning_class))
message_found = False
# Checks the message of all warnings belong to warning_class
for index in [i for i, x in enumerate(found) if x]:
# substring will match, the entire message with typo won't
msg = w[index].message # For Python 3 compatibility
msg = str(msg.args[0] if hasattr(msg, 'args') else msg)
if callable(message): # add support for certain tests
check_in_message = message
else:
check_in_message = lambda msg: message in msg
if check_in_message(msg):
message_found = True
break
if not message_found:
raise AssertionError("Did not receive the message you expected "
"('%s') for <%s>, got: '%s'"
% (message, func.__name__, msg))
return result
# To remove when we support numpy 1.7
def assert_no_warnings(func, *args, **kw):
# XXX: once we may depend on python >= 2.6, this can be replaced by the
# warnings module context manager.
# very important to avoid uncontrolled state propagation
clean_warning_registry()
with warnings.catch_warnings(record=True) as w:
warnings.simplefilter('always')
result = func(*args, **kw)
if hasattr(np, 'VisibleDeprecationWarning'):
# Filter out numpy-specific warnings in numpy >= 1.9
w = [e for e in w
if e.category is not np.VisibleDeprecationWarning]
if len(w) > 0:
raise AssertionError("Got warnings when calling %s: %s"
% (func.__name__, w))
return result
def ignore_warnings(obj=None):
""" Context manager and decorator to ignore warnings
Note. Using this (in both variants) will clear all warnings
from all python modules loaded. In case you need to test
cross-module-warning-logging this is not your tool of choice.
Examples
--------
>>> with ignore_warnings():
... warnings.warn('buhuhuhu')
>>> def nasty_warn():
... warnings.warn('buhuhuhu')
... print(42)
>>> ignore_warnings(nasty_warn)()
42
"""
if callable(obj):
return _ignore_warnings(obj)
else:
return _IgnoreWarnings()
def _ignore_warnings(fn):
"""Decorator to catch and hide warnings without visual nesting"""
@wraps(fn)
def wrapper(*args, **kwargs):
# very important to avoid uncontrolled state propagation
clean_warning_registry()
with warnings.catch_warnings(record=True) as w:
warnings.simplefilter('always')
return fn(*args, **kwargs)
w[:] = []
return wrapper
class _IgnoreWarnings(object):
"""Improved and simplified Python warnings context manager
Copied from Python 2.7.5 and modified as required.
"""
def __init__(self):
"""
Parameters
==========
category : warning class
The category to filter. Defaults to Warning. If None,
all categories will be muted.
"""
self._record = True
self._module = sys.modules['warnings']
self._entered = False
self.log = []
def __repr__(self):
args = []
if self._record:
args.append("record=True")
if self._module is not sys.modules['warnings']:
args.append("module=%r" % self._module)
name = type(self).__name__
return "%s(%s)" % (name, ", ".join(args))
def __enter__(self):
clean_warning_registry() # be safe and not propagate state + chaos
warnings.simplefilter('always')
if self._entered:
raise RuntimeError("Cannot enter %r twice" % self)
self._entered = True
self._filters = self._module.filters
self._module.filters = self._filters[:]
self._showwarning = self._module.showwarning
if self._record:
self.log = []
def showwarning(*args, **kwargs):
self.log.append(warnings.WarningMessage(*args, **kwargs))
self._module.showwarning = showwarning
return self.log
else:
return None
def __exit__(self, *exc_info):
if not self._entered:
raise RuntimeError("Cannot exit %r without entering first" % self)
self._module.filters = self._filters
self._module.showwarning = self._showwarning
self.log[:] = []
clean_warning_registry() # be safe and not propagate state + chaos
try:
from nose.tools import assert_less
except ImportError:
assert_less = _assert_less
try:
from nose.tools import assert_greater
except ImportError:
assert_greater = _assert_greater
def _assert_allclose(actual, desired, rtol=1e-7, atol=0,
err_msg='', verbose=True):
actual, desired = np.asanyarray(actual), np.asanyarray(desired)
if np.allclose(actual, desired, rtol=rtol, atol=atol):
return
msg = ('Array not equal to tolerance rtol=%g, atol=%g: '
'actual %s, desired %s') % (rtol, atol, actual, desired)
raise AssertionError(msg)
if hasattr(np.testing, 'assert_allclose'):
assert_allclose = np.testing.assert_allclose
else:
assert_allclose = _assert_allclose
def assert_raise_message(exceptions, message, function, *args, **kwargs):
"""Helper function to test error messages in exceptions
Parameters
----------
exceptions : exception or tuple of exception
Name of the estimator
func : callable
Calable object to raise error
*args : the positional arguments to `func`.
**kw : the keyword arguments to `func`
"""
try:
function(*args, **kwargs)
except exceptions as e:
error_message = str(e)
if message not in error_message:
raise AssertionError("Error message does not include the expected"
" string: %r. Observed error message: %r" %
(message, error_message))
else:
# concatenate exception names
if isinstance(exceptions, tuple):
names = " or ".join(e.__name__ for e in exceptions)
else:
names = exceptions.__name__
raise AssertionError("%s not raised by %s" %
(names, function.__name__))
def fake_mldata(columns_dict, dataname, matfile, ordering=None):
"""Create a fake mldata data set.
Parameters
----------
columns_dict : dict, keys=str, values=ndarray
Contains data as columns_dict[column_name] = array of data.
dataname : string
Name of data set.
matfile : string or file object
The file name string or the file-like object of the output file.
ordering : list, default None
List of column_names, determines the ordering in the data set.
Notes
-----
This function transposes all arrays, while fetch_mldata only transposes
'data', keep that into account in the tests.
"""
datasets = dict(columns_dict)
# transpose all variables
for name in datasets:
datasets[name] = datasets[name].T
if ordering is None:
ordering = sorted(list(datasets.keys()))
# NOTE: setting up this array is tricky, because of the way Matlab
# re-packages 1D arrays
datasets['mldata_descr_ordering'] = sp.empty((1, len(ordering)),
dtype='object')
for i, name in enumerate(ordering):
datasets['mldata_descr_ordering'][0, i] = name
scipy.io.savemat(matfile, datasets, oned_as='column')
class mock_mldata_urlopen(object):
def __init__(self, mock_datasets):
"""Object that mocks the urlopen function to fake requests to mldata.
`mock_datasets` is a dictionary of {dataset_name: data_dict}, or
{dataset_name: (data_dict, ordering).
`data_dict` itself is a dictionary of {column_name: data_array},
and `ordering` is a list of column_names to determine the ordering
in the data set (see `fake_mldata` for details).
When requesting a dataset with a name that is in mock_datasets,
this object creates a fake dataset in a StringIO object and
returns it. Otherwise, it raises an HTTPError.
"""
self.mock_datasets = mock_datasets
def __call__(self, urlname):
dataset_name = urlname.split('/')[-1]
if dataset_name in self.mock_datasets:
resource_name = '_' + dataset_name
from io import BytesIO
matfile = BytesIO()
dataset = self.mock_datasets[dataset_name]
ordering = None
if isinstance(dataset, tuple):
dataset, ordering = dataset
fake_mldata(dataset, resource_name, matfile, ordering)
matfile.seek(0)
return matfile
else:
raise HTTPError(urlname, 404, dataset_name + " is not available",
[], None)
def install_mldata_mock(mock_datasets):
# Lazy import to avoid mutually recursive imports
from sklearn import datasets
datasets.mldata.urlopen = mock_mldata_urlopen(mock_datasets)
def uninstall_mldata_mock():
# Lazy import to avoid mutually recursive imports
from sklearn import datasets
datasets.mldata.urlopen = urlopen
# Meta estimators need another estimator to be instantiated.
META_ESTIMATORS = ["OneVsOneClassifier",
"OutputCodeClassifier", "OneVsRestClassifier", "RFE",
"RFECV", "BaseEnsemble"]
# estimators that there is no way to default-construct sensibly
OTHER = ["Pipeline", "FeatureUnion", "GridSearchCV", "RandomizedSearchCV",
"SelectFromModel"]
# some trange ones
DONT_TEST = ['SparseCoder', 'EllipticEnvelope', 'DictVectorizer',
'LabelBinarizer', 'LabelEncoder',
'MultiLabelBinarizer', 'TfidfTransformer',
'TfidfVectorizer', 'IsotonicRegression',
'OneHotEncoder', 'RandomTreesEmbedding',
'FeatureHasher', 'DummyClassifier', 'DummyRegressor',
'TruncatedSVD', 'PolynomialFeatures',
'GaussianRandomProjectionHash', 'HashingVectorizer',
'CheckingClassifier', 'PatchExtractor', 'CountVectorizer',
# GradientBoosting base estimators, maybe should
# exclude them in another way
'ZeroEstimator', 'ScaledLogOddsEstimator',
'QuantileEstimator', 'MeanEstimator',
'LogOddsEstimator', 'PriorProbabilityEstimator',
'_SigmoidCalibration', 'VotingClassifier']
def all_estimators(include_meta_estimators=False,
include_other=False, type_filter=None,
include_dont_test=False):
"""Get a list of all estimators from sklearn.
This function crawls the module and gets all classes that inherit
from BaseEstimator. Classes that are defined in test-modules are not
included.
By default meta_estimators such as GridSearchCV are also not included.
Parameters
----------
include_meta_estimators : boolean, default=False
Whether to include meta-estimators that can be constructed using
an estimator as their first argument. These are currently
BaseEnsemble, OneVsOneClassifier, OutputCodeClassifier,
OneVsRestClassifier, RFE, RFECV.
include_other : boolean, default=False
Wether to include meta-estimators that are somehow special and can
not be default-constructed sensibly. These are currently
Pipeline, FeatureUnion and GridSearchCV
include_dont_test : boolean, default=False
Whether to include "special" label estimator or test processors.
type_filter : string, list of string, or None, default=None
Which kind of estimators should be returned. If None, no filter is
applied and all estimators are returned. Possible values are
'classifier', 'regressor', 'cluster' and 'transformer' to get
estimators only of these specific types, or a list of these to
get the estimators that fit at least one of the types.
Returns
-------
estimators : list of tuples
List of (name, class), where ``name`` is the class name as string
and ``class`` is the actuall type of the class.
"""
def is_abstract(c):
if not(hasattr(c, '__abstractmethods__')):
return False
if not len(c.__abstractmethods__):
return False
return True
all_classes = []
# get parent folder
path = sklearn.__path__
for importer, modname, ispkg in pkgutil.walk_packages(
path=path, prefix='sklearn.', onerror=lambda x: None):
if ".tests." in modname:
continue
module = __import__(modname, fromlist="dummy")
classes = inspect.getmembers(module, inspect.isclass)
all_classes.extend(classes)
all_classes = set(all_classes)
estimators = [c for c in all_classes
if (issubclass(c[1], BaseEstimator)
and c[0] != 'BaseEstimator')]
# get rid of abstract base classes
estimators = [c for c in estimators if not is_abstract(c[1])]
if not include_dont_test:
estimators = [c for c in estimators if not c[0] in DONT_TEST]
if not include_other:
estimators = [c for c in estimators if not c[0] in OTHER]
# possibly get rid of meta estimators
if not include_meta_estimators:
estimators = [c for c in estimators if not c[0] in META_ESTIMATORS]
if type_filter is not None:
if not isinstance(type_filter, list):
type_filter = [type_filter]
else:
type_filter = list(type_filter) # copy
filtered_estimators = []
filters = {'classifier': ClassifierMixin,
'regressor': RegressorMixin,
'transformer': TransformerMixin,
'cluster': ClusterMixin}
for name, mixin in filters.items():
if name in type_filter:
type_filter.remove(name)
filtered_estimators.extend([est for est in estimators
if issubclass(est[1], mixin)])
estimators = filtered_estimators
if type_filter:
raise ValueError("Parameter type_filter must be 'classifier', "
"'regressor', 'transformer', 'cluster' or None, got"
" %s." % repr(type_filter))
# drop duplicates, sort for reproducibility
return sorted(set(estimators))
def set_random_state(estimator, random_state=0):
"""Set random state of an estimator if it has the `random_state` param.
Classes for whom random_state is deprecated are ignored. Currently DBSCAN
is one such class.
"""
if isinstance(estimator, DBSCAN):
return
if "random_state" in estimator.get_params():
estimator.set_params(random_state=random_state)
def if_matplotlib(func):
"""Test decorator that skips test if matplotlib not installed. """
@wraps(func)
def run_test(*args, **kwargs):
try:
import matplotlib
matplotlib.use('Agg', warn=False)
# this fails if no $DISPLAY specified
import matplotlib.pyplot as plt
plt.figure()
except ImportError:
raise SkipTest('Matplotlib not available.')
else:
return func(*args, **kwargs)
return run_test
def skip_if_32bit(func):
"""Test decorator that skips tests on 32bit platforms."""
@wraps(func)
def run_test(*args, **kwargs):
bits = 8 * struct.calcsize("P")
if bits == 32:
raise SkipTest('Test skipped on 32bit platforms.')
else:
return func(*args, **kwargs)
return run_test
def if_not_mac_os(versions=('10.7', '10.8', '10.9'),
message='Multi-process bug in Mac OS X >= 10.7 '
'(see issue #636)'):
"""Test decorator that skips test if OS is Mac OS X and its
major version is one of ``versions``.
"""
warnings.warn("if_not_mac_os is deprecated in 0.17 and will be removed"
" in 0.19: use the safer and more generic"
" if_safe_multiprocessing_with_blas instead",
DeprecationWarning)
mac_version, _, _ = platform.mac_ver()
skip = '.'.join(mac_version.split('.')[:2]) in versions
def decorator(func):
if skip:
@wraps(func)
def func(*args, **kwargs):
raise SkipTest(message)
return func
return decorator
def if_safe_multiprocessing_with_blas(func):
"""Decorator for tests involving both BLAS calls and multiprocessing
Under POSIX (e.g. Linux or OSX), using multiprocessing in conjunction with
some implementation of BLAS (or other libraries that manage an internal
posix thread pool) can cause a crash or a freeze of the Python process.
In practice all known packaged distributions (from Linux distros or
Anaconda) of BLAS under Linux seems to be safe. So we this problem seems to
only impact OSX users.
This wrapper makes it possible to skip tests that can possibly cause
this crash under OS X with.
Under Python 3.4+ it is possible to use the `forkserver` start method
for multiprocessing to avoid this issue. However it can cause pickling
errors on interactively defined functions. It therefore not enabled by
default.
"""
@wraps(func)
def run_test(*args, **kwargs):
if sys.platform == 'darwin':
raise SkipTest(
"Possible multi-process bug with some BLAS")
return func(*args, **kwargs)
return run_test
def clean_warning_registry():
"""Safe way to reset warnings """
warnings.resetwarnings()
reg = "__warningregistry__"
for mod_name, mod in list(sys.modules.items()):
if 'six.moves' in mod_name:
continue
if hasattr(mod, reg):
getattr(mod, reg).clear()
def check_skip_network():
if int(os.environ.get('SKLEARN_SKIP_NETWORK_TESTS', 0)):
raise SkipTest("Text tutorial requires large dataset download")
def check_skip_travis():
"""Skip test if being run on Travis."""
if os.environ.get('TRAVIS') == "true":
raise SkipTest("This test needs to be skipped on Travis")
def _delete_folder(folder_path, warn=False):
"""Utility function to cleanup a temporary folder if still existing.
Copy from joblib.pool (for independance)"""
try:
if os.path.exists(folder_path):
# This can fail under windows,
# but will succeed when called by atexit
shutil.rmtree(folder_path)
except WindowsError:
if warn:
warnings.warn("Could not delete temporary folder %s" % folder_path)
class TempMemmap(object):
def __init__(self, data, mmap_mode='r'):
self.temp_folder = tempfile.mkdtemp(prefix='sklearn_testing_')
self.mmap_mode = mmap_mode
self.data = data
def __enter__(self):
fpath = op.join(self.temp_folder, 'data.pkl')
joblib.dump(self.data, fpath)
data_read_only = joblib.load(fpath, mmap_mode=self.mmap_mode)
atexit.register(lambda: _delete_folder(self.temp_folder, warn=True))
return data_read_only
def __exit__(self, exc_type, exc_val, exc_tb):
_delete_folder(self.temp_folder)
with_network = with_setup(check_skip_network)
with_travis = with_setup(check_skip_travis)
|
mit
|
huzq/scikit-learn
|
examples/neighbors/plot_digits_kde_sampling.py
|
50
|
2007
|
"""
=========================
Kernel Density Estimation
=========================
This example shows how kernel density estimation (KDE), a powerful
non-parametric density estimation technique, can be used to learn
a generative model for a dataset. With this generative model in place,
new samples can be drawn. These new samples reflect the underlying model
of the data.
"""
import numpy as np
import matplotlib.pyplot as plt
from sklearn.datasets import load_digits
from sklearn.neighbors import KernelDensity
from sklearn.decomposition import PCA
from sklearn.model_selection import GridSearchCV
# load the data
digits = load_digits()
# project the 64-dimensional data to a lower dimension
pca = PCA(n_components=15, whiten=False)
data = pca.fit_transform(digits.data)
# use grid search cross-validation to optimize the bandwidth
params = {'bandwidth': np.logspace(-1, 1, 20)}
grid = GridSearchCV(KernelDensity(), params)
grid.fit(data)
print("best bandwidth: {0}".format(grid.best_estimator_.bandwidth))
# use the best estimator to compute the kernel density estimate
kde = grid.best_estimator_
# sample 44 new points from the data
new_data = kde.sample(44, random_state=0)
new_data = pca.inverse_transform(new_data)
# turn data into a 4x11 grid
new_data = new_data.reshape((4, 11, -1))
real_data = digits.data[:44].reshape((4, 11, -1))
# plot real digits and resampled digits
fig, ax = plt.subplots(9, 11, subplot_kw=dict(xticks=[], yticks=[]))
for j in range(11):
ax[4, j].set_visible(False)
for i in range(4):
im = ax[i, j].imshow(real_data[i, j].reshape((8, 8)),
cmap=plt.cm.binary, interpolation='nearest')
im.set_clim(0, 16)
im = ax[i + 5, j].imshow(new_data[i, j].reshape((8, 8)),
cmap=plt.cm.binary, interpolation='nearest')
im.set_clim(0, 16)
ax[0, 5].set_title('Selection from the input data')
ax[5, 5].set_title('"New" digits drawn from the kernel density model')
plt.show()
|
bsd-3-clause
|
ArtsiomCh/tensorflow
|
tensorflow/examples/learn/iris_custom_model.py
|
37
|
3651
|
# Copyright 2016 The TensorFlow Authors. All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
"""Example of Estimator for Iris plant dataset."""
from __future__ import absolute_import
from __future__ import division
from __future__ import print_function
import numpy as np
from sklearn import datasets
from sklearn import metrics
from sklearn import model_selection
import tensorflow as tf
X_FEATURE = 'x' # Name of the input feature.
def my_model(features, labels, mode):
"""DNN with three hidden layers, and dropout of 0.1 probability."""
# Create three fully connected layers respectively of size 10, 20, and 10 with
# each layer having a dropout probability of 0.1.
net = features[X_FEATURE]
for units in [10, 20, 10]:
net = tf.layers.dense(net, units=units, activation=tf.nn.relu)
net = tf.layers.dropout(net, rate=0.1)
# Compute logits (1 per class).
logits = tf.layers.dense(net, 3, activation=None)
# Compute predictions.
predicted_classes = tf.argmax(logits, 1)
if mode == tf.estimator.ModeKeys.PREDICT:
predictions = {
'class': predicted_classes,
'prob': tf.nn.softmax(logits)
}
return tf.estimator.EstimatorSpec(mode, predictions=predictions)
# Convert the labels to a one-hot tensor of shape (length of features, 3) and
# with a on-value of 1 for each one-hot vector of length 3.
onehot_labels = tf.one_hot(labels, 3, 1, 0)
# Compute loss.
loss = tf.losses.softmax_cross_entropy(
onehot_labels=onehot_labels, logits=logits)
# Create training op.
if mode == tf.estimator.ModeKeys.TRAIN:
optimizer = tf.train.AdagradOptimizer(learning_rate=0.1)
train_op = optimizer.minimize(loss, global_step=tf.train.get_global_step())
return tf.estimator.EstimatorSpec(mode, loss=loss, train_op=train_op)
# Compute evaluation metrics.
eval_metric_ops = {
'accuracy': tf.metrics.accuracy(
labels=labels, predictions=predicted_classes)
}
return tf.estimator.EstimatorSpec(
mode, loss=loss, eval_metric_ops=eval_metric_ops)
def main(unused_argv):
iris = datasets.load_iris()
x_train, x_test, y_train, y_test = model_selection.train_test_split(
iris.data, iris.target, test_size=0.2, random_state=42)
classifier = tf.estimator.Estimator(model_fn=my_model)
# Train.
train_input_fn = tf.estimator.inputs.numpy_input_fn(
x={X_FEATURE: x_train}, y=y_train, num_epochs=None, shuffle=True)
classifier.train(input_fn=train_input_fn, steps=1000)
# Predict.
test_input_fn = tf.estimator.inputs.numpy_input_fn(
x={X_FEATURE: x_test}, y=y_test, num_epochs=1, shuffle=False)
predictions = classifier.predict(input_fn=test_input_fn)
y_predicted = np.array(list(p['class'] for p in predictions))
y_predicted = y_predicted.reshape(np.array(y_test).shape)
# Score with sklearn.
score = metrics.accuracy_score(y_test, y_predicted)
print('Accuracy (sklearn): {0:f}'.format(score))
# Score with tensorflow.
scores = classifier.evaluate(input_fn=test_input_fn)
print('Accuracy (tensorflow): {0:f}'.format(scores['accuracy']))
if __name__ == '__main__':
tf.app.run()
|
apache-2.0
|
jfsehuanes/aktivitarium
|
main.py
|
1
|
1331
|
__author__ = 'juan'
from auxiliary import *
import numpy as np
import pandas as pd
from IPython import embed
def fill_curr_course(current_course, persons_in_course, persons_data_frame):
""" Function returns the next matching person.
:param current_course:
:param persons_in_course:
:param persons_data_frame:
"""
room_persons = persons_in_course
embed()
quit()
pass
if __name__ == '__main__':
activities_df = pd.read_csv('./lista_de_actividades.csv')
days = len(activities_df)
persons_df = pd.read_csv('./lista_de_prueba.csv')
tmp_dict = {'day': '', 'person': '', 'course': '', 'room': '', 'gender': ''}
entries_df = pd.DataFrame(tmp_dict)
for curr_day in np.arange(0, days):
for curr_course in np.array(activities_df.index):
max_persons = activities_df.places[curr_course]
embed()
quit()
persons_in_course = entries_df[entries_df.course == activities_df.activities[curr_course]]
if len(persons_in_course) < max_persons:
fill_curr_course(curr_course, persons_in_course, persons_df)
else: # Course is full, need to continue
print 'Course is full, continuing with next person...'
continue
# embed()
# quit()
|
gpl-2.0
|
jzt5132/scikit-learn
|
benchmarks/bench_lasso.py
|
297
|
3305
|
"""
Benchmarks of Lasso vs LassoLars
First, we fix a training set and increase the number of
samples. Then we plot the computation time as function of
the number of samples.
In the second benchmark, we increase the number of dimensions of the
training set. Then we plot the computation time as function of
the number of dimensions.
In both cases, only 10% of the features are informative.
"""
import gc
from time import time
import numpy as np
from sklearn.datasets.samples_generator import make_regression
def compute_bench(alpha, n_samples, n_features, precompute):
lasso_results = []
lars_lasso_results = []
it = 0
for ns in n_samples:
for nf in n_features:
it += 1
print('==================')
print('Iteration %s of %s' % (it, max(len(n_samples),
len(n_features))))
print('==================')
n_informative = nf // 10
X, Y, coef_ = make_regression(n_samples=ns, n_features=nf,
n_informative=n_informative,
noise=0.1, coef=True)
X /= np.sqrt(np.sum(X ** 2, axis=0)) # Normalize data
gc.collect()
print("- benchmarking Lasso")
clf = Lasso(alpha=alpha, fit_intercept=False,
precompute=precompute)
tstart = time()
clf.fit(X, Y)
lasso_results.append(time() - tstart)
gc.collect()
print("- benchmarking LassoLars")
clf = LassoLars(alpha=alpha, fit_intercept=False,
normalize=False, precompute=precompute)
tstart = time()
clf.fit(X, Y)
lars_lasso_results.append(time() - tstart)
return lasso_results, lars_lasso_results
if __name__ == '__main__':
from sklearn.linear_model import Lasso, LassoLars
import pylab as pl
alpha = 0.01 # regularization parameter
n_features = 10
list_n_samples = np.linspace(100, 1000000, 5).astype(np.int)
lasso_results, lars_lasso_results = compute_bench(alpha, list_n_samples,
[n_features], precompute=True)
pl.figure('scikit-learn LASSO benchmark results')
pl.subplot(211)
pl.plot(list_n_samples, lasso_results, 'b-',
label='Lasso')
pl.plot(list_n_samples, lars_lasso_results, 'r-',
label='LassoLars')
pl.title('precomputed Gram matrix, %d features, alpha=%s' % (n_features, alpha))
pl.legend(loc='upper left')
pl.xlabel('number of samples')
pl.ylabel('Time (s)')
pl.axis('tight')
n_samples = 2000
list_n_features = np.linspace(500, 3000, 5).astype(np.int)
lasso_results, lars_lasso_results = compute_bench(alpha, [n_samples],
list_n_features, precompute=False)
pl.subplot(212)
pl.plot(list_n_features, lasso_results, 'b-', label='Lasso')
pl.plot(list_n_features, lars_lasso_results, 'r-', label='LassoLars')
pl.title('%d samples, alpha=%s' % (n_samples, alpha))
pl.legend(loc='upper left')
pl.xlabel('number of features')
pl.ylabel('Time (s)')
pl.axis('tight')
pl.show()
|
bsd-3-clause
|
wzbozon/scikit-learn
|
sklearn/datasets/twenty_newsgroups.py
|
126
|
13591
|
"""Caching loader for the 20 newsgroups text classification dataset
The description of the dataset is available on the official website at:
http://people.csail.mit.edu/jrennie/20Newsgroups/
Quoting the introduction:
The 20 Newsgroups data set is a collection of approximately 20,000
newsgroup documents, partitioned (nearly) evenly across 20 different
newsgroups. To the best of my knowledge, it was originally collected
by Ken Lang, probably for his Newsweeder: Learning to filter netnews
paper, though he does not explicitly mention this collection. The 20
newsgroups collection has become a popular data set for experiments
in text applications of machine learning techniques, such as text
classification and text clustering.
This dataset loader will download the recommended "by date" variant of the
dataset and which features a point in time split between the train and
test sets. The compressed dataset size is around 14 Mb compressed. Once
uncompressed the train set is 52 MB and the test set is 34 MB.
The data is downloaded, extracted and cached in the '~/scikit_learn_data'
folder.
The `fetch_20newsgroups` function will not vectorize the data into numpy
arrays but the dataset lists the filenames of the posts and their categories
as target labels.
The `fetch_20newsgroups_vectorized` function will in addition do a simple
tf-idf vectorization step.
"""
# Copyright (c) 2011 Olivier Grisel <[email protected]>
# License: BSD 3 clause
import os
import logging
import tarfile
import pickle
import shutil
import re
import codecs
import numpy as np
import scipy.sparse as sp
from .base import get_data_home
from .base import Bunch
from .base import load_files
from ..utils import check_random_state
from ..feature_extraction.text import CountVectorizer
from ..preprocessing import normalize
from ..externals import joblib, six
if six.PY3:
from urllib.request import urlopen
else:
from urllib2 import urlopen
logger = logging.getLogger(__name__)
URL = ("http://people.csail.mit.edu/jrennie/"
"20Newsgroups/20news-bydate.tar.gz")
ARCHIVE_NAME = "20news-bydate.tar.gz"
CACHE_NAME = "20news-bydate.pkz"
TRAIN_FOLDER = "20news-bydate-train"
TEST_FOLDER = "20news-bydate-test"
def download_20newsgroups(target_dir, cache_path):
"""Download the 20 newsgroups data and stored it as a zipped pickle."""
archive_path = os.path.join(target_dir, ARCHIVE_NAME)
train_path = os.path.join(target_dir, TRAIN_FOLDER)
test_path = os.path.join(target_dir, TEST_FOLDER)
if not os.path.exists(target_dir):
os.makedirs(target_dir)
if os.path.exists(archive_path):
# Download is not complete as the .tar.gz file is removed after
# download.
logger.warning("Download was incomplete, downloading again.")
os.remove(archive_path)
logger.warning("Downloading dataset from %s (14 MB)", URL)
opener = urlopen(URL)
with open(archive_path, 'wb') as f:
f.write(opener.read())
logger.info("Decompressing %s", archive_path)
tarfile.open(archive_path, "r:gz").extractall(path=target_dir)
os.remove(archive_path)
# Store a zipped pickle
cache = dict(train=load_files(train_path, encoding='latin1'),
test=load_files(test_path, encoding='latin1'))
compressed_content = codecs.encode(pickle.dumps(cache), 'zlib_codec')
with open(cache_path, 'wb') as f:
f.write(compressed_content)
shutil.rmtree(target_dir)
return cache
def strip_newsgroup_header(text):
"""
Given text in "news" format, strip the headers, by removing everything
before the first blank line.
"""
_before, _blankline, after = text.partition('\n\n')
return after
_QUOTE_RE = re.compile(r'(writes in|writes:|wrote:|says:|said:'
r'|^In article|^Quoted from|^\||^>)')
def strip_newsgroup_quoting(text):
"""
Given text in "news" format, strip lines beginning with the quote
characters > or |, plus lines that often introduce a quoted section
(for example, because they contain the string 'writes:'.)
"""
good_lines = [line for line in text.split('\n')
if not _QUOTE_RE.search(line)]
return '\n'.join(good_lines)
def strip_newsgroup_footer(text):
"""
Given text in "news" format, attempt to remove a signature block.
As a rough heuristic, we assume that signatures are set apart by either
a blank line or a line made of hyphens, and that it is the last such line
in the file (disregarding blank lines at the end).
"""
lines = text.strip().split('\n')
for line_num in range(len(lines) - 1, -1, -1):
line = lines[line_num]
if line.strip().strip('-') == '':
break
if line_num > 0:
return '\n'.join(lines[:line_num])
else:
return text
def fetch_20newsgroups(data_home=None, subset='train', categories=None,
shuffle=True, random_state=42,
remove=(),
download_if_missing=True):
"""Load the filenames and data from the 20 newsgroups dataset.
Read more in the :ref:`User Guide <20newsgroups>`.
Parameters
----------
subset: 'train' or 'test', 'all', optional
Select the dataset to load: 'train' for the training set, 'test'
for the test set, 'all' for both, with shuffled ordering.
data_home: optional, default: None
Specify a download and cache folder for the datasets. If None,
all scikit-learn data is stored in '~/scikit_learn_data' subfolders.
categories: None or collection of string or unicode
If None (default), load all the categories.
If not None, list of category names to load (other categories
ignored).
shuffle: bool, optional
Whether or not to shuffle the data: might be important for models that
make the assumption that the samples are independent and identically
distributed (i.i.d.), such as stochastic gradient descent.
random_state: numpy random number generator or seed integer
Used to shuffle the dataset.
download_if_missing: optional, True by default
If False, raise an IOError if the data is not locally available
instead of trying to download the data from the source site.
remove: tuple
May contain any subset of ('headers', 'footers', 'quotes'). Each of
these are kinds of text that will be detected and removed from the
newsgroup posts, preventing classifiers from overfitting on
metadata.
'headers' removes newsgroup headers, 'footers' removes blocks at the
ends of posts that look like signatures, and 'quotes' removes lines
that appear to be quoting another post.
'headers' follows an exact standard; the other filters are not always
correct.
"""
data_home = get_data_home(data_home=data_home)
cache_path = os.path.join(data_home, CACHE_NAME)
twenty_home = os.path.join(data_home, "20news_home")
cache = None
if os.path.exists(cache_path):
try:
with open(cache_path, 'rb') as f:
compressed_content = f.read()
uncompressed_content = codecs.decode(
compressed_content, 'zlib_codec')
cache = pickle.loads(uncompressed_content)
except Exception as e:
print(80 * '_')
print('Cache loading failed')
print(80 * '_')
print(e)
if cache is None:
if download_if_missing:
cache = download_20newsgroups(target_dir=twenty_home,
cache_path=cache_path)
else:
raise IOError('20Newsgroups dataset not found')
if subset in ('train', 'test'):
data = cache[subset]
elif subset == 'all':
data_lst = list()
target = list()
filenames = list()
for subset in ('train', 'test'):
data = cache[subset]
data_lst.extend(data.data)
target.extend(data.target)
filenames.extend(data.filenames)
data.data = data_lst
data.target = np.array(target)
data.filenames = np.array(filenames)
else:
raise ValueError(
"subset can only be 'train', 'test' or 'all', got '%s'" % subset)
data.description = 'the 20 newsgroups by date dataset'
if 'headers' in remove:
data.data = [strip_newsgroup_header(text) for text in data.data]
if 'footers' in remove:
data.data = [strip_newsgroup_footer(text) for text in data.data]
if 'quotes' in remove:
data.data = [strip_newsgroup_quoting(text) for text in data.data]
if categories is not None:
labels = [(data.target_names.index(cat), cat) for cat in categories]
# Sort the categories to have the ordering of the labels
labels.sort()
labels, categories = zip(*labels)
mask = np.in1d(data.target, labels)
data.filenames = data.filenames[mask]
data.target = data.target[mask]
# searchsorted to have continuous labels
data.target = np.searchsorted(labels, data.target)
data.target_names = list(categories)
# Use an object array to shuffle: avoids memory copy
data_lst = np.array(data.data, dtype=object)
data_lst = data_lst[mask]
data.data = data_lst.tolist()
if shuffle:
random_state = check_random_state(random_state)
indices = np.arange(data.target.shape[0])
random_state.shuffle(indices)
data.filenames = data.filenames[indices]
data.target = data.target[indices]
# Use an object array to shuffle: avoids memory copy
data_lst = np.array(data.data, dtype=object)
data_lst = data_lst[indices]
data.data = data_lst.tolist()
return data
def fetch_20newsgroups_vectorized(subset="train", remove=(), data_home=None):
"""Load the 20 newsgroups dataset and transform it into tf-idf vectors.
This is a convenience function; the tf-idf transformation is done using the
default settings for `sklearn.feature_extraction.text.Vectorizer`. For more
advanced usage (stopword filtering, n-gram extraction, etc.), combine
fetch_20newsgroups with a custom `Vectorizer` or `CountVectorizer`.
Read more in the :ref:`User Guide <20newsgroups>`.
Parameters
----------
subset: 'train' or 'test', 'all', optional
Select the dataset to load: 'train' for the training set, 'test'
for the test set, 'all' for both, with shuffled ordering.
data_home: optional, default: None
Specify an download and cache folder for the datasets. If None,
all scikit-learn data is stored in '~/scikit_learn_data' subfolders.
remove: tuple
May contain any subset of ('headers', 'footers', 'quotes'). Each of
these are kinds of text that will be detected and removed from the
newsgroup posts, preventing classifiers from overfitting on
metadata.
'headers' removes newsgroup headers, 'footers' removes blocks at the
ends of posts that look like signatures, and 'quotes' removes lines
that appear to be quoting another post.
Returns
-------
bunch : Bunch object
bunch.data: sparse matrix, shape [n_samples, n_features]
bunch.target: array, shape [n_samples]
bunch.target_names: list, length [n_classes]
"""
data_home = get_data_home(data_home=data_home)
filebase = '20newsgroup_vectorized'
if remove:
filebase += 'remove-' + ('-'.join(remove))
target_file = os.path.join(data_home, filebase + ".pk")
# we shuffle but use a fixed seed for the memoization
data_train = fetch_20newsgroups(data_home=data_home,
subset='train',
categories=None,
shuffle=True,
random_state=12,
remove=remove)
data_test = fetch_20newsgroups(data_home=data_home,
subset='test',
categories=None,
shuffle=True,
random_state=12,
remove=remove)
if os.path.exists(target_file):
X_train, X_test = joblib.load(target_file)
else:
vectorizer = CountVectorizer(dtype=np.int16)
X_train = vectorizer.fit_transform(data_train.data).tocsr()
X_test = vectorizer.transform(data_test.data).tocsr()
joblib.dump((X_train, X_test), target_file, compress=9)
# the data is stored as int16 for compactness
# but normalize needs floats
X_train = X_train.astype(np.float64)
X_test = X_test.astype(np.float64)
normalize(X_train, copy=False)
normalize(X_test, copy=False)
target_names = data_train.target_names
if subset == "train":
data = X_train
target = data_train.target
elif subset == "test":
data = X_test
target = data_test.target
elif subset == "all":
data = sp.vstack((X_train, X_test)).tocsr()
target = np.concatenate((data_train.target, data_test.target))
else:
raise ValueError("%r is not a valid subset: should be one of "
"['train', 'test', 'all']" % subset)
return Bunch(data=data, target=target, target_names=target_names)
|
bsd-3-clause
|
puruckertom/ubertool
|
ubertool/iec/iec_exe.py
|
1
|
2127
|
from __future__ import division
import numpy as np
import pandas as pd
from base.uber_model import UberModel, ModelSharedInputs
from .iec_functions import IecFunctions
class IecInputs(ModelSharedInputs):
"""
Input class for IEC.
"""
def __init__(self):
"""Class representing the inputs for IEC"""
super(IecInputs, self).__init__()
self.dose_response = pd.Series([], dtype="float")
self.lc50 = pd.Series([], dtype="float")
self.threshold = pd.Series([], dtype="float")
class IecOutputs(object):
"""
Output class for IEC.
"""
def __init__(self):
"""Class representing the outputs for IEC"""
super(IecOutputs, self).__init__()
self.out_z_score_f = pd.Series([], dtype="float", name="out_z_score_f")
self.out_f8_f = pd.Series([], dtype="float", name="out_f8_f")
self.out_chance_f = pd.Series([], dtype="float", name="out_chance_f")
class Iec(UberModel, IecInputs, IecOutputs, IecFunctions):
"""
IEC model for proportional population effect based on normal distribution.
"""
def __init__(self, pd_obj, pd_obj_exp):
"""Class representing the IEC model and containing all its methods"""
super(Iec, self).__init__()
self.pd_obj = pd_obj
self.pd_obj_exp = pd_obj_exp
self.pd_obj_out = None
def execute_model(self):
"""
Callable to execute the running of the model:
1) Populate input parameters
2) Create output DataFrame to hold the model outputs
3) Run the model's methods to generate outputs
4) Fill the output DataFrame with the generated model outputs
"""
self.populate_inputs(self.pd_obj)
self.pd_obj_out = self.populate_outputs()
self.run_methods()
self.fill_output_dataframe()
def run_methods(self):
"""
Execute all algorithm methods for model logic.
:return:
"""
try:
self.z_score_f()
self.f8_f()
self.chance_f()
except Exception as e:
pass
|
unlicense
|
ronalcc/zipline
|
zipline/finance/performance/position_tracker.py
|
4
|
13048
|
from __future__ import division
import logbook
import numpy as np
import pandas as pd
from pandas.lib import checknull
try:
# optional cython based OrderedDict
from cyordereddict import OrderedDict
except ImportError:
from collections import OrderedDict
from six import iteritems, itervalues
from zipline.finance.slippage import Transaction
from zipline.utils.serialization_utils import (
VERSION_LABEL
)
import zipline.protocol as zp
from zipline.assets import (
Equity, Future
)
from zipline.finance.trading import with_environment
from . position import positiondict
log = logbook.Logger('Performance')
class PositionTracker(object):
def __init__(self):
# sid => position object
self.positions = positiondict()
# Arrays for quick calculations of positions value
self._position_amounts = OrderedDict()
self._position_last_sale_prices = OrderedDict()
self._position_value_multipliers = OrderedDict()
self._position_exposure_multipliers = OrderedDict()
self._position_payout_multipliers = OrderedDict()
self._unpaid_dividends = pd.DataFrame(
columns=zp.DIVIDEND_PAYMENT_FIELDS,
)
self._positions_store = zp.Positions()
@with_environment()
def _retrieve_asset(self, sid, env=None):
return env.asset_finder.retrieve_asset(sid)
def _update_multipliers(self, sid):
try:
self._position_value_multipliers[sid]
self._position_exposure_multipliers[sid]
self._position_payout_multipliers[sid]
except KeyError:
# Collect the value multipliers from applicable sids
asset = self._retrieve_asset(sid)
if isinstance(asset, Equity):
self._position_value_multipliers[sid] = 1
self._position_exposure_multipliers[sid] = 1
self._position_payout_multipliers[sid] = 0
if isinstance(asset, Future):
self._position_value_multipliers[sid] = 0
self._position_exposure_multipliers[sid] = \
asset.contract_multiplier
self._position_payout_multipliers[sid] = \
asset.contract_multiplier
def update_last_sale(self, event):
# NOTE, PerformanceTracker already vetted as TRADE type
sid = event.sid
if sid not in self.positions:
return 0
price = event.price
if checknull(price):
return 0
pos = self.positions[sid]
old_price = pos.last_sale_price
pos.last_sale_date = event.dt
pos.last_sale_price = price
self._position_last_sale_prices[sid] = price
# Calculate cash adjustment on assets with multipliers
return ((price - old_price) * self._position_payout_multipliers[sid]
* pos.amount)
def update_positions(self, positions):
# update positions in batch
self.positions.update(positions)
for sid, pos in iteritems(positions):
self._position_amounts[sid] = pos.amount
self._position_last_sale_prices[sid] = pos.last_sale_price
self._update_multipliers(sid)
def update_position(self, sid, amount=None, last_sale_price=None,
last_sale_date=None, cost_basis=None):
pos = self.positions[sid]
if amount is not None:
pos.amount = amount
self._position_amounts[sid] = amount
self._position_values = None # invalidate cache
self._update_multipliers(sid=sid)
if last_sale_price is not None:
pos.last_sale_price = last_sale_price
self._position_last_sale_prices[sid] = last_sale_price
self._position_values = None # invalidate cache
if last_sale_date is not None:
pos.last_sale_date = last_sale_date
if cost_basis is not None:
pos.cost_basis = cost_basis
def execute_transaction(self, txn):
# Update Position
# ----------------
sid = txn.sid
position = self.positions[sid]
position.update(txn)
self._position_amounts[sid] = position.amount
self._position_last_sale_prices[sid] = position.last_sale_price
self._update_multipliers(sid)
def handle_commission(self, commission):
# Adjust the cost basis of the stock if we own it
if commission.sid in self.positions:
self.positions[commission.sid].\
adjust_commission_cost_basis(commission)
@property
def position_values(self):
iter_amount_price_multiplier = zip(
itervalues(self._position_amounts),
itervalues(self._position_last_sale_prices),
itervalues(self._position_value_multipliers),
)
return [
price * amount * multiplier for
price, amount, multiplier in iter_amount_price_multiplier
]
@property
def position_exposures(self):
iter_amount_price_multiplier = zip(
itervalues(self._position_amounts),
itervalues(self._position_last_sale_prices),
itervalues(self._position_exposure_multipliers),
)
return [
price * amount * multiplier for
price, amount, multiplier in iter_amount_price_multiplier
]
def calculate_positions_value(self):
if len(self.position_values) == 0:
return np.float64(0)
return sum(self.position_values)
def calculate_positions_exposure(self):
if len(self.position_exposures) == 0:
return np.float64(0)
return sum(self.position_exposures)
def _longs_count(self):
return sum(1 for i in self.position_exposures if i > 0)
def _long_exposure(self):
return sum(i for i in self.position_exposures if i > 0)
def _long_value(self):
return sum(i for i in self.position_values if i > 0)
def _shorts_count(self):
return sum(1 for i in self.position_exposures if i < 0)
def _short_exposure(self):
return sum(i for i in self.position_exposures if i < 0)
def _short_value(self):
return sum(i for i in self.position_values if i < 0)
def _gross_exposure(self):
return self._long_exposure() + abs(self._short_exposure())
def _gross_value(self):
return self._long_value() + abs(self._short_value())
def _net_exposure(self):
return self.calculate_positions_exposure()
def _net_value(self):
return self.calculate_positions_value()
def handle_split(self, split):
if split.sid in self.positions:
# Make the position object handle the split. It returns the
# leftover cash from a fractional share, if there is any.
position = self.positions[split.sid]
leftover_cash = position.handle_split(split)
self._position_amounts[split.sid] = position.amount
self._position_last_sale_prices[split.sid] = \
position.last_sale_price
self._update_multipliers(split.sid)
return leftover_cash
def _maybe_earn_dividend(self, dividend):
"""
Take a historical dividend record and return a Series with fields in
zipline.protocol.DIVIDEND_FIELDS (plus an 'id' field) representing
the cash/stock amount we are owed when the dividend is paid.
"""
if dividend['sid'] in self.positions:
return self.positions[dividend['sid']].earn_dividend(dividend)
else:
return zp.dividend_payment()
def earn_dividends(self, dividend_frame):
"""
Given a frame of dividends whose ex_dates are all the next trading day,
calculate and store the cash and/or stock payments to be paid on each
dividend's pay date.
"""
earned = dividend_frame.apply(self._maybe_earn_dividend, axis=1)\
.dropna(how='all')
if len(earned) > 0:
# Store the earned dividends so that they can be paid on the
# dividends' pay_dates.
self._unpaid_dividends = pd.concat(
[self._unpaid_dividends, earned],
)
def _maybe_pay_dividend(self, dividend):
"""
Take a historical dividend record, look up any stored record of
cash/stock we are owed for that dividend, and return a Series
with fields drawn from zipline.protocol.DIVIDEND_PAYMENT_FIELDS.
"""
try:
unpaid_dividend = self._unpaid_dividends.loc[dividend['id']]
return unpaid_dividend
except KeyError:
return zp.dividend_payment()
def pay_dividends(self, dividend_frame):
"""
Given a frame of dividends whose pay_dates are all the next trading
day, grant the cash and/or stock payments that were calculated on the
given dividends' ex dates.
"""
payments = dividend_frame.apply(self._maybe_pay_dividend, axis=1)\
.dropna(how='all')
# Mark these dividends as paid by dropping them from our unpaid
# table.
self._unpaid_dividends.drop(payments.index)
# Add stock for any stock dividends paid. Again, the values here may
# be negative in the case of short positions.
stock_payments = payments[payments['payment_sid'].notnull()]
for _, row in stock_payments.iterrows():
stock = row['payment_sid']
share_count = row['share_count']
# note we create a Position for stock dividend if we don't
# already own the asset
position = self.positions[stock]
position.amount += share_count
self._position_amounts[stock] = position.amount
self._position_last_sale_prices[stock] = position.last_sale_price
self._update_multipliers(stock)
# Add cash equal to the net cash payed from all dividends. Note that
# "negative cash" is effectively paid if we're short an asset,
# representing the fact that we're required to reimburse the owner of
# the stock for any dividends paid while borrowing.
net_cash_payment = payments['cash_amount'].fillna(0).sum()
return net_cash_payment
def create_close_position_transaction(self, event):
if not self._position_amounts.get(event.sid):
return None
txn = Transaction(
sid=event.sid,
amount=(-1 * self._position_amounts[event.sid]),
dt=event.dt,
price=event.price,
commission=0,
order_id=0
)
return txn
def get_positions(self):
positions = self._positions_store
for sid, pos in iteritems(self.positions):
if pos.amount == 0:
# Clear out the position if it has become empty since the last
# time get_positions was called. Catching the KeyError is
# faster than checking `if sid in positions`, and this can be
# potentially called in a tight inner loop.
try:
del positions[sid]
except KeyError:
pass
continue
# Note that this will create a position if we don't currently have
# an entry
position = positions[sid]
position.amount = pos.amount
position.cost_basis = pos.cost_basis
position.last_sale_price = pos.last_sale_price
return positions
def get_positions_list(self):
positions = []
for sid, pos in iteritems(self.positions):
if pos.amount != 0:
positions.append(pos.to_dict())
return positions
def __getstate__(self):
state_dict = {}
state_dict['positions'] = dict(self.positions)
state_dict['unpaid_dividends'] = self._unpaid_dividends
STATE_VERSION = 1
state_dict[VERSION_LABEL] = STATE_VERSION
return state_dict
def __setstate__(self, state):
OLDEST_SUPPORTED_STATE = 1
version = state.pop(VERSION_LABEL)
if version < OLDEST_SUPPORTED_STATE:
raise BaseException("PositionTracker saved state is too old.")
self.positions = positiondict()
# note that positions_store is temporary and gets regened from
# .positions
self._positions_store = zp.Positions()
self._unpaid_dividends = state['unpaid_dividends']
# Arrays for quick calculations of positions value
self._position_amounts = OrderedDict()
self._position_last_sale_prices = OrderedDict()
self._position_value_multipliers = OrderedDict()
self._position_exposure_multipliers = OrderedDict()
self._position_payout_multipliers = OrderedDict()
self.update_positions(state['positions'])
|
apache-2.0
|
BorisJeremic/Real-ESSI-Examples
|
analytic_solution/test_cases/Contact/Stress_Based_Contact_Verification/SoftContact_NonLinHardSoftShear/Area/A_1e2/Normalized_Shear_Stress_Plot.py
|
48
|
3533
|
#!/usr/bin/python
import h5py
import matplotlib.pylab as plt
import matplotlib as mpl
import sys
import numpy as np;
plt.rcParams.update({'font.size': 28})
# set tick width
mpl.rcParams['xtick.major.size'] = 10
mpl.rcParams['xtick.major.width'] = 5
mpl.rcParams['xtick.minor.size'] = 10
mpl.rcParams['xtick.minor.width'] = 5
plt.rcParams['xtick.labelsize']=24
mpl.rcParams['ytick.major.size'] = 10
mpl.rcParams['ytick.major.width'] = 5
mpl.rcParams['ytick.minor.size'] = 10
mpl.rcParams['ytick.minor.width'] = 5
plt.rcParams['ytick.labelsize']=24
###############################################################
## Analytical Solution
###############################################################
# Go over each feioutput and plot each one.
thefile = "Analytical_Solution_Shear.feioutput";
finput = h5py.File(thefile)
# Read the time and displacement
times = finput["time"][:]
shear_strain_x = finput["/Model/Elements/Element_Outputs"][4,:]
shear_strain_y = finput["/Model/Elements/Element_Outputs"][5,:]
shear_stress_x = finput["/Model/Elements/Element_Outputs"][7,:]
shear_stress_y = finput["/Model/Elements/Element_Outputs"][8,:]
normal_stress = -finput["/Model/Elements/Element_Outputs"][9,:];
shear_strain = np.sqrt(shear_strain_x*shear_strain_x + shear_strain_y*shear_strain_y) ;
shear_stress = np.sqrt(shear_stress_x*shear_stress_x + shear_stress_y*shear_stress_y );
shear_stress = shear_stress_x;
shear_strain = shear_strain_x;
# Configure the figure filename, according to the input filename.
outfig=thefile.replace("_","-")
outfigname=outfig.replace("h5.feioutput","pdf")
# Plot the figure. Add labels and titles.
plt.figure(figsize=(12,10))
plt.plot(shear_strain*5,shear_stress/normal_stress,'-r',label='Analytical Solution', Linewidth=4)
plt.xlabel(r"Shear Displacement $\Delta_t [mm]$")
plt.ylabel(r"Normalized Shear Stress $\tau/\sigma_n$")
###############################################################
## Numerical Solution
###############################################################
# Go over each feioutput and plot each one.
thefile = "Monotonic_Contact_Behaviour_Adding_Tangential_Load.h5.feioutput";
finput = h5py.File(thefile)
# Read the time and displacement
times = finput["time"][:]
shear_strain_x = finput["/Model/Elements/Element_Outputs"][4,:]
shear_strain_y = finput["/Model/Elements/Element_Outputs"][5,:]
shear_stress_x = finput["/Model/Elements/Element_Outputs"][7,:]
shear_stress_y = finput["/Model/Elements/Element_Outputs"][8,:]
normal_stress = -finput["/Model/Elements/Element_Outputs"][9,:];
shear_strain = np.sqrt(shear_strain_x*shear_strain_x + shear_strain_y*shear_strain_y) ;
shear_stress = np.sqrt(shear_stress_x*shear_stress_x + shear_stress_y*shear_stress_y );
shear_stress = shear_stress_x;
shear_strain = shear_strain_x;
# Configure the figure filename, according to the input filename.
outfig=thefile.replace("_","-")
outfigname=outfig.replace("h5.feioutput","pdf")
# Plot the figure. Add labels and titles.
plt.plot(shear_strain*5,shear_stress/normal_stress,'-k',label='Numerical Solution', Linewidth=4)
plt.xlabel(r"Shear Displacement $\Delta_t [mm]$")
plt.ylabel(r"Normalized Shear Stress $\tau/\sigma_n$")
########################################################
# # axes = plt.gca()
# # axes.set_xlim([-7,7])
# # axes.set_ylim([-1,1])
outfigname = "Normalized_Shear_Stress.pdf";
legend = plt.legend()
legend.get_frame().set_linewidth(0.0)
legend.get_frame().set_facecolor('none')
plt.savefig(outfigname, bbox_inches='tight')
# plt.show()
|
cc0-1.0
|
ttfnrob/NLTalk
|
process_comments.py
|
1
|
9429
|
# Script to train a Naive Bayesian Classifier with NLTK - based on https://github.com/abromberg/sentiment_analysis_python
# Classifier is trained using 1.6M Tweets pre-procesed at Sanford and available at http://help.sentiment140.com/for-students
# Other data is also save din the training-data folder
# Script and HTML tepmate are designed for specific Zooniverse data.
# This is extracted from the Zooniverse discussion platform 'Talk' - please contact [email protected] for more information.
# Inputs are a MySQL DB of text comments, and NLTK+training data
# Outputs are CSV for of sentiment scores, and HTML files to show positive and negative comments
# Basic Components
import math
import time
import datetime
import os
import numpy as np
import pandas as pd
import sys
# For database and data IO
import pymysql
import json
import csv
import urllib2
from subprocess import call
# For Text processing
import re, collections, itertools
import nltk, nltk.classify.util, nltk.metrics
from nltk.classify import NaiveBayesClassifier
from nltk.metrics import BigramAssocMeasures
from nltk.probability import FreqDist, ConditionalFreqDist
########################## Set parameters for different projects ##########################
# project_slug = 'galaxy_zoo'
# talk_url = 'talk.galaxyzoo.org'
# min_comments = 5
# imgy='250'
# project_slug = 'serengeti'
# talk_url = 'talk.snapshotserengeti.org'
# min_comments = 5
# imgy='175'
project_slug = 'planet_four'
talk_url = 'talk.planetfour.org'
min_comments = 5
imgy='193'
# project_slug = 'milky_way'
# talk_url = 'talk.milkywayproject.org'
# min_comments = 5
# imgy='125'
######################## ------------------------------------- ###########################
# Function to create HTML file from list of results
def focus_list_to_html_table(focus_list):
html = """<style type="text/css">
body {font-size:14px; color: #ffffff; font-family: sans-serif;}
div.thumbnail {display: inline-block; position: relative; margin: 5px;}
div.thumbnail img {width:250px;}
div.details {position:absolute; bottom:5px; left:5px; width:240px;}
span.pos_frac {color: #8DFF87;}
span.neg_frac {color: #FF7B6B;}
span.zoo_id {position:absolute; top:5px; left:5px;}
span.comments {position:absolute; top:5px; right:5px;}
span.words {display:none;}
</style>
<script src="http://ajax.googleapis.com/ajax/libs/jquery/1.11.0/jquery.min.js"></script>
<script>
function id2url(zooID) {
$.getJSON( "https://api.zooniverse.org/projects/"""+project_slug+"""/subjects/"+zooID, function( data ) {
if (data.location.standard instanceof Array) {
$("#"+zooID).attr("src", data.location.standard[0]);
} else {
$("#"+zooID).attr("src", data.location.standard);
}
});
}
$(document).ready(function() {
$( ".img_waiting" ).each(function( index ) {
id2url($( this ).attr('id'));
});
})
</script>
<body>
"""
c=0
focus_list.reverse()
total = len(focus_list)
for r in focus_list:
if r[3][0]=="A":
img_html="<a href='http://"+talk_url+"/#/subjects/"+r[3]+"' target='_blank'><img class='img_waiting' id='"+r[3]+"' src='http://placehold.it/250x"+imgy+"' /></a>"
else:
img_html="<img class='thumb' src='http://placehold.it/250x"+imgy+"' />"
html+="""<div class='thumbnail'>
"""+img_html+"""
<span class='zoo_id'>"""+str(r[3])+"""</span>
<div class='details'>
<span class='pos_frac'>"""+"{:.2f}".format(r[1])+"""</span>
<span class='neg_frac'>"""+"{:.2f}".format(r[2])+"""</span>
</div>
<span class='comments'>"""+str(r[4])+"""</span>
</div>"""
c+=1
html+="""</body>"""
return html
# Function to get the feature words from text
def extract_features(document):
document_words = set(document)
features = {}
for word in document_words:
features[word] = (word in document_words)
return features
# Function to create dictionary of text
def make_full_dict(words):
return dict([(word, True) for word in words])
# Function to score words in text and make distributions
def create_word_scores():
posWords = []
negWords = []
with open(POS_DATA_FILE, 'r') as posSentences:
for i in posSentences:
posWord = re.findall(r"[\w']+|[.,!?;]", i.rstrip())
posWords.append(posWord)
with open(NEG_DATA_FILE, 'r') as negSentences:
for i in negSentences:
negWord = re.findall(r"[\w']+|[.,!?;]", i.rstrip())
negWords.append(negWord)
posWords = list(itertools.chain(*posWords))
negWords = list(itertools.chain(*negWords))
# Build frequency distibution of all words and then frequency distributions of words within positive and negative labels
word_fd = FreqDist()
cond_word_fd = ConditionalFreqDist()
for word in posWords:
word_fd.inc(word.lower())
cond_word_fd['pos'].inc(word.lower())
for word in negWords:
word_fd.inc(word.lower())
cond_word_fd['neg'].inc(word.lower())
# Create counts of positive, negative, and total words
pos_word_count = cond_word_fd['pos'].N()
neg_word_count = cond_word_fd['neg'].N()
total_word_count = pos_word_count + neg_word_count
# Builds dictionary of word scores based on chi-squared test
word_scores = {}
for word, freq in word_fd.iteritems():
pos_score = BigramAssocMeasures.chi_sq(cond_word_fd['pos'][word], (freq, pos_word_count), total_word_count)
neg_score = BigramAssocMeasures.chi_sq(cond_word_fd['neg'][word], (freq, neg_word_count), total_word_count)
word_scores[word] = pos_score + neg_score
return word_scores
if len(sys.argv) < 2:
print "No file specificed\n"
else:
input_filename = sys.argv[1]
print "Initialized "+project_slug+" with min of "+str(min_comments)+" - processing file "+input_filename
print "Loading training data..."
DATA_DIRECTORY = os.path.join('training-data', 'twitter_data')
POS_DATA_FILE = os.path.join(DATA_DIRECTORY, 'positive_tweets.txt')
NEG_DATA_FILE = os.path.join(DATA_DIRECTORY, 'negative_tweets.txt')
# DATA_DIRECTORY = os.path.join('training-data', 'combined')
# POS_DATA_FILE = os.path.join(DATA_DIRECTORY, 'positive.txt')
# NEG_DATA_FILE = os.path.join(DATA_DIRECTORY, 'negative.txt')
print "Training NLTK Bayesian classifier..."
posFeatures = []
negFeatures = []
# Process text into words with pos/neg connotation
with open(POS_DATA_FILE, 'r') as posSentences:
for i in posSentences:
posWords = re.findall(r"[\w']+|[.,!?;]", i.rstrip())
posWords = [make_full_dict(posWords), 'pos']
posFeatures.append(posWords)
with open(NEG_DATA_FILE, 'r') as negSentences:
for i in negSentences:
negWords = re.findall(r"[\w']+|[.,!?;]", i.rstrip())
negWords = [make_full_dict(negWords), 'neg']
negFeatures.append(negWords)
# Selects 5/6 of the features to be used for training and 1/6 to be used for testing
posCutoff = int(math.floor(len(posFeatures)*5/6))
negCutoff = int(math.floor(len(negFeatures)*5/6))
trainFeatures = posFeatures[:posCutoff] + negFeatures[:negCutoff]
testFeatures = posFeatures[posCutoff:] + negFeatures[negCutoff:]
# Train a Naive Bayes Classifier
classifier = NaiveBayesClassifier.train(trainFeatures)
# Create reference and test set
referenceSets = collections.defaultdict(set)
testSets = collections.defaultdict(set)
# Puts correctly labeled sentences in referenceSets and the predictively labeled version in testSets
for i, (features, label) in enumerate(testFeatures):
referenceSets[label].add(i)
predicted = classifier.classify(features)
testSets[predicted].add(i)
print "Esimated accuracy: ", nltk.classify.util.accuracy(classifier, testFeatures)
print "Talk data loaded from file"
print "Performing sentiment analysis..."
df = pd.read_csv(input_filename, skipinitialspace=True, sep='\t')
g = df.groupby('focus_id')
flist = g['body'].apply(list)
focus_list = []
for k,v in flist.iteritems():
if (isinstance(v, list)):
if (len(v)>min_comments):
string = ' '.join([str(i) for i in v])
# print string
ob = (classifier.classify(extract_features(string.split())), classifier.prob_classify(extract_features(string.split())).prob('pos'), classifier.prob_classify(extract_features(string.split())).prob('neg'), k, len(v), extract_features(string.split()))
focus_list.insert(0, ob)
# Create lists
sorted_list = sorted(focus_list, key=lambda x: (-x[1], x[4]))
sorted_list_rev = list(sorted_list)
sorted_list_rev.reverse()
# Filter lists
pos_list = filter(lambda x: x[0] == 'pos', sorted_list_rev)
neg_list = filter(lambda x: x[0] == 'neg', sorted_list)
n = int(len(sorted_list)*1.00)
print "%i positive and %i negative items" % (len(pos_list), len(neg_list))
# Output files as CSV and HTML
print "Writing CSV..."
filename = os.path.join('output', project_slug, project_slug+'_'+str(min_comments)+'.csv')
with open(filename, "wb") as f:
writer = csv.writer(f)
writer.writerows(sorted_list)
print "Writing HTML files..."
html = focus_list_to_html_table(pos_list)
filename = os.path.join('output', project_slug, project_slug+'_'+str(min_comments)+'_positive.html')
with open(filename, "w") as text_file:
text_file.write(html)
call(["open", filename])
html = focus_list_to_html_table(neg_list)
filename = os.path.join('output', project_slug, project_slug+'_'+str(min_comments)+'_negative.html')
with open(filename, "w") as text_file:
text_file.write(html)
call(["open", filename])
print "Done!"
|
mit
|
zorroblue/scikit-learn
|
sklearn/kernel_approximation.py
|
29
|
19022
|
"""
The :mod:`sklearn.kernel_approximation` module implements several
approximate kernel feature maps base on Fourier transforms.
"""
# Author: Andreas Mueller <[email protected]>
#
# License: BSD 3 clause
import warnings
import numpy as np
import scipy.sparse as sp
from scipy.linalg import svd
from .base import BaseEstimator
from .base import TransformerMixin
from .utils import check_array, check_random_state, as_float_array
from .utils.extmath import safe_sparse_dot
from .utils.validation import check_is_fitted
from .metrics.pairwise import pairwise_kernels, KERNEL_PARAMS
class RBFSampler(BaseEstimator, TransformerMixin):
"""Approximates feature map of an RBF kernel by Monte Carlo approximation
of its Fourier transform.
It implements a variant of Random Kitchen Sinks.[1]
Read more in the :ref:`User Guide <rbf_kernel_approx>`.
Parameters
----------
gamma : float
Parameter of RBF kernel: exp(-gamma * x^2)
n_components : int
Number of Monte Carlo samples per original feature.
Equals the dimensionality of the computed feature space.
random_state : int, RandomState instance or None, optional (default=None)
If int, random_state is the seed used by the random number generator;
If RandomState instance, random_state is the random number generator;
If None, the random number generator is the RandomState instance used
by `np.random`.
Notes
-----
See "Random Features for Large-Scale Kernel Machines" by A. Rahimi and
Benjamin Recht.
[1] "Weighted Sums of Random Kitchen Sinks: Replacing
minimization with randomization in learning" by A. Rahimi and
Benjamin Recht.
(http://people.eecs.berkeley.edu/~brecht/papers/08.rah.rec.nips.pdf)
"""
def __init__(self, gamma=1., n_components=100, random_state=None):
self.gamma = gamma
self.n_components = n_components
self.random_state = random_state
def fit(self, X, y=None):
"""Fit the model with X.
Samples random projection according to n_features.
Parameters
----------
X : {array-like, sparse matrix}, shape (n_samples, n_features)
Training data, where n_samples in the number of samples
and n_features is the number of features.
Returns
-------
self : object
Returns the transformer.
"""
X = check_array(X, accept_sparse='csr')
random_state = check_random_state(self.random_state)
n_features = X.shape[1]
self.random_weights_ = (np.sqrt(2 * self.gamma) * random_state.normal(
size=(n_features, self.n_components)))
self.random_offset_ = random_state.uniform(0, 2 * np.pi,
size=self.n_components)
return self
def transform(self, X):
"""Apply the approximate feature map to X.
Parameters
----------
X : {array-like, sparse matrix}, shape (n_samples, n_features)
New data, where n_samples in the number of samples
and n_features is the number of features.
Returns
-------
X_new : array-like, shape (n_samples, n_components)
"""
check_is_fitted(self, 'random_weights_')
X = check_array(X, accept_sparse='csr')
projection = safe_sparse_dot(X, self.random_weights_)
projection += self.random_offset_
np.cos(projection, projection)
projection *= np.sqrt(2.) / np.sqrt(self.n_components)
return projection
class SkewedChi2Sampler(BaseEstimator, TransformerMixin):
"""Approximates feature map of the "skewed chi-squared" kernel by Monte
Carlo approximation of its Fourier transform.
Read more in the :ref:`User Guide <skewed_chi_kernel_approx>`.
Parameters
----------
skewedness : float
"skewedness" parameter of the kernel. Needs to be cross-validated.
n_components : int
number of Monte Carlo samples per original feature.
Equals the dimensionality of the computed feature space.
random_state : int, RandomState instance or None, optional (default=None)
If int, random_state is the seed used by the random number generator;
If RandomState instance, random_state is the random number generator;
If None, the random number generator is the RandomState instance used
by `np.random`.
References
----------
See "Random Fourier Approximations for Skewed Multiplicative Histogram
Kernels" by Fuxin Li, Catalin Ionescu and Cristian Sminchisescu.
See also
--------
AdditiveChi2Sampler : A different approach for approximating an additive
variant of the chi squared kernel.
sklearn.metrics.pairwise.chi2_kernel : The exact chi squared kernel.
"""
def __init__(self, skewedness=1., n_components=100, random_state=None):
self.skewedness = skewedness
self.n_components = n_components
self.random_state = random_state
def fit(self, X, y=None):
"""Fit the model with X.
Samples random projection according to n_features.
Parameters
----------
X : array-like, shape (n_samples, n_features)
Training data, where n_samples in the number of samples
and n_features is the number of features.
Returns
-------
self : object
Returns the transformer.
"""
X = check_array(X)
random_state = check_random_state(self.random_state)
n_features = X.shape[1]
uniform = random_state.uniform(size=(n_features, self.n_components))
# transform by inverse CDF of sech
self.random_weights_ = (1. / np.pi
* np.log(np.tan(np.pi / 2. * uniform)))
self.random_offset_ = random_state.uniform(0, 2 * np.pi,
size=self.n_components)
return self
def transform(self, X):
"""Apply the approximate feature map to X.
Parameters
----------
X : array-like, shape (n_samples, n_features)
New data, where n_samples in the number of samples
and n_features is the number of features. All values of X must be
strictly greater than "-skewedness".
Returns
-------
X_new : array-like, shape (n_samples, n_components)
"""
check_is_fitted(self, 'random_weights_')
X = as_float_array(X, copy=True)
X = check_array(X, copy=False)
if (X <= -self.skewedness).any():
raise ValueError("X may not contain entries smaller than"
" -skewedness.")
X += self.skewedness
np.log(X, X)
projection = safe_sparse_dot(X, self.random_weights_)
projection += self.random_offset_
np.cos(projection, projection)
projection *= np.sqrt(2.) / np.sqrt(self.n_components)
return projection
class AdditiveChi2Sampler(BaseEstimator, TransformerMixin):
"""Approximate feature map for additive chi2 kernel.
Uses sampling the fourier transform of the kernel characteristic
at regular intervals.
Since the kernel that is to be approximated is additive, the components of
the input vectors can be treated separately. Each entry in the original
space is transformed into 2*sample_steps+1 features, where sample_steps is
a parameter of the method. Typical values of sample_steps include 1, 2 and
3.
Optimal choices for the sampling interval for certain data ranges can be
computed (see the reference). The default values should be reasonable.
Read more in the :ref:`User Guide <additive_chi_kernel_approx>`.
Parameters
----------
sample_steps : int, optional
Gives the number of (complex) sampling points.
sample_interval : float, optional
Sampling interval. Must be specified when sample_steps not in {1,2,3}.
Notes
-----
This estimator approximates a slightly different version of the additive
chi squared kernel then ``metric.additive_chi2`` computes.
See also
--------
SkewedChi2Sampler : A Fourier-approximation to a non-additive variant of
the chi squared kernel.
sklearn.metrics.pairwise.chi2_kernel : The exact chi squared kernel.
sklearn.metrics.pairwise.additive_chi2_kernel : The exact additive chi
squared kernel.
References
----------
See `"Efficient additive kernels via explicit feature maps"
<http://www.robots.ox.ac.uk/~vedaldi/assets/pubs/vedaldi11efficient.pdf>`_
A. Vedaldi and A. Zisserman, Pattern Analysis and Machine Intelligence,
2011
"""
def __init__(self, sample_steps=2, sample_interval=None):
self.sample_steps = sample_steps
self.sample_interval = sample_interval
def fit(self, X, y=None):
"""Set parameters."""
X = check_array(X, accept_sparse='csr')
if self.sample_interval is None:
# See reference, figure 2 c)
if self.sample_steps == 1:
self.sample_interval_ = 0.8
elif self.sample_steps == 2:
self.sample_interval_ = 0.5
elif self.sample_steps == 3:
self.sample_interval_ = 0.4
else:
raise ValueError("If sample_steps is not in [1, 2, 3],"
" you need to provide sample_interval")
else:
self.sample_interval_ = self.sample_interval
return self
def transform(self, X):
"""Apply approximate feature map to X.
Parameters
----------
X : {array-like, sparse matrix}, shape = (n_samples, n_features)
Returns
-------
X_new : {array, sparse matrix}, \
shape = (n_samples, n_features * (2*sample_steps + 1))
Whether the return value is an array of sparse matrix depends on
the type of the input X.
"""
msg = ("%(name)s is not fitted. Call fit to set the parameters before"
" calling transform")
check_is_fitted(self, "sample_interval_", msg=msg)
X = check_array(X, accept_sparse='csr')
sparse = sp.issparse(X)
# check if X has negative values. Doesn't play well with np.log.
if ((X.data if sparse else X) < 0).any():
raise ValueError("Entries of X must be non-negative.")
# zeroth component
# 1/cosh = sech
# cosh(0) = 1.0
transf = self._transform_sparse if sparse else self._transform_dense
return transf(X)
def _transform_dense(self, X):
non_zero = (X != 0.0)
X_nz = X[non_zero]
X_step = np.zeros_like(X)
X_step[non_zero] = np.sqrt(X_nz * self.sample_interval_)
X_new = [X_step]
log_step_nz = self.sample_interval_ * np.log(X_nz)
step_nz = 2 * X_nz * self.sample_interval_
for j in range(1, self.sample_steps):
factor_nz = np.sqrt(step_nz /
np.cosh(np.pi * j * self.sample_interval_))
X_step = np.zeros_like(X)
X_step[non_zero] = factor_nz * np.cos(j * log_step_nz)
X_new.append(X_step)
X_step = np.zeros_like(X)
X_step[non_zero] = factor_nz * np.sin(j * log_step_nz)
X_new.append(X_step)
return np.hstack(X_new)
def _transform_sparse(self, X):
indices = X.indices.copy()
indptr = X.indptr.copy()
data_step = np.sqrt(X.data * self.sample_interval_)
X_step = sp.csr_matrix((data_step, indices, indptr),
shape=X.shape, dtype=X.dtype, copy=False)
X_new = [X_step]
log_step_nz = self.sample_interval_ * np.log(X.data)
step_nz = 2 * X.data * self.sample_interval_
for j in range(1, self.sample_steps):
factor_nz = np.sqrt(step_nz /
np.cosh(np.pi * j * self.sample_interval_))
data_step = factor_nz * np.cos(j * log_step_nz)
X_step = sp.csr_matrix((data_step, indices, indptr),
shape=X.shape, dtype=X.dtype, copy=False)
X_new.append(X_step)
data_step = factor_nz * np.sin(j * log_step_nz)
X_step = sp.csr_matrix((data_step, indices, indptr),
shape=X.shape, dtype=X.dtype, copy=False)
X_new.append(X_step)
return sp.hstack(X_new)
class Nystroem(BaseEstimator, TransformerMixin):
"""Approximate a kernel map using a subset of the training data.
Constructs an approximate feature map for an arbitrary kernel
using a subset of the data as basis.
Read more in the :ref:`User Guide <nystroem_kernel_approx>`.
Parameters
----------
kernel : string or callable, default="rbf"
Kernel map to be approximated. A callable should accept two arguments
and the keyword arguments passed to this object as kernel_params, and
should return a floating point number.
n_components : int
Number of features to construct.
How many data points will be used to construct the mapping.
gamma : float, default=None
Gamma parameter for the RBF, laplacian, polynomial, exponential chi2
and sigmoid kernels. Interpretation of the default value is left to
the kernel; see the documentation for sklearn.metrics.pairwise.
Ignored by other kernels.
degree : float, default=None
Degree of the polynomial kernel. Ignored by other kernels.
coef0 : float, default=None
Zero coefficient for polynomial and sigmoid kernels.
Ignored by other kernels.
kernel_params : mapping of string to any, optional
Additional parameters (keyword arguments) for kernel function passed
as callable object.
random_state : int, RandomState instance or None, optional (default=None)
If int, random_state is the seed used by the random number generator;
If RandomState instance, random_state is the random number generator;
If None, the random number generator is the RandomState instance used
by `np.random`.
Attributes
----------
components_ : array, shape (n_components, n_features)
Subset of training points used to construct the feature map.
component_indices_ : array, shape (n_components)
Indices of ``components_`` in the training set.
normalization_ : array, shape (n_components, n_components)
Normalization matrix needed for embedding.
Square root of the kernel matrix on ``components_``.
References
----------
* Williams, C.K.I. and Seeger, M.
"Using the Nystroem method to speed up kernel machines",
Advances in neural information processing systems 2001
* T. Yang, Y. Li, M. Mahdavi, R. Jin and Z. Zhou
"Nystroem Method vs Random Fourier Features: A Theoretical and Empirical
Comparison",
Advances in Neural Information Processing Systems 2012
See also
--------
RBFSampler : An approximation to the RBF kernel using random Fourier
features.
sklearn.metrics.pairwise.kernel_metrics : List of built-in kernels.
"""
def __init__(self, kernel="rbf", gamma=None, coef0=None, degree=None,
kernel_params=None, n_components=100, random_state=None):
self.kernel = kernel
self.gamma = gamma
self.coef0 = coef0
self.degree = degree
self.kernel_params = kernel_params
self.n_components = n_components
self.random_state = random_state
def fit(self, X, y=None):
"""Fit estimator to data.
Samples a subset of training points, computes kernel
on these and computes normalization matrix.
Parameters
----------
X : array-like, shape=(n_samples, n_feature)
Training data.
"""
X = check_array(X, accept_sparse='csr')
rnd = check_random_state(self.random_state)
n_samples = X.shape[0]
# get basis vectors
if self.n_components > n_samples:
# XXX should we just bail?
n_components = n_samples
warnings.warn("n_components > n_samples. This is not possible.\n"
"n_components was set to n_samples, which results"
" in inefficient evaluation of the full kernel.")
else:
n_components = self.n_components
n_components = min(n_samples, n_components)
inds = rnd.permutation(n_samples)
basis_inds = inds[:n_components]
basis = X[basis_inds]
basis_kernel = pairwise_kernels(basis, metric=self.kernel,
filter_params=True,
**self._get_kernel_params())
# sqrt of kernel matrix on basis vectors
U, S, V = svd(basis_kernel)
S = np.maximum(S, 1e-12)
self.normalization_ = np.dot(U / np.sqrt(S), V)
self.components_ = basis
self.component_indices_ = inds
return self
def transform(self, X):
"""Apply feature map to X.
Computes an approximate feature map using the kernel
between some training points and X.
Parameters
----------
X : array-like, shape=(n_samples, n_features)
Data to transform.
Returns
-------
X_transformed : array, shape=(n_samples, n_components)
Transformed data.
"""
check_is_fitted(self, 'components_')
X = check_array(X, accept_sparse='csr')
kernel_params = self._get_kernel_params()
embedded = pairwise_kernels(X, self.components_,
metric=self.kernel,
filter_params=True,
**kernel_params)
return np.dot(embedded, self.normalization_.T)
def _get_kernel_params(self):
params = self.kernel_params
if params is None:
params = {}
if not callable(self.kernel):
for param in (KERNEL_PARAMS[self.kernel]):
if getattr(self, param) is not None:
params[param] = getattr(self, param)
else:
if (self.gamma is not None or
self.coef0 is not None or
self.degree is not None):
warnings.warn(
"Passing gamma, coef0 or degree to Nystroem when using a"
" callable kernel is deprecated in version 0.19 and will"
" raise an error in 0.21, as they are ignored. Use "
"kernel_params instead.", DeprecationWarning)
return params
|
bsd-3-clause
|
NelisVerhoef/scikit-learn
|
examples/linear_model/plot_bayesian_ridge.py
|
248
|
2588
|
"""
=========================
Bayesian Ridge Regression
=========================
Computes a Bayesian Ridge Regression on a synthetic dataset.
See :ref:`bayesian_ridge_regression` for more information on the regressor.
Compared to the OLS (ordinary least squares) estimator, the coefficient
weights are slightly shifted toward zeros, which stabilises them.
As the prior on the weights is a Gaussian prior, the histogram of the
estimated weights is Gaussian.
The estimation of the model is done by iteratively maximizing the
marginal log-likelihood of the observations.
"""
print(__doc__)
import numpy as np
import matplotlib.pyplot as plt
from scipy import stats
from sklearn.linear_model import BayesianRidge, LinearRegression
###############################################################################
# Generating simulated data with Gaussian weigthts
np.random.seed(0)
n_samples, n_features = 100, 100
X = np.random.randn(n_samples, n_features) # Create Gaussian data
# Create weigts with a precision lambda_ of 4.
lambda_ = 4.
w = np.zeros(n_features)
# Only keep 10 weights of interest
relevant_features = np.random.randint(0, n_features, 10)
for i in relevant_features:
w[i] = stats.norm.rvs(loc=0, scale=1. / np.sqrt(lambda_))
# Create noise with a precision alpha of 50.
alpha_ = 50.
noise = stats.norm.rvs(loc=0, scale=1. / np.sqrt(alpha_), size=n_samples)
# Create the target
y = np.dot(X, w) + noise
###############################################################################
# Fit the Bayesian Ridge Regression and an OLS for comparison
clf = BayesianRidge(compute_score=True)
clf.fit(X, y)
ols = LinearRegression()
ols.fit(X, y)
###############################################################################
# Plot true weights, estimated weights and histogram of the weights
plt.figure(figsize=(6, 5))
plt.title("Weights of the model")
plt.plot(clf.coef_, 'b-', label="Bayesian Ridge estimate")
plt.plot(w, 'g-', label="Ground truth")
plt.plot(ols.coef_, 'r--', label="OLS estimate")
plt.xlabel("Features")
plt.ylabel("Values of the weights")
plt.legend(loc="best", prop=dict(size=12))
plt.figure(figsize=(6, 5))
plt.title("Histogram of the weights")
plt.hist(clf.coef_, bins=n_features, log=True)
plt.plot(clf.coef_[relevant_features], 5 * np.ones(len(relevant_features)),
'ro', label="Relevant features")
plt.ylabel("Features")
plt.xlabel("Values of the weights")
plt.legend(loc="lower left")
plt.figure(figsize=(6, 5))
plt.title("Marginal log-likelihood")
plt.plot(clf.scores_)
plt.ylabel("Score")
plt.xlabel("Iterations")
plt.show()
|
bsd-3-clause
|
QuLogic/burnman
|
misc/paper_incorrect_averaging.py
|
1
|
8987
|
# BurnMan - a lower mantle toolkit
# Copyright (C) 2012, 2013, Heister, T., Unterborn, C., Rose, I. and Cottaar, S.
# Released under GPL v2 or later.
"""
paper_incorrect_averaging
-------------------------
This script reproduces :cite:`Cottaar2014`, Figure 5.
Attempt to reproduce Figure 6.12 from :cite:`Murakami2013`
"""
import os, sys, numpy as np, matplotlib.pyplot as plt
#hack to allow scripts to be placed in subdirectories next to burnman:
if not os.path.exists('burnman') and os.path.exists('../burnman'):
sys.path.insert(1,os.path.abspath('..'))
import burnman
from burnman import minerals
from burnman.mineral_helpers import HelperSolidSolution
import matplotlib.image as mpimg
import colors
if __name__ == "__main__":
plt.figure(dpi=100,figsize=(12,6))
prop={'size':12}
plt.rc('text', usetex=True)
plt.rcParams['text.latex.preamble'] = '\usepackage{relsize}'
dashstyle2=(7,3)
dashstyle3=(3,2)
method = 'slb2'
#define the minerals from table 6.3
mg_perovskite = burnman.Mineral()
mg_perovskite.params = {'name': 'Mg perovskite',
'molar_mass' : 0.1004,
'V_0': 24.43e-6,
'K_0': 253.0e9,
'Kprime_0': 3.9,
'G_0' : 172.9e9,
'Gprime_0' : 1.56,
'n': 5.0,
'Debye_0': 1100.,
'grueneisen_0': 1.40,
'q_0': 1.40,
'eta_s_0' : 2.6}
mg_perovskite.set_method('slb2')
fe_perovskite = burnman.Mineral()
fe_perovskite.params = {'name': 'Fe perovskite',
'molar_mass' : 0.1319,
'V_0': 25.49e-6,
'K_0': 281.0e9,
'Kprime_0': 4.1,
'G_0' : 138.0e9,
'Gprime_0' : 1.70,
'n': 5.0,
'Debye_0': 841.,
'grueneisen_0': 1.48,
'q_0': 1.40,
'eta_s_0' : 2.1}
fe_perovskite.set_method(method)
periclase = burnman.Mineral()
periclase.params = {'name': 'periclase',
'molar_mass' : 0.0403,
'V_0': 11.24e-6,
'K_0': 161.0e9,
'Kprime_0': 3.9,
'G_0' : 130.9e9,
'Gprime_0' : 1.92,
'n': 2.0,
'Debye_0': 773.,
'grueneisen_0': 1.50,
'q_0': 1.50,
'eta_s_0' : 2.3}
periclase.set_method(method)
wustite = burnman.Mineral()
wustite.params = {'name': 'wustite',
'molar_mass' : 0.07184,
'V_0': 12.06e-6,
'K_0': 152.0e9,
'Kprime_0': 4.9,
'G_0' : 47.0e9,
'Gprime_0' : 0.70,
'n': 2.0,
'Debye_0': 455.,
'grueneisen_0': 1.28,
'q_0': 1.50,
'eta_s_0' : 0.8}
wustite.set_method(method)
#in the text for the book chapter a linear relationship in elastic properties
#for the solid solutions is assumed...
class ferropericlase(HelperSolidSolution):
def __init__(self, fe_num):
endmembers = [periclase, wustite]
molar_fractions = [1. - fe_num, 0.0 + fe_num]
HelperSolidSolution.__init__(self, endmembers, molar_fractions)
class perovskite(HelperSolidSolution):
def __init__(self, fe_num):
endmembers = [mg_perovskite, fe_perovskite]
molar_fractions = [1. - fe_num, 0.0 + fe_num]
HelperSolidSolution.__init__(self, endmembers, molar_fractions)
#define the P-T path
pressure = np.linspace(28.0e9, 129e9, 25.)
temperature_bs = burnman.geotherm.brown_shankland(pressure)
temperature_an = burnman.geotherm.anderson(pressure)
#seismic model for comparison:
seismic_model = burnman.seismic.PREM() # pick from .prem() .slow() .fast() (see burnman/seismic.py)
depths = map(seismic_model.depth, pressure)
seis_p, seis_rho, seis_vp, seis_vs, seis_vphi = seismic_model.evaluate_all_at(depths)
#pure perovskite
perovskitite = burnman.Composite( ( (perovskite(0.06), 1.0),) )
perovskitite.set_method(method)
#pure periclase
periclasite = burnman.Composite( ( (ferropericlase(0.21), 1.0),))
periclasite.set_method(method)
#pyrolite (80% perovskite)
pyrolite = burnman.Composite( ( (perovskite(0.06), 0.834),
(ferropericlase(0.21), 0.166) ) )
pyrolite.set_method(method)
#preferred mixture?
amount_perovskite = 0.92
preferred_mixture = burnman.Composite( ( (perovskite(0.06), amount_perovskite),
(ferropericlase(0.21), 1.0-amount_perovskite) ) )
preferred_mixture.set_method(method)
mat_rho_1, mat_vp_1, mat_vs_1, mat_vphi_1, mat_K_1, mat_G_1 = burnman.velocities_from_rock(perovskitite,seis_p, temperature_bs)
mat_rho_2, mat_vp_2, mat_vs_2, mat_vphi_2, mat_K_2, mat_G_2 = burnman.velocities_from_rock(periclasite,seis_p, temperature_bs)
mat_rho_3, mat_vp_3, mat_vs_3, mat_vphi_3, mat_K_3, mat_G_3 = burnman.velocities_from_rock(pyrolite,seis_p, temperature_bs)
mat_rho_4, mat_vp_4, mat_vs_4, mat_vphi_4, mat_K_4, mat_G_4 = burnman.velocities_from_rock(preferred_mixture,seis_p, temperature_bs)
### HERE IS THE STEP WITH THE INCORRECT MIXING ###
# comment this out to have correct phase averaging, leave it in to have incorrect phase averaging
mat_vs_3_wr = 0.5*((0.834*mat_vs_1 + 0.166*mat_vs_2) + np.ones_like(mat_vs_1)/(0.834/mat_vs_1 + 0.166/mat_vs_2))
mat_vs_4_wr = 0.5*((0.92*mat_vs_1 + 0.08*mat_vs_2) + np.ones_like(mat_vs_1)/(0.92/mat_vs_1 + 0.08/mat_vs_2))
plt.subplot(1,2,2)
plt.ylim(5.2,7.4)
plt.xlim(25,135)
#fig1 = mpimg.imread('input_figures/murakami_book_chapter.png')
#plt.imshow(fig1, extent=[25,135,5.0,7.6], aspect='auto')
plt.plot(seis_p/1.e9,seis_vs/1.e3,color='k',linestyle='-',marker='None',markerfacecolor='w',markersize=4,label='PREM',linewidth=3.0,mew=1.5)
plt.plot(seis_p/1.e9,mat_vs_1/1.e3,color=colors.color(3),marker='v',markerfacecolor=colors.color(3), \
markersize=4, markeredgecolor=colors.color(3),markevery=2,linewidth=1.5,label='perovskite')
plt.plot(seis_p/1.e9,mat_vs_2/1.e3,color=colors.color(1),linestyle='-', \
linewidth=1.5,marker='^',markerfacecolor=colors.color(1), markersize=4, \
markeredgecolor=colors.color(1),markevery=2,label='periclase')
plt.plot(seis_p/1.e9,mat_vs_4_wr/1.e3,color=colors.color(4),dashes=dashstyle3, \
linewidth=1.5,marker='o',markerfacecolor=colors.color(4), markersize=4, \
markeredgecolor=colors.color(4),markevery=2,label='92\% pv')
plt.plot(seis_p/1.e9,mat_vs_3_wr/1.e3,color='g',linestyle='-',dashes=dashstyle2, \
linewidth=1.5,marker='o',markerfacecolor='w', markersize=4, markeredgecolor='g',markevery=2,label='83\% pv')
plt.legend(loc='lower right',prop={'size':12})
plt.title("Phase average on velocities")
plt.xlabel("Pressure (GPa)")
plt.subplot(1,2,1)
plt.ylim(5.2,7.4)
plt.xlim(25,135)
#fig1 = mpimg.imread('input_figures/murakami_book_chapter.png')
#plt.imshow(fig1, extent=[25,135,5.0,7.6], aspect='auto')
plt.plot(seis_p/1.e9,seis_vs/1.e3,color='k',linestyle='-',marker='None',markerfacecolor='w',markersize=4,label='PREM',linewidth=3.0,mew=1.5)
plt.plot(seis_p/1.e9,mat_vs_1/1.e3,color=colors.color(3),marker='v',markerfacecolor=colors.color(3), \
markersize=4, markeredgecolor=colors.color(3),markevery=2,linewidth=1.5,label='perovskite')
plt.plot(seis_p/1.e9,mat_vs_2/1.e3,color=colors.color(1),linestyle='-', \
linewidth=1.5,marker='^',markerfacecolor=colors.color(1), markersize=4, \
markeredgecolor=colors.color(1),markevery=2,label='periclase')
plt.plot(seis_p/1.e9,mat_vs_4/1.e3,color=colors.color(4),dashes=dashstyle3, \
linewidth=1.5,marker='o',markerfacecolor=colors.color(4), markersize=4, \
markeredgecolor=colors.color(4),markevery=2,label='92\% pv')
plt.plot(seis_p/1.e9,mat_vs_3/1.e3,color='g',linestyle='-',dashes=dashstyle2, \
linewidth=1.5,marker='o',markerfacecolor='w', markersize=4, markeredgecolor='g',markevery=2, label='83\% pv')
plt.title(" V.-R.-H. on moduli")
plt.xlabel("Pressure (GPa)")
plt.ylabel("Shear Velocity Vs (km/s)")
plt.tight_layout()
plt.savefig("example_incorrect_averaging.pdf",bbox_inches='tight')
plt.show()
|
gpl-2.0
|
DailyActie/Surrogate-Model
|
01-codes/scikit-learn-master/sklearn/linear_model/tests/test_ransac.py
|
1
|
17468
|
import numpy as np
from numpy.testing import assert_array_almost_equal
from numpy.testing import assert_array_equal
from numpy.testing import assert_equal, assert_raises
from scipy import sparse
from sklearn.linear_model import LinearRegression, RANSACRegressor, Lasso
from sklearn.linear_model.ransac import _dynamic_max_trials
from sklearn.utils import check_random_state
from sklearn.utils.testing import assert_almost_equal
from sklearn.utils.testing import assert_less
from sklearn.utils.testing import assert_raises_regexp
from sklearn.utils.testing import assert_warns
# Generate coordinates of line
X = np.arange(-200, 200)
y = 0.2 * X + 20
data = np.column_stack([X, y])
# Add some faulty data
outliers = np.array((10, 30, 200))
data[outliers[0], :] = (1000, 1000)
data[outliers[1], :] = (-1000, -1000)
data[outliers[2], :] = (-100, -50)
X = data[:, 0][:, np.newaxis]
y = data[:, 1]
def test_ransac_inliers_outliers():
base_estimator = LinearRegression()
ransac_estimator = RANSACRegressor(base_estimator, min_samples=2,
residual_threshold=5, random_state=0)
# Estimate parameters of corrupted data
ransac_estimator.fit(X, y)
# Ground truth / reference inlier mask
ref_inlier_mask = np.ones_like(ransac_estimator.inlier_mask_
).astype(np.bool_)
ref_inlier_mask[outliers] = False
assert_equal(ransac_estimator.inlier_mask_, ref_inlier_mask)
def test_ransac_is_data_valid():
def is_data_valid(X, y):
assert_equal(X.shape[0], 2)
assert_equal(y.shape[0], 2)
return False
X = np.random.rand(10, 2)
y = np.random.rand(10, 1)
base_estimator = LinearRegression()
ransac_estimator = RANSACRegressor(base_estimator, min_samples=2,
residual_threshold=5,
is_data_valid=is_data_valid,
random_state=0)
assert_raises(ValueError, ransac_estimator.fit, X, y)
def test_ransac_is_model_valid():
def is_model_valid(estimator, X, y):
assert_equal(X.shape[0], 2)
assert_equal(y.shape[0], 2)
return False
base_estimator = LinearRegression()
ransac_estimator = RANSACRegressor(base_estimator, min_samples=2,
residual_threshold=5,
is_model_valid=is_model_valid,
random_state=0)
assert_raises(ValueError, ransac_estimator.fit, X, y)
def test_ransac_max_trials():
base_estimator = LinearRegression()
ransac_estimator = RANSACRegressor(base_estimator, min_samples=2,
residual_threshold=5, max_trials=0,
random_state=0)
assert_raises(ValueError, ransac_estimator.fit, X, y)
ransac_estimator = RANSACRegressor(base_estimator, min_samples=2,
residual_threshold=5, max_trials=11,
random_state=0)
assert getattr(ransac_estimator, 'n_trials_', None) is None
ransac_estimator.fit(X, y)
assert_equal(ransac_estimator.n_trials_, 2)
def test_ransac_stop_n_inliers():
base_estimator = LinearRegression()
ransac_estimator = RANSACRegressor(base_estimator, min_samples=2,
residual_threshold=5, stop_n_inliers=2,
random_state=0)
ransac_estimator.fit(X, y)
assert_equal(ransac_estimator.n_trials_, 1)
def test_ransac_stop_score():
base_estimator = LinearRegression()
ransac_estimator = RANSACRegressor(base_estimator, min_samples=2,
residual_threshold=5, stop_score=0,
random_state=0)
ransac_estimator.fit(X, y)
assert_equal(ransac_estimator.n_trials_, 1)
def test_ransac_score():
X = np.arange(100)[:, None]
y = np.zeros((100,))
y[0] = 1
y[1] = 100
base_estimator = LinearRegression()
ransac_estimator = RANSACRegressor(base_estimator, min_samples=2,
residual_threshold=0.5, random_state=0)
ransac_estimator.fit(X, y)
assert_equal(ransac_estimator.score(X[2:], y[2:]), 1)
assert_less(ransac_estimator.score(X[:2], y[:2]), 1)
def test_ransac_predict():
X = np.arange(100)[:, None]
y = np.zeros((100,))
y[0] = 1
y[1] = 100
base_estimator = LinearRegression()
ransac_estimator = RANSACRegressor(base_estimator, min_samples=2,
residual_threshold=0.5, random_state=0)
ransac_estimator.fit(X, y)
assert_equal(ransac_estimator.predict(X), np.zeros(100))
def test_ransac_resid_thresh_no_inliers():
# When residual_threshold=0.0 there are no inliers and a
# ValueError with a message should be raised
base_estimator = LinearRegression()
ransac_estimator = RANSACRegressor(base_estimator, min_samples=2,
residual_threshold=0.0, random_state=0)
assert_raises_regexp(ValueError,
"No inliers.*residual_threshold.*0\.0",
ransac_estimator.fit, X, y)
def test_ransac_sparse_coo():
X_sparse = sparse.coo_matrix(X)
base_estimator = LinearRegression()
ransac_estimator = RANSACRegressor(base_estimator, min_samples=2,
residual_threshold=5, random_state=0)
ransac_estimator.fit(X_sparse, y)
ref_inlier_mask = np.ones_like(ransac_estimator.inlier_mask_
).astype(np.bool_)
ref_inlier_mask[outliers] = False
assert_equal(ransac_estimator.inlier_mask_, ref_inlier_mask)
def test_ransac_sparse_csr():
X_sparse = sparse.csr_matrix(X)
base_estimator = LinearRegression()
ransac_estimator = RANSACRegressor(base_estimator, min_samples=2,
residual_threshold=5, random_state=0)
ransac_estimator.fit(X_sparse, y)
ref_inlier_mask = np.ones_like(ransac_estimator.inlier_mask_
).astype(np.bool_)
ref_inlier_mask[outliers] = False
assert_equal(ransac_estimator.inlier_mask_, ref_inlier_mask)
def test_ransac_sparse_csc():
X_sparse = sparse.csc_matrix(X)
base_estimator = LinearRegression()
ransac_estimator = RANSACRegressor(base_estimator, min_samples=2,
residual_threshold=5, random_state=0)
ransac_estimator.fit(X_sparse, y)
ref_inlier_mask = np.ones_like(ransac_estimator.inlier_mask_
).astype(np.bool_)
ref_inlier_mask[outliers] = False
assert_equal(ransac_estimator.inlier_mask_, ref_inlier_mask)
def test_ransac_none_estimator():
base_estimator = LinearRegression()
ransac_estimator = RANSACRegressor(base_estimator, min_samples=2,
residual_threshold=5, random_state=0)
ransac_none_estimator = RANSACRegressor(None, 2, 5, random_state=0)
ransac_estimator.fit(X, y)
ransac_none_estimator.fit(X, y)
assert_array_almost_equal(ransac_estimator.predict(X),
ransac_none_estimator.predict(X))
def test_ransac_min_n_samples():
base_estimator = LinearRegression()
ransac_estimator1 = RANSACRegressor(base_estimator, min_samples=2,
residual_threshold=5, random_state=0)
ransac_estimator2 = RANSACRegressor(base_estimator,
min_samples=2. / X.shape[0],
residual_threshold=5, random_state=0)
ransac_estimator3 = RANSACRegressor(base_estimator, min_samples=-1,
residual_threshold=5, random_state=0)
ransac_estimator4 = RANSACRegressor(base_estimator, min_samples=5.2,
residual_threshold=5, random_state=0)
ransac_estimator5 = RANSACRegressor(base_estimator, min_samples=2.0,
residual_threshold=5, random_state=0)
ransac_estimator6 = RANSACRegressor(base_estimator,
residual_threshold=5, random_state=0)
ransac_estimator7 = RANSACRegressor(base_estimator,
min_samples=X.shape[0] + 1,
residual_threshold=5, random_state=0)
ransac_estimator1.fit(X, y)
ransac_estimator2.fit(X, y)
ransac_estimator5.fit(X, y)
ransac_estimator6.fit(X, y)
assert_array_almost_equal(ransac_estimator1.predict(X),
ransac_estimator2.predict(X))
assert_array_almost_equal(ransac_estimator1.predict(X),
ransac_estimator5.predict(X))
assert_array_almost_equal(ransac_estimator1.predict(X),
ransac_estimator6.predict(X))
assert_raises(ValueError, ransac_estimator3.fit, X, y)
assert_raises(ValueError, ransac_estimator4.fit, X, y)
assert_raises(ValueError, ransac_estimator7.fit, X, y)
def test_ransac_multi_dimensional_targets():
base_estimator = LinearRegression()
ransac_estimator = RANSACRegressor(base_estimator, min_samples=2,
residual_threshold=5, random_state=0)
# 3-D target values
yyy = np.column_stack([y, y, y])
# Estimate parameters of corrupted data
ransac_estimator.fit(X, yyy)
# Ground truth / reference inlier mask
ref_inlier_mask = np.ones_like(ransac_estimator.inlier_mask_
).astype(np.bool_)
ref_inlier_mask[outliers] = False
assert_equal(ransac_estimator.inlier_mask_, ref_inlier_mask)
# XXX: Remove in 0.20
def test_ransac_residual_metric():
residual_metric1 = lambda dy: np.sum(np.abs(dy), axis=1)
residual_metric2 = lambda dy: np.sum(dy ** 2, axis=1)
yyy = np.column_stack([y, y, y])
base_estimator = LinearRegression()
ransac_estimator0 = RANSACRegressor(base_estimator, min_samples=2,
residual_threshold=5, random_state=0)
ransac_estimator1 = RANSACRegressor(base_estimator, min_samples=2,
residual_threshold=5, random_state=0,
residual_metric=residual_metric1)
ransac_estimator2 = RANSACRegressor(base_estimator, min_samples=2,
residual_threshold=5, random_state=0,
residual_metric=residual_metric2)
# multi-dimensional
ransac_estimator0.fit(X, yyy)
assert_warns(DeprecationWarning, ransac_estimator1.fit, X, yyy)
assert_warns(DeprecationWarning, ransac_estimator2.fit, X, yyy)
assert_array_almost_equal(ransac_estimator0.predict(X),
ransac_estimator1.predict(X))
assert_array_almost_equal(ransac_estimator0.predict(X),
ransac_estimator2.predict(X))
# one-dimensional
ransac_estimator0.fit(X, y)
assert_warns(DeprecationWarning, ransac_estimator2.fit, X, y)
assert_array_almost_equal(ransac_estimator0.predict(X),
ransac_estimator2.predict(X))
def test_ransac_residual_loss():
loss_multi1 = lambda y_true, y_pred: np.sum(np.abs(y_true - y_pred), axis=1)
loss_multi2 = lambda y_true, y_pred: np.sum((y_true - y_pred) ** 2, axis=1)
loss_mono = lambda y_true, y_pred: np.abs(y_true - y_pred)
yyy = np.column_stack([y, y, y])
base_estimator = LinearRegression()
ransac_estimator0 = RANSACRegressor(base_estimator, min_samples=2,
residual_threshold=5, random_state=0)
ransac_estimator1 = RANSACRegressor(base_estimator, min_samples=2,
residual_threshold=5, random_state=0,
loss=loss_multi1)
ransac_estimator2 = RANSACRegressor(base_estimator, min_samples=2,
residual_threshold=5, random_state=0,
loss=loss_multi2)
# multi-dimensional
ransac_estimator0.fit(X, yyy)
ransac_estimator1.fit(X, yyy)
ransac_estimator2.fit(X, yyy)
assert_array_almost_equal(ransac_estimator0.predict(X),
ransac_estimator1.predict(X))
assert_array_almost_equal(ransac_estimator0.predict(X),
ransac_estimator2.predict(X))
# one-dimensional
ransac_estimator0.fit(X, y)
ransac_estimator2.loss = loss_mono
ransac_estimator2.fit(X, y)
assert_array_almost_equal(ransac_estimator0.predict(X),
ransac_estimator2.predict(X))
ransac_estimator3 = RANSACRegressor(base_estimator, min_samples=2,
residual_threshold=5, random_state=0,
loss="squared_loss")
ransac_estimator3.fit(X, y)
assert_array_almost_equal(ransac_estimator0.predict(X),
ransac_estimator2.predict(X))
def test_ransac_default_residual_threshold():
base_estimator = LinearRegression()
ransac_estimator = RANSACRegressor(base_estimator, min_samples=2,
random_state=0)
# Estimate parameters of corrupted data
ransac_estimator.fit(X, y)
# Ground truth / reference inlier mask
ref_inlier_mask = np.ones_like(ransac_estimator.inlier_mask_
).astype(np.bool_)
ref_inlier_mask[outliers] = False
assert_equal(ransac_estimator.inlier_mask_, ref_inlier_mask)
def test_ransac_dynamic_max_trials():
# Numbers hand-calculated and confirmed on page 119 (Table 4.3) in
# Hartley, R.~I. and Zisserman, A., 2004,
# Multiple View Geometry in Computer Vision, Second Edition,
# Cambridge University Press, ISBN: 0521540518
# e = 0%, min_samples = X
assert_equal(_dynamic_max_trials(100, 100, 2, 0.99), 1)
# e = 5%, min_samples = 2
assert_equal(_dynamic_max_trials(95, 100, 2, 0.99), 2)
# e = 10%, min_samples = 2
assert_equal(_dynamic_max_trials(90, 100, 2, 0.99), 3)
# e = 30%, min_samples = 2
assert_equal(_dynamic_max_trials(70, 100, 2, 0.99), 7)
# e = 50%, min_samples = 2
assert_equal(_dynamic_max_trials(50, 100, 2, 0.99), 17)
# e = 5%, min_samples = 8
assert_equal(_dynamic_max_trials(95, 100, 8, 0.99), 5)
# e = 10%, min_samples = 8
assert_equal(_dynamic_max_trials(90, 100, 8, 0.99), 9)
# e = 30%, min_samples = 8
assert_equal(_dynamic_max_trials(70, 100, 8, 0.99), 78)
# e = 50%, min_samples = 8
assert_equal(_dynamic_max_trials(50, 100, 8, 0.99), 1177)
# e = 0%, min_samples = 10
assert_equal(_dynamic_max_trials(1, 100, 10, 0), 0)
assert_equal(_dynamic_max_trials(1, 100, 10, 1), float('inf'))
base_estimator = LinearRegression()
ransac_estimator = RANSACRegressor(base_estimator, min_samples=2,
stop_probability=-0.1)
assert_raises(ValueError, ransac_estimator.fit, X, y)
ransac_estimator = RANSACRegressor(base_estimator, min_samples=2,
stop_probability=1.1)
assert_raises(ValueError, ransac_estimator.fit, X, y)
def test_ransac_fit_sample_weight():
ransac_estimator = RANSACRegressor(random_state=0)
n_samples = y.shape[0]
weights = np.ones(n_samples)
ransac_estimator.fit(X, y, weights)
# sanity check
assert_equal(ransac_estimator.inlier_mask_.shape[0], n_samples)
ref_inlier_mask = np.ones_like(ransac_estimator.inlier_mask_
).astype(np.bool_)
ref_inlier_mask[outliers] = False
# check that mask is correct
assert_array_equal(ransac_estimator.inlier_mask_, ref_inlier_mask)
# check that fit(X) = fit([X1, X2, X3],sample_weight = [n1, n2, n3]) where
# X = X1 repeated n1 times, X2 repeated n2 times and so forth
random_state = check_random_state(0)
X_ = random_state.randint(0, 200, [10, 1])
y_ = np.ndarray.flatten(0.2 * X_ + 2)
sample_weight = random_state.randint(0, 10, 10)
outlier_X = random_state.randint(0, 1000, [1, 1])
outlier_weight = random_state.randint(0, 10, 1)
outlier_y = random_state.randint(-1000, 0, 1)
X_flat = np.append(np.repeat(X_, sample_weight, axis=0),
np.repeat(outlier_X, outlier_weight, axis=0), axis=0)
y_flat = np.ndarray.flatten(np.append(np.repeat(y_, sample_weight, axis=0),
np.repeat(outlier_y, outlier_weight, axis=0),
axis=0))
ransac_estimator.fit(X_flat, y_flat)
ref_coef_ = ransac_estimator.estimator_.coef_
sample_weight = np.append(sample_weight, outlier_weight)
X_ = np.append(X_, outlier_X, axis=0)
y_ = np.append(y_, outlier_y)
ransac_estimator.fit(X_, y_, sample_weight)
assert_almost_equal(ransac_estimator.estimator_.coef_, ref_coef_)
# check that if base_estimator.fit doesn't support
# sample_weight, raises error
base_estimator = Lasso()
ransac_estimator = RANSACRegressor(base_estimator)
assert_raises(ValueError, ransac_estimator.fit, X, y, weights)
|
mit
|
jwdebelius/break_4w
|
break4w/data_dictionary.py
|
1
|
22592
|
"""
I need really good documentation for this module that I haven't begun to
write yet. This will be really important?
"""
from collections import OrderedDict
import datetime
import pydoc
import numpy as np
import pandas as pd
from pandas.api.types import CategoricalDtype
from break4w.question import Question
from break4w.categorical import Categorical
from break4w.bool import Bool
from break4w.continous import Continous
import break4w._defaults as b4wdefaults
type_lookup = {'continous': Continous,
'categorical': Categorical,
'multiple choice': Categorical,
'ordinal': Categorical,
'bool': Bool,
'boolean': Bool,
'yes/no': Bool,
}
class DataDictionary(OrderedDict):
"""
Generates a data dictionary object
Parameters
----------
columns: list of dicts
A list of dictionaries representing each column in the metadata.
The dictionaries must contain a `name` key, describing the column
name. The values in the dictionary should the variables needed
for each type of question object in a data dictionary.
types: list of strings
A description of the type of question being asked. These come
from a relatively controlled vocabulary and include types such as
`"continous", "categorical", "bool"`. If the question type does
not conform to the controlled vocabulary, the column will be
read as a Question object with limited functionality.
description: str
A description of the data dictionary or study of no more than
80 characters.
"""
default_cols = ['name', 'description', 'type', 'dtype', 'order',
'units', 'ambigious', 'missing', 'notes']
def __init__(self, columns, types, description=None):
"""Initializes the dictionary object
This is a very basic prototype of the data dictionary object
"""
self.log = []
if description is None:
self.description = ''
elif len(description) > 80:
raise ValueError('The dictionary description cannot be more than '
'80 characters')
else:
self.description = description
# Adds the question objects to the dictionary
for col_, type_ in zip(*(columns, types)):
self.add_question(question_data=col_,
question_type=type_,
record=False,
check=False)
self.columns = list(self.keys())
def __str__(self):
"""
Generates printed summary
"""
summary = ['Data Dictionary with %i columns' % len(self)]
if len(self.description) > 0:
summary.append('\t%s' % self.description)
summary.append('-----------------------------------------------------'
'-------------------------------')
for col in self.values():
summary.append('%s (%s)\n\t%s' % (col.name, col.type, col.description))
summary.append('-----------------------------------------------------'
'-------------------------------')
return '\n'.join(summary)
def _update_log(self, command, column=None,
transform_type=None, transformation=None):
"""Used for internal tracking of the columns and data
Every time a Question acts on data, a record should be made of
the transformation. (See break4w.question.Question._update_log).
However, this also tracks the transformation on the dictionary
level.
Parameters
----------
command : str
A short textual description of the command performed. This
may be the function name in text format.
column : str, optional
The column in the metadata being explored.
transform_type: str, optional
A more general description of the type of action that was
performed. Ideally, this comes for a preset list of possible
actions, and the descriptions are consistent.
transformation: str, optional
Explains exactly how values were changed.
"""
self.log.append({
'timestamp': datetime.datetime.now(),
'column': column,
'command': command,
'transform_type': transform_type,
'transformation': transformation,
})
def _pull_question_log(self, column=None):
"""Adds information from the specified column to the log."""
raise NotImplementedError
def add_question(self, question_data, question_type='',
check=True, record=True, var_delim=' | ', code_delim='=',
null_value='None'):
"""
Adds a new question object to the data dictionary
Parameters
----------
question_data: Dict, Question
Describes the data dictionary entry for the question. This can
be a break4w question object created directly, or a dictionary
objecting with information like the name in the metadata
representation, data type, a description, and specific information
for the type of question. For instance, `question_type` specified
the qustion was `"continous"`, the `question_data` must also
describe units for the question.
question_type: str, optional
Describes the type of question object that should be selected
for the question. If `question_data` is a `Question` object, then
no `question_type` is needed.
check: bool, optional
Checks whether a name already exists in the question name space.
If this is true, then the function will check if the column
already exists in the dictionary. If the column does exist and
check is true, an error will be raised. If check is not true, the
data dictionary entry for the column will be overwritten and any
information in that column will be lost.
record, bool, optional
Indicates where the addition should be logged.
read_numeric_codes: bool, optional
Whether columns should be read with a numerical delimiter (i.e
"=") to parse a numeric value into a categorical one. For example,
if numeric is true, then "0=female | 1=male" would be parsed that
any data encoded as 0 maps to female, any data encoded as 1 maps
to male, and the order of hte values is `[0, 1]` (corresponding to
`['female', 'male']`). Otherwise, the line would be read
literally, and the order is read as `["0=female", "1=male"]`.
val_delim: str, optional
The seperator between values in the "order" column.
code_delim: str, optional
The delimiter between a numericly coded categorical variable and
the value it maps to.
Raises
------
ValueError
When the function is checking for the column and the column name
is already in the dictionary. If this is the case, the dictionary
entry should be adjusted using `update_question`, not
`add_question`, since this function will otherwise over write the
existing column.
"""
error1 = False
# Converts to a Question object
question_object = type_lookup.get(question_type.lower(), Question)
if isinstance(question_data, pd.Series):
question_data.dropna(inplace=True)
question_data = question_object._read_series(
question_data, var_delim=var_delim,
code_delim=code_delim, null_value=null_value,
)
elif isinstance(question_data, dict):
question_data = question_object(**question_data)
elif isinstance(question_data, Question):
pass
else:
message = ('question_data must be a Question, dict, or'
' Series')
if record:
self._update_log('add column',
column=None,
transformation=message,
transform_type='error')
raise ValueError(message)
name = question_data.name
# Checks if the question is in the dictionary
if (name in self.keys()) and check:
error1 = True
message = '%s already has a dictionary entry' % name
transform_type = 'error'
else:
message = '%s was added to the dictionary' % name
transform_type = None
# Updates the log
if record:
self._update_log('add column',
column=name,
transformation=message,
transform_type=transform_type)
# Raises an error or updates the dictionary, as appropriate
if error1:
raise ValueError(message)
else:
self[name] = question_data
self.columns = list(self.keys())
def get_question(self, name):
"""
Returns the data dictionary column
Parameters
----------
name: str
The name of the dictionary column to be returned
Returns
-------
Question
The question object for the appropriate dictionary
object
Raises
------
ValueError
When the column being asked for does not exist.
"""
if name not in self.keys():
message = 'There is no entry for %s' % name
self._update_log(column=name,
command='get question',
transform_type='error',
transformation=message)
raise ValueError(message)
self._update_log(column=name, command='get question')
return self[name]
def drop_question(self, name):
"""
Removes a dictionary entry for the specified column.
Parameters
----------
name: str
The name of the dictionary column to be returned
"""
if name in self.keys():
del self[name]
self.columns = list(self.keys())
self._update_log(command='remove question', column=name)
def update_question(self, update, name=None):
"""
Updates dictionary entry for the data
Parameters
----------
update: Dict, Question
Describes the data dictionary entry for the question. This can
be a break4w question object created directly, or a dictionary
objecting with information like the name in the metadata
representation, data type, a description, and specific information
for the type of question. For instance, `question_type` specified
the qustion was `"continous"`, the `question_data` must also
describe units for the question.
name: str, optional
The name of the dictionary column to be returned. If `update` is
a Question object, this can be infered from the question.
"""
# Gets the dictionary of the new column and column name
if isinstance(update, Question):
update = vars(update)
if name is None:
name = update['name']
# Checks if the data is already in the dictionary
if name not in self.keys():
message = ('%s is not a question in the current dictionary.\n'
'Have you tried adding the question?') % name
self._update_log(command='update question',
column=name,
transform_type='error',
transformation=message)
raise ValueError(message)
current = vars(self[name])
diff = {k: v for k, v in update.items()
if (((k not in current) or (v != current[k])) and
(k not in {'log'}))
}
change_keys = {}
for k, v in diff.items():
if k in current:
change_keys[k] = (current[k], v)
else:
change_keys[k] = ('add', v)
setattr(self[name], k, v)
if 'log' in update:
self[name].log.extend(update['log'])
self._update_log(
command='update question',
column=name,
transform_type='update dictionary values',
transformation=' | '.join(['%s : %s > %s' % (k, v[0], v[1])
for k, v in change_keys.items()]))
def validate(self, map_, check_order=True):
"""
Checks columns appear in the mapping file in the appropriate order
and conform to the standards set in the data dictionary.
Parameters
----------
map_ : DataFrame
A pandas object containing the metadata being analyzed.
check_order: bool, optional
Do the order of columns in the data dictionary and metadata have
to match?
"""
pass_ = True
failures = []
fail_message = []
self._validate_question_order(map_, check_order)
for name, question in self.items():
if question.type == 'Question':
continue
try:
question.validate(map_)
except:
pass_ = False
failures.append(
'\t%s - %s' % (name, question.log[-1]['transformation'])
)
self.log.append(question.log[-1])
if pass_:
self._update_log('validate', transform_type='pass',
transformation='All columns passed')
else:
message = ('There were issues with the following columns:\n%s'
% '\n'.join(failures))
message_l = (('There were issues with the following columns:\n%s'
'\nPlease See the log for more details.')
% '\n'.join([fail.split(' - ')[0].replace('\t', '')
for fail in failures]))
self._update_log('validate', transform_type='error',
transformation=message_l)
raise ValueError(message)
def _validate_question_order(self, map_, check_order=True, record=True,
verbose=False):
"""
Checks all the required questions are present in the mapping file
and that they are in the correct order.
Parameters
----------
map_ : DataFrame
A pandas object containing the metadata being analyzed.
check_order: bool, optional
Do the order of columns in the data dictionary and metadata have
to match?
record: bool, optional
Indicates where the addition should be logged.
verbose: bool, optional
Provides more detailed information about the error
Raises
------
ValueError
"""
pass_ = True
message = ('The columns in the mapping file match the columns in '
'the data dictionary.')
map_columns = list(map_.columns)
dict_columns = list(self.keys())
if not set(map_columns) == set(dict_columns):
pass_ = False
in_map = list(set(map_columns) - set(dict_columns))
in_dict = list(set(dict_columns) - set(map_columns))
text = ('There are %i columns in the data dictionary '
'not in the mapping file, and %i from the mapping'
' file not in the data dictionary.'
% (len(in_dict), len(in_map)))
if len(in_dict) > 0:
not_map = ('In the dictionary but not in the map: \n\t%s\n'
% '; '.join(in_dict))
else:
not_map = ''
if len(in_map) > 0:
t_ = '\nIn the map but not in the dictionary:\n\t%s\n'
not_dict = t_ % '; '.join(in_map)
else:
not_dict = ''
if verbose:
message = '%s%s%s' % (text, not_map, not_dict)
# message = not_dict
else:
message = text
elif not (map_columns == dict_columns) and check_order:
pass_ = False
message = ('The columns in the dictionary and map are not in'
' the same order.')
if record and pass_:
self._update_log(command='validate', transform_type='pass',
transformation=message)
elif record and not pass_:
self._update_log(command='validate', transform_type='fail',
transformation=message)
raise ValueError(message)
elif not pass_:
raise ValueError(message)
def to_dataframe(self, clean=False, val_delim=' | ', code_delim='='):
u"""Converts data dictionary to a pandas dataframe
Parameters
----------
clean: bool, optional
Returns a subset of columns for the data dictionary. When True,
the data dicitonary will return the following columns:
* `name` -- the name of the column
* `description` -- the 80 character description
* `type` -- the type of question (Continous, Question,
Categorical, or Boolean)
* `dtype` -- the datatype for the pandas column.
* `order` -- the order of data for categorical objects or
range of values for continous values
* `units` -- units for continous values
* `ambigious` -- values for ambigious results
* `missing` -- values for missing values
* `notes` -- any notes passed into the data dictionary
object to be retained
val_delim: str, optional
The seperator between values in the "order" column.
code_delim: str, optional
The delimiter between a numericly coded categorical variable and
the value it maps to.
Returns
-------
DataFrame
A dataframe mapping the variable name to its description, question
type, datatype, and order.
Example
-------
"""
cols = []
for col in self.values():
ser_ = col._to_series()
# if isinstance(col, Continous):
ser_.rename({'limits': 'order'}, inplace=True)
cols.append(ser_)
df_ = pd.concat(axis=1, sort=False, objs=cols).T
if ('var_labels' in df_.columns):
df_.loc[df_['var_labels'].notna(), 'order'] = \
df_.loc[df_['var_labels'].notna(), 'var_labels']
df_.drop(columns=['var_labels'], inplace=True)
if clean:
cols = [c for c in self.default_cols if c in df_]
df_ = df_[cols]
df_.drop(columns=df_.columns[df_.isna().all(axis=0)],
inplace=True)
return df_.set_index('name')
def to_pandas_stata(self):
"""
Generates strings and dictionary compatible with writing to stata
Returns
-------
str
A stata-compatible dataset description for `pandas.write_stata`
dictionary
A stata-compatible description for each variable, compatible with
`pandas.write_stata`.
"""
variable_desc = {k: v.description for k,v in self.items()}
return self.description, variable_desc
def to_ddi_xml(self):
pass
@classmethod
def read_dataframe(cls, df_, description=None, var_delim=' | ',
code_delim='=', null_value='None'):
"""Builds the data dictionary from a dataframe
Parameters
----------
df_ : DataFrame
A pandas dataframe version of the data dictionary where the data
is indexed by `name`
description: str
A description of the data dictionary or study of no more than
80 characters.
read_codes: bool, optional
Whether columns should be read with a numerical delimiter (i.e
"=") to parse a numeric value into a categorical one. For example,
if numeric is true, then "0=female | 1=male" would be parsed that
any data encoded as 0 maps to female, any data encoded as 1 maps
to male, and the order of hte values is `[0, 1]` (corresponding to
`['female', 'male']`). Otherwise, the line would be read
literally, and the order is read as `["0=female", "1=male"]`.
val_delim: str, optional
The seperator between values in the "order" column.
code_delim: str, optional
The delimiter between a numericly coded categorical variable and
the value it maps to.
Returns
-------
DataDictionary
A data dictionary object with the newly described study.
Examples
--------
"""
types = []
cols = []
if 'name' not in df_.columns:
df_.reset_index(inplace=True)
for name_, var_ in df_.iterrows():
# Describes the question type
type_ = var_['type']
qclass = type_lookup.get(type_.lower(), Question)
var_.drop('type', inplace=True)
# Updates the column and type objects
types.append(type_)
cols.append(qclass._read_series(var_.dropna(),
var_delim=var_delim,
code_delim=code_delim,
null_value=null_value))
return cls(columns=cols, types=types, description=description)
# @classmethod
def to_usgs_xml(self):
"""Converts the data dictionary to a usgs xlm format"""
pass
@classmethod
def read_stata(cls, iter_, ):
pass
|
bsd-2-clause
|
kewitz/mestrado
|
Eletromagnetismo Computacional II/MOM.carganofio.py
|
1
|
1063
|
# -*- coding: utf-8 -*-
"""
Created on Fri Aug 1 15:09:54 2014
@author: leo
"""
import numpy as np
import matplotlib.pyplot as plt
from mpl_toolkits.mplot3d import axes3d
# Defs
irange = lambda a: zip(range(len(a)),a)
pi = np.pi
# Parâmetros
L = np.float64(1.0) # Comprimento do fio em m.
a = np.float64(1E-3) # Raio do condutor.
Delta = np.float64(.01) # Delta.
V0 = np.float64(1.0)
Eps = np.float64(8.854E-12)
# Funções
l = lambda m, n: Delta/np.abs(y[m-1]-y[n-1]) if m != n else 2*np.log(Delta/a)
g = lambda m: 4*pi*Eps*V0
# Domínios e constantes
y = np.arange(0,L,Delta, dtype=np.float64)
ns = y.size
ms = ns
L = np.matrix(np.zeros((ms,ns)))
G = np.matrix(np.zeros((ns)))
# Processamento
for i in range(ms):
m = np.float64(i+1.0)
G[0,i] = g(m) # Monta o vetor de tensões
for j in range(ns):
n = np.float64(j+1.0)
L[i,j] = l(m,n) # Monta a matriz de ?
rho = np.linalg.solve(L,G.T) # Obtem o vetor 5de Permeabilidades
Q = rho.sum() * Delta
print "Carga total no condutor %.3eC" % Q
# Plots
plt.plot(y,rho)
|
mit
|
astroML/astroML
|
astroML/plotting/regression.py
|
2
|
3574
|
import numpy as np
import matplotlib.pyplot as plt
from scipy import optimize
from astroML.linear_model import TLS_logL, LinearRegression
# TLS:
def get_m_b(beta):
b = np.dot(beta, beta) / beta[1]
m = -beta[0] / beta[1]
return m, b
def plot_regressions(ksi, eta, x, y, sigma_x, sigma_y, add_regression_lines=False,
alpha_in=1, beta_in=0.5, basis='linear'):
figure = plt.figure(figsize=(8, 6))
ax = figure.add_subplot(111)
ax.scatter(x, y, alpha=0.5)
ax.errorbar(x, y, xerr=sigma_x, yerr=sigma_y, alpha=0.3, ls='')
ax.set_xlabel('x')
ax.set_ylabel('y')
x0 = np.linspace(np.min(x) - 0.5, np.max(x) + 0.5, 20)
# True regression line
if alpha_in is not None and beta_in is not None:
if basis == 'linear':
y0 = alpha_in + x0 * beta_in
elif basis == 'poly':
y0 = alpha_in + beta_in[0] * x0 + beta_in[1] * x0 * x0 + beta_in[2] * x0 * x0 * x0
ax.plot(x0, y0, color='black', label='True regression')
else:
y0 = None
if add_regression_lines:
for label, data, *target in [['fit no errors', x, y, 1],
['fit y errors only', x, y, sigma_y],
['fit x errors only', y, x, sigma_x]]:
linreg = LinearRegression()
linreg.fit(data[:, None], *target)
if label == 'fit x errors only' and y0 is not None:
x_fit = linreg.predict(y0[:, None])
ax.plot(x_fit, y0, label=label)
else:
y_fit = linreg.predict(x0[:, None])
ax.plot(x0, y_fit, label=label)
# TLS
X = np.vstack((x, y)).T
dX = np.zeros((len(x), 2, 2))
dX[:, 0, 0] = sigma_x
dX[:, 1, 1] = sigma_y
def min_func(beta): return -TLS_logL(beta, X, dX)
beta_fit = optimize.fmin(min_func, x0=[-1, 1])
m_fit, b_fit = get_m_b(beta_fit)
x_fit = np.linspace(-10, 10, 20)
ax.plot(x_fit, m_fit * x_fit + b_fit, label='TLS')
ax.set_xlim(np.min(x)-0.5, np.max(x)+0.5)
ax.set_ylim(np.min(y)-0.5, np.max(y)+0.5)
ax.legend()
def plot_regression_from_trace(fitted, observed, ax=None, chains=None, multidim_ind=None):
traces = [fitted.trace, ]
xi, yi, sigx, sigy = observed
if multidim_ind is not None:
xi = xi[multidim_ind]
x = np.linspace(np.min(xi)-0.5, np.max(xi)+0.5, 50)
for i, trace in enumerate(traces):
if 'theta' in trace.varnames and 'slope' not in trace.varnames:
trace.add_values({'slope': np.tan(trace['theta'])})
if multidim_ind is not None:
trace_slope = trace['slope'][:, multidim_ind]
else:
trace_slope = trace['slope'][:, 0]
if chains is not None:
for chain in range(100, len(trace) * trace.nchains, chains):
y = trace['inter'][chain] + trace_slope[chain] * x
ax.plot(x, y, alpha=0.03, c='red')
# plot the best-fit line only
H2D, bins1, bins2 = np.histogram2d(trace_slope,
trace['inter'], bins=50)
w = np.where(H2D == H2D.max())
# choose the maximum posterior slope and intercept
slope_best = bins1[w[0][0]]
intercept_best = bins2[w[1][0]]
print("beta:", slope_best, "alpha:", intercept_best)
y = intercept_best + slope_best * x
# y_pre = fitted.predict(x[:, None])
ax.plot(x, y, ':', label='fitted')
ax.legend()
break
|
bsd-2-clause
|
yuanagain/seniorthesis
|
venv/lib/python2.7/site-packages/matplotlib/tests/test_delaunay.py
|
7
|
7137
|
from __future__ import (absolute_import, division, print_function,
unicode_literals)
from matplotlib.externals import six
from matplotlib.externals.six.moves import xrange
import warnings
import numpy as np
from matplotlib.testing.decorators import image_comparison, knownfailureif
from matplotlib.cbook import MatplotlibDeprecationWarning
with warnings.catch_warnings():
# the module is deprecated. The tests should be removed when the module is.
warnings.simplefilter('ignore', MatplotlibDeprecationWarning)
from matplotlib.delaunay.triangulate import Triangulation
from matplotlib import pyplot as plt
import matplotlib as mpl
def constant(x, y):
return np.ones(x.shape, x.dtype)
constant.title = 'Constant'
def xramp(x, y):
return x
xramp.title = 'X Ramp'
def yramp(x, y):
return y
yramp.title = 'Y Ramp'
def exponential(x, y):
x = x*9
y = y*9
x1 = x+1.0
x2 = x-2.0
x4 = x-4.0
x7 = x-7.0
y1 = x+1.0
y2 = y-2.0
y3 = y-3.0
y7 = y-7.0
f = (0.75 * np.exp(-(x2*x2+y2*y2)/4.0) +
0.75 * np.exp(-x1*x1/49.0 - y1/10.0) +
0.5 * np.exp(-(x7*x7 + y3*y3)/4.0) -
0.2 * np.exp(-x4*x4 -y7*y7))
return f
exponential.title = 'Exponential and Some Gaussians'
def cliff(x, y):
f = np.tanh(9.0*(y-x) + 1.0)/9.0
return f
cliff.title = 'Cliff'
def saddle(x, y):
f = (1.25 + np.cos(5.4*y))/(6.0 + 6.0*(3*x-1.0)**2)
return f
saddle.title = 'Saddle'
def gentle(x, y):
f = np.exp(-5.0625*((x-0.5)**2+(y-0.5)**2))/3.0
return f
gentle.title = 'Gentle Peak'
def steep(x, y):
f = np.exp(-20.25*((x-0.5)**2+(y-0.5)**2))/3.0
return f
steep.title = 'Steep Peak'
def sphere(x, y):
circle = 64-81*((x-0.5)**2 + (y-0.5)**2)
f = np.where(circle >= 0, np.sqrt(np.clip(circle,0,100)) - 0.5, 0.0)
return f
sphere.title = 'Sphere'
def trig(x, y):
f = 2.0*np.cos(10.0*x)*np.sin(10.0*y) + np.sin(10.0*x*y)
return f
trig.title = 'Cosines and Sines'
def gauss(x, y):
x = 5.0-10.0*x
y = 5.0-10.0*y
g1 = np.exp(-x*x/2)
g2 = np.exp(-y*y/2)
f = g1 + 0.75*g2*(1 + g1)
return f
gauss.title = 'Gaussian Peak and Gaussian Ridges'
def cloverleaf(x, y):
ex = np.exp((10.0-20.0*x)/3.0)
ey = np.exp((10.0-20.0*y)/3.0)
logitx = 1.0/(1.0+ex)
logity = 1.0/(1.0+ey)
f = (((20.0/3.0)**3 * ex*ey)**2 * (logitx*logity)**5 *
(ex-2.0*logitx)*(ey-2.0*logity))
return f
cloverleaf.title = 'Cloverleaf'
def cosine_peak(x, y):
circle = np.hypot(80*x-40.0, 90*y-45.)
f = np.exp(-0.04*circle) * np.cos(0.15*circle)
return f
cosine_peak.title = 'Cosine Peak'
allfuncs = [exponential, cliff, saddle, gentle, steep, sphere, trig, gauss, cloverleaf, cosine_peak]
class LinearTester(object):
name = 'Linear'
def __init__(self, xrange=(0.0, 1.0), yrange=(0.0, 1.0), nrange=101, npoints=250):
self.xrange = xrange
self.yrange = yrange
self.nrange = nrange
self.npoints = npoints
rng = np.random.RandomState(1234567890)
self.x = rng.uniform(xrange[0], xrange[1], size=npoints)
self.y = rng.uniform(yrange[0], yrange[1], size=npoints)
self.tri = Triangulation(self.x, self.y)
def replace_data(self, dataset):
self.x = dataset.x
self.y = dataset.y
self.tri = Triangulation(self.x, self.y)
def interpolator(self, func):
z = func(self.x, self.y)
return self.tri.linear_extrapolator(z, bbox=self.xrange+self.yrange)
def plot(self, func, interp=True, plotter='imshow'):
if interp:
lpi = self.interpolator(func)
z = lpi[self.yrange[0]:self.yrange[1]:complex(0,self.nrange),
self.xrange[0]:self.xrange[1]:complex(0,self.nrange)]
else:
y, x = np.mgrid[self.yrange[0]:self.yrange[1]:complex(0,self.nrange),
self.xrange[0]:self.xrange[1]:complex(0,self.nrange)]
z = func(x, y)
z = np.where(np.isinf(z), 0.0, z)
extent = (self.xrange[0], self.xrange[1],
self.yrange[0], self.yrange[1])
fig = plt.figure()
plt.hot() # Some like it hot
if plotter == 'imshow':
plt.imshow(np.nan_to_num(z), interpolation='nearest', extent=extent, origin='lower')
elif plotter == 'contour':
Y, X = np.ogrid[self.yrange[0]:self.yrange[1]:complex(0,self.nrange),
self.xrange[0]:self.xrange[1]:complex(0,self.nrange)]
plt.contour(np.ravel(X), np.ravel(Y), z, 20)
x = self.x
y = self.y
lc = mpl.collections.LineCollection(np.array([((x[i], y[i]), (x[j], y[j]))
for i, j in self.tri.edge_db]), colors=[(0,0,0,0.2)])
ax = plt.gca()
ax.add_collection(lc)
if interp:
title = '%s Interpolant' % self.name
else:
title = 'Reference'
if hasattr(func, 'title'):
plt.title('%s: %s' % (func.title, title))
else:
plt.title(title)
class NNTester(LinearTester):
name = 'Natural Neighbors'
def interpolator(self, func):
z = func(self.x, self.y)
return self.tri.nn_extrapolator(z, bbox=self.xrange+self.yrange)
def make_all_2d_testfuncs(allfuncs=allfuncs):
def make_test(func):
filenames = [
'%s-%s' % (func.__name__, x) for x in
['ref-img', 'nn-img', 'lin-img', 'ref-con', 'nn-con', 'lin-con']]
# We only generate PNGs to save disk space -- we just assume
# that any backend differences are caught by other tests.
@image_comparison(filenames, extensions=['png'],
freetype_version=('2.4.5', '2.4.9'),
remove_text=True)
def reference_test():
nnt.plot(func, interp=False, plotter='imshow')
nnt.plot(func, interp=True, plotter='imshow')
lpt.plot(func, interp=True, plotter='imshow')
nnt.plot(func, interp=False, plotter='contour')
nnt.plot(func, interp=True, plotter='contour')
lpt.plot(func, interp=True, plotter='contour')
tester = reference_test
tester.__name__ = str('test_%s' % func.__name__)
return tester
nnt = NNTester(npoints=1000)
lpt = LinearTester(npoints=1000)
for func in allfuncs:
globals()['test_%s' % func.__name__] = make_test(func)
make_all_2d_testfuncs()
# 1d and 0d grid tests
ref_interpolator = Triangulation([0,10,10,0],
[0,0,10,10]).linear_interpolator([1,10,5,2.0])
def test_1d_grid():
res = ref_interpolator[3:6:2j,1:1:1j]
assert np.allclose(res, [[1.6],[1.9]], rtol=0)
def test_0d_grid():
res = ref_interpolator[3:3:1j,1:1:1j]
assert np.allclose(res, [[1.6]], rtol=0)
@image_comparison(baseline_images=['delaunay-1d-interp'], extensions=['png'])
def test_1d_plots():
x_range = slice(0.25,9.75,20j)
x = np.mgrid[x_range]
ax = plt.gca()
for y in xrange(2,10,2):
plt.plot(x, ref_interpolator[x_range,y:y:1j])
ax.set_xticks([])
ax.set_yticks([])
|
mit
|
kobejean/tensorflow
|
tensorflow/examples/get_started/regression/test.py
|
41
|
4037
|
# Copyright 2016 The TensorFlow Authors. All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
# ==============================================================================
"""A simple smoke test that runs these examples for 1 training iteration."""
from __future__ import absolute_import
from __future__ import division
from __future__ import print_function
import sys
import pandas as pd
from six.moves import StringIO
import tensorflow.examples.get_started.regression.imports85 as imports85
sys.modules["imports85"] = imports85
# pylint: disable=g-bad-import-order,g-import-not-at-top
import tensorflow.contrib.data as data
import tensorflow.examples.get_started.regression.dnn_regression as dnn_regression
import tensorflow.examples.get_started.regression.linear_regression as linear_regression
import tensorflow.examples.get_started.regression.linear_regression_categorical as linear_regression_categorical
import tensorflow.examples.get_started.regression.custom_regression as custom_regression
from tensorflow.python.platform import googletest
from tensorflow.python.platform import test
# pylint: disable=g-bad-import-order,g-import-not-at-top
# pylint: disable=line-too-long
FOUR_LINES = "\n".join([
"1,?,alfa-romero,gas,std,two,hatchback,rwd,front,94.50,171.20,65.50,52.40,2823,ohcv,six,152,mpfi,2.68,3.47,9.00,154,5000,19,26,16500",
"2,164,audi,gas,std,four,sedan,fwd,front,99.80,176.60,66.20,54.30,2337,ohc,four,109,mpfi,3.19,3.40,10.00,102,5500,24,30,13950",
"2,164,audi,gas,std,four,sedan,4wd,front,99.40,176.60,66.40,54.30,2824,ohc,five,136,mpfi,3.19,3.40,8.00,115,5500,18,22,17450",
"2,?,audi,gas,std,two,sedan,fwd,front,99.80,177.30,66.30,53.10,2507,ohc,five,136,mpfi,3.19,3.40,8.50,110,5500,19,25,15250",])
# pylint: enable=line-too-long
def four_lines_dataframe():
text = StringIO(FOUR_LINES)
return pd.read_csv(text, names=imports85.types.keys(),
dtype=imports85.types, na_values="?")
def four_lines_dataset(*args, **kwargs):
del args, kwargs
return data.Dataset.from_tensor_slices(FOUR_LINES.split("\n"))
class RegressionTest(googletest.TestCase):
"""Test the regression examples in this directory."""
@test.mock.patch.dict(data.__dict__,
{"TextLineDataset": four_lines_dataset})
@test.mock.patch.dict(imports85.__dict__, {"_get_imports85": (lambda: None)})
@test.mock.patch.dict(linear_regression.__dict__, {"STEPS": 1})
def test_linear_regression(self):
linear_regression.main([""])
@test.mock.patch.dict(data.__dict__,
{"TextLineDataset": four_lines_dataset})
@test.mock.patch.dict(imports85.__dict__, {"_get_imports85": (lambda: None)})
@test.mock.patch.dict(linear_regression_categorical.__dict__, {"STEPS": 1})
def test_linear_regression_categorical(self):
linear_regression_categorical.main([""])
@test.mock.patch.dict(data.__dict__,
{"TextLineDataset": four_lines_dataset})
@test.mock.patch.dict(imports85.__dict__, {"_get_imports85": (lambda: None)})
@test.mock.patch.dict(dnn_regression.__dict__, {"STEPS": 1})
def test_dnn_regression(self):
dnn_regression.main([""])
@test.mock.patch.dict(data.__dict__, {"TextLineDataset": four_lines_dataset})
@test.mock.patch.dict(imports85.__dict__, {"_get_imports85": (lambda: None)})
@test.mock.patch.dict(custom_regression.__dict__, {"STEPS": 1})
def test_custom_regression(self):
custom_regression.main([""])
if __name__ == "__main__":
googletest.main()
|
apache-2.0
|
BhallaLab/moose-full
|
moose-examples/snippets/MULTI/midchan.py
|
2
|
13452
|
# midchan.py ---
# Upi Bhalla, NCBS Bangalore 2014.
#
# Commentary:
#
# This loads in a medium-detail model incorporating
# reac-diff and elec signaling in neurons. The reac-diff model
# has just Ca and CaM in it, and there are no-cross-compartment
# reactions though Ca diffuses everywhere. The elec model controls the
# Ca levels in the chem compartments.
#
# This program is free software; you can redistribute it and/or
# modify it under the terms of the GNU General Public License as
# published by the Free Software Foundation; either version 3, or
# (at your option) any later version.
#
# This program is distributed in the hope that it will be useful,
# but WITHOUT ANY WARRANTY; without even the implied warranty of
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
# General Public License for more details.
#
# You should have received a copy of the GNU General Public License
# along with this program; see the file COPYING. If not, write to
# the Free Software Foundation, Inc., 51 Franklin Street, Fifth
# Floor, Boston, MA 02110-1301, USA.
#
# Code:
import sys
sys.path.append('../../python')
import os
os.environ['NUMPTHREADS'] = '1'
import math
import numpy
import matplotlib.pyplot as plt
import moose
import proto18
EREST_ACT = -70e-3
def loadElec():
library = moose.Neutral( '/library' )
moose.setCwe( '/library' )
proto18.make_Ca()
proto18.make_Ca_conc()
proto18.make_K_AHP()
proto18.make_K_C()
proto18.make_Na()
proto18.make_K_DR()
proto18.make_K_A()
proto18.make_glu()
proto18.make_NMDA()
proto18.make_Ca_NMDA()
proto18.make_NMDA_Ca_conc()
proto18.make_axon()
moose.setCwe( '/library' )
model = moose.Neutral( '/model' )
cellId = moose.loadModel( 'ca1_asym.p', '/model/elec', "Neutral" )
return cellId
def loadChem( diffLength ):
chem = moose.Neutral( '/model/chem' )
neuroCompt = moose.NeuroMesh( '/model/chem/kinetics' )
neuroCompt.separateSpines = 1
neuroCompt.geometryPolicy = 'cylinder'
spineCompt = moose.SpineMesh( '/model/chem/compartment_1' )
moose.connect( neuroCompt, 'spineListOut', spineCompt, 'spineList', 'OneToOne' )
psdCompt = moose.PsdMesh( '/model/chem/compartment_2' )
#print 'Meshvolume[neuro, spine, psd] = ', neuroCompt.mesh[0].volume, spineCompt.mesh[0].volume, psdCompt.mesh[0].volume
moose.connect( neuroCompt, 'psdListOut', psdCompt, 'psdList', 'OneToOne' )
modelId = moose.loadModel( 'minimal.g', '/model/chem', 'ee' )
#modelId = moose.loadModel( 'psd_merged31d.g', '/model/chem', 'ee' )
neuroCompt.name = 'dend'
spineCompt.name = 'spine'
psdCompt.name = 'psd'
def makeNeuroMeshModel():
diffLength = 10e-6 # Aim for 2 soma compartments.
elec = loadElec()
loadChem( diffLength )
neuroCompt = moose.element( '/model/chem/dend' )
neuroCompt.diffLength = diffLength
neuroCompt.cellPortion( elec, '/model/elec/#' )
for x in moose.wildcardFind( '/model/chem/##[ISA=PoolBase]' ):
if (x.diffConst > 0):
x.diffConst = 1e-11
for x in moose.wildcardFind( '/model/chem/##/Ca' ):
x.diffConst = 1e-10
# Put in dend solvers
ns = neuroCompt.numSegments
ndc = neuroCompt.numDiffCompts
print 'ns = ', ns, ', ndc = ', ndc
assert( neuroCompt.numDiffCompts == neuroCompt.mesh.num )
assert( ns == 36 ) #
assert( ndc == 278 ) #
nmksolve = moose.Ksolve( '/model/chem/dend/ksolve' )
nmdsolve = moose.Dsolve( '/model/chem/dend/dsolve' )
nmstoich = moose.Stoich( '/model/chem/dend/stoich' )
nmstoich.compartment = neuroCompt
nmstoich.ksolve = nmksolve
nmstoich.dsolve = nmdsolve
nmstoich.path = "/model/chem/dend/##"
print 'done setting path, numPools = ', nmdsolve.numPools
assert( nmdsolve.numPools == 1 )
assert( nmdsolve.numAllVoxels == ndc )
assert( nmstoich.numAllPools == 1 )
# oddly, numLocalFields does not work.
ca = moose.element( '/model/chem/dend/DEND/Ca' )
assert( ca.numData == ndc )
# Put in spine solvers. Note that these get info from the neuroCompt
spineCompt = moose.element( '/model/chem/spine' )
sdc = spineCompt.mesh.num
print 'sdc = ', sdc
assert( sdc == 13 )
smksolve = moose.Ksolve( '/model/chem/spine/ksolve' )
smdsolve = moose.Dsolve( '/model/chem/spine/dsolve' )
smstoich = moose.Stoich( '/model/chem/spine/stoich' )
smstoich.compartment = spineCompt
smstoich.ksolve = smksolve
smstoich.dsolve = smdsolve
smstoich.path = "/model/chem/spine/##"
print 'spine num Pools = ', smstoich.numAllPools
assert( smstoich.numAllPools == 3 )
assert( smdsolve.numPools == 3 )
assert( smdsolve.numAllVoxels == sdc )
# Put in PSD solvers. Note that these get info from the neuroCompt
psdCompt = moose.element( '/model/chem/psd' )
pdc = psdCompt.mesh.num
assert( pdc == 13 )
pmksolve = moose.Ksolve( '/model/chem/psd/ksolve' )
pmdsolve = moose.Dsolve( '/model/chem/psd/dsolve' )
pmstoich = moose.Stoich( '/model/chem/psd/stoich' )
pmstoich.compartment = psdCompt
pmstoich.ksolve = pmksolve
pmstoich.dsolve = pmdsolve
pmstoich.path = "/model/chem/psd/##"
assert( pmstoich.numAllPools == 3 )
assert( pmdsolve.numPools == 3 )
assert( pmdsolve.numAllVoxels == pdc )
foo = moose.element( '/model/chem/psd/Ca' )
print 'PSD: numfoo = ', foo.numData
print 'PSD: numAllVoxels = ', pmksolve.numAllVoxels
# Put in junctions between the diffusion solvers
nmdsolve.buildNeuroMeshJunctions( smdsolve, pmdsolve )
"""
CaNpsd = moose.vec( '/model/chem/psdMesh/PSD/PP1_PSD/CaN' )
print 'numCaN in PSD = ', CaNpsd.nInit, ', vol = ', CaNpsd.volume
CaNspine = moose.vec( '/model/chem/spine/SPINE/CaN_BULK/CaN' )
print 'numCaN in spine = ', CaNspine.nInit, ', vol = ', CaNspine.volume
"""
##################################################################
# set up adaptors
aCa = moose.Adaptor( '/model/chem/spine/adaptCa', sdc )
adaptCa = moose.vec( '/model/chem/spine/adaptCa' )
chemCa = moose.vec( '/model/chem/spine/Ca' )
#print 'aCa = ', aCa, ' foo = ', foo, "len( ChemCa ) = ", len( chemCa ), ", numData = ", chemCa.numData, "len( adaptCa ) = ", len( adaptCa )
assert( len( adaptCa ) == sdc )
assert( len( chemCa ) == sdc )
for i in range( sdc ):
elecCa = moose.element( '/model/elec/spine_head_14_' + str(i+1) + '/NMDA_Ca_conc' )
#print elecCa
moose.connect( elecCa, 'concOut', adaptCa[i], 'input', 'Single' )
moose.connect( adaptCa, 'output', chemCa, 'setConc', 'OneToOne' )
adaptCa.inputOffset = 0.0 #
adaptCa.outputOffset = 0.00008 # 80 nM offset in chem.
adaptCa.scale = 1e-4 # 520 to 0.0052 mM
#print adaptCa.outputOffset
moose.le( '/model/chem/dend/DEND' )
compts = neuroCompt.elecComptList
begin = neuroCompt.startVoxelInCompt
end = neuroCompt.endVoxelInCompt
aCa = moose.Adaptor( '/model/chem/dend/DEND/adaptCa', len( compts))
adaptCa = moose.vec( '/model/chem/dend/DEND/adaptCa' )
chemCa = moose.vec( '/model/chem/dend/DEND/Ca' )
#print 'aCa = ', aCa, ' foo = ', foo, "len( ChemCa ) = ", len( chemCa ), ", numData = ", chemCa.numData, "len( adaptCa ) = ", len( adaptCa )
assert( len( chemCa ) == ndc )
for i in zip( compts, adaptCa, begin, end ):
name = i[0].path + '/Ca_conc'
if ( moose.exists( name ) ):
elecCa = moose.element( name )
#print i[2], i[3], ' ', elecCa
#print i[1]
moose.connect( elecCa, 'concOut', i[1], 'input', 'Single' )
for j in range( i[2], i[3] ):
moose.connect( i[1], 'output', chemCa[j], 'setConc', 'Single' )
adaptCa.inputOffset = 0.0 #
adaptCa.outputOffset = 0.00008 # 80 nM offset in chem.
adaptCa.scale = 20e-6 # 10 arb units to 2 uM.
def addPlot( objpath, field, plot ):
#assert moose.exists( objpath )
if moose.exists( objpath ):
tab = moose.Table( '/graphs/' + plot )
obj = moose.element( objpath )
if obj.className == 'Neutral':
print "addPlot failed: object is a Neutral: ", objpath
return moose.element( '/' )
else:
#print "object was found: ", objpath, obj.className
moose.connect( tab, 'requestOut', obj, field )
return tab
else:
print "addPlot failed: object not found: ", objpath
return moose.element( '/' )
def makeElecPlots():
graphs = moose.Neutral( '/graphs' )
elec = moose.Neutral( '/graphs/elec' )
addPlot( '/model/elec/soma', 'getVm', 'elec/somaVm' )
addPlot( '/model/elec/spine_head_14_4', 'getVm', 'elec/spineVm' )
addPlot( '/model/elec/soma/Ca_conc', 'getCa', 'elec/somaCa' )
addPlot( '/model/elec/lat_11_2/Ca_conc', 'getCa', 'elec/lat11Ca' )
addPlot( '/model/elec/spine_head_14_4/NMDA_Ca_conc', 'getCa', 'elec/spine4Ca' )
addPlot( '/model/elec/spine_head_14_12/NMDA_Ca_conc', 'getCa', 'elec/spine12Ca' )
def makeChemPlots():
graphs = moose.Neutral( '/graphs' )
chem = moose.Neutral( '/graphs/chem' )
addPlot( '/model/chem/psd/Ca_CaM', 'getConc', 'chem/psdCaCam' )
addPlot( '/model/chem/psd/Ca', 'getConc', 'chem/psdCa' )
addPlot( '/model/chem/spine/Ca_CaM', 'getConc', 'chem/spineCaCam' )
addPlot( '/model/chem/spine/Ca[3]', 'getConc', 'chem/spine4Ca' )
addPlot( '/model/chem/spine/Ca[11]', 'getConc', 'chem/spine12Ca' )
addPlot( '/model/chem/dend/DEND/Ca', 'getConc', 'chem/dendCa' )
addPlot( '/model/chem/dend/DEND/Ca[20]', 'getConc', 'chem/dendCa20' )
def testNeuroMeshMultiscale():
elecDt = 50e-6
chemDt = 0.005
ePlotDt = 0.5e-3
cPlotDt = 0.005
plotName = 'nm.plot'
makeNeuroMeshModel()
print "after model is completely done"
for i in moose.wildcardFind( '/model/chem/#/#/#/transloc#' ):
print i[0].name, i[0].Kf, i[0].Kb, i[0].kf, i[0].kb
makeChemPlots()
makeElecPlots()
moose.setClock( 0, elecDt )
moose.setClock( 1, elecDt )
moose.setClock( 2, elecDt )
moose.setClock( 4, chemDt )
moose.setClock( 5, chemDt )
moose.setClock( 6, chemDt )
moose.setClock( 7, cPlotDt )
moose.setClock( 8, ePlotDt )
moose.useClock( 0, '/model/elec/##[ISA=Compartment]', 'init' )
moose.useClock( 1, '/model/elec/##[ISA=Compartment]', 'process' )
moose.useClock( 1, '/model/elec/##[ISA=SpikeGen]', 'process' )
moose.useClock( 2, '/model/elec/##[ISA=ChanBase],/model/##[ISA=SynBase],/model/##[ISA=CaConc]','process')
#moose.useClock( 5, '/model/chem/##[ISA=PoolBase],/model/##[ISA=ReacBase],/model/##[ISA=EnzBase]', 'process' )
#moose.useClock( 4, '/model/chem/##[ISA=Adaptor]', 'process' )
moose.useClock( 4, '/model/chem/#/dsolve', 'process' )
moose.useClock( 5, '/model/chem/#/ksolve', 'process' )
moose.useClock( 6, '/model/chem/spine/adaptCa', 'process' )
moose.useClock( 6, '/model/chem/dend/DEND/adaptCa', 'process' )
moose.useClock( 7, '/graphs/chem/#', 'process' )
moose.useClock( 8, '/graphs/elec/#', 'process' )
#hsolve = moose.HSolve( '/model/elec/hsolve' )
#moose.useClock( 1, '/model/elec/hsolve', 'process' )
#hsolve.dt = elecDt
#hsolve.target = '/model/elec/compt'
#moose.reinit()
moose.element( '/model/elec/soma' ).inject = 2e-10
moose.element( '/model/chem/psd/Ca' ).concInit = 0.001
moose.element( '/model/chem/spine/Ca' ).concInit = 0.002
moose.element( '/model/chem/dend/DEND/Ca' ).concInit = 0.003
moose.reinit()
moose.start( 0.25 )
# moose.element( '/model/elec/soma' ).inject = 0
# moose.start( 0.25 )
plt.ion()
fig = plt.figure( figsize=(8,8) )
chem = fig.add_subplot( 311 )
chem.set_ylim( 0, 0.002 )
plt.ylabel( 'Conc (mM)' )
plt.xlabel( 'time (seconds)' )
for x in moose.wildcardFind( '/graphs/chem/#[ISA=Table]' ):
pos = numpy.arange( 0, x.vector.size, 1 ) * cPlotDt
line1, = chem.plot( pos, x.vector, label=x.name )
plt.legend()
elec = fig.add_subplot( 312 )
plt.ylabel( 'Vm (V)' )
plt.xlabel( 'time (seconds)' )
for x in moose.wildcardFind( '/graphs/elec/#[ISA=Table]' ):
pos = numpy.arange( 0, x.vector.size, 1 ) * ePlotDt
line1, = elec.plot( pos, x.vector, label=x.name )
plt.legend()
lenplot = fig.add_subplot( 313 )
plt.ylabel( 'Ca (mM )' )
plt.xlabel( 'Voxel#)' )
spineCa = moose.vec( '/model/chem/spine/Ca' )
dendCa = moose.vec( '/model/chem/dend/DEND/Ca' )
line1, = lenplot.plot( range( len( spineCa ) ), spineCa.conc, label='spine' )
line2, = lenplot.plot( range( len( dendCa ) ), dendCa.conc, label='dend' )
ca = [ x.Ca * 0.0001 for x in moose.wildcardFind( '/model/elec/##[ISA=CaConc]') ]
line3, = lenplot.plot( range( len( ca ) ), ca, label='elec' )
spineCaM = moose.vec( '/model/chem/spine/Ca_CaM' )
line4, = lenplot.plot( range( len( spineCaM ) ), spineCaM.conc, label='spineCaM' )
psdCaM = moose.vec( '/model/chem/psd/Ca_CaM' )
line5, = lenplot.plot( range( len( psdCaM ) ), psdCaM.conc, label='psdCaM' )
plt.legend()
fig.canvas.draw()
raw_input()
'''
for x in moose.wildcardFind( '/graphs/##[ISA=Table]' ):
t = numpy.arange( 0, x.vector.size, 1 )
pylab.plot( t, x.vector, label=x.name )
pylab.legend()
pylab.show()
'''
print 'All done'
def main():
testNeuroMeshMultiscale()
if __name__ == '__main__':
main()
#
# minimal.py ends here.
|
gpl-2.0
|
timqian/sms-tools
|
software/transformations_interface/hpsTransformations_function.py
|
23
|
6610
|
# function call to the transformation functions of relevance for the hpsModel
import numpy as np
import matplotlib.pyplot as plt
from scipy.signal import get_window
import sys, os
sys.path.append(os.path.join(os.path.dirname(os.path.realpath(__file__)), '../models/'))
sys.path.append(os.path.join(os.path.dirname(os.path.realpath(__file__)), '../transformations/'))
import hpsModel as HPS
import hpsTransformations as HPST
import harmonicTransformations as HT
import utilFunctions as UF
def analysis(inputFile='../../sounds/sax-phrase-short.wav', window='blackman', M=601, N=1024, t=-100,
minSineDur=0.1, nH=100, minf0=350, maxf0=700, f0et=5, harmDevSlope=0.01, stocf=0.1):
"""
Analyze a sound with the harmonic plus stochastic model
inputFile: input sound file (monophonic with sampling rate of 44100)
window: analysis window type (rectangular, hanning, hamming, blackman, blackmanharris)
M: analysis window size
N: fft size (power of two, bigger or equal than M)
t: magnitude threshold of spectral peaks
minSineDur: minimum duration of sinusoidal tracks
nH: maximum number of harmonics
minf0: minimum fundamental frequency in sound
maxf0: maximum fundamental frequency in sound
f0et: maximum error accepted in f0 detection algorithm
harmDevSlope: allowed deviation of harmonic tracks, higher harmonics have higher allowed deviation
stocf: decimation factor used for the stochastic approximation
returns inputFile: input file name; fs: sampling rate of input file,
hfreq, hmag: harmonic frequencies, magnitude; mYst: stochastic residual
"""
# size of fft used in synthesis
Ns = 512
# hop size (has to be 1/4 of Ns)
H = 128
# read input sound
(fs, x) = UF.wavread(inputFile)
# compute analysis window
w = get_window(window, M)
# compute the harmonic plus stochastic model of the whole sound
hfreq, hmag, hphase, mYst = HPS.hpsModelAnal(x, fs, w, N, H, t, nH, minf0, maxf0, f0et, harmDevSlope, minSineDur, Ns, stocf)
# synthesize the harmonic plus stochastic model without original phases
y, yh, yst = HPS.hpsModelSynth(hfreq, hmag, np.array([]), mYst, Ns, H, fs)
# write output sound
outputFile = 'output_sounds/' + os.path.basename(inputFile)[:-4] + '_hpsModel.wav'
UF.wavwrite(y,fs, outputFile)
# create figure to plot
plt.figure(figsize=(12, 9))
# frequency range to plot
maxplotfreq = 15000.0
# plot the input sound
plt.subplot(3,1,1)
plt.plot(np.arange(x.size)/float(fs), x)
plt.axis([0, x.size/float(fs), min(x), max(x)])
plt.ylabel('amplitude')
plt.xlabel('time (sec)')
plt.title('input sound: x')
# plot spectrogram stochastic compoment
plt.subplot(3,1,2)
numFrames = int(mYst[:,0].size)
sizeEnv = int(mYst[0,:].size)
frmTime = H*np.arange(numFrames)/float(fs)
binFreq = (.5*fs)*np.arange(sizeEnv*maxplotfreq/(.5*fs))/sizeEnv
plt.pcolormesh(frmTime, binFreq, np.transpose(mYst[:,:sizeEnv*maxplotfreq/(.5*fs)+1]))
plt.autoscale(tight=True)
# plot harmonic on top of stochastic spectrogram
if (hfreq.shape[1] > 0):
harms = hfreq*np.less(hfreq,maxplotfreq)
harms[harms==0] = np.nan
numFrames = int(harms[:,0].size)
frmTime = H*np.arange(numFrames)/float(fs)
plt.plot(frmTime, harms, color='k', ms=3, alpha=1)
plt.xlabel('time (sec)')
plt.ylabel('frequency (Hz)')
plt.autoscale(tight=True)
plt.title('harmonics + stochastic spectrogram')
# plot the output sound
plt.subplot(3,1,3)
plt.plot(np.arange(y.size)/float(fs), y)
plt.axis([0, y.size/float(fs), min(y), max(y)])
plt.ylabel('amplitude')
plt.xlabel('time (sec)')
plt.title('output sound: y')
plt.tight_layout()
plt.show(block=False)
return inputFile, fs, hfreq, hmag, mYst
def transformation_synthesis(inputFile, fs, hfreq, hmag, mYst, freqScaling = np.array([0, 1.2, 2.01, 1.2, 2.679, .7, 3.146, .7]),
freqStretching = np.array([0, 1, 2.01, 1, 2.679, 1.5, 3.146, 1.5]), timbrePreservation = 1,
timeScaling = np.array([0, 0, 2.138, 2.138-1.0, 3.146, 3.146])):
"""
transform the analysis values returned by the analysis function and synthesize the sound
inputFile: name of input file
fs: sampling rate of input file
hfreq, hmag: harmonic frequencies and magnitudes
mYst: stochastic residual
freqScaling: frequency scaling factors, in time-value pairs (value of 1 no scaling)
freqStretching: frequency stretching factors, in time-value pairs (value of 1 no stretching)
timbrePreservation: 1 preserves original timbre, 0 it does not
timeScaling: time scaling factors, in time-value pairs
"""
# size of fft used in synthesis
Ns = 512
# hop size (has to be 1/4 of Ns)
H = 128
# frequency scaling of the harmonics
hfreqt, hmagt = HT.harmonicFreqScaling(hfreq, hmag, freqScaling, freqStretching, timbrePreservation, fs)
# time scaling the sound
yhfreq, yhmag, ystocEnv = HPST.hpsTimeScale(hfreqt, hmagt, mYst, timeScaling)
# synthesis from the trasformed hps representation
y, yh, yst = HPS.hpsModelSynth(yhfreq, yhmag, np.array([]), ystocEnv, Ns, H, fs)
# write output sound
outputFile = 'output_sounds/' + os.path.basename(inputFile)[:-4] + '_hpsModelTransformation.wav'
UF.wavwrite(y,fs, outputFile)
# create figure to plot
plt.figure(figsize=(12, 6))
# frequency range to plot
maxplotfreq = 15000.0
# plot spectrogram of transformed stochastic compoment
plt.subplot(2,1,1)
numFrames = int(ystocEnv[:,0].size)
sizeEnv = int(ystocEnv[0,:].size)
frmTime = H*np.arange(numFrames)/float(fs)
binFreq = (.5*fs)*np.arange(sizeEnv*maxplotfreq/(.5*fs))/sizeEnv
plt.pcolormesh(frmTime, binFreq, np.transpose(ystocEnv[:,:sizeEnv*maxplotfreq/(.5*fs)+1]))
plt.autoscale(tight=True)
# plot transformed harmonic on top of stochastic spectrogram
if (yhfreq.shape[1] > 0):
harms = yhfreq*np.less(yhfreq,maxplotfreq)
harms[harms==0] = np.nan
numFrames = int(harms[:,0].size)
frmTime = H*np.arange(numFrames)/float(fs)
plt.plot(frmTime, harms, color='k', ms=3, alpha=1)
plt.xlabel('time (sec)')
plt.ylabel('frequency (Hz)')
plt.autoscale(tight=True)
plt.title('harmonics + stochastic spectrogram')
# plot the output sound
plt.subplot(2,1,2)
plt.plot(np.arange(y.size)/float(fs), y)
plt.axis([0, y.size/float(fs), min(y), max(y)])
plt.ylabel('amplitude')
plt.xlabel('time (sec)')
plt.title('output sound: y')
plt.tight_layout()
plt.show()
if __name__ == "__main__":
# analysis
inputFile, fs, hfreq, hmag, mYst = analysis()
# transformation and synthesis
transformation_synthesis(inputFile, fs, hfreq, hmag, mYst)
plt.show()
|
agpl-3.0
|
adammenges/statsmodels
|
statsmodels/regression/linear_model.py
|
16
|
93645
|
# TODO: Determine which tests are valid for GLSAR, and under what conditions
# TODO: Fix issue with constant and GLS
# TODO: GLS: add options Iterative GLS, for iterative fgls if sigma is None
# TODO: GLS: default if sigma is none should be two-step GLS
# TODO: Check nesting when performing model based tests, lr, wald, lm
"""
This module implements standard regression models:
Generalized Least Squares (GLS)
Ordinary Least Squares (OLS)
Weighted Least Squares (WLS)
Generalized Least Squares with autoregressive error terms GLSAR(p)
Models are specified with an endogenous response variable and an
exogenous design matrix and are fit using their `fit` method.
Subclasses that have more complicated covariance matrices
should write over the 'whiten' method as the fit method
prewhitens the response by calling 'whiten'.
General reference for regression models:
D. C. Montgomery and E.A. Peck. "Introduction to Linear Regression
Analysis." 2nd. Ed., Wiley, 1992.
Econometrics references for regression models:
R. Davidson and J.G. MacKinnon. "Econometric Theory and Methods," Oxford,
2004.
W. Green. "Econometric Analysis," 5th ed., Pearson, 2003.
"""
from __future__ import print_function
from statsmodels.compat.python import lrange, lzip, range
__docformat__ = 'restructuredtext en'
__all__ = ['GLS', 'WLS', 'OLS', 'GLSAR']
import numpy as np
import pandas as pd
from scipy.linalg import toeplitz
from scipy import stats
from scipy import optimize
from statsmodels.compat.numpy import np_matrix_rank
from statsmodels.tools.data import _is_using_pandas
from statsmodels.tools.tools import add_constant, chain_dot, pinv_extended
from statsmodels.tools.decorators import (resettable_cache,
cache_readonly,
cache_writable)
import statsmodels.base.model as base
import statsmodels.base.wrapper as wrap
from statsmodels.emplike.elregress import _ELRegOpts
import warnings
from statsmodels.tools.sm_exceptions import InvalidTestWarning
# need import in module instead of lazily to copy `__doc__`
from . import _prediction as pred
def _get_sigma(sigma, nobs):
"""
Returns sigma (matrix, nobs by nobs) for GLS and the inverse of its
Cholesky decomposition. Handles dimensions and checks integrity.
If sigma is None, returns None, None. Otherwise returns sigma,
cholsigmainv.
"""
if sigma is None:
return None, None
sigma = np.asarray(sigma).squeeze()
if sigma.ndim == 0:
sigma = np.repeat(sigma, nobs)
if sigma.ndim == 1:
if sigma.shape != (nobs,):
raise ValueError("Sigma must be a scalar, 1d of length %s or a 2d "
"array of shape %s x %s" % (nobs, nobs, nobs))
cholsigmainv = 1/np.sqrt(sigma)
else:
if sigma.shape != (nobs, nobs):
raise ValueError("Sigma must be a scalar, 1d of length %s or a 2d "
"array of shape %s x %s" % (nobs, nobs, nobs))
cholsigmainv = np.linalg.cholesky(np.linalg.pinv(sigma)).T
return sigma, cholsigmainv
class RegressionModel(base.LikelihoodModel):
"""
Base class for linear regression models. Should not be directly called.
Intended for subclassing.
"""
def __init__(self, endog, exog, **kwargs):
super(RegressionModel, self).__init__(endog, exog, **kwargs)
self._data_attr.extend(['pinv_wexog', 'wendog', 'wexog', 'weights'])
def initialize(self):
self.wexog = self.whiten(self.exog)
self.wendog = self.whiten(self.endog)
# overwrite nobs from class Model:
self.nobs = float(self.wexog.shape[0])
self._df_model = None
self._df_resid = None
self.rank = None
@property
def df_model(self):
"""
The model degree of freedom, defined as the rank of the regressor
matrix minus 1 if a constant is included.
"""
if self._df_model is None:
if self.rank is None:
self.rank = np_matrix_rank(self.exog)
self._df_model = float(self.rank - self.k_constant)
return self._df_model
@df_model.setter
def df_model(self, value):
self._df_model = value
@property
def df_resid(self):
"""
The residual degree of freedom, defined as the number of observations
minus the rank of the regressor matrix.
"""
if self._df_resid is None:
if self.rank is None:
self.rank = np_matrix_rank(self.exog)
self._df_resid = self.nobs - self.rank
return self._df_resid
@df_resid.setter
def df_resid(self, value):
self._df_resid = value
def whiten(self, X):
raise NotImplementedError("Subclasses should implement.")
def fit(self, method="pinv", cov_type='nonrobust', cov_kwds=None,
use_t=None, **kwargs):
"""
Full fit of the model.
The results include an estimate of covariance matrix, (whitened)
residuals and an estimate of scale.
Parameters
----------
method : str, optional
Can be "pinv", "qr". "pinv" uses the Moore-Penrose pseudoinverse
to solve the least squares problem. "qr" uses the QR
factorization.
cov_type : str, optional
See `regression.linear_model.RegressionResults` for a description
of the available covariance estimators
cov_kwds : list or None, optional
See `linear_model.RegressionResults.get_robustcov_results` for a
description required keywords for alternative covariance estimators
use_t : bool, optional
Flag indicating to use the Student's t distribution when computing
p-values. Default behavior depends on cov_type. See
`linear_model.RegressionResults.get_robustcov_results` for
implementation details.
Returns
-------
A RegressionResults class instance.
See Also
---------
regression.linear_model.RegressionResults
regression.linear_model.RegressionResults.get_robustcov_results
Notes
-----
The fit method uses the pseudoinverse of the design/exogenous variables
to solve the least squares minimization.
"""
if method == "pinv":
if ((not hasattr(self, 'pinv_wexog')) or
(not hasattr(self, 'normalized_cov_params')) or
(not hasattr(self, 'rank'))):
self.pinv_wexog, singular_values = pinv_extended(self.wexog)
self.normalized_cov_params = np.dot(self.pinv_wexog,
np.transpose(self.pinv_wexog))
# Cache these singular values for use later.
self.wexog_singular_values = singular_values
self.rank = np_matrix_rank(np.diag(singular_values))
beta = np.dot(self.pinv_wexog, self.wendog)
elif method == "qr":
if ((not hasattr(self, 'exog_Q')) or
(not hasattr(self, 'exog_R')) or
(not hasattr(self, 'normalized_cov_params')) or
(getattr(self, 'rank', None) is None)):
Q, R = np.linalg.qr(self.wexog)
self.exog_Q, self.exog_R = Q, R
self.normalized_cov_params = np.linalg.inv(np.dot(R.T, R))
# Cache singular values from R.
self.wexog_singular_values = np.linalg.svd(R, 0, 0)
self.rank = np_matrix_rank(R)
else:
Q, R = self.exog_Q, self.exog_R
# used in ANOVA
self.effects = effects = np.dot(Q.T, self.wendog)
beta = np.linalg.solve(R, effects)
if self._df_model is None:
self._df_model = float(self.rank - self.k_constant)
if self._df_resid is None:
self.df_resid = self.nobs - self.rank
if isinstance(self, OLS):
lfit = OLSResults(self, beta,
normalized_cov_params=self.normalized_cov_params,
cov_type=cov_type, cov_kwds=cov_kwds, use_t=use_t)
else:
lfit = RegressionResults(self, beta,
normalized_cov_params=self.normalized_cov_params,
cov_type=cov_type, cov_kwds=cov_kwds, use_t=use_t,
**kwargs)
return RegressionResultsWrapper(lfit)
def fit_regularized(self, method="coord_descent", maxiter=1000,
alpha=0., L1_wt=1., start_params=None,
cnvrg_tol=1e-8, zero_tol=1e-8, **kwargs):
"""
Return a regularized fit to a linear regression model.
Parameters
----------
method : string
Only the coordinate descent algorithm is implemented.
maxiter : integer
The maximum number of iteration cycles (an iteration cycle
involves running coordinate descent on all variables).
alpha : scalar or array-like
The penalty weight. If a scalar, the same penalty weight
applies to all variables in the model. If a vector, it
must have the same length as `params`, and contains a
penalty weight for each coefficient.
L1_wt : scalar
The fraction of the penalty given to the L1 penalty term.
Must be between 0 and 1 (inclusive). If 0, the fit is
ridge regression. If 1, the fit is the lasso.
start_params : array-like
Starting values for ``params``.
cnvrg_tol : scalar
If ``params`` changes by less than this amount (in sup-norm)
in once iteration cycle, the algorithm terminates with
convergence.
zero_tol : scalar
Any estimated coefficient smaller than this value is
replaced with zero.
Returns
-------
A RegressionResults object, of the same type returned by
``fit``.
Notes
-----
The approach closely follows that implemented in the glmnet
package in R. The penalty is the "elastic net" penalty, which
is a convex combination of L1 and L2 penalties.
The function that is minimized is: ..math::
0.5*RSS/n + alpha*((1-L1_wt)*|params|_2^2/2 + L1_wt*|params|_1)
where RSS is the usual regression sum of squares, n is the
sample size, and :math:`|*|_1` and :math:`|*|_2` are the L1 and L2
norms.
Post-estimation results are based on the same data used to
select variables, hence may be subject to overfitting biases.
References
----------
Friedman, Hastie, Tibshirani (2008). Regularization paths for
generalized linear models via coordinate descent. Journal of
Statistical Software 33(1), 1-22 Feb 2010.
"""
k_exog = self.wexog.shape[1]
if np.isscalar(alpha):
alpha = alpha * np.ones(k_exog, dtype=np.float64)
# Below we work with RSS + penalty, so we need to rescale.
alpha *= 2 * self.wexog.shape[0]
if start_params is None:
params = np.zeros(k_exog, dtype=np.float64)
else:
params = start_params.copy()
converged = False
xxprod = 2*(self.wexog**2).sum(0)
# Coordinate descent
for itr in range(maxiter):
params_save = params.copy()
for k in range(self.wexog.shape[1]):
params[k] = 0.
wendog_adj = self.wendog - np.dot(self.wexog, params)
xyprod = 2*np.dot(self.wexog[:,k], wendog_adj)
den = xxprod[k] + alpha[k] * (1 - L1_wt)
a = alpha[k] * L1_wt
if a >= np.abs(xyprod):
params[k] = 0.
elif xyprod > 0:
params[k] = (xyprod - a) / den
else:
params[k] = (xyprod + a) / den
# Check for convergence
pchange = np.max(np.abs(params - params_save))
if pchange < cnvrg_tol:
converged = True
break
# Set approximate zero coefficients to be exactly zero
params *= np.abs(params) >= zero_tol
# Fit the reduced model to get standard errors and other
# post-estimation results.
ii = np.flatnonzero(params)
cov = np.zeros((k_exog, k_exog), dtype=np.float64)
if len(ii) > 0:
model = self.__class__(self.wendog, self.wexog[:,ii])
rslt = model.fit()
cov[np.ix_(ii, ii)] = rslt.normalized_cov_params
lfit = RegressionResults(self, params,
normalized_cov_params=cov)
lfit.converged = converged
return RegressionResultsWrapper(lfit)
def predict(self, params, exog=None):
"""
Return linear predicted values from a design matrix.
Parameters
----------
params : array-like
Parameters of a linear model
exog : array-like, optional.
Design / exogenous data. Model exog is used if None.
Returns
-------
An array of fitted values
Notes
-----
If the model has not yet been fit, params is not optional.
"""
#JP: this doesn't look correct for GLMAR
#SS: it needs its own predict method
if exog is None:
exog = self.exog
return np.dot(exog, params)
class GLS(RegressionModel):
__doc__ = """
Generalized least squares model with a general covariance structure.
%(params)s
sigma : scalar or array
`sigma` is the weighting matrix of the covariance.
The default is None for no scaling. If `sigma` is a scalar, it is
assumed that `sigma` is an n x n diagonal matrix with the given
scalar, `sigma` as the value of each diagonal element. If `sigma`
is an n-length vector, then `sigma` is assumed to be a diagonal
matrix with the given `sigma` on the diagonal. This should be the
same as WLS.
%(extra_params)s
**Attributes**
pinv_wexog : array
`pinv_wexog` is the p x n Moore-Penrose pseudoinverse of `wexog`.
cholsimgainv : array
The transpose of the Cholesky decomposition of the pseudoinverse.
df_model : float
p - 1, where p is the number of regressors including the intercept.
of freedom.
df_resid : float
Number of observations n less the number of parameters p.
llf : float
The value of the likelihood function of the fitted model.
nobs : float
The number of observations n.
normalized_cov_params : array
p x p array :math:`(X^{T}\Sigma^{-1}X)^{-1}`
results : RegressionResults instance
A property that returns the RegressionResults class if fit.
sigma : array
`sigma` is the n x n covariance structure of the error terms.
wexog : array
Design matrix whitened by `cholsigmainv`
wendog : array
Response variable whitened by `cholsigmainv`
Notes
-----
If sigma is a function of the data making one of the regressors
a constant, then the current postestimation statistics will not be correct.
Examples
--------
>>> import numpy as np
>>> import statsmodels.api as sm
>>> data = sm.datasets.longley.load()
>>> data.exog = sm.add_constant(data.exog)
>>> ols_resid = sm.OLS(data.endog, data.exog).fit().resid
>>> res_fit = sm.OLS(ols_resid[1:], ols_resid[:-1]).fit()
>>> rho = res_fit.params
`rho` is a consistent estimator of the correlation of the residuals from
an OLS fit of the longley data. It is assumed that this is the true rho
of the AR process data.
>>> from scipy.linalg import toeplitz
>>> order = toeplitz(np.arange(16))
>>> sigma = rho**order
`sigma` is an n x n matrix of the autocorrelation structure of the
data.
>>> gls_model = sm.GLS(data.endog, data.exog, sigma=sigma)
>>> gls_results = gls_model.fit()
>>> print(gls_results.summary()))
""" % {'params' : base._model_params_doc,
'extra_params' : base._missing_param_doc + base._extra_param_doc}
def __init__(self, endog, exog, sigma=None, missing='none', hasconst=None,
**kwargs):
#TODO: add options igls, for iterative fgls if sigma is None
#TODO: default if sigma is none should be two-step GLS
sigma, cholsigmainv = _get_sigma(sigma, len(endog))
super(GLS, self).__init__(endog, exog, missing=missing,
hasconst=hasconst, sigma=sigma,
cholsigmainv=cholsigmainv, **kwargs)
#store attribute names for data arrays
self._data_attr.extend(['sigma', 'cholsigmainv'])
def whiten(self, X):
"""
GLS whiten method.
Parameters
-----------
X : array-like
Data to be whitened.
Returns
-------
np.dot(cholsigmainv,X)
See Also
--------
regression.GLS
"""
X = np.asarray(X)
if self.sigma is None or self.sigma.shape == ():
return X
elif self.sigma.ndim == 1:
if X.ndim == 1:
return X * self.cholsigmainv
else:
return X * self.cholsigmainv[:, None]
else:
return np.dot(self.cholsigmainv, X)
def loglike(self, params):
"""
Returns the value of the Gaussian log-likelihood function at params.
Given the whitened design matrix, the log-likelihood is evaluated
at the parameter vector `params` for the dependent variable `endog`.
Parameters
----------
params : array-like
The parameter estimates
Returns
-------
loglike : float
The value of the log-likelihood function for a GLS Model.
Notes
-----
The log-likelihood function for the normal distribution is
.. math:: -\\frac{n}{2}\\log\\left(\\left(Y-\\hat{Y}\\right)^{\\prime}\\left(Y-\\hat{Y}\\right)\\right)-\\frac{n}{2}\\left(1+\\log\\left(\\frac{2\\pi}{n}\\right)\\right)-\\frac{1}{2}\\log\\left(\\left|\\Sigma\\right|\\right)
Y and Y-hat are whitened.
"""
#TODO: combine this with OLS/WLS loglike and add _det_sigma argument
nobs2 = self.nobs / 2.0
SSR = np.sum((self.wendog - np.dot(self.wexog, params))**2, axis=0)
llf = -np.log(SSR) * nobs2 # concentrated likelihood
llf -= (1+np.log(np.pi/nobs2))*nobs2 # with likelihood constant
if np.any(self.sigma):
#FIXME: robust-enough check? unneeded if _det_sigma gets defined
if self.sigma.ndim==2:
det = np.linalg.slogdet(self.sigma)
llf -= .5*det[1]
else:
llf -= 0.5*np.sum(np.log(self.sigma))
# with error covariance matrix
return llf
class WLS(RegressionModel):
__doc__ = """
A regression model with diagonal but non-identity covariance structure.
The weights are presumed to be (proportional to) the inverse of the
variance of the observations. That is, if the variables are to be
transformed by 1/sqrt(W) you must supply weights = 1/W.
%(params)s
weights : array-like, optional
1d array of weights. If you supply 1/W then the variables are pre-
multiplied by 1/sqrt(W). If no weights are supplied the default value
is 1 and WLS reults are the same as OLS.
%(extra_params)s
Attributes
----------
weights : array
The stored weights supplied as an argument.
See regression.GLS
Examples
---------
>>> import numpy as np
>>> import statsmodels.api as sm
>>> Y = [1,3,4,5,2,3,4]
>>> X = range(1,8)
>>> X = sm.add_constant(X)
>>> wls_model = sm.WLS(Y,X, weights=list(range(1,8)))
>>> results = wls_model.fit()
>>> results.params
array([ 2.91666667, 0.0952381 ])
>>> results.tvalues
array([ 2.0652652 , 0.35684428])
>>> print(results.t_test([1, 0]))
<T test: effect=array([ 2.91666667]), sd=array([[ 1.41224801]]), t=array([[ 2.0652652]]), p=array([[ 0.04690139]]), df_denom=5>
>>> print(results.f_test([0, 1]))
<F test: F=array([[ 0.12733784]]), p=[[ 0.73577409]], df_denom=5, df_num=1>
Notes
-----
If the weights are a function of the data, then the post estimation
statistics such as fvalue and mse_model might not be correct, as the
package does not yet support no-constant regression.
""" % {'params' : base._model_params_doc,
'extra_params' : base._missing_param_doc + base._extra_param_doc}
def __init__(self, endog, exog, weights=1., missing='none', hasconst=None,
**kwargs):
weights = np.array(weights)
if weights.shape == ():
if (missing == 'drop' and 'missing_idx' in kwargs and
kwargs['missing_idx'] is not None):
# patsy may have truncated endog
weights = np.repeat(weights, len(kwargs['missing_idx']))
else:
weights = np.repeat(weights, len(endog))
# handle case that endog might be of len == 1
if len(weights) == 1:
weights = np.array([weights.squeeze()])
else:
weights = weights.squeeze()
super(WLS, self).__init__(endog, exog, missing=missing,
weights=weights, hasconst=hasconst, **kwargs)
nobs = self.exog.shape[0]
weights = self.weights
# Experimental normalization of weights
weights = weights / np.sum(weights) * nobs
if weights.size != nobs and weights.shape[0] != nobs:
raise ValueError('Weights must be scalar or same length as design')
def whiten(self, X):
"""
Whitener for WLS model, multiplies each column by sqrt(self.weights)
Parameters
----------
X : array-like
Data to be whitened
Returns
-------
sqrt(weights)*X
"""
#print(self.weights.var()))
X = np.asarray(X)
if X.ndim == 1:
return X * np.sqrt(self.weights)
elif X.ndim == 2:
return np.sqrt(self.weights)[:, None]*X
def loglike(self, params):
"""
Returns the value of the gaussian log-likelihood function at params.
Given the whitened design matrix, the log-likelihood is evaluated
at the parameter vector `params` for the dependent variable `Y`.
Parameters
----------
params : array-like
The parameter estimates.
Returns
-------
llf : float
The value of the log-likelihood function for a WLS Model.
Notes
--------
.. math:: -\\frac{n}{2}\\log\\left(Y-\\hat{Y}\\right)-\\frac{n}{2}\\left(1+\\log\\left(\\frac{2\\pi}{n}\\right)\\right)-\\frac{1}{2}log\\left(\\left|W\\right|\\right)
where :math:`W` is a diagonal matrix
"""
nobs2 = self.nobs / 2.0
SSR = np.sum((self.wendog - np.dot(self.wexog,params))**2, axis=0)
llf = -np.log(SSR) * nobs2 # concentrated likelihood
llf -= (1+np.log(np.pi/nobs2))*nobs2 # with constant
llf += 0.5 * np.sum(np.log(self.weights))
return llf
class OLS(WLS):
__doc__ = """
A simple ordinary least squares model.
%(params)s
%(extra_params)s
Attributes
----------
weights : scalar
Has an attribute weights = array(1.0) due to inheritance from WLS.
See Also
--------
GLS
Examples
--------
>>> import numpy as np
>>>
>>> import statsmodels.api as sm
>>>
>>> Y = [1,3,4,5,2,3,4]
>>> X = range(1,8)
>>> X = sm.add_constant(X)
>>>
>>> model = sm.OLS(Y,X)
>>> results = model.fit()
>>> results.params
array([ 2.14285714, 0.25 ])
>>> results.tvalues
array([ 1.87867287, 0.98019606])
>>> print(results.t_test([1, 0])))
<T test: effect=array([ 2.14285714]), sd=array([[ 1.14062282]]), t=array([[ 1.87867287]]), p=array([[ 0.05953974]]), df_denom=5>
>>> print(results.f_test(np.identity(2)))
<F test: F=array([[ 19.46078431]]), p=[[ 0.00437251]], df_denom=5, df_num=2>
Notes
-----
No constant is added by the model unless you are using formulas.
""" % {'params' : base._model_params_doc,
'extra_params' : base._missing_param_doc + base._extra_param_doc}
#TODO: change example to use datasets. This was the point of datasets!
def __init__(self, endog, exog=None, missing='none', hasconst=None,
**kwargs):
super(OLS, self).__init__(endog, exog, missing=missing,
hasconst=hasconst, **kwargs)
if "weights" in self._init_keys:
self._init_keys.remove("weights")
def loglike(self, params):
"""
The likelihood function for the clasical OLS model.
Parameters
----------
params : array-like
The coefficients with which to estimate the log-likelihood.
Returns
-------
The concentrated likelihood function evaluated at params.
"""
nobs2 = self.nobs / 2.0
return -nobs2*np.log(2*np.pi)-nobs2*np.log(1/(2*nobs2) *\
np.dot(np.transpose(self.endog -
np.dot(self.exog, params)),
(self.endog - np.dot(self.exog,params)))) -\
nobs2
def whiten(self, Y):
"""
OLS model whitener does nothing: returns Y.
"""
return Y
class GLSAR(GLS):
__doc__ = """
A regression model with an AR(p) covariance structure.
%(params)s
rho : int
Order of the autoregressive covariance
%(extra_params)s
Examples
--------
>>> import statsmodels.api as sm
>>> X = range(1,8)
>>> X = sm.add_constant(X)
>>> Y = [1,3,4,5,8,10,9]
>>> model = sm.GLSAR(Y, X, rho=2)
>>> for i in range(6):
... results = model.fit()
... print("AR coefficients: {0}".format(model.rho))
... rho, sigma = sm.regression.yule_walker(results.resid,
... order=model.order)
... model = sm.GLSAR(Y, X, rho)
...
AR coefficients: [ 0. 0.]
AR coefficients: [-0.52571491 -0.84496178]
AR coefficients: [-0.6104153 -0.86656458]
AR coefficients: [-0.60439494 -0.857867 ]
AR coefficients: [-0.6048218 -0.85846157]
AR coefficients: [-0.60479146 -0.85841922]
>>> results.params
array([-0.66661205, 1.60850853])
>>> results.tvalues
array([ -2.10304127, 21.8047269 ])
>>> print(results.t_test([1, 0]))
<T test: effect=array([-0.66661205]), sd=array([[ 0.31697526]]), t=array([[-2.10304127]]), p=array([[ 0.06309969]]), df_denom=3>
>>> print(results.f_test(np.identity(2)))
<F test: F=array([[ 1815.23061844]]), p=[[ 0.00002372]], df_denom=3, df_num=2>
Or, equivalently
>>> model2 = sm.GLSAR(Y, X, rho=2)
>>> res = model2.iterative_fit(maxiter=6)
>>> model2.rho
array([-0.60479146, -0.85841922])
Notes
-----
GLSAR is considered to be experimental.
The linear autoregressive process of order p--AR(p)--is defined as:
TODO
""" % {'params' : base._model_params_doc,
'extra_params' : base._missing_param_doc + base._extra_param_doc}
def __init__(self, endog, exog=None, rho=1, missing='none', **kwargs):
#this looks strange, interpreting rho as order if it is int
if isinstance(rho, np.int):
self.order = rho
self.rho = np.zeros(self.order, np.float64)
else:
self.rho = np.squeeze(np.asarray(rho))
if len(self.rho.shape) not in [0,1]:
raise ValueError("AR parameters must be a scalar or a vector")
if self.rho.shape == ():
self.rho.shape = (1,)
self.order = self.rho.shape[0]
if exog is None:
#JP this looks wrong, should be a regression on constant
#results for rho estimate now identical to yule-walker on y
#super(AR, self).__init__(endog, add_constant(endog))
super(GLSAR, self).__init__(endog, np.ones((endog.shape[0],1)),
missing=missing, **kwargs)
else:
super(GLSAR, self).__init__(endog, exog, missing=missing,
**kwargs)
def iterative_fit(self, maxiter=3, rtol=1e-4, **kwds):
"""
Perform an iterative two-stage procedure to estimate a GLS model.
The model is assumed to have AR(p) errors, AR(p) parameters and
regression coefficients are estimated iteratively.
Parameters
----------
maxiter : integer, optional
the number of iterations
rtol : float, optional
Relative tolerance between estimated coefficients to stop the
estimation. Stops if
max(abs(last - current) / abs(last)) < rtol
"""
# TODO: update this after going through example.
converged = False
i = -1 # need to initialize for maxiter < 1 (skip loop)
history = {'params': [], 'rho':[self.rho]}
for i in range(maxiter - 1):
if hasattr(self, 'pinv_wexog'):
del self.pinv_wexog
self.initialize()
results = self.fit()
history['params'].append(results.params)
if i == 0:
last = results.params
else:
diff = np.max(np.abs(last - results.params) / np.abs(last))
if diff < rtol:
converged = True
break
last = results.params
self.rho, _ = yule_walker(results.resid,
order=self.order, df=None)
history['rho'].append(self.rho)
# why not another call to self.initialize
# Use kwarg to insert history
if not converged and maxiter > 0:
# maxiter <= 0 just does OLS
if hasattr(self, 'pinv_wexog'):
del self.pinv_wexog
self.initialize()
# if converged then this is a duplicate fit, because we didn't update rho
results = self.fit(history=history, **kwds)
results.iter = i + 1
# add last fit to history, not if duplicate fit
if not converged:
results.history['params'].append(results.params)
results.iter += 1
results.converged = converged
return results
def whiten(self, X):
"""
Whiten a series of columns according to an AR(p)
covariance structure. This drops initial p observations.
Parameters
----------
X : array-like
The data to be whitened,
Returns
-------
whitened array
"""
#TODO: notation for AR process
X = np.asarray(X, np.float64)
_X = X.copy()
#the following loops over the first axis, works for 1d and nd
for i in range(self.order):
_X[(i+1):] = _X[(i+1):] - self.rho[i] * X[0:-(i+1)]
return _X[self.order:]
def yule_walker(X, order=1, method="unbiased", df=None, inv=False, demean=True):
"""
Estimate AR(p) parameters from a sequence X using Yule-Walker equation.
Unbiased or maximum-likelihood estimator (mle)
See, for example:
http://en.wikipedia.org/wiki/Autoregressive_moving_average_model
Parameters
----------
X : array-like
1d array
order : integer, optional
The order of the autoregressive process. Default is 1.
method : string, optional
Method can be "unbiased" or "mle" and this determines denominator in
estimate of autocorrelation function (ACF) at lag k. If "mle", the
denominator is n=X.shape[0], if "unbiased" the denominator is n-k.
The default is unbiased.
df : integer, optional
Specifies the degrees of freedom. If `df` is supplied, then it is assumed
the X has `df` degrees of freedom rather than `n`. Default is None.
inv : bool
If inv is True the inverse of R is also returned. Default is False.
demean : bool
True, the mean is subtracted from `X` before estimation.
Returns
-------
rho
The autoregressive coefficients
sigma
TODO
Examples
--------
>>> import statsmodels.api as sm
>>> from statsmodels.datasets.sunspots import load
>>> data = load()
>>> rho, sigma = sm.regression.yule_walker(data.endog,
order=4, method="mle")
>>> rho
array([ 1.28310031, -0.45240924, -0.20770299, 0.04794365])
>>> sigma
16.808022730464351
"""
#TODO: define R better, look back at notes and technical notes on YW.
#First link here is useful
#http://www-stat.wharton.upenn.edu/~steele/Courses/956/ResourceDetails/YuleWalkerAndMore.htm
method = str(method).lower()
if method not in ["unbiased", "mle"]:
raise ValueError("ACF estimation method must be 'unbiased' or 'MLE'")
X = np.array(X, dtype=np.float64)
if demean:
X -= X.mean() # automatically demean's X
n = df or X.shape[0]
if method == "unbiased": # this is df_resid ie., n - p
denom = lambda k: n - k
else:
denom = lambda k: n
if X.ndim > 1 and X.shape[1] != 1:
raise ValueError("expecting a vector to estimate AR parameters")
r = np.zeros(order+1, np.float64)
r[0] = (X**2).sum() / denom(0)
for k in range(1,order+1):
r[k] = (X[0:-k]*X[k:]).sum() / denom(k)
R = toeplitz(r[:-1])
rho = np.linalg.solve(R, r[1:])
sigmasq = r[0] - (r[1:]*rho).sum()
if inv==True:
return rho, np.sqrt(sigmasq), np.linalg.inv(R)
else:
return rho, np.sqrt(sigmasq)
class RegressionResults(base.LikelihoodModelResults):
"""
This class summarizes the fit of a linear regression model.
It handles the output of contrasts, estimates of covariance, etc.
Returns
-------
**Attributes**
aic
Aikake's information criteria. For a model with a constant
:math:`-2llf + 2(df_model + 1)`. For a model without a constant
:math:`-2llf + 2(df_model)`.
bic
Bayes' information criteria For a model with a constant
:math:`-2llf + \log(n)(df_model+1)`. For a model without a constant
:math:`-2llf + \log(n)(df_model)`
bse
The standard errors of the parameter estimates.
pinv_wexog
See specific model class docstring
centered_tss
The total (weighted) sum of squares centered about the mean.
cov_HC0
Heteroscedasticity robust covariance matrix. See HC0_se below.
cov_HC1
Heteroscedasticity robust covariance matrix. See HC1_se below.
cov_HC2
Heteroscedasticity robust covariance matrix. See HC2_se below.
cov_HC3
Heteroscedasticity robust covariance matrix. See HC3_se below.
cov_type
Parameter covariance estimator used for standard errors and t-stats
df_model
Model degress of freedom. The number of regressors `p`. Does not
include the constant if one is present
df_resid
Residual degrees of freedom. `n - p - 1`, if a constant is present.
`n - p` if a constant is not included.
ess
Explained sum of squares. If a constant is present, the centered
total sum of squares minus the sum of squared residuals. If there is
no constant, the uncentered total sum of squares is used.
fvalue
F-statistic of the fully specified model. Calculated as the mean
squared error of the model divided by the mean squared error of the
residuals.
f_pvalue
p-value of the F-statistic
fittedvalues
The predicted the values for the original (unwhitened) design.
het_scale
adjusted squared residuals for heteroscedasticity robust standard
errors. Is only available after `HC#_se` or `cov_HC#` is called.
See HC#_se for more information.
history
Estimation history for iterative estimators
HC0_se
White's (1980) heteroskedasticity robust standard errors.
Defined as sqrt(diag(X.T X)^(-1)X.T diag(e_i^(2)) X(X.T X)^(-1)
where e_i = resid[i]
HC0_se is a cached property.
When HC0_se or cov_HC0 is called the RegressionResults instance will
then have another attribute `het_scale`, which is in this case is just
resid**2.
HC1_se
MacKinnon and White's (1985) alternative heteroskedasticity robust
standard errors.
Defined as sqrt(diag(n/(n-p)*HC_0)
HC1_see is a cached property.
When HC1_se or cov_HC1 is called the RegressionResults instance will
then have another attribute `het_scale`, which is in this case is
n/(n-p)*resid**2.
HC2_se
MacKinnon and White's (1985) alternative heteroskedasticity robust
standard errors.
Defined as (X.T X)^(-1)X.T diag(e_i^(2)/(1-h_ii)) X(X.T X)^(-1)
where h_ii = x_i(X.T X)^(-1)x_i.T
HC2_see is a cached property.
When HC2_se or cov_HC2 is called the RegressionResults instance will
then have another attribute `het_scale`, which is in this case is
resid^(2)/(1-h_ii).
HC3_se
MacKinnon and White's (1985) alternative heteroskedasticity robust
standard errors.
Defined as (X.T X)^(-1)X.T diag(e_i^(2)/(1-h_ii)^(2)) X(X.T X)^(-1)
where h_ii = x_i(X.T X)^(-1)x_i.T
HC3_see is a cached property.
When HC3_se or cov_HC3 is called the RegressionResults instance will
then have another attribute `het_scale`, which is in this case is
resid^(2)/(1-h_ii)^(2).
model
A pointer to the model instance that called fit() or results.
mse_model
Mean squared error the model. This is the explained sum of squares
divided by the model degrees of freedom.
mse_resid
Mean squared error of the residuals. The sum of squared residuals
divided by the residual degrees of freedom.
mse_total
Total mean squared error. Defined as the uncentered total sum of
squares divided by n the number of observations.
nobs
Number of observations n.
normalized_cov_params
See specific model class docstring
params
The linear coefficients that minimize the least squares criterion. This
is usually called Beta for the classical linear model.
pvalues
The two-tailed p values for the t-stats of the params.
resid
The residuals of the model.
resid_pearson
`wresid` normalized to have unit variance.
rsquared
R-squared of a model with an intercept. This is defined here as
1 - `ssr`/`centered_tss` if the constant is included in the model and
1 - `ssr`/`uncentered_tss` if the constant is omitted.
rsquared_adj
Adjusted R-squared. This is defined here as
1 - (`nobs`-1)/`df_resid` * (1-`rsquared`) if a constant is included
and 1 - `nobs`/`df_resid` * (1-`rsquared`) if no constant is included.
scale
A scale factor for the covariance matrix.
Default value is ssr/(n-p). Note that the square root of `scale` is
often called the standard error of the regression.
ssr
Sum of squared (whitened) residuals.
uncentered_tss
Uncentered sum of squares. Sum of the squared values of the
(whitened) endogenous response variable.
wresid
The residuals of the transformed/whitened regressand and regressor(s)
"""
_cache = {} # needs to be a class attribute for scale setter?
def __init__(self, model, params, normalized_cov_params=None, scale=1.,
cov_type='nonrobust', cov_kwds=None, use_t=None, **kwargs):
super(RegressionResults, self).__init__(model, params,
normalized_cov_params,
scale)
self._cache = resettable_cache()
if hasattr(model, 'wexog_singular_values'):
self._wexog_singular_values = model.wexog_singular_values
else:
self._wexog_singular_values = None
self.df_model = model.df_model
self.df_resid = model.df_resid
if cov_type == 'nonrobust':
self.cov_type = 'nonrobust'
self.cov_kwds = {'description' : 'Standard Errors assume that the ' +
'covariance matrix of the errors is correctly ' +
'specified.'}
if use_t is None:
self.use_t = True # TODO: class default
else:
if cov_kwds is None:
cov_kwds = {}
if 'use_t' in cov_kwds:
# TODO: we want to get rid of 'use_t' in cov_kwds
use_t_2 = cov_kwds.pop('use_t')
if use_t is None:
use_t = use_t_2
# TODO: warn or not?
self.get_robustcov_results(cov_type=cov_type, use_self=True,
use_t=use_t, **cov_kwds)
for key in kwargs:
setattr(self, key, kwargs[key])
def __str__(self):
self.summary()
def conf_int(self, alpha=.05, cols=None):
"""
Returns the confidence interval of the fitted parameters.
Parameters
----------
alpha : float, optional
The `alpha` level for the confidence interval.
ie., The default `alpha` = .05 returns a 95% confidence interval.
cols : array-like, optional
`cols` specifies which confidence intervals to return
Notes
-----
The confidence interval is based on Student's t-distribution.
"""
# keep method for docstring for now
ci = super(RegressionResults, self).conf_int(alpha=alpha, cols=cols)
return ci
@cache_readonly
def nobs(self):
return float(self.model.wexog.shape[0])
@cache_readonly
def fittedvalues(self):
return self.model.predict(self.params, self.model.exog)
@cache_readonly
def wresid(self):
return self.model.wendog - self.model.predict(self.params,
self.model.wexog)
@cache_readonly
def resid(self):
return self.model.endog - self.model.predict(self.params,
self.model.exog)
#TODO: fix writable example
@cache_writable()
def scale(self):
wresid = self.wresid
return np.dot(wresid, wresid) / self.df_resid
@cache_readonly
def ssr(self):
wresid = self.wresid
return np.dot(wresid, wresid)
@cache_readonly
def centered_tss(self):
model = self.model
weights = getattr(model, 'weights', None)
if weights is not None:
return np.sum(weights*(model.endog - np.average(model.endog,
weights=weights))**2)
else: # this is probably broken for GLS
centered_endog = model.wendog - model.wendog.mean()
return np.dot(centered_endog, centered_endog)
@cache_readonly
def uncentered_tss(self):
wendog = self.model.wendog
return np.dot(wendog, wendog)
@cache_readonly
def ess(self):
if self.k_constant:
return self.centered_tss - self.ssr
else:
return self.uncentered_tss - self.ssr
@cache_readonly
def rsquared(self):
if self.k_constant:
return 1 - self.ssr/self.centered_tss
else:
return 1 - self.ssr/self.uncentered_tss
@cache_readonly
def rsquared_adj(self):
return 1 - np.divide(self.nobs - self.k_constant, self.df_resid) * (1 - self.rsquared)
@cache_readonly
def mse_model(self):
return self.ess/self.df_model
@cache_readonly
def mse_resid(self):
return self.ssr/self.df_resid
@cache_readonly
def mse_total(self):
if self.k_constant:
return self.centered_tss / (self.df_resid + self.df_model)
else:
return self.uncentered_tss / (self.df_resid + self.df_model)
@cache_readonly
def fvalue(self):
if hasattr(self, 'cov_type') and self.cov_type != 'nonrobust':
# with heteroscedasticity or correlation robustness
k_params = self.normalized_cov_params.shape[0]
mat = np.eye(k_params)
const_idx = self.model.data.const_idx
# TODO: What if model includes implcit constant, e.g. all dummies but no constant regressor?
# TODO: Restats as LM test by projecting orthogonalizing to constant?
if self.model.data.k_constant == 1:
# if constant is implicit, return nan see #2444
if const_idx is None:
return np.nan
idx = lrange(k_params)
idx.pop(const_idx)
mat = mat[idx] # remove constant
ft = self.f_test(mat)
# using backdoor to set another attribute that we already have
self._cache['f_pvalue'] = ft.pvalue
return ft.fvalue
else:
# for standard homoscedastic case
return self.mse_model/self.mse_resid
@cache_readonly
def f_pvalue(self):
return stats.f.sf(self.fvalue, self.df_model, self.df_resid)
@cache_readonly
def bse(self):
return np.sqrt(np.diag(self.cov_params()))
@cache_readonly
def aic(self):
return -2 * self.llf + 2 * (self.df_model + self.k_constant)
@cache_readonly
def bic(self):
return (-2 * self.llf + np.log(self.nobs) * (self.df_model +
self.k_constant))
@cache_readonly
def eigenvals(self):
"""
Return eigenvalues sorted in decreasing order.
"""
if self._wexog_singular_values is not None:
eigvals = self._wexog_singular_values ** 2
else:
eigvals = np.linalg.linalg.eigvalsh(np.dot(self.model.wexog.T, self.model.wexog))
return np.sort(eigvals)[::-1]
@cache_readonly
def condition_number(self):
"""
Return condition number of exogenous matrix.
Calculated as ratio of largest to smallest eigenvalue.
"""
eigvals = self.eigenvals
return np.sqrt(eigvals[0]/eigvals[-1])
#TODO: make these properties reset bse
def _HCCM(self, scale):
H = np.dot(self.model.pinv_wexog,
scale[:,None]*self.model.pinv_wexog.T)
return H
@cache_readonly
def cov_HC0(self):
"""
See statsmodels.RegressionResults
"""
self.het_scale = self.wresid**2
cov_HC0 = self._HCCM(self.het_scale)
return cov_HC0
@cache_readonly
def cov_HC1(self):
"""
See statsmodels.RegressionResults
"""
self.het_scale = self.nobs/(self.df_resid)*(self.wresid**2)
cov_HC1 = self._HCCM(self.het_scale)
return cov_HC1
@cache_readonly
def cov_HC2(self):
"""
See statsmodels.RegressionResults
"""
# probably could be optimized
h = np.diag(chain_dot(self.model.wexog,
self.normalized_cov_params,
self.model.wexog.T))
self.het_scale = self.wresid**2/(1-h)
cov_HC2 = self._HCCM(self.het_scale)
return cov_HC2
@cache_readonly
def cov_HC3(self):
"""
See statsmodels.RegressionResults
"""
h = np.diag(chain_dot(self.model.wexog,
self.normalized_cov_params,
self.model.wexog.T))
self.het_scale=(self.wresid/(1-h))**2
cov_HC3 = self._HCCM(self.het_scale)
return cov_HC3
@cache_readonly
def HC0_se(self):
"""
See statsmodels.RegressionResults
"""
return np.sqrt(np.diag(self.cov_HC0))
@cache_readonly
def HC1_se(self):
"""
See statsmodels.RegressionResults
"""
return np.sqrt(np.diag(self.cov_HC1))
@cache_readonly
def HC2_se(self):
"""
See statsmodels.RegressionResults
"""
return np.sqrt(np.diag(self.cov_HC2))
@cache_readonly
def HC3_se(self):
"""
See statsmodels.RegressionResults
"""
return np.sqrt(np.diag(self.cov_HC3))
@cache_readonly
def resid_pearson(self):
"""
Residuals, normalized to have unit variance.
Returns
-------
An array wresid/sqrt(scale)
"""
if not hasattr(self, 'resid'):
raise ValueError('Method requires residuals.')
eps = np.finfo(self.wresid.dtype).eps
if np.sqrt(self.scale) < 10 * eps * self.model.endog.mean():
# don't divide if scale is zero close to numerical precision
from warnings import warn
warn("All residuals are 0, cannot compute normed residuals.",
RuntimeWarning)
return self.wresid
else:
return self.wresid / np.sqrt(self.scale)
def _is_nested(self, restricted):
"""
Parameters
----------
restricted : Result instance
The restricted model is assumed to be nested in the current
model. The result instance of the restricted model is required to
have two attributes, residual sum of squares, `ssr`, residual
degrees of freedom, `df_resid`.
Returns
-------
nested : bool
True if nested, otherwise false
Notes
-----
A most nests another model if the regressors in the smaller model are spanned
by the regressors in the larger model and the regressand is identical.
"""
if self.model.nobs != restricted.model.nobs:
return False
full_rank = self.model.rank
restricted_rank = restricted.model.rank
if full_rank <= restricted_rank:
return False
restricted_exog = restricted.model.wexog
full_wresid = self.wresid
scores = restricted_exog * full_wresid[:,None]
score_l2 = np.sqrt(np.mean(scores.mean(0) ** 2))
# TODO: Could be improved, and may fail depending on scale of regressors
return np.allclose(score_l2,0)
def compare_lm_test(self, restricted, demean=True, use_lr=False):
"""Use Lagrange Multiplier test to test whether restricted model is correct
Parameters
----------
restricted : Result instance
The restricted model is assumed to be nested in the current
model. The result instance of the restricted model is required to
have two attributes, residual sum of squares, `ssr`, residual
degrees of freedom, `df_resid`.
demean : bool
Flag indicating whether the demean the scores based on the residuals
from the restricted model. If True, the covariance of the scores
are used and the LM test is identical to the large sample version
of the LR test.
Returns
-------
lm_value : float
test statistic, chi2 distributed
p_value : float
p-value of the test statistic
df_diff : int
degrees of freedom of the restriction, i.e. difference in df between
models
Notes
-----
TODO: explain LM text
"""
import statsmodels.stats.sandwich_covariance as sw
from numpy.linalg import inv
if not self._is_nested(restricted):
raise ValueError("Restricted model is not nested by full model.")
wresid = restricted.wresid
wexog = self.model.wexog
scores = wexog * wresid[:,None]
n = self.nobs
df_full = self.df_resid
df_restr = restricted.df_resid
df_diff = (df_restr - df_full)
s = scores.mean(axis=0)
if use_lr:
scores = wexog * self.wresid[:,None]
demean = False
if demean:
scores = scores - scores.mean(0)[None,:]
# Form matters here. If homoskedastics can be sigma^2 (X'X)^-1
# If Heteroskedastic then the form below is fine
# If HAC then need to use HAC
# If Cluster, shoudl use cluster
cov_type = getattr(self, 'cov_type', 'nonrobust')
if cov_type == 'nonrobust':
sigma2 = np.mean(wresid**2)
XpX = np.dot(wexog.T,wexog) / n
Sinv = inv(sigma2 * XpX)
elif cov_type in ('HC0', 'HC1', 'HC2', 'HC3'):
Sinv = inv(np.dot(scores.T,scores) / n)
elif cov_type == 'HAC':
print("HAC")
maxlags = self.cov_kwds['maxlags']
Sinv = inv(sw.S_hac_simple(scores, maxlags) / n)
elif cov_type == 'cluster':
#cluster robust standard errors
groups = self.cov_kwds['groups']
# TODO: Might need demean option in S_crosssection by group?
Sinv = inv(sw.S_crosssection(scores, groups))
else:
raise ValueError('Only nonrobust, HC, HAC and cluster are ' +
'currently connected')
lm_value = n * chain_dot(s,Sinv,s.T)
p_value = stats.chi2.sf(lm_value, df_diff)
return lm_value, p_value, df_diff
def compare_f_test(self, restricted):
"""use F test to test whether restricted model is correct
Parameters
----------
restricted : Result instance
The restricted model is assumed to be nested in the current
model. The result instance of the restricted model is required to
have two attributes, residual sum of squares, `ssr`, residual
degrees of freedom, `df_resid`.
Returns
-------
f_value : float
test statistic, F distributed
p_value : float
p-value of the test statistic
df_diff : int
degrees of freedom of the restriction, i.e. difference in df between
models
Notes
-----
See mailing list discussion October 17,
This test compares the residual sum of squares of the two models.
This is not a valid test, if there is unspecified heteroscedasticity
or correlation. This method will issue a warning if this is detected
but still return the results under the assumption of homoscedasticity
and no autocorrelation (sphericity).
"""
has_robust1 = getattr(self, 'cov_type', 'nonrobust') != 'nonrobust'
has_robust2 = (getattr(restricted, 'cov_type', 'nonrobust') !=
'nonrobust')
if has_robust1 or has_robust2:
warnings.warn('F test for comparison is likely invalid with ' +
'robust covariance, proceeding anyway',
InvalidTestWarning)
ssr_full = self.ssr
ssr_restr = restricted.ssr
df_full = self.df_resid
df_restr = restricted.df_resid
df_diff = (df_restr - df_full)
f_value = (ssr_restr - ssr_full) / df_diff / ssr_full * df_full
p_value = stats.f.sf(f_value, df_diff, df_full)
return f_value, p_value, df_diff
def compare_lr_test(self, restricted, large_sample=False):
"""
Likelihood ratio test to test whether restricted model is correct
Parameters
----------
restricted : Result instance
The restricted model is assumed to be nested in the current model.
The result instance of the restricted model is required to have two
attributes, residual sum of squares, `ssr`, residual degrees of
freedom, `df_resid`.
large_sample : bool
Flag indicating whether to use a heteroskedasticity robust version
of the LR test, which is a modified LM test.
Returns
-------
lr_stat : float
likelihood ratio, chisquare distributed with df_diff degrees of
freedom
p_value : float
p-value of the test statistic
df_diff : int
degrees of freedom of the restriction, i.e. difference in df between
models
Notes
-----
The exact likelihood ratio is valid for homoskedastic data, and is
defined as
.. math:: D=-2\\log\\left(\\frac{\\mathcal{L}_{null}}
{\\mathcal{L}_{alternative}}\\right)
where :math:`\mathcal{L}` is the likelihood of the model. With :math:`D`
distributed as chisquare with df equal to difference in number of
parameters or equivalently difference in residual degrees of freedom.
The large sample version of the likelihood ratio is defined as
.. math:: D=n s^{\\prime}S^{-1}s
where :math:`s=n^{-1}\\sum_{i=1}^{n} s_{i}`
.. math:: s_{i} = x_{i,alternative} \\epsilon_{i,null}
is the average score of the model evaluated using the residuals from
null model and the regressors from the alternative model and :math:`S`
is the covariance of the scores, :math:`s_{i}`. The covariance of the
scores is estimated using the same estimator as in the alternative model.
This test compares the loglikelihood of the two models.
This may not be a valid test, if there is unspecified heteroscedasticity
or correlation. This method will issue a warning if this is detected
but still return the results without taking unspecified
heteroscedasticity or correlation into account.
This test compares the loglikelihood of the two models.
This may not be a valid test, if there is unspecified heteroscedasticity
or correlation. This method will issue a warning if this is detected
but still return the results without taking unspecified
heteroscedasticity or correlation into account.
is the average score of the model evaluated using the residuals from
null model and the regressors from the alternative model and :math:`S`
is the covariance of the scores, :math:`s_{i}`. The covariance of the
scores is estimated using the same estimator as in the alternative model.
TODO: put into separate function, needs tests
"""
# See mailing list discussion October 17,
if large_sample:
return self.compare_lm_test(restricted, use_lr=True)
has_robust1 = (getattr(self, 'cov_type', 'nonrobust') != 'nonrobust')
has_robust2 = (getattr(restricted, 'cov_type', 'nonrobust') !=
'nonrobust')
if has_robust1 or has_robust2:
warnings.warn('Likelihood Ratio test is likely invalid with ' +
'robust covariance, proceeding anyway',
InvalidTestWarning)
llf_full = self.llf
llf_restr = restricted.llf
df_full = self.df_resid
df_restr = restricted.df_resid
lrdf = (df_restr - df_full)
lrstat = -2*(llf_restr - llf_full)
lr_pvalue = stats.chi2.sf(lrstat, lrdf)
return lrstat, lr_pvalue, lrdf
def get_robustcov_results(self, cov_type='HC1', use_t=None, **kwds):
"""create new results instance with robust covariance as default
Parameters
----------
cov_type : string
the type of robust sandwich estimator to use. see Notes below
use_t : bool
If true, then the t distribution is used for inference.
If false, then the normal distribution is used.
If `use_t` is None, then an appropriate default is used, which is
`true` if the cov_type is nonrobust, and `false` in all other cases.
kwds : depends on cov_type
Required or optional arguments for robust covariance calculation.
see Notes below
Returns
-------
results : results instance
This method creates a new results instance with the requested
robust covariance as the default covariance of the parameters.
Inferential statistics like p-values and hypothesis tests will be
based on this covariance matrix.
Notes
-----
The following covariance types and required or optional arguments are
currently available:
- 'fixed scale' and optional keyword argument 'scale' which uses
a predefined scale estimate with default equal to one.
- 'HC0', 'HC1', 'HC2', 'HC3' and no keyword arguments:
heteroscedasticity robust covariance
- 'HAC' and keywords
- `maxlag` integer (required) : number of lags to use
- `kernel` string (optional) : kernel, default is Bartlett
- `use_correction` bool (optional) : If true, use small sample
correction
- 'cluster' and required keyword `groups`, integer group indicator
- `groups` array_like, integer (required) :
index of clusters or groups
- `use_correction` bool (optional) :
If True the sandwich covariance is calulated with a small
sample correction.
If False the the sandwich covariance is calulated without
small sample correction.
- `df_correction` bool (optional)
If True (default), then the degrees of freedom for the
inferential statistics and hypothesis tests, such as
pvalues, f_pvalue, conf_int, and t_test and f_test, are
based on the number of groups minus one instead of the
total number of observations minus the number of explanatory
variables. `df_resid` of the results instance is adjusted.
If False, then `df_resid` of the results instance is not
adjusted.
- 'hac-groupsum' Driscoll and Kraay, heteroscedasticity and
autocorrelation robust standard errors in panel data
keywords
- `time` array_like (required) : index of time periods
- `maxlag` integer (required) : number of lags to use
- `kernel` string (optional) : kernel, default is Bartlett
- `use_correction` False or string in ['hac', 'cluster'] (optional) :
If False the the sandwich covariance is calulated without
small sample correction.
If `use_correction = 'cluster'` (default), then the same
small sample correction as in the case of 'covtype='cluster''
is used.
- `df_correction` bool (optional)
adjustment to df_resid, see cov_type 'cluster' above
#TODO: we need more options here
- 'hac-panel' heteroscedasticity and autocorrelation robust standard
errors in panel data.
The data needs to be sorted in this case, the time series for
each panel unit or cluster need to be stacked.
keywords
- `time` array_like (required) : index of time periods
- `maxlag` integer (required) : number of lags to use
- `kernel` string (optional) : kernel, default is Bartlett
- `use_correction` False or string in ['hac', 'cluster'] (optional) :
If False the the sandwich covariance is calulated without
small sample correction.
- `df_correction` bool (optional)
adjustment to df_resid, see cov_type 'cluster' above
#TODO: we need more options here
Reminder:
`use_correction` in "nw-groupsum" and "nw-panel" is not bool,
needs to be in [False, 'hac', 'cluster']
TODO: Currently there is no check for extra or misspelled keywords,
except in the case of cov_type `HCx`
"""
import statsmodels.stats.sandwich_covariance as sw
# TODO: make separate function that returns a robust cov plus info
use_self = kwds.pop('use_self', False)
if use_self:
res = self
else:
res = self.__class__(self.model, self.params,
normalized_cov_params=self.normalized_cov_params,
scale=self.scale)
res.cov_type = cov_type
# use_t might already be defined by the class, and already set
if use_t is None:
use_t = self.use_t
res.cov_kwds = {'use_t':use_t} # store for information
res.use_t = use_t
adjust_df = False
if cov_type in ['cluster', 'nw-panel', 'nw-groupsum']:
df_correction = kwds.get('df_correction', None)
# TODO: check also use_correction, do I need all combinations?
if df_correction is not False: # i.e. in [None, True]:
# user didn't explicitely set it to False
adjust_df = True
res.cov_kwds['adjust_df'] = adjust_df
# verify and set kwds, and calculate cov
# TODO: this should be outsourced in a function so we can reuse it in
# other models
# TODO: make it DRYer repeated code for checking kwds
if cov_type in ['fixed scale', 'fixed_scale']:
res.cov_kwds['description'] = ('Standard Errors are based on ' +
'fixed scale')
res.cov_kwds['scale'] = scale = kwds.get('scale', 1.)
res.cov_params_default = scale * res.normalized_cov_params
elif cov_type in ('HC0', 'HC1', 'HC2', 'HC3'):
if kwds:
raise ValueError('heteroscedasticity robust covarians ' +
'does not use keywords')
res.cov_kwds['description'] = ('Standard Errors are heteroscedasticity ' +
'robust ' + '(' + cov_type + ')')
# TODO cannot access cov without calling se first
getattr(self, cov_type.upper() + '_se')
res.cov_params_default = getattr(self, 'cov_' + cov_type.upper())
elif cov_type == 'HAC':
maxlags = kwds['maxlags'] # required?, default in cov_hac_simple
res.cov_kwds['maxlags'] = maxlags
use_correction = kwds.get('use_correction', False)
res.cov_kwds['use_correction'] = use_correction
res.cov_kwds['description'] = ('Standard Errors are heteroscedasticity ' +
'and autocorrelation robust (HAC) using %d lags and %s small ' +
'sample correction') % (maxlags, ['without', 'with'][use_correction])
res.cov_params_default = sw.cov_hac_simple(self, nlags=maxlags,
use_correction=use_correction)
elif cov_type == 'cluster':
#cluster robust standard errors, one- or two-way
groups = kwds['groups']
if not hasattr(groups, 'shape'):
groups = np.asarray(groups).T
if groups.ndim >= 2:
groups = groups.squeeze()
res.cov_kwds['groups'] = groups
use_correction = kwds.get('use_correction', True)
res.cov_kwds['use_correction'] = use_correction
if groups.ndim == 1:
if adjust_df:
# need to find number of groups
# duplicate work
self.n_groups = n_groups = len(np.unique(groups))
res.cov_params_default = sw.cov_cluster(self, groups,
use_correction=use_correction)
elif groups.ndim == 2:
if hasattr(groups, 'values'):
groups = groups.values
if adjust_df:
# need to find number of groups
# duplicate work
n_groups0 = len(np.unique(groups[:,0]))
n_groups1 = len(np.unique(groups[:, 1]))
self.n_groups = (n_groups0, n_groups1)
n_groups = min(n_groups0, n_groups1) # use for adjust_df
# Note: sw.cov_cluster_2groups has 3 returns
res.cov_params_default = sw.cov_cluster_2groups(self, groups,
use_correction=use_correction)[0]
else:
raise ValueError('only two groups are supported')
res.cov_kwds['description'] = ('Standard Errors are robust to' +
'cluster correlation ' + '(' + cov_type + ')')
elif cov_type == 'nw-panel':
#cluster robust standard errors
res.cov_kwds['time'] = time = kwds['time']
#TODO: nlags is currently required
#nlags = kwds.get('nlags', True)
#res.cov_kwds['nlags'] = nlags
#TODO: `nlags` or `maxlags`
res.cov_kwds['maxlags'] = maxlags = kwds['maxlags']
use_correction = kwds.get('use_correction', 'hac')
res.cov_kwds['use_correction'] = use_correction
weights_func = kwds.get('weights_func', sw.weights_bartlett)
res.cov_kwds['weights_func'] = weights_func
# TODO: clumsy time index in cov_nw_panel
tt = (np.nonzero(np.diff(time) < 0)[0] + 1).tolist()
groupidx = lzip([0] + tt, tt + [len(time)])
self.n_groups = n_groups = len(groupidx)
res.cov_params_default = sw.cov_nw_panel(self, maxlags, groupidx,
weights_func=weights_func,
use_correction=use_correction)
res.cov_kwds['description'] = ('Standard Errors are robust to' +
'cluster correlation ' + '(' + cov_type + ')')
elif cov_type == 'nw-groupsum':
# Driscoll-Kraay standard errors
res.cov_kwds['time'] = time = kwds['time']
#TODO: nlags is currently required
#nlags = kwds.get('nlags', True)
#res.cov_kwds['nlags'] = nlags
#TODO: `nlags` or `maxlags`
res.cov_kwds['maxlags'] = maxlags = kwds['maxlags']
use_correction = kwds.get('use_correction', 'cluster')
res.cov_kwds['use_correction'] = use_correction
weights_func = kwds.get('weights_func', sw.weights_bartlett)
res.cov_kwds['weights_func'] = weights_func
if adjust_df:
# need to find number of groups
tt = (np.nonzero(np.diff(time) < 0)[0] + 1)
self.n_groups = n_groups = len(tt) + 1
res.cov_params_default = sw.cov_nw_groupsum(self, maxlags, time,
weights_func=weights_func,
use_correction=use_correction)
res.cov_kwds['description'] = (
'Driscoll and Kraay Standard Errors are robust to ' +
'cluster correlation ' + '(' + cov_type + ')')
else:
raise ValueError('cov_type not recognized. See docstring for ' +
'available options and spelling')
if adjust_df:
# Note: df_resid is used for scale and others, add new attribute
res.df_resid_inference = n_groups - 1
return res
def get_prediction(self, exog=None, transform=True, weights=None,
row_labels=None, **kwds):
return pred.get_prediction(self, exog=exog, transform=transform,
weights=weights, row_labels=row_labels, **kwds)
get_prediction.__doc__ = pred.get_prediction.__doc__
def summary(self, yname=None, xname=None, title=None, alpha=.05):
"""Summarize the Regression Results
Parameters
-----------
yname : string, optional
Default is `y`
xname : list of strings, optional
Default is `var_##` for ## in p the number of regressors
title : string, optional
Title for the top table. If not None, then this replaces the
default title
alpha : float
significance level for the confidence intervals
Returns
-------
smry : Summary instance
this holds the summary tables and text, which can be printed or
converted to various output formats.
See Also
--------
statsmodels.iolib.summary.Summary : class to hold summary
results
"""
#TODO: import where we need it (for now), add as cached attributes
from statsmodels.stats.stattools import (jarque_bera,
omni_normtest, durbin_watson)
jb, jbpv, skew, kurtosis = jarque_bera(self.wresid)
omni, omnipv = omni_normtest(self.wresid)
eigvals = self.eigenvals
condno = self.condition_number
self.diagn = dict(jb=jb, jbpv=jbpv, skew=skew, kurtosis=kurtosis,
omni=omni, omnipv=omnipv, condno=condno,
mineigval=eigvals[-1])
#TODO not used yet
#diagn_left_header = ['Models stats']
#diagn_right_header = ['Residual stats']
#TODO: requiring list/iterable is a bit annoying
#need more control over formatting
#TODO: default don't work if it's not identically spelled
top_left = [('Dep. Variable:', None),
('Model:', None),
('Method:', ['Least Squares']),
('Date:', None),
('Time:', None),
('No. Observations:', None),
('Df Residuals:', None), #[self.df_resid]), #TODO: spelling
('Df Model:', None), #[self.df_model])
]
if hasattr(self, 'cov_type'):
top_left.append(('Covariance Type:', [self.cov_type]))
top_right = [('R-squared:', ["%#8.3f" % self.rsquared]),
('Adj. R-squared:', ["%#8.3f" % self.rsquared_adj]),
('F-statistic:', ["%#8.4g" % self.fvalue] ),
('Prob (F-statistic):', ["%#6.3g" % self.f_pvalue]),
('Log-Likelihood:', None), #["%#6.4g" % self.llf]),
('AIC:', ["%#8.4g" % self.aic]),
('BIC:', ["%#8.4g" % self.bic])
]
diagn_left = [('Omnibus:', ["%#6.3f" % omni]),
('Prob(Omnibus):', ["%#6.3f" % omnipv]),
('Skew:', ["%#6.3f" % skew]),
('Kurtosis:', ["%#6.3f" % kurtosis])
]
diagn_right = [('Durbin-Watson:', ["%#8.3f" % durbin_watson(self.wresid)]),
('Jarque-Bera (JB):', ["%#8.3f" % jb]),
('Prob(JB):', ["%#8.3g" % jbpv]),
('Cond. No.', ["%#8.3g" % condno])
]
if title is None:
title = self.model.__class__.__name__ + ' ' + "Regression Results"
#create summary table instance
from statsmodels.iolib.summary import Summary
smry = Summary()
smry.add_table_2cols(self, gleft=top_left, gright=top_right,
yname=yname, xname=xname, title=title)
smry.add_table_params(self, yname=yname, xname=xname, alpha=alpha,
use_t=self.use_t)
smry.add_table_2cols(self, gleft=diagn_left, gright=diagn_right,
yname=yname, xname=xname,
title="")
#add warnings/notes, added to text format only
etext =[]
if hasattr(self, 'cov_type'):
etext.append(self.cov_kwds['description'])
if self.model.exog.shape[0] < self.model.exog.shape[1]:
wstr = "The input rank is higher than the number of observations."
etext.append(wstr)
if eigvals[-1] < 1e-10:
wstr = "The smallest eigenvalue is %6.3g. This might indicate "
wstr += "that there are\n"
wstr += "strong multicollinearity problems or that the design "
wstr += "matrix is singular."
wstr = wstr % eigvals[-1]
etext.append(wstr)
elif condno > 1000: #TODO: what is recommended
wstr = "The condition number is large, %6.3g. This might "
wstr += "indicate that there are\n"
wstr += "strong multicollinearity or other numerical "
wstr += "problems."
wstr = wstr % condno
etext.append(wstr)
if etext:
etext = ["[{0}] {1}".format(i + 1, text) for i, text in enumerate(etext)]
etext.insert(0, "Warnings:")
smry.add_extra_txt(etext)
return smry
#top = summary_top(self, gleft=topleft, gright=diagn_left, #[],
# yname=yname, xname=xname,
# title=self.model.__class__.__name__ + ' ' +
# "Regression Results")
#par = summary_params(self, yname=yname, xname=xname, alpha=.05,
# use_t=False)
#
#diagn = summary_top(self, gleft=diagn_left, gright=diagn_right,
# yname=yname, xname=xname,
# title="Linear Model")
#
#return summary_return([top, par, diagn], return_fmt=return_fmt)
def summary2(self, yname=None, xname=None, title=None, alpha=.05,
float_format="%.4f"):
"""Experimental summary function to summarize the regression results
Parameters
-----------
xname : List of strings of length equal to the number of parameters
Names of the independent variables (optional)
yname : string
Name of the dependent variable (optional)
title : string, optional
Title for the top table. If not None, then this replaces the
default title
alpha : float
significance level for the confidence intervals
float_format: string
print format for floats in parameters summary
Returns
-------
smry : Summary instance
this holds the summary tables and text, which can be printed or
converted to various output formats.
See Also
--------
statsmodels.iolib.summary.Summary : class to hold summary
results
"""
# Diagnostics
from statsmodels.stats.stattools import (jarque_bera,
omni_normtest,
durbin_watson)
from statsmodels.compat.collections import OrderedDict
jb, jbpv, skew, kurtosis = jarque_bera(self.wresid)
omni, omnipv = omni_normtest(self.wresid)
dw = durbin_watson(self.wresid)
eigvals = self.eigenvals
condno = self.condition_number
eigvals = np.sort(eigvals) #in increasing order
diagnostic = OrderedDict([
('Omnibus:', "%.3f" % omni),
('Prob(Omnibus):', "%.3f" % omnipv),
('Skew:', "%.3f" % skew),
('Kurtosis:', "%.3f" % kurtosis),
('Durbin-Watson:', "%.3f" % dw),
('Jarque-Bera (JB):', "%.3f" % jb),
('Prob(JB):', "%.3f" % jbpv),
('Condition No.:', "%.0f" % condno)
])
# Summary
from statsmodels.iolib import summary2
smry = summary2.Summary()
smry.add_base(results=self, alpha=alpha, float_format=float_format,
xname=xname, yname=yname, title=title)
smry.add_dict(diagnostic)
# Warnings
if eigvals[-1] < 1e-10:
warn = "The smallest eigenvalue is %6.3g. This might indicate that\
there are strong multicollinearity problems or that the design\
matrix is singular." % eigvals[-1]
smry.add_text(warn)
if condno > 1000:
warn = "* The condition number is large (%.g). This might indicate \
strong multicollinearity or other numerical problems." % condno
smry.add_text(warn)
return smry
class OLSResults(RegressionResults):
"""
Results class for for an OLS model.
Most of the methods and attributes are inherited from RegressionResults.
The special methods that are only available for OLS are:
- get_influence
- outlier_test
- el_test
- conf_int_el
See Also
--------
RegressionResults
"""
def get_influence(self):
"""
get an instance of Influence with influence and outlier measures
Returns
-------
infl : Influence instance
the instance has methods to calculate the main influence and
outlier measures for the OLS regression
See also
--------
:class:`statsmodels.stats.outliers_influence.OLSInfluence`
"""
from statsmodels.stats.outliers_influence import OLSInfluence
return OLSInfluence(self)
def outlier_test(self, method='bonf', alpha=.05):
"""
Test observations for outliers according to method
Parameters
----------
method : str
- `bonferroni` : one-step correction
- `sidak` : one-step correction
- `holm-sidak` :
- `holm` :
- `simes-hochberg` :
- `hommel` :
- `fdr_bh` : Benjamini/Hochberg
- `fdr_by` : Benjamini/Yekutieli
See `statsmodels.stats.multitest.multipletests` for details.
alpha : float
familywise error rate
Returns
-------
table : ndarray or DataFrame
Returns either an ndarray or a DataFrame if labels is not None.
Will attempt to get labels from model_results if available. The
columns are the Studentized residuals, the unadjusted p-value,
and the corrected p-value according to method.
Notes
-----
The unadjusted p-value is stats.t.sf(abs(resid), df) where
df = df_resid - 1.
"""
from statsmodels.stats.outliers_influence import outlier_test
return outlier_test(self, method, alpha)
def el_test(self, b0_vals, param_nums, return_weights=0,
ret_params=0, method='nm',
stochastic_exog=1, return_params=0):
"""
Tests single or joint hypotheses of the regression parameters using
Empirical Likelihood.
Parameters
----------
b0_vals : 1darray
The hypothesized value of the parameter to be tested
param_nums : 1darray
The parameter number to be tested
print_weights : bool
If true, returns the weights that optimize the likelihood
ratio at b0_vals. Default is False
ret_params : bool
If true, returns the parameter vector that maximizes the likelihood
ratio at b0_vals. Also returns the weights. Default is False
method : string
Can either be 'nm' for Nelder-Mead or 'powell' for Powell. The
optimization method that optimizes over nuisance parameters.
Default is 'nm'
stochastic_exog : bool
When TRUE, the exogenous variables are assumed to be stochastic.
When the regressors are nonstochastic, moment conditions are
placed on the exogenous variables. Confidence intervals for
stochastic regressors are at least as large as non-stochastic
regressors. Default = TRUE
Returns
-------
res : tuple
The p-value and -2 times the log-likelihood ratio for the
hypothesized values.
Examples
--------
>>> import statsmodels.api as sm
>>> data = sm.datasets.stackloss.load()
>>> endog = data.endog
>>> exog = sm.add_constant(data.exog)
>>> model = sm.OLS(endog, exog)
>>> fitted = model.fit()
>>> fitted.params
>>> array([-39.91967442, 0.7156402 , 1.29528612, -0.15212252])
>>> fitted.rsquared
>>> 0.91357690446068196
>>> # Test that the slope on the first variable is 0
>>> fitted.test_beta([0], [1])
>>> (1.7894660442330235e-07, 27.248146353709153)
"""
params = np.copy(self.params)
opt_fun_inst = _ELRegOpts() # to store weights
if len(param_nums) == len(params):
llr = opt_fun_inst._opt_nuis_regress([],
param_nums=param_nums,
endog=self.model.endog,
exog=self.model.exog,
nobs=self.model.nobs,
nvar=self.model.exog.shape[1],
params=params,
b0_vals=b0_vals,
stochastic_exog=stochastic_exog)
pval = 1 - stats.chi2.cdf(llr, len(param_nums))
if return_weights:
return llr, pval, opt_fun_inst.new_weights
else:
return llr, pval
x0 = np.delete(params, param_nums)
args = (param_nums, self.model.endog, self.model.exog,
self.model.nobs, self.model.exog.shape[1], params,
b0_vals, stochastic_exog)
if method == 'nm':
llr = optimize.fmin(opt_fun_inst._opt_nuis_regress, x0, maxfun=10000,
maxiter=10000, full_output=1, disp=0,
args=args)[1]
if method == 'powell':
llr = optimize.fmin_powell(opt_fun_inst._opt_nuis_regress, x0,
full_output=1, disp=0,
args=args)[1]
pval = 1 - stats.chi2.cdf(llr, len(param_nums))
if ret_params:
return llr, pval, opt_fun_inst.new_weights, opt_fun_inst.new_params
elif return_weights:
return llr, pval, opt_fun_inst.new_weights
else:
return llr, pval
def conf_int_el(self, param_num, sig=.05, upper_bound=None, lower_bound=None,
method='nm', stochastic_exog=1):
"""
Computes the confidence interval for the parameter given by param_num
using Empirical Likelihood
Parameters
----------
param_num : float
The parameter for which the confidence interval is desired
sig : float
The significance level. Default is .05
upper_bound : float
The maximum value the upper limit can be. Default is the
99.9% confidence value under OLS assumptions.
lower_bound : float
The minimum value the lower limit can be. Default is the 99.9%
confidence value under OLS assumptions.
method : string
Can either be 'nm' for Nelder-Mead or 'powell' for Powell. The
optimization method that optimizes over nuisance parameters.
Default is 'nm'
Returns
-------
ci : tuple
The confidence interval
See Also
--------
el_test
Notes
-----
This function uses brentq to find the value of beta where
test_beta([beta], param_num)[1] is equal to the critical
value.
The function returns the results of each iteration of brentq at
each value of beta.
The current function value of the last printed optimization
should be the critical value at the desired significance level.
For alpha=.05, the value is 3.841459.
To ensure optimization terminated successfully, it is suggested to
do el_test([lower_limit], [param_num])
If the optimization does not terminate successfully, consider switching
optimization algorithms.
If optimization is still not successful, try changing the values of
start_int_params. If the current function value repeatedly jumps
from a number between 0 and the critical value and a very large number
(>50), the starting parameters of the interior minimization need
to be changed.
"""
r0 = stats.chi2.ppf(1 - sig, 1)
if upper_bound is None:
upper_bound = self.conf_int(.01)[param_num][1]
if lower_bound is None:
lower_bound = self.conf_int(.01)[param_num][0]
f = lambda b0: self.el_test(np.array([b0]), np.array([param_num]),
method=method,
stochastic_exog=stochastic_exog)[0]-r0
lowerl = optimize.brenth(f, lower_bound,
self.params[param_num])
upperl = optimize.brenth(f, self.params[param_num],
upper_bound)
# ^ Seems to be faster than brentq in most cases
return (lowerl, upperl)
class RegressionResultsWrapper(wrap.ResultsWrapper):
_attrs = {
'chisq' : 'columns',
'sresid' : 'rows',
'weights' : 'rows',
'wresid' : 'rows',
'bcov_unscaled' : 'cov',
'bcov_scaled' : 'cov',
'HC0_se' : 'columns',
'HC1_se' : 'columns',
'HC2_se' : 'columns',
'HC3_se' : 'columns',
'norm_resid' : 'rows',
}
_wrap_attrs = wrap.union_dicts(base.LikelihoodResultsWrapper._attrs,
_attrs)
_methods = {}
_wrap_methods = wrap.union_dicts(
base.LikelihoodResultsWrapper._wrap_methods,
_methods)
wrap.populate_wrapper(RegressionResultsWrapper,
RegressionResults)
if __name__ == "__main__":
import statsmodels.api as sm
data = sm.datasets.longley.load()
data.exog = add_constant(data.exog, prepend=False)
ols_results = OLS(data.endog, data.exog).fit() #results
gls_results = GLS(data.endog, data.exog).fit() #results
print(ols_results.summary())
tables = ols_results.summary(returns='tables')
csv = ols_results.summary(returns='csv')
"""
Summary of Regression Results
=======================================
| Dependent Variable: ['y']|
| Model: OLS|
| Method: Least Squares|
| Date: Tue, 29 Jun 2010|
| Time: 22:32:21|
| # obs: 16.0|
| Df residuals: 9.0|
| Df model: 6.0|
===========================================================================
| coefficient std. error t-statistic prob.|
---------------------------------------------------------------------------
| x1 15.0619 84.9149 0.1774 0.8631|
| x2 -0.0358 0.0335 -1.0695 0.3127|
| x3 -2.0202 0.4884 -4.1364 0.002535|
| x4 -1.0332 0.2143 -4.8220 0.0009444|
| x5 -0.0511 0.2261 -0.2261 0.8262|
| x6 1829.1515 455.4785 4.0159 0.003037|
| const -3482258.6346 890420.3836 -3.9108 0.003560|
===========================================================================
| Models stats Residual stats |
---------------------------------------------------------------------------
| R-squared: 0.995479 Durbin-Watson: 2.55949 |
| Adjusted R-squared: 0.992465 Omnibus: 0.748615 |
| F-statistic: 330.285 Prob(Omnibus): 0.687765 |
| Prob (F-statistic): 4.98403e-10 JB: 0.352773 |
| Log likelihood: -109.617 Prob(JB): 0.838294 |
| AIC criterion: 233.235 Skew: 0.419984 |
| BIC criterion: 238.643 Kurtosis: 2.43373 |
---------------------------------------------------------------------------
"""
|
bsd-3-clause
|
Lucas-Armand/genetic-algorithm
|
dev/8ºSemana/testes of speed.py
|
5
|
3255
|
# -*- coding: utf-8 -*-
import os
import csv
import random
import numpy as np
import timeit
import time as Time
import matplotlib.pyplot as plt
import matplotlib.animation as animation
from itertools import product, combinations
class Block:
def __init__(self,point,a,b,c,weight,btype):
self.p=point
self.a=a
self.b=b
self.c=c
self.w=weight
self.t=btype
def csv_read(name): #Metodo de leitura, transforma um arquivo CSV em um vetor
CSV=open(name,'r')
dados=CSV.read()
dados=dados.replace(',','.')
dados=dados.replace(';',',')
CSV.close()
CSV=open("temp.csv",'w')
CSV.write(dados)
CSV.close()
CSV=open("temp.csv",'r')
dados=csv.reader(CSV)
v=[]
for i in dados:
I=[]
for j in i:
try:
j = float(j)
except:
pass
I.append(j)
v.append(I)
CSV.close()
os.remove("temp.csv")
return (v)
def defineGeometry(name):
vect = csv_read(name)
blockNumber ={}
for i in vect:
a = i[1]
b = i[2]
c = i[3]
point = [i[4],i[5],i[6]]
weight = i[7]
btype = i[-1]
block = Block(point,a,b,c,weight,btype)
blockNumber[i[0]] = block
return blockNumber
bNumb=defineGeometry('GeometriaNavio.csv')
# Define vicinity
#deck
vicinity={1:[2]}
for i in range(2,16):
vicinity[i] = [i-1,i+1]
vicinity[16] = [15]
#side
vicinity[17] = [18,19]
vicinity[18] = [17,20]
for i in range(19,31):
v = i-1 if i%2==0 else i+1
vicinity[i] = [v,i-2,i+2]
vicinity[31] = [29,32]
vicinity[32] = [30,31]
#bott
vicinity[33] = [34,35]
vicinity[34] = [33,36]
for i in range(35,63):
v = i-1 if i%2==0 else i+1
vicinity[i] = [v,i-2,i+2]
vicinity[63] = [61,64]
vicinity[64] = [63,62]
#coff
vicinity[65] = [66]
for i in range(66,70):
vicinity[i] = [i-1,i+1]
vicinity[70] = [69]
alfa = 10
beta = 1
built = []
time = 0
append = built.append
def order(x): return vicinity[x]
def time(bNumb,vicinity,chromo):
t_time = Time.time()
alfa = 1
built = []
time = 0
append = built.append
def time_vector(x,y):
for i in y:
if i in built:
time = alfa
break
try:time
except: time = 10*alfa
append(x)
return time
vic = [vicinity[x] for x in chromo]
time = sum((time_vector(x,y) for x,y in zip(chromo,vic)))
return time
chromo = [44, 39, 56, 47, 49, 37, 42, 46, 51, 58, 60, 62, 52, 41, 35, 33, 50, 61, 54, 34, 59, 43, 48, 45, 55, 53, 38, 57, 64, 67, 68, 63, 40, 36, 21, 66, 22, 6, 20, 65, 18, 5, 17, 69, 28, 27, 70, 29, 1, 12, 30, 13, 14, 26, 31, 24, 19, 2, 3, 4, 25, 11, 32, 10, 15, 16, 9, 23, 7, 8]
import cProfile
cProfile.run('time(bNumb,vicinity,chromo)')
##
##print timeit.timeit(setup='from __main__ import chromo;'+
## 'from __main__ import bNumb;'+
## 'from __main__ import time;'+
## 'from __main__ import vicinity '
## ,stmt='time(bNumb,vicinity,chromo)')
#print t.timeit(number = 1000000)
|
gpl-3.0
|
jchodera/assaytools
|
scripts/xml2png4scans.py
|
2
|
5177
|
# This script takes xml data file output from the Tecan Infinite m1000 Pro plate reader
# and makes quick and dirty images of the raw data.
#But with scans and not just singlet reads.
# The same procedure can be used to make matrices suitable for analysis using
# matrix = dataframe.values
# Made by Sonya Hanson, with some help from things that worked in xml2png.py
# Friday, June 20,2014
# Usage: python xml2png4scans.py *.xml
############ For future to combine with xml2png.py
#
# for i, sect in enumerate(Sections):
# reads = sect.xpath("*/Well")
# parameters = root.xpath(path)[0]
# if reads[0].attrib['Type'] == "Scan":
#
##############
import numpy as np
import matplotlib.pyplot as plt
from lxml import etree
import pandas as pd
import matplotlib.cm as cm
import seaborn
import sys
import os
# Define extract function that extracts parameters
def extract(taglist):
result = []
for p in taglist:
print "Attempting to extract tag '%s'..." % p
try:
param = parameters.xpath("*[@Name='" + p + "']")[0]
result.append( p + '=' + param.attrib['Value'])
except:
# tag not found
result.append(None)
return result
def process_files(xml_files):
so_many = len(xml_files)
print "****This script is about to make png files for %s xml files. ****" % so_many
for file in xml_files:
# Parse XML file.
root = etree.parse(file)
# Remove extension from xml filename.
file_name = os.path.splitext(file)[0]
# Extract plate type and barcode.
plate = root.xpath("/*/Header/Parameters/Parameter[@Name='Plate']")[0]
plate_type = plate.attrib['Value']
bar = root.xpath("/*/Plate/BC")[0]
barcode = bar.text
# Define Sections.
Sections = root.xpath("/*/Section")
much = len(Sections)
print "****The xml file " + file + " has %s data sections:****" % much
for sect in Sections:
print sect.attrib['Name']
data = []
for i, sect in enumerate(Sections):
# Extract Parameters for this section.
path = "/*/Section[@Name='" + sect.attrib['Name'] + "']/Parameters"
parameters = root.xpath(path)[0]
# Parameters are extracted slightly differently depending on Absorbance or Fluorescence read.
if parameters[0].attrib['Value'] == "Absorbance":
result = extract(["Mode", "Wavelength Start", "Wavelength End", "Wavelength Step Size"])
title = '%s, %s, %s, %s' % tuple(result)
else:
result = extract(["Gain", "Excitation Wavelength", "Emission Wavelength", "Part of Plate", "Mode"])
title = '%s, %s, %s, \n %s, %s' % tuple(result)
print "****The %sth section has the parameters:****" %i
print title
# Extract Reads for this section.
Sections = root.xpath("/*/Section")
reads = root.xpath("/*/*/*/Well")
wellIDs = [read.attrib['Pos'] for read in reads]
data = [(float(s.text), float(s.attrib['WL']), r.attrib['Pos'])
for r in reads
for s in r]
dataframe = pd.DataFrame(data, columns=['fluorescence','wavelength (nm)','Well'])
dataframe_pivot = pd.pivot_table(dataframe, index = 'wavelength (nm)', columns = ['Well'])
# Make plot, complete with separate png for each section.
section_name = sect.attrib['Name']
fig, axes = plt.subplots(nrows=3, ncols=3, figsize=(12, 12))
for i in range(1,12):
dataframe_pivot.fluorescence.get('A' + str(i)).plot(ax=axes[0,0], title='A', c=cm.hsv(i*15))
for i in range(1,12):
dataframe_pivot.fluorescence.get('B' + str(i)).plot(ax=axes[0,1], title='B', c=cm.hsv(i*15))
for i in range(1,12):
dataframe_pivot.fluorescence.get('C' + str(i)).plot(ax=axes[0,2], title='C', c=cm.hsv(i*15))
for i in range(1,12):
dataframe_pivot.fluorescence.get('D' + str(i)).plot(ax=axes[1,0], title='D', c=cm.hsv(i*15))
for i in range(1,12):
dataframe_pivot.fluorescence.get('E' + str(i)).plot(ax=axes[1,1], title='E', c=cm.hsv(i*15))
for i in range(1,12):
dataframe_pivot.fluorescence.get('F' + str(i)).plot(ax=axes[1,2], title='F', c=cm.hsv(i*15))
for i in range(1,12):
dataframe_pivot.fluorescence.get('G' + str(i)).plot(ax=axes[2,0], title='G', c=cm.hsv(i*15))
for i in range(1,12):
dataframe_pivot.fluorescence.get('H' + str(i)).plot(ax=axes[2,1], title='H', c=cm.hsv(i*15))
fig.suptitle('%s \n %s \n Barcode = %s' % (title, plate_type, barcode), fontsize=14)
fig.subplots_adjust(hspace=0.3)
plt.savefig('%s_%s.png' % (file_name, section_name))
return
def entry_point():
xml_files = sys.argv[1:]
process_files(xml_files)
if __name__ == '__main__':
xml_files = sys.argv[1:]
process_files(xml_files)
|
lgpl-2.1
|
kazemakase/scikit-learn
|
examples/plot_multilabel.py
|
87
|
4279
|
# Authors: Vlad Niculae, Mathieu Blondel
# License: BSD 3 clause
"""
=========================
Multilabel classification
=========================
This example simulates a multi-label document classification problem. The
dataset is generated randomly based on the following process:
- pick the number of labels: n ~ Poisson(n_labels)
- n times, choose a class c: c ~ Multinomial(theta)
- pick the document length: k ~ Poisson(length)
- k times, choose a word: w ~ Multinomial(theta_c)
In the above process, rejection sampling is used to make sure that n is more
than 2, and that the document length is never zero. Likewise, we reject classes
which have already been chosen. The documents that are assigned to both
classes are plotted surrounded by two colored circles.
The classification is performed by projecting to the first two principal
components found by PCA and CCA for visualisation purposes, followed by using
the :class:`sklearn.multiclass.OneVsRestClassifier` metaclassifier using two
SVCs with linear kernels to learn a discriminative model for each class.
Note that PCA is used to perform an unsupervised dimensionality reduction,
while CCA is used to perform a supervised one.
Note: in the plot, "unlabeled samples" does not mean that we don't know the
labels (as in semi-supervised learning) but that the samples simply do *not*
have a label.
"""
print(__doc__)
import numpy as np
import matplotlib.pyplot as plt
from sklearn.datasets import make_multilabel_classification
from sklearn.multiclass import OneVsRestClassifier
from sklearn.svm import SVC
from sklearn.preprocessing import LabelBinarizer
from sklearn.decomposition import PCA
from sklearn.cross_decomposition import CCA
def plot_hyperplane(clf, min_x, max_x, linestyle, label):
# get the separating hyperplane
w = clf.coef_[0]
a = -w[0] / w[1]
xx = np.linspace(min_x - 5, max_x + 5) # make sure the line is long enough
yy = a * xx - (clf.intercept_[0]) / w[1]
plt.plot(xx, yy, linestyle, label=label)
def plot_subfigure(X, Y, subplot, title, transform):
if transform == "pca":
X = PCA(n_components=2).fit_transform(X)
elif transform == "cca":
X = CCA(n_components=2).fit(X, Y).transform(X)
else:
raise ValueError
min_x = np.min(X[:, 0])
max_x = np.max(X[:, 0])
min_y = np.min(X[:, 1])
max_y = np.max(X[:, 1])
classif = OneVsRestClassifier(SVC(kernel='linear'))
classif.fit(X, Y)
plt.subplot(2, 2, subplot)
plt.title(title)
zero_class = np.where(Y[:, 0])
one_class = np.where(Y[:, 1])
plt.scatter(X[:, 0], X[:, 1], s=40, c='gray')
plt.scatter(X[zero_class, 0], X[zero_class, 1], s=160, edgecolors='b',
facecolors='none', linewidths=2, label='Class 1')
plt.scatter(X[one_class, 0], X[one_class, 1], s=80, edgecolors='orange',
facecolors='none', linewidths=2, label='Class 2')
plot_hyperplane(classif.estimators_[0], min_x, max_x, 'k--',
'Boundary\nfor class 1')
plot_hyperplane(classif.estimators_[1], min_x, max_x, 'k-.',
'Boundary\nfor class 2')
plt.xticks(())
plt.yticks(())
plt.xlim(min_x - .5 * max_x, max_x + .5 * max_x)
plt.ylim(min_y - .5 * max_y, max_y + .5 * max_y)
if subplot == 2:
plt.xlabel('First principal component')
plt.ylabel('Second principal component')
plt.legend(loc="upper left")
plt.figure(figsize=(8, 6))
X, Y = make_multilabel_classification(n_classes=2, n_labels=1,
allow_unlabeled=True,
return_indicator=True,
random_state=1)
plot_subfigure(X, Y, 1, "With unlabeled samples + CCA", "cca")
plot_subfigure(X, Y, 2, "With unlabeled samples + PCA", "pca")
X, Y = make_multilabel_classification(n_classes=2, n_labels=1,
allow_unlabeled=False,
return_indicator=True,
random_state=1)
plot_subfigure(X, Y, 3, "Without unlabeled samples + CCA", "cca")
plot_subfigure(X, Y, 4, "Without unlabeled samples + PCA", "pca")
plt.subplots_adjust(.04, .02, .97, .94, .09, .2)
plt.show()
|
bsd-3-clause
|
andaag/scikit-learn
|
examples/plot_johnson_lindenstrauss_bound.py
|
134
|
7452
|
"""
=====================================================================
The Johnson-Lindenstrauss bound for embedding with random projections
=====================================================================
The `Johnson-Lindenstrauss lemma`_ states that any high dimensional
dataset can be randomly projected into a lower dimensional Euclidean
space while controlling the distortion in the pairwise distances.
.. _`Johnson-Lindenstrauss lemma`: http://en.wikipedia.org/wiki/Johnson%E2%80%93Lindenstrauss_lemma
Theoretical bounds
==================
The distortion introduced by a random projection `p` is asserted by
the fact that `p` is defining an eps-embedding with good probability
as defined by:
(1 - eps) ||u - v||^2 < ||p(u) - p(v)||^2 < (1 + eps) ||u - v||^2
Where u and v are any rows taken from a dataset of shape [n_samples,
n_features] and p is a projection by a random Gaussian N(0, 1) matrix
with shape [n_components, n_features] (or a sparse Achlioptas matrix).
The minimum number of components to guarantees the eps-embedding is
given by:
n_components >= 4 log(n_samples) / (eps^2 / 2 - eps^3 / 3)
The first plot shows that with an increasing number of samples ``n_samples``,
the minimal number of dimensions ``n_components`` increased logarithmically
in order to guarantee an ``eps``-embedding.
The second plot shows that an increase of the admissible
distortion ``eps`` allows to reduce drastically the minimal number of
dimensions ``n_components`` for a given number of samples ``n_samples``
Empirical validation
====================
We validate the above bounds on the the digits dataset or on the 20 newsgroups
text document (TF-IDF word frequencies) dataset:
- for the digits dataset, some 8x8 gray level pixels data for 500
handwritten digits pictures are randomly projected to spaces for various
larger number of dimensions ``n_components``.
- for the 20 newsgroups dataset some 500 documents with 100k
features in total are projected using a sparse random matrix to smaller
euclidean spaces with various values for the target number of dimensions
``n_components``.
The default dataset is the digits dataset. To run the example on the twenty
newsgroups dataset, pass the --twenty-newsgroups command line argument to this
script.
For each value of ``n_components``, we plot:
- 2D distribution of sample pairs with pairwise distances in original
and projected spaces as x and y axis respectively.
- 1D histogram of the ratio of those distances (projected / original).
We can see that for low values of ``n_components`` the distribution is wide
with many distorted pairs and a skewed distribution (due to the hard
limit of zero ratio on the left as distances are always positives)
while for larger values of n_components the distortion is controlled
and the distances are well preserved by the random projection.
Remarks
=======
According to the JL lemma, projecting 500 samples without too much distortion
will require at least several thousands dimensions, irrespective of the
number of features of the original dataset.
Hence using random projections on the digits dataset which only has 64 features
in the input space does not make sense: it does not allow for dimensionality
reduction in this case.
On the twenty newsgroups on the other hand the dimensionality can be decreased
from 56436 down to 10000 while reasonably preserving pairwise distances.
"""
print(__doc__)
import sys
from time import time
import numpy as np
import matplotlib.pyplot as plt
from sklearn.random_projection import johnson_lindenstrauss_min_dim
from sklearn.random_projection import SparseRandomProjection
from sklearn.datasets import fetch_20newsgroups_vectorized
from sklearn.datasets import load_digits
from sklearn.metrics.pairwise import euclidean_distances
# Part 1: plot the theoretical dependency between n_components_min and
# n_samples
# range of admissible distortions
eps_range = np.linspace(0.1, 0.99, 5)
colors = plt.cm.Blues(np.linspace(0.3, 1.0, len(eps_range)))
# range of number of samples (observation) to embed
n_samples_range = np.logspace(1, 9, 9)
plt.figure()
for eps, color in zip(eps_range, colors):
min_n_components = johnson_lindenstrauss_min_dim(n_samples_range, eps=eps)
plt.loglog(n_samples_range, min_n_components, color=color)
plt.legend(["eps = %0.1f" % eps for eps in eps_range], loc="lower right")
plt.xlabel("Number of observations to eps-embed")
plt.ylabel("Minimum number of dimensions")
plt.title("Johnson-Lindenstrauss bounds:\nn_samples vs n_components")
# range of admissible distortions
eps_range = np.linspace(0.01, 0.99, 100)
# range of number of samples (observation) to embed
n_samples_range = np.logspace(2, 6, 5)
colors = plt.cm.Blues(np.linspace(0.3, 1.0, len(n_samples_range)))
plt.figure()
for n_samples, color in zip(n_samples_range, colors):
min_n_components = johnson_lindenstrauss_min_dim(n_samples, eps=eps_range)
plt.semilogy(eps_range, min_n_components, color=color)
plt.legend(["n_samples = %d" % n for n in n_samples_range], loc="upper right")
plt.xlabel("Distortion eps")
plt.ylabel("Minimum number of dimensions")
plt.title("Johnson-Lindenstrauss bounds:\nn_components vs eps")
# Part 2: perform sparse random projection of some digits images which are
# quite low dimensional and dense or documents of the 20 newsgroups dataset
# which is both high dimensional and sparse
if '--twenty-newsgroups' in sys.argv:
# Need an internet connection hence not enabled by default
data = fetch_20newsgroups_vectorized().data[:500]
else:
data = load_digits().data[:500]
n_samples, n_features = data.shape
print("Embedding %d samples with dim %d using various random projections"
% (n_samples, n_features))
n_components_range = np.array([300, 1000, 10000])
dists = euclidean_distances(data, squared=True).ravel()
# select only non-identical samples pairs
nonzero = dists != 0
dists = dists[nonzero]
for n_components in n_components_range:
t0 = time()
rp = SparseRandomProjection(n_components=n_components)
projected_data = rp.fit_transform(data)
print("Projected %d samples from %d to %d in %0.3fs"
% (n_samples, n_features, n_components, time() - t0))
if hasattr(rp, 'components_'):
n_bytes = rp.components_.data.nbytes
n_bytes += rp.components_.indices.nbytes
print("Random matrix with size: %0.3fMB" % (n_bytes / 1e6))
projected_dists = euclidean_distances(
projected_data, squared=True).ravel()[nonzero]
plt.figure()
plt.hexbin(dists, projected_dists, gridsize=100, cmap=plt.cm.PuBu)
plt.xlabel("Pairwise squared distances in original space")
plt.ylabel("Pairwise squared distances in projected space")
plt.title("Pairwise distances distribution for n_components=%d" %
n_components)
cb = plt.colorbar()
cb.set_label('Sample pairs counts')
rates = projected_dists / dists
print("Mean distances rate: %0.2f (%0.2f)"
% (np.mean(rates), np.std(rates)))
plt.figure()
plt.hist(rates, bins=50, normed=True, range=(0., 2.))
plt.xlabel("Squared distances rate: projected / original")
plt.ylabel("Distribution of samples pairs")
plt.title("Histogram of pairwise distance rates for n_components=%d" %
n_components)
# TODO: compute the expected value of eps and add them to the previous plot
# as vertical lines / region
plt.show()
|
bsd-3-clause
|
smorante/continuous-goal-directed-actions
|
demonstration-feature-selection/src/alternatives/main_dtw_mds_dbscan.py
|
2
|
3384
|
# -*- coding: utf-8 -*-
"""
Author: Santiago Morante
Robotics Lab. Universidad Carlos III de Madrid
"""
########################## DTW ####################################
import libmddtw
import matplotlib.pyplot as plt
from dtw import dtw
########################## MDS ####################################
import numpy as np
from sklearn.metrics import euclidean_distances
import libmds
########################## DBSCAN ####################################
import libdbscan
from sklearn.preprocessing import StandardScaler # to normalize
import glob
from sklearn import preprocessing
EXPERIMENT = "experiment-1"
PATH = "../datasets/" + EXPERIMENT +"/raw/*.csv"
def normalize(X):
return StandardScaler().fit_transform(X)
def standardize(X):
return preprocessing.scale(X)
def main():
demons=[]
demoNames = sorted(glob.glob(PATH))
print demoNames
for elem in demoNames:
tmp = np.loadtxt(elem)
tmp_clean = tmp[:,1:]
tmp_clean = standardize(tmp_clean)
demons.append(tmp_clean)
dist=np.zeros((len(demoNames),len(demoNames)))
##########################################################################
########################## DTW ####################################
##########################################################################
# fill distance matrix
for i in range(len(demoNames)):
for j in range(len(demoNames)):
mddtw = libmddtw.Mddtw()
x,y = mddtw.collapseRows(demons[i],demons[j])
#fig = plt.figure()
#plt.plot(x)
#plt.plot(y)
singleDist, singleCost, singlePath = mddtw.compute(demons[i],demons[j])
dist[i][j]=singleDist
# print 'Minimum distance found:', singleDist
#fig = plt.figure()
# plt.imshow(cost.T, origin='lower', cmap=plt.cm.gray, interpolation='nearest')
# plt.plot(path[0], path[1], 'w')
# plt.xlim((-0.5, cost.shape[0]-0.5))
# plt.ylim((-0.5, cost.shape[1]-0.5))
# print "dist", dist
###########################################################################
########################### MDS ####################################
###########################################################################
md = libmds.Mds()
md.create(n_components=2, metric=True, max_iter=3000, eps=1e-12, random_state=None,
dissimilarity="precomputed", n_jobs=-1, n_init=100)
points = md.compute(dist)
print "points", points
# md.plot()
##########################################################################
########################## DBSCAN ####################################
##########################################################################
# normalize
normalizedPoints = normalize(points)
# ########################## dbscan
db = libdbscan.Dbscan()
db.create(eps=1.5, min_samples=2)
db.compute(normalizedPoints)
db.plot()
print "[INFO] Detected outliers: ", db.getOutliers()
##############################################################################
##############################################################################
if __name__ == "__main__":
main()
|
mit
|
sandeepgupta2k4/tensorflow
|
tensorflow/examples/learn/iris.py
|
35
|
1654
|
# Copyright 2016 The TensorFlow Authors. All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
"""Example of DNNClassifier for Iris plant dataset."""
from __future__ import absolute_import
from __future__ import division
from __future__ import print_function
from sklearn import datasets
from sklearn import metrics
from sklearn import model_selection
import tensorflow as tf
def main(unused_argv):
# Load dataset.
iris = datasets.load_iris()
x_train, x_test, y_train, y_test = model_selection.train_test_split(
iris.data, iris.target, test_size=0.2, random_state=42)
# Build 3 layer DNN with 10, 20, 10 units respectively.
feature_columns = tf.contrib.learn.infer_real_valued_columns_from_input(
x_train)
classifier = tf.contrib.learn.DNNClassifier(
feature_columns=feature_columns, hidden_units=[10, 20, 10], n_classes=3)
# Fit and predict.
classifier.fit(x_train, y_train, steps=200)
predictions = list(classifier.predict(x_test, as_iterable=True))
score = metrics.accuracy_score(y_test, predictions)
print('Accuracy: {0:f}'.format(score))
if __name__ == '__main__':
tf.app.run()
|
apache-2.0
|
raincoatrun/ThinkStats2
|
code/chap13soln.py
|
68
|
2961
|
"""This file contains code for use with "Think Stats",
by Allen B. Downey, available from greenteapress.com
Copyright 2014 Allen B. Downey
License: GNU GPLv3 http://www.gnu.org/licenses/gpl.html
"""
from __future__ import print_function
import pandas
import numpy as np
import thinkplot
import thinkstats2
import survival
def CleanData(resp):
"""Cleans respondent data.
resp: DataFrame
"""
resp.cmdivorcx.replace([9998, 9999], np.nan, inplace=True)
resp['notdivorced'] = resp.cmdivorcx.isnull().astype(int)
resp['duration'] = (resp.cmdivorcx - resp.cmmarrhx) / 12.0
resp['durationsofar'] = (resp.cmintvw - resp.cmmarrhx) / 12.0
month0 = pandas.to_datetime('1899-12-15')
dates = [month0 + pandas.DateOffset(months=cm)
for cm in resp.cmbirth]
resp['decade'] = (pandas.DatetimeIndex(dates).year - 1900) // 10
def ResampleDivorceCurve(resps):
"""Plots divorce curves based on resampled data.
resps: list of respondent DataFrames
"""
for _ in range(41):
samples = [thinkstats2.ResampleRowsWeighted(resp)
for resp in resps]
sample = pandas.concat(samples, ignore_index=True)
PlotDivorceCurveByDecade(sample, color='#225EA8', alpha=0.1)
thinkplot.Show(xlabel='years',
axis=[0, 28, 0, 1])
def ResampleDivorceCurveByDecade(resps):
"""Plots divorce curves for each birth cohort.
resps: list of respondent DataFrames
"""
for i in range(41):
samples = [thinkstats2.ResampleRowsWeighted(resp)
for resp in resps]
sample = pandas.concat(samples, ignore_index=True)
groups = sample.groupby('decade')
if i == 0:
survival.AddLabelsByDecade(groups, alpha=0.7)
EstimateSurvivalByDecade(groups, alpha=0.1)
thinkplot.Save(root='survival7',
xlabel='years',
axis=[0, 28, 0, 1])
def EstimateSurvivalByDecade(groups, **options):
"""Groups respondents by decade and plots survival curves.
groups: GroupBy object
"""
thinkplot.PrePlot(len(groups))
for name, group in groups:
print(name, len(group))
_, sf = EstimateSurvival(group)
thinkplot.Plot(sf, **options)
def EstimateSurvival(resp):
"""Estimates the survival curve.
resp: DataFrame of respondents
returns: pair of HazardFunction, SurvivalFunction
"""
complete = resp[resp.notdivorced == 0].duration
ongoing = resp[resp.notdivorced == 1].durationsofar
hf = survival.EstimateHazardFunction(complete, ongoing)
sf = hf.MakeSurvival()
return hf, sf
def main():
resp6 = survival.ReadFemResp2002()
CleanData(resp6)
married6 = resp6[resp6.evrmarry==1]
resp7 = survival.ReadFemResp2010()
CleanData(resp7)
married7 = resp7[resp7.evrmarry==1]
ResampleDivorceCurveByDecade([married6, married7])
if __name__ == '__main__':
main()
|
gpl-3.0
|
mistercrunch/panoramix
|
superset/db_engine_specs/hive.py
|
1
|
20297
|
# Licensed to the Apache Software Foundation (ASF) under one
# or more contributor license agreements. See the NOTICE file
# distributed with this work for additional information
# regarding copyright ownership. The ASF licenses this file
# to you under the Apache License, Version 2.0 (the
# "License"); you may not use this file except in compliance
# with the License. You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing,
# software distributed under the License is distributed on an
# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
# KIND, either express or implied. See the License for the
# specific language governing permissions and limitations
# under the License.
import logging
import os
import re
import tempfile
import time
from datetime import datetime
from typing import Any, Dict, List, Optional, Tuple, TYPE_CHECKING
from urllib import parse
import numpy as np
import pandas as pd
import pyarrow as pa
import pyarrow.parquet as pq
from flask import current_app, g
from sqlalchemy import Column, text
from sqlalchemy.engine.base import Engine
from sqlalchemy.engine.reflection import Inspector
from sqlalchemy.engine.url import make_url, URL
from sqlalchemy.orm import Session
from sqlalchemy.sql.expression import ColumnClause, Select
from superset.db_engine_specs.base import BaseEngineSpec
from superset.db_engine_specs.presto import PrestoEngineSpec
from superset.exceptions import SupersetException
from superset.extensions import cache_manager
from superset.models.sql_lab import Query
from superset.sql_parse import ParsedQuery, Table
from superset.utils import core as utils
if TYPE_CHECKING:
# prevent circular imports
from superset.models.core import Database
QueryStatus = utils.QueryStatus
logger = logging.getLogger(__name__)
def upload_to_s3(filename: str, upload_prefix: str, table: Table) -> str:
"""
Upload the file to S3.
:param filename: The file to upload
:param upload_prefix: The S3 prefix
:param table: The table that will be created
:returns: The S3 location of the table
"""
# Optional dependency
import boto3 # pylint: disable=import-error
bucket_path = current_app.config["CSV_TO_HIVE_UPLOAD_S3_BUCKET"]
if not bucket_path:
logger.info("No upload bucket specified")
raise Exception(
"No upload bucket specified. You can specify one in the config file."
)
s3 = boto3.client("s3")
location = os.path.join("s3a://", bucket_path, upload_prefix, table.table)
s3.upload_file(
filename,
bucket_path,
os.path.join(upload_prefix, table.table, os.path.basename(filename)),
)
return location
class HiveEngineSpec(PrestoEngineSpec):
"""Reuses PrestoEngineSpec functionality."""
engine = "hive"
engine_name = "Apache Hive"
max_column_name_length = 767
allows_alias_to_source_column = True
allows_hidden_ordeby_agg = False
# When running `SHOW FUNCTIONS`, what is the name of the column with the
# function names?
_show_functions_column = "tab_name"
# pylint: disable=line-too-long
_time_grain_expressions = {
None: "{col}",
"PT1S": "from_unixtime(unix_timestamp({col}), 'yyyy-MM-dd HH:mm:ss')",
"PT1M": "from_unixtime(unix_timestamp({col}), 'yyyy-MM-dd HH:mm:00')",
"PT1H": "from_unixtime(unix_timestamp({col}), 'yyyy-MM-dd HH:00:00')",
"P1D": "from_unixtime(unix_timestamp({col}), 'yyyy-MM-dd 00:00:00')",
"P1W": "date_format(date_sub({col}, CAST(7-from_unixtime(unix_timestamp({col}),'u') as int)), 'yyyy-MM-dd 00:00:00')",
"P1M": "from_unixtime(unix_timestamp({col}), 'yyyy-MM-01 00:00:00')",
"P0.25Y": "date_format(add_months(trunc({col}, 'MM'), -(month({col})-1)%3), 'yyyy-MM-dd 00:00:00')",
"P1Y": "from_unixtime(unix_timestamp({col}), 'yyyy-01-01 00:00:00')",
"P1W/1970-01-03T00:00:00Z": "date_format(date_add({col}, INT(6-from_unixtime(unix_timestamp({col}), 'u'))), 'yyyy-MM-dd 00:00:00')",
"1969-12-28T00:00:00Z/P1W": "date_format(date_add({col}, -INT(from_unixtime(unix_timestamp({col}), 'u'))), 'yyyy-MM-dd 00:00:00')",
}
# Scoping regex at class level to avoid recompiling
# 17/02/07 19:36:38 INFO ql.Driver: Total jobs = 5
jobs_stats_r = re.compile(r".*INFO.*Total jobs = (?P<max_jobs>[0-9]+)")
# 17/02/07 19:37:08 INFO ql.Driver: Launching Job 2 out of 5
launching_job_r = re.compile(
".*INFO.*Launching Job (?P<job_number>[0-9]+) out of " "(?P<max_jobs>[0-9]+)"
)
# 17/02/07 19:36:58 INFO exec.Task: 2017-02-07 19:36:58,152 Stage-18
# map = 0%, reduce = 0%
stage_progress_r = re.compile(
r".*INFO.*Stage-(?P<stage_number>[0-9]+).*"
r"map = (?P<map_progress>[0-9]+)%.*"
r"reduce = (?P<reduce_progress>[0-9]+)%.*"
)
@classmethod
def patch(cls) -> None:
from pyhive import hive
from TCLIService import (
constants as patched_constants,
TCLIService as patched_TCLIService,
ttypes as patched_ttypes,
)
from superset.db_engines import hive as patched_hive
hive.TCLIService = patched_TCLIService
hive.constants = patched_constants
hive.ttypes = patched_ttypes
hive.Cursor.fetch_logs = patched_hive.fetch_logs
@classmethod
def get_all_datasource_names(
cls, database: "Database", datasource_type: str
) -> List[utils.DatasourceName]:
return BaseEngineSpec.get_all_datasource_names(database, datasource_type)
@classmethod
def fetch_data(
cls, cursor: Any, limit: Optional[int] = None
) -> List[Tuple[Any, ...]]:
import pyhive
from TCLIService import ttypes
state = cursor.poll()
if state.operationState == ttypes.TOperationState.ERROR_STATE:
raise Exception("Query error", state.errorMessage)
try:
return super().fetch_data(cursor, limit)
except pyhive.exc.ProgrammingError:
return []
@classmethod
def df_to_sql(
cls,
database: "Database",
table: Table,
df: pd.DataFrame,
to_sql_kwargs: Dict[str, Any],
) -> None:
"""
Upload data from a Pandas DataFrame to a database.
The data is stored via the binary Parquet format which is both less problematic
and more performant than a text file. More specifically storing a table as a
CSV text file has severe limitations including the fact that the Hive CSV SerDe
does not support multiline fields.
Note this method does not create metadata for the table.
:param database: The database to upload the data to
:param: table The table to upload the data to
:param df: The dataframe with data to be uploaded
:param to_sql_kwargs: The kwargs to be passed to pandas.DataFrame.to_sql` method
"""
engine = cls.get_engine(database)
if to_sql_kwargs["if_exists"] == "append":
raise SupersetException("Append operation not currently supported")
if to_sql_kwargs["if_exists"] == "fail":
# Ensure table doesn't already exist.
if table.schema:
table_exists = not database.get_df(
f"SHOW TABLES IN {table.schema} LIKE '{table.table}'"
).empty
else:
table_exists = not database.get_df(
f"SHOW TABLES LIKE '{table.table}'"
).empty
if table_exists:
raise SupersetException("Table already exists")
elif to_sql_kwargs["if_exists"] == "replace":
engine.execute(f"DROP TABLE IF EXISTS {str(table)}")
def _get_hive_type(dtype: np.dtype) -> str:
hive_type_by_dtype = {
np.dtype("bool"): "BOOLEAN",
np.dtype("float64"): "DOUBLE",
np.dtype("int64"): "BIGINT",
np.dtype("object"): "STRING",
}
return hive_type_by_dtype.get(dtype, "STRING")
schema_definition = ", ".join(
f"`{name}` {_get_hive_type(dtype)}" for name, dtype in df.dtypes.items()
)
with tempfile.NamedTemporaryFile(
dir=current_app.config["UPLOAD_FOLDER"], suffix=".parquet"
) as file:
pq.write_table(pa.Table.from_pandas(df), where=file.name)
engine.execute(
text(
f"""
CREATE TABLE {str(table)} ({schema_definition})
STORED AS PARQUET
LOCATION :location
"""
),
location=upload_to_s3(
filename=file.name,
upload_prefix=current_app.config[
"CSV_TO_HIVE_UPLOAD_DIRECTORY_FUNC"
](database, g.user, table.schema),
table=table,
),
)
@classmethod
def convert_dttm(cls, target_type: str, dttm: datetime) -> Optional[str]:
tt = target_type.upper()
if tt == utils.TemporalType.DATE:
return f"CAST('{dttm.date().isoformat()}' AS DATE)"
if tt == utils.TemporalType.TIMESTAMP:
return f"""CAST('{dttm
.isoformat(sep=" ", timespec="microseconds")}' AS TIMESTAMP)"""
return None
@classmethod
def adjust_database_uri(
cls, uri: URL, selected_schema: Optional[str] = None
) -> None:
if selected_schema:
uri.database = parse.quote(selected_schema, safe="")
@classmethod
def _extract_error_message(cls, ex: Exception) -> str:
msg = str(ex)
match = re.search(r'errorMessage="(.*?)(?<!\\)"', msg)
if match:
msg = match.group(1)
return msg
@classmethod
def progress(cls, log_lines: List[str]) -> int:
total_jobs = 1 # assuming there's at least 1 job
current_job = 1
stages: Dict[int, float] = {}
for line in log_lines:
match = cls.jobs_stats_r.match(line)
if match:
total_jobs = int(match.groupdict()["max_jobs"]) or 1
match = cls.launching_job_r.match(line)
if match:
current_job = int(match.groupdict()["job_number"])
total_jobs = int(match.groupdict()["max_jobs"]) or 1
stages = {}
match = cls.stage_progress_r.match(line)
if match:
stage_number = int(match.groupdict()["stage_number"])
map_progress = int(match.groupdict()["map_progress"])
reduce_progress = int(match.groupdict()["reduce_progress"])
stages[stage_number] = (map_progress + reduce_progress) / 2
logger.info(
"Progress detail: {}, " # pylint: disable=logging-format-interpolation
"current job {}, "
"total jobs: {}".format(stages, current_job, total_jobs)
)
stage_progress = sum(stages.values()) / len(stages.values()) if stages else 0
progress = 100 * (current_job - 1) / total_jobs + stage_progress / total_jobs
return int(progress)
@classmethod
def get_tracking_url(cls, log_lines: List[str]) -> Optional[str]:
lkp = "Tracking URL = "
for line in log_lines:
if lkp in line:
return line.split(lkp)[1]
return None
@classmethod
def handle_cursor( # pylint: disable=too-many-locals
cls, cursor: Any, query: Query, session: Session
) -> None:
"""Updates progress information"""
from pyhive import hive
unfinished_states = (
hive.ttypes.TOperationState.INITIALIZED_STATE,
hive.ttypes.TOperationState.RUNNING_STATE,
)
polled = cursor.poll()
last_log_line = 0
tracking_url = None
job_id = None
query_id = query.id
while polled.operationState in unfinished_states:
query = session.query(type(query)).filter_by(id=query_id).one()
if query.status == QueryStatus.STOPPED:
cursor.cancel()
break
log = cursor.fetch_logs() or ""
if log:
log_lines = log.splitlines()
progress = cls.progress(log_lines)
logger.info(
"Query %s: Progress total: %s", str(query_id), str(progress)
)
needs_commit = False
if progress > query.progress:
query.progress = progress
needs_commit = True
if not tracking_url:
tracking_url = cls.get_tracking_url(log_lines)
if tracking_url:
job_id = tracking_url.split("/")[-2]
logger.info(
"Query %s: Found the tracking url: %s",
str(query_id),
tracking_url,
)
tracking_url = current_app.config["TRACKING_URL_TRANSFORMER"]
logger.info(
"Query %s: Transformation applied: %s",
str(query_id),
tracking_url,
)
query.tracking_url = tracking_url
logger.info("Query %s: Job id: %s", str(query_id), str(job_id))
needs_commit = True
if job_id and len(log_lines) > last_log_line:
# Wait for job id before logging things out
# this allows for prefixing all log lines and becoming
# searchable in something like Kibana
for l in log_lines[last_log_line:]:
logger.info("Query %s: [%s] %s", str(query_id), str(job_id), l)
last_log_line = len(log_lines)
if needs_commit:
session.commit()
time.sleep(current_app.config["HIVE_POLL_INTERVAL"])
polled = cursor.poll()
@classmethod
def get_columns(
cls, inspector: Inspector, table_name: str, schema: Optional[str]
) -> List[Dict[str, Any]]:
return inspector.get_columns(table_name, schema)
@classmethod
def where_latest_partition( # pylint: disable=too-many-arguments
cls,
table_name: str,
schema: Optional[str],
database: "Database",
query: Select,
columns: Optional[List[Dict[str, str]]] = None,
) -> Optional[Select]:
try:
col_names, values = cls.latest_partition(
table_name, schema, database, show_first=True
)
except Exception: # pylint: disable=broad-except
# table is not partitioned
return None
if values is not None and columns is not None:
for col_name, value in zip(col_names, values):
for clm in columns:
if clm.get("name") == col_name:
query = query.where(Column(col_name) == value)
return query
return None
@classmethod
def _get_fields(cls, cols: List[Dict[str, Any]]) -> List[ColumnClause]:
return BaseEngineSpec._get_fields(cols) # pylint: disable=protected-access
@classmethod
def latest_sub_partition(
cls, table_name: str, schema: Optional[str], database: "Database", **kwargs: Any
) -> str:
# TODO(bogdan): implement`
pass
@classmethod
def _latest_partition_from_df(cls, df: pd.DataFrame) -> Optional[List[str]]:
"""Hive partitions look like ds={partition name}"""
if not df.empty:
return [df.ix[:, 0].max().split("=")[1]]
return None
@classmethod
def _partition_query( # pylint: disable=too-many-arguments
cls,
table_name: str,
database: "Database",
limit: int = 0,
order_by: Optional[List[Tuple[str, bool]]] = None,
filters: Optional[Dict[Any, Any]] = None,
) -> str:
return f"SHOW PARTITIONS {table_name}"
@classmethod
def select_star( # pylint: disable=too-many-arguments
cls,
database: "Database",
table_name: str,
engine: Engine,
schema: Optional[str] = None,
limit: int = 100,
show_cols: bool = False,
indent: bool = True,
latest_partition: bool = True,
cols: Optional[List[Dict[str, Any]]] = None,
) -> str:
return super( # pylint: disable=bad-super-call
PrestoEngineSpec, cls
).select_star(
database,
table_name,
engine,
schema,
limit,
show_cols,
indent,
latest_partition,
cols,
)
@classmethod
def modify_url_for_impersonation(
cls, url: URL, impersonate_user: bool, username: Optional[str]
) -> None:
"""
Modify the SQL Alchemy URL object with the user to impersonate if applicable.
:param url: SQLAlchemy URL object
:param impersonate_user: Flag indicating if impersonation is enabled
:param username: Effective username
"""
# Do nothing in the URL object since instead this should modify
# the configuraiton dictionary. See get_configuration_for_impersonation
@classmethod
def update_impersonation_config(
cls, connect_args: Dict[str, Any], uri: str, username: Optional[str],
) -> None:
"""
Update a configuration dictionary
that can set the correct properties for impersonating users
:param connect_args:
:param uri: URI string
:param impersonate_user: Flag indicating if impersonation is enabled
:param username: Effective username
:return: None
"""
url = make_url(uri)
backend_name = url.get_backend_name()
# Must be Hive connection, enable impersonation, and set optional param
# auth=LDAP|KERBEROS
# this will set hive.server2.proxy.user=$effective_username on connect_args['configuration']
if backend_name == "hive" and username is not None:
configuration = connect_args.get("configuration", {})
configuration["hive.server2.proxy.user"] = username
connect_args["configuration"] = configuration
@staticmethod
def execute( # type: ignore
cursor, query: str, async_: bool = False
): # pylint: disable=arguments-differ
kwargs = {"async": async_}
cursor.execute(query, **kwargs)
@classmethod
@cache_manager.cache.memoize()
def get_function_names(cls, database: "Database") -> List[str]:
"""
Get a list of function names that are able to be called on the database.
Used for SQL Lab autocomplete.
:param database: The database to get functions for
:return: A list of function names useable in the database
"""
df = database.get_df("SHOW FUNCTIONS")
if cls._show_functions_column in df:
return df[cls._show_functions_column].tolist()
columns = df.columns.values.tolist()
logger.error(
"Payload from `SHOW FUNCTIONS` has the incorrect format. "
"Expected column `%s`, found: %s.",
cls._show_functions_column,
", ".join(columns),
exc_info=True,
)
# if the results have a single column, use that
if len(columns) == 1:
return df[columns[0]].tolist()
# otherwise, return no function names to prevent errors
return []
@classmethod
def is_readonly_query(cls, parsed_query: ParsedQuery) -> bool:
"""Pessimistic readonly, 100% sure statement won't mutate anything"""
return (
super().is_readonly_query(parsed_query)
or parsed_query.is_set()
or parsed_query.is_show()
)
|
apache-2.0
|
aurelieladier/openturns
|
validation/src/optimal_lhs/validate_MC_small.py
|
7
|
1877
|
#! /usr/bin/env python
import openturns as ot
import matplotlib
import matplotlib.pyplot as plt
from matplotlib.backends.backend_pdf import PdfPages
from openturns.viewer import View
import time
ot.Log.Show(ot.Log.INFO)
# Bounds are [0,1]^dimension
dimension = 2
bounds = ot.Interval(dimension)
nSimu = 10000
c2 = ot.SpaceFillingC2()
# Size of sample
size = 10
print("dimension=%d, size=%d"%(dimension, size))
for nSimu in [100, 200, 400, 800, 1600, 3200, 6400, 12800, 25600, 51200, 102400, 204800, 409600]:
ot.RandomGenerator.SetSeed(0)
# Factory: lhs generates
lhsDesign = ot.LHSExperiment(ot.ComposedDistribution([ot.Uniform(0.0, 1.0)] * dimension), size)
lhsDesign.setAlwaysShuffle(True) # randomized
mc = ot.MonteCarloLHS(lhsDesign, nSimu, c2)
tic = time.time()
design = mc.generate()
result = mc.getResult()
toc = time.time()
print("%d %f %f"%(nSimu,result.getOptimalValue(), toc-tic))
pp = PdfPages('small_mc_OTLHS.pdf')
# plot criterion & save it
crit = result.drawHistoryCriterion()
fig = View(crit, plot_kwargs={'color':'blue'}).getFigure()
pp.savefig(fig)
plt.close(fig)
minDist = ot.SpaceFillingMinDist()
# Factory: lhs generates
lhsDesign = ot.LHSExperiment(ot.ComposedDistribution([ot.Uniform(0.0, 1.0)] * dimension), size)
lhsDesign.setAlwaysShuffle(True) # randomized
mc = ot.MonteCarloLHS(lhsDesign, nSimu, minDist)
tic = time.time()
design = mc.generate()
result = mc.getResult()
toc = time.time()
print("cpu time=%f"%(toc-tic))
print("dimension=%d, size=%d,mc=%s"%(dimension, size, mc))
print("optimal value="+ str(result.getOptimalValue())+" c2="+str(result.getC2())+" phiP="+str(result.getPhiP())+" minDist="+str(result.getMinDist()))
# plot criterion & save it
crit = result.drawHistoryCriterion()
fig = View(crit, plot_kwargs={'color':'blue'}).getFigure()
pp.savefig(fig)
plt.close(fig)
pp.close()
|
lgpl-3.0
|
ueshin/apache-spark
|
python/pyspark/pandas/tests/test_spark_functions.py
|
11
|
2127
|
#
# Licensed to the Apache Software Foundation (ASF) under one or more
# contributor license agreements. See the NOTICE file distributed with
# this work for additional information regarding copyright ownership.
# The ASF licenses this file to You under the Apache License, Version 2.0
# (the "License"); you may not use this file except in compliance with
# the License. You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
#
import numpy as np
from pyspark.pandas.spark import functions as SF
from pyspark.pandas.utils import spark_column_equals
from pyspark.sql import functions as F
from pyspark.sql.types import (
ByteType,
FloatType,
IntegerType,
LongType,
)
from pyspark.testing.pandasutils import PandasOnSparkTestCase
class SparkFunctionsTests(PandasOnSparkTestCase):
def test_lit(self):
self.assertTrue(spark_column_equals(SF.lit(np.int64(1)), F.lit(1).astype(LongType())))
self.assertTrue(spark_column_equals(SF.lit(np.int32(1)), F.lit(1).astype(IntegerType())))
self.assertTrue(spark_column_equals(SF.lit(np.int8(1)), F.lit(1).astype(ByteType())))
self.assertTrue(spark_column_equals(SF.lit(np.byte(1)), F.lit(1).astype(ByteType())))
self.assertTrue(
spark_column_equals(SF.lit(np.float32(1)), F.lit(float(1)).astype(FloatType()))
)
self.assertTrue(spark_column_equals(SF.lit(1), F.lit(1)))
if __name__ == "__main__":
import unittest
from pyspark.pandas.tests.test_spark_functions import * # noqa: F401
try:
import xmlrunner # type: ignore[import]
testRunner = xmlrunner.XMLTestRunner(output="target/test-reports", verbosity=2)
except ImportError:
testRunner = None
unittest.main(testRunner=testRunner, verbosity=2)
|
apache-2.0
|
btabibian/scikit-learn
|
examples/hetero_feature_union.py
|
81
|
6241
|
"""
=============================================
Feature Union with Heterogeneous Data Sources
=============================================
Datasets can often contain components of that require different feature
extraction and processing pipelines. This scenario might occur when:
1. Your dataset consists of heterogeneous data types (e.g. raster images and
text captions)
2. Your dataset is stored in a Pandas DataFrame and different columns
require different processing pipelines.
This example demonstrates how to use
:class:`sklearn.feature_extraction.FeatureUnion` on a dataset containing
different types of features. We use the 20-newsgroups dataset and compute
standard bag-of-words features for the subject line and body in separate
pipelines as well as ad hoc features on the body. We combine them (with
weights) using a FeatureUnion and finally train a classifier on the combined
set of features.
The choice of features is not particularly helpful, but serves to illustrate
the technique.
"""
# Author: Matt Terry <[email protected]>
#
# License: BSD 3 clause
from __future__ import print_function
import numpy as np
from sklearn.base import BaseEstimator, TransformerMixin
from sklearn.datasets import fetch_20newsgroups
from sklearn.datasets.twenty_newsgroups import strip_newsgroup_footer
from sklearn.datasets.twenty_newsgroups import strip_newsgroup_quoting
from sklearn.decomposition import TruncatedSVD
from sklearn.feature_extraction import DictVectorizer
from sklearn.feature_extraction.text import TfidfVectorizer
from sklearn.metrics import classification_report
from sklearn.pipeline import FeatureUnion
from sklearn.pipeline import Pipeline
from sklearn.svm import SVC
class ItemSelector(BaseEstimator, TransformerMixin):
"""For data grouped by feature, select subset of data at a provided key.
The data is expected to be stored in a 2D data structure, where the first
index is over features and the second is over samples. i.e.
>> len(data[key]) == n_samples
Please note that this is the opposite convention to scikit-learn feature
matrixes (where the first index corresponds to sample).
ItemSelector only requires that the collection implement getitem
(data[key]). Examples include: a dict of lists, 2D numpy array, Pandas
DataFrame, numpy record array, etc.
>> data = {'a': [1, 5, 2, 5, 2, 8],
'b': [9, 4, 1, 4, 1, 3]}
>> ds = ItemSelector(key='a')
>> data['a'] == ds.transform(data)
ItemSelector is not designed to handle data grouped by sample. (e.g. a
list of dicts). If your data is structured this way, consider a
transformer along the lines of `sklearn.feature_extraction.DictVectorizer`.
Parameters
----------
key : hashable, required
The key corresponding to the desired value in a mappable.
"""
def __init__(self, key):
self.key = key
def fit(self, x, y=None):
return self
def transform(self, data_dict):
return data_dict[self.key]
class TextStats(BaseEstimator, TransformerMixin):
"""Extract features from each document for DictVectorizer"""
def fit(self, x, y=None):
return self
def transform(self, posts):
return [{'length': len(text),
'num_sentences': text.count('.')}
for text in posts]
class SubjectBodyExtractor(BaseEstimator, TransformerMixin):
"""Extract the subject & body from a usenet post in a single pass.
Takes a sequence of strings and produces a dict of sequences. Keys are
`subject` and `body`.
"""
def fit(self, x, y=None):
return self
def transform(self, posts):
features = np.recarray(shape=(len(posts),),
dtype=[('subject', object), ('body', object)])
for i, text in enumerate(posts):
headers, _, bod = text.partition('\n\n')
bod = strip_newsgroup_footer(bod)
bod = strip_newsgroup_quoting(bod)
features['body'][i] = bod
prefix = 'Subject:'
sub = ''
for line in headers.split('\n'):
if line.startswith(prefix):
sub = line[len(prefix):]
break
features['subject'][i] = sub
return features
pipeline = Pipeline([
# Extract the subject & body
('subjectbody', SubjectBodyExtractor()),
# Use FeatureUnion to combine the features from subject and body
('union', FeatureUnion(
transformer_list=[
# Pipeline for pulling features from the post's subject line
('subject', Pipeline([
('selector', ItemSelector(key='subject')),
('tfidf', TfidfVectorizer(min_df=50)),
])),
# Pipeline for standard bag-of-words model for body
('body_bow', Pipeline([
('selector', ItemSelector(key='body')),
('tfidf', TfidfVectorizer()),
('best', TruncatedSVD(n_components=50)),
])),
# Pipeline for pulling ad hoc features from post's body
('body_stats', Pipeline([
('selector', ItemSelector(key='body')),
('stats', TextStats()), # returns a list of dicts
('vect', DictVectorizer()), # list of dicts -> feature matrix
])),
],
# weight components in FeatureUnion
transformer_weights={
'subject': 0.8,
'body_bow': 0.5,
'body_stats': 1.0,
},
)),
# Use a SVC classifier on the combined features
('svc', SVC(kernel='linear')),
])
# limit the list of categories to make running this example faster.
categories = ['alt.atheism', 'talk.religion.misc']
train = fetch_20newsgroups(random_state=1,
subset='train',
categories=categories,
)
test = fetch_20newsgroups(random_state=1,
subset='test',
categories=categories,
)
pipeline.fit(train.data, train.target)
y = pipeline.predict(test.data)
print(classification_report(y, test.target))
|
bsd-3-clause
|
wbengine/SPMILM
|
egs/1-billion/run_trf_2.py
|
1
|
6271
|
import os
import sys
import numpy as np
import matplotlib.pyplot as plt
sys.path.insert(0, os.getcwd() + '/../../tools/')
import wb
import trf
# revise this function to config the dataset used to train different model
def data(tskdir):
train = tskdir + 'data/train.txt'
valid = tskdir + 'data/valid.txt'
test = tskdir + 'data/test.txt'
return data_verfy([train, valid, test]) + data_wsj92nbest()
def data_verfy(paths):
for w in paths:
if not os.path.isfile(w):
print('[ERROR] no such file: ' + w)
return paths
def data_wsj92nbest():
root = './data/WSJ92-test-data/'
nbest = root + '1000best.sent'
trans = root + 'transcript.txt'
ac = root + '1000best.acscore'
lm = root + '1000best.lmscore'
return data_verfy([nbest, trans, ac, lm])
def evaulate_trf(model, vocab, read_model, tsize, fres):
res_name = '{}:'.format(int(tsize)) + os.path.split(read_model)[-1]
tskdir = '{}/'.format(tsize)
# rescore
config = ' -vocab {} '.format(vocab)
config += ' -read {}.model '.format(read_model)
config += ' -nbest {} '.format(data(tskdir)[3])
config += ' -lmscore {0}.lmscore'.format(read_model)
model.use(config)
# WER
[read_nbest, read_templ, read_acscore, read_lmscore] = data(tskdir)[3:7]
read_lmscore = read_model + '.lmscore'
[wer, lmscale, acscale] = wb.TuneWER(read_nbest, read_templ,
wb.LoadScore(read_lmscore),
wb.LoadScore(read_acscore), np.linspace(0.1,0.9,9))
print('wer={:.4f} lmscale={:.2f} acscale={:.2f}'.format(wer, lmscale, acscale))
# calculate the ppl on wsj test
templ_txt = model.workdir + os.path.split(read_templ)[-1] + '.rmlabel'
wb.file_rmlabel(read_templ, templ_txt)
PPL_templ = model.ppl(vocab, read_model+'.model', templ_txt)
LL_templ = -wb.PPL2LL(PPL_templ, templ_txt)
# output the result
fres.Add(res_name, ['LL-wsj', 'PPL-wsj'], [LL_templ, PPL_templ])
fres.AddWER(res_name, wer)
def main():
if len(sys.argv) == 1:
print('\"python run.py -train\" train LSTM\n',
'\"python run.py -rescore\" rescore nbest\n',
'\"python run.py -wer\" compute WER'
)
for tsize in [2]:
bindir = '../../tools/trf/bin/'
tskdir = '{}/'.format(tsize)
workdir = tskdir + 'trflm/'
fres = wb.FRes('result.txt')
model = trf.model(bindir, workdir)
class_num = 200
train = workdir + 'train.id'
valid = workdir + 'valid.id'
test = workdir + 'test.id'
vocab = workdir + 'vocab_c{}.list'.format(class_num)
order = 4
feat = 'g4_w_c_ws_cs_wsh_csh_tied.fs'
#feat = 'g4_w_c_ws_cs_cpw.fs'
maxlen = 100
tmax = 50000
t0 = 2000
minibatch = 100
gamma_lambda = '1000,0'
gamma_zeta = '0,0.6'
reg = 1e-5
thread = 8
write_model = workdir + 'trf_c{}_{}'.format(class_num, feat[0:-3])
write_name = '{}:{}'.format(tsize, os.path.split(write_model)[1])
if '-class' in sys.argv:
# just cluster for each tsks.
model.prepare(data(tskdir)[0], data(tskdir)[1], data(tskdir)[2], class_num)
if '-train' in sys.argv or '-all' in sys.argv:
config = '-vocab {} -train {} -valid {} -test {} '.format(vocab, train, valid, test)
config += ' -order {} -feat {} '.format(order, feat)
config += ' -len {} '.format(maxlen)
config += ' -write {0}.model -log {0}.log '.format(write_model)
config += ' -t0 {} -iter {}'.format(t0, tmax)
config += ' -gamma-lambda {} -gamma-zeta {}'.format(gamma_lambda, gamma_zeta)
config += ' -L2 {} '.format(reg)
config += ' -mini-batch {} '.format(minibatch)
config += ' -thread {} '.format(thread)
config += ' -print-per-iter 10 -write-at-iter 10000:10000:{}'.format(tmax)
model.prepare(data(tskdir)[0], data(tskdir)[1], data(tskdir)[2], class_num)
model.train(config)
# output
LL = model.get_last_value(write_model + '.log')
fres.AddLL(write_name, LL, data(tskdir)[0:3])
if '-plot' in sys.argv:
baseline = fres.Get('{}:KN5'.format(tsize))
trf.PlotLog([write_model], [baseline])
if '-rescore' in sys.argv or '-all' in sys.argv:
config = ' -vocab {} '.format(vocab)
config += ' -read {}.model '.format(write_model)
config += ' -nbest {} '.format(data(tskdir)[3])
config += ' -lmscore {0}.lmscore -lmscore-test-id {0}.test-id '.format(write_model)
model.use(config)
if '-wer' in sys.argv or '-all' in sys.argv:
[read_nbest, read_templ, read_acscore, read_lmscore] = data(tskdir)[3:7]
read_lmscore = write_model + '.lmscore'
[wer, lmscale, acscale] = wb.TuneWER(read_nbest, read_templ,
wb.LoadScore(read_lmscore),
wb.LoadScore(read_acscore), np.linspace(0.1,0.9,9))
print('wer={:.4f} lmscale={:.2f} acscale={:.2f}'.format(wer, lmscale, acscale))
# calculate the ppl on wsj test
write_templ_id = workdir + os.path.split(read_templ)[1] + '.id'
v = trf.ReadVocab(vocab)
trf.NbestToID(read_templ, write_templ_id, v)
config = ' -vocab {} '.format(vocab)
config += ' -read {}.model '.format(write_model)
config += ' -test {} '.format(write_templ_id)
LL_templ = model.use(config)
PPL_templ = wb.LL2PPL(-LL_templ, write_templ_id)
# output the result
fres.Add(write_name, ['LL-wsj', 'PPL-wsj'], [LL_templ, PPL_templ])
fres.AddWER(write_name, wer)
if '-inter' in sys.argv:
# calculate the WER for intermediate models
for n in np.linspace(10000, 40000, 4):
inter_model = workdir + 'trf_c{}_{}.n{}'.format(class_num, feat[0:-3], int(n))
evaulate_trf(model, vocab, inter_model, tsize, fres)
if __name__ == '__main__':
main()
|
apache-2.0
|
plissonf/scikit-learn
|
examples/svm/plot_svm_scale_c.py
|
223
|
5375
|
"""
==============================================
Scaling the regularization parameter for SVCs
==============================================
The following example illustrates the effect of scaling the
regularization parameter when using :ref:`svm` for
:ref:`classification <svm_classification>`.
For SVC classification, we are interested in a risk minimization for the
equation:
.. math::
C \sum_{i=1, n} \mathcal{L} (f(x_i), y_i) + \Omega (w)
where
- :math:`C` is used to set the amount of regularization
- :math:`\mathcal{L}` is a `loss` function of our samples
and our model parameters.
- :math:`\Omega` is a `penalty` function of our model parameters
If we consider the loss function to be the individual error per
sample, then the data-fit term, or the sum of the error for each sample, will
increase as we add more samples. The penalization term, however, will not
increase.
When using, for example, :ref:`cross validation <cross_validation>`, to
set the amount of regularization with `C`, there will be a
different amount of samples between the main problem and the smaller problems
within the folds of the cross validation.
Since our loss function is dependent on the amount of samples, the latter
will influence the selected value of `C`.
The question that arises is `How do we optimally adjust C to
account for the different amount of training samples?`
The figures below are used to illustrate the effect of scaling our
`C` to compensate for the change in the number of samples, in the
case of using an `l1` penalty, as well as the `l2` penalty.
l1-penalty case
-----------------
In the `l1` case, theory says that prediction consistency
(i.e. that under given hypothesis, the estimator
learned predicts as well as a model knowing the true distribution)
is not possible because of the bias of the `l1`. It does say, however,
that model consistency, in terms of finding the right set of non-zero
parameters as well as their signs, can be achieved by scaling
`C1`.
l2-penalty case
-----------------
The theory says that in order to achieve prediction consistency, the
penalty parameter should be kept constant
as the number of samples grow.
Simulations
------------
The two figures below plot the values of `C` on the `x-axis` and the
corresponding cross-validation scores on the `y-axis`, for several different
fractions of a generated data-set.
In the `l1` penalty case, the cross-validation-error correlates best with
the test-error, when scaling our `C` with the number of samples, `n`,
which can be seen in the first figure.
For the `l2` penalty case, the best result comes from the case where `C`
is not scaled.
.. topic:: Note:
Two separate datasets are used for the two different plots. The reason
behind this is the `l1` case works better on sparse data, while `l2`
is better suited to the non-sparse case.
"""
print(__doc__)
# Author: Andreas Mueller <[email protected]>
# Jaques Grobler <[email protected]>
# License: BSD 3 clause
import numpy as np
import matplotlib.pyplot as plt
from sklearn.svm import LinearSVC
from sklearn.cross_validation import ShuffleSplit
from sklearn.grid_search import GridSearchCV
from sklearn.utils import check_random_state
from sklearn import datasets
rnd = check_random_state(1)
# set up dataset
n_samples = 100
n_features = 300
# l1 data (only 5 informative features)
X_1, y_1 = datasets.make_classification(n_samples=n_samples,
n_features=n_features, n_informative=5,
random_state=1)
# l2 data: non sparse, but less features
y_2 = np.sign(.5 - rnd.rand(n_samples))
X_2 = rnd.randn(n_samples, n_features / 5) + y_2[:, np.newaxis]
X_2 += 5 * rnd.randn(n_samples, n_features / 5)
clf_sets = [(LinearSVC(penalty='l1', loss='squared_hinge', dual=False,
tol=1e-3),
np.logspace(-2.3, -1.3, 10), X_1, y_1),
(LinearSVC(penalty='l2', loss='squared_hinge', dual=True,
tol=1e-4),
np.logspace(-4.5, -2, 10), X_2, y_2)]
colors = ['b', 'g', 'r', 'c']
for fignum, (clf, cs, X, y) in enumerate(clf_sets):
# set up the plot for each regressor
plt.figure(fignum, figsize=(9, 10))
for k, train_size in enumerate(np.linspace(0.3, 0.7, 3)[::-1]):
param_grid = dict(C=cs)
# To get nice curve, we need a large number of iterations to
# reduce the variance
grid = GridSearchCV(clf, refit=False, param_grid=param_grid,
cv=ShuffleSplit(n=n_samples, train_size=train_size,
n_iter=250, random_state=1))
grid.fit(X, y)
scores = [x[1] for x in grid.grid_scores_]
scales = [(1, 'No scaling'),
((n_samples * train_size), '1/n_samples'),
]
for subplotnum, (scaler, name) in enumerate(scales):
plt.subplot(2, 1, subplotnum + 1)
plt.xlabel('C')
plt.ylabel('CV Score')
grid_cs = cs * float(scaler) # scale the C's
plt.semilogx(grid_cs, scores, label="fraction %.2f" %
train_size)
plt.title('scaling=%s, penalty=%s, loss=%s' %
(name, clf.penalty, clf.loss))
plt.legend(loc="best")
plt.show()
|
bsd-3-clause
|
jaredwo/topowx
|
twx/utils/config.py
|
1
|
10923
|
from ConfigParser import ConfigParser
from twx.utils import ymdL, mkdir_p
import numpy as np
import os
import pandas as pd
class TwxConfig():
'''Class to load and access TopoWx configuration settings in a INI file.
Upon initialization, also creates necessary sub-directories in the TopoWx
data root directory if they do not exist.
Example TopoWx INI File:
[TOPOWX_CONFIG]
# Path to TopoWx data root
TWX_DATA_ROOT=[a path]
# Lon/lat bounding box for station observations
STN_BBOX=-126.0,22.0,-64.0,53.0
# Start date for which to process station observations
OBS_START_DATE=1895-01-01
# End data for which to process station observations
OBS_END_DATE=2016-03-29
# Start date for interpolation
INTERP_START_DATE=1948-01-01
# End date for interpolation
INTERP_END_DATE=2015-12-31
# Station observation elements to process
OBS_ELEMS=tmin,tmax,prcp,tobs_tmin,tobs_tmax,tobs_prcp
# Primary station observation elements
OBS_MAIN_ELEMS=tmin,tmax,prcp
# Station chunk size for which to load and process station observations
STN_READ_CHUNK_GHCND=100
STN_READ_CHUNK_SNOTEL=20
STN_READ_CHUNK_RAWS=20
# Station chunk size for loading and writing to netcdf file
STN_WRITE_CHUNK_NC=100
# Station chunk size for creating aggregated data (e.g.--monthly from daily)
STN_AGG_CHUNK=1000
# A geonames username for accessing DEM elevation services
USERNAME_GEONAMES=[a username]
'''
def __init__(self, fpath_ini):
cfg = ConfigParser()
cfg.read(fpath_ini)
self.twx_data_root = cfg.get('TOPOWX_CONFIG', 'twx_data_root')
self.obs_start_date = pd.Timestamp(cfg.get('TOPOWX_CONFIG',
'obs_start_date'))
self.obs_end_date = pd.Timestamp(cfg.get('TOPOWX_CONFIG',
'obs_end_date'))
self.interp_start_date = pd.Timestamp(cfg.get('TOPOWX_CONFIG',
'interp_start_date'))
self.interp_end_date = pd.Timestamp(cfg.get('TOPOWX_CONFIG',
'interp_end_date'))
bbox_str = cfg.get('TOPOWX_CONFIG', 'stn_bbox')
self.stn_bbox = tuple([np.float(i) for i in bbox_str.split(',')])
self.obs_elems = tuple(cfg.get('TOPOWX_CONFIG', 'obs_elems').split(','))
self.obs_main_elems = tuple(cfg.get('TOPOWX_CONFIG',
'obs_main_elems').split(','))
self.stn_read_chunk_ghcnd = int(cfg.get('TOPOWX_CONFIG',
'stn_read_chunk_ghcnd'))
self.stn_read_chunk_snotel = int(cfg.get('TOPOWX_CONFIG',
'stn_read_chunk_snotel'))
self.stn_read_chunk_raws = int(cfg.get('TOPOWX_CONFIG',
'stn_read_chunk_raws'))
self.stn_write_chunk_nc = int(cfg.get('TOPOWX_CONFIG',
'stn_write_chunk_nc'))
self.stn_agg_chunk = int(cfg.get('TOPOWX_CONFIG',
'stn_agg_chunk'))
self.username_geonames = cfg.get('TOPOWX_CONFIG',
'username_geonames')
self.fpath_log_daily_infill = cfg.get('TOPOWX_CONFIG',
'fpath_log_daily_infill')
self.twx_data_version = cfg.get('TOPOWX_CONFIG',
'twx_data_version')
# Make TopoWx data directory for local storage of station observations
self.path_stndata = os.path.join(self.twx_data_root, 'station_data')
mkdir_p(self.path_stndata)
fname_stndata_hdf_ghcnd = 'obs_ghcnd_%d_%d.hdf' % (ymdL(self.obs_start_date),
ymdL(self.obs_end_date))
self.fpath_stndata_hdf_ghcnd = os.path.join(self.path_stndata,
fname_stndata_hdf_ghcnd)
fname_stndata_hdf_snotel = 'obs_snotel_%d_%d.hdf' % (ymdL(self.obs_start_date),
ymdL(self.obs_end_date))
self.fpath_stndata_hdf_snotel = os.path.join(self.path_stndata,
fname_stndata_hdf_snotel)
fname_stndata_hdf_raws = 'obs_raws_%d_%d.hdf' % (ymdL(self.obs_start_date),
ymdL(self.obs_end_date))
self.fpath_stndata_hdf_raws = os.path.join(self.path_stndata,
fname_stndata_hdf_raws)
fname_stndata_nc_all = 'obs_all_%d_%d.nc' % (ymdL(self.obs_start_date),
ymdL(self.obs_end_date))
self.fpath_stndata_nc_all = os.path.join(self.path_stndata,
fname_stndata_nc_all)
fname_stndata_nc_tair_tobs_adj = 'tair_tobs_adj_%d_%d.nc' % (ymdL(self.obs_start_date),
ymdL(self.obs_end_date))
self.fpath_stndata_nc_tair_tobs_adj = os.path.join(self.path_stndata,
fname_stndata_nc_tair_tobs_adj)
fname_stndata_nc_tair_homog = 'tair_homog_%d_%d.nc' % (ymdL(self.obs_start_date),
ymdL(self.obs_end_date))
self.fpath_stndata_nc_tair_homog = os.path.join(self.path_stndata,
fname_stndata_nc_tair_homog)
self.fpath_locqa_hdf = os.path.join(self.path_stndata, 'locqa.hdf')
self.fpath_locqa_fail_csv = os.path.join(self.path_stndata, 'locqa_fail.csv')
# Make TopoWx data directory for PHA-based homogenization
self.path_homog_pha = os.path.join(self.path_stndata, 'homog')
mkdir_p(self.path_homog_pha)
self.fpath_pha_tgz = os.path.join(self.path_homog_pha, 'phav52i.tar.gz')
# Make TopoWx data directories for reanalysis data
self.path_reanalysis_data = os.path.join(self.twx_data_root,
'reanalysis_data')
mkdir_p(self.path_reanalysis_data)
self.path_reanalysis_namerica = os.path.join(self.path_reanalysis_data,
'n_america_subset')
mkdir_p(self.path_reanalysis_namerica)
# Make TopoWx data directory for infilled station observations
self.path_stndata_infill = os.path.join(self.path_stndata, 'infill')
mkdir_p(self.path_stndata_infill)
self.fpath_xval_infill_nc = os.path.join(self.path_stndata_infill,
'xval_infill_tair.nc')
self.fpath_stndata_nc_infill_tmin = os.path.join(self.path_stndata_infill,
'infill_tmin.nc')
self.fpath_stndata_nc_infill_tmax = os.path.join(self.path_stndata_infill,
'infill_tmax.nc')
self.fpath_flagged_bad_stns = os.path.join(self.path_stndata_infill,
'bad_stns.csv')
self.fpath_stndata_nc_serial_tmin = os.path.join(self.path_stndata_infill,
'serial_tmin.nc')
self.fpath_stndata_nc_serial_tmax = os.path.join(self.path_stndata_infill,
'serial_tmax.nc')
# Make data directories for storing interp param optimization files
# Temperature normals
self.path_interp_optim_norms = os.path.join(self.path_stndata_infill,
'optim_norm')
mkdir_p(self.path_interp_optim_norms)
# Daily anomalies
self.path_interp_optim_anoms = os.path.join(self.path_stndata_infill,
'optim_anom')
mkdir_p(self.path_interp_optim_anoms)
self.fpath_xval_interp_nc_tmin = os.path.join(self.path_stndata_infill,
'xval_interp_tmin.nc')
self.fpath_xval_interp_nc_tmax = os.path.join(self.path_stndata_infill,
'xval_interp_tmax.nc')
# Make TopoWx data directory for raster data
self.path_rasters = os.path.join(self.twx_data_root, 'rasters')
mkdir_p(self.path_rasters)
self.path_predictor_rasters = os.path.join(self.path_rasters,
'conus_interp_grids', 'ncdf')
mkdir_p(self.path_predictor_rasters)
# Make TopoWx data directory for writing output tiles
self.path_tile_out = os.path.join(self.twx_data_root, 'tile_output')
mkdir_p(self.path_tile_out)
# Make TopoWx log directory
self.path_logs = os.path.join(self.twx_data_root, 'logs')
mkdir_p(self.path_logs)
##################################
# Make TopoWx data directory for final outputs
##################################
self.path_final_output = os.path.join(self.twx_data_root, 'final_output_data')
mkdir_p(self.path_final_output)
# Final auxiliary data directories
self.path_aux_data = os.path.join(self.path_final_output, 'auxiliary_data')
mkdir_p(self.path_aux_data)
self.path_aux_stndata = os.path.join(self.path_aux_data, 'station_data')
mkdir_p(self.path_aux_stndata)
self.fpath_stndata_nc_aux_tmin = os.path.join(self.path_aux_stndata,
'stn_obs_tmin.nc')
self.fpath_stndata_nc_aux_tmax = os.path.join(self.path_aux_stndata,
'stn_obs_tmax.nc')
self.fpath_pha_adj_aux = os.path.join(self.path_aux_stndata, 'homog_adjust.csv')
self.path_aux_grids = os.path.join(self.path_aux_data, 'auxiliary_grids')
mkdir_p(self.path_aux_grids)
# Final TopoWx output mosaics for normals, daily, and monthly data
self.path_mosaic_norms = os.path.join(self.path_final_output, 'normals')
mkdir_p(self.path_mosaic_norms)
self.path_mosaic_daily = os.path.join(self.path_final_output, 'daily')
mkdir_p(self.path_mosaic_daily)
self.path_mosaic_monthly = os.path.join(self.path_final_output, 'monthly')
mkdir_p(self.path_mosaic_monthly)
|
gpl-3.0
|
cdiazbas/MPySIR
|
all2maps.py
|
1
|
4874
|
# Author: [email protected]
import matplotlib.pyplot as plt
import pyLib.imtools as imtools
import numpy as np
# ========================= CREANDO PHIMAP
import matplotlib.colors as mcolors
def make_colormap(seq):
seq = [(None,) * 3, 0.0] + list(seq) + [1.0, (None,) * 3]
cdict = {'red': [], 'green': [], 'blue': []}
for i, item in enumerate(seq):
if isinstance(item, float):
r1, g1, b1 = seq[i - 1]
r2, g2, b2 = seq[i + 1]
cdict['red'].append([item, r1, r2])
cdict['green'].append([item, g1, g2])
cdict['blue'].append([item, b1, b2])
return mcolors.LinearSegmentedColormap('CustomMap', cdict)
c = mcolors.ColorConverter().to_rgb
phimap = make_colormap([c('white'), c('tomato'), 0.33, c('tomato'), c('deepskyblue'), 0.66, c('deepskyblue'),c('white')])
def dimMap(resultadoSir):
height = resultadoSir.shape[0]*(resultadoSir[0][-1][0][0]+1)
width = (resultadoSir[0][-1][0][1]+1)
return [height, width]
def readmapa(resultadoSir, mapa, magnitud):
cont = 0
for fila in range(0, height):
for columna in range(0, width):
punto = cont % resultadoSir.shape[1]
veces = int(cont/resultadoSir.shape[1])
if magnitud == 8 or magnitud == 9 or magnitud == 10 or magnitud == 11:
mapa[columna,fila] = resultadoSir[veces][punto][1][0][magnitud]
else:
mapa[columna,fila] = resultadoSir[veces][punto][1][0][magnitud][index]
cont += 1
return mapa
def corrphi(mapa):
mapa[mapa<0] = (mapa[mapa<0]+360) % 360; mapa[mapa>180] = (mapa[mapa>180]-180)
def do1map(logTau, magnitud):
# ==============================================================================================
# global index
# global magnitud
# ========================= INPUT
invSir1 = 'MAPA1.npy'
invSir2 = 'MAPA2.npy'
# logTau = 0.0
# magnitud = 2
# hsv
cmapArray = ['gray','gray','gray','bone','bone','seismic','Spectral_r',phimap,'bone','gray','gray','cubehelix']
magTitle = [r'${\rm log(\tau)=}$',r'${\rm T\ [kK]}$','p',r'${\rm v\ [km/s]}$',r'${\rm B\ [kG]}$',r'${\rm v\ [km/s]}$',r'${\rm \gamma\ [d]}$',r'${\rm \phi\ [d]}$','vmacro','fillingf','difusa',r'${\rm \chi^2}$']
magFile = ['TAU','TEMP','PRESION','VMICRO','CAMPO','VLOS','GAMMA','PHI','VMACRO','FILLING','DIFUSA','CHI2']
# ========================= MAP
resultadoSir1 = np.load(invSir1)
resultadoSir2 = np.load(invSir2)
# height, width = dimMap(resultadoSir1)
# print('height:',height,'width:',width)
# mapa = np.zeros((height, width))
index = np.where(resultadoSir1[0][0][1][0][0] == logTau)[0][0]
print('logTau: '+str(logTau)+' -> index: '+str(index))
# readmapa(resultadoSir1, mapa.T ,magnitud)
from pySir import sirtools as st
mapa1 = st.readSIRMap(resultadoSir1, magnitud, index)
mapa2 = st.readSIRMap(resultadoSir2, magnitud, index)
mapa = np.concatenate((mapa1, mapa2))
from scipy import ndimage
mapa = ndimage.median_filter(np.flipud(mapa), 3)
# Limites en la escala de color
if magnitud == 7: corrphi(mapa)
print('3sigma_map: {0:2.2f}'.format(3*np.std(mapa)))
print('Mean_map: {0:2.2f}'.format(np.mean(mapa)))
print('Min_map: {0:2.2f}'.format(np.min(mapa)))
print('Max_map: {0:2.2f}'.format(np.max(mapa)))
vmini = np.mean(mapa)-3*np.std(mapa)
if np.min(mapa) >= 0.0 and magnitud != 1: vmini = 0.
vmaxi = np.mean(mapa)+3*np.std(mapa)
if magnitud == 1 or magnitud == 4: vmini = np.min(mapa); vmaxi = np.max(mapa)
if magnitud == 6: vmaxi = 180.
if magnitud == 7: vmaxi = 180.;vmini = 0.
if magnitud == 11: vmaxi = np.max(mapa); vmini = 0.
if magnitud == 5: vmini = np.mean(mapa)-4*np.std(mapa); vmaxi = -vmini
from matplotlib.colors import LogNorm
plt.imshow(mapa,cmap=cmapArray[magnitud],origin='lower',interpolation='None',vmin=vmini,vmax=vmaxi)#norm=LogNorm()
plt.title('Map 17jun14.006 (1-2)')
plt.xlabel('Slit Axis [pix]')
plt.ylabel('Time Axis [pix]')
cb = plt.colorbar(shrink=.46)#, ticks=[0.6, 0.8, 1., 1.2])
#cb = plt.colorbar(shrink=.46, ticks=[0.3, 0.6, 0.9, 1.2, 1.5])
# cb.set_label(r'Intensity HeI ({0:4.1f}) /$I_{{qs}}$({1:4.1f})'.format(xLambda[341],xLambda[posicontinuo]), labelpad=5., y=0.5, fontsize=12.)
loglabel = r'${\rm log(\tau)=}$'
cb.set_label(r""+magTitle[magnitud]+r", "+loglabel+"{0}".format(logTau), labelpad=8., y=0.5, fontsize=12.)
# plt.show()
plt.savefig(magFile[magnitud]+'_log{0:02d}.pdf'.format(int(logTau)), bbox_inches='tight')
print(magFile[magnitud]+'_log{0:02d}.pdf SAVE'.format(int(logTau)))
print('-----------------------'+str(magnitud))
plt.clf()
for magnitud in range(12):
do1map(0.0, magnitud)
|
mit
|
timberhill/blablaplot
|
blablaplot.py
|
1
|
6659
|
#!/usr/bin/python
from numpy import loadtxt, asarray
from numpy.random import normal as gaussian_noise
import matplotlib.pyplot as plt
import matplotlib.gridspec as gridspec
import warnings
"""
Here you register new characters in format:
'<char>' : (<width>, <height>, '<filename>'),
"""
charlist = {
'a' : (0.7, 1.0, 'a'),
'b' : (0.7, 1.0, 'b'),
'c' : (0.7, 1.0, 'c'),
'd' : (0.7, 1.0, 'd'),
'e' : (0.7, 1.0, 'e'),
'f' : (0.7, 1.0, 'f'),
'g' : (0.7, 1.0, 'g'),
'h' : (0.7, 1.0, 'h'),
'i' : (0.4, 1.0, 'i'),
'j' : (0.4, 1.0, 'j'),
'k' : (0.7, 1.0, 'k'),
'l' : (0.7, 1.0, 'l'),
'm' : (0.7, 1.0, 'm'),
'n' : (0.7, 1.0, 'n'),
'o' : (0.7, 1.0, 'o'),
'p' : (0.7, 1.0, 'p'),
'q' : (0.7, 1.0, 'q'),
'r' : (0.7, 1.0, 'r'),
's' : (0.7, 1.0, 's'),
't' : (0.7, 1.0, 't'),
'u' : (0.7, 1.0, 'u'),
'v' : (0.7, 1.0, 'v'),
'w' : (0.7, 1.0, 'w'),
'x' : (0.7, 1.0, 'x'),
'y' : (0.7, 1.0, 'y'),
'z' : (0.7, 1.0, 'z'),
'0' : (0.7, 1.0, '0'),
'1' : (0.5, 1.0, '1'),
'2' : (0.7, 1.0, '2'),
'3' : (0.7, 1.0, '3'),
'4' : (0.7, 1.0, '4'),
'5' : (0.7, 1.0, '5'),
'6' : (0.7, 1.0, '6'),
'7' : (0.7, 1.0, '7'),
'8' : (0.7, 1.0, '8'),
'9' : (0.7, 1.0, '9'),
' ' : (0.7, 0.0, 'space'),
'?' : (0.7, 1.0, 'questionmark'),
'!' : (0.2, 1.0, 'exclamationmark'),
',' : (0.1, 0.1, 'comma'),
'.' : (0.2, 0.1, 'fullstop'),
'&' : (0.6, 1.0, 'ampersand'),
'$' : (0.5, 1.0, 'dollar'),
'@' : (0.7, 1.0, 'at'),
'(' : (0.3, 1.0, 'brackets_open'),
')' : (0.3, 1.0, 'brackets_close'),
'#' : (0.7, 1.0, 'hash'),
'%' : (0.7, 1.0, 'percent'),
}
class Character(object):
"""
ARGUMENTS
char - single character (first one is chosen)
size - size of the letter (width, height)
self.xs, self.ys - arrays with letter points
"""
def __init__(self, char, filename='', size=(1.0, 1.0), jitter=0.0):
if len(char) < 1:
raise Exception('Empty string is passed to Character() constructor.')
self.char = char[0]
if len(filename) > 0:
self.filename = filename
else:
'chars/' + self.char + '.dat'
self._getPoints()
self.resize(size=size)
def _getPoints(self):
xs, ys = loadtxt('chars/' + self.filename + '.dat', unpack=True)
self.xs = asarray(xs)
self.ys = asarray(ys)
self._sort()
def _sort(self):
points = zip(self.xs, self.ys)
sorted_points = sorted(points)
self.xs = asarray([point[0] for point in sorted_points])
self.ys = asarray([point[1] for point in sorted_points])
def resize(self, size=(1.0, 1.0)):
self.size = size
if len(self.xs) < 1:
self._getPoints()
xmin = min(self.xs)
xmax = max(self.xs)
ymin = min(self.ys)
ymax = max(self.ys)
for i in range(0, len(self.xs)):
self.xs[i] = self.size[0] * (self.xs[i] - xmin) / (xmax - xmin)
self.ys[i] = self.size[1] * (self.ys[i] - ymin) / (ymax - ymin)
class TextyPloty(object):
"""
ARGUMENTS
jitter - to randomize points locations, represents sigma for gaussian noise
spacing - distance between letters
offset - offset from zero point if format (x, y)
scale - scale/size of the letters
func - function to add text to
"""
def __init__(self, jitter=0.0, spacing=0.1, offset=(0.0, 0.0), scale=(1.0, 1.0), func=None):
self.jitter = jitter
self.spacing = spacing
self.offset = offset
self.scale = scale
self.func = func
self.charlist = charlist
"""
ARGUMENTS
text - string to plot
RETURNS
xs, ys - points coordinates
"""
def get(self, text):
xs, ys = [], []
xoffset = self.offset[0]
for char in text:
if char == ' ':
xoffset += self.charlist[char][0] * self.scale[0]
elif char == '\t':
xoffset += self.charlist[char][0] * self.scale[0] * 4
elif char in self.charlist:
charobj = Character(char=char, filename=self.charlist[char][2], size=self.charlist[char])
xs.extend(self.scale[0] * charobj.xs + xoffset)
ys.extend(self.scale[1] * charobj.ys + self.offset[1])
xoffset += self.charlist[char][0] * self.scale[0]
else:
warnings.warn('Could not find file with "' + char + '" character. Skipping...', Warning)
xoffset += self.spacing * self.scale[0]
if self.func != None:
for i in range(0,len(xs)):
ys[i] += self.func(xs[i])
if self.jitter > 0:
noise = gaussian_noise(0.0, self.jitter*self.scale[1], (len(ys)))
ys = [x+y for x, y in zip(ys, noise)]
return asarray(xs), asarray(ys)
class ResidualsPlot(object):
"""
"""
def __init__(self, data=([],[]), datastyle='k.', xs_fit=[], func=None, fitstyle='r-', \
xlabel='', ylabel='', reslabel='', ratio=[4, 1], figsize=(10,6), axis=None, res_axis=None, \
fitlabel='fit', datalabel='points'):
self.plt_instance = plt
self.xs = data[0]
self.ys = data[1]
self.datastyle = datastyle
self.xs_fit = xs_fit
self.func = func
self.ys_fit = self.func(self.xs_fit)
self.fitstyle = fitstyle
self.xlabel = xlabel
self.ylabel = ylabel
self.reslabel = reslabel
self.ratio = ratio
self.figsize = figsize
self.axis = axis
self.res_axis = res_axis
self.fitlabel = fitlabel
self.datalabel = datalabel
def draw(self):
self.redraw()
def redraw(self):
self.plt_instance = plt
self.plt_instance.figure(figsize=self.figsize)
self.gridspec_instance = gridspec.GridSpec(2, 1, height_ratios=self.ratio)
self.gridspec_instance.update(hspace=0.00)
self.ax0 = self.plt_instance.subplot(self.gridspec_instance[0])
self.ax1 = self.plt_instance.subplot(self.gridspec_instance[1])
self.ys_res = self.ys - self.func(self.xs)
# set axis ranges
if self.axis == None:
self.ax0.axis([min(self.xs_fit) * 1.1, max(self.xs_fit)*1.1, min(self.ys_fit) * 1.1, max(self.ys_fit) * 1.1])
elif len(self.axis) != 4:
raise Exception('ResidualsPlot: axis should contain 4 numbers: (x1, x2, y1, y2)')
else:
self.ax0.axis(self.axis)
if self.res_axis == None:
self.ax1.axis([min(self.xs_fit) * 1.1, max(self.xs_fit)*1.1, min(self.ys_res) * 1.1, max(self.ys_res)*1.1])
elif len(self.res_axis) != 4:
raise Exception('ResidualsPlot: res_axis should contain 4 numbers: (x1, x2, y1, y2)')
else:
self.ax1.axis(self.res_axis)
# set axis labels
self.ax0.set_ylabel(self.ylabel)
self.ax1.set_ylabel(self.reslabel)
self.ax1.set_xlabel(self.xlabel)
# first subplot: datapoints and fit
self.ax0.plot(self.xs_fit, self.ys_fit, self.fitstyle, label=self.fitlabel)
self.ax0.plot(self.xs, self.ys, self.datastyle, label=self.datalabel)
# second subplot: residuals
self.ax1.plot([min(self.xs), max(self.xs)], [0,0], self.fitstyle)
self.ax1.plot(self.xs, self.ys_res, self.datastyle)
self.ax0.legend(loc="upper right")
def show(self):
self.plt_instance.show()
def savefig(self, name='plot.pdf'):
self.plt_instance.savefig(name)
|
mit
|
tiankanl/2014_fall_ASTR599
|
notebooks/fig_code/helpers.py
|
74
|
2301
|
"""
Small helpers for code that is not shown in the notebooks
"""
from sklearn import neighbors, datasets, linear_model
import pylab as pl
import numpy as np
from matplotlib.colors import ListedColormap
# Create color maps for 3-class classification problem, as with iris
cmap_light = ListedColormap(['#FFAAAA', '#AAFFAA', '#AAAAFF'])
cmap_bold = ListedColormap(['#FF0000', '#00FF00', '#0000FF'])
def plot_iris_knn():
iris = datasets.load_iris()
X = iris.data[:, :2] # we only take the first two features. We could
# avoid this ugly slicing by using a two-dim dataset
y = iris.target
knn = neighbors.KNeighborsClassifier(n_neighbors=3)
knn.fit(X, y)
x_min, x_max = X[:, 0].min() - .1, X[:, 0].max() + .1
y_min, y_max = X[:, 1].min() - .1, X[:, 1].max() + .1
xx, yy = np.meshgrid(np.linspace(x_min, x_max, 100),
np.linspace(y_min, y_max, 100))
Z = knn.predict(np.c_[xx.ravel(), yy.ravel()])
# Put the result into a color plot
Z = Z.reshape(xx.shape)
pl.figure()
pl.pcolormesh(xx, yy, Z, cmap=cmap_light)
# Plot also the training points
pl.scatter(X[:, 0], X[:, 1], c=y, cmap=cmap_bold)
pl.xlabel('sepal length (cm)')
pl.ylabel('sepal width (cm)')
pl.axis('tight')
def plot_polynomial_regression():
rng = np.random.RandomState(0)
x = 2*rng.rand(100) - 1
f = lambda t: 1.2 * t**2 + .1 * t**3 - .4 * t **5 - .5 * t ** 9
y = f(x) + .4 * rng.normal(size=100)
x_test = np.linspace(-1, 1, 100)
pl.figure()
pl.scatter(x, y, s=4)
X = np.array([x**i for i in range(5)]).T
X_test = np.array([x_test**i for i in range(5)]).T
regr = linear_model.LinearRegression()
regr.fit(X, y)
pl.plot(x_test, regr.predict(X_test), label='4th order')
X = np.array([x**i for i in range(10)]).T
X_test = np.array([x_test**i for i in range(10)]).T
regr = linear_model.LinearRegression()
regr.fit(X, y)
pl.plot(x_test, regr.predict(X_test), label='9th order')
pl.legend(loc='best')
pl.axis('tight')
pl.title('Fitting a 4th and a 9th order polynomial')
pl.figure()
pl.scatter(x, y, s=4)
pl.plot(x_test, f(x_test), label="truth")
pl.axis('tight')
pl.title('Ground truth (9th order polynomial)')
|
apache-2.0
|
mwv/scikit-learn
|
examples/datasets/plot_random_dataset.py
|
348
|
2254
|
"""
==============================================
Plot randomly generated classification dataset
==============================================
Plot several randomly generated 2D classification datasets.
This example illustrates the :func:`datasets.make_classification`
:func:`datasets.make_blobs` and :func:`datasets.make_gaussian_quantiles`
functions.
For ``make_classification``, three binary and two multi-class classification
datasets are generated, with different numbers of informative features and
clusters per class. """
print(__doc__)
import matplotlib.pyplot as plt
from sklearn.datasets import make_classification
from sklearn.datasets import make_blobs
from sklearn.datasets import make_gaussian_quantiles
plt.figure(figsize=(8, 8))
plt.subplots_adjust(bottom=.05, top=.9, left=.05, right=.95)
plt.subplot(321)
plt.title("One informative feature, one cluster per class", fontsize='small')
X1, Y1 = make_classification(n_features=2, n_redundant=0, n_informative=1,
n_clusters_per_class=1)
plt.scatter(X1[:, 0], X1[:, 1], marker='o', c=Y1)
plt.subplot(322)
plt.title("Two informative features, one cluster per class", fontsize='small')
X1, Y1 = make_classification(n_features=2, n_redundant=0, n_informative=2,
n_clusters_per_class=1)
plt.scatter(X1[:, 0], X1[:, 1], marker='o', c=Y1)
plt.subplot(323)
plt.title("Two informative features, two clusters per class", fontsize='small')
X2, Y2 = make_classification(n_features=2, n_redundant=0, n_informative=2)
plt.scatter(X2[:, 0], X2[:, 1], marker='o', c=Y2)
plt.subplot(324)
plt.title("Multi-class, two informative features, one cluster",
fontsize='small')
X1, Y1 = make_classification(n_features=2, n_redundant=0, n_informative=2,
n_clusters_per_class=1, n_classes=3)
plt.scatter(X1[:, 0], X1[:, 1], marker='o', c=Y1)
plt.subplot(325)
plt.title("Three blobs", fontsize='small')
X1, Y1 = make_blobs(n_features=2, centers=3)
plt.scatter(X1[:, 0], X1[:, 1], marker='o', c=Y1)
plt.subplot(326)
plt.title("Gaussian divided into three quantiles", fontsize='small')
X1, Y1 = make_gaussian_quantiles(n_features=2, n_classes=3)
plt.scatter(X1[:, 0], X1[:, 1], marker='o', c=Y1)
plt.show()
|
bsd-3-clause
|
r-mart/scikit-learn
|
examples/mixture/plot_gmm_selection.py
|
248
|
3223
|
"""
=================================
Gaussian Mixture Model Selection
=================================
This example shows that model selection can be performed with
Gaussian Mixture Models using information-theoretic criteria (BIC).
Model selection concerns both the covariance type
and the number of components in the model.
In that case, AIC also provides the right result (not shown to save time),
but BIC is better suited if the problem is to identify the right model.
Unlike Bayesian procedures, such inferences are prior-free.
In that case, the model with 2 components and full covariance
(which corresponds to the true generative model) is selected.
"""
print(__doc__)
import itertools
import numpy as np
from scipy import linalg
import matplotlib.pyplot as plt
import matplotlib as mpl
from sklearn import mixture
# Number of samples per component
n_samples = 500
# Generate random sample, two components
np.random.seed(0)
C = np.array([[0., -0.1], [1.7, .4]])
X = np.r_[np.dot(np.random.randn(n_samples, 2), C),
.7 * np.random.randn(n_samples, 2) + np.array([-6, 3])]
lowest_bic = np.infty
bic = []
n_components_range = range(1, 7)
cv_types = ['spherical', 'tied', 'diag', 'full']
for cv_type in cv_types:
for n_components in n_components_range:
# Fit a mixture of Gaussians with EM
gmm = mixture.GMM(n_components=n_components, covariance_type=cv_type)
gmm.fit(X)
bic.append(gmm.bic(X))
if bic[-1] < lowest_bic:
lowest_bic = bic[-1]
best_gmm = gmm
bic = np.array(bic)
color_iter = itertools.cycle(['k', 'r', 'g', 'b', 'c', 'm', 'y'])
clf = best_gmm
bars = []
# Plot the BIC scores
spl = plt.subplot(2, 1, 1)
for i, (cv_type, color) in enumerate(zip(cv_types, color_iter)):
xpos = np.array(n_components_range) + .2 * (i - 2)
bars.append(plt.bar(xpos, bic[i * len(n_components_range):
(i + 1) * len(n_components_range)],
width=.2, color=color))
plt.xticks(n_components_range)
plt.ylim([bic.min() * 1.01 - .01 * bic.max(), bic.max()])
plt.title('BIC score per model')
xpos = np.mod(bic.argmin(), len(n_components_range)) + .65 +\
.2 * np.floor(bic.argmin() / len(n_components_range))
plt.text(xpos, bic.min() * 0.97 + .03 * bic.max(), '*', fontsize=14)
spl.set_xlabel('Number of components')
spl.legend([b[0] for b in bars], cv_types)
# Plot the winner
splot = plt.subplot(2, 1, 2)
Y_ = clf.predict(X)
for i, (mean, covar, color) in enumerate(zip(clf.means_, clf.covars_,
color_iter)):
v, w = linalg.eigh(covar)
if not np.any(Y_ == i):
continue
plt.scatter(X[Y_ == i, 0], X[Y_ == i, 1], .8, color=color)
# Plot an ellipse to show the Gaussian component
angle = np.arctan2(w[0][1], w[0][0])
angle = 180 * angle / np.pi # convert to degrees
v *= 4
ell = mpl.patches.Ellipse(mean, v[0], v[1], 180 + angle, color=color)
ell.set_clip_box(splot.bbox)
ell.set_alpha(.5)
splot.add_artist(ell)
plt.xlim(-10, 10)
plt.ylim(-3, 6)
plt.xticks(())
plt.yticks(())
plt.title('Selected GMM: full model, 2 components')
plt.subplots_adjust(hspace=.35, bottom=.02)
plt.show()
|
bsd-3-clause
|
MusicVisualizationUMass/TeamNameGenerator
|
src/musicvisualizer/pipeline/models/tests/losc_manual_tests.py
|
1
|
1565
|
#!/usr/bin/env python3
'''A set of manual tests to make sure bits and pieces are working. Not part of
the general testing framework but kept for now in case there is some useful data
here later
'''
from musicvisualizer.pipeline.models.linear_oscillator import LinearOscillatorModel
import matplotlib.pyplot as plt
#plt.style.use('ggplot')
if __name__ == '__main__':
points = 1024
def dataIn():
print("CUSTOM DATA IN")
t = 0.0
MAXT = 30
while t < MAXT:
t += 0.1
def dataIn_empty():
for i in range(1000):
yield (0.0, 0.0)
def dataIn_singlePulse():
yield(points/2, 20)
for i in range(1000):
yield (0.0, 0.0)
M = LinearOscillatorModel(
sampleRate = 24, # Visual sample rate
dataInFPS = 96, # Data sample rate (to generate visual)
number_of_points = points, # how many points in simulation?
hook = 11.0,
dataIn = None,
damping = 0.9999)
I = iter(M)
plt.ion() # Interactive I/O
for frame in I:
ys = [ p[0] for p in frame]
vs = [ p[1] for p in frame]
xs = range(len(frame))
# print("max(ys) = {}".format(max(ys)))
# print("max(vs) = {}".format(max(vs)))
ys = ys + [1.0, -1.0]
xs = list(xs) + [0, 0]
plt.scatter(xs, ys)
plt.show() # Update visuals
plt.pause(0.02) # Pause
plt.cla() # Clear
|
mit
|
Ziqi-Li/bknqgis
|
pandas/pandas/core/dtypes/inference.py
|
8
|
8381
|
""" basic inference routines """
import collections
import re
import numpy as np
from numbers import Number
from pandas.compat import (PY2, string_types, text_type,
string_and_binary_types)
from pandas._libs import lib
is_bool = lib.is_bool
is_integer = lib.is_integer
is_float = lib.is_float
is_complex = lib.is_complex
is_scalar = lib.isscalar
is_decimal = lib.is_decimal
is_interval = lib.is_interval
def is_number(obj):
"""
Check if the object is a number.
Parameters
----------
obj : The object to check.
Returns
-------
is_number : bool
Whether `obj` is a number or not.
Examples
--------
>>> is_number(1)
True
>>> is_number("foo")
False
"""
return isinstance(obj, (Number, np.number))
def is_string_like(obj):
"""
Check if the object is a string.
Parameters
----------
obj : The object to check.
Examples
--------
>>> is_string_like("foo")
True
>>> is_string_like(1)
False
Returns
-------
is_str_like : bool
Whether `obj` is a string or not.
"""
return isinstance(obj, (text_type, string_types))
def _iterable_not_string(obj):
"""
Check if the object is an iterable but not a string.
Parameters
----------
obj : The object to check.
Returns
-------
is_iter_not_string : bool
Whether `obj` is a non-string iterable.
Examples
--------
>>> _iterable_not_string([1, 2, 3])
True
>>> _iterable_not_string("foo")
False
>>> _iterable_not_string(1)
False
"""
return (isinstance(obj, collections.Iterable) and
not isinstance(obj, string_types))
def is_iterator(obj):
"""
Check if the object is an iterator.
For example, lists are considered iterators
but not strings or datetime objects.
Parameters
----------
obj : The object to check.
Returns
-------
is_iter : bool
Whether `obj` is an iterator.
Examples
--------
>>> is_iterator([1, 2, 3])
True
>>> is_iterator(datetime(2017, 1, 1))
False
>>> is_iterator("foo")
False
>>> is_iterator(1)
False
"""
if not hasattr(obj, '__iter__'):
return False
if PY2:
return hasattr(obj, 'next')
else:
# Python 3 generators have
# __next__ instead of next
return hasattr(obj, '__next__')
def is_file_like(obj):
"""
Check if the object is a file-like object.
For objects to be considered file-like, they must
be an iterator AND have either a `read` and/or `write`
method as an attribute.
Note: file-like objects must be iterable, but
iterable objects need not be file-like.
.. versionadded:: 0.20.0
Parameters
----------
obj : The object to check.
Returns
-------
is_file_like : bool
Whether `obj` has file-like properties.
Examples
--------
>>> buffer(StringIO("data"))
>>> is_file_like(buffer)
True
>>> is_file_like([1, 2, 3])
False
"""
if not (hasattr(obj, 'read') or hasattr(obj, 'write')):
return False
if not hasattr(obj, "__iter__"):
return False
return True
def is_re(obj):
"""
Check if the object is a regex pattern instance.
Parameters
----------
obj : The object to check.
Returns
-------
is_regex : bool
Whether `obj` is a regex pattern.
Examples
--------
>>> is_re(re.compile(".*"))
True
>>> is_re("foo")
False
"""
return isinstance(obj, re._pattern_type)
def is_re_compilable(obj):
"""
Check if the object can be compiled into a regex pattern instance.
Parameters
----------
obj : The object to check.
Returns
-------
is_regex_compilable : bool
Whether `obj` can be compiled as a regex pattern.
Examples
--------
>>> is_re_compilable(".*")
True
>>> is_re_compilable(1)
False
"""
try:
re.compile(obj)
except TypeError:
return False
else:
return True
def is_list_like(obj):
"""
Check if the object is list-like.
Objects that are considered list-like are for example Python
lists, tuples, sets, NumPy arrays, and Pandas Series.
Strings and datetime objects, however, are not considered list-like.
Parameters
----------
obj : The object to check.
Returns
-------
is_list_like : bool
Whether `obj` has list-like properties.
Examples
--------
>>> is_list_like([1, 2, 3])
True
>>> is_list_like({1, 2, 3})
True
>>> is_list_like(datetime(2017, 1, 1))
False
>>> is_list_like("foo")
False
>>> is_list_like(1)
False
"""
return (hasattr(obj, '__iter__') and
not isinstance(obj, string_and_binary_types))
def is_nested_list_like(obj):
"""
Check if the object is list-like, and that all of its elements
are also list-like.
.. versionadded:: 0.20.0
Parameters
----------
obj : The object to check.
Returns
-------
is_list_like : bool
Whether `obj` has list-like properties.
Examples
--------
>>> is_nested_list_like([[1, 2, 3]])
True
>>> is_nested_list_like([{1, 2, 3}, {1, 2, 3}])
True
>>> is_nested_list_like(["foo"])
False
>>> is_nested_list_like([])
False
>>> is_nested_list_like([[1, 2, 3], 1])
False
Notes
-----
This won't reliably detect whether a consumable iterator (e. g.
a generator) is a nested-list-like without consuming the iterator.
To avoid consuming it, we always return False if the outer container
doesn't define `__len__`.
See Also
--------
is_list_like
"""
return (is_list_like(obj) and hasattr(obj, '__len__') and
len(obj) > 0 and all(is_list_like(item) for item in obj))
def is_dict_like(obj):
"""
Check if the object is dict-like.
Parameters
----------
obj : The object to check.
Returns
-------
is_dict_like : bool
Whether `obj` has dict-like properties.
Examples
--------
>>> is_dict_like({1: 2})
True
>>> is_dict_like([1, 2, 3])
False
"""
return hasattr(obj, '__getitem__') and hasattr(obj, 'keys')
def is_named_tuple(obj):
"""
Check if the object is a named tuple.
Parameters
----------
obj : The object to check.
Returns
-------
is_named_tuple : bool
Whether `obj` is a named tuple.
Examples
--------
>>> Point = namedtuple("Point", ["x", "y"])
>>> p = Point(1, 2)
>>>
>>> is_named_tuple(p)
True
>>> is_named_tuple((1, 2))
False
"""
return isinstance(obj, tuple) and hasattr(obj, '_fields')
def is_hashable(obj):
"""Return True if hash(obj) will succeed, False otherwise.
Some types will pass a test against collections.Hashable but fail when they
are actually hashed with hash().
Distinguish between these and other types by trying the call to hash() and
seeing if they raise TypeError.
Examples
--------
>>> a = ([],)
>>> isinstance(a, collections.Hashable)
True
>>> is_hashable(a)
False
"""
# Unfortunately, we can't use isinstance(obj, collections.Hashable), which
# can be faster than calling hash. That is because numpy scalars on Python
# 3 fail this test.
# Reconsider this decision once this numpy bug is fixed:
# https://github.com/numpy/numpy/issues/5562
try:
hash(obj)
except TypeError:
return False
else:
return True
def is_sequence(obj):
"""
Check if the object is a sequence of objects.
String types are not included as sequences here.
Parameters
----------
obj : The object to check.
Returns
-------
is_sequence : bool
Whether `obj` is a sequence of objects.
Examples
--------
>>> l = [1, 2, 3]
>>>
>>> is_sequence(l)
True
>>> is_sequence(iter(l))
False
"""
try:
iter(obj) # Can iterate over it.
len(obj) # Has a length associated with it.
return not isinstance(obj, string_and_binary_types)
except (TypeError, AttributeError):
return False
|
gpl-2.0
|
yassersouri/omgh
|
src/scripts/grid_search_c.py
|
1
|
2365
|
import sys
import os
sys.path.append(os.path.dirname(os.path.dirname(__file__)))
from dataset import CUB_200_2011
from storage import datastore
from deep_extractor import CNN_Features_CAFFE_REFERENCE
from datetime import datetime as dt
import settings
import utils
import numpy as np
cub = CUB_200_2011(settings.CUB_ROOT)
features_storage_r = datastore(settings.storage('ccrft'))
feature_extractor_r = CNN_Features_CAFFE_REFERENCE(features_storage_r, make_net=False)
features_storage_c = datastore(settings.storage('cccft'))
feature_extractor_c = CNN_Features_CAFFE_REFERENCE(features_storage_c, make_net=False)
features_storage_p_h = datastore(settings.storage('ccpheadft-100000'))
feature_extractor_p_h = CNN_Features_CAFFE_REFERENCE(features_storage_p_h, make_net=False)
features_storage_p_h = datastore(settings.storage('ccpheadft-100000'))
feature_extractor_p_h = CNN_Features_CAFFE_REFERENCE(features_storage_p_h, make_net=False)
features_storage_p_b = datastore(settings.storage('ccpbodyft-10000'))
feature_extractor_p_b = CNN_Features_CAFFE_REFERENCE(features_storage_p_b, make_net=False)
Xtrain_r, ytrain_r, Xtest_r, ytest_r = cub.get_train_test(feature_extractor_r.extract_one)
Xtrain_c, ytrain_c, Xtest_c, ytest_c = cub.get_train_test(feature_extractor_c.extract_one)
Xtrain_p_h, ytrain_p_h, Xtest_p_h, ytest_p_h = cub.get_train_test(feature_extractor_p_h.extract_one)
Xtrain_p_b, ytrain_p_b, Xtest_p_b, ytest_p_b = cub.get_train_test(feature_extractor_p_b.extract_one)
Xtrain = np.concatenate((Xtrain_r, Xtrain_c, Xtrain_p_h, Xtrain_p_b), axis=1)
Xtest = np.concatenate((Xtest_r, Xtest_c, Xtest_p_h, Xtest_p_b), axis=1)
import numpy
from sklearn import svm
from sklearn.metrics import accuracy_score
from sklearn.grid_search import GridSearchCV
CS = numpy.array([100, 10, 1, 0.1, 0.01, 0.001, 0.0001])
model = svm.LinearSVC()
grid_search = GridSearchCV(estimator=model, param_grid=dict(C=CS), n_jobs=3)
grid_search.fit(Xtrain, ytrain_r)
print 'best c:', grid_search.best_params_
a = dt.now()
model = svm.LinearSVC(C=grid_search.best_params_['C'])
model.fit(Xtrain, ytrain_r)
b = dt.now()
print 'fitted in: %s' % (b - a)
a = dt.now()
predictions = model.predict(Xtest)
b = dt.now()
print 'predicted in: %s' % (b - a)
print 'accuracy', accuracy_score(ytest_r, predictions)
print 'mean accuracy', utils.mean_accuracy(ytest_r, predictions)
|
mit
|
louispotok/pandas
|
pandas/tests/indexes/datetimes/test_partial_slicing.py
|
1
|
15706
|
""" test partial slicing on Series/Frame """
import pytest
from datetime import datetime
import numpy as np
import pandas as pd
import operator as op
from pandas import (DatetimeIndex, Series, DataFrame,
date_range, Index, Timedelta, Timestamp)
from pandas.util import testing as tm
class TestSlicing(object):
def test_dti_slicing(self):
dti = DatetimeIndex(start='1/1/2005', end='12/1/2005', freq='M')
dti2 = dti[[1, 3, 5]]
v1 = dti2[0]
v2 = dti2[1]
v3 = dti2[2]
assert v1 == Timestamp('2/28/2005')
assert v2 == Timestamp('4/30/2005')
assert v3 == Timestamp('6/30/2005')
# don't carry freq through irregular slicing
assert dti2.freq is None
def test_slice_keeps_name(self):
# GH4226
st = pd.Timestamp('2013-07-01 00:00:00', tz='America/Los_Angeles')
et = pd.Timestamp('2013-07-02 00:00:00', tz='America/Los_Angeles')
dr = pd.date_range(st, et, freq='H', name='timebucket')
assert dr[1:].name == dr.name
def test_slice_with_negative_step(self):
ts = Series(np.arange(20),
date_range('2014-01-01', periods=20, freq='MS'))
SLC = pd.IndexSlice
def assert_slices_equivalent(l_slc, i_slc):
tm.assert_series_equal(ts[l_slc], ts.iloc[i_slc])
tm.assert_series_equal(ts.loc[l_slc], ts.iloc[i_slc])
tm.assert_series_equal(ts.loc[l_slc], ts.iloc[i_slc])
assert_slices_equivalent(SLC[Timestamp('2014-10-01')::-1], SLC[9::-1])
assert_slices_equivalent(SLC['2014-10-01'::-1], SLC[9::-1])
assert_slices_equivalent(SLC[:Timestamp('2014-10-01'):-1], SLC[:8:-1])
assert_slices_equivalent(SLC[:'2014-10-01':-1], SLC[:8:-1])
assert_slices_equivalent(SLC['2015-02-01':'2014-10-01':-1],
SLC[13:8:-1])
assert_slices_equivalent(SLC[Timestamp('2015-02-01'):Timestamp(
'2014-10-01'):-1], SLC[13:8:-1])
assert_slices_equivalent(SLC['2015-02-01':Timestamp('2014-10-01'):-1],
SLC[13:8:-1])
assert_slices_equivalent(SLC[Timestamp('2015-02-01'):'2014-10-01':-1],
SLC[13:8:-1])
assert_slices_equivalent(SLC['2014-10-01':'2015-02-01':-1], SLC[:0])
def test_slice_with_zero_step_raises(self):
ts = Series(np.arange(20),
date_range('2014-01-01', periods=20, freq='MS'))
tm.assert_raises_regex(ValueError, 'slice step cannot be zero',
lambda: ts[::0])
tm.assert_raises_regex(ValueError, 'slice step cannot be zero',
lambda: ts.loc[::0])
tm.assert_raises_regex(ValueError, 'slice step cannot be zero',
lambda: ts.loc[::0])
def test_slice_bounds_empty(self):
# GH 14354
empty_idx = DatetimeIndex(freq='1H', periods=0, end='2015')
right = empty_idx._maybe_cast_slice_bound('2015-01-02', 'right', 'loc')
exp = Timestamp('2015-01-02 23:59:59.999999999')
assert right == exp
left = empty_idx._maybe_cast_slice_bound('2015-01-02', 'left', 'loc')
exp = Timestamp('2015-01-02 00:00:00')
assert left == exp
def test_slice_duplicate_monotonic(self):
# https://github.com/pandas-dev/pandas/issues/16515
idx = pd.DatetimeIndex(['2017', '2017'])
result = idx._maybe_cast_slice_bound('2017-01-01', 'left', 'loc')
expected = Timestamp('2017-01-01')
assert result == expected
def test_monotone_DTI_indexing_bug(self):
# GH 19362
# Testing accessing the first element in a montononic descending
# partial string indexing.
df = pd.DataFrame(list(range(5)))
date_list = ['2018-01-02', '2017-02-10', '2016-03-10',
'2015-03-15', '2014-03-16']
date_index = pd.to_datetime(date_list)
df['date'] = date_index
expected = pd.DataFrame({0: list(range(5)), 'date': date_index})
tm.assert_frame_equal(df, expected)
df = pd.DataFrame({'A': [1, 2, 3]},
index=pd.date_range('20170101',
periods=3)[::-1])
expected = pd.DataFrame({'A': 1},
index=pd.date_range('20170103',
periods=1))
tm.assert_frame_equal(df.loc['2017-01-03'], expected)
def test_slice_year(self):
dti = DatetimeIndex(freq='B', start=datetime(2005, 1, 1), periods=500)
s = Series(np.arange(len(dti)), index=dti)
result = s['2005']
expected = s[s.index.year == 2005]
tm.assert_series_equal(result, expected)
df = DataFrame(np.random.rand(len(dti), 5), index=dti)
result = df.loc['2005']
expected = df[df.index.year == 2005]
tm.assert_frame_equal(result, expected)
rng = date_range('1/1/2000', '1/1/2010')
result = rng.get_loc('2009')
expected = slice(3288, 3653)
assert result == expected
def test_slice_quarter(self):
dti = DatetimeIndex(freq='D', start=datetime(2000, 6, 1), periods=500)
s = Series(np.arange(len(dti)), index=dti)
assert len(s['2001Q1']) == 90
df = DataFrame(np.random.rand(len(dti), 5), index=dti)
assert len(df.loc['1Q01']) == 90
def test_slice_month(self):
dti = DatetimeIndex(freq='D', start=datetime(2005, 1, 1), periods=500)
s = Series(np.arange(len(dti)), index=dti)
assert len(s['2005-11']) == 30
df = DataFrame(np.random.rand(len(dti), 5), index=dti)
assert len(df.loc['2005-11']) == 30
tm.assert_series_equal(s['2005-11'], s['11-2005'])
def test_partial_slice(self):
rng = DatetimeIndex(freq='D', start=datetime(2005, 1, 1), periods=500)
s = Series(np.arange(len(rng)), index=rng)
result = s['2005-05':'2006-02']
expected = s['20050501':'20060228']
tm.assert_series_equal(result, expected)
result = s['2005-05':]
expected = s['20050501':]
tm.assert_series_equal(result, expected)
result = s[:'2006-02']
expected = s[:'20060228']
tm.assert_series_equal(result, expected)
result = s['2005-1-1']
assert result == s.iloc[0]
pytest.raises(Exception, s.__getitem__, '2004-12-31')
def test_partial_slice_daily(self):
rng = DatetimeIndex(freq='H', start=datetime(2005, 1, 31), periods=500)
s = Series(np.arange(len(rng)), index=rng)
result = s['2005-1-31']
tm.assert_series_equal(result, s.iloc[:24])
pytest.raises(Exception, s.__getitem__, '2004-12-31 00')
def test_partial_slice_hourly(self):
rng = DatetimeIndex(freq='T', start=datetime(2005, 1, 1, 20, 0, 0),
periods=500)
s = Series(np.arange(len(rng)), index=rng)
result = s['2005-1-1']
tm.assert_series_equal(result, s.iloc[:60 * 4])
result = s['2005-1-1 20']
tm.assert_series_equal(result, s.iloc[:60])
assert s['2005-1-1 20:00'] == s.iloc[0]
pytest.raises(Exception, s.__getitem__, '2004-12-31 00:15')
def test_partial_slice_minutely(self):
rng = DatetimeIndex(freq='S', start=datetime(2005, 1, 1, 23, 59, 0),
periods=500)
s = Series(np.arange(len(rng)), index=rng)
result = s['2005-1-1 23:59']
tm.assert_series_equal(result, s.iloc[:60])
result = s['2005-1-1']
tm.assert_series_equal(result, s.iloc[:60])
assert s[Timestamp('2005-1-1 23:59:00')] == s.iloc[0]
pytest.raises(Exception, s.__getitem__, '2004-12-31 00:00:00')
def test_partial_slice_second_precision(self):
rng = DatetimeIndex(start=datetime(2005, 1, 1, 0, 0, 59,
microsecond=999990),
periods=20, freq='US')
s = Series(np.arange(20), rng)
tm.assert_series_equal(s['2005-1-1 00:00'], s.iloc[:10])
tm.assert_series_equal(s['2005-1-1 00:00:59'], s.iloc[:10])
tm.assert_series_equal(s['2005-1-1 00:01'], s.iloc[10:])
tm.assert_series_equal(s['2005-1-1 00:01:00'], s.iloc[10:])
assert s[Timestamp('2005-1-1 00:00:59.999990')] == s.iloc[0]
tm.assert_raises_regex(KeyError, '2005-1-1 00:00:00',
lambda: s['2005-1-1 00:00:00'])
def test_partial_slicing_dataframe(self):
# GH14856
# Test various combinations of string slicing resolution vs.
# index resolution
# - If string resolution is less precise than index resolution,
# string is considered a slice
# - If string resolution is equal to or more precise than index
# resolution, string is considered an exact match
formats = ['%Y', '%Y-%m', '%Y-%m-%d', '%Y-%m-%d %H',
'%Y-%m-%d %H:%M', '%Y-%m-%d %H:%M:%S']
resolutions = ['year', 'month', 'day', 'hour', 'minute', 'second']
for rnum, resolution in enumerate(resolutions[2:], 2):
# we check only 'day', 'hour', 'minute' and 'second'
unit = Timedelta("1 " + resolution)
middate = datetime(2012, 1, 1, 0, 0, 0)
index = DatetimeIndex([middate - unit,
middate, middate + unit])
values = [1, 2, 3]
df = DataFrame({'a': values}, index, dtype=np.int64)
assert df.index.resolution == resolution
# Timestamp with the same resolution as index
# Should be exact match for Series (return scalar)
# and raise KeyError for Frame
for timestamp, expected in zip(index, values):
ts_string = timestamp.strftime(formats[rnum])
# make ts_string as precise as index
result = df['a'][ts_string]
assert isinstance(result, np.int64)
assert result == expected
pytest.raises(KeyError, df.__getitem__, ts_string)
# Timestamp with resolution less precise than index
for fmt in formats[:rnum]:
for element, theslice in [[0, slice(None, 1)],
[1, slice(1, None)]]:
ts_string = index[element].strftime(fmt)
# Series should return slice
result = df['a'][ts_string]
expected = df['a'][theslice]
tm.assert_series_equal(result, expected)
# Frame should return slice as well
result = df[ts_string]
expected = df[theslice]
tm.assert_frame_equal(result, expected)
# Timestamp with resolution more precise than index
# Compatible with existing key
# Should return scalar for Series
# and raise KeyError for Frame
for fmt in formats[rnum + 1:]:
ts_string = index[1].strftime(fmt)
result = df['a'][ts_string]
assert isinstance(result, np.int64)
assert result == 2
pytest.raises(KeyError, df.__getitem__, ts_string)
# Not compatible with existing key
# Should raise KeyError
for fmt, res in list(zip(formats, resolutions))[rnum + 1:]:
ts = index[1] + Timedelta("1 " + res)
ts_string = ts.strftime(fmt)
pytest.raises(KeyError, df['a'].__getitem__, ts_string)
pytest.raises(KeyError, df.__getitem__, ts_string)
def test_partial_slicing_with_multiindex(self):
# GH 4758
# partial string indexing with a multi-index buggy
df = DataFrame({'ACCOUNT': ["ACCT1", "ACCT1", "ACCT1", "ACCT2"],
'TICKER': ["ABC", "MNP", "XYZ", "XYZ"],
'val': [1, 2, 3, 4]},
index=date_range("2013-06-19 09:30:00",
periods=4, freq='5T'))
df_multi = df.set_index(['ACCOUNT', 'TICKER'], append=True)
expected = DataFrame([
[1]
], index=Index(['ABC'], name='TICKER'), columns=['val'])
result = df_multi.loc[('2013-06-19 09:30:00', 'ACCT1')]
tm.assert_frame_equal(result, expected)
expected = df_multi.loc[
(pd.Timestamp('2013-06-19 09:30:00', tz=None), 'ACCT1', 'ABC')]
result = df_multi.loc[('2013-06-19 09:30:00', 'ACCT1', 'ABC')]
tm.assert_series_equal(result, expected)
# this is a KeyError as we don't do partial string selection on
# multi-levels
def f():
df_multi.loc[('2013-06-19', 'ACCT1', 'ABC')]
pytest.raises(KeyError, f)
# GH 4294
# partial slice on a series mi
s = pd.DataFrame(np.random.rand(1000, 1000), index=pd.date_range(
'2000-1-1', periods=1000)).stack()
s2 = s[:-1].copy()
expected = s2['2000-1-4']
result = s2[pd.Timestamp('2000-1-4')]
tm.assert_series_equal(result, expected)
result = s[pd.Timestamp('2000-1-4')]
expected = s['2000-1-4']
tm.assert_series_equal(result, expected)
df2 = pd.DataFrame(s)
expected = df2.xs('2000-1-4')
result = df2.loc[pd.Timestamp('2000-1-4')]
tm.assert_frame_equal(result, expected)
def test_partial_slice_doesnt_require_monotonicity(self):
# For historical reasons.
s = pd.Series(np.arange(10), pd.date_range('2014-01-01', periods=10))
nonmonotonic = s[[3, 5, 4]]
expected = nonmonotonic.iloc[:0]
timestamp = pd.Timestamp('2014-01-10')
tm.assert_series_equal(nonmonotonic['2014-01-10':], expected)
tm.assert_raises_regex(KeyError,
r"Timestamp\('2014-01-10 00:00:00'\)",
lambda: nonmonotonic[timestamp:])
tm.assert_series_equal(nonmonotonic.loc['2014-01-10':], expected)
tm.assert_raises_regex(KeyError,
r"Timestamp\('2014-01-10 00:00:00'\)",
lambda: nonmonotonic.loc[timestamp:])
def test_loc_datetime_length_one(self):
# GH16071
df = pd.DataFrame(columns=['1'],
index=pd.date_range('2016-10-01T00:00:00',
'2016-10-01T23:59:59'))
result = df.loc[datetime(2016, 10, 1):]
tm.assert_frame_equal(result, df)
result = df.loc['2016-10-01T00:00:00':]
tm.assert_frame_equal(result, df)
@pytest.mark.parametrize('datetimelike', [
Timestamp('20130101'), datetime(2013, 1, 1),
np.datetime64('2013-01-01T00:00', 'ns')])
@pytest.mark.parametrize('op,expected', [
(op.lt, [True, False, False, False]),
(op.le, [True, True, False, False]),
(op.eq, [False, True, False, False]),
(op.gt, [False, False, False, True])])
def test_selection_by_datetimelike(self, datetimelike, op, expected):
# GH issue #17965, test for ability to compare datetime64[ns] columns
# to datetimelike
df = DataFrame({'A': [pd.Timestamp('20120101'),
pd.Timestamp('20130101'),
np.nan, pd.Timestamp('20130103')]})
result = op(df.A, datetimelike)
expected = Series(expected, name='A')
tm.assert_series_equal(result, expected)
|
bsd-3-clause
|
dorvaljulien/StarFiddle
|
density_scatter_plot.py
|
1
|
4635
|
"""
A "density scatter plot" is a scatter plot with points displaying a color
corresponding to the local "point density".
"""
import matplotlib.pyplot as plt, numpy as np, numpy.random, scipy
#mport cubehelix
from kdtree import Tree
log=np.log10
def DensityScatter(xdat,ydat,ax=None,NNb=15,Nbins=20,logx=False,logy=False,**kwargs):
"""
ax = DensityScatter( xdat, ydat,ax=None, NNb=15, Nbins=20,
logx=False, logy=False, **kwargs)
------------------------------------------------------------
xdat : data array for x
ydat : data array for y
ax : If needed, previously existing matplotlib axis object
Nnb : Number of neighbour points to compute local density
Nbins : Number of density(colour) bins
logx : Boolean, do you want xdata to be displayed on a logscale ?
logy : Boolean, do you want ydata to be displayed on a logscale ?
**kwargs : Means any additionnal keyword will be passed to plt.plot
Display a scatter plot of xdat, ydat and attribute colors to points
according to the local point density. Allows to visualize the distribution
of points in high density regions without doing an histogram2d.
"""
N=len(xdat)
xdat = np.array(xdat); ydat = np.array(ydat)
X = (xdat - min(xdat))/(max(xdat) - min(xdat))
Y = (ydat - min(ydat))/(max(ydat) - min(ydat))
if logx:
X = log(xdat/max(xdat))
if logy:
Y = log(ydat/max(ydat))
T = Tree(X, Y)
density = np.zeros(N)
def ComputeDensity(nb,d):
return nb/( np.pi*d**2)
for i in range(N):
_, dist = T.nnearest(i, NNb)
density[i] = ComputeDensity(NNb,dist[-1])
density_bins = np.logspace( 0.5*(log(min(density))+log(max(density))), log(max(density)),
Nbins)
density_bins = np.array( [0] + list(density_bins) )
SelectionIndices = []
for i in range(Nbins):
ind_arr = np.nonzero(( density_bins[i] <= density ) * ( density < density_bins[i+1]))[0]
SelectionIndices.append(ind_arr)
if ax is None:
fig = plt.figure()
ax = fig.add_subplot(111)
cm = plt.get_cmap("rainbow")
for i,(ind,alph) in enumerate(zip(SelectionIndices,np.linspace(1.,0.,Nbins))):
color = cm(1.*(i)/Nbins)
ax.plot( xdat[ind], ydat[ind], "o", color=color, alpha=alph,
markeredgecolor="none",**kwargs)
if logy:
ax.set_yscale("log")
if logx:
ax.set_xscale("log")
return ax
def DensityScatter3D(xdat,ydat,zdat,ax=None,NNb=15,Nbins=20,**kwargs):
"""
ax = DensityScatter3D( xdat, ydat, zdat, ax=None, NNb=15, Nbins=20, **kwargs)
------------------------------------------------------------
xdat : data array for x
ydat : data array for y
zdat : data array for z
ax : If needed, previously existing matplotlib axis object
Nnb : Number of neighbour points to compute local density
Nbins : Number of density(colour) bins
**kwargs : Means any additionnal keyword will be passed to plt.plot
Display a 3d scatter plot of xdat, ydat, zdat and attribute colors to points
according to the local point density. It's kind of experimental, I played with
transparency and order or display to be able to see what's going on in high density
regions.
"""
N=len(xdat)
xdat = np.array(xdat); ydat = np.array(ydat)
X = (xdat - min(xdat))/(max(xdat) - min(xdat))
Y = (ydat - min(ydat))/(max(ydat) - min(ydat))
Z = (zdat - min(zdat))/(max(zdat) - min(zdat))
T = Tree(X, Y, Z)
density = np.zeros(N)
def ComputeDensity(nb,d):
return nb/( 4./3 *np.pi*d**3)
for i in range(N):
_, dist = T.nnearest(i, NNb)
density[i] = ComputeDensity(NNb,dist[-1])
density_bins = np.logspace( 0.5*(log(min(density))+log(max(density))), log(max(density)),
Nbins)
density_bins = np.array( [0] + list(density_bins) )
SelectionIndices = []
for i in range(Nbins):
ind_arr = np.nonzero(( density_bins[i] <= density ) * ( density < density_bins[i+1]))[0]
SelectionIndices.append(ind_arr)
if ax is None:
fig = plt.figure()
ax = fig.add_subplot(111, projection="3d")
cm = plt.get_cmap("rainbow")
for i,(ind,alph) in enumerate(zip(SelectionIndices,np.linspace(1.,0.,Nbins))):
color = cm(1.*(i)/Nbins)
ax.plot( xdat[ind], ydat[ind], zdat[ind], "o", color=color, alpha=alph,
markeredgecolor="none",**kwargs)
return ax
|
mit
|
Huyuwei/tvm
|
docs/conf.py
|
2
|
8618
|
# -*- coding: utf-8 -*-
# Licensed to the Apache Software Foundation (ASF) under one
# or more contributor license agreements. See the NOTICE file
# distributed with this work for additional information
# regarding copyright ownership. The ASF licenses this file
# to you under the Apache License, Version 2.0 (the
# "License"); you may not use this file except in compliance
# with the License. You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing,
# software distributed under the License is distributed on an
# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
# KIND, either express or implied. See the License for the
# specific language governing permissions and limitations
# under the License.
#
# documentation build configuration file, created by
# sphinx-quickstart on Thu Jul 23 19:40:08 2015.
#
# This file is execfile()d with the current directory set to its
# containing dir.
#
# Note that not all possible configuration values are present in this
# autogenerated file.
#
# All configuration values have a default; values that are commented out
# serve to show the default.
import sys
import os, subprocess
import shlex
import recommonmark
import sphinx_gallery
from recommonmark.parser import CommonMarkParser
from recommonmark.transform import AutoStructify
# If extensions (or modules to document with autodoc) are in another directory,
# add these directories to sys.path here. If the directory is relative to the
# documentation root, use os.path.abspath to make it absolute, like shown here.
curr_path = os.path.dirname(os.path.abspath(os.path.expanduser(__file__)))
sys.path.insert(0, os.path.join(curr_path, '../python/'))
sys.path.insert(0, os.path.join(curr_path, '../topi/python'))
sys.path.insert(0, os.path.join(curr_path, '../nnvm/python'))
sys.path.insert(0, os.path.join(curr_path, '../vta/python'))
# -- General configuration ------------------------------------------------
# General information about the project.
project = u'tvm'
author = u'%s developers' % project
copyright = u'2018, %s' % author
github_doc_root = 'https://github.com/tqchen/tvm/tree/master/docs/'
# add markdown parser
CommonMarkParser.github_doc_root = github_doc_root
source_parsers = {
'.md': CommonMarkParser
}
os.environ['TVM_BUILD_DOC'] = '1'
os.environ['NNVM_BUILD_DOC'] = '1'
# Version information.
import tvm
version = tvm.__version__
release = tvm.__version__
# Add any Sphinx extension module names here, as strings. They can be
# extensions coming with Sphinx (named 'sphinx.ext.*') or your custom ones
extensions = [
'sphinx.ext.autodoc',
'sphinx.ext.autosummary',
'sphinx.ext.intersphinx',
'sphinx.ext.napoleon',
'sphinx.ext.mathjax',
'sphinx_gallery.gen_gallery',
]
breathe_projects = {'tvm' : 'doxygen/xml/'}
breathe_default_project = 'tvm'
# Add any paths that contain templates here, relative to this directory.
templates_path = ['_templates']
# The suffix(es) of source filenames.
# You can specify multiple suffix as a list of string:
# source_suffix = ['.rst', '.md']
source_suffix = ['.rst', '.md']
# The encoding of source files.
#source_encoding = 'utf-8-sig'
# generate autosummary even if no references
autosummary_generate = True
# The master toctree document.
master_doc = 'index'
# The language for content autogenerated by Sphinx. Refer to documentation
# for a list of supported languages.
#
# This is also used if you do content translation via gettext catalogs.
# Usually you set "language" from the command line for these cases.
language = None
# There are two options for replacing |today|: either, you set today to some
# non-false value, then it is used:
#today = ''
# Else, today_fmt is used as the format for a strftime call.
#today_fmt = '%B %d, %Y'
# List of patterns, relative to source directory, that match files and
# directories to ignore when looking for source files.
exclude_patterns = ['_build']
# The reST default role (used for this markup: `text`) to use for all
# documents.
#default_role = None
# If true, '()' will be appended to :func: etc. cross-reference text.
#add_function_parentheses = True
# If true, the current module name will be prepended to all description
# unit titles (such as .. function::).
#add_module_names = True
# If true, sectionauthor and moduleauthor directives will be shown in the
# output. They are ignored by default.
#show_authors = False
# The name of the Pygments (syntax highlighting) style to use.
pygments_style = 'sphinx'
# A list of ignored prefixes for module index sorting.
#modindex_common_prefix = []
# If true, keep warnings as "system message" paragraphs in the built documents.
#keep_warnings = False
# If true, `todo` and `todoList` produce output, else they produce nothing.
todo_include_todos = False
# -- Options for HTML output ----------------------------------------------
# The theme is set by the make target
html_theme = os.environ.get('TVM_THEME', 'rtd')
on_rtd = os.environ.get('READTHEDOCS', None) == 'True'
# only import rtd theme and set it if want to build docs locally
if not on_rtd and html_theme == 'rtd':
import sphinx_rtd_theme
html_theme = 'sphinx_rtd_theme'
html_theme_path = [sphinx_rtd_theme.get_html_theme_path()]
# Add any paths that contain custom static files (such as style sheets) here,
# relative to this directory. They are copied after the builtin static files,
# so a file named "default.css" will overwrite the builtin "default.css".
html_static_path = ['_static']
html_theme_options = {
'analytics_id': 'UA-75982049-2',
'logo_only': True,
}
html_logo = "_static/img/tvm-logo-small.png"
html_favicon = "_static/img/tvm-logo-square.png"
# Output file base name for HTML help builder.
htmlhelp_basename = project + 'doc'
# -- Options for LaTeX output ---------------------------------------------
latex_elements = {
}
# Grouping the document tree into LaTeX files. List of tuples
# (source start file, target name, title,
# author, documentclass [howto, manual, or own class]).
latex_documents = [
(master_doc, '%s.tex' % project, project,
author, 'manual'),
]
# hook for doxygen
def run_doxygen(folder):
"""Run the doxygen make command in the designated folder."""
try:
#retcode = subprocess.call("cd %s; make doc" % folder, shell=True)
retcode = subprocess.call("rm -rf _build/html/doxygen", shell=True)
retcode = subprocess.call("mkdir -p _build/html", shell=True)
retcode = subprocess.call("cp -rf doxygen/html _build/html/doxygen", shell=True)
if retcode < 0:
sys.stderr.write("doxygen terminated by signal %s" % (-retcode))
except OSError as e:
sys.stderr.write("doxygen execution failed: %s" % e)
intersphinx_mapping = {
'python': ('https://docs.python.org/{.major}'.format(sys.version_info), None),
'numpy': ('http://docs.scipy.org/doc/numpy/', None),
'scipy': ('http://docs.scipy.org/doc/scipy/reference', None),
'matplotlib': ('http://matplotlib.org/', None),
}
from sphinx_gallery.sorting import ExplicitOrder
examples_dirs = ["../tutorials/", "../vta/tutorials/"]
gallery_dirs = ["tutorials", "vta/tutorials"]
subsection_order = ExplicitOrder(
['../tutorials/frontend',
'../tutorials/language',
'../tutorials/optimize',
'../tutorials/autotvm',
'../tutorials/dev',
'../tutorials/topi',
'../tutorials/deployment',
'../vta/tutorials/frontend',
'../vta/tutorials/optimize',
'../vta/tutorials/autotvm'])
def generate_doxygen_xml(app):
"""Run the doxygen make commands if we're on the ReadTheDocs server"""
run_doxygen('..')
def setup(app):
# Add hook for building doxygen xml when needed
# no c++ API for now
app.connect("builder-inited", generate_doxygen_xml)
app.add_stylesheet('css/tvm_theme.css')
app.add_config_value('recommonmark_config', {
'url_resolver': lambda url: github_doc_root + url,
'auto_doc_ref': True
}, True)
app.add_transform(AutoStructify)
sphinx_gallery_conf = {
'backreferences_dir': 'gen_modules/backreferences',
'doc_module': ('tvm', 'numpy'),
'reference_url': {
'tvm': None,
'matplotlib': 'http://matplotlib.org',
'numpy': 'http://docs.scipy.org/doc/numpy-1.9.1'},
'examples_dirs': examples_dirs,
'gallery_dirs': gallery_dirs,
'subsection_order': subsection_order,
'filename_pattern': os.environ.get("TVM_TUTORIAL_EXEC_PATTERN", ".py"),
'find_mayavi_figures': False,
'expected_failing_examples': []
}
|
apache-2.0
|
dpshelio/sunpy
|
examples/parse_time.py
|
2
|
3839
|
"""
========================================
Parsing times with sunpy.time.parse_time
========================================
This is an example to show some possible usage of ``parse_time``.
``parse_time`` is a function that can be useful to create `~astropy.time.Time`
objects from various other time objects and strings.
"""
##############################################################################
# Import the required modules.
from datetime import datetime, date
import time
import numpy as np
import pandas
from sunpy.time import parse_time
##############################################################################
# Suppose you want to parse some strings, ``parse_time`` can do that.
t1 = parse_time('1995-12-31 23:59:60')
##############################################################################
# Of course you could do the same with `~astropy.time.Time`.
# But SunPy ``parse_time`` can parse even more formats of time strings.
# And as you see from the examples, thanks to `~astropy.time.Time`, ``parse_time``
# can handle leap seconds too.
t2 = parse_time('1995-Dec-31 23:59:60')
##############################################################################
# You can mention the scale of the time as a keyword parameter if you need.
# Similar to scale you can pass in any astropy Time compatible keywords to
# ``parse_time``. See all arguments
# `here: <https://docs.astropy.org/en/stable/time/#creating-a-time-object>`__
t3 = parse_time('2012:124:21:08:12', scale='tai')
##############################################################################
# Now that you are done with strings, let's see other type ``parse_time`` handles,
# tuples. `~astropy.time.Time` does not handle tuples but ``parse_time`` does.
t4 = parse_time((1998, 11, 14))
t5 = parse_time((2001, 1, 1, 12, 12, 12, 8899))
##############################################################################
# This also means that you can parse a ``time.struct_time``.
t6 = parse_time(time.localtime())
##############################################################################
# ``parse_time`` also parses ``datetime`` and ``date`` objects.
t7 = parse_time(datetime.now())
t8 = parse_time(date.today())
##############################################################################
# ``parse_time`` can return ``astropy.time.Time`` objects for ``pandas.Timestamp``,
# ``pandas.Series`` and ``pandas.DatetimeIndex``.
t9 = parse_time(pandas.Timestamp(datetime(1966, 2, 3)))
t10 = parse_time(
pandas.Series([[datetime(2012, 1, 1, 0, 0),
datetime(2012, 1, 2, 0, 0)],
[datetime(2012, 1, 3, 0, 0),
datetime(2012, 1, 4, 0, 0)]]))
t11 = parse_time(
pandas.DatetimeIndex([
datetime(2012, 1, 1, 0, 0),
datetime(2012, 1, 2, 0, 0),
datetime(2012, 1, 3, 0, 0),
datetime(2012, 1, 4, 0, 0)
]))
##############################################################################
# ``parse_time`` can parse ``numpy.datetime64`` objects.
t12 = parse_time(np.datetime64('2014-02-07T16:47:51.008288123-0500'))
t13 = parse_time(
np.array(
['2014-02-07T16:47:51.008288123', '2014-02-07T18:47:51.008288123'],
dtype='datetime64'))
##############################################################################
# Parse time returns `~astropy.time.Time` object for every parsable input that
# you give to it.
# ``parse_time`` can handle all formats that `~astropy.time.Time` can handle.
# That is,
# ['jd', 'mjd', 'decimalyear', 'unix', 'cxcsec', 'gps', 'plot_date', 'datetime',
# 'iso', 'isot', 'yday', 'fits', 'byear', 'jyear', 'byear_str', 'jyear_str']
# at the time of writing. This can be used by passing format keyword argument
# to ``parse_time``.
parse_time(1234.0, format='jd')
parse_time('B1950.0', format='byear_str')
|
bsd-2-clause
|
ekadhanda/bin
|
python/coda-cont.py
|
1
|
7175
|
#! /usr/bin/env python
# Written by Vasaant S/O Krishnan Friday, 19 May 2017
# Run without arguments for instructions.
import sys
usrFile = sys.argv[1:]
if len(usrFile) == 0:
print ""
print "# Script to read in file of the CODA format and plot a multivariate"
print "# distribution with contours."
print "# An index.txt and chain.txt file must be provided and the script"
print "# will automatically identify them for internal use. Options are:"
print ""
print "# samp = Sample chain.txt data at this frequency (computational consideration)."
print ""
print " -->$ coda-cont.py CODAindex.txt CODAchain.txt samp=xx"
print ""
exit()
import re
import numpy as np
import matplotlib.pyplot as plt
import seaborn as sns
#=====================================================================
# Define variables.
#
ints = '\s+?([+-]?\d+)' # Integers for regex
#floats = '\s+?([+-]?\d+(?:\.\d+)?)' # Floats or int
floats = '\s+?([+-]?\d+(?:\.\d+)?|\.\d+)([eE][+-]?\d+)?' # Floats or int or scientific
codaFiles = [] # CODAindex and CODAchain files
indexFileFnd = False # CODAindex file identified?
chainFileFnd = False # CODAchain file identified?
indexCodes = {} # Dictionary containing CODAindex info.
# chainIndx = [] # Indexes/Column 1 of CODAchain.txt file
chainData = [] # Data/Column 2 of CODAchain.txt file
varOne = '' # x data
varTwo = '' # y data
#=====================================================================
#=====================================================================
# Determine which are the CODAindex and CODAchain files and
# automatically assign them to their respective variables.
#
for i in usrFile:
codaSearch = re.search('.txt',i)
if codaSearch:
codaFiles.append(i)
if len(codaFiles) == 2: # Assuming 1 index and 1 chain file
for j in codaFiles:
with open(j,'r') as chkTyp: # Run a quick check on the first line only
firstLine = chkTyp.readline()
codaIndex = re.search('^(\S+)' + ints + ints + '$', firstLine)
codaChain = re.search('^(\d+)' + floats + '$', firstLine)
if codaIndex:
indexFile = j
indexFileFnd = True
if codaChain:
chainFile = j
chainFileFnd = True
else:
print "Insfficient files of CODA*.txt format."
print "Check your input files."
#=====================================================================
#=====================================================================
# Determine user requested variable from CODAIndex file
#
for i in usrFile:
userReqCodaIndx = re.search('var=(\S+),(\S+)',i)
if userReqCodaIndx:
varOne = str(userReqCodaIndx.group(1))
varTwo = str(userReqCodaIndx.group(2))
#=====================================================================
if indexFileFnd and chainFileFnd:
#=====================================================================
# Harvest index file for the variable list and corresponding
# [start,stop] coords:
#
for line in open(indexFile, 'r'):
reqIndex = re.search('^(\S+)' + ints + ints + '$', line)
if reqIndex:
key = str(reqIndex.group(1))
value = [int(reqIndex.group(2)), int(reqIndex.group(3))]
indexCodes[key] = value
maxElement = max(indexCodes, key = indexCodes.get) # The key with the largest value
chainLen = max(indexCodes[maxElement]) # The largest value (expected amt. of data)
if len(indexCodes) < 2:
print "Insufficient variables in %s for contour plot."%(indexFile)
contVarsOk = False
elif len(indexCodes) == 2:
varOne = indexCodes.keys()[0]
varTwo = indexCodes.keys()[1]
contOne = indexCodes[varOne]
contTwo = indexCodes[varTwo]
contVarsOk = True
else:
if varOne == '' or varTwo == '':
print "Manually select variables for contour plot."
contVarsOk = False
else:
contOne = indexCodes[varOne]
contTwo = indexCodes[varTwo]
contVarsOk = True
#=====================================================================
#=====================================================================
# Harvest chain file
#
for line in open(chainFile, 'r'):
reqChain = re.search('^(\d+)' + floats + '$', line)
if reqChain:
#chainIndx.append( int(reqChain.group(1)))
chainData.append(float(reqChain.group(2)))
#chainIndx = np.array(chainIndx)
chainData = np.array(chainData)
#=====================================================================
#=====================================================================
# Basic check on the harvest by comparing harvested vs. expected
# no. of data.
#
if len(chainData) != chainLen:
print " Warning! "
print " %10d lines expected from %s."%(chainLen,indexFile)
print " %10d lines harvested from %s."%(len(chainData),chainFile)
#=====================================================================
#=====================================================================
# Contour plot
#
#
if contVarsOk:
dataOne = chainData[contOne[0]-1:contOne[1]] # Python starts from 0. CODAindex from 1
dataTwo = chainData[contTwo[0]-1:contTwo[1]]
# Ensure same amount of data from both variables
if (contOne[0]-contOne[1]) != (contTwo[0]-contTwo[1]):
print " %10d lines harvested from %s."%(len(dataOne),varOne)
print " %10d lines harvested from %s."%(len(dataTwo),varTwo)
else:
# This section to get data to the ~100s for computational consideration...
if len(dataOne) >= 1000:
sampleFactor = 10**int(np.floor(np.log10(len(dataOne)) - 2))
elif len(dataOne) > 500 and len(dataOne) < 1000:
sampleFactor = int(len(dataOne)/5.0)
else:
sampleFactor = 1
# ... unless you want a customised option:
for i in usrFile:
userReqSamp = re.search('samp=(\d+)',i)
if userReqSamp:
if int(userReqSamp.group(1)) < len(dataOne):
sampleFactor = int(userReqSamp.group(1))
dataOne = dataOne[0::sampleFactor] # Select data at intervals
dataTwo = dataTwo[0::sampleFactor]
dataComb = {varOne:dataOne, # Apparently jointplot likes dict format
varTwo:dataTwo}
sns.jointplot(x=varOne,y=varTwo,data=dataComb,kind="kde").set_axis_labels(varOne,varTwo)
plt.show()
#=====================================================================
|
mit
|
alephu5/Soundbyte
|
environment/lib/python3.3/site-packages/pandas/sparse/tests/test_libsparse.py
|
1
|
11260
|
from pandas import Series
import nose
from numpy import nan
import numpy as np
import operator
from numpy.testing import assert_almost_equal, assert_equal
import pandas.util.testing as tm
from pandas.core.sparse import SparseSeries
from pandas import DataFrame
from pandas._sparse import IntIndex, BlockIndex
import pandas._sparse as splib
TEST_LENGTH = 20
plain_case = dict(xloc=[0, 7, 15],
xlen=[3, 5, 5],
yloc=[2, 9, 14],
ylen=[2, 3, 5],
intersect_loc=[2, 9, 15],
intersect_len=[1, 3, 4])
delete_blocks = dict(xloc=[0, 5],
xlen=[4, 4],
yloc=[1],
ylen=[4],
intersect_loc=[1],
intersect_len=[3])
split_blocks = dict(xloc=[0],
xlen=[10],
yloc=[0, 5],
ylen=[3, 7],
intersect_loc=[0, 5],
intersect_len=[3, 5])
skip_block = dict(xloc=[10],
xlen=[5],
yloc=[0, 12],
ylen=[5, 3],
intersect_loc=[12],
intersect_len=[3])
no_intersect = dict(xloc=[0, 10],
xlen=[4, 6],
yloc=[5, 17],
ylen=[4, 2],
intersect_loc=[],
intersect_len=[])
def check_cases(_check_case):
def _check_case_dict(case):
_check_case(case['xloc'], case['xlen'], case['yloc'], case['ylen'],
case['intersect_loc'], case['intersect_len'])
_check_case_dict(plain_case)
_check_case_dict(delete_blocks)
_check_case_dict(split_blocks)
_check_case_dict(skip_block)
_check_case_dict(no_intersect)
# one or both is empty
_check_case([0], [5], [], [], [], [])
_check_case([], [], [], [], [], [])
def test_index_make_union():
def _check_case(xloc, xlen, yloc, ylen, eloc, elen):
xindex = BlockIndex(TEST_LENGTH, xloc, xlen)
yindex = BlockIndex(TEST_LENGTH, yloc, ylen)
bresult = xindex.make_union(yindex)
assert(isinstance(bresult, BlockIndex))
assert_equal(bresult.blocs, eloc)
assert_equal(bresult.blengths, elen)
ixindex = xindex.to_int_index()
iyindex = yindex.to_int_index()
iresult = ixindex.make_union(iyindex)
assert(isinstance(iresult, IntIndex))
assert_equal(iresult.indices, bresult.to_int_index().indices)
"""
x: ----
y: ----
r: --------
"""
xloc = [0]
xlen = [5]
yloc = [5]
ylen = [4]
eloc = [0]
elen = [9]
_check_case(xloc, xlen, yloc, ylen, eloc, elen)
"""
x: ----- -----
y: ----- --
"""
xloc = [0, 10]
xlen = [5, 5]
yloc = [2, 17]
ylen = [5, 2]
eloc = [0, 10, 17]
elen = [7, 5, 2]
_check_case(xloc, xlen, yloc, ylen, eloc, elen)
"""
x: ------
y: -------
r: ----------
"""
xloc = [1]
xlen = [5]
yloc = [3]
ylen = [5]
eloc = [1]
elen = [7]
_check_case(xloc, xlen, yloc, ylen, eloc, elen)
"""
x: ------ -----
y: -------
r: -------------
"""
xloc = [2, 10]
xlen = [4, 4]
yloc = [4]
ylen = [8]
eloc = [2]
elen = [12]
_check_case(xloc, xlen, yloc, ylen, eloc, elen)
"""
x: --- -----
y: -------
r: -------------
"""
xloc = [0, 5]
xlen = [3, 5]
yloc = [0]
ylen = [7]
eloc = [0]
elen = [10]
_check_case(xloc, xlen, yloc, ylen, eloc, elen)
"""
x: ------ -----
y: ------- ---
r: -------------
"""
xloc = [2, 10]
xlen = [4, 4]
yloc = [4, 13]
ylen = [8, 4]
eloc = [2]
elen = [15]
_check_case(xloc, xlen, yloc, ylen, eloc, elen)
"""
x: ----------------------
y: ---- ---- ---
r: ----------------------
"""
xloc = [2]
xlen = [15]
yloc = [4, 9, 14]
ylen = [3, 2, 2]
eloc = [2]
elen = [15]
_check_case(xloc, xlen, yloc, ylen, eloc, elen)
"""
x: ---- ---
y: --- ---
"""
xloc = [0, 10]
xlen = [3, 3]
yloc = [5, 15]
ylen = [2, 2]
eloc = [0, 5, 10, 15]
elen = [3, 2, 3, 2]
_check_case(xloc, xlen, yloc, ylen, eloc, elen)
# TODO: different-length index objects
def test_lookup():
def _check(index):
assert(index.lookup(0) == -1)
assert(index.lookup(5) == 0)
assert(index.lookup(7) == 2)
assert(index.lookup(8) == -1)
assert(index.lookup(9) == -1)
assert(index.lookup(10) == -1)
assert(index.lookup(11) == -1)
assert(index.lookup(12) == 3)
assert(index.lookup(17) == 8)
assert(index.lookup(18) == -1)
bindex = BlockIndex(20, [5, 12], [3, 6])
iindex = bindex.to_int_index()
_check(bindex)
_check(iindex)
# corner cases
def test_intersect():
def _check_correct(a, b, expected):
result = a.intersect(b)
assert(result.equals(expected))
def _check_length_exc(a, longer):
nose.tools.assert_raises(Exception, a.intersect, longer)
def _check_case(xloc, xlen, yloc, ylen, eloc, elen):
xindex = BlockIndex(TEST_LENGTH, xloc, xlen)
yindex = BlockIndex(TEST_LENGTH, yloc, ylen)
expected = BlockIndex(TEST_LENGTH, eloc, elen)
longer_index = BlockIndex(TEST_LENGTH + 1, yloc, ylen)
_check_correct(xindex, yindex, expected)
_check_correct(xindex.to_int_index(),
yindex.to_int_index(),
expected.to_int_index())
_check_length_exc(xindex, longer_index)
_check_length_exc(xindex.to_int_index(),
longer_index.to_int_index())
check_cases(_check_case)
class TestBlockIndex(tm.TestCase):
def test_equals(self):
index = BlockIndex(10, [0, 4], [2, 5])
self.assert_(index.equals(index))
self.assert_(not index.equals(BlockIndex(10, [0, 4], [2, 6])))
def test_check_integrity(self):
locs = []
lengths = []
# 0-length OK
index = BlockIndex(0, locs, lengths)
# also OK even though empty
index = BlockIndex(1, locs, lengths)
# block extend beyond end
self.assertRaises(Exception, BlockIndex, 10, [5], [10])
# block overlap
self.assertRaises(Exception, BlockIndex, 10, [2, 5], [5, 3])
def test_to_int_index(self):
locs = [0, 10]
lengths = [4, 6]
exp_inds = [0, 1, 2, 3, 10, 11, 12, 13, 14, 15]
block = BlockIndex(20, locs, lengths)
dense = block.to_int_index()
assert_equal(dense.indices, exp_inds)
def test_to_block_index(self):
index = BlockIndex(10, [0, 5], [4, 5])
self.assert_(index.to_block_index() is index)
class TestIntIndex(tm.TestCase):
def test_equals(self):
index = IntIndex(10, [0, 1, 2, 3, 4])
self.assert_(index.equals(index))
self.assert_(not index.equals(IntIndex(10, [0, 1, 2, 3])))
def test_to_block_index(self):
def _check_case(xloc, xlen, yloc, ylen, eloc, elen):
xindex = BlockIndex(TEST_LENGTH, xloc, xlen)
yindex = BlockIndex(TEST_LENGTH, yloc, ylen)
# see if survive the round trip
xbindex = xindex.to_int_index().to_block_index()
ybindex = yindex.to_int_index().to_block_index()
tm.assert_isinstance(xbindex, BlockIndex)
self.assert_(xbindex.equals(xindex))
self.assert_(ybindex.equals(yindex))
check_cases(_check_case)
def test_to_int_index(self):
index = IntIndex(10, [2, 3, 4, 5, 6])
self.assert_(index.to_int_index() is index)
class TestSparseOperators(tm.TestCase):
def _nan_op_tests(self, sparse_op, python_op):
def _check_case(xloc, xlen, yloc, ylen, eloc, elen):
xindex = BlockIndex(TEST_LENGTH, xloc, xlen)
yindex = BlockIndex(TEST_LENGTH, yloc, ylen)
xdindex = xindex.to_int_index()
ydindex = yindex.to_int_index()
x = np.arange(xindex.npoints) * 10. + 1
y = np.arange(yindex.npoints) * 100. + 1
result_block_vals, rb_index = sparse_op(x, xindex, y, yindex)
result_int_vals, ri_index = sparse_op(x, xdindex, y, ydindex)
self.assert_(rb_index.to_int_index().equals(ri_index))
assert_equal(result_block_vals, result_int_vals)
# check versus Series...
xseries = Series(x, xdindex.indices)
yseries = Series(y, ydindex.indices)
series_result = python_op(xseries, yseries).valid()
assert_equal(result_block_vals, series_result.values)
assert_equal(result_int_vals, series_result.values)
check_cases(_check_case)
def _op_tests(self, sparse_op, python_op):
def _check_case(xloc, xlen, yloc, ylen, eloc, elen):
xindex = BlockIndex(TEST_LENGTH, xloc, xlen)
yindex = BlockIndex(TEST_LENGTH, yloc, ylen)
xdindex = xindex.to_int_index()
ydindex = yindex.to_int_index()
x = np.arange(xindex.npoints) * 10. + 1
y = np.arange(yindex.npoints) * 100. + 1
xfill = 0
yfill = 2
result_block_vals, rb_index = sparse_op(
x, xindex, xfill, y, yindex, yfill)
result_int_vals, ri_index = sparse_op(x, xdindex, xfill,
y, ydindex, yfill)
self.assert_(rb_index.to_int_index().equals(ri_index))
assert_equal(result_block_vals, result_int_vals)
# check versus Series...
xseries = Series(x, xdindex.indices)
xseries = xseries.reindex(np.arange(TEST_LENGTH)).fillna(xfill)
yseries = Series(y, ydindex.indices)
yseries = yseries.reindex(np.arange(TEST_LENGTH)).fillna(yfill)
series_result = python_op(xseries, yseries)
series_result = series_result.reindex(ri_index.indices)
assert_equal(result_block_vals, series_result.values)
assert_equal(result_int_vals, series_result.values)
check_cases(_check_case)
# too cute? oh but how I abhor code duplication
check_ops = ['add', 'sub', 'mul', 'truediv', 'floordiv']
def make_nanoptestf(op):
def f(self):
sparse_op = getattr(splib, 'sparse_nan%s' % op)
python_op = getattr(operator, op)
self._nan_op_tests(sparse_op, python_op)
f.__name__ = 'test_nan%s' % op
return f
def make_optestf(op):
def f(self):
sparse_op = getattr(splib, 'sparse_%s' % op)
python_op = getattr(operator, op)
self._op_tests(sparse_op, python_op)
f.__name__ = 'test_%s' % op
return f
for op in check_ops:
f = make_nanoptestf(op)
g = make_optestf(op)
setattr(TestSparseOperators, f.__name__, f)
setattr(TestSparseOperators, g.__name__, g)
del f
del g
if __name__ == '__main__':
import nose
nose.runmodule(argv=[__file__, '-vvs', '-x', '--pdb', '--pdb-failure'],
exit=False)
|
gpl-3.0
|
tionn/holo-at-on
|
code/get.py
|
1
|
1360
|
# -*- coding: utf-8 -*-
import os
import io
import urllib2
import string
from BeautifulSoup import BeautifulSoup
import pandas as pd
import sys
city_url = 'http://twblg.dict.edu.tw/holodict_new/index/xiangzhen_level1.jsp?county=1'
def extract_items(base_url):
html = urllib2.urlopen(base_url).read()
soup = BeautifulSoup(html)
#print(soup.prettify())
data = []
table = soup.findAll('tr', attrs={'class':['all_space1', 'all_space2']})
for row in table:
cols = row.findAll('td')
cols = [ele.text.strip() for ele in cols]
data.append([ele for ele in cols if ele]) # Get rid of empty values
return data
def get_area_url():
base_url = 'http://twblg.dict.edu.tw/holodict_new/index/xiangzhen_level1.jsp?county=%s'
url = []
for i in string.ascii_uppercase:
url.append(base_url % i)
return url
if __name__=='__main__':
# 縣市名稱
data = extract_items(city_url)
data.pop() # ignore data from '其他'
print 'Cities and countries are done.'
# 鄉鎮區名稱
area_url = get_area_url()
for i in area_url:
area_data = extract_items(i)
data.extend(area_data)
print 'Townships are done.'
#df = pd.DataFrame(data, columns=['name', 'holo'])
df = pd.DataFrame(data)
df.to_csv('moe_mapping.csv', encoding='utf-8', index=False, header=0)
print 'csv file done.'
|
cc0-1.0
|
jmetzen/scikit-learn
|
examples/tree/plot_tree_regression_multioutput.py
|
22
|
1848
|
"""
===================================================================
Multi-output Decision Tree Regression
===================================================================
An example to illustrate multi-output regression with decision tree.
The :ref:`decision trees <tree>`
is used to predict simultaneously the noisy x and y observations of a circle
given a single underlying feature. As a result, it learns local linear
regressions approximating the circle.
We can see that if the maximum depth of the tree (controlled by the
`max_depth` parameter) is set too high, the decision trees learn too fine
details of the training data and learn from the noise, i.e. they overfit.
"""
print(__doc__)
import numpy as np
import matplotlib.pyplot as plt
from sklearn.tree import DecisionTreeRegressor
# Create a random dataset
rng = np.random.RandomState(1)
X = np.sort(200 * rng.rand(100, 1) - 100, axis=0)
y = np.array([np.pi * np.sin(X).ravel(), np.pi * np.cos(X).ravel()]).T
y[::5, :] += (0.5 - rng.rand(20, 2))
# Fit regression model
regr_1 = DecisionTreeRegressor(max_depth=2)
regr_2 = DecisionTreeRegressor(max_depth=5)
regr_3 = DecisionTreeRegressor(max_depth=8)
regr_1.fit(X, y)
regr_2.fit(X, y)
regr_3.fit(X, y)
# Predict
X_test = np.arange(-100.0, 100.0, 0.01)[:, np.newaxis]
y_1 = regr_1.predict(X_test)
y_2 = regr_2.predict(X_test)
y_3 = regr_3.predict(X_test)
# Plot the results
plt.figure()
s = 50
plt.scatter(y[:, 0], y[:, 1], c="navy", s=s, label="data")
plt.scatter(y_1[:, 0], y_1[:, 1], c="cornflowerblue", s=s, label="max_depth=2")
plt.scatter(y_2[:, 0], y_2[:, 1], c="c", s=s, label="max_depth=5")
plt.scatter(y_3[:, 0], y_3[:, 1], c="orange", s=s, label="max_depth=8")
plt.xlim([-6, 6])
plt.ylim([-6, 6])
plt.xlabel("data")
plt.ylabel("target")
plt.title("Multi-output Decision Tree Regression")
plt.legend()
plt.show()
|
bsd-3-clause
|
wzbozon/scikit-learn
|
benchmarks/bench_glm.py
|
297
|
1493
|
"""
A comparison of different methods in GLM
Data comes from a random square matrix.
"""
from datetime import datetime
import numpy as np
from sklearn import linear_model
from sklearn.utils.bench import total_seconds
if __name__ == '__main__':
import pylab as pl
n_iter = 40
time_ridge = np.empty(n_iter)
time_ols = np.empty(n_iter)
time_lasso = np.empty(n_iter)
dimensions = 500 * np.arange(1, n_iter + 1)
for i in range(n_iter):
print('Iteration %s of %s' % (i, n_iter))
n_samples, n_features = 10 * i + 3, 10 * i + 3
X = np.random.randn(n_samples, n_features)
Y = np.random.randn(n_samples)
start = datetime.now()
ridge = linear_model.Ridge(alpha=1.)
ridge.fit(X, Y)
time_ridge[i] = total_seconds(datetime.now() - start)
start = datetime.now()
ols = linear_model.LinearRegression()
ols.fit(X, Y)
time_ols[i] = total_seconds(datetime.now() - start)
start = datetime.now()
lasso = linear_model.LassoLars()
lasso.fit(X, Y)
time_lasso[i] = total_seconds(datetime.now() - start)
pl.figure('scikit-learn GLM benchmark results')
pl.xlabel('Dimensions')
pl.ylabel('Time (s)')
pl.plot(dimensions, time_ridge, color='r')
pl.plot(dimensions, time_ols, color='g')
pl.plot(dimensions, time_lasso, color='b')
pl.legend(['Ridge', 'OLS', 'LassoLars'], loc='upper left')
pl.axis('tight')
pl.show()
|
bsd-3-clause
|
hainm/scikit-learn
|
sklearn/utils/extmath.py
|
142
|
21102
|
"""
Extended math utilities.
"""
# Authors: Gael Varoquaux
# Alexandre Gramfort
# Alexandre T. Passos
# Olivier Grisel
# Lars Buitinck
# Stefan van der Walt
# Kyle Kastner
# License: BSD 3 clause
from __future__ import division
from functools import partial
import warnings
import numpy as np
from scipy import linalg
from scipy.sparse import issparse
from . import check_random_state
from .fixes import np_version
from ._logistic_sigmoid import _log_logistic_sigmoid
from ..externals.six.moves import xrange
from .sparsefuncs_fast import csr_row_norms
from .validation import check_array, NonBLASDotWarning
def norm(x):
"""Compute the Euclidean or Frobenius norm of x.
Returns the Euclidean norm when x is a vector, the Frobenius norm when x
is a matrix (2-d array). More precise than sqrt(squared_norm(x)).
"""
x = np.asarray(x)
nrm2, = linalg.get_blas_funcs(['nrm2'], [x])
return nrm2(x)
# Newer NumPy has a ravel that needs less copying.
if np_version < (1, 7, 1):
_ravel = np.ravel
else:
_ravel = partial(np.ravel, order='K')
def squared_norm(x):
"""Squared Euclidean or Frobenius norm of x.
Returns the Euclidean norm when x is a vector, the Frobenius norm when x
is a matrix (2-d array). Faster than norm(x) ** 2.
"""
x = _ravel(x)
return np.dot(x, x)
def row_norms(X, squared=False):
"""Row-wise (squared) Euclidean norm of X.
Equivalent to np.sqrt((X * X).sum(axis=1)), but also supports CSR sparse
matrices and does not create an X.shape-sized temporary.
Performs no input validation.
"""
if issparse(X):
norms = csr_row_norms(X)
else:
norms = np.einsum('ij,ij->i', X, X)
if not squared:
np.sqrt(norms, norms)
return norms
def fast_logdet(A):
"""Compute log(det(A)) for A symmetric
Equivalent to : np.log(nl.det(A)) but more robust.
It returns -Inf if det(A) is non positive or is not defined.
"""
sign, ld = np.linalg.slogdet(A)
if not sign > 0:
return -np.inf
return ld
def _impose_f_order(X):
"""Helper Function"""
# important to access flags instead of calling np.isfortran,
# this catches corner cases.
if X.flags.c_contiguous:
return check_array(X.T, copy=False, order='F'), True
else:
return check_array(X, copy=False, order='F'), False
def _fast_dot(A, B):
if B.shape[0] != A.shape[A.ndim - 1]: # check adopted from '_dotblas.c'
raise ValueError
if A.dtype != B.dtype or any(x.dtype not in (np.float32, np.float64)
for x in [A, B]):
warnings.warn('Data must be of same type. Supported types '
'are 32 and 64 bit float. '
'Falling back to np.dot.', NonBLASDotWarning)
raise ValueError
if min(A.shape) == 1 or min(B.shape) == 1 or A.ndim != 2 or B.ndim != 2:
raise ValueError
# scipy 0.9 compliant API
dot = linalg.get_blas_funcs(['gemm'], (A, B))[0]
A, trans_a = _impose_f_order(A)
B, trans_b = _impose_f_order(B)
return dot(alpha=1.0, a=A, b=B, trans_a=trans_a, trans_b=trans_b)
def _have_blas_gemm():
try:
linalg.get_blas_funcs(['gemm'])
return True
except (AttributeError, ValueError):
warnings.warn('Could not import BLAS, falling back to np.dot')
return False
# Only use fast_dot for older NumPy; newer ones have tackled the speed issue.
if np_version < (1, 7, 2) and _have_blas_gemm():
def fast_dot(A, B):
"""Compute fast dot products directly calling BLAS.
This function calls BLAS directly while warranting Fortran contiguity.
This helps avoiding extra copies `np.dot` would have created.
For details see section `Linear Algebra on large Arrays`:
http://wiki.scipy.org/PerformanceTips
Parameters
----------
A, B: instance of np.ndarray
Input arrays. Arrays are supposed to be of the same dtype and to
have exactly 2 dimensions. Currently only floats are supported.
In case these requirements aren't met np.dot(A, B) is returned
instead. To activate the related warning issued in this case
execute the following lines of code:
>> import warnings
>> from sklearn.utils.validation import NonBLASDotWarning
>> warnings.simplefilter('always', NonBLASDotWarning)
"""
try:
return _fast_dot(A, B)
except ValueError:
# Maltyped or malformed data.
return np.dot(A, B)
else:
fast_dot = np.dot
def density(w, **kwargs):
"""Compute density of a sparse vector
Return a value between 0 and 1
"""
if hasattr(w, "toarray"):
d = float(w.nnz) / (w.shape[0] * w.shape[1])
else:
d = 0 if w is None else float((w != 0).sum()) / w.size
return d
def safe_sparse_dot(a, b, dense_output=False):
"""Dot product that handle the sparse matrix case correctly
Uses BLAS GEMM as replacement for numpy.dot where possible
to avoid unnecessary copies.
"""
if issparse(a) or issparse(b):
ret = a * b
if dense_output and hasattr(ret, "toarray"):
ret = ret.toarray()
return ret
else:
return fast_dot(a, b)
def randomized_range_finder(A, size, n_iter, random_state=None):
"""Computes an orthonormal matrix whose range approximates the range of A.
Parameters
----------
A: 2D array
The input data matrix
size: integer
Size of the return array
n_iter: integer
Number of power iterations used to stabilize the result
random_state: RandomState or an int seed (0 by default)
A random number generator instance
Returns
-------
Q: 2D array
A (size x size) projection matrix, the range of which
approximates well the range of the input matrix A.
Notes
-----
Follows Algorithm 4.3 of
Finding structure with randomness: Stochastic algorithms for constructing
approximate matrix decompositions
Halko, et al., 2009 (arXiv:909) http://arxiv.org/pdf/0909.4061
"""
random_state = check_random_state(random_state)
# generating random gaussian vectors r with shape: (A.shape[1], size)
R = random_state.normal(size=(A.shape[1], size))
# sampling the range of A using by linear projection of r
Y = safe_sparse_dot(A, R)
del R
# perform power iterations with Y to further 'imprint' the top
# singular vectors of A in Y
for i in xrange(n_iter):
Y = safe_sparse_dot(A, safe_sparse_dot(A.T, Y))
# extracting an orthonormal basis of the A range samples
Q, R = linalg.qr(Y, mode='economic')
return Q
def randomized_svd(M, n_components, n_oversamples=10, n_iter=0,
transpose='auto', flip_sign=True, random_state=0):
"""Computes a truncated randomized SVD
Parameters
----------
M: ndarray or sparse matrix
Matrix to decompose
n_components: int
Number of singular values and vectors to extract.
n_oversamples: int (default is 10)
Additional number of random vectors to sample the range of M so as
to ensure proper conditioning. The total number of random vectors
used to find the range of M is n_components + n_oversamples.
n_iter: int (default is 0)
Number of power iterations (can be used to deal with very noisy
problems).
transpose: True, False or 'auto' (default)
Whether the algorithm should be applied to M.T instead of M. The
result should approximately be the same. The 'auto' mode will
trigger the transposition if M.shape[1] > M.shape[0] since this
implementation of randomized SVD tend to be a little faster in that
case).
flip_sign: boolean, (True by default)
The output of a singular value decomposition is only unique up to a
permutation of the signs of the singular vectors. If `flip_sign` is
set to `True`, the sign ambiguity is resolved by making the largest
loadings for each component in the left singular vectors positive.
random_state: RandomState or an int seed (0 by default)
A random number generator instance to make behavior
Notes
-----
This algorithm finds a (usually very good) approximate truncated
singular value decomposition using randomization to speed up the
computations. It is particularly fast on large matrices on which
you wish to extract only a small number of components.
References
----------
* Finding structure with randomness: Stochastic algorithms for constructing
approximate matrix decompositions
Halko, et al., 2009 http://arxiv.org/abs/arXiv:0909.4061
* A randomized algorithm for the decomposition of matrices
Per-Gunnar Martinsson, Vladimir Rokhlin and Mark Tygert
"""
random_state = check_random_state(random_state)
n_random = n_components + n_oversamples
n_samples, n_features = M.shape
if transpose == 'auto' and n_samples > n_features:
transpose = True
if transpose:
# this implementation is a bit faster with smaller shape[1]
M = M.T
Q = randomized_range_finder(M, n_random, n_iter, random_state)
# project M to the (k + p) dimensional space using the basis vectors
B = safe_sparse_dot(Q.T, M)
# compute the SVD on the thin matrix: (k + p) wide
Uhat, s, V = linalg.svd(B, full_matrices=False)
del B
U = np.dot(Q, Uhat)
if flip_sign:
U, V = svd_flip(U, V)
if transpose:
# transpose back the results according to the input convention
return V[:n_components, :].T, s[:n_components], U[:, :n_components].T
else:
return U[:, :n_components], s[:n_components], V[:n_components, :]
def logsumexp(arr, axis=0):
"""Computes the sum of arr assuming arr is in the log domain.
Returns log(sum(exp(arr))) while minimizing the possibility of
over/underflow.
Examples
--------
>>> import numpy as np
>>> from sklearn.utils.extmath import logsumexp
>>> a = np.arange(10)
>>> np.log(np.sum(np.exp(a)))
9.4586297444267107
>>> logsumexp(a)
9.4586297444267107
"""
arr = np.rollaxis(arr, axis)
# Use the max to normalize, as with the log this is what accumulates
# the less errors
vmax = arr.max(axis=0)
out = np.log(np.sum(np.exp(arr - vmax), axis=0))
out += vmax
return out
def weighted_mode(a, w, axis=0):
"""Returns an array of the weighted modal (most common) value in a
If there is more than one such value, only the first is returned.
The bin-count for the modal bins is also returned.
This is an extension of the algorithm in scipy.stats.mode.
Parameters
----------
a : array_like
n-dimensional array of which to find mode(s).
w : array_like
n-dimensional array of weights for each value
axis : int, optional
Axis along which to operate. Default is 0, i.e. the first axis.
Returns
-------
vals : ndarray
Array of modal values.
score : ndarray
Array of weighted counts for each mode.
Examples
--------
>>> from sklearn.utils.extmath import weighted_mode
>>> x = [4, 1, 4, 2, 4, 2]
>>> weights = [1, 1, 1, 1, 1, 1]
>>> weighted_mode(x, weights)
(array([ 4.]), array([ 3.]))
The value 4 appears three times: with uniform weights, the result is
simply the mode of the distribution.
>>> weights = [1, 3, 0.5, 1.5, 1, 2] # deweight the 4's
>>> weighted_mode(x, weights)
(array([ 2.]), array([ 3.5]))
The value 2 has the highest score: it appears twice with weights of
1.5 and 2: the sum of these is 3.
See Also
--------
scipy.stats.mode
"""
if axis is None:
a = np.ravel(a)
w = np.ravel(w)
axis = 0
else:
a = np.asarray(a)
w = np.asarray(w)
axis = axis
if a.shape != w.shape:
w = np.zeros(a.shape, dtype=w.dtype) + w
scores = np.unique(np.ravel(a)) # get ALL unique values
testshape = list(a.shape)
testshape[axis] = 1
oldmostfreq = np.zeros(testshape)
oldcounts = np.zeros(testshape)
for score in scores:
template = np.zeros(a.shape)
ind = (a == score)
template[ind] = w[ind]
counts = np.expand_dims(np.sum(template, axis), axis)
mostfrequent = np.where(counts > oldcounts, score, oldmostfreq)
oldcounts = np.maximum(counts, oldcounts)
oldmostfreq = mostfrequent
return mostfrequent, oldcounts
def pinvh(a, cond=None, rcond=None, lower=True):
"""Compute the (Moore-Penrose) pseudo-inverse of a hermetian matrix.
Calculate a generalized inverse of a symmetric matrix using its
eigenvalue decomposition and including all 'large' eigenvalues.
Parameters
----------
a : array, shape (N, N)
Real symmetric or complex hermetian matrix to be pseudo-inverted
cond : float or None, default None
Cutoff for 'small' eigenvalues.
Singular values smaller than rcond * largest_eigenvalue are considered
zero.
If None or -1, suitable machine precision is used.
rcond : float or None, default None (deprecated)
Cutoff for 'small' eigenvalues.
Singular values smaller than rcond * largest_eigenvalue are considered
zero.
If None or -1, suitable machine precision is used.
lower : boolean
Whether the pertinent array data is taken from the lower or upper
triangle of a. (Default: lower)
Returns
-------
B : array, shape (N, N)
Raises
------
LinAlgError
If eigenvalue does not converge
Examples
--------
>>> import numpy as np
>>> a = np.random.randn(9, 6)
>>> a = np.dot(a, a.T)
>>> B = pinvh(a)
>>> np.allclose(a, np.dot(a, np.dot(B, a)))
True
>>> np.allclose(B, np.dot(B, np.dot(a, B)))
True
"""
a = np.asarray_chkfinite(a)
s, u = linalg.eigh(a, lower=lower)
if rcond is not None:
cond = rcond
if cond in [None, -1]:
t = u.dtype.char.lower()
factor = {'f': 1E3, 'd': 1E6}
cond = factor[t] * np.finfo(t).eps
# unlike svd case, eigh can lead to negative eigenvalues
above_cutoff = (abs(s) > cond * np.max(abs(s)))
psigma_diag = np.zeros_like(s)
psigma_diag[above_cutoff] = 1.0 / s[above_cutoff]
return np.dot(u * psigma_diag, np.conjugate(u).T)
def cartesian(arrays, out=None):
"""Generate a cartesian product of input arrays.
Parameters
----------
arrays : list of array-like
1-D arrays to form the cartesian product of.
out : ndarray
Array to place the cartesian product in.
Returns
-------
out : ndarray
2-D array of shape (M, len(arrays)) containing cartesian products
formed of input arrays.
Examples
--------
>>> cartesian(([1, 2, 3], [4, 5], [6, 7]))
array([[1, 4, 6],
[1, 4, 7],
[1, 5, 6],
[1, 5, 7],
[2, 4, 6],
[2, 4, 7],
[2, 5, 6],
[2, 5, 7],
[3, 4, 6],
[3, 4, 7],
[3, 5, 6],
[3, 5, 7]])
"""
arrays = [np.asarray(x) for x in arrays]
shape = (len(x) for x in arrays)
dtype = arrays[0].dtype
ix = np.indices(shape)
ix = ix.reshape(len(arrays), -1).T
if out is None:
out = np.empty_like(ix, dtype=dtype)
for n, arr in enumerate(arrays):
out[:, n] = arrays[n][ix[:, n]]
return out
def svd_flip(u, v, u_based_decision=True):
"""Sign correction to ensure deterministic output from SVD.
Adjusts the columns of u and the rows of v such that the loadings in the
columns in u that are largest in absolute value are always positive.
Parameters
----------
u, v : ndarray
u and v are the output of `linalg.svd` or
`sklearn.utils.extmath.randomized_svd`, with matching inner dimensions
so one can compute `np.dot(u * s, v)`.
u_based_decision : boolean, (default=True)
If True, use the columns of u as the basis for sign flipping. Otherwise,
use the rows of v. The choice of which variable to base the decision on
is generally algorithm dependent.
Returns
-------
u_adjusted, v_adjusted : arrays with the same dimensions as the input.
"""
if u_based_decision:
# columns of u, rows of v
max_abs_cols = np.argmax(np.abs(u), axis=0)
signs = np.sign(u[max_abs_cols, xrange(u.shape[1])])
u *= signs
v *= signs[:, np.newaxis]
else:
# rows of v, columns of u
max_abs_rows = np.argmax(np.abs(v), axis=1)
signs = np.sign(v[xrange(v.shape[0]), max_abs_rows])
u *= signs
v *= signs[:, np.newaxis]
return u, v
def log_logistic(X, out=None):
"""Compute the log of the logistic function, ``log(1 / (1 + e ** -x))``.
This implementation is numerically stable because it splits positive and
negative values::
-log(1 + exp(-x_i)) if x_i > 0
x_i - log(1 + exp(x_i)) if x_i <= 0
For the ordinary logistic function, use ``sklearn.utils.fixes.expit``.
Parameters
----------
X: array-like, shape (M, N)
Argument to the logistic function
out: array-like, shape: (M, N), optional:
Preallocated output array.
Returns
-------
out: array, shape (M, N)
Log of the logistic function evaluated at every point in x
Notes
-----
See the blog post describing this implementation:
http://fa.bianp.net/blog/2013/numerical-optimizers-for-logistic-regression/
"""
is_1d = X.ndim == 1
X = check_array(X, dtype=np.float)
n_samples, n_features = X.shape
if out is None:
out = np.empty_like(X)
_log_logistic_sigmoid(n_samples, n_features, X, out)
if is_1d:
return np.squeeze(out)
return out
def safe_min(X):
"""Returns the minimum value of a dense or a CSR/CSC matrix.
Adapated from http://stackoverflow.com/q/13426580
"""
if issparse(X):
if len(X.data) == 0:
return 0
m = X.data.min()
return m if X.getnnz() == X.size else min(m, 0)
else:
return X.min()
def make_nonnegative(X, min_value=0):
"""Ensure `X.min()` >= `min_value`."""
min_ = safe_min(X)
if min_ < min_value:
if issparse(X):
raise ValueError("Cannot make the data matrix"
" nonnegative because it is sparse."
" Adding a value to every entry would"
" make it no longer sparse.")
X = X + (min_value - min_)
return X
def _batch_mean_variance_update(X, old_mean, old_variance, old_sample_count):
"""Calculate an average mean update and a Youngs and Cramer variance update.
From the paper "Algorithms for computing the sample variance: analysis and
recommendations", by Chan, Golub, and LeVeque.
Parameters
----------
X : array-like, shape (n_samples, n_features)
Data to use for variance update
old_mean : array-like, shape: (n_features,)
old_variance : array-like, shape: (n_features,)
old_sample_count : int
Returns
-------
updated_mean : array, shape (n_features,)
updated_variance : array, shape (n_features,)
updated_sample_count : int
References
----------
T. Chan, G. Golub, R. LeVeque. Algorithms for computing the sample variance:
recommendations, The American Statistician, Vol. 37, No. 3, pp. 242-247
"""
new_sum = X.sum(axis=0)
new_variance = X.var(axis=0) * X.shape[0]
old_sum = old_mean * old_sample_count
n_samples = X.shape[0]
updated_sample_count = old_sample_count + n_samples
partial_variance = old_sample_count / (n_samples * updated_sample_count) * (
n_samples / old_sample_count * old_sum - new_sum) ** 2
unnormalized_variance = old_variance * old_sample_count + new_variance + \
partial_variance
return ((old_sum + new_sum) / updated_sample_count,
unnormalized_variance / updated_sample_count,
updated_sample_count)
def _deterministic_vector_sign_flip(u):
"""Modify the sign of vectors for reproducibility
Flips the sign of elements of all the vectors (rows of u) such that
the absolute maximum element of each vector is positive.
Parameters
----------
u : ndarray
Array with vectors as its rows.
Returns
-------
u_flipped : ndarray with same shape as u
Array with the sign flipped vectors as its rows.
"""
max_abs_rows = np.argmax(np.abs(u), axis=1)
signs = np.sign(u[range(u.shape[0]), max_abs_rows])
u *= signs[:, np.newaxis]
return u
|
bsd-3-clause
|
RMKD/networkx
|
examples/drawing/unix_email.py
|
62
|
2683
|
#!/usr/bin/env python
"""
Create a directed graph, allowing multiple edges and self loops, from
a unix mailbox. The nodes are email addresses with links
that point from the sender to the recievers. The edge data
is a Python email.Message object which contains all of
the email message data.
This example shows the power of XDiGraph to hold edge data
of arbitrary Python objects (in this case a list of email messages).
By default, load the sample unix email mailbox called "unix_email.mbox".
You can load your own mailbox by naming it on the command line, eg
python unixemail.py /var/spool/mail/username
"""
__author__ = """Aric Hagberg ([email protected])"""
# Copyright (C) 2005 by
# Aric Hagberg <[email protected]>
# Dan Schult <[email protected]>
# Pieter Swart <[email protected]>
# All rights reserved.
# BSD license.
import email
from email.utils import getaddresses,parseaddr
import mailbox
import sys
# unix mailbox recipe
# see http://www.python.org/doc/current/lib/module-mailbox.html
def msgfactory(fp):
try:
return email.message_from_file(fp)
except email.Errors.MessageParseError:
# Don't return None since that will stop the mailbox iterator
return ''
if __name__ == '__main__':
import networkx as nx
try:
import matplotlib.pyplot as plt
except:
pass
if len(sys.argv)==1:
filePath = "unix_email.mbox"
else:
filePath = sys.argv[1]
mbox = mailbox.mbox(filePath, msgfactory) # parse unix mailbox
G=nx.MultiDiGraph() # create empty graph
# parse each messages and build graph
for msg in mbox: # msg is python email.Message.Message object
(source_name,source_addr) = parseaddr(msg['From']) # sender
# get all recipients
# see http://www.python.org/doc/current/lib/module-email.Utils.html
tos = msg.get_all('to', [])
ccs = msg.get_all('cc', [])
resent_tos = msg.get_all('resent-to', [])
resent_ccs = msg.get_all('resent-cc', [])
all_recipients = getaddresses(tos + ccs + resent_tos + resent_ccs)
# now add the edges for this mail message
for (target_name,target_addr) in all_recipients:
G.add_edge(source_addr,target_addr,message=msg)
# print edges with message subject
for (u,v,d) in G.edges_iter(data=True):
print("From: %s To: %s Subject: %s"%(u,v,d['message']["Subject"]))
try: # draw
pos=nx.spring_layout(G,iterations=10)
nx.draw(G,pos,node_size=0,alpha=0.4,edge_color='r',font_size=16)
plt.savefig("unix_email.png")
plt.show()
except: # matplotlib not available
pass
|
bsd-3-clause
|
kdebrab/pandas
|
pandas/tests/frame/test_convert_to.py
|
3
|
12494
|
# -*- coding: utf-8 -*-
from datetime import datetime
import pytest
import pytz
import collections
from collections import OrderedDict, defaultdict
import numpy as np
from pandas import compat
from pandas.compat import long
from pandas import (DataFrame, Series, MultiIndex, Timestamp,
date_range)
import pandas.util.testing as tm
from pandas.tests.frame.common import TestData
class TestDataFrameConvertTo(TestData):
def test_to_dict_timestamp(self):
# GH11247
# split/records producing np.datetime64 rather than Timestamps
# on datetime64[ns] dtypes only
tsmp = Timestamp('20130101')
test_data = DataFrame({'A': [tsmp, tsmp], 'B': [tsmp, tsmp]})
test_data_mixed = DataFrame({'A': [tsmp, tsmp], 'B': [1, 2]})
expected_records = [{'A': tsmp, 'B': tsmp},
{'A': tsmp, 'B': tsmp}]
expected_records_mixed = [{'A': tsmp, 'B': 1},
{'A': tsmp, 'B': 2}]
assert (test_data.to_dict(orient='records') ==
expected_records)
assert (test_data_mixed.to_dict(orient='records') ==
expected_records_mixed)
expected_series = {
'A': Series([tsmp, tsmp], name='A'),
'B': Series([tsmp, tsmp], name='B'),
}
expected_series_mixed = {
'A': Series([tsmp, tsmp], name='A'),
'B': Series([1, 2], name='B'),
}
tm.assert_dict_equal(test_data.to_dict(orient='series'),
expected_series)
tm.assert_dict_equal(test_data_mixed.to_dict(orient='series'),
expected_series_mixed)
expected_split = {
'index': [0, 1],
'data': [[tsmp, tsmp],
[tsmp, tsmp]],
'columns': ['A', 'B']
}
expected_split_mixed = {
'index': [0, 1],
'data': [[tsmp, 1],
[tsmp, 2]],
'columns': ['A', 'B']
}
tm.assert_dict_equal(test_data.to_dict(orient='split'),
expected_split)
tm.assert_dict_equal(test_data_mixed.to_dict(orient='split'),
expected_split_mixed)
def test_to_dict_invalid_orient(self):
df = DataFrame({'A': [0, 1]})
pytest.raises(ValueError, df.to_dict, orient='xinvalid')
def test_to_records_dt64(self):
df = DataFrame([["one", "two", "three"],
["four", "five", "six"]],
index=date_range("2012-01-01", "2012-01-02"))
# convert_datetime64 defaults to None
expected = df.index.values[0]
result = df.to_records()['index'][0]
assert expected == result
# check for FutureWarning if convert_datetime64=False is passed
with tm.assert_produces_warning(FutureWarning):
expected = df.index.values[0]
result = df.to_records(convert_datetime64=False)['index'][0]
assert expected == result
# check for FutureWarning if convert_datetime64=True is passed
with tm.assert_produces_warning(FutureWarning):
expected = df.index[0]
result = df.to_records(convert_datetime64=True)['index'][0]
assert expected == result
def test_to_records_with_multindex(self):
# GH3189
index = [['bar', 'bar', 'baz', 'baz', 'foo', 'foo', 'qux', 'qux'],
['one', 'two', 'one', 'two', 'one', 'two', 'one', 'two']]
data = np.zeros((8, 4))
df = DataFrame(data, index=index)
r = df.to_records(index=True)['level_0']
assert 'bar' in r
assert 'one' not in r
def test_to_records_with_Mapping_type(self):
import email
from email.parser import Parser
import collections
collections.Mapping.register(email.message.Message)
headers = Parser().parsestr('From: <[email protected]>\n'
'To: <[email protected]>\n'
'Subject: Test message\n'
'\n'
'Body would go here\n')
frame = DataFrame.from_records([headers])
all(x in frame for x in ['Type', 'Subject', 'From'])
def test_to_records_floats(self):
df = DataFrame(np.random.rand(10, 10))
df.to_records()
def test_to_records_index_name(self):
df = DataFrame(np.random.randn(3, 3))
df.index.name = 'X'
rs = df.to_records()
assert 'X' in rs.dtype.fields
df = DataFrame(np.random.randn(3, 3))
rs = df.to_records()
assert 'index' in rs.dtype.fields
df.index = MultiIndex.from_tuples([('a', 'x'), ('a', 'y'), ('b', 'z')])
df.index.names = ['A', None]
rs = df.to_records()
assert 'level_0' in rs.dtype.fields
def test_to_records_with_unicode_index(self):
# GH13172
# unicode_literals conflict with to_records
result = DataFrame([{u'a': u'x', u'b': 'y'}]).set_index(u'a')\
.to_records()
expected = np.rec.array([('x', 'y')], dtype=[('a', 'O'), ('b', 'O')])
tm.assert_almost_equal(result, expected)
def test_to_records_with_unicode_column_names(self):
# xref issue: https://github.com/numpy/numpy/issues/2407
# Issue #11879. to_records used to raise an exception when used
# with column names containing non-ascii characters in Python 2
result = DataFrame(data={u"accented_name_é": [1.0]}).to_records()
# Note that numpy allows for unicode field names but dtypes need
# to be specified using dictionary instead of list of tuples.
expected = np.rec.array(
[(0, 1.0)],
dtype={"names": ["index", u"accented_name_é"],
"formats": ['=i8', '=f8']}
)
tm.assert_almost_equal(result, expected)
def test_to_records_with_categorical(self):
# GH8626
# dict creation
df = DataFrame({'A': list('abc')}, dtype='category')
expected = Series(list('abc'), dtype='category', name='A')
tm.assert_series_equal(df['A'], expected)
# list-like creation
df = DataFrame(list('abc'), dtype='category')
expected = Series(list('abc'), dtype='category', name=0)
tm.assert_series_equal(df[0], expected)
# to record array
# this coerces
result = df.to_records()
expected = np.rec.array([(0, 'a'), (1, 'b'), (2, 'c')],
dtype=[('index', '=i8'), ('0', 'O')])
tm.assert_almost_equal(result, expected)
@pytest.mark.parametrize('mapping', [
dict,
collections.defaultdict(list),
collections.OrderedDict])
def test_to_dict(self, mapping):
test_data = {
'A': {'1': 1, '2': 2},
'B': {'1': '1', '2': '2', '3': '3'},
}
# GH16122
recons_data = DataFrame(test_data).to_dict(into=mapping)
for k, v in compat.iteritems(test_data):
for k2, v2 in compat.iteritems(v):
assert (v2 == recons_data[k][k2])
recons_data = DataFrame(test_data).to_dict("l", mapping)
for k, v in compat.iteritems(test_data):
for k2, v2 in compat.iteritems(v):
assert (v2 == recons_data[k][int(k2) - 1])
recons_data = DataFrame(test_data).to_dict("s", mapping)
for k, v in compat.iteritems(test_data):
for k2, v2 in compat.iteritems(v):
assert (v2 == recons_data[k][k2])
recons_data = DataFrame(test_data).to_dict("sp", mapping)
expected_split = {'columns': ['A', 'B'], 'index': ['1', '2', '3'],
'data': [[1.0, '1'], [2.0, '2'], [np.nan, '3']]}
tm.assert_dict_equal(recons_data, expected_split)
recons_data = DataFrame(test_data).to_dict("r", mapping)
expected_records = [{'A': 1.0, 'B': '1'},
{'A': 2.0, 'B': '2'},
{'A': np.nan, 'B': '3'}]
assert isinstance(recons_data, list)
assert (len(recons_data) == 3)
for l, r in zip(recons_data, expected_records):
tm.assert_dict_equal(l, r)
# GH10844
recons_data = DataFrame(test_data).to_dict("i")
for k, v in compat.iteritems(test_data):
for k2, v2 in compat.iteritems(v):
assert (v2 == recons_data[k2][k])
df = DataFrame(test_data)
df['duped'] = df[df.columns[0]]
recons_data = df.to_dict("i")
comp_data = test_data.copy()
comp_data['duped'] = comp_data[df.columns[0]]
for k, v in compat.iteritems(comp_data):
for k2, v2 in compat.iteritems(v):
assert (v2 == recons_data[k2][k])
@pytest.mark.parametrize('mapping', [
list,
collections.defaultdict,
[]])
def test_to_dict_errors(self, mapping):
# GH16122
df = DataFrame(np.random.randn(3, 3))
with pytest.raises(TypeError):
df.to_dict(into=mapping)
def test_to_dict_not_unique_warning(self):
# GH16927: When converting to a dict, if a column has a non-unique name
# it will be dropped, throwing a warning.
df = DataFrame([[1, 2, 3]], columns=['a', 'a', 'b'])
with tm.assert_produces_warning(UserWarning):
df.to_dict()
@pytest.mark.parametrize('tz', ['UTC', 'GMT', 'US/Eastern'])
def test_to_records_datetimeindex_with_tz(self, tz):
# GH13937
dr = date_range('2016-01-01', periods=10,
freq='S', tz=tz)
df = DataFrame({'datetime': dr}, index=dr)
expected = df.to_records()
result = df.tz_convert("UTC").to_records()
# both converted to UTC, so they are equal
tm.assert_numpy_array_equal(result, expected)
def test_to_dict_box_scalars(self):
# 14216
# make sure that we are boxing properly
d = {'a': [1], 'b': ['b']}
result = DataFrame(d).to_dict()
assert isinstance(list(result['a'])[0], (int, long))
assert isinstance(list(result['b'])[0], (int, long))
result = DataFrame(d).to_dict(orient='records')
assert isinstance(result[0]['a'], (int, long))
def test_frame_to_dict_tz(self):
# GH18372 When converting to dict with orient='records' columns of
# datetime that are tz-aware were not converted to required arrays
data = [(datetime(2017, 11, 18, 21, 53, 0, 219225, tzinfo=pytz.utc),),
(datetime(2017, 11, 18, 22, 6, 30, 61810, tzinfo=pytz.utc,),)]
df = DataFrame(list(data), columns=["d", ])
result = df.to_dict(orient='records')
expected = [
{'d': Timestamp('2017-11-18 21:53:00.219225+0000', tz=pytz.utc)},
{'d': Timestamp('2017-11-18 22:06:30.061810+0000', tz=pytz.utc)},
]
tm.assert_dict_equal(result[0], expected[0])
tm.assert_dict_equal(result[1], expected[1])
@pytest.mark.parametrize('into, expected', [
(dict, {0: {'int_col': 1, 'float_col': 1.0},
1: {'int_col': 2, 'float_col': 2.0},
2: {'int_col': 3, 'float_col': 3.0}}),
(OrderedDict, OrderedDict([(0, {'int_col': 1, 'float_col': 1.0}),
(1, {'int_col': 2, 'float_col': 2.0}),
(2, {'int_col': 3, 'float_col': 3.0})])),
(defaultdict(list), defaultdict(list,
{0: {'int_col': 1, 'float_col': 1.0},
1: {'int_col': 2, 'float_col': 2.0},
2: {'int_col': 3, 'float_col': 3.0}}))
])
def test_to_dict_index_dtypes(self, into, expected):
# GH 18580
# When using to_dict(orient='index') on a dataframe with int
# and float columns only the int columns were cast to float
df = DataFrame({'int_col': [1, 2, 3],
'float_col': [1.0, 2.0, 3.0]})
result = df.to_dict(orient='index', into=into)
cols = ['int_col', 'float_col']
result = DataFrame.from_dict(result, orient='index')[cols]
expected = DataFrame.from_dict(expected, orient='index')[cols]
tm.assert_frame_equal(result, expected)
|
bsd-3-clause
|
rrohan/scikit-learn
|
examples/model_selection/plot_validation_curve.py
|
229
|
1823
|
"""
==========================
Plotting Validation Curves
==========================
In this plot you can see the training scores and validation scores of an SVM
for different values of the kernel parameter gamma. For very low values of
gamma, you can see that both the training score and the validation score are
low. This is called underfitting. Medium values of gamma will result in high
values for both scores, i.e. the classifier is performing fairly well. If gamma
is too high, the classifier will overfit, which means that the training score
is good but the validation score is poor.
"""
print(__doc__)
import matplotlib.pyplot as plt
import numpy as np
from sklearn.datasets import load_digits
from sklearn.svm import SVC
from sklearn.learning_curve import validation_curve
digits = load_digits()
X, y = digits.data, digits.target
param_range = np.logspace(-6, -1, 5)
train_scores, test_scores = validation_curve(
SVC(), X, y, param_name="gamma", param_range=param_range,
cv=10, scoring="accuracy", n_jobs=1)
train_scores_mean = np.mean(train_scores, axis=1)
train_scores_std = np.std(train_scores, axis=1)
test_scores_mean = np.mean(test_scores, axis=1)
test_scores_std = np.std(test_scores, axis=1)
plt.title("Validation Curve with SVM")
plt.xlabel("$\gamma$")
plt.ylabel("Score")
plt.ylim(0.0, 1.1)
plt.semilogx(param_range, train_scores_mean, label="Training score", color="r")
plt.fill_between(param_range, train_scores_mean - train_scores_std,
train_scores_mean + train_scores_std, alpha=0.2, color="r")
plt.semilogx(param_range, test_scores_mean, label="Cross-validation score",
color="g")
plt.fill_between(param_range, test_scores_mean - test_scores_std,
test_scores_mean + test_scores_std, alpha=0.2, color="g")
plt.legend(loc="best")
plt.show()
|
bsd-3-clause
|
slipguru/palladio
|
palladio/config_templates/default_config.py
|
1
|
2485
|
# Configuration file example for PALLADIO
# version: 2.0
import numpy as np
from sklearn.feature_selection import RFE
from sklearn.svm import LinearSVC
from sklearn.model_selection import GridSearchCV
from palladio import datasets
import os
#####################
# DATASET PATHS ###
#####################
# * All the path are w.r.t. config file path
# The list of all files required for the experiments
data_path = 'data/gedm.csv'
target_path = 'data/labels.csv'
# pandas.read_csv options
data_loading_options = {
'delimiter': ',',
'header': 0,
'index_col': 0
}
target_loading_options = data_loading_options
dataset = datasets.load_csv(os.path.join(os.path.dirname(__file__),data_path),
os.path.join(os.path.dirname(__file__),target_path),
data_loading_options=data_loading_options,
target_loading_options=target_loading_options,
samples_on='col')
data, labels = dataset.data, dataset.target
feature_names = dataset.feature_names
#######################
# SESSION OPTIONS ###
#######################
session_folder = 'palladio_test_session'
# The learning task, if None palladio tries to guess it
# [see sklearn.utils.multiclass.type_of_target]
learning_task = None
# The number of repetitions of 'regular' experiments
n_splits_regular = 50
# The number of repetitions of 'permutation' experiments
n_splits_permutation = 50
#######################
# LEARNER OPTIONS ###
#######################
model = RFE(LinearSVC(loss='hinge'), step=0.3)
# Set the estimator to be a GridSearchCV
param_grid = {
'n_features_to_select': [10, 20, 50],
'estimator__C': np.logspace(-4, 0, 5),
}
estimator = GridSearchCV(model, param_grid=param_grid, cv=3, scoring='accuracy', n_jobs=1)
# Set options for ModelAssessment
ma_options = {
'test_size': 0.25,
'scoring': 'accuracy',
'n_jobs': -1,
'n_splits': n_splits_regular
}
# For the Pipeline object, indicate the name of the step from which to
# retrieve the list of selected features
# For a single estimator which has a `coef_` attributes (e.g., elastic net or
# lasso) set to True
vs_analysis = True
# ~~ Signature Parameters
# ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
frequency_threshold = 0.75
# ~~ Plotting Options
# ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
score_surfaces_options = {
'logspace': ['estimator__C'],
'plot_errors': True
}
|
gpl-3.0
|
DonBeo/scikit-learn
|
sklearn/svm/tests/test_sparse.py
|
1
|
10550
|
from nose.tools import assert_raises, assert_true, assert_false
import numpy as np
from scipy import sparse
from numpy.testing import (assert_array_almost_equal, assert_array_equal,
assert_equal)
from sklearn import datasets, svm, linear_model, base
from sklearn.datasets import make_classification, load_digits
from sklearn.svm.tests import test_svm
from sklearn.utils import ConvergenceWarning
from sklearn.utils.extmath import safe_sparse_dot
from sklearn.utils.testing import assert_warns
# test sample 1
X = np.array([[-2, -1], [-1, -1], [-1, -2], [1, 1], [1, 2], [2, 1]])
X_sp = sparse.lil_matrix(X)
Y = [1, 1, 1, 2, 2, 2]
T = np.array([[-1, -1], [2, 2], [3, 2]])
true_result = [1, 2, 2]
# test sample 2
X2 = np.array([[0, 0, 0], [1, 1, 1], [2, 0, 0, ],
[0, 0, 2], [3, 3, 3]])
X2_sp = sparse.dok_matrix(X2)
Y2 = [1, 2, 2, 2, 3]
T2 = np.array([[-1, -1, -1], [1, 1, 1], [2, 2, 2]])
true_result2 = [1, 2, 3]
iris = datasets.load_iris()
# permute
rng = np.random.RandomState(0)
perm = rng.permutation(iris.target.size)
iris.data = iris.data[perm]
iris.target = iris.target[perm]
# sparsify
iris.data = sparse.csr_matrix(iris.data)
def test_svc():
# Check that sparse SVC gives the same result as SVC
clf = svm.SVC(kernel='linear', probability=True, random_state=0)
clf.fit(X, Y)
sp_clf = svm.SVC(kernel='linear', probability=True, random_state=0)
sp_clf.fit(X_sp, Y)
assert_array_equal(sp_clf.predict(T), true_result)
assert_true(sparse.issparse(sp_clf.support_vectors_))
assert_array_almost_equal(clf.support_vectors_,
sp_clf.support_vectors_.toarray())
assert_true(sparse.issparse(sp_clf.dual_coef_))
assert_array_almost_equal(clf.dual_coef_, sp_clf.dual_coef_.toarray())
assert_true(sparse.issparse(sp_clf.coef_))
assert_array_almost_equal(clf.coef_, sp_clf.coef_.toarray())
assert_array_almost_equal(clf.support_, sp_clf.support_)
assert_array_almost_equal(clf.predict(T), sp_clf.predict(T))
# refit with a different dataset
clf.fit(X2, Y2)
sp_clf.fit(X2_sp, Y2)
assert_array_almost_equal(clf.support_vectors_,
sp_clf.support_vectors_.toarray())
assert_array_almost_equal(clf.dual_coef_, sp_clf.dual_coef_.toarray())
assert_array_almost_equal(clf.coef_, sp_clf.coef_.toarray())
assert_array_almost_equal(clf.support_, sp_clf.support_)
assert_array_almost_equal(clf.predict(T2), sp_clf.predict(T2))
assert_array_almost_equal(clf.predict_proba(T2),
sp_clf.predict_proba(T2), 4)
def test_unsorted_indices():
# test that the result with sorted and unsorted indices in csr is the same
# we use a subset of digits as iris, blobs or make_classification didn't
# show the problem
digits = load_digits()
X, y = digits.data[:50], digits.target[:50]
X_test = sparse.csr_matrix(digits.data[50:100])
X_sparse = sparse.csr_matrix(X)
coef_dense = svm.SVC(kernel='linear', probability=True,
random_state=0).fit(X, y).coef_
sparse_svc = svm.SVC(kernel='linear', probability=True,
random_state=0).fit(X_sparse, y)
coef_sorted = sparse_svc.coef_
# make sure dense and sparse SVM give the same result
assert_array_almost_equal(coef_dense, coef_sorted.toarray())
X_sparse_unsorted = X_sparse[np.arange(X.shape[0])]
X_test_unsorted = X_test[np.arange(X_test.shape[0])]
# make sure we scramble the indices
assert_false(X_sparse_unsorted.has_sorted_indices)
assert_false(X_test_unsorted.has_sorted_indices)
unsorted_svc = svm.SVC(kernel='linear', probability=True,
random_state=0).fit(X_sparse_unsorted, y)
coef_unsorted = unsorted_svc.coef_
# make sure unsorted indices give same result
assert_array_almost_equal(coef_unsorted.toarray(), coef_sorted.toarray())
assert_array_almost_equal(sparse_svc.predict_proba(X_test_unsorted),
sparse_svc.predict_proba(X_test))
def test_svc_with_custom_kernel():
kfunc = lambda x, y: safe_sparse_dot(x, y.T)
clf_lin = svm.SVC(kernel='linear').fit(X_sp, Y)
clf_mylin = svm.SVC(kernel=kfunc).fit(X_sp, Y)
assert_array_equal(clf_lin.predict(X_sp), clf_mylin.predict(X_sp))
def test_svc_iris():
# Test the sparse SVC with the iris dataset
for k in ('linear', 'poly', 'rbf'):
sp_clf = svm.SVC(kernel=k).fit(iris.data, iris.target)
clf = svm.SVC(kernel=k).fit(iris.data.toarray(), iris.target)
assert_array_almost_equal(clf.support_vectors_,
sp_clf.support_vectors_.toarray())
assert_array_almost_equal(clf.dual_coef_, sp_clf.dual_coef_.toarray())
assert_array_almost_equal(
clf.predict(iris.data.toarray()), sp_clf.predict(iris.data))
if k == 'linear':
assert_array_almost_equal(clf.coef_, sp_clf.coef_.toarray())
def test_error():
# Test that it gives proper exception on deficient input
# impossible value of C
assert_raises(ValueError, svm.SVC(C=-1).fit, X, Y)
# impossible value of nu
clf = svm.NuSVC(nu=0.0)
assert_raises(ValueError, clf.fit, X_sp, Y)
Y2 = Y[:-1] # wrong dimensions for labels
assert_raises(ValueError, clf.fit, X_sp, Y2)
clf = svm.SVC()
clf.fit(X_sp, Y)
assert_array_equal(clf.predict(T), true_result)
def test_linearsvc():
# Similar to test_SVC
clf = svm.LinearSVC(random_state=0).fit(X, Y)
sp_clf = svm.LinearSVC(random_state=0).fit(X_sp, Y)
assert_true(sp_clf.fit_intercept)
assert_array_almost_equal(clf.coef_, sp_clf.coef_, decimal=4)
assert_array_almost_equal(clf.intercept_, sp_clf.intercept_, decimal=4)
assert_array_almost_equal(clf.predict(X), sp_clf.predict(X_sp))
clf.fit(X2, Y2)
sp_clf.fit(X2_sp, Y2)
assert_array_almost_equal(clf.coef_, sp_clf.coef_, decimal=4)
assert_array_almost_equal(clf.intercept_, sp_clf.intercept_, decimal=4)
def test_linearsvc_iris():
# Test the sparse LinearSVC with the iris dataset
sp_clf = svm.LinearSVC(random_state=0).fit(iris.data, iris.target)
clf = svm.LinearSVC(random_state=0).fit(iris.data.toarray(), iris.target)
assert_equal(clf.fit_intercept, sp_clf.fit_intercept)
assert_array_almost_equal(clf.coef_, sp_clf.coef_, decimal=1)
assert_array_almost_equal(clf.intercept_, sp_clf.intercept_, decimal=1)
assert_array_almost_equal(
clf.predict(iris.data.toarray()), sp_clf.predict(iris.data))
# check decision_function
pred = np.argmax(sp_clf.decision_function(iris.data), 1)
assert_array_almost_equal(pred, clf.predict(iris.data.toarray()))
# sparsify the coefficients on both models and check that they still
# produce the same results
clf.sparsify()
assert_array_equal(pred, clf.predict(iris.data))
sp_clf.sparsify()
assert_array_equal(pred, sp_clf.predict(iris.data))
def test_weight():
# Test class weights
X_, y_ = make_classification(n_samples=200, n_features=100,
weights=[0.833, 0.167], random_state=0)
X_ = sparse.csr_matrix(X_)
for clf in (linear_model.LogisticRegression(),
svm.LinearSVC(random_state=0),
svm.SVC()):
clf.set_params(class_weight={0: 5})
clf.fit(X_[:180], y_[:180])
y_pred = clf.predict(X_[180:])
assert_true(np.sum(y_pred == y_[180:]) >= 11)
def test_sample_weights():
# Test weights on individual samples
clf = svm.SVC()
clf.fit(X_sp, Y)
assert_array_equal(clf.predict(X[2]), [1.])
sample_weight = [.1] * 3 + [10] * 3
clf.fit(X_sp, Y, sample_weight=sample_weight)
assert_array_equal(clf.predict(X[2]), [2.])
def test_sparse_liblinear_intercept_handling():
# Test that sparse liblinear honours intercept_scaling param
test_svm.test_dense_liblinear_intercept_handling(svm.LinearSVC)
def test_sparse_realdata():
# Test on a subset from the 20newsgroups dataset.
# This catchs some bugs if input is not correctly converted into
# sparse format or weights are not correctly initialized.
data = np.array([0.03771744, 0.1003567, 0.01174647, 0.027069])
indices = np.array([6, 5, 35, 31])
indptr = np.array(
[0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,
1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 2, 2, 2, 2, 2, 2,
2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2,
2, 2, 2, 2, 2, 2, 2, 2, 2, 4, 4, 4])
X = sparse.csr_matrix((data, indices, indptr))
y = np.array(
[1., 0., 2., 2., 1., 1., 1., 2., 2., 0., 1., 2., 2.,
0., 2., 0., 3., 0., 3., 0., 1., 1., 3., 2., 3., 2.,
0., 3., 1., 0., 2., 1., 2., 0., 1., 0., 2., 3., 1.,
3., 0., 1., 0., 0., 2., 0., 1., 2., 2., 2., 3., 2.,
0., 3., 2., 1., 2., 3., 2., 2., 0., 1., 0., 1., 2.,
3., 0., 0., 2., 2., 1., 3., 1., 1., 0., 1., 2., 1.,
1., 3.])
clf = svm.SVC(kernel='linear').fit(X.toarray(), y)
sp_clf = svm.SVC(kernel='linear').fit(sparse.coo_matrix(X), y)
assert_array_equal(clf.support_vectors_, sp_clf.support_vectors_.toarray())
assert_array_equal(clf.dual_coef_, sp_clf.dual_coef_.toarray())
def test_sparse_svc_clone_with_callable_kernel():
# Test that the "dense_fit" is called even though we use sparse input
# meaning that everything works fine.
a = svm.SVC(C=1, kernel=lambda x, y: x * y.T, probability=True,
random_state=0)
b = base.clone(a)
b.fit(X_sp, Y)
pred = b.predict(X_sp)
b.predict_proba(X_sp)
dense_svm = svm.SVC(C=1, kernel=lambda x, y: np.dot(x, y.T),
probability=True, random_state=0)
pred_dense = dense_svm.fit(X, Y).predict(X)
assert_array_equal(pred_dense, pred)
# b.decision_function(X_sp) # XXX : should be supported
def test_timeout():
sp = svm.SVC(C=1, kernel=lambda x, y: x * y.T, probability=True,
random_state=0, max_iter=1)
assert_warns(ConvergenceWarning, sp.fit, X_sp, Y)
def test_consistent_proba():
a = svm.SVC(probability=True, max_iter=1, random_state=0)
proba_1 = a.fit(X, Y).predict_proba(X)
a = svm.SVC(probability=True, max_iter=1, random_state=0)
proba_2 = a.fit(X, Y).predict_proba(X)
assert_array_almost_equal(proba_1, proba_2)
|
bsd-3-clause
|
Kongsea/tensorflow
|
tensorflow/contrib/learn/python/learn/estimators/estimator_input_test.py
|
10
|
12872
|
# Copyright 2016 The TensorFlow Authors. All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
# ==============================================================================
"""Tests for Estimator input."""
from __future__ import absolute_import
from __future__ import division
from __future__ import print_function
import functools
import tempfile
import numpy as np
from tensorflow.python.training import training_util
from tensorflow.contrib.layers.python.layers import optimizers
from tensorflow.contrib.learn.python.learn import metric_spec
from tensorflow.contrib.learn.python.learn import models
from tensorflow.contrib.learn.python.learn.datasets import base
from tensorflow.contrib.learn.python.learn.estimators import _sklearn
from tensorflow.contrib.learn.python.learn.estimators import estimator
from tensorflow.contrib.learn.python.learn.estimators import model_fn
from tensorflow.contrib.metrics.python.ops import metric_ops
from tensorflow.python.framework import constant_op
from tensorflow.python.framework import dtypes
from tensorflow.python.ops import array_ops
from tensorflow.python.ops import data_flow_ops
from tensorflow.python.ops import math_ops
from tensorflow.python.platform import test
from tensorflow.python.training import input as input_lib
from tensorflow.python.training import queue_runner_impl
_BOSTON_INPUT_DIM = 13
_IRIS_INPUT_DIM = 4
def boston_input_fn(num_epochs=None):
boston = base.load_boston()
features = input_lib.limit_epochs(
array_ops.reshape(
constant_op.constant(boston.data), [-1, _BOSTON_INPUT_DIM]),
num_epochs=num_epochs)
labels = array_ops.reshape(constant_op.constant(boston.target), [-1, 1])
return features, labels
def boston_input_fn_with_queue(num_epochs=None):
features, labels = boston_input_fn(num_epochs=num_epochs)
# Create a minimal queue runner.
fake_queue = data_flow_ops.FIFOQueue(30, dtypes.int32)
queue_runner = queue_runner_impl.QueueRunner(fake_queue,
[constant_op.constant(0)])
queue_runner_impl.add_queue_runner(queue_runner)
return features, labels
def iris_input_fn():
iris = base.load_iris()
features = array_ops.reshape(
constant_op.constant(iris.data), [-1, _IRIS_INPUT_DIM])
labels = array_ops.reshape(constant_op.constant(iris.target), [-1])
return features, labels
def iris_input_fn_labels_dict():
iris = base.load_iris()
features = array_ops.reshape(
constant_op.constant(iris.data), [-1, _IRIS_INPUT_DIM])
labels = {
'labels': array_ops.reshape(constant_op.constant(iris.target), [-1])
}
return features, labels
def boston_eval_fn():
boston = base.load_boston()
n_examples = len(boston.target)
features = array_ops.reshape(
constant_op.constant(boston.data), [n_examples, _BOSTON_INPUT_DIM])
labels = array_ops.reshape(
constant_op.constant(boston.target), [n_examples, 1])
return array_ops.concat([features, features], 0), array_ops.concat(
[labels, labels], 0)
def extract(data, key):
if isinstance(data, dict):
assert key in data
return data[key]
else:
return data
def linear_model_params_fn(features, labels, mode, params):
features = extract(features, 'input')
labels = extract(labels, 'labels')
assert mode in (model_fn.ModeKeys.TRAIN, model_fn.ModeKeys.EVAL,
model_fn.ModeKeys.INFER)
prediction, loss = (models.linear_regression_zero_init(features, labels))
train_op = optimizers.optimize_loss(
loss,
training_util.get_global_step(),
optimizer='Adagrad',
learning_rate=params['learning_rate'])
return prediction, loss, train_op
def linear_model_fn(features, labels, mode):
features = extract(features, 'input')
labels = extract(labels, 'labels')
assert mode in (model_fn.ModeKeys.TRAIN, model_fn.ModeKeys.EVAL,
model_fn.ModeKeys.INFER)
if isinstance(features, dict):
(_, features), = features.items()
prediction, loss = (models.linear_regression_zero_init(features, labels))
train_op = optimizers.optimize_loss(
loss, training_util.get_global_step(), optimizer='Adagrad', learning_rate=0.1)
return prediction, loss, train_op
def linear_model_fn_with_model_fn_ops(features, labels, mode):
"""Same as linear_model_fn, but returns `ModelFnOps`."""
assert mode in (model_fn.ModeKeys.TRAIN, model_fn.ModeKeys.EVAL,
model_fn.ModeKeys.INFER)
prediction, loss = (models.linear_regression_zero_init(features, labels))
train_op = optimizers.optimize_loss(
loss, training_util.get_global_step(), optimizer='Adagrad', learning_rate=0.1)
return model_fn.ModelFnOps(
mode=mode, predictions=prediction, loss=loss, train_op=train_op)
def logistic_model_no_mode_fn(features, labels):
features = extract(features, 'input')
labels = extract(labels, 'labels')
labels = array_ops.one_hot(labels, 3, 1, 0)
prediction, loss = (models.logistic_regression_zero_init(features, labels))
train_op = optimizers.optimize_loss(
loss, training_util.get_global_step(), optimizer='Adagrad', learning_rate=0.1)
return {
'class': math_ops.argmax(prediction, 1),
'prob': prediction
}, loss, train_op
VOCAB_FILE_CONTENT = 'emerson\nlake\npalmer\n'
EXTRA_FILE_CONTENT = 'kermit\npiggy\nralph\n'
class EstimatorInputTest(test.TestCase):
def testContinueTrainingDictionaryInput(self):
boston = base.load_boston()
output_dir = tempfile.mkdtemp()
est = estimator.Estimator(model_fn=linear_model_fn, model_dir=output_dir)
boston_input = {'input': boston.data}
float64_target = {'labels': boston.target.astype(np.float64)}
est.fit(x=boston_input, y=float64_target, steps=50)
scores = est.evaluate(
x=boston_input,
y=float64_target,
metrics={'MSE': metric_ops.streaming_mean_squared_error})
del est
# Create another estimator object with the same output dir.
est2 = estimator.Estimator(model_fn=linear_model_fn, model_dir=output_dir)
# Check we can evaluate and predict.
scores2 = est2.evaluate(
x=boston_input,
y=float64_target,
metrics={'MSE': metric_ops.streaming_mean_squared_error})
self.assertAllClose(scores2['MSE'], scores['MSE'])
predictions = np.array(list(est2.predict(x=boston_input)))
other_score = _sklearn.mean_squared_error(predictions,
float64_target['labels'])
self.assertAllClose(other_score, scores['MSE'])
def testBostonAll(self):
boston = base.load_boston()
est = estimator.SKCompat(estimator.Estimator(model_fn=linear_model_fn))
float64_labels = boston.target.astype(np.float64)
est.fit(x=boston.data, y=float64_labels, steps=100)
scores = est.score(
x=boston.data,
y=float64_labels,
metrics={'MSE': metric_ops.streaming_mean_squared_error})
predictions = np.array(list(est.predict(x=boston.data)))
other_score = _sklearn.mean_squared_error(predictions, boston.target)
self.assertAllClose(scores['MSE'], other_score)
self.assertTrue('global_step' in scores)
self.assertEqual(100, scores['global_step'])
def testBostonAllDictionaryInput(self):
boston = base.load_boston()
est = estimator.Estimator(model_fn=linear_model_fn)
boston_input = {'input': boston.data}
float64_target = {'labels': boston.target.astype(np.float64)}
est.fit(x=boston_input, y=float64_target, steps=100)
scores = est.evaluate(
x=boston_input,
y=float64_target,
metrics={'MSE': metric_ops.streaming_mean_squared_error})
predictions = np.array(list(est.predict(x=boston_input)))
other_score = _sklearn.mean_squared_error(predictions, boston.target)
self.assertAllClose(other_score, scores['MSE'])
self.assertTrue('global_step' in scores)
self.assertEqual(scores['global_step'], 100)
def testIrisAll(self):
iris = base.load_iris()
est = estimator.SKCompat(
estimator.Estimator(model_fn=logistic_model_no_mode_fn))
est.fit(iris.data, iris.target, steps=100)
scores = est.score(
x=iris.data,
y=iris.target,
metrics={('accuracy', 'class'): metric_ops.streaming_accuracy})
predictions = est.predict(x=iris.data)
predictions_class = est.predict(x=iris.data, outputs=['class'])['class']
self.assertEqual(predictions['prob'].shape[0], iris.target.shape[0])
self.assertAllClose(predictions['class'], predictions_class)
self.assertAllClose(
predictions['class'], np.argmax(
predictions['prob'], axis=1))
other_score = _sklearn.accuracy_score(iris.target, predictions['class'])
self.assertAllClose(scores['accuracy'], other_score)
self.assertTrue('global_step' in scores)
self.assertEqual(100, scores['global_step'])
def testIrisAllDictionaryInput(self):
iris = base.load_iris()
est = estimator.Estimator(model_fn=logistic_model_no_mode_fn)
iris_data = {'input': iris.data}
iris_target = {'labels': iris.target}
est.fit(iris_data, iris_target, steps=100)
scores = est.evaluate(
x=iris_data,
y=iris_target,
metrics={('accuracy', 'class'): metric_ops.streaming_accuracy})
predictions = list(est.predict(x=iris_data))
predictions_class = list(est.predict(x=iris_data, outputs=['class']))
self.assertEqual(len(predictions), iris.target.shape[0])
classes_batch = np.array([p['class'] for p in predictions])
self.assertAllClose(classes_batch,
np.array([p['class'] for p in predictions_class]))
self.assertAllClose(
classes_batch,
np.argmax(
np.array([p['prob'] for p in predictions]), axis=1))
other_score = _sklearn.accuracy_score(iris.target, classes_batch)
self.assertAllClose(other_score, scores['accuracy'])
self.assertTrue('global_step' in scores)
self.assertEqual(scores['global_step'], 100)
def testIrisInputFn(self):
iris = base.load_iris()
est = estimator.Estimator(model_fn=logistic_model_no_mode_fn)
est.fit(input_fn=iris_input_fn, steps=100)
_ = est.evaluate(input_fn=iris_input_fn, steps=1)
predictions = list(est.predict(x=iris.data))
self.assertEqual(len(predictions), iris.target.shape[0])
def testIrisInputFnLabelsDict(self):
iris = base.load_iris()
est = estimator.Estimator(model_fn=logistic_model_no_mode_fn)
est.fit(input_fn=iris_input_fn_labels_dict, steps=100)
_ = est.evaluate(
input_fn=iris_input_fn_labels_dict,
steps=1,
metrics={
'accuracy':
metric_spec.MetricSpec(
metric_fn=metric_ops.streaming_accuracy,
prediction_key='class',
label_key='labels')
})
predictions = list(est.predict(x=iris.data))
self.assertEqual(len(predictions), iris.target.shape[0])
def testTrainInputFn(self):
est = estimator.Estimator(model_fn=linear_model_fn)
est.fit(input_fn=boston_input_fn, steps=1)
_ = est.evaluate(input_fn=boston_eval_fn, steps=1)
def testPredictInputFn(self):
est = estimator.Estimator(model_fn=linear_model_fn)
boston = base.load_boston()
est.fit(input_fn=boston_input_fn, steps=1)
input_fn = functools.partial(boston_input_fn, num_epochs=1)
output = list(est.predict(input_fn=input_fn))
self.assertEqual(len(output), boston.target.shape[0])
def testPredictInputFnWithQueue(self):
est = estimator.Estimator(model_fn=linear_model_fn)
boston = base.load_boston()
est.fit(input_fn=boston_input_fn, steps=1)
input_fn = functools.partial(boston_input_fn_with_queue, num_epochs=2)
output = list(est.predict(input_fn=input_fn))
self.assertEqual(len(output), boston.target.shape[0] * 2)
def testPredictConstInputFn(self):
est = estimator.Estimator(model_fn=linear_model_fn)
boston = base.load_boston()
est.fit(input_fn=boston_input_fn, steps=1)
def input_fn():
features = array_ops.reshape(
constant_op.constant(boston.data), [-1, _BOSTON_INPUT_DIM])
labels = array_ops.reshape(constant_op.constant(boston.target), [-1, 1])
return features, labels
output = list(est.predict(input_fn=input_fn))
self.assertEqual(len(output), boston.target.shape[0])
if __name__ == '__main__':
test.main()
|
apache-2.0
|
arabenjamin/scikit-learn
|
doc/datasets/mldata_fixture.py
|
367
|
1183
|
"""Fixture module to skip the datasets loading when offline
Mock urllib2 access to mldata.org and create a temporary data folder.
"""
from os import makedirs
from os.path import join
import numpy as np
import tempfile
import shutil
from sklearn import datasets
from sklearn.utils.testing import install_mldata_mock
from sklearn.utils.testing import uninstall_mldata_mock
def globs(globs):
# Create a temporary folder for the data fetcher
global custom_data_home
custom_data_home = tempfile.mkdtemp()
makedirs(join(custom_data_home, 'mldata'))
globs['custom_data_home'] = custom_data_home
return globs
def setup_module():
# setup mock urllib2 module to avoid downloading from mldata.org
install_mldata_mock({
'mnist-original': {
'data': np.empty((70000, 784)),
'label': np.repeat(np.arange(10, dtype='d'), 7000),
},
'iris': {
'data': np.empty((150, 4)),
},
'datasets-uci-iris': {
'double0': np.empty((150, 4)),
'class': np.empty((150,)),
},
})
def teardown_module():
uninstall_mldata_mock()
shutil.rmtree(custom_data_home)
|
bsd-3-clause
|
mo-g/iris
|
lib/iris/quickplot.py
|
3
|
8992
|
# (C) British Crown Copyright 2010 - 2015, Met Office
#
# This file is part of Iris.
#
# Iris is free software: you can redistribute it and/or modify it under
# the terms of the GNU Lesser General Public License as published by the
# Free Software Foundation, either version 3 of the License, or
# (at your option) any later version.
#
# Iris is distributed in the hope that it will be useful,
# but WITHOUT ANY WARRANTY; without even the implied warranty of
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
# GNU Lesser General Public License for more details.
#
# You should have received a copy of the GNU Lesser General Public License
# along with Iris. If not, see <http://www.gnu.org/licenses/>.
"""
High-level plotting extensions to :mod:`iris.plot`.
These routines work much like their :mod:`iris.plot` counterparts, but they
automatically add a plot title, axis titles, and a colour bar when appropriate.
See also: :ref:`matplotlib <matplotlib:users-guide-index>`.
"""
from __future__ import (absolute_import, division, print_function)
from six.moves import (filter, input, map, range, zip) # noqa
import cf_units
import matplotlib.pyplot as plt
import iris.config
import iris.coords
import iris.plot as iplt
def _use_symbol(units):
# For non-time units use the shortest unit representation.
# E.g. prefer 'K' over 'kelvin', but not '0.0174532925199433 rad'
# over 'degrees'
return (not units.is_time() and
not units.is_time_reference() and
len(units.symbol) < len(str(units)))
def _title(cube_or_coord, with_units):
if cube_or_coord is None:
title = ''
else:
title = cube_or_coord.name().replace('_', ' ').capitalize()
units = cube_or_coord.units
if with_units and not (units.is_unknown() or
units.is_no_unit() or
units == cf_units.Unit('1')):
if _use_symbol(units):
units = units.symbol
title += ' / {}'.format(units)
return title
def _label(cube, mode, result=None, ndims=2, coords=None):
"""Puts labels on the current plot using the given cube."""
plt.title(_title(cube, with_units=False))
if result is not None:
draw_edges = mode == iris.coords.POINT_MODE
bar = plt.colorbar(result, orientation='horizontal',
drawedges=draw_edges)
has_known_units = not (cube.units.is_unknown() or
cube.units.is_no_unit())
if has_known_units and cube.units != cf_units.Unit('1'):
# Use shortest unit representation for anything other than time
if _use_symbol(cube.units):
bar.set_label(cube.units.symbol)
else:
bar.set_label(cube.units)
# Remove the tick which is put on the colorbar by default.
bar.ax.tick_params(length=0)
if coords is None:
plot_defn = iplt._get_plot_defn(cube, mode, ndims)
else:
plot_defn = iplt._get_plot_defn_custom_coords_picked(
cube, coords, mode, ndims=ndims)
if ndims == 2:
if not iplt._can_draw_map(plot_defn.coords):
plt.ylabel(_title(plot_defn.coords[0], with_units=True))
plt.xlabel(_title(plot_defn.coords[1], with_units=True))
elif ndims == 1:
plt.xlabel(_title(plot_defn.coords[0], with_units=True))
plt.ylabel(_title(cube, with_units=True))
else:
msg = 'Unexpected number of dimensions (%s) given to _label.' % ndims
raise ValueError(msg)
def _label_with_bounds(cube, result=None, ndims=2, coords=None):
_label(cube, iris.coords.BOUND_MODE, result, ndims, coords)
def _label_with_points(cube, result=None, ndims=2, coords=None):
_label(cube, iris.coords.POINT_MODE, result, ndims, coords)
def _get_titles(u_object, v_object):
if u_object is None:
u_object = iplt._u_object_from_v_object(v_object)
xunits = u_object is not None and not u_object.units.is_time_reference()
yunits = not v_object.units.is_time_reference()
xlabel = _title(u_object, with_units=xunits)
ylabel = _title(v_object, with_units=yunits)
title = ''
if u_object is None:
title = _title(v_object, with_units=False)
elif isinstance(u_object, iris.cube.Cube) and \
not isinstance(v_object, iris.cube.Cube):
title = _title(u_object, with_units=False)
elif isinstance(v_object, iris.cube.Cube) and \
not isinstance(u_object, iris.cube.Cube):
title = _title(v_object, with_units=False)
return xlabel, ylabel, title
def _label_1d_plot(*args):
if len(args) > 1 and isinstance(args[1],
(iris.cube.Cube, iris.coords.Coord)):
xlabel, ylabel, title = _get_titles(*args[:2])
else:
xlabel, ylabel, title = _get_titles(None, args[0])
plt.title(title)
plt.xlabel(xlabel)
plt.ylabel(ylabel)
def contour(cube, *args, **kwargs):
"""
Draws contour lines on a labelled plot based on the given Cube.
With the basic call signature, contour "level" values are chosen
automatically::
contour(cube)
Supply a number to use *N* automatically chosen levels::
contour(cube, N)
Supply a sequence *V* to use explicitly defined levels::
contour(cube, V)
See :func:`iris.plot.contour` for details of valid keyword arguments.
"""
coords = kwargs.get('coords')
result = iplt.contour(cube, *args, **kwargs)
_label_with_points(cube, coords=coords)
return result
def contourf(cube, *args, **kwargs):
"""
Draws filled contours on a labelled plot based on the given Cube.
With the basic call signature, contour "level" values are chosen
automatically::
contour(cube)
Supply a number to use *N* automatically chosen levels::
contour(cube, N)
Supply a sequence *V* to use explicitly defined levels::
contour(cube, V)
See :func:`iris.plot.contourf` for details of valid keyword arguments.
"""
coords = kwargs.get('coords')
result = iplt.contourf(cube, *args, **kwargs)
_label_with_points(cube, result, coords=coords)
return result
def outline(cube, coords=None, color='k', linewidth=None):
"""
Draws cell outlines on a labelled plot based on the given Cube.
Kwargs:
* coords: list of :class:`~iris.coords.Coord` objects or coordinate names
Use the given coordinates as the axes for the plot. The order of the
given coordinates indicates which axis to use for each, where the first
element is the horizontal axis of the plot and the second element is
the vertical axis of the plot.
* color: None or mpl color
The color of the cell outlines. If None, the matplotlibrc setting
patch.edgecolor is used by default.
* linewidth: None or number
The width of the lines showing the cell outlines. If None, the default
width in patch.linewidth in matplotlibrc is used.
"""
result = iplt.outline(cube, color=color, linewidth=linewidth,
coords=coords)
_label_with_bounds(cube, coords=coords)
return result
def pcolor(cube, *args, **kwargs):
"""
Draws a labelled pseudocolor plot based on the given Cube.
See :func:`iris.plot.pcolor` for details of valid keyword arguments.
"""
coords = kwargs.get('coords')
result = iplt.pcolor(cube, *args, **kwargs)
_label_with_bounds(cube, result, coords=coords)
return result
def pcolormesh(cube, *args, **kwargs):
"""
Draws a labelled pseudocolour plot based on the given Cube.
See :func:`iris.plot.pcolormesh` for details of valid keyword arguments.
"""
coords = kwargs.get('coords')
result = iplt.pcolormesh(cube, *args, **kwargs)
_label_with_bounds(cube, result, coords=coords)
return result
def points(cube, *args, **kwargs):
"""
Draws sample point positions on a labelled plot based on the given Cube.
See :func:`iris.plot.points` for details of valid keyword arguments.
"""
coords = kwargs.get('coords')
result = iplt.points(cube, *args, **kwargs)
_label_with_points(cube, coords=coords)
return result
def plot(*args, **kwargs):
"""
Draws a labelled line plot based on the given cube(s) or
coordinate(s).
See :func:`iris.plot.plot` for details of valid arguments and
keyword arguments.
"""
result = iplt.plot(*args, **kwargs)
_label_1d_plot(*args)
return result
def scatter(x, y, *args, **kwargs):
"""
Draws a labelled scatter plot based on the given cubes or
coordinates.
See :func:`iris.plot.scatter` for details of valid arguments and
keyword arguments.
"""
result = iplt.scatter(x, y, *args, **kwargs)
_label_1d_plot(x, y)
return result
# Provide a convenience show method from pyplot.
show = plt.show
|
gpl-3.0
|
liyinwei/pandas
|
quickstart/12_getting_data_in_out.py
|
1
|
1191
|
#!/usr/bin/env python
# -*- coding: utf-8 -*-
"""
@Author: liyinwei
@E-mail: [email protected]
@Time: 2016/11/21 11:35
@Description:
1.文件读写，包括：
a)csv
Writing to a csv file: http://pandas.pydata.org/pandas-docs/stable/io.html#io-store-in-csv
Reading from a csv file: http://pandas.pydata.org/pandas-docs/stable/io.html#io-read-csv-table
b)HDF5: http://pandas.pydata.org/pandas-docs/stable/io.html#io-hdf5
c)Excel: http://pandas.pydata.org/pandas-docs/stable/io.html#io-excel
"""
"""
ID: 12_01
Desc: Writing to a csv file
"""
# df.to_csv('foo.csv')
"""
ID: 12_02
Desc: Reading from a csv file
"""
# pd.read_csv('foo.csv')
"""
ID: 12_03
Desc: Writing to a HDF5 Store
"""
# df.to_hdf('foo.h5','df')
"""
ID: 12_04
Desc: Reading from a HDF5 Store
"""
# pd.read_hdf('foo.h5','df')
"""
ID: 12_05
Desc: Writing to an excel file
"""
# df.to_excel('foo.xlsx', sheet_name='Sheet1')
"""
ID: 12_06
Desc: Reading from an excel file
"""
# pd.read_excel('foo.xlsx', 'Sheet1', index_col=None, na_values=['NA'])
if __name__ == '__main__':
pass
|
gpl-3.0
|
ryandougherty/mwa-capstone
|
MWA_Tools/build/matplotlib/doc/mpl_examples/pylab_examples/legend_auto.py
|
7
|
2267
|
"""
This file was written to test matplotlib's autolegend placement
algorithm, but shows lots of different ways to create legends so is
useful as a general examples
Thanks to John Gill and Phil ?? for help at the matplotlib sprint at
pycon 2005 where the auto-legend support was written.
"""
from pylab import *
import sys
rcParams['legend.loc'] = 'best'
N = 100
x = arange(N)
def fig_1():
figure(1)
t = arange(0, 40.0 * pi, 0.1)
l, = plot(t, 100*sin(t), 'r', label='sine')
legend()
def fig_2():
figure(2)
plot(x, 'o', label='x=y')
legend()
def fig_3():
figure(3)
plot(x, -x, 'o', label='x= -y')
legend()
def fig_4():
figure(4)
plot(x, ones(len(x)), 'o', label='y=1')
plot(x, -ones(len(x)), 'o', label='y=-1')
legend()
def fig_5():
figure(5)
n, bins, patches = hist(randn(1000), 40, normed=1)
l, = plot(bins, normpdf(bins, 0.0, 1.0), 'r--', label='fit', linewidth=3)
legend([l, patches[0]], ['fit', 'hist'])
def fig_6():
figure(6)
plot(x, 50-x, 'o', label='y=1')
plot(x, x-50, 'o', label='y=-1')
legend()
def fig_7():
figure(7)
xx = x - (N/2.0)
plot(xx, (xx*xx)-1225, 'bo', label='$y=x^2$')
plot(xx, 25*xx, 'go', label='$y=25x$')
plot(xx, -25*xx, 'mo', label='$y=-25x$')
legend()
def fig_8():
figure(8)
b1 = bar(x, x, color='m')
b2 = bar(x, x[::-1], color='g')
legend([b1[0], b2[0]], ['up', 'down'])
def fig_9():
figure(9)
b1 = bar(x, -x)
b2 = bar(x, -x[::-1], color='r')
legend([b1[0], b2[0]], ['down', 'up'])
def fig_10():
figure(10)
b1 = bar(x, x, bottom=-100, color='m')
b2 = bar(x, x[::-1], bottom=-100, color='g')
b3 = bar(x, -x, bottom=100)
b4 = bar(x, -x[::-1], bottom=100, color='r')
legend([b1[0], b2[0], b3[0], b4[0]], ['bottom right', 'bottom left',
'top left', 'top right'])
if __name__ == '__main__':
nfigs = 10
figures = []
for f in sys.argv[1:]:
try:
figures.append(int(f))
except ValueError:
pass
if len(figures) == 0:
figures = range(1, nfigs+1)
for fig in figures:
fn_name = "fig_%d" % fig
fn = globals()[fn_name]
fn()
show()
|
gpl-2.0
|
paulrbrenner/GOS
|
examples/migration/visualization/plotlyviz.py
|
2
|
1188
|
import plotly
import pandas as pd
def map(dataframe, title = "Map", colorbarName = None):
#---The next line and the line at bottom are for the Jupyter Notebook---
#plotly.offline.init_notebook_mode(connected=True)
data = [ dict(
type = 'choropleth',
locations = dataframe['country'],
z = dataframe['value'],
# text = dataframe['name'],
colorscale = [[0,"rgb(215,25,28)"],[0.25,"rgb(253,174,97)"],[0.5,"rgb(255,255,191)"],[0.75,"rgb(166,217,106)"],[1,"rgb(26,150,65)"]],
autocolorscale = False,
reversescale = False,
marker = dict(
line = dict (
color = 'rgb(180,180,180)',
width = 0.5
) ),
colorbar = dict(
autotick = False,
# tickprefix = 'V',
title = colorbarName),
) ]
layout = dict(
title = title,
titlefont = dict(
size = 60
),
geo = dict(
showframe = False,
showcoastlines = False,
showcountries = True,
countrycolor = "#f0f0f0",
projection = dict(
type = 'Mercator'
)
)
)
fig = dict( data=data, layout=layout )
#plotly.offline.iplot(fig, validate=False, filename='plotly-map' )
plotly.offline.plot(fig, validate=False, filename='plotly-map' )
|
apache-2.0
|
awni/tensorflow
|
tensorflow/examples/skflow/multiple_gpu.py
|
1
|
1664
|
# Copyright 2015-present The Scikit Flow Authors. All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
from __future__ import absolute_import
from __future__ import division
from __future__ import print_function
from sklearn import datasets, metrics, cross_validation
import tensorflow as tf
from tensorflow.contrib import skflow
iris = datasets.load_iris()
X_train, X_test, y_train, y_test = cross_validation.train_test_split(iris.data, iris.target,
test_size=0.2, random_state=42)
def my_model(X, y):
"""
This is DNN with 10, 20, 10 hidden layers, and dropout of 0.5 probability.
Note: If you want to run this example with multiple GPUs, Cuda Toolkit 7.0 and
CUDNN 6.5 V2 from NVIDIA need to be installed beforehand.
"""
with tf.device('/gpu:1'):
layers = skflow.ops.dnn(X, [10, 20, 10], keep_prob=0.5)
with tf.device('/gpu:2'):
return skflow.models.logistic_regression(layers, y)
classifier = skflow.TensorFlowEstimator(model_fn=my_model, n_classes=3)
classifier.fit(X_train, y_train)
score = metrics.accuracy_score(y_test, classifier.predict(X_test))
print('Accuracy: {0:f}'.format(score))
|
apache-2.0
|
skudriashev/incubator-airflow
|
airflow/hooks/base_hook.py
|
8
|
2950
|
# -*- coding: utf-8 -*-
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
from __future__ import absolute_import
from __future__ import division
from __future__ import print_function
from __future__ import unicode_literals
import os
import random
from airflow import settings
from airflow.models import Connection
from airflow.exceptions import AirflowException
from airflow.utils.log.logging_mixin import LoggingMixin
CONN_ENV_PREFIX = 'AIRFLOW_CONN_'
class BaseHook(LoggingMixin):
"""
Abstract base class for hooks, hooks are meant as an interface to
interact with external systems. MySqlHook, HiveHook, PigHook return
object that can handle the connection and interaction to specific
instances of these systems, and expose consistent methods to interact
with them.
"""
def __init__(self, source):
pass
@classmethod
def _get_connections_from_db(cls, conn_id):
session = settings.Session()
db = (
session.query(Connection)
.filter(Connection.conn_id == conn_id)
.all()
)
session.expunge_all()
session.close()
if not db:
raise AirflowException(
"The conn_id `{0}` isn't defined".format(conn_id))
return db
@classmethod
def _get_connection_from_env(cls, conn_id):
environment_uri = os.environ.get(CONN_ENV_PREFIX + conn_id.upper())
conn = None
if environment_uri:
conn = Connection(conn_id=conn_id, uri=environment_uri)
return conn
@classmethod
def get_connections(cls, conn_id):
conn = cls._get_connection_from_env(conn_id)
if conn:
conns = [conn]
else:
conns = cls._get_connections_from_db(conn_id)
return conns
@classmethod
def get_connection(cls, conn_id):
conn = random.choice(cls.get_connections(conn_id))
if conn.host:
log = LoggingMixin().log
log.info("Using connection to: %s", conn.host)
return conn
@classmethod
def get_hook(cls, conn_id):
connection = cls.get_connection(conn_id)
return connection.get_hook()
def get_conn(self):
raise NotImplementedError()
def get_records(self, sql):
raise NotImplementedError()
def get_pandas_df(self, sql):
raise NotImplementedError()
def run(self, sql):
raise NotImplementedError()
|
apache-2.0
|
tinkerinestudio/Tinkerine-Suite
|
TinkerineSuite/python/Lib/numpy/core/function_base.py
|
82
|
5474
|
__all__ = ['logspace', 'linspace']
import numeric as _nx
from numeric import array
def linspace(start, stop, num=50, endpoint=True, retstep=False):
"""
Return evenly spaced numbers over a specified interval.
Returns `num` evenly spaced samples, calculated over the
interval [`start`, `stop` ].
The endpoint of the interval can optionally be excluded.
Parameters
----------
start : scalar
The starting value of the sequence.
stop : scalar
The end value of the sequence, unless `endpoint` is set to False.
In that case, the sequence consists of all but the last of ``num + 1``
evenly spaced samples, so that `stop` is excluded. Note that the step
size changes when `endpoint` is False.
num : int, optional
Number of samples to generate. Default is 50.
endpoint : bool, optional
If True, `stop` is the last sample. Otherwise, it is not included.
Default is True.
retstep : bool, optional
If True, return (`samples`, `step`), where `step` is the spacing
between samples.
Returns
-------
samples : ndarray
There are `num` equally spaced samples in the closed interval
``[start, stop]`` or the half-open interval ``[start, stop)``
(depending on whether `endpoint` is True or False).
step : float (only if `retstep` is True)
Size of spacing between samples.
See Also
--------
arange : Similiar to `linspace`, but uses a step size (instead of the
number of samples).
logspace : Samples uniformly distributed in log space.
Examples
--------
>>> np.linspace(2.0, 3.0, num=5)
array([ 2. , 2.25, 2.5 , 2.75, 3. ])
>>> np.linspace(2.0, 3.0, num=5, endpoint=False)
array([ 2. , 2.2, 2.4, 2.6, 2.8])
>>> np.linspace(2.0, 3.0, num=5, retstep=True)
(array([ 2. , 2.25, 2.5 , 2.75, 3. ]), 0.25)
Graphical illustration:
>>> import matplotlib.pyplot as plt
>>> N = 8
>>> y = np.zeros(N)
>>> x1 = np.linspace(0, 10, N, endpoint=True)
>>> x2 = np.linspace(0, 10, N, endpoint=False)
>>> plt.plot(x1, y, 'o')
[<matplotlib.lines.Line2D object at 0x...>]
>>> plt.plot(x2, y + 0.5, 'o')
[<matplotlib.lines.Line2D object at 0x...>]
>>> plt.ylim([-0.5, 1])
(-0.5, 1)
>>> plt.show()
"""
num = int(num)
if num <= 0:
return array([], float)
if endpoint:
if num == 1:
return array([float(start)])
step = (stop-start)/float((num-1))
y = _nx.arange(0, num) * step + start
y[-1] = stop
else:
step = (stop-start)/float(num)
y = _nx.arange(0, num) * step + start
if retstep:
return y, step
else:
return y
def logspace(start,stop,num=50,endpoint=True,base=10.0):
"""
Return numbers spaced evenly on a log scale.
In linear space, the sequence starts at ``base ** start``
(`base` to the power of `start`) and ends with ``base ** stop``
(see `endpoint` below).
Parameters
----------
start : float
``base ** start`` is the starting value of the sequence.
stop : float
``base ** stop`` is the final value of the sequence, unless `endpoint`
is False. In that case, ``num + 1`` values are spaced over the
interval in log-space, of which all but the last (a sequence of
length ``num``) are returned.
num : integer, optional
Number of samples to generate. Default is 50.
endpoint : boolean, optional
If true, `stop` is the last sample. Otherwise, it is not included.
Default is True.
base : float, optional
The base of the log space. The step size between the elements in
``ln(samples) / ln(base)`` (or ``log_base(samples)``) is uniform.
Default is 10.0.
Returns
-------
samples : ndarray
`num` samples, equally spaced on a log scale.
See Also
--------
arange : Similiar to linspace, with the step size specified instead of the
number of samples. Note that, when used with a float endpoint, the
endpoint may or may not be included.
linspace : Similar to logspace, but with the samples uniformly distributed
in linear space, instead of log space.
Notes
-----
Logspace is equivalent to the code
>>> y = np.linspace(start, stop, num=num, endpoint=endpoint)
... # doctest: +SKIP
>>> power(base, y)
... # doctest: +SKIP
Examples
--------
>>> np.logspace(2.0, 3.0, num=4)
array([ 100. , 215.443469 , 464.15888336, 1000. ])
>>> np.logspace(2.0, 3.0, num=4, endpoint=False)
array([ 100. , 177.827941 , 316.22776602, 562.34132519])
>>> np.logspace(2.0, 3.0, num=4, base=2.0)
array([ 4. , 5.0396842 , 6.34960421, 8. ])
Graphical illustration:
>>> import matplotlib.pyplot as plt
>>> N = 10
>>> x1 = np.logspace(0.1, 1, N, endpoint=True)
>>> x2 = np.logspace(0.1, 1, N, endpoint=False)
>>> y = np.zeros(N)
>>> plt.plot(x1, y, 'o')
[<matplotlib.lines.Line2D object at 0x...>]
>>> plt.plot(x2, y + 0.5, 'o')
[<matplotlib.lines.Line2D object at 0x...>]
>>> plt.ylim([-0.5, 1])
(-0.5, 1)
>>> plt.show()
"""
y = linspace(start,stop,num=num,endpoint=endpoint)
return _nx.power(base,y)
|
agpl-3.0
|
kwentz10/Photosynthesis_Optimization_Modeling
|
Traits_Physical_Factorial_CummulativeGS.py
|
1
|
9910
|
#!/usr/bin/env python2
# -*- coding: utf-8 -*-
"""
Created on Thu May 25 10:10:28 2017
@author: Katherine
"""
#!/usr/bin/env python2
# -*- coding: utf-8 -*-
"""
Created on Tue May 23 16:04:21 2017
@author: Katherine
"""
# -*- coding: utf-8 -*-
"""
Photosynthesis and Stomatal Conductance Model
Created 9/27/2016
Katherine Wentz
This is a program that runs photosynthesis and
stomatal conductance models given changes in leaf-
level traits.
The end product is graphs of NUE vs. WUE.
Update: I am going to run the model for plants with
traits that are distinctive of the meadow moisture
gradient in the alpine tundra.
Fix: correct for atmospheric pressure differences in co2, o2, and vapor pressure
Fix: vcmax temp dependence (pg 63 in plant physiological ecology book)
Fix: NEW VARIBALE TRAIT-->make the fraction of leaf N in rubisco go down with increasing SLA,
chlorophyll content, and decreasing light (wet meadow)--more N is allocated
to thylakoids. The only way for chl/m2 to increase even when g N/m2 goes down
or is constant is for the leaf to allocate more of leaf N to chl...also, note
that there is more organic N designated to photo in leaf when SLA goes up
because less N is used in structure. see "Photosynthesis or persistence: N allocation
in leaves of evergreen and deciduous... by Takashima et al. 2004. Also see Photosynthetic
nitrogen-use efficiency of species...by Poorter and Evans 1998
Note to self: NUE and WUE relationship flipflops with change in air temperature;
NUE makes sense because C:N decreases from dry to wet meadows; WUE increasing
in snowbed does not necessarilly make sense--look in the literature for this
herbs have a higher NUE
"""
#---------------Import Modules---------------#
import itertools as it
import numpy as np
from matplotlib import pyplot as plt
#Import combinations of variable parameters
from uncertain_params import monte_carlo
#Import photosynthesis model
from Photosynthesis_Model import photo_bound_meso_eqstom as photo
#Import functions to switch between Pa and umol/mol at sea level
from photo_functions import pa_con_atmfrac
#import timeseries of vwc and temp
from time_dep_params import surtemp_dm, surtemp_wm, vwc_dm, vwc_wm, na_dm_min_inter,na_wm_min_inter,na_dm_max_inter,na_wm_max_inter
#---------------Determine if I Want to Keep Any of the Variable Parameters Constant---------------#
const_params=[]
for xxx in it.combinations(['ht'],0): #keep ht and t constant for constant vpd
const_params+=[xxx]
#do this when I do not put any of the variable parameters as constant. instead I
#vary each parameter one at a time while keeping the other parameters constant.
if const_params==[()]:
const_params=[[-999999]]
#---------------Begin Looping Through Photosynthesis Model---------------#
#each loop is for a constant value, or combinatin of constant values, of variable parameter as determined above
for ii in range(len(const_params)):
#---------------Run through time series---------------#
days=np.linspace(1,365,365)
#dry meadow
tot_nue_dm_avg=[]
tot_wue_dm_avg=[]
tot_nue_dm_min=[]
tot_wue_dm_min=[]
tot_nue_dm_max=[]
tot_wue_dm_max=[]
tot_A_dm_avg=[]
tot_gs_dm_avg=[]
#moist meadow
tot_nue_mm_avg=[]
tot_wue_mm_avg=[]
tot_nue_mm_min=[]
tot_wue_mm_min=[]
tot_nue_mm_max=[]
tot_wue_mm_max=[]
tot_A_mm_avg=[]
tot_gs_mm_avg=[]
#wet meadow
tot_nue_wm_avg=[]
tot_wue_wm_avg=[]
tot_nue_wm_min=[]
tot_wue_wm_min=[]
tot_nue_wm_max=[]
tot_wue_wm_max=[]
tot_A_wm_avg=[]
tot_gs_wm_avg=[]
#---------------Photosynthesis + Stomatal Conductance Model---------------#
##---Constant Parameter Arrays for Model---##
#----Params Used in Model Currently----#
tk_25=298.16; #absolute temperature at 25 C
ekc=80500.0 #Activation energy for K of CO2 (J mol-1)
eko=14500.0 #Activation energy for K of O2 (J mol-1)
etau=-29000.0 #Activation energy for tau (???) (J mol-1)
ev=55000.0 #Activation energy for carboxylation (J mol-1)
ej=55000.0 #Activation energy for electron transport (J mol-1)
toptv=303.0 #Optimum temperature for maximum carboxylation (K)
toptj=303.0 #Optimum temperature for maximum electron transport (K)
ra=np.zeros(shape=1)+20.7 #specific rubisco activity (umol CO2/g Rub s)
flnr=np.zeros(shape=1)+0.1 #fraction of leaf nitrogen in rubisco (g N Rub/g N leaf)
frnr=np.zeros(shape=1)+6.25 #weight fraction of nitrogen in rubisco molecule (g Rub/g N Rub)
rh=np.zeros(shape=1)+0.5 #relative humidity (kPa/kPa)
ca=np.zeros(shape=1)+405 #ambient carbon dioxide (umol CO2/mol air)
ko25=np.zeros(shape=1)+30000 #Michaelis-Menten kinetic coefficient for oxygen at 25 C(Pa)
kc25=np.zeros(shape=1)+30 #Michaelis-Menten kinetic coefficient for carbon dioxide at 25 C (Pa)
o=np.zeros(shape=1)+210000 #concentration of ambient oxygen (umol/mol)
g0=np.zeros(shape=1)+0.002 #Ball-Berry stomatal conductance intercept parameter (mol H2O/m2s)
a=np.zeros(shape=1)+1.6 #Conversion Coefficient between stomatal conductance to water and carbon dioxide (unitless)
ij=np.zeros(shape=1)+1.0 #leaf angle index--downregulates jmax
m=np.zeros(shape=1)+9.0 #ball-berry parameter (unitless)
b=1.37 #Conversion Coefficient between boundary layer conductance to water and carbon dioxide
u=5.0 #windspeed (m/s)
qeff=0.32 #leaf quantum yield, electrons
PAR=2000 #photosynthetic active radiation (umol/m2s)
jm=2.68 #slope coefficient
vwc_min=0.08 #minimum soil water content for photosynthesis to occur (permanent wilting point) (cm3/cm3)
vwc_max=0.68 #maximum soil water content where increases in soil water do not affect photosynthesis (field capacity?) (cm3/cm3)
q=0.2 #parameter for soil water affect on photosynthesis (unitless)
#------constant variable params for sensitivty analysis-----#
chl_c=np.zeros(shape=1)+(np.mean([396,465,476])) #Chlorophyll Content of the Leaf (umol chl/m2)
ht_c=np.zeros(shape=1)+(np.mean([9.2,19.5,20.0])) #Temperature of the Leaf (K)
dia_c=np.zeros(shape=1)+(np.mean([1.4,2.3,2.6])/100.) #Mean diameter or size of leaf (m)
na_c=np.zeros(shape=1)+(np.mean([2.5,5.6,6.3])) #leaf nitrogen (g N/ m2)
t_c=np.zeros(shape=1)+15.0 #temp (C)
#-----which timeseries should I use--based on factorial meadow type---#
na_min=[na_dm_min_inter, na_dm_min_inter, na_wm_min_inter, na_wm_min_inter]
na_max=[na_dm_max_inter, na_dm_max_inter, na_wm_max_inter, na_wm_max_inter]
vwc_type=[vwc_dm,vwc_dm,vwc_wm,vwc_wm]
temp_type=[surtemp_dm,surtemp_dm,surtemp_wm,surtemp_wm]
A_tot_all=[]
chl_mean=[[395.7132],[475.8913],[395.7132],[475.8913]]
chl_sd=[[24.410199999999975],[29.185099999999977],[24.410199999999975],[29.185099999999977]]
dia_mean=[[1.6/100.],[3.0/100.],[1.6/100.],[3.0/100.]]
dia_sd=[[0.9/100.0],[1.2/100.0],[0.9/100.0],[1.2/100.0]]
ht_mean=[[9.183549],[19.98519],[9.183549],[19.98519]]
ht_sd=[[1.5],[3.1],[1.5],[3.1]]
depth=[0.2,0.2,0.2,0.4,0.4,0.4]
#---------------Import Variable Parameter Arrays from Leaf Parameter File---------------#
for iii in range(len(chl_mean)):
A_tot=0
for time in range(129):
params=monte_carlo(chl_mean[iii], chl_sd[iii], dia_mean[iii], dia_sd[iii], [na_min[iii][time]], [na_max[iii][time]], ht_mean[iii], ht_sd[iii])
A_day=[]
for xx in range(len(params)):
for yy in range(len(params[xx])):
for key,val in params[xx][yy].items():
exec(key + '=val')
#set variable parameters constant if I specify this above
if 'na' in const_params[ii]:
na=na_c
if 'dia' in const_params[ii]:
dia=dia_c
if 'chl' in const_params[ii]:
chl=chl_c
if 'ht' in const_params[ii]:
ht=ht_c
#------calculate vapor pressure-----#
pa_v=611*np.exp((17.27*temp_type[iii][time])/(temp_type[iii][time]+237.3)) #saturation vapor pressure of air (Pa)
ea_str=pa_con_atmfrac(pa_v,3528) #saturation vapor pressure of air (Pa-->umol h20/mol air)
ea=rh*ea_str #vapor pressure (umol h2O/mol air)
#correct for leaf temperatures using leaf height
t_diff=18-0.4*ht
tl=temp_type[iii][time]+t_diff
z=depth[iii]
#---------------Photosynthesis Function---------------#
#alter this line of code for when implementing different photosynthesis functions
wue, nue, A, E, cs, ci, gsw, gs, gbw, gb, gm, cc,dd =photo(tk_25,ekc,eko,etau,ev,ej,toptv,toptj,na, qeff, PAR,tl,ea,chl,ij,kc25,ko25,o,ca,rh,m,a,frnr,flnr,ra,jm,g0,b,dia,u,q,vwc_min,vwc_max,vwc_type[iii][time],z)
#test to make sure wue and nue are positive at not 'nan'
if wue[0]==-999 and nue[0]==-999:
continue
if np.isnan(A[0]):
A[0]=0.0
A_day+=[(A[0]*3600*6)/1000000.*44.]
A_tot+=np.mean(A_day)
A_tot_all+=[A_tot]
print A_tot_all
print A_tot_all
|
mit
|
tu-rbo/omip
|
shape_reconstruction/src/plot_statistics.py
|
1
|
1935
|
#!/usr/bin/python
##############
# View the statistics for a single experiment (bag file)
#
# Statistics are plotted separately, i.e. one window per object per variant,
# showing precision and recall.
import numpy as np
import matplotlib.pylab as plt
import matplotlib
matplotlib.rcParams['ps.useafm'] = True
matplotlib.rcParams['pdf.use14corefonts'] = True
matplotlib.rcParams['text.usetex'] = True
import sys
import os
import os.path
def plot_statistics(folder):
for f in os.listdir(folder):
if f[-3:] != "txt":
continue
filename = os.path.join(folder, f)
data = np.genfromtxt(filename, dtype=float, delimiter=' ', names=True)
precision = data['tp'] / (data['tp']+data['fp'])
recall = data['tp'] / (data['tp']+data['fn'])
seg_acc = data['tp'] / (data['tp']+data['fp']+data['fn'])
time = data['time'] - data['time'][0]
# clean up
precision[np.where(np.isnan(precision))] = 0.
recall[np.where(np.isnan(recall))] = 0.
seg_acc[np.where(np.isnan(seg_acc))] = 0.
plt.figure(figsize=(7.5,5))
for y in np.arange(0.0, 1.1, 0.2):
plt.plot(time, [y] * len(time), "--", lw=0.5, color="black", alpha=0.3)
plt.plot(time, seg_acc, "k", label="Segmentation Accuracy", lw=3.0)
plt.plot(time, precision, "b", label="Precision", lw=2.0, ls="--")
plt.plot(time, recall, "r", label="Recall", lw=2.0, ls="--")
plt.xlim(0, data['time'][-1] - data['time'][0])
plt.ylim(-0.1, 1.1)
plt.xlabel("time")
plt.title(os.path.basename(filename[:-3]))
plt.legend(loc=4)
img_path = os.path.join(folder, f[:-3]+"pdf")
print ("Saving image at %s" % img_path)
plt.savefig(img_path, bbox_inches="tight")
if __name__ == "__main__":
if len(sys.argv) != 2:
print "Usage: plot_statistics.py <experiment folder>"
sys.exit()
print ("Starting plot statistics")
plot_statistics(sys.argv[1])
plt.show()
|
mit
|
nrhine1/scikit-learn
|
examples/decomposition/plot_kernel_pca.py
|
353
|
2011
|
"""
==========
Kernel PCA
==========
This example shows that Kernel PCA is able to find a projection of the data
that makes data linearly separable.
"""
print(__doc__)
# Authors: Mathieu Blondel
# Andreas Mueller
# License: BSD 3 clause
import numpy as np
import matplotlib.pyplot as plt
from sklearn.decomposition import PCA, KernelPCA
from sklearn.datasets import make_circles
np.random.seed(0)
X, y = make_circles(n_samples=400, factor=.3, noise=.05)
kpca = KernelPCA(kernel="rbf", fit_inverse_transform=True, gamma=10)
X_kpca = kpca.fit_transform(X)
X_back = kpca.inverse_transform(X_kpca)
pca = PCA()
X_pca = pca.fit_transform(X)
# Plot results
plt.figure()
plt.subplot(2, 2, 1, aspect='equal')
plt.title("Original space")
reds = y == 0
blues = y == 1
plt.plot(X[reds, 0], X[reds, 1], "ro")
plt.plot(X[blues, 0], X[blues, 1], "bo")
plt.xlabel("$x_1$")
plt.ylabel("$x_2$")
X1, X2 = np.meshgrid(np.linspace(-1.5, 1.5, 50), np.linspace(-1.5, 1.5, 50))
X_grid = np.array([np.ravel(X1), np.ravel(X2)]).T
# projection on the first principal component (in the phi space)
Z_grid = kpca.transform(X_grid)[:, 0].reshape(X1.shape)
plt.contour(X1, X2, Z_grid, colors='grey', linewidths=1, origin='lower')
plt.subplot(2, 2, 2, aspect='equal')
plt.plot(X_pca[reds, 0], X_pca[reds, 1], "ro")
plt.plot(X_pca[blues, 0], X_pca[blues, 1], "bo")
plt.title("Projection by PCA")
plt.xlabel("1st principal component")
plt.ylabel("2nd component")
plt.subplot(2, 2, 3, aspect='equal')
plt.plot(X_kpca[reds, 0], X_kpca[reds, 1], "ro")
plt.plot(X_kpca[blues, 0], X_kpca[blues, 1], "bo")
plt.title("Projection by KPCA")
plt.xlabel("1st principal component in space induced by $\phi$")
plt.ylabel("2nd component")
plt.subplot(2, 2, 4, aspect='equal')
plt.plot(X_back[reds, 0], X_back[reds, 1], "ro")
plt.plot(X_back[blues, 0], X_back[blues, 1], "bo")
plt.title("Original space after inverse transform")
plt.xlabel("$x_1$")
plt.ylabel("$x_2$")
plt.subplots_adjust(0.02, 0.10, 0.98, 0.94, 0.04, 0.35)
plt.show()
|
bsd-3-clause
|
cjayb/mne-python
|
mne/decoding/receptive_field.py
|
2
|
20189
|
# -*- coding: utf-8 -*-
# Authors: Chris Holdgraf <[email protected]>
# Eric Larson <[email protected]>
# License: BSD (3-clause)
import numbers
import numpy as np
from scipy import linalg
from .base import get_coef, BaseEstimator, _check_estimator
from .time_delaying_ridge import TimeDelayingRidge
from ..fixes import is_regressor
from ..utils import _validate_type, verbose
class ReceptiveField(BaseEstimator):
"""Fit a receptive field model.
This allows you to fit an encoding model (stimulus to brain) or a decoding
model (brain to stimulus) using time-lagged input features (for example, a
spectro- or spatio-temporal receptive field, or STRF).
Parameters
----------
tmin : float
The starting lag, in seconds (or samples if ``sfreq`` == 1).
tmax : float
The ending lag, in seconds (or samples if ``sfreq`` == 1).
Must be >= tmin.
sfreq : float
The sampling frequency used to convert times into samples.
feature_names : array, shape (n_features,) | None
Names for input features to the model. If None, feature names will
be auto-generated from the shape of input data after running `fit`.
estimator : instance of sklearn.base.BaseEstimator | float | None
The model used in fitting inputs and outputs. This can be any
scikit-learn-style model that contains a fit and predict method. If a
float is passed, it will be interpreted as the ``alpha`` parameter
to be passed to a Ridge regression model. If `None`, then a Ridge
regression model with an alpha of 0 will be used.
fit_intercept : bool | None
If True (default), the sample mean is removed before fitting.
If ``estimator`` is a :class:`sklearn.base.BaseEstimator`,
this must be None or match ``estimator.fit_intercept``.
scoring : ['r2', 'corrcoef']
Defines how predictions will be scored. Currently must be one of
'r2' (coefficient of determination) or 'corrcoef' (the correlation
coefficient).
patterns : bool
If True, inverse coefficients will be computed upon fitting using the
covariance matrix of the inputs, and the cross-covariance of the
inputs/outputs, according to [5]_. Defaults to False.
n_jobs : int | str
Number of jobs to run in parallel. Can be 'cuda' if CuPy
is installed properly and ``estimator is None``.
.. versionadded:: 0.18
edge_correction : bool
If True (default), correct the autocorrelation coefficients for
non-zero delays for the fact that fewer samples are available.
Disabling this speeds up performance at the cost of accuracy
depending on the relationship between epoch length and model
duration. Only used if ``estimator`` is float or None.
.. versionadded:: 0.18
verbose : bool, str, int, or None
If not None, override default verbose level (see
:func:`mne.verbose` and :ref:`Logging documentation <tut_logging>`
for more).
Attributes
----------
coef_ : array, shape ([n_outputs, ]n_features, n_delays)
The coefficients from the model fit, reshaped for easy visualization.
During :meth:`mne.decoding.ReceptiveField.fit`, if ``y`` has one
dimension (time), the ``n_outputs`` dimension here is omitted.
patterns_ : array, shape ([n_outputs, ]n_features, n_delays)
If fit, the inverted coefficients from the model.
delays_ : array, shape (n_delays,), dtype int
The delays used to fit the model, in indices. To return the delays
in seconds, use ``self.delays_ / self.sfreq``
valid_samples_ : slice
The rows to keep during model fitting after removing rows with
missing values due to time delaying. This can be used to get an
output equivalent to using :func:`numpy.convolve` or
:func:`numpy.correlate` with ``mode='valid'``.
See Also
--------
mne.decoding.TimeDelayingRidge
Notes
-----
For a causal system, the encoding model will have significant
non-zero values only at positive lags. In other words, lags point
backward in time relative to the input, so positive lags correspond
to previous input time samples, while negative lags correspond to
future input time samples.
References
----------
.. [1] Theunissen, F. E. et al. Estimating spatio-temporal receptive
fields of auditory and visual neurons from their responses to
natural stimuli. Network 12, 289-316 (2001).
.. [2] Willmore, B. & Smyth, D. Methods for first-order kernel
estimation: simple-cell receptive fields from responses to
natural scenes. Network 14, 553-77 (2003).
.. [3] Crosse, M. J., Di Liberto, G. M., Bednar, A. & Lalor, E. C. (2016).
The Multivariate Temporal Response Function (mTRF) Toolbox:
A MATLAB Toolbox for Relating Neural Signals to Continuous Stimuli.
Frontiers in Human Neuroscience 10, 604.
doi:10.3389/fnhum.2016.00604
.. [4] Holdgraf, C. R. et al. Rapid tuning shifts in human auditory cortex
enhance speech intelligibility. Nature Communications,
7, 13654 (2016). doi:10.1038/ncomms13654
.. [5] Haufe, S., Meinecke, F., Goergen, K., Daehne, S., Haynes, J.-D.,
Blankertz, B., & Biessmann, F. (2014). On the interpretation of
weight vectors of linear models in multivariate neuroimaging.
NeuroImage, 87, 96-110. doi:10.1016/j.neuroimage.2013.10.067
"""
@verbose
def __init__(self, tmin, tmax, sfreq, feature_names=None, estimator=None,
fit_intercept=None, scoring='r2', patterns=False,
n_jobs=1, edge_correction=True, verbose=None):
self.feature_names = feature_names
self.sfreq = float(sfreq)
self.tmin = tmin
self.tmax = tmax
self.estimator = 0. if estimator is None else estimator
self.fit_intercept = fit_intercept
self.scoring = scoring
self.patterns = patterns
self.n_jobs = n_jobs
self.edge_correction = edge_correction
self.verbose = verbose
def __repr__(self): # noqa: D105
s = "tmin, tmax : (%.3f, %.3f), " % (self.tmin, self.tmax)
estimator = self.estimator
if not isinstance(estimator, str):
estimator = type(self.estimator)
s += "estimator : %s, " % (estimator,)
if hasattr(self, 'coef_'):
if self.feature_names is not None:
feats = self.feature_names
if len(feats) == 1:
s += "feature: %s, " % feats[0]
else:
s += "features : [%s, ..., %s], " % (feats[0], feats[-1])
s += "fit: True"
else:
s += "fit: False"
if hasattr(self, 'scores_'):
s += "scored (%s)" % self.scoring
return "<ReceptiveField | %s>" % s
def _delay_and_reshape(self, X, y=None):
"""Delay and reshape the variables."""
if not isinstance(self.estimator_, TimeDelayingRidge):
# X is now shape (n_times, n_epochs, n_feats, n_delays)
X = _delay_time_series(X, self.tmin, self.tmax, self.sfreq,
fill_mean=self.fit_intercept)
X = _reshape_for_est(X)
# Concat times + epochs
if y is not None:
y = y.reshape(-1, y.shape[-1], order='F')
return X, y
@verbose
def fit(self, X, y):
"""Fit a receptive field model.
Parameters
----------
X : array, shape (n_times[, n_epochs], n_features)
The input features for the model.
y : array, shape (n_times[, n_epochs][, n_outputs])
The output features for the model.
Returns
-------
self : instance
The instance so you can chain operations.
"""
if self.scoring not in _SCORERS.keys():
raise ValueError('scoring must be one of %s, got'
'%s ' % (sorted(_SCORERS.keys()), self.scoring))
from sklearn.base import clone
X, y, _, self._y_dim = self._check_dimensions(X, y)
if self.tmin > self.tmax:
raise ValueError('tmin (%s) must be at most tmax (%s)'
% (self.tmin, self.tmax))
# Initialize delays
self.delays_ = _times_to_delays(self.tmin, self.tmax, self.sfreq)
# Define the slice that we should use in the middle
self.valid_samples_ = _delays_to_slice(self.delays_)
if isinstance(self.estimator, numbers.Real):
if self.fit_intercept is None:
self.fit_intercept = True
estimator = TimeDelayingRidge(
self.tmin, self.tmax, self.sfreq, alpha=self.estimator,
fit_intercept=self.fit_intercept, n_jobs=self.n_jobs,
edge_correction=self.edge_correction)
elif is_regressor(self.estimator):
estimator = clone(self.estimator)
if self.fit_intercept is not None and \
estimator.fit_intercept != self.fit_intercept:
raise ValueError(
'Estimator fit_intercept (%s) != initialization '
'fit_intercept (%s), initialize ReceptiveField with the '
'same fit_intercept value or use fit_intercept=None'
% (estimator.fit_intercept, self.fit_intercept))
self.fit_intercept = estimator.fit_intercept
else:
raise ValueError('`estimator` must be a float or an instance'
' of `BaseEstimator`,'
' got type %s.' % type(self.estimator))
self.estimator_ = estimator
del estimator
_check_estimator(self.estimator_)
# Create input features
n_times, n_epochs, n_feats = X.shape
n_outputs = y.shape[-1]
n_delays = len(self.delays_)
# Update feature names if we have none
if ((self.feature_names is not None) and
(len(self.feature_names) != n_feats)):
raise ValueError('n_features in X does not match feature names '
'(%s != %s)' % (n_feats, len(self.feature_names)))
# Create input features
X, y = self._delay_and_reshape(X, y)
self.estimator_.fit(X, y)
coef = get_coef(self.estimator_, 'coef_') # (n_targets, n_features)
shape = [n_feats, n_delays]
if self._y_dim > 1:
shape.insert(0, -1)
self.coef_ = coef.reshape(shape)
# Inverse-transform model weights
if self.patterns:
if isinstance(self.estimator_, TimeDelayingRidge):
cov_ = self.estimator_.cov_ / float(n_times * n_epochs - 1)
y = y.reshape(-1, y.shape[-1], order='F')
else:
X = X - X.mean(0, keepdims=True)
cov_ = np.cov(X.T)
del X
# Inverse output covariance
if y.ndim == 2 and y.shape[1] != 1:
y = y - y.mean(0, keepdims=True)
inv_Y = linalg.pinv(np.cov(y.T))
else:
inv_Y = 1. / float(n_times * n_epochs - 1)
del y
# Inverse coef according to Haufe's method
# patterns has shape (n_feats * n_delays, n_outputs)
coef = np.reshape(self.coef_, (n_feats * n_delays, n_outputs))
patterns = cov_.dot(coef.dot(inv_Y))
self.patterns_ = patterns.reshape(shape)
return self
def predict(self, X):
"""Generate predictions with a receptive field.
Parameters
----------
X : array, shape (n_times[, n_epochs], n_channels)
The input features for the model.
Returns
-------
y_pred : array, shape (n_times[, n_epochs][, n_outputs])
The output predictions. "Note that valid samples (those
unaffected by edge artifacts during the time delaying step) can
be obtained using ``y_pred[rf.valid_samples_]``.
"""
if not hasattr(self, 'delays_'):
raise ValueError('Estimator has not been fit yet.')
X, _, X_dim = self._check_dimensions(X, None, predict=True)[:3]
del _
# convert to sklearn and back
pred_shape = X.shape[:-1]
if self._y_dim > 1:
pred_shape = pred_shape + (self.coef_.shape[0],)
X, _ = self._delay_and_reshape(X)
y_pred = self.estimator_.predict(X)
y_pred = y_pred.reshape(pred_shape, order='F')
shape = list(y_pred.shape)
if X_dim <= 2:
shape.pop(1) # epochs
extra = 0
else:
extra = 1
shape = shape[:self._y_dim + extra]
y_pred.shape = shape
return y_pred
def score(self, X, y):
"""Score predictions generated with a receptive field.
This calls ``self.predict``, then masks the output of this
and ``y` with ``self.mask_prediction_``. Finally, it passes
this to a :mod:`sklearn.metrics` scorer.
Parameters
----------
X : array, shape (n_times[, n_epochs], n_channels)
The input features for the model.
y : array, shape (n_times[, n_epochs][, n_outputs])
Used for scikit-learn compatibility.
Returns
-------
scores : list of float, shape (n_outputs,)
The scores estimated by the model for each output (e.g. mean
R2 of ``predict(X)``).
"""
# Create our scoring object
scorer_ = _SCORERS[self.scoring]
# Generate predictions, then reshape so we can mask time
X, y = self._check_dimensions(X, y, predict=True)[:2]
n_times, n_epochs, n_outputs = y.shape
y_pred = self.predict(X)
y_pred = y_pred[self.valid_samples_]
y = y[self.valid_samples_]
# Re-vectorize and call scorer
y = y.reshape([-1, n_outputs], order='F')
y_pred = y_pred.reshape([-1, n_outputs], order='F')
assert y.shape == y_pred.shape
scores = scorer_(y, y_pred, multioutput='raw_values')
return scores
def _check_dimensions(self, X, y, predict=False):
X_dim = X.ndim
y_dim = y.ndim if y is not None else 0
if X_dim == 2:
# Ensure we have a 3D input by adding singleton epochs dimension
X = X[:, np.newaxis, :]
if y is not None:
if y_dim == 1:
y = y[:, np.newaxis, np.newaxis] # epochs, outputs
elif y_dim == 2:
y = y[:, np.newaxis, :] # epochs
else:
raise ValueError('y must be shape (n_times[, n_epochs]'
'[,n_outputs], got %s' % (y.shape,))
elif X.ndim == 3:
if y is not None:
if y.ndim == 2:
y = y[:, :, np.newaxis] # Add an outputs dim
elif y.ndim != 3:
raise ValueError('If X has 3 dimensions, '
'y must have 2 or 3 dimensions')
else:
raise ValueError('X must be shape (n_times[, n_epochs],'
' n_features), got %s' % (X.shape,))
if y is not None:
if X.shape[0] != y.shape[0]:
raise ValueError('X and y do not have the same n_times\n'
'%s != %s' % (X.shape[0], y.shape[0]))
if X.shape[1] != y.shape[1]:
raise ValueError('X and y do not have the same n_epochs\n'
'%s != %s' % (X.shape[1], y.shape[1]))
if predict and y.shape[-1] != len(self.estimator_.coef_):
raise ValueError('Number of outputs does not match'
' estimator coefficients dimensions')
return X, y, X_dim, y_dim
def _delay_time_series(X, tmin, tmax, sfreq, fill_mean=False):
"""Return a time-lagged input time series.
Parameters
----------
X : array, shape (n_times[, n_epochs], n_features)
The time series to delay. Must be 2D or 3D.
tmin : int | float
The starting lag.
tmax : int | float
The ending lag.
Must be >= tmin.
sfreq : int | float
The sampling frequency of the series. Defaults to 1.0.
fill_mean : bool
If True, the fill value will be the mean along the time dimension
of the feature, and each cropped and delayed segment of data
will be shifted to have the same mean value (ensuring that mean
subtraction works properly). If False, the fill value will be zero.
Returns
-------
delayed : array, shape(n_times[, n_epochs][, n_features], n_delays)
The delayed data. It has the same shape as X, with an extra dimension
appended to the end.
Examples
--------
>>> tmin, tmax = -0.1, 0.2
>>> sfreq = 10.
>>> x = np.arange(1, 6)
>>> x_del = _delay_time_series(x, tmin, tmax, sfreq)
>>> print(x_del) # doctest:+SKIP
[[2. 1. 0. 0.]
[3. 2. 1. 0.]
[4. 3. 2. 1.]
[5. 4. 3. 2.]
[0. 5. 4. 3.]]
"""
_check_delayer_params(tmin, tmax, sfreq)
delays = _times_to_delays(tmin, tmax, sfreq)
# Iterate through indices and append
delayed = np.zeros(X.shape + (len(delays),))
if fill_mean:
mean_value = X.mean(axis=0)
if X.ndim == 3:
mean_value = np.mean(mean_value, axis=0)
delayed[:] = mean_value[:, np.newaxis]
for ii, ix_delay in enumerate(delays):
# Create zeros to populate w/ delays
if ix_delay < 0:
out = delayed[:ix_delay, ..., ii]
use_X = X[-ix_delay:]
elif ix_delay > 0:
out = delayed[ix_delay:, ..., ii]
use_X = X[:-ix_delay]
else: # == 0
out = delayed[..., ii]
use_X = X
out[:] = use_X
if fill_mean:
out[:] += (mean_value - use_X.mean(axis=0))
return delayed
def _times_to_delays(tmin, tmax, sfreq):
"""Convert a tmin/tmax in seconds to delays."""
# Convert seconds to samples
delays = np.arange(int(np.round(tmin * sfreq)),
int(np.round(tmax * sfreq) + 1))
return delays
def _delays_to_slice(delays):
"""Find the slice to be taken in order to remove missing values."""
# Negative values == cut off rows at the end
min_delay = None if delays[-1] <= 0 else delays[-1]
# Positive values == cut off rows at the end
max_delay = None if delays[0] >= 0 else delays[0]
return slice(min_delay, max_delay)
def _check_delayer_params(tmin, tmax, sfreq):
"""Check delayer input parameters. For future custom delay support."""
_validate_type(sfreq, 'numeric', '`sfreq`')
for tlim in (tmin, tmax):
_validate_type(tlim, 'numeric', 'tmin/tmax')
if not tmin <= tmax:
raise ValueError('tmin must be <= tmax')
def _reshape_for_est(X_del):
"""Convert X_del to a sklearn-compatible shape."""
n_times, n_epochs, n_feats, n_delays = X_del.shape
X_del = X_del.reshape(n_times, n_epochs, -1) # concatenate feats
X_del = X_del.reshape(n_times * n_epochs, -1, order='F')
return X_del
# Create a correlation scikit-learn-style scorer
def _corr_score(y_true, y, multioutput=None):
from scipy.stats import pearsonr
assert multioutput == 'raw_values'
for this_y in (y_true, y):
if this_y.ndim != 2:
raise ValueError('inputs must be shape (samples, outputs), got %s'
% (this_y.shape,))
return np.array([pearsonr(y_true[:, ii], y[:, ii])[0]
for ii in range(y.shape[-1])])
def _r2_score(y_true, y, multioutput=None):
from sklearn.metrics import r2_score
return r2_score(y_true, y, multioutput=multioutput)
_SCORERS = {'r2': _r2_score, 'corrcoef': _corr_score}
|
bsd-3-clause
|
IntelLabs/hpat
|
sdc/datatypes/hpat_pandas_stringmethods_functions.py
|
1
|
44761
|
# *****************************************************************************
# Copyright (c) 2020, Intel Corporation All rights reserved.
#
# Redistribution and use in source and binary forms, with or without
# modification, are permitted provided that the following conditions are met:
#
# Redistributions of source code must retain the above copyright notice,
# this list of conditions and the following disclaimer.
#
# Redistributions in binary form must reproduce the above copyright notice,
# this list of conditions and the following disclaimer in the documentation
# and/or other materials provided with the distribution.
#
# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"
# AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO,
# THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR
# PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR
# CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
# EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO,
# PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS;
# OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY,
# WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR
# OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE,
# EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
# *****************************************************************************
"""
| :class:`pandas.core.strings.StringMethods` functions and operators implementations in HPAT
.. only:: developer
This is autogenerated sources for all Unicode string functions supported by Numba.
Currently tested 45 functions only. List of functions obtained automatically from
`numba.types.misc.UnicodeType` class
Example of the generated method (for method upper()):
`hpat_pandas_stringmethods_upper_parallel_impl` is paralell version
(required additional import mentioned in the body)
@sdc_overload_method(StringMethodsType, 'upper')
def hpat_pandas_stringmethods_upper(self):
ty_checker = TypeChecker('Method stringmethods.upper().')
ty_checker.check(self, StringMethodsType)
def hpat_pandas_stringmethods_upper_parallel_impl(self):
from numba.parfor import (init_prange, min_checker, internal_prange)
init_prange()
result = []
item_count = len(self._data)
min_checker(item_count)
for i in internal_prange(item_count):
item = self._data[i]
item_method = item.upper()
result.append(item_method)
return pandas.Series(result)
return hpat_pandas_stringmethods_upper_parallel_impl
def hpat_pandas_stringmethods_upper_impl(self):
result = []
item_count = len(self._data)
for i in range(item_count):
item = self._data[i]
item_method = item.upper()
result.append(item_method)
return pandas.Series(result)
return hpat_pandas_stringmethods_upper_impl
Test: python -m sdc.runtests sdc.tests.test_hiframes.TestHiFrames.test_str_split_filter
"""
import numpy
import pandas
import numba
from numba.types import (Boolean, Integer, NoneType,
Omitted, StringLiteral, UnicodeType)
from sdc.utilities.sdc_typing_utils import TypeChecker
from sdc.datatypes.hpat_pandas_stringmethods_types import StringMethodsType
from sdc.utilities.utils import sdc_overload_method
from sdc.hiframes.api import get_nan_mask
from sdc.str_arr_ext import str_arr_set_na_by_mask, create_str_arr_from_list
_hpat_pandas_stringmethods_autogen_global_dict = {
'pandas': pandas,
'numpy': numpy,
'numba': numba,
'StringMethodsType': StringMethodsType,
'TypeChecker': TypeChecker
}
_hpat_pandas_stringmethods_functions_params = {
'cat': ', others=None, sep=None, na_rep=None, join="left"',
'center': ', width, fillchar=" "',
'contains': ', pat, case=True, flags=0, na=numpy.nan, regex=True',
'count': ', pat, flags=0',
'decode': ', encoding, errors="strict"',
'encode': ', encoding, errors="strict"',
'endswith': ', pat, na=numpy.nan',
'extractall': ', pat, flags=0',
'extract': ', pat, flags=0, expand=True',
'findall': ', pat, flags=0',
'find': ', sub, start=0, end=None',
'get': ', i',
'get_dummies': ', sep="|"',
'index': ', sub, start=0, end=None',
'join': ', sep',
'ljust': ', width, fillchar=" "',
'lstrip': ', to_strip=None',
'match': ', pat, case=True, flags=0, na=numpy.nan',
'normalize': ', form',
'pad': ', width, side="left", fillchar=" "',
'partition': ', sep=" ", expand=True',
'repeat': ', repeats',
'replace': ', pat, repl, n=-1, case=None, flags=0, regex=True',
'rfind': ', sub, start=0, end=None',
'rindex': ', sub, start=0, end=None',
'rjust': ', width, fillchar=" "',
'rpartition': ', sep=" ", expand=True',
'rsplit': ', pat=None, n=-1, expand=False',
'rstrip': ', to_strip=None',
'slice_replace': ', start=None, stop=None, repl=None',
'slice': ', start=None, stop=None, step=None',
'split': ', pat=None, n=-1, expand=False',
'startswith': ', pat, na=numpy.nan',
'strip': ', to_strip=None',
'translate': ', table',
'wrap': ', width',
'zfill': ', width',
}
_hpat_pandas_stringmethods_functions_template = """
# @sdc_overload_method(StringMethodsType, '{methodname}')
def hpat_pandas_stringmethods_{methodname}(self{methodparams}):
\"\"\"
Pandas Series method :meth:`pandas.core.strings.StringMethods.{methodname}()` implementation.
Note: Unicode type of list elements are supported only. Numpy.NaN is not supported as elements.
.. only:: developer
Test: python -m sdc.runtests sdc.tests.test_strings.TestStrings.test_str2str
python -m sdc.runtests sdc.tests.test_series.TestSeries.test_series_str2str
python -m sdc.runtests sdc.tests.test_hiframes.TestHiFrames.test_str_get
python -m sdc.runtests sdc.tests.test_hiframes.TestHiFrames.test_str_replace_noregex
python -m sdc.runtests sdc.tests.test_hiframes.TestHiFrames.test_str_split
python -m sdc.runtests sdc.tests.test_hiframes.TestHiFrames.test_str_contains_regex
Parameters
----------
self: :class:`pandas.core.strings.StringMethods`
input arg
other: {methodparams}
input arguments decription in
https://pandas.pydata.org/pandas-docs/version/0.25/reference/series.html#string-handling
Returns
-------
:obj:`pandas.Series`
returns :obj:`pandas.Series` object
\"\"\"
ty_checker = TypeChecker('Method {methodname}().')
ty_checker.check(self, StringMethodsType)
def hpat_pandas_stringmethods_{methodname}_impl(self{methodparams}):
item_count = len(self._data)
result = [''] * item_count
# result = numba.typed.List.empty_list(numba.types.unicode_type)
for it in range(item_count):
item = self._data._data[it]
if len(item) > 0:
result[it] = item.{methodname}({methodparams_call})
else:
result[it] = item
return pandas.Series(result, self._data._index, name=self._data._name)
return hpat_pandas_stringmethods_{methodname}_impl
"""
@sdc_overload_method(StringMethodsType, 'center')
def hpat_pandas_stringmethods_center(self, width, fillchar=' '):
"""
Intel Scalable Dataframe Compiler User Guide
********************************************
Pandas API: pandas.Series.str.center
Limitations
-----------
Series elements are expected to be Unicode strings. Elements cannot be NaN.
Examples
--------
.. literalinclude:: ../../../examples/series/str/series_str_center.py
:language: python
:lines: 27-
:caption: Filling left and right side of strings in the Series with an additional character
:name: ex_series_str_center
.. command-output:: python ./series/str/series_str_center.py
:cwd: ../../../examples
.. todo:: Add support of 32-bit Unicode for `str.center()`
Intel Scalable Dataframe Compiler Developer Guide
*************************************************
Pandas Series method :meth:`pandas.core.strings.StringMethods.center()` implementation.
Note: Unicode type of list elements are supported only. Numpy.NaN is not supported as elements.
.. only:: developer
Test: python -m sdc.runtests -k sdc.tests.test_series.TestSeries.test_series_center
Parameters
----------
self: :class:`pandas.core.strings.StringMethods`
input arg
width: :obj:`int`
Minimum width of resulting string
fillchar: :obj:`str`
Additional character for filling, default is whitespace
Returns
-------
:obj:`pandas.Series`
returns :obj:`pandas.Series` object
"""
ty_checker = TypeChecker('Method center().')
ty_checker.check(self, StringMethodsType)
if not isinstance(width, Integer):
ty_checker.raise_exc(width, 'int', 'width')
accepted_types = (Omitted, StringLiteral, UnicodeType)
if not isinstance(fillchar, accepted_types) and fillchar != ' ':
ty_checker.raise_exc(fillchar, 'str', 'fillchar')
def hpat_pandas_stringmethods_center_impl(self, width, fillchar=' '):
item_count = len(self._data)
result = [''] * item_count
for idx, item in enumerate(self._data._data):
result[idx] = item.center(width, fillchar)
return pandas.Series(result, self._data._index, name=self._data._name)
return hpat_pandas_stringmethods_center_impl
@sdc_overload_method(StringMethodsType, 'endswith')
def hpat_pandas_stringmethods_endswith(self, pat, na=None):
"""
Intel Scalable Dataframe Compiler User Guide
********************************************
Pandas API: pandas.Series.str.endswith
Limitations
-----------
Series elements are expected to be Unicode strings. Elements cannot be NaN.
Examples
--------
.. literalinclude:: ../../../examples/series/str/series_str_endswith.py
:language: python
:lines: 27-
:caption: Test if the end of each string element matches a string
:name: ex_series_str_endswith
.. command-output:: python ./series/str/series_str_endswith.py
:cwd: ../../../examples
.. todo::
- Add support of matching the end of each string by a pattern
- Add support of parameter ``na``
.. seealso::
`str.endswith <https://docs.python.org/3/library/stdtypes.html#str.endswith>`_
Python standard library string method.
:ref:`Series.str.startswith <pandas.Series.str.startswith>`
Same as endswith, but tests the start of string.
:ref:`Series.str.contains <pandas.Series.str.contains>`
Tests if string element contains a pattern.
Intel Scalable Dataframe Compiler Developer Guide
*************************************************
Pandas Series method :meth:`pandas.core.strings.StringMethods.endswith()` implementation.
Note: Unicode type of list elements are supported only. Numpy.NaN is not supported as elements.
.. only:: developer
Test: python -m sdc.runtests -k sdc.tests.test_series.TestSeries.test_series_endswith
Parameters
----------
self: :class:`pandas.core.strings.StringMethods`
input arg
pat: :obj:`str`
Character sequence
na: :obj:`bool`
Object shown if element tested is not a string
*unsupported*
Returns
-------
:obj:`pandas.Series`
returns :obj:`pandas.Series` object
"""
ty_checker = TypeChecker('Method endswith().')
ty_checker.check(self, StringMethodsType)
if not isinstance(pat, (StringLiteral, UnicodeType)):
ty_checker.raise_exc(pat, 'str', 'pat')
if not isinstance(na, (Boolean, NoneType, Omitted)) and na is not None:
ty_checker.raise_exc(na, 'bool', 'na')
def hpat_pandas_stringmethods_endswith_impl(self, pat, na=None):
if na is not None:
msg = 'Method endswith(). The object na\n expected: None'
raise ValueError(msg)
item_endswith = len(self._data)
result = numpy.empty(item_endswith, numba.types.boolean)
for idx, item in enumerate(self._data._data):
result[idx] = item.endswith(pat)
return pandas.Series(result, self._data._index, name=self._data._name)
return hpat_pandas_stringmethods_endswith_impl
@sdc_overload_method(StringMethodsType, 'find')
def hpat_pandas_stringmethods_find(self, sub, start=0, end=None):
"""
Intel Scalable Dataframe Compiler User Guide
********************************************
Pandas API: pandas.Series.str.find
Limitations
-----------
Series elements are expected to be Unicode strings. Elements cannot be NaN.
Examples
--------
.. literalinclude:: ../../../examples/series/str/series_str_find.py
:language: python
:lines: 27-
:caption: Return lowest indexes in each strings in the Series
:name: ex_series_str_find
.. command-output:: python ./series/str/series_str_find.py
:cwd: ../../../examples
.. todo:: Add support of parameters ``start`` and ``end``
.. seealso::
:ref:`Series.str.rfind <pandas.Series.str.rfind>`
Return highest indexes in each strings.
Intel Scalable Dataframe Compiler Developer Guide
*************************************************
Pandas Series method :meth:`pandas.core.strings.StringMethods.find()` implementation.
Note: Unicode type of list elements are supported only. Numpy.NaN is not supported as elements.
.. only:: developer
Test: python -m sdc.runtests -k sdc.tests.test_series.TestSeries.test_series_find
Parameters
----------
self: :class:`pandas.core.strings.StringMethods`
input arg
sub: :obj:`str`
Substring being searched
start: :obj:`int`
Left edge index
*unsupported*
end: :obj:`int`
Right edge index
*unsupported*
Returns
-------
:obj:`pandas.Series`
returns :obj:`pandas.Series` object
"""
ty_checker = TypeChecker('Method find().')
ty_checker.check(self, StringMethodsType)
if not isinstance(sub, (StringLiteral, UnicodeType)):
ty_checker.raise_exc(sub, 'str', 'sub')
accepted_types = (Integer, NoneType, Omitted)
if not isinstance(start, accepted_types) and start != 0:
ty_checker.raise_exc(start, 'None, int', 'start')
if not isinstance(end, accepted_types) and end is not None:
ty_checker.raise_exc(end, 'None, int', 'end')
def hpat_pandas_stringmethods_find_impl(self, sub, start=0, end=None):
if start != 0:
raise ValueError('Method find(). The object start\n expected: 0')
if end is not None:
raise ValueError('Method find(). The object end\n expected: None')
item_count = len(self._data)
result = numpy.empty(item_count, numba.types.int64)
for idx, item in enumerate(self._data._data):
result[idx] = item.find(sub)
return pandas.Series(result, self._data._index, name=self._data._name)
return hpat_pandas_stringmethods_find_impl
@sdc_overload_method(StringMethodsType, 'isupper')
def hpat_pandas_stringmethods_isupper(self):
ty_checker = TypeChecker('Method isupper().')
ty_checker.check(self, StringMethodsType)
def hpat_pandas_stringmethods_isupper_impl(self):
item_count = len(self._data)
result = numpy.empty(item_count, numba.types.boolean)
for idx, item in enumerate(self._data._data):
result[idx] = item.isupper()
return pandas.Series(result, self._data._index, name=self._data._name)
return hpat_pandas_stringmethods_isupper_impl
@sdc_overload_method(StringMethodsType, 'len')
def hpat_pandas_stringmethods_len(self):
"""
Intel Scalable Dataframe Compiler User Guide
********************************************
Pandas API: pandas.Series.str.len
Limitations
-----------
Series elements are expected to be Unicode strings. Elements cannot be NaN.
Examples
--------
.. literalinclude:: ../../../examples/series/str/series_str_len.py
:language: python
:lines: 27-
:caption: Compute the length of each element in the Series
:name: ex_series_str_len
.. command-output:: python ./series/str/series_str_len.py
:cwd: ../../../examples
.. seealso::
`str.len`
Python built-in function returning the length of an object.
:ref:`Series.size <pandas.Series.size>`
Returns the length of the Series.
Intel Scalable Dataframe Compiler Developer Guide
*************************************************
Pandas Series method :meth:`pandas.core.strings.StringMethods.len()` implementation.
Note: Unicode type of list elements are supported only. Numpy.NaN is not supported as elements.
.. only:: developer
Test: python -m sdc.runtests sdc.tests.test_series.TestSeries.test_series_str_len1
Parameters
----------
self: :class:`pandas.core.strings.StringMethods`
input arg
Returns
-------
:obj:`pandas.Series`
returns :obj:`pandas.Series` object
"""
ty_checker = TypeChecker('Method len().')
ty_checker.check(self, StringMethodsType)
def hpat_pandas_stringmethods_len_impl(self):
item_count = len(self._data)
result = numpy.empty(item_count, numba.types.int64)
for idx, item in enumerate(self._data._data):
result[idx] = len(item)
return pandas.Series(result, self._data._index, name=self._data._name)
return hpat_pandas_stringmethods_len_impl
@sdc_overload_method(StringMethodsType, 'ljust')
def hpat_pandas_stringmethods_ljust(self, width, fillchar=' '):
"""
Intel Scalable Dataframe Compiler User Guide
********************************************
Pandas API: pandas.Series.str.ljust
Limitations
-----------
Series elements are expected to be Unicode strings. Elements cannot be NaN.
Examples
--------
.. literalinclude:: ../../../examples/series/str/series_str_ljust.py
:language: python
:lines: 27-
:caption: Filling right side of strings in the Series with an additional character
:name: ex_series_str_ljust
.. command-output:: python ./series/str/series_str_ljust.py
:cwd: ../../../examples
.. todo:: Add support of 32-bit Unicode for `str.ljust()`
Intel Scalable Dataframe Compiler Developer Guide
*************************************************
Pandas Series method :meth:`pandas.core.strings.StringMethods.ljust()` implementation.
Note: Unicode type of list elements are supported only. Numpy.NaN is not supported as elements.
.. only:: developer
Test: python -m sdc.runtests -k sdc.tests.test_series.TestSeries.test_series_ljust
Parameters
----------
self: :class:`pandas.core.strings.StringMethods`
input arg
width: :obj:`int`
Minimum width of resulting string
fillchar: :obj:`str`
Additional character for filling, default is whitespace
Returns
-------
:obj:`pandas.Series`
returns :obj:`pandas.Series` object
"""
ty_checker = TypeChecker('Method ljust().')
ty_checker.check(self, StringMethodsType)
if not isinstance(width, Integer):
ty_checker.raise_exc(width, 'int', 'width')
accepted_types = (Omitted, StringLiteral, UnicodeType)
if not isinstance(fillchar, accepted_types) and fillchar != ' ':
ty_checker.raise_exc(fillchar, 'str', 'fillchar')
def hpat_pandas_stringmethods_ljust_impl(self, width, fillchar=' '):
item_count = len(self._data)
result = [''] * item_count
for idx, item in enumerate(self._data._data):
result[idx] = item.ljust(width, fillchar)
return pandas.Series(result, self._data._index, name=self._data._name)
return hpat_pandas_stringmethods_ljust_impl
@sdc_overload_method(StringMethodsType, 'rjust')
def hpat_pandas_stringmethods_rjust(self, width, fillchar=' '):
"""
Intel Scalable Dataframe Compiler User Guide
********************************************
Pandas API: pandas.Series.str.rjust
Limitations
-----------
Series elements are expected to be Unicode strings. Elements cannot be NaN.
Examples
--------
.. literalinclude:: ../../../examples/series/str/series_str_rjust.py
:language: python
:lines: 27-
:caption: Filling left side of strings in the Series with an additional character
:name: ex_series_str_rjust
.. command-output:: python ./series/str/series_str_rjust.py
:cwd: ../../../examples
.. todo:: Add support of 32-bit Unicode for `str.rjust()`
Intel Scalable Dataframe Compiler Developer Guide
*************************************************
Pandas Series method :meth:`pandas.core.strings.StringMethods.rjust()` implementation.
Note: Unicode type of list elements are supported only. Numpy.NaN is not supported as elements.
.. only:: developer
Test: python -m sdc.runtests -k sdc.tests.test_series.TestSeries.test_series_rjust
Parameters
----------
self: :class:`pandas.core.strings.StringMethods`
input arg
width: :obj:`int`
Minimum width of resulting string
fillchar: :obj:`str`
Additional character for filling, default is whitespace
Returns
-------
:obj:`pandas.Series`
returns :obj:`pandas.Series` object
"""
ty_checker = TypeChecker('Method rjust().')
ty_checker.check(self, StringMethodsType)
if not isinstance(width, Integer):
ty_checker.raise_exc(width, 'int', 'width')
accepted_types = (Omitted, StringLiteral, UnicodeType)
if not isinstance(fillchar, accepted_types) and fillchar != ' ':
ty_checker.raise_exc(fillchar, 'str', 'fillchar')
def hpat_pandas_stringmethods_rjust_impl(self, width, fillchar=' '):
item_count = len(self._data)
result = [''] * item_count
for idx, item in enumerate(self._data._data):
result[idx] = item.rjust(width, fillchar)
return pandas.Series(result, self._data._index, name=self._data._name)
return hpat_pandas_stringmethods_rjust_impl
@sdc_overload_method(StringMethodsType, 'startswith')
def hpat_pandas_stringmethods_startswith(self, pat, na=None):
"""
Intel Scalable Dataframe Compiler User Guide
********************************************
Pandas API: pandas.Series.str.startswith
Limitations
-----------
Series elements are expected to be Unicode strings. Elements cannot be NaN.
Examples
--------
.. literalinclude:: ../../../examples/series/str/series_str_startswith.py
:language: python
:lines: 27-
:caption: Test if the start of each string element matches a string
:name: ex_series_str_startswith
.. command-output:: python ./series/str/series_str_startswith.py
:cwd: ../../../examples
.. todo::
- Add support of matching the start of each string by a pattern
- Add support of parameter ``na``
.. seealso::
`str.startswith <https://docs.python.org/3/library/stdtypes.html#str.startswith>`_
Python standard library string method.
:ref:`Series.str.endswith <pandas.Series.str.endswith>`
Same as startswith, but tests the end of string.
:ref:`Series.str.contains <pandas.Series.str.contains>`
Tests if string element contains a pattern.
Intel Scalable Dataframe Compiler Developer Guide
*************************************************
Pandas Series method :meth:`pandas.core.strings.StringMethods.startswith()` implementation.
Note: Unicode type of list elements are supported only. Numpy.NaN is not supported as elements.
.. only:: developer
Test: python -m sdc.runtests -k sdc.tests.test_series.TestSeries.test_series_startswith
Parameters
----------
self: :class:`pandas.core.strings.StringMethods`
input arg
pat: :obj:`str`
Character sequence
na: :obj:`bool`
Object shown if element tested is not a string
*unsupported*
Returns
-------
:obj:`pandas.Series`
returns :obj:`pandas.Series` object
"""
ty_checker = TypeChecker('Method startswith().')
ty_checker.check(self, StringMethodsType)
if not isinstance(pat, (StringLiteral, UnicodeType)):
ty_checker.raise_exc(pat, 'str', 'pat')
if not isinstance(na, (Boolean, NoneType, Omitted)) and na is not None:
ty_checker.raise_exc(na, 'bool', 'na')
def hpat_pandas_stringmethods_startswith_impl(self, pat, na=None):
if na is not None:
msg = 'Method startswith(). The object na\n expected: None'
raise ValueError(msg)
item_startswith = len(self._data)
result = numpy.empty(item_startswith, numba.types.boolean)
for idx, item in enumerate(self._data._data):
result[idx] = item.startswith(pat)
return pandas.Series(result, self._data._index, name=self._data._name)
return hpat_pandas_stringmethods_startswith_impl
@sdc_overload_method(StringMethodsType, 'zfill')
def hpat_pandas_stringmethods_zfill(self, width):
"""
Intel Scalable Dataframe Compiler User Guide
********************************************
Pandas API: pandas.Series.str.zfill
Limitations
-----------
Series elements are expected to be Unicode strings. Elements cannot be NaN.
Examples
--------
.. literalinclude:: ../../../examples/series/str/series_str_zfill.py
:language: python
:lines: 27-
:caption: Pad strings in the Series by prepending '0' characters
:name: ex_series_str_zfill
.. command-output:: python ./series/str/series_str_zfill.py
:cwd: ../../../examples
.. todo:: Add support of 32-bit Unicode for `str.zfill()`
.. seealso::
:ref:`Series.str.rjust <pandas.Series.str.rjust>`
Fills the left side of strings with an arbitrary character.
:ref:`Series.str.ljust <pandas.Series.str.ljust>`
Fills the right side of strings with an arbitrary character.
:ref:`Series.str.pad <pandas.Series.str.pad>`
Fills the specified sides of strings with an arbitrary character.
:ref:`Series.str.center <pandas.Series.str.center>`
Fills boths sides of strings with an arbitrary character.
Intel Scalable Dataframe Compiler Developer Guide
*************************************************
Pandas Series method :meth:`pandas.core.strings.StringMethods.zfill()` implementation.
Note: Unicode type of list elements are supported only. Numpy.NaN is not supported as elements.
.. only:: developer
Test: python -m sdc.runtests -k sdc.tests.test_series.TestSeries.test_series_zfill
Parameters
----------
self: :class:`pandas.core.strings.StringMethods`
input arg
width: :obj:`int`
Minimum width of resulting string
Returns
-------
:obj:`pandas.Series`
returns :obj:`pandas.Series` object
"""
ty_checker = TypeChecker('Method zfill().')
ty_checker.check(self, StringMethodsType)
if not isinstance(width, Integer):
ty_checker.raise_exc(width, 'int', 'width')
def hpat_pandas_stringmethods_zfill_impl(self, width):
item_count = len(self._data)
result = [''] * item_count
for idx, item in enumerate(self._data._data):
result[idx] = item.zfill(width)
return pandas.Series(result, self._data._index, name=self._data._name)
return hpat_pandas_stringmethods_zfill_impl
def _hpat_pandas_stringmethods_autogen(method_name):
""""
The function generates a function for 'method_name' from source text that is created on the fly.
"""
params = ""
params_call = ""
# get function parameters by name
params_dict = _hpat_pandas_stringmethods_functions_params.get(method_name)
if params_dict is not None:
params = params_dict
if len(params) > 0:
"""
Translate parameters string for method
For example:
parameters for split(): ', pat=None, n=-1, expand=False'
translate into: 'pat, n, expand'
"""
params_call_splitted = params.split(',')
params_call_list = []
for item in params_call_splitted:
params_call_list.append(item.split("=")[0])
params_call = ",".join(params_call_list)
if len(params_call) > 1:
params_call = params_call[2:]
sourcecode = _hpat_pandas_stringmethods_functions_template.format(methodname=method_name,
methodparams=params,
methodparams_call=params_call)
exec(sourcecode, _hpat_pandas_stringmethods_autogen_global_dict)
global_dict_name = 'hpat_pandas_stringmethods_{methodname}'.format(methodname=method_name)
return _hpat_pandas_stringmethods_autogen_global_dict[global_dict_name]
sdc_pandas_series_str_docstring_template = """
Intel Scalable Dataframe Compiler User Guide
********************************************
Pandas API: pandas.Series.str.{method_name}
Limitations
-----------
Series elements are expected to be Unicode strings. Elements cannot be NaN.
Examples
--------
.. literalinclude:: ../../../examples/series/str/series_str_{method_name}.py
:language: python
:lines: 27-
:caption: {caption}
:name: ex_series_str_{method_name}
.. command-output:: python ./series/str/series_str_{method_name}.py
:cwd: ../../../examples
.. seealso::
{seealso}
Intel Scalable Dataframe Compiler Developer Guide
*************************************************
Pandas Series method :meth:`pandas.core.strings.StringMethods.{method_name}()` implementation.
Note: Unicode type of list elements are supported only. Numpy.NaN is not supported as elements.
.. only:: developer
Test: python -m sdc.runtests sdc.tests.test_series.TestSeries.test_series_{method_name}_str
Parameters
----------
self: :class:`pandas.core.strings.StringMethods`
input arg
Returns
-------
:obj:`pandas.Series`
returns :obj:`pandas.Series` object
"""
@sdc_overload_method(StringMethodsType, 'istitle')
def hpat_pandas_stringmethods_istitle(self):
ty_checker = TypeChecker('Method istitle().')
ty_checker.check(self, StringMethodsType)
def hpat_pandas_stringmethods_istitle_impl(self):
item_count = len(self._data)
result = numpy.empty(item_count, numba.types.boolean)
for idx, item in enumerate(self._data._data):
result[idx] = item.istitle()
return pandas.Series(result, self._data._index, name=self._data._name)
return hpat_pandas_stringmethods_istitle_impl
@sdc_overload_method(StringMethodsType, 'isspace')
def hpat_pandas_stringmethods_isspace(self):
ty_checker = TypeChecker('Method isspace().')
ty_checker.check(self, StringMethodsType)
def hpat_pandas_stringmethods_isspace_impl(self):
item_count = len(self._data)
result = numpy.empty(item_count, numba.types.boolean)
for idx, item in enumerate(self._data._data):
result[idx] = item.isspace()
return pandas.Series(result, self._data._index, name=self._data._name)
return hpat_pandas_stringmethods_isspace_impl
@sdc_overload_method(StringMethodsType, 'isalpha')
def hpat_pandas_stringmethods_isalpha(self):
ty_checker = TypeChecker('Method isalpha().')
ty_checker.check(self, StringMethodsType)
def hpat_pandas_stringmethods_isalpha_impl(self):
item_count = len(self._data)
result = numpy.empty(item_count, numba.types.boolean)
for idx, item in enumerate(self._data._data):
result[idx] = item.isalpha()
return pandas.Series(result, self._data._index, name=self._data._name)
return hpat_pandas_stringmethods_isalpha_impl
@sdc_overload_method(StringMethodsType, 'islower')
def hpat_pandas_stringmethods_islower(self):
ty_checker = TypeChecker('Method islower().')
ty_checker.check(self, StringMethodsType)
def hpat_pandas_stringmethods_islower_impl(self):
item_count = len(self._data)
result = numpy.empty(item_count, numba.types.boolean)
for idx, item in enumerate(self._data._data):
result[idx] = item.islower()
return pandas.Series(result, self._data._index, name=self._data._name)
return hpat_pandas_stringmethods_islower_impl
@sdc_overload_method(StringMethodsType, 'isalnum')
def hpat_pandas_stringmethods_isalnum(self):
ty_checker = TypeChecker('Method isalnum().')
ty_checker.check(self, StringMethodsType)
def hpat_pandas_stringmethods_isalnum_impl(self):
item_count = len(self._data)
result = numpy.empty(item_count, numba.types.boolean)
for idx, item in enumerate(self._data._data):
result[idx] = item.isalnum()
return pandas.Series(result, self._data._index, name=self._data._name)
return hpat_pandas_stringmethods_isalnum_impl
@sdc_overload_method(StringMethodsType, 'isnumeric')
def hpat_pandas_stringmethods_isnumeric(self):
ty_checker = TypeChecker('Method isnumeric().')
ty_checker.check(self, StringMethodsType)
def hpat_pandas_stringmethods_isnumeric_impl(self):
item_count = len(self._data)
result = numpy.empty(item_count, numba.types.boolean)
for idx, item in enumerate(self._data._data):
result[idx] = item.isnumeric()
return pandas.Series(result, self._data._index, name=self._data._name)
return hpat_pandas_stringmethods_isnumeric_impl
@sdc_overload_method(StringMethodsType, 'isdigit')
def hpat_pandas_stringmethods_isdigit(self):
ty_checker = TypeChecker('Method isdigit().')
ty_checker.check(self, StringMethodsType)
def hpat_pandas_stringmethods_isdigit_impl(self):
item_count = len(self._data)
result = numpy.empty(item_count, numba.types.boolean)
for idx, item in enumerate(self._data._data):
result[idx] = item.isdigit()
return pandas.Series(result, self._data._index, name=self._data._name)
return hpat_pandas_stringmethods_isdigit_impl
@sdc_overload_method(StringMethodsType, 'isdecimal')
def hpat_pandas_stringmethods_isdecimal(self):
ty_checker = TypeChecker('Method isdecimal().')
ty_checker.check(self, StringMethodsType)
def hpat_pandas_stringmethods_isdecimal_impl(self):
item_count = len(self._data)
result = numpy.empty(item_count, numba.types.boolean)
for idx, item in enumerate(self._data._data):
result[idx] = item.isdecimal()
return pandas.Series(result, self._data._index, name=self._data._name)
return hpat_pandas_stringmethods_isdecimal_impl
@sdc_overload_method(StringMethodsType, 'capitalize')
def hpat_pandas_stringmethods_capitalize(self):
ty_checker = TypeChecker('Method capitalize().')
ty_checker.check(self, StringMethodsType)
def hpat_pandas_stringmethods_capitalize_impl(self):
mask = get_nan_mask(self._data._data)
item_count = len(self._data)
res_list = [''] * item_count
for idx in numba.prange(item_count):
res_list[idx] = self._data._data[idx].capitalize()
str_arr = create_str_arr_from_list(res_list)
result = str_arr_set_na_by_mask(str_arr, mask)
return pandas.Series(result, self._data._index, name=self._data._name)
return hpat_pandas_stringmethods_capitalize_impl
@sdc_overload_method(StringMethodsType, 'title')
def hpat_pandas_stringmethods_title(self):
ty_checker = TypeChecker('Method title().')
ty_checker.check(self, StringMethodsType)
def hpat_pandas_stringmethods_title_impl(self):
mask = get_nan_mask(self._data._data)
item_count = len(self._data)
res_list = [''] * item_count
for idx in numba.prange(item_count):
res_list[idx] = self._data._data[idx].title()
str_arr = create_str_arr_from_list(res_list)
result = str_arr_set_na_by_mask(str_arr, mask)
return pandas.Series(result, self._data._index, name=self._data._name)
return hpat_pandas_stringmethods_title_impl
@sdc_overload_method(StringMethodsType, 'swapcase')
def hpat_pandas_stringmethods_swapcase(self):
ty_checker = TypeChecker('Method swapcase().')
ty_checker.check(self, StringMethodsType)
def hpat_pandas_stringmethods_swapcase_impl(self):
mask = get_nan_mask(self._data._data)
item_count = len(self._data)
res_list = [''] * item_count
for idx in numba.prange(item_count):
res_list[idx] = self._data._data[idx].swapcase()
str_arr = create_str_arr_from_list(res_list)
result = str_arr_set_na_by_mask(str_arr, mask)
return pandas.Series(result, self._data._index, name=self._data._name)
return hpat_pandas_stringmethods_swapcase_impl
@sdc_overload_method(StringMethodsType, 'casefold')
def hpat_pandas_stringmethods_casefold(self):
ty_checker = TypeChecker('Method casefold().')
ty_checker.check(self, StringMethodsType)
def hpat_pandas_stringmethods_casefold_impl(self):
mask = get_nan_mask(self._data._data)
item_count = len(self._data)
res_list = [''] * item_count
for idx in numba.prange(item_count):
res_list[idx] = self._data._data[idx].casefold()
str_arr = create_str_arr_from_list(res_list)
result = str_arr_set_na_by_mask(str_arr, mask)
return pandas.Series(result, self._data._index, name=self._data._name)
return hpat_pandas_stringmethods_casefold_impl
seealso_check_methods = """
:ref:`Series.str.isalpha <pandas.Series.str.isalpha>`
Check whether all characters are alphabetic.
:ref:`Series.str.isnumeric <pandas.Series.str.isnumeric>`
Check whether all characters are numeric.
:ref:`Series.str.isalnum <pandas.Series.str.isalnum>`
Check whether all characters are alphanumeric.
:ref:`Series.str.isdigit <pandas.Series.str.isdigit>`
Check whether all characters are digits.
:ref:`Series.str.isdecimal <pandas.Series.str.isdecimal>`
Check whether all characters are decimal.
:ref:`Series.str.isspace <pandas.Series.str.isspace>`
Check whether all characters are whitespace.
:ref:`Series.str.islower <pandas.Series.str.islower>`
Check whether all characters are lowercase.
:ref:`Series.str.isupper <pandas.Series.str.isupper>`
Check whether all characters are uppercase.
:ref:`Series.str.istitle <pandas.Series.str.istitle>`
Check whether all characters are titlecase.
"""
seealso_transform_methods = """
:ref:`Series.str.lower <pandas.Series.str.lower>`
Converts all characters to lowercase.
:ref:`Series.str.upper <pandas.Series.str.upper>`
Converts all characters to uppercase.
:ref:`Series.str.title <pandas.Series.str.title>`
Converts first character of each word to uppercase and remaining to lowercase.
:ref:`Series.str.capitalize <pandas.Series.str.capitalize>`
Converts first character to uppercase and remaining to lowercase.
:ref:`Series.str.swapcase <pandas.Series.str.swapcase>`
Converts uppercase to lowercase and lowercase to uppercase.
:ref:`Series.str.casefold <pandas.Series.str.casefold>`
Removes all case distinctions in the string.
"""
stringmethods_funcs = {
'istitle': {'method': hpat_pandas_stringmethods_istitle,
'caption': 'Check if each word start with an upper case letter',
'seealso': seealso_check_methods},
'isspace': {'method': hpat_pandas_stringmethods_isspace,
'caption': 'Check if all the characters in the text are whitespaces',
'seealso': seealso_check_methods},
'isalpha': {'method': hpat_pandas_stringmethods_isalpha,
'caption': 'Check whether all characters in each string are alphabetic',
'seealso': seealso_check_methods},
'islower': {'method': hpat_pandas_stringmethods_islower,
'caption': 'Check if all the characters in the text are alphanumeric',
'seealso': seealso_check_methods},
'isalnum': {'method': hpat_pandas_stringmethods_isalnum,
'caption': 'Check if all the characters in the text are alphanumeric',
'seealso': seealso_check_methods},
'isnumeric': {'method': hpat_pandas_stringmethods_isnumeric,
'caption': 'Check whether all characters in each string are numeric.',
'seealso': seealso_check_methods},
'isdigit': {'method': hpat_pandas_stringmethods_isdigit,
'caption': 'Check whether all characters in each string in the Series/Index are digits.',
'seealso': seealso_check_methods},
'isdecimal': {'method': hpat_pandas_stringmethods_isdecimal,
'caption': 'Check whether all characters in each string are decimal.',
'seealso': seealso_check_methods},
'isupper': {'method': hpat_pandas_stringmethods_isupper,
'caption': 'Check whether all characters in each string are uppercase.',
'seealso': seealso_check_methods},
'capitalize': {'method': hpat_pandas_stringmethods_capitalize,
'caption': 'Convert strings in the Series/Index to be capitalized.',
'seealso': seealso_transform_methods},
'title': {'method': hpat_pandas_stringmethods_title,
'caption': 'Convert strings in the Series/Index to titlecase.',
'seealso': seealso_transform_methods},
'swapcase': {'method': hpat_pandas_stringmethods_swapcase,
'caption': 'Convert strings in the Series/Index to be swapcased.',
'seealso': seealso_transform_methods},
'casefold': {'method': hpat_pandas_stringmethods_casefold,
'caption': 'Convert strings in the Series/Index to be casefolded.',
'seealso': seealso_transform_methods},
}
for name, data in stringmethods_funcs.items():
data['method'].__doc__ = sdc_pandas_series_str_docstring_template.format(**{'method_name': name,
'caption': data['caption'],
'seealso': data['seealso']})
# _hpat_pandas_stringmethods_autogen_methods = sorted(dir(numba.types.misc.UnicodeType.__getattribute__.__qualname__))
_hpat_pandas_stringmethods_autogen_methods = ['upper', 'lower', 'lstrip', 'rstrip', 'strip']
"""
This is the list of function which are autogenerated to be used from Numba directly.
"""
_hpat_pandas_stringmethods_autogen_exceptions = ['split', 'get', 'replace']
for method_name in _hpat_pandas_stringmethods_autogen_methods:
if not (method_name.startswith('__') or method_name in _hpat_pandas_stringmethods_autogen_exceptions):
sdc_overload_method(StringMethodsType, method_name)(_hpat_pandas_stringmethods_autogen(method_name))
|
bsd-2-clause
|
abimannans/scikit-learn
|
examples/datasets/plot_iris_dataset.py
|
283
|
1928
|
#!/usr/bin/python
# -*- coding: utf-8 -*-
"""
=========================================================
The Iris Dataset
=========================================================
This data sets consists of 3 different types of irises'
(Setosa, Versicolour, and Virginica) petal and sepal
length, stored in a 150x4 numpy.ndarray
The rows being the samples and the columns being:
Sepal Length, Sepal Width, Petal Length and Petal Width.
The below plot uses the first two features.
See `here <http://en.wikipedia.org/wiki/Iris_flower_data_set>`_ for more
information on this dataset.
"""
print(__doc__)
# Code source: Gaël Varoquaux
# Modified for documentation by Jaques Grobler
# License: BSD 3 clause
import matplotlib.pyplot as plt
from mpl_toolkits.mplot3d import Axes3D
from sklearn import datasets
from sklearn.decomposition import PCA
# import some data to play with
iris = datasets.load_iris()
X = iris.data[:, :2] # we only take the first two features.
Y = iris.target
x_min, x_max = X[:, 0].min() - .5, X[:, 0].max() + .5
y_min, y_max = X[:, 1].min() - .5, X[:, 1].max() + .5
plt.figure(2, figsize=(8, 6))
plt.clf()
# Plot the training points
plt.scatter(X[:, 0], X[:, 1], c=Y, cmap=plt.cm.Paired)
plt.xlabel('Sepal length')
plt.ylabel('Sepal width')
plt.xlim(x_min, x_max)
plt.ylim(y_min, y_max)
plt.xticks(())
plt.yticks(())
# To getter a better understanding of interaction of the dimensions
# plot the first three PCA dimensions
fig = plt.figure(1, figsize=(8, 6))
ax = Axes3D(fig, elev=-150, azim=110)
X_reduced = PCA(n_components=3).fit_transform(iris.data)
ax.scatter(X_reduced[:, 0], X_reduced[:, 1], X_reduced[:, 2], c=Y,
cmap=plt.cm.Paired)
ax.set_title("First three PCA directions")
ax.set_xlabel("1st eigenvector")
ax.w_xaxis.set_ticklabels([])
ax.set_ylabel("2nd eigenvector")
ax.w_yaxis.set_ticklabels([])
ax.set_zlabel("3rd eigenvector")
ax.w_zaxis.set_ticklabels([])
plt.show()
|
bsd-3-clause
|
mdeff/ntds_2017
|
projects/reports/arab_springs/lib/clustering.py
|
1
|
1319
|
import pickle
import pandas as pd
import json
import numpy as np
import matplotlib.pyplot as plt
from scipy import spatial, sparse
import scipy.sparse.linalg
import scipy
from sklearn.cluster import KMeans
from pygsp import graphs, filters, plotting
import operator
import io
from lib import models, graph, coarsening, utils
get_ipython().magic('matplotlib inline')
def take_eigenvectors(laplacian, K=5):
eigenvalues, eigenvectors = sparse.linalg.eigsh(laplacian, k=K, which = 'SA')
return eigenvalues, eigenvectors
def do_kmeans(eigenvectors, K=5):
#kmeans to find clusters
kmeans = KMeans(n_clusters=K, random_state=0).fit(eigenvectors)
return kmeans.labels_
def label_data(df, kmeans_labels, K=5, NUMBER = 40):
counts = [dict() for x in range(K)]
for i, label in enumerate(kmeans_labels):
words = df.loc[i].Tokens
for w in words:
try:
counts[label][w]+=1
except: counts[label][w]=1
total = {}
for k in range(K):
sorted_words = sorted(counts[k], key=operator.itemgetter(1), reverse=True)[:NUMBER]
for w in sorted_words:
try:
total[w]+=1
except: total[w]=1
labels = [[] for i in range(K)]
for k in range(K):
sorted_words = sorted(counts[k], key=operator.itemgetter(1), reverse=True)[:NUMBER]
for w in sorted_words:
if total[w]==1: labels[k].append(w)
return labels
|
mit
|
bubae/gazeAssistRecognize
|
train_model.py
|
1
|
5633
|
import init_path
import rcnnModule
from sklearn import svm
import numpy as np
import os, sys, cv2
import csv
from sklearn.multiclass import OneVsRestClassifier
from sklearn.svm import LinearSVC
from utils.timer import Timer
from sklearn.externals import joblib
CLASSES = ('__background__',
'aeroplane', 'bicycle', 'bird', 'boat',
'bottle', 'bus', 'car', 'cat', 'chair',
'cow', 'diningtable', 'dog', 'horse',
'motorbike', 'person', 'pottedplant',
'sheep', 'sofa', 'train', 'tvmonitor')
NETS = {'vgg_cnn_m_1024': ('VGG_CNN_M_1024', 'vgg_cnn_m_1024_fast_rcnn_iter_40000.caffemodel'),
'caffenet': ('CaffeNet', 'caffenet_fast_rcnn_iter_40000.caffemodel'),
'zf': ('ZF', 'ZF_faster_rcnn_final.caffemodel')}
def init_train():
print "Init Train..."
setting = {}
setting['NET'] = 'zf'
setting['ROOT_DIR'] = os.getcwd()
setting['DATA_DIR'] = os.path.join(setting['ROOT_DIR'], 'data')
setting['IMAGE_DIR'] = os.path.join(setting['DATA_DIR'], 'imageNet', 'images')
setting['TEST_DIR'] = os.path.join(setting['DATA_DIR'], 'Test')
setting['DST_DIR'] = os.path.join(setting['DATA_DIR'], 'result')
setting['DST_MODEL_DIR'] = os.path.join(setting['DST_DIR'], 'imageNet', setting['NET'])
setting['featureDstDir'] = os.path.join(setting['DST_MODEL_DIR'], "FEATURE")
categories = sorted([f for f in os.listdir(setting['IMAGE_DIR'])])
categoryDirPath = [os.path.join(setting['IMAGE_DIR'], f) for f in categories]
cid2name = categories
cid2path = categoryDirPath
iid2path = np.array([])
iid2name = np.array([])
iid2cid = np.array([])
cNum = len(cid2path)
cid = 0
for dirPath in categoryDirPath:
# dirPath = cid2path[i]
imList = np.array(sorted([f for f in os.listdir(dirPath)]))
imPath = np.array([os.path.join(dirPath, im) for im in imList])
iid2name = np.append(iid2name, imList)
iid2path = np.append(iid2path, imPath)
iid2cid = np.append(iid2cid, np.ones(len(imPath))*cid)
cid = cid + 1
iid2cid = iid2cid.astype(int)
cid2name = np.array(cid2name)
cid2path = np.array(cid2path)
return setting, cid2name, cid2path, iid2path, iid2name, iid2cid
def train_SVM(setting, y):
print "train SVM"
# SVM Training
# SVM options
# svm_kernel = 'rbf';
# svm_C = 1.0;
# svm_loss = 'squared_hinge'
# svm_penalty = 'l2'
# svm_multi_class = 'ovr'
# svm_random_state = 0
filePath = os.path.join(setting['DST_MODEL_DIR'], "svm_trained.pkl")
try:
clf = joblib.load(filePath)
print "using trained model"
except:
print "building svm model"
X = loadDesc(setting)
X = X.astype('float')
timer = Timer()
timer.tic()
clf = OneVsRestClassifier(LinearSVC(random_state=0)).fit(X, y)
timer.toc()
print timer.total_time
joblib.dump(clf, filePath)
# TEST
# print clf.decision_function(X[0])
# print clf.predict(X[5000])
return clf
def loadDesc(setting):
print "Load Desc..."
timer = Timer()
featureDstDir = setting['featureDstDir']
sortedList = sorted([ f for f in os.listdir(featureDstDir)])
descPath = np.array([ os.path.join(featureDstDir, x) for x in sortedList])
X = []
cnt = 0
size = len(descPath)
timer.tic()
for path in descPath:
feature = readCSV(path)
X.append(feature)
print "%d / %d file loaded" % (cnt, size)
cnt = cnt + 1
timer.toc()
# print timer.total_time
X = np.array(X)
X = np.reshape(X, X.shape[0:2])
return X
def readCSV(path):
rlist = []
with open(path, 'rb') as f:
reader = csv.reader(f, delimiter=' ')
for row in reader:
rlist.append(row)
return np.array(rlist)
def writeCSV(data, path):
with open(path, 'wb') as fout:
writer = csv.writer(fout, delimiter=',')
for d in data:
writer.writerow([d])
def featureExtraction(setting, cid2name, cid2path, iid2path, iid2name, iid2cid, rcnnModel):
print "Feature Extraction.."
featureDstDir = setting['featureDstDir']
if not os.path.exists(featureDstDir):
os.makedirs(featureDstDir)
numIm = len(iid2path)
descExist = np.zeros(numIm)
fList = np.array([ int(x[0:-4]) for x in os.listdir(featureDstDir) ])
for i in fList:
descExist[i] = 1
nonDescList = np.where(descExist == 0)[0]
numDesc = len(nonDescList)
if numDesc==0:
print "No image to desc."
cnt = 0
for i in nonDescList:
print i, cid2name[iid2cid[i]], iid2name[i],": %0.2f percent finished" % (cnt*100.0/numDesc)
im = cv2.imread(iid2path[i])
[features, bbox] = rcnnModel.getFeatureIm(im)
feature = np.mean(features, axis=0)
fileName = "%06d.csv" % i
filePath = os.path.join(featureDstDir, fileName)
writeCSV(feature, filePath)
cnt = cnt+1
def TestModel(setting, rcnnModel, clf):
print "Test trained Model"
testDir = setting['TEST_DIR']
sortedList = sorted([ f for f in os.listdir(testDir)])
imPath = np.array([ os.path.join(testDir, x) for x in sortedList])
for path in imPath:
im = cv2.imread(path)
[features, bbox] = rcnnModel.getFeatureIm(im)
feature = np.mean(features, axis=0)
predict_result = clf.predict(features)
print clf.predict(feature)
print len(np.where(predict_result==0)[0])
# print imPath
def main():
[setting, cid2name, cid2path, iid2path, iid2name, iid2cid] = init_train();
print "rcnnModel loading..."
rcnnModel = rcnnModule.RcnnObject('zf', False);
featureExtraction(setting, cid2name, cid2path, iid2path, iid2name, iid2cid, rcnnModel)
clf = train_SVM(setting, iid2cid)
TestModel(setting, rcnnModel, clf)
if __name__ == '__main__':
main()
|
mit
|
robbymeals/scikit-learn
|
sklearn/ensemble/partial_dependence.py
|
251
|
15097
|
"""Partial dependence plots for tree ensembles. """
# Authors: Peter Prettenhofer
# License: BSD 3 clause
from itertools import count
import numbers
import numpy as np
from scipy.stats.mstats import mquantiles
from ..utils.extmath import cartesian
from ..externals.joblib import Parallel, delayed
from ..externals import six
from ..externals.six.moves import map, range, zip
from ..utils import check_array
from ..tree._tree import DTYPE
from ._gradient_boosting import _partial_dependence_tree
from .gradient_boosting import BaseGradientBoosting
def _grid_from_X(X, percentiles=(0.05, 0.95), grid_resolution=100):
"""Generate a grid of points based on the ``percentiles of ``X``.
The grid is generated by placing ``grid_resolution`` equally
spaced points between the ``percentiles`` of each column
of ``X``.
Parameters
----------
X : ndarray
The data
percentiles : tuple of floats
The percentiles which are used to construct the extreme
values of the grid axes.
grid_resolution : int
The number of equally spaced points that are placed
on the grid.
Returns
-------
grid : ndarray
All data points on the grid; ``grid.shape[1] == X.shape[1]``
and ``grid.shape[0] == grid_resolution * X.shape[1]``.
axes : seq of ndarray
The axes with which the grid has been created.
"""
if len(percentiles) != 2:
raise ValueError('percentile must be tuple of len 2')
if not all(0. <= x <= 1. for x in percentiles):
raise ValueError('percentile values must be in [0, 1]')
axes = []
for col in range(X.shape[1]):
uniques = np.unique(X[:, col])
if uniques.shape[0] < grid_resolution:
# feature has low resolution use unique vals
axis = uniques
else:
emp_percentiles = mquantiles(X, prob=percentiles, axis=0)
# create axis based on percentiles and grid resolution
axis = np.linspace(emp_percentiles[0, col],
emp_percentiles[1, col],
num=grid_resolution, endpoint=True)
axes.append(axis)
return cartesian(axes), axes
def partial_dependence(gbrt, target_variables, grid=None, X=None,
percentiles=(0.05, 0.95), grid_resolution=100):
"""Partial dependence of ``target_variables``.
Partial dependence plots show the dependence between the joint values
of the ``target_variables`` and the function represented
by the ``gbrt``.
Read more in the :ref:`User Guide <partial_dependence>`.
Parameters
----------
gbrt : BaseGradientBoosting
A fitted gradient boosting model.
target_variables : array-like, dtype=int
The target features for which the partial dependecy should be
computed (size should be smaller than 3 for visual renderings).
grid : array-like, shape=(n_points, len(target_variables))
The grid of ``target_variables`` values for which the
partial dependecy should be evaluated (either ``grid`` or ``X``
must be specified).
X : array-like, shape=(n_samples, n_features)
The data on which ``gbrt`` was trained. It is used to generate
a ``grid`` for the ``target_variables``. The ``grid`` comprises
``grid_resolution`` equally spaced points between the two
``percentiles``.
percentiles : (low, high), default=(0.05, 0.95)
The lower and upper percentile used create the extreme values
for the ``grid``. Only if ``X`` is not None.
grid_resolution : int, default=100
The number of equally spaced points on the ``grid``.
Returns
-------
pdp : array, shape=(n_classes, n_points)
The partial dependence function evaluated on the ``grid``.
For regression and binary classification ``n_classes==1``.
axes : seq of ndarray or None
The axes with which the grid has been created or None if
the grid has been given.
Examples
--------
>>> samples = [[0, 0, 2], [1, 0, 0]]
>>> labels = [0, 1]
>>> from sklearn.ensemble import GradientBoostingClassifier
>>> gb = GradientBoostingClassifier(random_state=0).fit(samples, labels)
>>> kwargs = dict(X=samples, percentiles=(0, 1), grid_resolution=2)
>>> partial_dependence(gb, [0], **kwargs) # doctest: +SKIP
(array([[-4.52..., 4.52...]]), [array([ 0., 1.])])
"""
if not isinstance(gbrt, BaseGradientBoosting):
raise ValueError('gbrt has to be an instance of BaseGradientBoosting')
if gbrt.estimators_.shape[0] == 0:
raise ValueError('Call %s.fit before partial_dependence' %
gbrt.__class__.__name__)
if (grid is None and X is None) or (grid is not None and X is not None):
raise ValueError('Either grid or X must be specified')
target_variables = np.asarray(target_variables, dtype=np.int32,
order='C').ravel()
if any([not (0 <= fx < gbrt.n_features) for fx in target_variables]):
raise ValueError('target_variables must be in [0, %d]'
% (gbrt.n_features - 1))
if X is not None:
X = check_array(X, dtype=DTYPE, order='C')
grid, axes = _grid_from_X(X[:, target_variables], percentiles,
grid_resolution)
else:
assert grid is not None
# dont return axes if grid is given
axes = None
# grid must be 2d
if grid.ndim == 1:
grid = grid[:, np.newaxis]
if grid.ndim != 2:
raise ValueError('grid must be 2d but is %dd' % grid.ndim)
grid = np.asarray(grid, dtype=DTYPE, order='C')
assert grid.shape[1] == target_variables.shape[0]
n_trees_per_stage = gbrt.estimators_.shape[1]
n_estimators = gbrt.estimators_.shape[0]
pdp = np.zeros((n_trees_per_stage, grid.shape[0],), dtype=np.float64,
order='C')
for stage in range(n_estimators):
for k in range(n_trees_per_stage):
tree = gbrt.estimators_[stage, k].tree_
_partial_dependence_tree(tree, grid, target_variables,
gbrt.learning_rate, pdp[k])
return pdp, axes
def plot_partial_dependence(gbrt, X, features, feature_names=None,
label=None, n_cols=3, grid_resolution=100,
percentiles=(0.05, 0.95), n_jobs=1,
verbose=0, ax=None, line_kw=None,
contour_kw=None, **fig_kw):
"""Partial dependence plots for ``features``.
The ``len(features)`` plots are arranged in a grid with ``n_cols``
columns. Two-way partial dependence plots are plotted as contour
plots.
Read more in the :ref:`User Guide <partial_dependence>`.
Parameters
----------
gbrt : BaseGradientBoosting
A fitted gradient boosting model.
X : array-like, shape=(n_samples, n_features)
The data on which ``gbrt`` was trained.
features : seq of tuples or ints
If seq[i] is an int or a tuple with one int value, a one-way
PDP is created; if seq[i] is a tuple of two ints, a two-way
PDP is created.
feature_names : seq of str
Name of each feature; feature_names[i] holds
the name of the feature with index i.
label : object
The class label for which the PDPs should be computed.
Only if gbrt is a multi-class model. Must be in ``gbrt.classes_``.
n_cols : int
The number of columns in the grid plot (default: 3).
percentiles : (low, high), default=(0.05, 0.95)
The lower and upper percentile used to create the extreme values
for the PDP axes.
grid_resolution : int, default=100
The number of equally spaced points on the axes.
n_jobs : int
The number of CPUs to use to compute the PDs. -1 means 'all CPUs'.
Defaults to 1.
verbose : int
Verbose output during PD computations. Defaults to 0.
ax : Matplotlib axis object, default None
An axis object onto which the plots will be drawn.
line_kw : dict
Dict with keywords passed to the ``pylab.plot`` call.
For one-way partial dependence plots.
contour_kw : dict
Dict with keywords passed to the ``pylab.plot`` call.
For two-way partial dependence plots.
fig_kw : dict
Dict with keywords passed to the figure() call.
Note that all keywords not recognized above will be automatically
included here.
Returns
-------
fig : figure
The Matplotlib Figure object.
axs : seq of Axis objects
A seq of Axis objects, one for each subplot.
Examples
--------
>>> from sklearn.datasets import make_friedman1
>>> from sklearn.ensemble import GradientBoostingRegressor
>>> X, y = make_friedman1()
>>> clf = GradientBoostingRegressor(n_estimators=10).fit(X, y)
>>> fig, axs = plot_partial_dependence(clf, X, [0, (0, 1)]) #doctest: +SKIP
...
"""
import matplotlib.pyplot as plt
from matplotlib import transforms
from matplotlib.ticker import MaxNLocator
from matplotlib.ticker import ScalarFormatter
if not isinstance(gbrt, BaseGradientBoosting):
raise ValueError('gbrt has to be an instance of BaseGradientBoosting')
if gbrt.estimators_.shape[0] == 0:
raise ValueError('Call %s.fit before partial_dependence' %
gbrt.__class__.__name__)
# set label_idx for multi-class GBRT
if hasattr(gbrt, 'classes_') and np.size(gbrt.classes_) > 2:
if label is None:
raise ValueError('label is not given for multi-class PDP')
label_idx = np.searchsorted(gbrt.classes_, label)
if gbrt.classes_[label_idx] != label:
raise ValueError('label %s not in ``gbrt.classes_``' % str(label))
else:
# regression and binary classification
label_idx = 0
X = check_array(X, dtype=DTYPE, order='C')
if gbrt.n_features != X.shape[1]:
raise ValueError('X.shape[1] does not match gbrt.n_features')
if line_kw is None:
line_kw = {'color': 'green'}
if contour_kw is None:
contour_kw = {}
# convert feature_names to list
if feature_names is None:
# if not feature_names use fx indices as name
feature_names = [str(i) for i in range(gbrt.n_features)]
elif isinstance(feature_names, np.ndarray):
feature_names = feature_names.tolist()
def convert_feature(fx):
if isinstance(fx, six.string_types):
try:
fx = feature_names.index(fx)
except ValueError:
raise ValueError('Feature %s not in feature_names' % fx)
return fx
# convert features into a seq of int tuples
tmp_features = []
for fxs in features:
if isinstance(fxs, (numbers.Integral,) + six.string_types):
fxs = (fxs,)
try:
fxs = np.array([convert_feature(fx) for fx in fxs], dtype=np.int32)
except TypeError:
raise ValueError('features must be either int, str, or tuple '
'of int/str')
if not (1 <= np.size(fxs) <= 2):
raise ValueError('target features must be either one or two')
tmp_features.append(fxs)
features = tmp_features
names = []
try:
for fxs in features:
l = []
# explicit loop so "i" is bound for exception below
for i in fxs:
l.append(feature_names[i])
names.append(l)
except IndexError:
raise ValueError('features[i] must be in [0, n_features) '
'but was %d' % i)
# compute PD functions
pd_result = Parallel(n_jobs=n_jobs, verbose=verbose)(
delayed(partial_dependence)(gbrt, fxs, X=X,
grid_resolution=grid_resolution,
percentiles=percentiles)
for fxs in features)
# get global min and max values of PD grouped by plot type
pdp_lim = {}
for pdp, axes in pd_result:
min_pd, max_pd = pdp[label_idx].min(), pdp[label_idx].max()
n_fx = len(axes)
old_min_pd, old_max_pd = pdp_lim.get(n_fx, (min_pd, max_pd))
min_pd = min(min_pd, old_min_pd)
max_pd = max(max_pd, old_max_pd)
pdp_lim[n_fx] = (min_pd, max_pd)
# create contour levels for two-way plots
if 2 in pdp_lim:
Z_level = np.linspace(*pdp_lim[2], num=8)
if ax is None:
fig = plt.figure(**fig_kw)
else:
fig = ax.get_figure()
fig.clear()
n_cols = min(n_cols, len(features))
n_rows = int(np.ceil(len(features) / float(n_cols)))
axs = []
for i, fx, name, (pdp, axes) in zip(count(), features, names,
pd_result):
ax = fig.add_subplot(n_rows, n_cols, i + 1)
if len(axes) == 1:
ax.plot(axes[0], pdp[label_idx].ravel(), **line_kw)
else:
# make contour plot
assert len(axes) == 2
XX, YY = np.meshgrid(axes[0], axes[1])
Z = pdp[label_idx].reshape(list(map(np.size, axes))).T
CS = ax.contour(XX, YY, Z, levels=Z_level, linewidths=0.5,
colors='k')
ax.contourf(XX, YY, Z, levels=Z_level, vmax=Z_level[-1],
vmin=Z_level[0], alpha=0.75, **contour_kw)
ax.clabel(CS, fmt='%2.2f', colors='k', fontsize=10, inline=True)
# plot data deciles + axes labels
deciles = mquantiles(X[:, fx[0]], prob=np.arange(0.1, 1.0, 0.1))
trans = transforms.blended_transform_factory(ax.transData,
ax.transAxes)
ylim = ax.get_ylim()
ax.vlines(deciles, [0], 0.05, transform=trans, color='k')
ax.set_xlabel(name[0])
ax.set_ylim(ylim)
# prevent x-axis ticks from overlapping
ax.xaxis.set_major_locator(MaxNLocator(nbins=6, prune='lower'))
tick_formatter = ScalarFormatter()
tick_formatter.set_powerlimits((-3, 4))
ax.xaxis.set_major_formatter(tick_formatter)
if len(axes) > 1:
# two-way PDP - y-axis deciles + labels
deciles = mquantiles(X[:, fx[1]], prob=np.arange(0.1, 1.0, 0.1))
trans = transforms.blended_transform_factory(ax.transAxes,
ax.transData)
xlim = ax.get_xlim()
ax.hlines(deciles, [0], 0.05, transform=trans, color='k')
ax.set_ylabel(name[1])
# hline erases xlim
ax.set_xlim(xlim)
else:
ax.set_ylabel('Partial dependence')
if len(axes) == 1:
ax.set_ylim(pdp_lim[1])
axs.append(ax)
fig.subplots_adjust(bottom=0.15, top=0.7, left=0.1, right=0.95, wspace=0.4,
hspace=0.3)
return fig, axs
|
bsd-3-clause
|
BeatsonLab-MicrobialGenomics/DiscoPlot
|
discoplot/DiscoPlot.py
|
1
|
23712
|
#!/usr/bin/env python
# DiscoPlot: identify genomic rearrangements, misassemblies and sequencing
# artefacts in NGS data
# Copyright (C) 2013-2015 Mitchell Sullivan
# This program is free software: you can redistribute it and/or modify
# it under the terms of the GNU General Public License as published by
# the Free Software Foundation, either version 3 of the License, or
# (at your option) any later version.
#
# This program is distributed in the hope that it will be useful,
# but WITHOUT ANY WARRANTY; without even the implied warranty of
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
# GNU General Public License for more details.
#
# You should have received a copy of the GNU General Public License
# along with this program. If not, see <http://www.gnu.org/licenses/>.
#
# Mitchell Sullivan
# [email protected]
# School of Chemistry & Molecular Biosciences
# The University of Queensland
# Brisbane, QLD 4072.
# Australia
__title__ = 'DiscoPlot'
__version__ = '1.0.2'
__description__ = ("DiscoPlot: identify genomic rearrangements, misassemblies "
"and sequencing artefacts in NGS data")
__author__ = 'Mitchell Sullivan'
__license__ = 'GPLv3'
__author_email__ = "[email protected]"
__url__ = 'https://github.com/BeatsonLab-MicrobialGenomics/DiscoPlot'
import argparse
import numpy
import sys
import subprocess
def read_sbam(args):
import pysam
if not args.bam_file is None:
sam = pysam.Samfile(args.bam_file, 'rb')
elif not args.sam_file:
sam = pysam.Samfile(args.sam_file)
global refpos
global cuta
global cutb
cuta = 0
cutb = float('inf')
refpos = {}
if not args.subsection is None:
if len(args.subsection) == 1:
refpos[args.subsection[0]] = 0
totallength = None
for i in range(0, len(sam.references)):
if sam.references[i] == args.subsection[0]:
totallength = sam.lengths[i]
if totallength is None:
sys.stderr.write('Selected reference not found.')
sys.exit()
elif len(args.subsection) == 2:
refpos[sam.references[0]] = 0
cuta = int(args.subsection[0])
cutb = int(args.subsection[1])
totallength = cutb - cuta
elif len(args.subsection) == 3:
refpos[args.subsection[0]] = 0
cuta = int(args.subsection[1])
cutb = int(args.subsection[2])
totallength = cutb - cuta
else:
sys.stderr.write('Too many arguments given for subsection')
sys.exit()
if args.bin_size is None:
args.bin_size = totallength / args.size + 1
else:
args.size = totallength / args.bin_size + 1
else:
references = sam.references
reflengths = sam.lengths
currpos = 0
if args.bin_size is None:
args.bin_size = sum(reflengths) / (args.size - (len(reflengths) -1) * (args.gap + 1)) + 1
else:
args.size = sum(map(lambda x: x/args.bin_size, reflengths)) + (len(reflengths) -1) * args.gap + 1
for i in range(len(references)):
refpos[references[i]] = currpos
currpos += reflengths[i] / args.bin_size + args.gap
global invgrid, dirgrid, unmapped_for, unmapped_rev
unmapped_rev = {}
unmapped_for = {}
invgrid = {}
dirgrid = {}
for read in sam.fetch():
ref = sam.getrname(read.tid)
if ref in refpos:
if read.is_read1:
if cuta <= read.pos <= cutb:
pos1 = (read.pos - cuta) / args.bin_size + refpos[ref]
if read.mate_is_unmapped:
if read.is_reverse:
if pos1 in unmapped_rev:
unmapped_rev[pos1] += 1
else:
unmapped_rev[pos1] = 1
else:
if pos1 in unmapped_for:
unmapped_for[pos1] += 1
else:
unmapped_for[pos1] = 1
else:
mref = sam.getrname(read.rnext)
if mref in refpos:
if cuta <= read.pnext <= cutb:
pos2 = (read.pnext - cuta) / args.bin_size + refpos[mref]
if read.is_reverse:
if read.mate_is_reverse:
if pos1 < pos2:
if pos2 in dirgrid and pos1 in dirgrid[pos2]:
dirgrid[pos2][pos1] += 1
elif pos2 in dirgrid:
dirgrid[pos2][pos1] = 1
else:
dirgrid[pos2] = {pos1:1}
else:
if pos1 in dirgrid and pos2 in dirgrid[pos1]:
dirgrid[pos1][pos2] += 1
elif pos1 in dirgrid:
dirgrid[pos1][pos2] = 1
else:
dirgrid[pos1] = {pos2:1}
else:
if pos2 in invgrid and pos1 in invgrid[pos2]:
invgrid[pos2][pos1] += 1
elif pos2 in invgrid:
invgrid[pos2][pos1] = 1
else:
invgrid[pos2] = {pos1:1}
else:
if read.mate_is_reverse:
if pos1 in invgrid and pos2 in invgrid[pos1]:
invgrid[pos1][pos2] += 1
elif pos1 in invgrid:
invgrid[pos1][pos2] = 1
else:
invgrid[pos1] = {pos2:1}
else:
if pos1 < pos2:
if pos1 in dirgrid and pos2 in dirgrid[pos1]:
dirgrid[pos1][pos2] += 1
elif pos1 in dirgrid:
dirgrid[pos1][pos2] = 1
else:
dirgrid[pos1] = {pos2:1}
else:
if pos2 in dirgrid and pos1 in dirgrid[pos2]:
dirgrid[pos2][pos1] += 1
elif pos2 in dirgrid:
dirgrid[pos2][pos1] = 1
else:
dirgrid[pos2] = {pos1:1}
else:
if read.mate_is_unmapped:
ref = sam.getrname(read.tid)
if ref in refpos:
if cuta <= read.pos <= cutb:
pos = (read.pos - cuta) / args.bin_size + refpos[ref]
if read.is_reverse:
if pos in unmapped_rev:
unmapped_rev[pos] += 1
else:
unmapped_rev[pos] = 1
else:
if pos in unmapped_for:
unmapped_for[pos] += 1
else:
unmapped_for[pos] = 1
def read_sing(args):
readlen = None
if not args.read_file is None:
reads = open(args.read_file)
first = True
getfq = 0
readlen = {}
for line in reads:
if first:
first = False
if line.startswith('@'):
getfq = 2
name = line.rstrip()[1:]
seq = ''
elif line.startswith('>'):
readlen[name] = len(seq)
name = line.rstrip()[1:]
seq = ''
elif getfq == 0:
seq += line.rstrip()
elif getfq == 1:
readlen[name] = len(seq)
name = line.rstrip()
seq = ''
elif getfq == 2:
seq += line.rstrip()
getfq = 3
elif getfq == 3:
getfq = 4
elif getfq == 4:
getfq = 1
readlen[name] = len(seq)
if not args.reference_file is None:
ref = open(args.reference_file)
first = True
references = []
reflengths = []
for line in ref:
if line.startswith('>'):
if first:
first = False
else:
references.append(name)
reflengths.append(len(seq))
name = line.rstrip()[1:]
seq = ''
else:
seq += line
references.append(name)
reflengths.append(len(seq))
else:
blast = open(args.blast_file)
refdict = {}
for line in blast:
if line.split()[1] in refdict:
if max([int(line.split()[8]), int(line.split()[9])]) > refdict[line.split()[1]]:
refdict[line.split()[1]] = max([int(line.split()[8]), int(line.split()[9])])
else:
refdict[line.split()[1]] = max([int(line.split()[8]), int(line.split()[9])])
blast.close()
references = []
reflengths = []
for i in refdict:
references.append(i)
reflengths.append(refdict[i])
cuta = 0
cutb = float('inf')
refpos = {}
if not args.subsection is None:
if len(args.subsection) == 1:
refpos[args.subsection[0]] = 0
totallength = None
for i in range(0, len(references)):
if references[i] == args.subsection[0]:
totallength = reflengths[i]
if totallength is None:
sys.stderr.write('Selected reference not found.')
sys.exit()
elif len(args.subsection) == 2:
refpos[references[0]] = 0
cuta = int(args.subsection[0])
cutb = int(args.subsection[1])
totallength = cutb - cuta
elif len(args.subsection) == 3:
refpos[args.subsection[0]] = 0
cuta = int(args.subsection[0])
cutb = int(args.subsection[1])
totallength = cutb - cuta
else:
sys.stderr.write('Too many arguments given for subsection')
sys.exit()
if args.bin_size is None:
args.bin_size = totallength / args.size
else:
args.size = totallength / args.bin_size
else:
currpos = 0
if args.bin_size is None:
args.bin_size = sum(reflengths) / (args.size - (len(reflengths) -1) * (args.gap + 1))
else:
args.size = sum(map(lambda x: x/args.bin_size, reflengths)) + (len(reflengths) -1) * args.gap
for i in range(len(references)):
refpos[references[i]] = currpos
currpos += reflengths[i] / args.bin_size + args.gap
global invgrid, dirgrid, unmapped_for, unmapped_rev
unmapped_rev = {}
unmapped_for = {}
invgrid = {}
dirgrid = {}
blast = open(args.blast_file)
lastquery = ''
hits = []
for line in blast:
query, subject, ident, length, mm, indel, qstart, qstop, rstart, rstop, eval, bitscore = line.split()
qstart, qstop, rstart, rstop, length, mm, indel = map(int, [qstart, qstop, rstart, rstop, length, mm, indel])
if query != lastquery and lastquery != '':
hits.sort(reverse=True)
newhits = [hits[0]]
qtaken = set()
for i in range(hits[2], hits[3] + 1):
qtaken.add(i)
for i in hits[1:]:
if i[:-3] == newhits[-1][:-3]:
newhits.append(i)
else:
getit = False
for j in range(hits[2], hits[3] + 1):
if not j in qtaken:
getit = True
qtaken.add(j)
if getit:
newhits.append(i)
anchor = None
revseq = None
for i in newhits:
bitscore, length, qstart, qstop, rstart, rstop, subject = i
if anchor is None:
if rstart < rstop:
anchor = rstart
revseq = False
else:
anchor = rstop
revseq = True
if min(qtaken) >= args.unmapped:
if revseq:
if anchor in unmapped_for:
unmapped_for[anchor] += 1
else:
unmapped_for[anchor] = 1
else:
if anchor in unmapped_rev:
unmapped_rev[anchor] += 1
else:
unmapped_rev[anchor] = 1
if max(qtaken) <= readlen[lastquery] - args.unmapped:
if revseq:
if anchor in unmapped_rev:
unmapped_rev[anchor] += 1
else:
unmapped_rev[anchor] = 1
else:
if anchor in unmapped_for:
unmapped_for[anchor] += 1
else:
unmapped_for[anchor] = 1
lastxpos = None
lastypos = None
oldstart, oldstop = qstart, qstop
if revseq:
rstart, rstop = rstop, rstart
qstart = readlen[lastquery] - qstop
qstop = readlen[lastquery] - oldstart
for j in range(qstart, qstop):
xpos = refpos[subject] + (anchor + j - cuta) / args.bin_size
ypos = refpos[subject] + (rstart + int(((j - qstart) * 1.0 / (qstop - qstart)) * (rstop - rstart))) / args.bin_size
if xpos != lastxpos or ypos != lastypos:
if rstart < rstop:
if xpos in dirgrid:
if ypos in dirgrid[xpos]:
dirgrid[xpos][ypos] += 1
else:
dirgrid[xpos][ypos] = 1
else:
dirgrid[xpos] = {ypos:1}
else:
if xpos in invgrid:
if ypos in invgrid[xpos]:
invgrid[xpos][ypos] += 1
else:
invgrid[xpos][ypos] = 1
else:
invgrid[xpos] = {ypos:1}
lastxpos, lastypos = xpos, ypos
if ident >= args.min_ident and length >= args.min_length and subject in refpos and ((cuta <= rstart <= cutb) or (cuta <= rstop <= cutb)):
hits.append((float(bitscore), length, qstart, qstop, rstart, rstop, subject))
lastquery = query
def generate_blast(args):
subprocess.Popen('makeblastdb -dbtype nucl -out ' + args.gen_blast + '.db -in ' +
args.reference_file, shell=True, stdout=subprocess.PIPE).wait()
subprocess.Popen('blastn -db ' + args.gen_blast + '.db -outfmt 6 -query ' +
args.read_file + ' -out ' + args.gen_blast + '.out', shell=True).wait()
args.blast_file = args.gen_blast + '.out'
def draw_dotplot(args):
global refpos
global cuta
global cutb
vals1, vals2 = [], []
for i in invgrid:
for j in invgrid[i]:
vals1.append(invgrid[i][j])
vals2.append(invgrid[i][j])
for i in dirgrid:
for j in dirgrid[i]:
vals1.append(dirgrid[i][j])
vals2.append(dirgrid[i][j])
vals2 = numpy.array(vals2)
for i in unmapped_rev:
vals1.append(unmapped_rev[i])
for i in unmapped_for:
vals1.append(unmapped_for[i])
vals1 = numpy.array(vals1)
med = numpy.median(vals2)
numvals = numpy.size(vals1)
sizemod = 2000.0 / args.size / med
fig = plt.figure(figsize=(10,10))
ax = fig.add_subplot(111, aspect='equal')
x = numpy.zeros(numvals, dtype='u4')
y = numpy.zeros(numvals, dtype='u4')
sizes = numpy.zeros(numvals, dtype='f4')
colours = numpy.array(['x' for i in range(numvals)])
count = 0
for i in dirgrid:
for j in dirgrid[i]:
if args.max_hits >= dirgrid[i][j] >= args.min_hits:
x[count] = i * args.bin_size + cuta
y[count] = j * args.bin_size + cuta
sizes[count] = dirgrid[i][j] * sizemod
colours[count] = 'r'
count += 1
for i in invgrid:
for j in invgrid[i]:
if args.max_hits >= invgrid[i][j] >= args.min_hits:
x[count] = i * args.bin_size + cuta
y[count] = j * args.bin_size + cuta
sizes[count] = invgrid[i][j] * sizemod
colours[count] = 'b'
count += 1
for i in unmapped_for:
if args.max_hits >= unmapped_for[i] >= args.min_hits:
x[count] = cuta
y[count] = i * args.bin_size + cuta
sizes[count] = unmapped_for[i] * sizemod
colours[count] = 'g'
count += 1
for i in unmapped_rev:
if args.max_hits >= unmapped_rev[i] >= args.min_hits:
x[count] = i * args.bin_size + cuta
y[count] = cuta
sizes[count] = unmapped_rev[i] * sizemod
colours[count] = 'g'
count += 1
count1, count2, count3 = 0, 0, 0
for i in colours:
if i == 'b':
count1 += 1
elif i == 'r':
count2 += 1
elif i == 'g':
count3 += 1
ax.scatter(x, y, s=sizes, c=colours, edgecolor='none', alpha=0.3)
sizes = []
names = []
for i in [10, 25, 50, 75, 90]:
sizes.append(numpy.percentile(vals2, i))
names.append(str(i) + '% Normal ' + str(sizes[-1]))
names.append('50% Inverted ' + str(sizes[2]))
a = plt.scatter(-100, -100, s=sizes[2] * sizemod, c='b', edgecolor='none', alpha=0.3)
b = plt.scatter(-100, -100, s=sizes[0] * sizemod, c='r', edgecolor='none', alpha=0.3)
c = plt.scatter(-100, -100, s=sizes[1] * sizemod, c='r', edgecolor='none', alpha=0.3)
d = plt.scatter(-100, -100, s=sizes[2] * sizemod, c='r', edgecolor='none', alpha=0.3)
e = plt.scatter(-100, -100, s=sizes[3] * sizemod, c='r', edgecolor='none', alpha=0.3)
f = plt.scatter(-100, -100, s=sizes[4] * sizemod, c='r', edgecolor='none', alpha=0.3)
leg = ax.legend([b, c, d, e, f, a], names, loc=4)
leg.draggable(state=True)
for i in refpos:
if not refpos[i] == 0:
ax.axhspan(refpos[i] * args.bin_size, refpos[i] * args.bin_size - args.gap * args.bin_size, facecolor='g', alpha=0.3)
ax.axvspan(refpos[i] * args.bin_size, refpos[i] * args.bin_size - args.gap * args.bin_size, facecolor='g', alpha=0.3)
if cutb == float('inf'):
cutb = args.size * args.bin_size + cuta
plt.xlim([cuta - args.bin_size * 10, cutb])
plt.ylim([cuta - args.bin_size * 10, cutb])
plt.grid(True)
if not args.output_file is None:
plt.savefig(args.output_file, dpi=args.image_quality)
else:
plt.show()
parser = argparse.ArgumentParser(prog='DiscoPlot', formatter_class=argparse.RawDescriptionHelpFormatter, description='''
DiscoPlot - read mapping visualisation in the large
USAGE: DiscoPlot -bam bamfile.bam -o output_file.bmp -size 5000
Create a bmp file from a bamfile of paired-end reads with a width and height of 5000px
DiscoPlot -r reads.fa -B blast_prefix -r reference -o output_file.png -bin bin_size
Create a png file from reads.fa, generate blast file. Image size will be reference length / bin_size
''', epilog="Thanks for using DiscoPlot")
parser.add_argument('-r', '--read_file', action='store', default=None, help='read file')
parser.add_argument('-ref', '--reference_file', action='store', default=None, help='reference file')
parser.add_argument('-bam', '--bam_file', action='store', default=None, help='bam file')
parser.add_argument('-sam', '--sam_file', action='store', default=None, help='sam file')
parser.add_argument('-B', '--gen_blast', action='store', default=None, help='Generate blast files, use argument as prefix for output.')
parser.add_argument('-b', '--blast_file', action='store', default=None, help='Blast file (output format 6)')
parser.add_argument('-o', '--output_file', action='store', default=None, help='output file [gif/bmp/png]')
parser.add_argument('-s', '--size', action='store', type=int, default=None, help='Number of bins')
parser.add_argument('-bin', '--bin_size', action='store', type=int, default=None, help='Bin size (in bp)')
parser.add_argument('-g', '--gap', action='store', type=int, default=5, help='Gap size')
parser.add_argument('-sub', '--subsection', nargs='+', action='store', default=None, help='Only display subection of genome [ref]/[min_cutoff max_cutoff]/[ref min_cutoff max_cutoff]')
parser.add_argument('-c', '--min_hits', action='store', type=int, default=1, help='Min hits to be shown')
parser.add_argument('-m', '--max_hits', action='store', type=float, default=float('inf'), help='Bins with more hits than this will be skipped.')
parser.add_argument('-dpi', '--image_quality', action='store', type=int, default=1600, help='Image quality (in DPI)')
args = parser.parse_args()
if args.size is None and args.bin_size is None:
sys.stderr.write('Please give a image size or bin size.')
sys.exit()
if not args.gen_blast is None:
if args.reference_file is None:
sys.stderr.write('Please provide a reference file')
sys.exit()
if args.read_file is None:
sys.stderr.write('Please provide a read file (FASTA)')
sys.exit()
generate_blast(args)
if not args.output_file is None:
import matplotlib
matplotlib.use('Agg')
import matplotlib.pyplot as plt
if not args.size is None and not args.bin_size is None:
sys.stderr.write('Only provide bin size or image size, not both.')
sys.exit()
if not args.sam_file is None or not args.bam_file is None:
read_sbam(args)
elif args.blast_file is None:
sys.stderr.write('Please either generate or provide a BLAST comparison')
sys.exit()
else:
read_sing(args)
draw_dotplot(args)
|
gpl-3.0
|
SSDS-Croatia/SSDS-2017
|
Day-5/util.py
|
1
|
5277
|
import os, sys, gzip, math, urllib
import numpy as np
from PIL import Image
import matplotlib.pyplot as plt
import matplotlib.gridspec as gridspec
class Dataset:
def __init__(self, data, labels=None):
self.data = data
if type(labels) == None:
self.supervised = False
else:
self.supervised = True
self.labels = labels
self.n = len(data)
self.batches_complete = 0
self.position_in_epoch = 0
def next_batch(self, batch_size, return_labels=False):
new_epoch = False
if self.position_in_epoch + batch_size >= self.n:
self.position_in_epoch = 0
self.batches_complete += 1
new_epoch = True
batch = self.data[self.position_in_epoch:self.position_in_epoch + batch_size]
if self.supervised and return_labels:
batch_labels = self.labels[self.position_in_epoch, self.position_in_epoch + batch_size]
batch = (batch, batch_labels)
self.position_in_epoch += batch_size
return new_epoch, batch
def plot(samples):
fig = plt.figure(figsize=(4, 4))
gs = gridspec.GridSpec(4, 4)
gs.update(wspace=0.05, hspace=0.05)
for i, sample in enumerate(samples):
ax = plt.subplot(gs[i])
plt.axis('off')
ax.set_xticklabels([])
ax.set_yticklabels([])
ax.set_aspect('equal')
plt.imshow(sample.reshape(28, 28), cmap='Greys_r')
return fig
def plot_single(sample, epoch=0):
plt.axis('off')
ax = plt.gca()
ax.set_xticklabels([])
ax.set_yticklabels([])
ax.set_aspect('equal')
plt.imshow(sample.reshape(28, 28), cmap='Greys_r')
def download_mnist(data_folder, dataset):
"""
Download and extract database
:param database_name: Database name
"""
image_files = ['train-images-idx3-ubyte.gz', 't10k-images-idx3-ubyte.gz']
label_files = ['train-labels-idx1-ubyte.gz', 't10k-labels-idx1-ubyte.gz']
url = 'http://yann.lecun.com/exdb/mnist/'
dataset_folder = os.path.join(data_folder, dataset)
if not os.path.exists(dataset_folder):
os.makedirs(dataset_folder)
for filename in image_files + label_files:
filepath = os.path.join(dataset_folder, filename)
filepath, _ = urllib.request.urlretrieve(url + filename, filepath)
statinfo = os.stat(filepath)
print('Successfully downloaded', filename, statinfo.st_size, 'bytes.')
else:
print('Found {} Data'.format(dataset))
return dataset_folder
def extract_data(filename, num_data, head_size, data_size):
with gzip.open(filename) as bytestream:
bytestream.read(head_size)
buf = bytestream.read(data_size * num_data)
data = np.frombuffer(buf, dtype=np.uint8).astype(np.float)
return data
def load_mnist(dataset_folder):
data = extract_data(dataset_folder + '/train-images-idx3-ubyte.gz', 60000, 16, 28 * 28)
trX = data.reshape((60000, 28, 28, 1))
data = extract_data(dataset_folder + '/train-labels-idx1-ubyte.gz', 60000, 8, 1)
trY = data.reshape((60000))
data = extract_data(dataset_folder + '/t10k-images-idx3-ubyte.gz', 10000, 16, 28 * 28)
teX = data.reshape((10000, 28, 28, 1))
data = extract_data(dataset_folder + '/t10k-labels-idx1-ubyte.gz', 10000, 8, 1)
teY = data.reshape((10000))
trY = np.asarray(trY)
teY = np.asarray(teY)
X = np.concatenate((trX, teX), axis=0)
y = np.concatenate((trY, teY), axis=0).astype(np.int)
seed = 547
np.random.seed(seed)
np.random.shuffle(X)
np.random.seed(seed)
np.random.shuffle(y)
y_vec = np.zeros((len(y), 10), dtype=np.float)
for i, label in enumerate(y):
y_vec[i, y[i]] = 1.0
return X / 255., y_vec
def images_square_grid(images, mode):
"""
Save images as a square grid
:param images: Images to be used for the grid
:param mode: The mode to use for images
:return: Image of images in a square grid
"""
# Get maximum size for square grid of images
save_size = math.floor(np.sqrt(images.shape[0]))
# Scale to 0-255
images = (((images - images.min()) * 255) / (images.max() - images.min())).astype(np.uint8)
# Put images in a square arrangement
images_in_square = np.reshape(
images[:save_size*save_size],
(save_size, save_size, images.shape[1], images.shape[2], images.shape[3]))
if mode == 'L':
images_in_square = np.squeeze(images_in_square, 4)
# Combine images to grid image
new_im = Image.new(mode, (images.shape[1] * save_size, images.shape[2] * save_size))
for col_i, col_images in enumerate(images_in_square):
for image_i, image in enumerate(col_images):
im = Image.fromarray(image, mode)
new_im.paste(im, (col_i * images.shape[1], image_i * images.shape[2]))
return new_im
def get_sample_images(data, dataset='mnist', n=25):
"""
Get a sample of n images from a dataset, able to be displayed with matplotlib
:param data_dir: Root directory of the dataset
:param dataset:
"""
# Display options
if dataset == 'mnist':
mode = 'L'
else:
mode = 'RGB'
return data[:n], mode
|
mit
|
miku/siskin
|
docs/btag-2017/scripts/pie.py
|
2
|
1614
|
# coding: utf-8
"""
Sources and sizes.
"""
import base64
import json
import requests
import matplotlib.pyplot as plt
import numpy as np
from matplotlib import cm
addr = base64.b64decode("""aHR0cDovLzE3Mi4xOC4xMTMuNzo4MDg1L3NvbHIvYmlibGlv""")
def total():
""" Return the total number of docs. """
r = requests.get('%s/select?wt=json&q=*:*' % (addr, label))
if r.status_code >= 300:
raise RuntimeError("got HTTP %s on %s" % (r.status_code, r.url))
doc = json.loads(r.text)
return doc['response']['numFound']
sources = (
('28', 'DOAJ'),
('48', 'WISO'),
('49', 'Crossref'),
('50', 'De Gruyter'),
('55', 'JSTOR'),
('60', 'Thieme'),
('85', 'Elsevier'),
('89', 'IEEE'),
('105', 'Springer'),
('121', 'Arxiv'),
)
labels, names, sizes = [s[0] for s in sources], [s[1] for s in sources], []
for label in labels:
r = requests.get('%s/select?wt=json&q=source_id:%s' % (addr, label))
if r.status_code >= 300:
raise RuntimeError("got HTTP %s on %s" % (r.status_code, r.url))
doc = json.loads(r.text)
found = doc['response']['numFound']
sizes.append(found)
explode = [0 for _ in range(len(labels))]
explode[2] = 0.1
fig1, ax1 = plt.subplots()
cmap = plt.get_cmap('Set1')
colors = [cmap(i) for i in np.linspace(0, 1, len(labels))]
patches, texts = plt.pie(sizes, startangle=90, colors=colors, shadow=False, explode=explode)
plt.legend(patches, names, loc="lower left")
ax1.axis('equal') # Equal aspect ratio ensures that pie is drawn as a circle.
plt.title('Article Metadata Index Sources (2017)')
plt.savefig('pie.png')
|
gpl-3.0
|
pratapvardhan/pandas
|
pandas/tests/indexes/timedeltas/test_timedelta_range.py
|
3
|
3021
|
import pytest
import numpy as np
import pandas as pd
import pandas.util.testing as tm
from pandas.tseries.offsets import Day, Second
from pandas import to_timedelta, timedelta_range
class TestTimedeltas(object):
def test_timedelta_range(self):
expected = to_timedelta(np.arange(5), unit='D')
result = timedelta_range('0 days', periods=5, freq='D')
tm.assert_index_equal(result, expected)
expected = to_timedelta(np.arange(11), unit='D')
result = timedelta_range('0 days', '10 days', freq='D')
tm.assert_index_equal(result, expected)
expected = to_timedelta(np.arange(5), unit='D') + Second(2) + Day()
result = timedelta_range('1 days, 00:00:02', '5 days, 00:00:02',
freq='D')
tm.assert_index_equal(result, expected)
expected = to_timedelta([1, 3, 5, 7, 9], unit='D') + Second(2)
result = timedelta_range('1 days, 00:00:02', periods=5, freq='2D')
tm.assert_index_equal(result, expected)
expected = to_timedelta(np.arange(50), unit='T') * 30
result = timedelta_range('0 days', freq='30T', periods=50)
tm.assert_index_equal(result, expected)
# GH 11776
arr = np.arange(10).reshape(2, 5)
df = pd.DataFrame(np.arange(10).reshape(2, 5))
for arg in (arr, df):
with tm.assert_raises_regex(TypeError, "1-d array"):
to_timedelta(arg)
for errors in ['ignore', 'raise', 'coerce']:
with tm.assert_raises_regex(TypeError, "1-d array"):
to_timedelta(arg, errors=errors)
# issue10583
df = pd.DataFrame(np.random.normal(size=(10, 4)))
df.index = pd.timedelta_range(start='0s', periods=10, freq='s')
expected = df.loc[pd.Timedelta('0s'):, :]
result = df.loc['0s':, :]
tm.assert_frame_equal(expected, result)
@pytest.mark.parametrize('periods, freq', [
(3, '2D'), (5, 'D'), (6, '19H12T'), (7, '16H'), (9, '12H')])
def test_linspace_behavior(self, periods, freq):
# GH 20976
result = timedelta_range(start='0 days', end='4 days', periods=periods)
expected = timedelta_range(start='0 days', end='4 days', freq=freq)
tm.assert_index_equal(result, expected)
def test_errors(self):
# not enough params
msg = ('Of the four parameters: start, end, periods, and freq, '
'exactly three must be specified')
with tm.assert_raises_regex(ValueError, msg):
timedelta_range(start='0 days')
with tm.assert_raises_regex(ValueError, msg):
timedelta_range(end='5 days')
with tm.assert_raises_regex(ValueError, msg):
timedelta_range(periods=2)
with tm.assert_raises_regex(ValueError, msg):
timedelta_range()
# too many params
with tm.assert_raises_regex(ValueError, msg):
timedelta_range(start='0 days', end='5 days', periods=10, freq='H')
|
bsd-3-clause
|
tttr222/autumn_ner
|
test.py
|
1
|
5277
|
#!/usr/bin/env python
import sys, os, random, pickle, json, codecs, time
import numpy as np
import sklearn.metrics as skm
import argparse
from model import AutumnNER
from utility import load_dataset
from utility import load_embeddings
from utility import report_performance
parser = argparse.ArgumentParser(description='Train and evaluate BiLSTM on a given dataset')
parser.add_argument('--datapath', dest='datapath', type=str,
default='CoNLL2003',
help='path to the datasets')
parser.add_argument('--embeddings', dest='embeddings_path', type=str,
default=None,
help='path to the testing dataset')
parser.add_argument('--optimizer', dest='optimizer', type=str,
default='default',
help='choose the optimizer: default, rmsprop, adagrad, adam.')
parser.add_argument('--batch-size', dest='batch_size', type=int,
default=64, help='number of instances in a minibatch')
parser.add_argument('--num-epoch', dest='num_epoch', type=int,
default=50, help='number of passes over the training set')
parser.add_argument('--learning-rate', dest='learning_rate', type=str,
default='default', help='learning rate')
parser.add_argument('--embedding-factor', dest='embedding_factor', type=float,
default=1.0, help='learning rate multiplier for embeddings')
parser.add_argument('--decay', dest='decay_rate', type=float,
default=0.95, help='exponential decay for learning rate')
parser.add_argument('--keep-prob', dest='keep_prob', type=float,
default=0.7, help='dropout keep rate')
parser.add_argument('--num-cores', dest='num_cores', type=int,
default=5, help='seed for training')
parser.add_argument('--seed', dest='seed', type=int,
default=1, help='seed for training')
def main(args):
print >> sys.stderr, "Running Autumn NER model testing module"
print >> sys.stderr, args
random.seed(args.seed)
trainset = []
devset = []
testset_standalone = {}
word_vocab = []
print "Loading dataset.."
assert(os.path.isdir(args.datapath))
for fname in sorted(os.listdir(args.datapath)):
if os.path.isdir(fname):
continue
if fname.endswith('.ner.txt'):
dataset, vocab = load_dataset(os.path.join(args.datapath,fname))
word_vocab += vocab
if fname.endswith('train.ner.txt'):
trainset += dataset
if fname.endswith('dev.ner.txt'):
devset += dataset
if fname.endswith('test.ner.txt'):
testset_standalone[fname] = dataset
print "Loaded {} instances with a vocab size of {} from {}".format(len(dataset),len(vocab),fname)
word_vocab = sorted(set(word_vocab))
if args.embeddings_path:
embeddings = load_embeddings(args.embeddings_path, word_vocab, 300)
else:
embeddings = None
print "Loaded {}/{} instances from training/dev set".format(len(trainset),len(devset))
X_train, y_train = zip(*trainset)
X_dev, y_dev = zip(*devset)
labels = []
for lb in y_train + y_dev:
labels += lb
labels = sorted(set(labels))
# Create the model, passing in relevant parameters
bilstm = AutumnNER(labels=labels,
word_vocab=word_vocab,
word_embeddings=embeddings,
optimizer=args.optimizer,
embedding_size=300,
char_embedding_size=32,
lstm_dim=200,
num_cores=args.num_cores,
embedding_factor=args.embedding_factor,
learning_rate=args.learning_rate,
decay_rate=args.decay_rate,
dropout_keep=args.keep_prob)
model_path = './scratch/saved_model_d{}_s{}'.format(hash(args.datapath),args.seed)
if not os.path.exists(model_path + '.meta'):
if not os.path.exists('./scratch'):
os.mkdir('./scratch')
print "Training.."
bilstm.fit(X_train,y_train,
X_dev, y_dev,
num_epoch=args.num_epoch,
batch_size=args.batch_size,
seed=args.seed)
bilstm.save(model_path)
else:
print "Loading saved model.."
bilstm.restore(model_path)
print "Evaluating.."
print "Performance on DEV set ----------------------------"
report_performance(bilstm, X_dev,y_dev, 'evaluation/devset_predictions.txt')
print "Performance on TEST set(s) ----------------------------"
overall_testset = []
for key, testset in testset_standalone:
X_test, y_test = zip(*testset)
report_performance(bilstm, X_test,y_test, 'evaluation/testset_{}_predictions.txt'.format(key))
overall_testset += testset
X_test, y_test = zip(*overall_testset)
report_performance(bilstm, X_test,y_test, 'evaluation/testset_overall_predictions.txt')
if __name__ == '__main__':
main(parser.parse_args())
|
mit
|
RachitKansal/scikit-learn
|
doc/conf.py
|
210
|
8446
|
# -*- coding: utf-8 -*-
#
# scikit-learn documentation build configuration file, created by
# sphinx-quickstart on Fri Jan 8 09:13:42 2010.
#
# This file is execfile()d with the current directory set to its containing
# dir.
#
# Note that not all possible configuration values are present in this
# autogenerated file.
#
# All configuration values have a default; values that are commented out
# serve to show the default.
from __future__ import print_function
import sys
import os
from sklearn.externals.six import u
# If extensions (or modules to document with autodoc) are in another
# directory, add these directories to sys.path here. If the directory
# is relative to the documentation root, use os.path.abspath to make it
# absolute, like shown here.
sys.path.insert(0, os.path.abspath('sphinxext'))
from github_link import make_linkcode_resolve
# -- General configuration ---------------------------------------------------
# Try to override the matplotlib configuration as early as possible
try:
import gen_rst
except:
pass
# Add any Sphinx extension module names here, as strings. They can be
# extensions coming with Sphinx (named 'sphinx.ext.*') or your custom ones.
extensions = ['gen_rst',
'sphinx.ext.autodoc', 'sphinx.ext.autosummary',
'sphinx.ext.pngmath', 'numpy_ext.numpydoc',
'sphinx.ext.linkcode',
]
autosummary_generate = True
autodoc_default_flags = ['members', 'inherited-members']
# Add any paths that contain templates here, relative to this directory.
templates_path = ['templates']
# generate autosummary even if no references
autosummary_generate = True
# The suffix of source filenames.
source_suffix = '.rst'
# The encoding of source files.
#source_encoding = 'utf-8'
# Generate the plots for the gallery
plot_gallery = True
# The master toctree document.
master_doc = 'index'
# General information about the project.
project = u('scikit-learn')
copyright = u('2010 - 2014, scikit-learn developers (BSD License)')
# The version info for the project you're documenting, acts as replacement for
# |version| and |release|, also used in various other places throughout the
# built documents.
#
# The short X.Y version.
import sklearn
version = sklearn.__version__
# The full version, including alpha/beta/rc tags.
release = sklearn.__version__
# The language for content autogenerated by Sphinx. Refer to documentation
# for a list of supported languages.
#language = None
# There are two options for replacing |today|: either, you set today to some
# non-false value, then it is used:
#today = ''
# Else, today_fmt is used as the format for a strftime call.
#today_fmt = '%B %d, %Y'
# List of documents that shouldn't be included in the build.
#unused_docs = []
# List of directories, relative to source directory, that shouldn't be
# searched for source files.
exclude_trees = ['_build', 'templates', 'includes']
# The reST default role (used for this markup: `text`) to use for all
# documents.
#default_role = None
# If true, '()' will be appended to :func: etc. cross-reference text.
add_function_parentheses = False
# If true, the current module name will be prepended to all description
# unit titles (such as .. function::).
#add_module_names = True
# If true, sectionauthor and moduleauthor directives will be shown in the
# output. They are ignored by default.
#show_authors = False
# The name of the Pygments (syntax highlighting) style to use.
pygments_style = 'sphinx'
# A list of ignored prefixes for module index sorting.
#modindex_common_prefix = []
# -- Options for HTML output -------------------------------------------------
# The theme to use for HTML and HTML Help pages. Major themes that come with
# Sphinx are currently 'default' and 'sphinxdoc'.
html_theme = 'scikit-learn'
# Theme options are theme-specific and customize the look and feel of a theme
# further. For a list of options available for each theme, see the
# documentation.
html_theme_options = {'oldversion': False, 'collapsiblesidebar': True,
'google_analytics': True, 'surveybanner': False,
'sprintbanner': True}
# Add any paths that contain custom themes here, relative to this directory.
html_theme_path = ['themes']
# The name for this set of Sphinx documents. If None, it defaults to
# "<project> v<release> documentation".
#html_title = None
# A shorter title for the navigation bar. Default is the same as html_title.
html_short_title = 'scikit-learn'
# The name of an image file (relative to this directory) to place at the top
# of the sidebar.
html_logo = 'logos/scikit-learn-logo-small.png'
# The name of an image file (within the static path) to use as favicon of the
# docs. This file should be a Windows icon file (.ico) being 16x16 or 32x32
# pixels large.
html_favicon = 'logos/favicon.ico'
# Add any paths that contain custom static files (such as style sheets) here,
# relative to this directory. They are copied after the builtin static files,
# so a file named "default.css" will overwrite the builtin "default.css".
html_static_path = ['images']
# If not '', a 'Last updated on:' timestamp is inserted at every page bottom,
# using the given strftime format.
#html_last_updated_fmt = '%b %d, %Y'
# If true, SmartyPants will be used to convert quotes and dashes to
# typographically correct entities.
#html_use_smartypants = True
# Custom sidebar templates, maps document names to template names.
#html_sidebars = {}
# Additional templates that should be rendered to pages, maps page names to
# template names.
#html_additional_pages = {}
# If false, no module index is generated.
html_domain_indices = False
# If false, no index is generated.
html_use_index = False
# If true, the index is split into individual pages for each letter.
#html_split_index = False
# If true, links to the reST sources are added to the pages.
#html_show_sourcelink = True
# If true, an OpenSearch description file will be output, and all pages will
# contain a <link> tag referring to it. The value of this option must be the
# base URL from which the finished HTML is served.
#html_use_opensearch = ''
# If nonempty, this is the file name suffix for HTML files (e.g. ".xhtml").
#html_file_suffix = ''
# Output file base name for HTML help builder.
htmlhelp_basename = 'scikit-learndoc'
# -- Options for LaTeX output ------------------------------------------------
# The paper size ('letter' or 'a4').
#latex_paper_size = 'letter'
# The font size ('10pt', '11pt' or '12pt').
#latex_font_size = '10pt'
# Grouping the document tree into LaTeX files. List of tuples
# (source start file, target name, title, author, documentclass
# [howto/manual]).
latex_documents = [('index', 'user_guide.tex', u('scikit-learn user guide'),
u('scikit-learn developers'), 'manual'), ]
# The name of an image file (relative to this directory) to place at the top of
# the title page.
latex_logo = "logos/scikit-learn-logo.png"
# For "manual" documents, if this is true, then toplevel headings are parts,
# not chapters.
#latex_use_parts = False
# Additional stuff for the LaTeX preamble.
latex_preamble = r"""
\usepackage{amsmath}\usepackage{amsfonts}\usepackage{bm}\usepackage{morefloats}
\usepackage{enumitem} \setlistdepth{10}
"""
# Documents to append as an appendix to all manuals.
#latex_appendices = []
# If false, no module index is generated.
latex_domain_indices = False
trim_doctests_flags = True
def generate_example_rst(app, what, name, obj, options, lines):
# generate empty examples files, so that we don't get
# inclusion errors if there are no examples for a class / module
examples_path = os.path.join(app.srcdir, "modules", "generated",
"%s.examples" % name)
if not os.path.exists(examples_path):
# touch file
open(examples_path, 'w').close()
def setup(app):
# to hide/show the prompt in code examples:
app.add_javascript('js/copybutton.js')
app.connect('autodoc-process-docstring', generate_example_rst)
# The following is used by sphinx.ext.linkcode to provide links to github
linkcode_resolve = make_linkcode_resolve('sklearn',
u'https://github.com/scikit-learn/'
'scikit-learn/blob/{revision}/'
'{package}/{path}#L{lineno}')
|
bsd-3-clause
|
KonradBreitsprecher/espresso
|
samples/lb_profile.py
|
1
|
1902
|
import numpy as np
import matplotlib.pyplot as plt
import espressomd
import espressomd.lb
import espressomd.observables
import espressomd.shapes
import espressomd.lbboundaries
import espressomd.accumulators
system = espressomd.System(box_l=[10.0, 10.0, 5.0])
system.time_step = 0.01
system.cell_system.skin = 0.4
lb_fluid = espressomd.lb.LBFluidGPU(agrid=1.0, fric=1.0, dens=1.0, visc=1.0, tau=0.01, ext_force=[0, 0, 0.15])
system.actors.add(lb_fluid)
system.thermostat.set_lb(kT=1.0)
fluid_obs = espressomd.observables.CylindricalLBVelocityProfile(
center = [5.0, 5.0, 0.0],
axis = 'z',
n_r_bins = 100,
n_phi_bins = 1,
n_z_bins = 1,
min_r = 0.0,
max_r = 4.0,
min_phi = -np.pi,
max_phi = np.pi,
min_z = 0.0,
max_z = 10.0,
sampling_delta_x = 0.05,
sampling_delta_y = 0.05,
sampling_delta_z = 1.0)
cylinder_shape = espressomd.shapes.Cylinder(
center = [5.0, 5.0, 5.0],
axis = [0, 0, 1],
direction = -1,
radius = 4.0,
length = 20.0)
cylinder_boundary = espressomd.lbboundaries.LBBoundary(shape=cylinder_shape)
system.lbboundaries.add(cylinder_boundary)
system.integrator.run(5000)
accumulator = espressomd.accumulators.MeanVarianceCalculator(obs=fluid_obs)
system.auto_update_accumulators.add(accumulator)
system.integrator.run(5000)
lb_fluid_profile = accumulator.get_mean()
lb_fluid_profile = np.reshape(lb_fluid_profile, (100, 1, 1, 3))
def poiseuille_flow(r, R, ext_force):
return ext_force * 1./4 * (R**2.0-r**2.0)
# Please note that due to symmetry and interpolation a plateau is seen near r=0.
n_bins = len(lb_fluid_profile[:, 0, 0, 2])
r_max = 4.0
r = np.linspace(0.0, r_max, n_bins)
plt.plot(r, lb_fluid_profile[:, 0, 0, 2], label='LB profile')
plt.plot(r, poiseuille_flow(r, r_max, 0.15), label='analytical solution')
plt.show()
|
gpl-3.0
|
sambitgaan/nupic
|
external/linux32/lib/python2.6/site-packages/matplotlib/axes.py
|
69
|
259904
|
from __future__ import division, generators
import math, sys, warnings, datetime, new
import numpy as np
from numpy import ma
import matplotlib
rcParams = matplotlib.rcParams
import matplotlib.artist as martist
import matplotlib.axis as maxis
import matplotlib.cbook as cbook
import matplotlib.collections as mcoll
import matplotlib.colors as mcolors
import matplotlib.contour as mcontour
import matplotlib.dates as mdates
import matplotlib.font_manager as font_manager
import matplotlib.image as mimage
import matplotlib.legend as mlegend
import matplotlib.lines as mlines
import matplotlib.mlab as mlab
import matplotlib.patches as mpatches
import matplotlib.quiver as mquiver
import matplotlib.scale as mscale
import matplotlib.table as mtable
import matplotlib.text as mtext
import matplotlib.ticker as mticker
import matplotlib.transforms as mtransforms
iterable = cbook.iterable
is_string_like = cbook.is_string_like
def _process_plot_format(fmt):
"""
Process a matlab(TM) style color/line style format string. Return a
(*linestyle*, *color*) tuple as a result of the processing. Default
values are ('-', 'b'). Example format strings include:
* 'ko': black circles
* '.b': blue dots
* 'r--': red dashed lines
.. seealso::
:func:`~matplotlib.Line2D.lineStyles` and
:func:`~matplotlib.pyplot.colors`:
for all possible styles and color format string.
"""
linestyle = None
marker = None
color = None
# Is fmt just a colorspec?
try:
color = mcolors.colorConverter.to_rgb(fmt)
return linestyle, marker, color # Yes.
except ValueError:
pass # No, not just a color.
# handle the multi char special cases and strip them from the
# string
if fmt.find('--')>=0:
linestyle = '--'
fmt = fmt.replace('--', '')
if fmt.find('-.')>=0:
linestyle = '-.'
fmt = fmt.replace('-.', '')
if fmt.find(' ')>=0:
linestyle = 'None'
fmt = fmt.replace(' ', '')
chars = [c for c in fmt]
for c in chars:
if c in mlines.lineStyles:
if linestyle is not None:
raise ValueError(
'Illegal format string "%s"; two linestyle symbols' % fmt)
linestyle = c
elif c in mlines.lineMarkers:
if marker is not None:
raise ValueError(
'Illegal format string "%s"; two marker symbols' % fmt)
marker = c
elif c in mcolors.colorConverter.colors:
if color is not None:
raise ValueError(
'Illegal format string "%s"; two color symbols' % fmt)
color = c
else:
raise ValueError(
'Unrecognized character %c in format string' % c)
if linestyle is None and marker is None:
linestyle = rcParams['lines.linestyle']
if linestyle is None:
linestyle = 'None'
if marker is None:
marker = 'None'
return linestyle, marker, color
def set_default_color_cycle(clist):
"""
Change the default cycle of colors that will be used by the plot
command. This must be called before creating the
:class:`Axes` to which it will apply; it will
apply to all future axes.
*clist* is a sequence of mpl color specifiers
"""
_process_plot_var_args.defaultColors = clist[:]
rcParams['lines.color'] = clist[0]
class _process_plot_var_args:
"""
Process variable length arguments to the plot command, so that
plot commands like the following are supported::
plot(t, s)
plot(t1, s1, t2, s2)
plot(t1, s1, 'ko', t2, s2)
plot(t1, s1, 'ko', t2, s2, 'r--', t3, e3)
an arbitrary number of *x*, *y*, *fmt* are allowed
"""
defaultColors = ['b','g','r','c','m','y','k']
def __init__(self, axes, command='plot'):
self.axes = axes
self.command = command
self._clear_color_cycle()
def _clear_color_cycle(self):
self.colors = _process_plot_var_args.defaultColors[:]
# if the default line color is a color format string, move it up
# in the que
try: ind = self.colors.index(rcParams['lines.color'])
except ValueError:
self.firstColor = rcParams['lines.color']
else:
self.colors[0], self.colors[ind] = self.colors[ind], self.colors[0]
self.firstColor = self.colors[0]
self.Ncolors = len(self.colors)
self.count = 0
def set_color_cycle(self, clist):
self.colors = clist[:]
self.firstColor = self.colors[0]
self.Ncolors = len(self.colors)
self.count = 0
def _get_next_cycle_color(self):
if self.count==0:
color = self.firstColor
else:
color = self.colors[int(self.count % self.Ncolors)]
self.count += 1
return color
def __call__(self, *args, **kwargs):
if self.axes.xaxis is not None and self.axes.yaxis is not None:
xunits = kwargs.pop( 'xunits', self.axes.xaxis.units)
yunits = kwargs.pop( 'yunits', self.axes.yaxis.units)
if xunits!=self.axes.xaxis.units:
self.axes.xaxis.set_units(xunits)
if yunits!=self.axes.yaxis.units:
self.axes.yaxis.set_units(yunits)
ret = self._grab_next_args(*args, **kwargs)
return ret
def set_lineprops(self, line, **kwargs):
assert self.command == 'plot', 'set_lineprops only works with "plot"'
for key, val in kwargs.items():
funcName = "set_%s"%key
if not hasattr(line,funcName):
raise TypeError, 'There is no line property "%s"'%key
func = getattr(line,funcName)
func(val)
def set_patchprops(self, fill_poly, **kwargs):
assert self.command == 'fill', 'set_patchprops only works with "fill"'
for key, val in kwargs.items():
funcName = "set_%s"%key
if not hasattr(fill_poly,funcName):
raise TypeError, 'There is no patch property "%s"'%key
func = getattr(fill_poly,funcName)
func(val)
def _xy_from_y(self, y):
if self.axes.yaxis is not None:
b = self.axes.yaxis.update_units(y)
if b: return np.arange(len(y)), y, False
if not ma.isMaskedArray(y):
y = np.asarray(y)
if len(y.shape) == 1:
y = y[:,np.newaxis]
nr, nc = y.shape
x = np.arange(nr)
if len(x.shape) == 1:
x = x[:,np.newaxis]
return x,y, True
def _xy_from_xy(self, x, y):
if self.axes.xaxis is not None and self.axes.yaxis is not None:
bx = self.axes.xaxis.update_units(x)
by = self.axes.yaxis.update_units(y)
# right now multicol is not supported if either x or y are
# unit enabled but this can be fixed..
if bx or by: return x, y, False
x = ma.asarray(x)
y = ma.asarray(y)
if len(x.shape) == 1:
x = x[:,np.newaxis]
if len(y.shape) == 1:
y = y[:,np.newaxis]
nrx, ncx = x.shape
nry, ncy = y.shape
assert nrx == nry, 'Dimensions of x and y are incompatible'
if ncx == ncy:
return x, y, True
if ncx == 1:
x = np.repeat(x, ncy, axis=1)
if ncy == 1:
y = np.repeat(y, ncx, axis=1)
assert x.shape == y.shape, 'Dimensions of x and y are incompatible'
return x, y, True
def _plot_1_arg(self, y, **kwargs):
assert self.command == 'plot', 'fill needs at least 2 arguments'
ret = []
x, y, multicol = self._xy_from_y(y)
if multicol:
for j in xrange(y.shape[1]):
color = self._get_next_cycle_color()
seg = mlines.Line2D(x, y[:,j],
color = color,
axes=self.axes,
)
self.set_lineprops(seg, **kwargs)
ret.append(seg)
else:
color = self._get_next_cycle_color()
seg = mlines.Line2D(x, y,
color = color,
axes=self.axes,
)
self.set_lineprops(seg, **kwargs)
ret.append(seg)
return ret
def _plot_2_args(self, tup2, **kwargs):
ret = []
if is_string_like(tup2[1]):
assert self.command == 'plot', ('fill needs at least 2 non-string '
'arguments')
y, fmt = tup2
x, y, multicol = self._xy_from_y(y)
linestyle, marker, color = _process_plot_format(fmt)
def makeline(x, y):
_color = color
if _color is None:
_color = self._get_next_cycle_color()
seg = mlines.Line2D(x, y,
color=_color,
linestyle=linestyle, marker=marker,
axes=self.axes,
)
self.set_lineprops(seg, **kwargs)
ret.append(seg)
if multicol:
for j in xrange(y.shape[1]):
makeline(x[:,j], y[:,j])
else:
makeline(x, y)
return ret
else:
x, y = tup2
x, y, multicol = self._xy_from_xy(x, y)
def makeline(x, y):
color = self._get_next_cycle_color()
seg = mlines.Line2D(x, y,
color=color,
axes=self.axes,
)
self.set_lineprops(seg, **kwargs)
ret.append(seg)
def makefill(x, y):
x = self.axes.convert_xunits(x)
y = self.axes.convert_yunits(y)
facecolor = self._get_next_cycle_color()
seg = mpatches.Polygon(np.hstack(
(x[:,np.newaxis],y[:,np.newaxis])),
facecolor = facecolor,
fill=True,
closed=closed
)
self.set_patchprops(seg, **kwargs)
ret.append(seg)
if self.command == 'plot':
func = makeline
else:
closed = kwargs.get('closed', True)
func = makefill
if multicol:
for j in xrange(y.shape[1]):
func(x[:,j], y[:,j])
else:
func(x, y)
return ret
def _plot_3_args(self, tup3, **kwargs):
ret = []
x, y, fmt = tup3
x, y, multicol = self._xy_from_xy(x, y)
linestyle, marker, color = _process_plot_format(fmt)
def makeline(x, y):
_color = color
if _color is None:
_color = self._get_next_cycle_color()
seg = mlines.Line2D(x, y,
color=_color,
linestyle=linestyle, marker=marker,
axes=self.axes,
)
self.set_lineprops(seg, **kwargs)
ret.append(seg)
def makefill(x, y):
facecolor = color
x = self.axes.convert_xunits(x)
y = self.axes.convert_yunits(y)
seg = mpatches.Polygon(np.hstack(
(x[:,np.newaxis],y[:,np.newaxis])),
facecolor = facecolor,
fill=True,
closed=closed
)
self.set_patchprops(seg, **kwargs)
ret.append(seg)
if self.command == 'plot':
func = makeline
else:
closed = kwargs.get('closed', True)
func = makefill
if multicol:
for j in xrange(y.shape[1]):
func(x[:,j], y[:,j])
else:
func(x, y)
return ret
def _grab_next_args(self, *args, **kwargs):
remaining = args
while 1:
if len(remaining)==0: return
if len(remaining)==1:
for seg in self._plot_1_arg(remaining[0], **kwargs):
yield seg
remaining = []
continue
if len(remaining)==2:
for seg in self._plot_2_args(remaining, **kwargs):
yield seg
remaining = []
continue
if len(remaining)==3:
if not is_string_like(remaining[2]):
raise ValueError, 'third arg must be a format string'
for seg in self._plot_3_args(remaining, **kwargs):
yield seg
remaining=[]
continue
if is_string_like(remaining[2]):
for seg in self._plot_3_args(remaining[:3], **kwargs):
yield seg
remaining=remaining[3:]
else:
for seg in self._plot_2_args(remaining[:2], **kwargs):
yield seg
remaining=remaining[2:]
class Axes(martist.Artist):
"""
The :class:`Axes` contains most of the figure elements:
:class:`~matplotlib.axis.Axis`, :class:`~matplotlib.axis.Tick`,
:class:`~matplotlib.lines.Line2D`, :class:`~matplotlib.text.Text`,
:class:`~matplotlib.patches.Polygon`, etc., and sets the
coordinate system.
The :class:`Axes` instance supports callbacks through a callbacks
attribute which is a :class:`~matplotlib.cbook.CallbackRegistry`
instance. The events you can connect to are 'xlim_changed' and
'ylim_changed' and the callback will be called with func(*ax*)
where *ax* is the :class:`Axes` instance.
"""
name = "rectilinear"
_shared_x_axes = cbook.Grouper()
_shared_y_axes = cbook.Grouper()
def __str__(self):
return "Axes(%g,%g;%gx%g)" % tuple(self._position.bounds)
def __init__(self, fig, rect,
axisbg = None, # defaults to rc axes.facecolor
frameon = True,
sharex=None, # use Axes instance's xaxis info
sharey=None, # use Axes instance's yaxis info
label='',
**kwargs
):
"""
Build an :class:`Axes` instance in
:class:`~matplotlib.figure.Figure` *fig* with
*rect=[left, bottom, width, height]* in
:class:`~matplotlib.figure.Figure` coordinates
Optional keyword arguments:
================ =========================================
Keyword Description
================ =========================================
*adjustable* [ 'box' | 'datalim' ]
*alpha* float: the alpha transparency
*anchor* [ 'C', 'SW', 'S', 'SE', 'E', 'NE', 'N',
'NW', 'W' ]
*aspect* [ 'auto' | 'equal' | aspect_ratio ]
*autoscale_on* [ *True* | *False* ] whether or not to
autoscale the *viewlim*
*axis_bgcolor* any matplotlib color, see
:func:`~matplotlib.pyplot.colors`
*axisbelow* draw the grids and ticks below the other
artists
*cursor_props* a (*float*, *color*) tuple
*figure* a :class:`~matplotlib.figure.Figure`
instance
*frame_on* a boolean - draw the axes frame
*label* the axes label
*navigate* [ *True* | *False* ]
*navigate_mode* [ 'PAN' | 'ZOOM' | None ] the navigation
toolbar button status
*position* [left, bottom, width, height] in
class:`~matplotlib.figure.Figure` coords
*sharex* an class:`~matplotlib.axes.Axes` instance
to share the x-axis with
*sharey* an class:`~matplotlib.axes.Axes` instance
to share the y-axis with
*title* the title string
*visible* [ *True* | *False* ] whether the axes is
visible
*xlabel* the xlabel
*xlim* (*xmin*, *xmax*) view limits
*xscale* [%(scale)s]
*xticklabels* sequence of strings
*xticks* sequence of floats
*ylabel* the ylabel strings
*ylim* (*ymin*, *ymax*) view limits
*yscale* [%(scale)s]
*yticklabels* sequence of strings
*yticks* sequence of floats
================ =========================================
""" % {'scale': ' | '.join([repr(x) for x in mscale.get_scale_names()])}
martist.Artist.__init__(self)
if isinstance(rect, mtransforms.Bbox):
self._position = rect
else:
self._position = mtransforms.Bbox.from_bounds(*rect)
self._originalPosition = self._position.frozen()
self.set_axes(self)
self.set_aspect('auto')
self._adjustable = 'box'
self.set_anchor('C')
self._sharex = sharex
self._sharey = sharey
if sharex is not None:
self._shared_x_axes.join(self, sharex)
if sharex._adjustable == 'box':
sharex._adjustable = 'datalim'
#warnings.warn(
# 'shared axes: "adjustable" is being changed to "datalim"')
self._adjustable = 'datalim'
if sharey is not None:
self._shared_y_axes.join(self, sharey)
if sharey._adjustable == 'box':
sharey._adjustable = 'datalim'
#warnings.warn(
# 'shared axes: "adjustable" is being changed to "datalim"')
self._adjustable = 'datalim'
self.set_label(label)
self.set_figure(fig)
# this call may differ for non-sep axes, eg polar
self._init_axis()
if axisbg is None: axisbg = rcParams['axes.facecolor']
self._axisbg = axisbg
self._frameon = frameon
self._axisbelow = rcParams['axes.axisbelow']
self._hold = rcParams['axes.hold']
self._connected = {} # a dict from events to (id, func)
self.cla()
# funcs used to format x and y - fall back on major formatters
self.fmt_xdata = None
self.fmt_ydata = None
self.set_cursor_props((1,'k')) # set the cursor properties for axes
self._cachedRenderer = None
self.set_navigate(True)
self.set_navigate_mode(None)
if len(kwargs): martist.setp(self, **kwargs)
if self.xaxis is not None:
self._xcid = self.xaxis.callbacks.connect('units finalize',
self.relim)
if self.yaxis is not None:
self._ycid = self.yaxis.callbacks.connect('units finalize',
self.relim)
def get_window_extent(self, *args, **kwargs):
'''
get the axes bounding box in display space; *args* and
*kwargs* are empty
'''
return self.bbox
def _init_axis(self):
"move this out of __init__ because non-separable axes don't use it"
self.xaxis = maxis.XAxis(self)
self.yaxis = maxis.YAxis(self)
self._update_transScale()
def set_figure(self, fig):
"""
Set the class:`~matplotlib.axes.Axes` figure
accepts a class:`~matplotlib.figure.Figure` instance
"""
martist.Artist.set_figure(self, fig)
self.bbox = mtransforms.TransformedBbox(self._position, fig.transFigure)
#these will be updated later as data is added
self.dataLim = mtransforms.Bbox.unit()
self.viewLim = mtransforms.Bbox.unit()
self.transScale = mtransforms.TransformWrapper(
mtransforms.IdentityTransform())
self._set_lim_and_transforms()
def _set_lim_and_transforms(self):
"""
set the *dataLim* and *viewLim*
:class:`~matplotlib.transforms.Bbox` attributes and the
*transScale*, *transData*, *transLimits* and *transAxes*
transformations.
"""
self.transAxes = mtransforms.BboxTransformTo(self.bbox)
# Transforms the x and y axis separately by a scale factor
# It is assumed that this part will have non-linear components
self.transScale = mtransforms.TransformWrapper(
mtransforms.IdentityTransform())
# An affine transformation on the data, generally to limit the
# range of the axes
self.transLimits = mtransforms.BboxTransformFrom(
mtransforms.TransformedBbox(self.viewLim, self.transScale))
# The parentheses are important for efficiency here -- they
# group the last two (which are usually affines) separately
# from the first (which, with log-scaling can be non-affine).
self.transData = self.transScale + (self.transLimits + self.transAxes)
self._xaxis_transform = mtransforms.blended_transform_factory(
self.axes.transData, self.axes.transAxes)
self._yaxis_transform = mtransforms.blended_transform_factory(
self.axes.transAxes, self.axes.transData)
def get_xaxis_transform(self):
"""
Get the transformation used for drawing x-axis labels, ticks
and gridlines. The x-direction is in data coordinates and the
y-direction is in axis coordinates.
.. note::
This transformation is primarily used by the
:class:`~matplotlib.axis.Axis` class, and is meant to be
overridden by new kinds of projections that may need to
place axis elements in different locations.
"""
return self._xaxis_transform
def get_xaxis_text1_transform(self, pad_points):
"""
Get the transformation used for drawing x-axis labels, which
will add the given amount of padding (in points) between the
axes and the label. The x-direction is in data coordinates
and the y-direction is in axis coordinates. Returns a
3-tuple of the form::
(transform, valign, halign)
where *valign* and *halign* are requested alignments for the
text.
.. note::
This transformation is primarily used by the
:class:`~matplotlib.axis.Axis` class, and is meant to be
overridden by new kinds of projections that may need to
place axis elements in different locations.
"""
return (self._xaxis_transform +
mtransforms.ScaledTranslation(0, -1 * pad_points / 72.0,
self.figure.dpi_scale_trans),
"top", "center")
def get_xaxis_text2_transform(self, pad_points):
"""
Get the transformation used for drawing the secondary x-axis
labels, which will add the given amount of padding (in points)
between the axes and the label. The x-direction is in data
coordinates and the y-direction is in axis coordinates.
Returns a 3-tuple of the form::
(transform, valign, halign)
where *valign* and *halign* are requested alignments for the
text.
.. note::
This transformation is primarily used by the
:class:`~matplotlib.axis.Axis` class, and is meant to be
overridden by new kinds of projections that may need to
place axis elements in different locations.
"""
return (self._xaxis_transform +
mtransforms.ScaledTranslation(0, pad_points / 72.0,
self.figure.dpi_scale_trans),
"bottom", "center")
def get_yaxis_transform(self):
"""
Get the transformation used for drawing y-axis labels, ticks
and gridlines. The x-direction is in axis coordinates and the
y-direction is in data coordinates.
.. note::
This transformation is primarily used by the
:class:`~matplotlib.axis.Axis` class, and is meant to be
overridden by new kinds of projections that may need to
place axis elements in different locations.
"""
return self._yaxis_transform
def get_yaxis_text1_transform(self, pad_points):
"""
Get the transformation used for drawing y-axis labels, which
will add the given amount of padding (in points) between the
axes and the label. The x-direction is in axis coordinates
and the y-direction is in data coordinates. Returns a 3-tuple
of the form::
(transform, valign, halign)
where *valign* and *halign* are requested alignments for the
text.
.. note::
This transformation is primarily used by the
:class:`~matplotlib.axis.Axis` class, and is meant to be
overridden by new kinds of projections that may need to
place axis elements in different locations.
"""
return (self._yaxis_transform +
mtransforms.ScaledTranslation(-1 * pad_points / 72.0, 0,
self.figure.dpi_scale_trans),
"center", "right")
def get_yaxis_text2_transform(self, pad_points):
"""
Get the transformation used for drawing the secondary y-axis
labels, which will add the given amount of padding (in points)
between the axes and the label. The x-direction is in axis
coordinates and the y-direction is in data coordinates.
Returns a 3-tuple of the form::
(transform, valign, halign)
where *valign* and *halign* are requested alignments for the
text.
.. note::
This transformation is primarily used by the
:class:`~matplotlib.axis.Axis` class, and is meant to be
overridden by new kinds of projections that may need to
place axis elements in different locations.
"""
return (self._yaxis_transform +
mtransforms.ScaledTranslation(pad_points / 72.0, 0,
self.figure.dpi_scale_trans),
"center", "left")
def _update_transScale(self):
self.transScale.set(
mtransforms.blended_transform_factory(
self.xaxis.get_transform(), self.yaxis.get_transform()))
if hasattr(self, "lines"):
for line in self.lines:
line._transformed_path.invalidate()
def get_position(self, original=False):
'Return the a copy of the axes rectangle as a Bbox'
if original:
return self._originalPosition.frozen()
else:
return self._position.frozen()
def set_position(self, pos, which='both'):
"""
Set the axes position with::
pos = [left, bottom, width, height]
in relative 0,1 coords, or *pos* can be a
:class:`~matplotlib.transforms.Bbox`
There are two position variables: one which is ultimately
used, but which may be modified by :meth:`apply_aspect`, and a
second which is the starting point for :meth:`apply_aspect`.
Optional keyword arguments:
*which*
========== ====================
value description
========== ====================
'active' to change the first
'original' to change the second
'both' to change both
========== ====================
"""
if not isinstance(pos, mtransforms.BboxBase):
pos = mtransforms.Bbox.from_bounds(*pos)
if which in ('both', 'active'):
self._position.set(pos)
if which in ('both', 'original'):
self._originalPosition.set(pos)
def reset_position(self):
'Make the original position the active position'
pos = self.get_position(original=True)
self.set_position(pos, which='active')
def _set_artist_props(self, a):
'set the boilerplate props for artists added to axes'
a.set_figure(self.figure)
if not a.is_transform_set():
a.set_transform(self.transData)
a.set_axes(self)
def _gen_axes_patch(self):
"""
Returns the patch used to draw the background of the axes. It
is also used as the clipping path for any data elements on the
axes.
In the standard axes, this is a rectangle, but in other
projections it may not be.
.. note::
Intended to be overridden by new projection types.
"""
return mpatches.Rectangle((0.0, 0.0), 1.0, 1.0)
def cla(self):
'Clear the current axes'
# Note: this is called by Axes.__init__()
self.xaxis.cla()
self.yaxis.cla()
self.ignore_existing_data_limits = True
self.callbacks = cbook.CallbackRegistry(('xlim_changed',
'ylim_changed'))
if self._sharex is not None:
# major and minor are class instances with
# locator and formatter attributes
self.xaxis.major = self._sharex.xaxis.major
self.xaxis.minor = self._sharex.xaxis.minor
x0, x1 = self._sharex.get_xlim()
self.set_xlim(x0, x1, emit=False)
self.xaxis.set_scale(self._sharex.xaxis.get_scale())
else:
self.xaxis.set_scale('linear')
if self._sharey is not None:
self.yaxis.major = self._sharey.yaxis.major
self.yaxis.minor = self._sharey.yaxis.minor
y0, y1 = self._sharey.get_ylim()
self.set_ylim(y0, y1, emit=False)
self.yaxis.set_scale(self._sharey.yaxis.get_scale())
else:
self.yaxis.set_scale('linear')
self._autoscaleon = True
self._update_transScale() # needed?
self._get_lines = _process_plot_var_args(self)
self._get_patches_for_fill = _process_plot_var_args(self, 'fill')
self._gridOn = rcParams['axes.grid']
self.lines = []
self.patches = []
self.texts = []
self.tables = []
self.artists = []
self.images = []
self.legend_ = None
self.collections = [] # collection.Collection instances
self.grid(self._gridOn)
props = font_manager.FontProperties(size=rcParams['axes.titlesize'])
self.titleOffsetTrans = mtransforms.ScaledTranslation(
0.0, 5.0 / 72.0, self.figure.dpi_scale_trans)
self.title = mtext.Text(
x=0.5, y=1.0, text='',
fontproperties=props,
verticalalignment='bottom',
horizontalalignment='center',
)
self.title.set_transform(self.transAxes + self.titleOffsetTrans)
self.title.set_clip_box(None)
self._set_artist_props(self.title)
# the patch draws the background of the axes. we want this to
# be below the other artists; the axesPatch name is
# deprecated. We use the frame to draw the edges so we are
# setting the edgecolor to None
self.patch = self.axesPatch = self._gen_axes_patch()
self.patch.set_figure(self.figure)
self.patch.set_facecolor(self._axisbg)
self.patch.set_edgecolor('None')
self.patch.set_linewidth(0)
self.patch.set_transform(self.transAxes)
# the frame draws the border around the axes and we want this
# above. this is a place holder for a more sophisticated
# artist that might just draw a left, bottom frame, or a
# centered frame, etc the axesFrame name is deprecated
self.frame = self.axesFrame = self._gen_axes_patch()
self.frame.set_figure(self.figure)
self.frame.set_facecolor('none')
self.frame.set_edgecolor(rcParams['axes.edgecolor'])
self.frame.set_linewidth(rcParams['axes.linewidth'])
self.frame.set_transform(self.transAxes)
self.frame.set_zorder(2.5)
self.axison = True
self.xaxis.set_clip_path(self.patch)
self.yaxis.set_clip_path(self.patch)
self._shared_x_axes.clean()
self._shared_y_axes.clean()
def clear(self):
'clear the axes'
self.cla()
def set_color_cycle(self, clist):
"""
Set the color cycle for any future plot commands on this Axes.
clist is a list of mpl color specifiers.
"""
self._get_lines.set_color_cycle(clist)
def ishold(self):
'return the HOLD status of the axes'
return self._hold
def hold(self, b=None):
"""
call signature::
hold(b=None)
Set the hold state. If *hold* is *None* (default), toggle the
*hold* state. Else set the *hold* state to boolean value *b*.
Examples:
* toggle hold:
>>> hold()
* turn hold on:
>>> hold(True)
* turn hold off
>>> hold(False)
When hold is True, subsequent plot commands will be added to
the current axes. When hold is False, the current axes and
figure will be cleared on the next plot command
"""
if b is None:
self._hold = not self._hold
else:
self._hold = b
def get_aspect(self):
return self._aspect
def set_aspect(self, aspect, adjustable=None, anchor=None):
"""
*aspect*
======== ================================================
value description
======== ================================================
'auto' automatic; fill position rectangle with data
'normal' same as 'auto'; deprecated
'equal' same scaling from data to plot units for x and y
num a circle will be stretched such that the height
is num times the width. aspect=1 is the same as
aspect='equal'.
======== ================================================
*adjustable*
========= ============================
value description
========= ============================
'box' change physical size of axes
'datalim' change xlim or ylim
========= ============================
*anchor*
===== =====================
value description
===== =====================
'C' centered
'SW' lower left corner
'S' middle of bottom edge
'SE' lower right corner
etc.
===== =====================
"""
if aspect in ('normal', 'auto'):
self._aspect = 'auto'
elif aspect == 'equal':
self._aspect = 'equal'
else:
self._aspect = float(aspect) # raise ValueError if necessary
if adjustable is not None:
self.set_adjustable(adjustable)
if anchor is not None:
self.set_anchor(anchor)
def get_adjustable(self):
return self._adjustable
def set_adjustable(self, adjustable):
"""
ACCEPTS: [ 'box' | 'datalim' ]
"""
if adjustable in ('box', 'datalim'):
if self in self._shared_x_axes or self in self._shared_y_axes:
if adjustable == 'box':
raise ValueError(
'adjustable must be "datalim" for shared axes')
self._adjustable = adjustable
else:
raise ValueError('argument must be "box", or "datalim"')
def get_anchor(self):
return self._anchor
def set_anchor(self, anchor):
"""
*anchor*
===== ============
value description
===== ============
'C' Center
'SW' bottom left
'S' bottom
'SE' bottom right
'E' right
'NE' top right
'N' top
'NW' top left
'W' left
===== ============
"""
if anchor in mtransforms.Bbox.coefs.keys() or len(anchor) == 2:
self._anchor = anchor
else:
raise ValueError('argument must be among %s' %
', '.join(mtransforms.BBox.coefs.keys()))
def get_data_ratio(self):
"""
Returns the aspect ratio of the raw data.
This method is intended to be overridden by new projection
types.
"""
xmin,xmax = self.get_xbound()
xsize = max(math.fabs(xmax-xmin), 1e-30)
ymin,ymax = self.get_ybound()
ysize = max(math.fabs(ymax-ymin), 1e-30)
return ysize/xsize
def apply_aspect(self, position=None):
'''
Use :meth:`_aspect` and :meth:`_adjustable` to modify the
axes box or the view limits.
'''
if position is None:
position = self.get_position(original=True)
aspect = self.get_aspect()
if aspect == 'auto':
self.set_position( position , which='active')
return
if aspect == 'equal':
A = 1
else:
A = aspect
#Ensure at drawing time that any Axes involved in axis-sharing
# does not have its position changed.
if self in self._shared_x_axes or self in self._shared_y_axes:
if self._adjustable == 'box':
self._adjustable = 'datalim'
warnings.warn(
'shared axes: "adjustable" is being changed to "datalim"')
figW,figH = self.get_figure().get_size_inches()
fig_aspect = figH/figW
if self._adjustable == 'box':
box_aspect = A * self.get_data_ratio()
pb = position.frozen()
pb1 = pb.shrunk_to_aspect(box_aspect, pb, fig_aspect)
self.set_position(pb1.anchored(self.get_anchor(), pb), 'active')
return
# reset active to original in case it had been changed
# by prior use of 'box'
self.set_position(position, which='active')
xmin,xmax = self.get_xbound()
xsize = max(math.fabs(xmax-xmin), 1e-30)
ymin,ymax = self.get_ybound()
ysize = max(math.fabs(ymax-ymin), 1e-30)
l,b,w,h = position.bounds
box_aspect = fig_aspect * (h/w)
data_ratio = box_aspect / A
y_expander = (data_ratio*xsize/ysize - 1.0)
#print 'y_expander', y_expander
# If y_expander > 0, the dy/dx viewLim ratio needs to increase
if abs(y_expander) < 0.005:
#print 'good enough already'
return
dL = self.dataLim
xr = 1.05 * dL.width
yr = 1.05 * dL.height
xmarg = xsize - xr
ymarg = ysize - yr
Ysize = data_ratio * xsize
Xsize = ysize / data_ratio
Xmarg = Xsize - xr
Ymarg = Ysize - yr
xm = 0 # Setting these targets to, e.g., 0.05*xr does not seem to help.
ym = 0
#print 'xmin, xmax, ymin, ymax', xmin, xmax, ymin, ymax
#print 'xsize, Xsize, ysize, Ysize', xsize, Xsize, ysize, Ysize
changex = (self in self._shared_y_axes
and self not in self._shared_x_axes)
changey = (self in self._shared_x_axes
and self not in self._shared_y_axes)
if changex and changey:
warnings.warn("adjustable='datalim' cannot work with shared "
"x and y axes")
return
if changex:
adjust_y = False
else:
#print 'xmarg, ymarg, Xmarg, Ymarg', xmarg, ymarg, Xmarg, Ymarg
if xmarg > xm and ymarg > ym:
adjy = ((Ymarg > 0 and y_expander < 0)
or (Xmarg < 0 and y_expander > 0))
else:
adjy = y_expander > 0
#print 'y_expander, adjy', y_expander, adjy
adjust_y = changey or adjy #(Ymarg > xmarg)
if adjust_y:
yc = 0.5*(ymin+ymax)
y0 = yc - Ysize/2.0
y1 = yc + Ysize/2.0
self.set_ybound((y0, y1))
#print 'New y0, y1:', y0, y1
#print 'New ysize, ysize/xsize', y1-y0, (y1-y0)/xsize
else:
xc = 0.5*(xmin+xmax)
x0 = xc - Xsize/2.0
x1 = xc + Xsize/2.0
self.set_xbound((x0, x1))
#print 'New x0, x1:', x0, x1
#print 'New xsize, ysize/xsize', x1-x0, ysize/(x1-x0)
def axis(self, *v, **kwargs):
'''
Convenience method for manipulating the x and y view limits
and the aspect ratio of the plot.
*kwargs* are passed on to :meth:`set_xlim` and
:meth:`set_ylim`
'''
if len(v)==1 and is_string_like(v[0]):
s = v[0].lower()
if s=='on': self.set_axis_on()
elif s=='off': self.set_axis_off()
elif s in ('equal', 'tight', 'scaled', 'normal', 'auto', 'image'):
self.set_autoscale_on(True)
self.set_aspect('auto')
self.autoscale_view()
# self.apply_aspect()
if s=='equal':
self.set_aspect('equal', adjustable='datalim')
elif s == 'scaled':
self.set_aspect('equal', adjustable='box', anchor='C')
self.set_autoscale_on(False) # Req. by Mark Bakker
elif s=='tight':
self.autoscale_view(tight=True)
self.set_autoscale_on(False)
elif s == 'image':
self.autoscale_view(tight=True)
self.set_autoscale_on(False)
self.set_aspect('equal', adjustable='box', anchor='C')
else:
raise ValueError('Unrecognized string %s to axis; '
'try on or off' % s)
xmin, xmax = self.get_xlim()
ymin, ymax = self.get_ylim()
return xmin, xmax, ymin, ymax
try: v[0]
except IndexError:
emit = kwargs.get('emit', True)
xmin = kwargs.get('xmin', None)
xmax = kwargs.get('xmax', None)
xmin, xmax = self.set_xlim(xmin, xmax, emit)
ymin = kwargs.get('ymin', None)
ymax = kwargs.get('ymax', None)
ymin, ymax = self.set_ylim(ymin, ymax, emit)
return xmin, xmax, ymin, ymax
v = v[0]
if len(v) != 4:
raise ValueError('v must contain [xmin xmax ymin ymax]')
self.set_xlim([v[0], v[1]])
self.set_ylim([v[2], v[3]])
return v
def get_child_artists(self):
"""
Return a list of artists the axes contains.
.. deprecated:: 0.98
"""
raise DeprecationWarning('Use get_children instead')
def get_frame(self):
'Return the axes Rectangle frame'
warnings.warn('use ax.patch instead', DeprecationWarning)
return self.patch
def get_legend(self):
'Return the legend.Legend instance, or None if no legend is defined'
return self.legend_
def get_images(self):
'return a list of Axes images contained by the Axes'
return cbook.silent_list('AxesImage', self.images)
def get_lines(self):
'Return a list of lines contained by the Axes'
return cbook.silent_list('Line2D', self.lines)
def get_xaxis(self):
'Return the XAxis instance'
return self.xaxis
def get_xgridlines(self):
'Get the x grid lines as a list of Line2D instances'
return cbook.silent_list('Line2D xgridline', self.xaxis.get_gridlines())
def get_xticklines(self):
'Get the xtick lines as a list of Line2D instances'
return cbook.silent_list('Text xtickline', self.xaxis.get_ticklines())
def get_yaxis(self):
'Return the YAxis instance'
return self.yaxis
def get_ygridlines(self):
'Get the y grid lines as a list of Line2D instances'
return cbook.silent_list('Line2D ygridline', self.yaxis.get_gridlines())
def get_yticklines(self):
'Get the ytick lines as a list of Line2D instances'
return cbook.silent_list('Line2D ytickline', self.yaxis.get_ticklines())
#### Adding and tracking artists
def has_data(self):
'''Return *True* if any artists have been added to axes.
This should not be used to determine whether the *dataLim*
need to be updated, and may not actually be useful for
anything.
'''
return (
len(self.collections) +
len(self.images) +
len(self.lines) +
len(self.patches))>0
def add_artist(self, a):
'Add any :class:`~matplotlib.artist.Artist` to the axes'
a.set_axes(self)
self.artists.append(a)
self._set_artist_props(a)
a.set_clip_path(self.patch)
a._remove_method = lambda h: self.artists.remove(h)
def add_collection(self, collection, autolim=True):
'''
add a :class:`~matplotlib.collections.Collection` instance
to the axes
'''
label = collection.get_label()
if not label:
collection.set_label('collection%d'%len(self.collections))
self.collections.append(collection)
self._set_artist_props(collection)
collection.set_clip_path(self.patch)
if autolim:
if collection._paths and len(collection._paths):
self.update_datalim(collection.get_datalim(self.transData))
collection._remove_method = lambda h: self.collections.remove(h)
def add_line(self, line):
'''
Add a :class:`~matplotlib.lines.Line2D` to the list of plot
lines
'''
self._set_artist_props(line)
line.set_clip_path(self.patch)
self._update_line_limits(line)
if not line.get_label():
line.set_label('_line%d'%len(self.lines))
self.lines.append(line)
line._remove_method = lambda h: self.lines.remove(h)
def _update_line_limits(self, line):
p = line.get_path()
if p.vertices.size > 0:
self.dataLim.update_from_path(p, self.ignore_existing_data_limits,
updatex=line.x_isdata,
updatey=line.y_isdata)
self.ignore_existing_data_limits = False
def add_patch(self, p):
"""
Add a :class:`~matplotlib.patches.Patch` *p* to the list of
axes patches; the clipbox will be set to the Axes clipping
box. If the transform is not set, it will be set to
:attr:`transData`.
"""
self._set_artist_props(p)
p.set_clip_path(self.patch)
self._update_patch_limits(p)
self.patches.append(p)
p._remove_method = lambda h: self.patches.remove(h)
def _update_patch_limits(self, patch):
'update the data limits for patch *p*'
# hist can add zero height Rectangles, which is useful to keep
# the bins, counts and patches lined up, but it throws off log
# scaling. We'll ignore rects with zero height or width in
# the auto-scaling
if (isinstance(patch, mpatches.Rectangle) and
(patch.get_width()==0 or patch.get_height()==0)):
return
vertices = patch.get_path().vertices
if vertices.size > 0:
xys = patch.get_patch_transform().transform(vertices)
if patch.get_data_transform() != self.transData:
transform = (patch.get_data_transform() +
self.transData.inverted())
xys = transform.transform(xys)
self.update_datalim(xys, updatex=patch.x_isdata,
updatey=patch.y_isdata)
def add_table(self, tab):
'''
Add a :class:`~matplotlib.tables.Table` instance to the
list of axes tables
'''
self._set_artist_props(tab)
self.tables.append(tab)
tab.set_clip_path(self.patch)
tab._remove_method = lambda h: self.tables.remove(h)
def relim(self):
'recompute the data limits based on current artists'
# Collections are deliberately not supported (yet); see
# the TODO note in artists.py.
self.dataLim.ignore(True)
self.ignore_existing_data_limits = True
for line in self.lines:
self._update_line_limits(line)
for p in self.patches:
self._update_patch_limits(p)
def update_datalim(self, xys, updatex=True, updatey=True):
'Update the data lim bbox with seq of xy tups or equiv. 2-D array'
# if no data is set currently, the bbox will ignore its
# limits and set the bound to be the bounds of the xydata.
# Otherwise, it will compute the bounds of it's current data
# and the data in xydata
if iterable(xys) and not len(xys): return
if not ma.isMaskedArray(xys):
xys = np.asarray(xys)
self.dataLim.update_from_data_xy(xys, self.ignore_existing_data_limits,
updatex=updatex, updatey=updatey)
self.ignore_existing_data_limits = False
def update_datalim_numerix(self, x, y):
'Update the data lim bbox with seq of xy tups'
# if no data is set currently, the bbox will ignore it's
# limits and set the bound to be the bounds of the xydata.
# Otherwise, it will compute the bounds of it's current data
# and the data in xydata
if iterable(x) and not len(x): return
self.dataLim.update_from_data(x, y, self.ignore_existing_data_limits)
self.ignore_existing_data_limits = False
def update_datalim_bounds(self, bounds):
'''
Update the datalim to include the given
:class:`~matplotlib.transforms.Bbox` *bounds*
'''
self.dataLim.set(mtransforms.Bbox.union([self.dataLim, bounds]))
def _process_unit_info(self, xdata=None, ydata=None, kwargs=None):
'look for unit *kwargs* and update the axis instances as necessary'
if self.xaxis is None or self.yaxis is None: return
#print 'processing', self.get_geometry()
if xdata is not None:
# we only need to update if there is nothing set yet.
if not self.xaxis.have_units():
self.xaxis.update_units(xdata)
#print '\tset from xdata', self.xaxis.units
if ydata is not None:
# we only need to update if there is nothing set yet.
if not self.yaxis.have_units():
self.yaxis.update_units(ydata)
#print '\tset from ydata', self.yaxis.units
# process kwargs 2nd since these will override default units
if kwargs is not None:
xunits = kwargs.pop( 'xunits', self.xaxis.units)
if xunits!=self.xaxis.units:
#print '\tkw setting xunits', xunits
self.xaxis.set_units(xunits)
# If the units being set imply a different converter,
# we need to update.
if xdata is not None:
self.xaxis.update_units(xdata)
yunits = kwargs.pop('yunits', self.yaxis.units)
if yunits!=self.yaxis.units:
#print '\tkw setting yunits', yunits
self.yaxis.set_units(yunits)
# If the units being set imply a different converter,
# we need to update.
if ydata is not None:
self.yaxis.update_units(ydata)
def in_axes(self, mouseevent):
'''
return *True* if the given *mouseevent* (in display coords)
is in the Axes
'''
return self.patch.contains(mouseevent)[0]
def get_autoscale_on(self):
"""
Get whether autoscaling is applied on plot commands
"""
return self._autoscaleon
def set_autoscale_on(self, b):
"""
Set whether autoscaling is applied on plot commands
accepts: [ *True* | *False* ]
"""
self._autoscaleon = b
def autoscale_view(self, tight=False, scalex=True, scaley=True):
"""
autoscale the view limits using the data limits. You can
selectively autoscale only a single axis, eg, the xaxis by
setting *scaley* to *False*. The autoscaling preserves any
axis direction reversal that has already been done.
"""
# if image data only just use the datalim
if not self._autoscaleon: return
if scalex:
xshared = self._shared_x_axes.get_siblings(self)
dl = [ax.dataLim for ax in xshared]
bb = mtransforms.BboxBase.union(dl)
x0, x1 = bb.intervalx
if scaley:
yshared = self._shared_y_axes.get_siblings(self)
dl = [ax.dataLim for ax in yshared]
bb = mtransforms.BboxBase.union(dl)
y0, y1 = bb.intervaly
if (tight or (len(self.images)>0 and
len(self.lines)==0 and
len(self.patches)==0)):
if scalex:
self.set_xbound(x0, x1)
if scaley:
self.set_ybound(y0, y1)
return
if scalex:
XL = self.xaxis.get_major_locator().view_limits(x0, x1)
self.set_xbound(XL)
if scaley:
YL = self.yaxis.get_major_locator().view_limits(y0, y1)
self.set_ybound(YL)
#### Drawing
def draw(self, renderer=None, inframe=False):
"Draw everything (plot lines, axes, labels)"
if renderer is None:
renderer = self._cachedRenderer
if renderer is None:
raise RuntimeError('No renderer defined')
if not self.get_visible(): return
renderer.open_group('axes')
self.apply_aspect()
# the patch draws the background rectangle -- the frame below
# will draw the edges
if self.axison and self._frameon:
self.patch.draw(renderer)
artists = []
if len(self.images)<=1 or renderer.option_image_nocomposite():
for im in self.images:
im.draw(renderer)
else:
# make a composite image blending alpha
# list of (mimage.Image, ox, oy)
mag = renderer.get_image_magnification()
ims = [(im.make_image(mag),0,0)
for im in self.images if im.get_visible()]
l, b, r, t = self.bbox.extents
width = mag*((round(r) + 0.5) - (round(l) - 0.5))
height = mag*((round(t) + 0.5) - (round(b) - 0.5))
im = mimage.from_images(height,
width,
ims)
im.is_grayscale = False
l, b, w, h = self.bbox.bounds
# composite images need special args so they will not
# respect z-order for now
renderer.draw_image(
round(l), round(b), im, self.bbox,
self.patch.get_path(),
self.patch.get_transform())
artists.extend(self.collections)
artists.extend(self.patches)
artists.extend(self.lines)
artists.extend(self.texts)
artists.extend(self.artists)
if self.axison and not inframe:
if self._axisbelow:
self.xaxis.set_zorder(0.5)
self.yaxis.set_zorder(0.5)
else:
self.xaxis.set_zorder(2.5)
self.yaxis.set_zorder(2.5)
artists.extend([self.xaxis, self.yaxis])
if not inframe: artists.append(self.title)
artists.extend(self.tables)
if self.legend_ is not None:
artists.append(self.legend_)
# the frame draws the edges around the axes patch -- we
# decouple these so the patch can be in the background and the
# frame in the foreground.
if self.axison and self._frameon:
artists.append(self.frame)
dsu = [ (a.zorder, i, a) for i, a in enumerate(artists)
if not a.get_animated() ]
dsu.sort()
for zorder, i, a in dsu:
a.draw(renderer)
renderer.close_group('axes')
self._cachedRenderer = renderer
def draw_artist(self, a):
"""
This method can only be used after an initial draw which
caches the renderer. It is used to efficiently update Axes
data (axis ticks, labels, etc are not updated)
"""
assert self._cachedRenderer is not None
a.draw(self._cachedRenderer)
def redraw_in_frame(self):
"""
This method can only be used after an initial draw which
caches the renderer. It is used to efficiently update Axes
data (axis ticks, labels, etc are not updated)
"""
assert self._cachedRenderer is not None
self.draw(self._cachedRenderer, inframe=True)
def get_renderer_cache(self):
return self._cachedRenderer
def __draw_animate(self):
# ignore for now; broken
if self._lastRenderer is None:
raise RuntimeError('You must first call ax.draw()')
dsu = [(a.zorder, a) for a in self.animated.keys()]
dsu.sort()
renderer = self._lastRenderer
renderer.blit()
for tmp, a in dsu:
a.draw(renderer)
#### Axes rectangle characteristics
def get_frame_on(self):
"""
Get whether the axes rectangle patch is drawn
"""
return self._frameon
def set_frame_on(self, b):
"""
Set whether the axes rectangle patch is drawn
ACCEPTS: [ *True* | *False* ]
"""
self._frameon = b
def get_axisbelow(self):
"""
Get whether axis below is true or not
"""
return self._axisbelow
def set_axisbelow(self, b):
"""
Set whether the axis ticks and gridlines are above or below most artists
ACCEPTS: [ *True* | *False* ]
"""
self._axisbelow = b
def grid(self, b=None, **kwargs):
"""
call signature::
grid(self, b=None, **kwargs)
Set the axes grids on or off; *b* is a boolean
If *b* is *None* and ``len(kwargs)==0``, toggle the grid state. If
*kwargs* are supplied, it is assumed that you want a grid and *b*
is thus set to *True*
*kawrgs* are used to set the grid line properties, eg::
ax.grid(color='r', linestyle='-', linewidth=2)
Valid :class:`~matplotlib.lines.Line2D` kwargs are
%(Line2D)s
"""
if len(kwargs): b = True
self.xaxis.grid(b, **kwargs)
self.yaxis.grid(b, **kwargs)
grid.__doc__ = cbook.dedent(grid.__doc__) % martist.kwdocd
def ticklabel_format(self, **kwargs):
"""
Convenience method for manipulating the ScalarFormatter
used by default for linear axes.
Optional keyword arguments:
============ =====================================
Keyword Description
============ =====================================
*style* [ 'sci' (or 'scientific') | 'plain' ]
plain turns off scientific notation
*scilimits* (m, n), pair of integers; if *style*
is 'sci', scientific notation will
be used for numbers outside the range
10`-m`:sup: to 10`n`:sup:.
Use (0,0) to include all numbers.
*axis* [ 'x' | 'y' | 'both' ]
============ =====================================
Only the major ticks are affected.
If the method is called when the
:class:`~matplotlib.ticker.ScalarFormatter` is not the
:class:`~matplotlib.ticker.Formatter` being used, an
:exc:`AttributeError` will be raised.
"""
style = kwargs.pop('style', '').lower()
scilimits = kwargs.pop('scilimits', None)
if scilimits is not None:
try:
m, n = scilimits
m+n+1 # check that both are numbers
except (ValueError, TypeError):
raise ValueError("scilimits must be a sequence of 2 integers")
axis = kwargs.pop('axis', 'both').lower()
if style[:3] == 'sci':
sb = True
elif style in ['plain', 'comma']:
sb = False
if style == 'plain':
cb = False
else:
cb = True
raise NotImplementedError, "comma style remains to be added"
elif style == '':
sb = None
else:
raise ValueError, "%s is not a valid style value"
try:
if sb is not None:
if axis == 'both' or axis == 'x':
self.xaxis.major.formatter.set_scientific(sb)
if axis == 'both' or axis == 'y':
self.yaxis.major.formatter.set_scientific(sb)
if scilimits is not None:
if axis == 'both' or axis == 'x':
self.xaxis.major.formatter.set_powerlimits(scilimits)
if axis == 'both' or axis == 'y':
self.yaxis.major.formatter.set_powerlimits(scilimits)
except AttributeError:
raise AttributeError(
"This method only works with the ScalarFormatter.")
def set_axis_off(self):
"""turn off the axis"""
self.axison = False
def set_axis_on(self):
"""turn on the axis"""
self.axison = True
def get_axis_bgcolor(self):
'Return the axis background color'
return self._axisbg
def set_axis_bgcolor(self, color):
"""
set the axes background color
ACCEPTS: any matplotlib color - see
:func:`~matplotlib.pyplot.colors`
"""
self._axisbg = color
self.patch.set_facecolor(color)
### data limits, ticks, tick labels, and formatting
def invert_xaxis(self):
"Invert the x-axis."
left, right = self.get_xlim()
self.set_xlim(right, left)
def xaxis_inverted(self):
'Returns True if the x-axis is inverted.'
left, right = self.get_xlim()
return right < left
def get_xbound(self):
"""
Returns the x-axis numerical bounds where::
lowerBound < upperBound
"""
left, right = self.get_xlim()
if left < right:
return left, right
else:
return right, left
def set_xbound(self, lower=None, upper=None):
"""
Set the lower and upper numerical bounds of the x-axis.
This method will honor axes inversion regardless of parameter order.
"""
if upper is None and iterable(lower):
lower,upper = lower
old_lower,old_upper = self.get_xbound()
if lower is None: lower = old_lower
if upper is None: upper = old_upper
if self.xaxis_inverted():
if lower < upper:
self.set_xlim(upper, lower)
else:
self.set_xlim(lower, upper)
else:
if lower < upper:
self.set_xlim(lower, upper)
else:
self.set_xlim(upper, lower)
def get_xlim(self):
"""
Get the x-axis range [*xmin*, *xmax*]
"""
return tuple(self.viewLim.intervalx)
def set_xlim(self, xmin=None, xmax=None, emit=True, **kwargs):
"""
call signature::
set_xlim(self, *args, **kwargs)
Set the limits for the xaxis
Returns the current xlimits as a length 2 tuple: [*xmin*, *xmax*]
Examples::
set_xlim((valmin, valmax))
set_xlim(valmin, valmax)
set_xlim(xmin=1) # xmax unchanged
set_xlim(xmax=1) # xmin unchanged
Keyword arguments:
*ymin*: scalar
the min of the ylim
*ymax*: scalar
the max of the ylim
*emit*: [ True | False ]
notify observers of lim change
ACCEPTS: len(2) sequence of floats
"""
if xmax is None and iterable(xmin):
xmin,xmax = xmin
self._process_unit_info(xdata=(xmin, xmax))
if xmin is not None:
xmin = self.convert_xunits(xmin)
if xmax is not None:
xmax = self.convert_xunits(xmax)
old_xmin,old_xmax = self.get_xlim()
if xmin is None: xmin = old_xmin
if xmax is None: xmax = old_xmax
xmin, xmax = mtransforms.nonsingular(xmin, xmax, increasing=False)
xmin, xmax = self.xaxis.limit_range_for_scale(xmin, xmax)
self.viewLim.intervalx = (xmin, xmax)
if emit:
self.callbacks.process('xlim_changed', self)
# Call all of the other x-axes that are shared with this one
for other in self._shared_x_axes.get_siblings(self):
if other is not self:
other.set_xlim(self.viewLim.intervalx, emit=False)
if (other.figure != self.figure and
other.figure.canvas is not None):
other.figure.canvas.draw_idle()
return xmin, xmax
def get_xscale(self):
'return the xaxis scale string: %s' % (
", ".join(mscale.get_scale_names()))
return self.xaxis.get_scale()
def set_xscale(self, value, **kwargs):
"""
call signature::
set_xscale(value)
Set the scaling of the x-axis: %(scale)s
ACCEPTS: [%(scale)s]
Different kwargs are accepted, depending on the scale:
%(scale_docs)s
"""
self.xaxis.set_scale(value, **kwargs)
self.autoscale_view()
self._update_transScale()
set_xscale.__doc__ = cbook.dedent(set_xscale.__doc__) % {
'scale': ' | '.join([repr(x) for x in mscale.get_scale_names()]),
'scale_docs': mscale.get_scale_docs().strip()}
def get_xticks(self, minor=False):
'Return the x ticks as a list of locations'
return self.xaxis.get_ticklocs(minor=minor)
def set_xticks(self, ticks, minor=False):
"""
Set the x ticks with list of *ticks*
ACCEPTS: sequence of floats
"""
return self.xaxis.set_ticks(ticks, minor=minor)
def get_xmajorticklabels(self):
'Get the xtick labels as a list of Text instances'
return cbook.silent_list('Text xticklabel',
self.xaxis.get_majorticklabels())
def get_xminorticklabels(self):
'Get the xtick labels as a list of Text instances'
return cbook.silent_list('Text xticklabel',
self.xaxis.get_minorticklabels())
def get_xticklabels(self, minor=False):
'Get the xtick labels as a list of Text instances'
return cbook.silent_list('Text xticklabel',
self.xaxis.get_ticklabels(minor=minor))
def set_xticklabels(self, labels, fontdict=None, minor=False, **kwargs):
"""
call signature::
set_xticklabels(labels, fontdict=None, minor=False, **kwargs)
Set the xtick labels with list of strings *labels*. Return a
list of axis text instances.
*kwargs* set the :class:`~matplotlib.text.Text` properties.
Valid properties are
%(Text)s
ACCEPTS: sequence of strings
"""
return self.xaxis.set_ticklabels(labels, fontdict,
minor=minor, **kwargs)
set_xticklabels.__doc__ = cbook.dedent(
set_xticklabels.__doc__) % martist.kwdocd
def invert_yaxis(self):
"Invert the y-axis."
left, right = self.get_ylim()
self.set_ylim(right, left)
def yaxis_inverted(self):
'Returns True if the y-axis is inverted.'
left, right = self.get_ylim()
return right < left
def get_ybound(self):
"Return y-axis numerical bounds in the form of lowerBound < upperBound"
left, right = self.get_ylim()
if left < right:
return left, right
else:
return right, left
def set_ybound(self, lower=None, upper=None):
"""Set the lower and upper numerical bounds of the y-axis.
This method will honor axes inversion regardless of parameter order.
"""
if upper is None and iterable(lower):
lower,upper = lower
old_lower,old_upper = self.get_ybound()
if lower is None: lower = old_lower
if upper is None: upper = old_upper
if self.yaxis_inverted():
if lower < upper:
self.set_ylim(upper, lower)
else:
self.set_ylim(lower, upper)
else:
if lower < upper:
self.set_ylim(lower, upper)
else:
self.set_ylim(upper, lower)
def get_ylim(self):
"""
Get the y-axis range [*ymin*, *ymax*]
"""
return tuple(self.viewLim.intervaly)
def set_ylim(self, ymin=None, ymax=None, emit=True, **kwargs):
"""
call signature::
set_ylim(self, *args, **kwargs):
Set the limits for the yaxis; v = [ymin, ymax]::
set_ylim((valmin, valmax))
set_ylim(valmin, valmax)
set_ylim(ymin=1) # ymax unchanged
set_ylim(ymax=1) # ymin unchanged
Keyword arguments:
*ymin*: scalar
the min of the ylim
*ymax*: scalar
the max of the ylim
*emit*: [ True | False ]
notify observers of lim change
Returns the current ylimits as a length 2 tuple
ACCEPTS: len(2) sequence of floats
"""
if ymax is None and iterable(ymin):
ymin,ymax = ymin
if ymin is not None:
ymin = self.convert_yunits(ymin)
if ymax is not None:
ymax = self.convert_yunits(ymax)
old_ymin,old_ymax = self.get_ylim()
if ymin is None: ymin = old_ymin
if ymax is None: ymax = old_ymax
ymin, ymax = mtransforms.nonsingular(ymin, ymax, increasing=False)
ymin, ymax = self.yaxis.limit_range_for_scale(ymin, ymax)
self.viewLim.intervaly = (ymin, ymax)
if emit:
self.callbacks.process('ylim_changed', self)
# Call all of the other y-axes that are shared with this one
for other in self._shared_y_axes.get_siblings(self):
if other is not self:
other.set_ylim(self.viewLim.intervaly, emit=False)
if (other.figure != self.figure and
other.figure.canvas is not None):
other.figure.canvas.draw_idle()
return ymin, ymax
def get_yscale(self):
'return the xaxis scale string: %s' % (
", ".join(mscale.get_scale_names()))
return self.yaxis.get_scale()
def set_yscale(self, value, **kwargs):
"""
call signature::
set_yscale(value)
Set the scaling of the y-axis: %(scale)s
ACCEPTS: [%(scale)s]
Different kwargs are accepted, depending on the scale:
%(scale_docs)s
"""
self.yaxis.set_scale(value, **kwargs)
self.autoscale_view()
self._update_transScale()
set_yscale.__doc__ = cbook.dedent(set_yscale.__doc__) % {
'scale': ' | '.join([repr(x) for x in mscale.get_scale_names()]),
'scale_docs': mscale.get_scale_docs().strip()}
def get_yticks(self, minor=False):
'Return the y ticks as a list of locations'
return self.yaxis.get_ticklocs(minor=minor)
def set_yticks(self, ticks, minor=False):
"""
Set the y ticks with list of *ticks*
ACCEPTS: sequence of floats
Keyword arguments:
*minor*: [ False | True ]
Sets the minor ticks if True
"""
return self.yaxis.set_ticks(ticks, minor=minor)
def get_ymajorticklabels(self):
'Get the xtick labels as a list of Text instances'
return cbook.silent_list('Text yticklabel',
self.yaxis.get_majorticklabels())
def get_yminorticklabels(self):
'Get the xtick labels as a list of Text instances'
return cbook.silent_list('Text yticklabel',
self.yaxis.get_minorticklabels())
def get_yticklabels(self, minor=False):
'Get the xtick labels as a list of Text instances'
return cbook.silent_list('Text yticklabel',
self.yaxis.get_ticklabels(minor=minor))
def set_yticklabels(self, labels, fontdict=None, minor=False, **kwargs):
"""
call signature::
set_yticklabels(labels, fontdict=None, minor=False, **kwargs)
Set the ytick labels with list of strings *labels*. Return a list of
:class:`~matplotlib.text.Text` instances.
*kwargs* set :class:`~matplotlib.text.Text` properties for the labels.
Valid properties are
%(Text)s
ACCEPTS: sequence of strings
"""
return self.yaxis.set_ticklabels(labels, fontdict,
minor=minor, **kwargs)
set_yticklabels.__doc__ = cbook.dedent(
set_yticklabels.__doc__) % martist.kwdocd
def xaxis_date(self, tz=None):
"""Sets up x-axis ticks and labels that treat the x data as dates.
*tz* is the time zone to use in labeling dates. Defaults to rc value.
"""
xmin, xmax = self.dataLim.intervalx
if xmin==0.:
# no data has been added - let's set the default datalim.
# We should probably use a better proxy for the datalim
# have been updated than the ignore setting
dmax = today = datetime.date.today()
dmin = today-datetime.timedelta(days=10)
self._process_unit_info(xdata=(dmin, dmax))
dmin, dmax = self.convert_xunits([dmin, dmax])
self.viewLim.intervalx = dmin, dmax
self.dataLim.intervalx = dmin, dmax
locator = self.xaxis.get_major_locator()
if not isinstance(locator, mdates.DateLocator):
locator = mdates.AutoDateLocator(tz)
self.xaxis.set_major_locator(locator)
# the autolocator uses the viewlim to pick the right date
# locator, but it may not have correct viewlim before an
# autoscale. If the viewlim is still zero..1, set it to the
# datalim and the autoscaler will update it on request
if self.viewLim.intervalx[0]==0.:
self.viewLim.intervalx = tuple(self.dataLim.intervalx)
locator.refresh()
formatter = self.xaxis.get_major_formatter()
if not isinstance(formatter, mdates.DateFormatter):
formatter = mdates.AutoDateFormatter(locator, tz)
self.xaxis.set_major_formatter(formatter)
def yaxis_date(self, tz=None):
"""Sets up y-axis ticks and labels that treat the y data as dates.
*tz* is the time zone to use in labeling dates. Defaults to rc value.
"""
ymin, ymax = self.dataLim.intervaly
if ymin==0.:
# no data has been added - let's set the default datalim.
# We should probably use a better proxy for the datalim
# have been updated than the ignore setting
dmax = today = datetime.date.today()
dmin = today-datetime.timedelta(days=10)
self._process_unit_info(ydata=(dmin, dmax))
dmin, dmax = self.convert_yunits([dmin, dmax])
self.viewLim.intervaly = dmin, dmax
self.dataLim.intervaly = dmin, dmax
locator = self.yaxis.get_major_locator()
if not isinstance(locator, mdates.DateLocator):
locator = mdates.AutoDateLocator(tz)
self.yaxis.set_major_locator(locator)
# the autolocator uses the viewlim to pick the right date
# locator, but it may not have correct viewlim before an
# autoscale. If the viewlim is still zero..1, set it to the
# datalim and the autoscaler will update it on request
if self.viewLim.intervaly[0]==0.:
self.viewLim.intervaly = tuple(self.dataLim.intervaly)
locator.refresh()
formatter = self.xaxis.get_major_formatter()
if not isinstance(formatter, mdates.DateFormatter):
formatter = mdates.AutoDateFormatter(locator, tz)
self.yaxis.set_major_formatter(formatter)
def format_xdata(self, x):
"""
Return *x* string formatted. This function will use the attribute
self.fmt_xdata if it is callable, else will fall back on the xaxis
major formatter
"""
try: return self.fmt_xdata(x)
except TypeError:
func = self.xaxis.get_major_formatter().format_data_short
val = func(x)
return val
def format_ydata(self, y):
"""
Return y string formatted. This function will use the
:attr:`fmt_ydata` attribute if it is callable, else will fall
back on the yaxis major formatter
"""
try: return self.fmt_ydata(y)
except TypeError:
func = self.yaxis.get_major_formatter().format_data_short
val = func(y)
return val
def format_coord(self, x, y):
'return a format string formatting the *x*, *y* coord'
if x is None:
x = '???'
if y is None:
y = '???'
xs = self.format_xdata(x)
ys = self.format_ydata(y)
return 'x=%s, y=%s'%(xs,ys)
#### Interactive manipulation
def can_zoom(self):
"""
Return *True* if this axes support the zoom box
"""
return True
def get_navigate(self):
"""
Get whether the axes responds to navigation commands
"""
return self._navigate
def set_navigate(self, b):
"""
Set whether the axes responds to navigation toolbar commands
ACCEPTS: [ True | False ]
"""
self._navigate = b
def get_navigate_mode(self):
"""
Get the navigation toolbar button status: 'PAN', 'ZOOM', or None
"""
return self._navigate_mode
def set_navigate_mode(self, b):
"""
Set the navigation toolbar button status;
.. warning::
this is not a user-API function.
"""
self._navigate_mode = b
def start_pan(self, x, y, button):
"""
Called when a pan operation has started.
*x*, *y* are the mouse coordinates in display coords.
button is the mouse button number:
* 1: LEFT
* 2: MIDDLE
* 3: RIGHT
.. note::
Intended to be overridden by new projection types.
"""
self._pan_start = cbook.Bunch(
lim = self.viewLim.frozen(),
trans = self.transData.frozen(),
trans_inverse = self.transData.inverted().frozen(),
bbox = self.bbox.frozen(),
x = x,
y = y
)
def end_pan(self):
"""
Called when a pan operation completes (when the mouse button
is up.)
.. note::
Intended to be overridden by new projection types.
"""
del self._pan_start
def drag_pan(self, button, key, x, y):
"""
Called when the mouse moves during a pan operation.
*button* is the mouse button number:
* 1: LEFT
* 2: MIDDLE
* 3: RIGHT
*key* is a "shift" key
*x*, *y* are the mouse coordinates in display coords.
.. note::
Intended to be overridden by new projection types.
"""
def format_deltas(key, dx, dy):
if key=='control':
if(abs(dx)>abs(dy)):
dy = dx
else:
dx = dy
elif key=='x':
dy = 0
elif key=='y':
dx = 0
elif key=='shift':
if 2*abs(dx) < abs(dy):
dx=0
elif 2*abs(dy) < abs(dx):
dy=0
elif(abs(dx)>abs(dy)):
dy=dy/abs(dy)*abs(dx)
else:
dx=dx/abs(dx)*abs(dy)
return (dx,dy)
p = self._pan_start
dx = x - p.x
dy = y - p.y
if dx == 0 and dy == 0:
return
if button == 1:
dx, dy = format_deltas(key, dx, dy)
result = p.bbox.translated(-dx, -dy) \
.transformed(p.trans_inverse)
elif button == 3:
try:
dx = -dx / float(self.bbox.width)
dy = -dy / float(self.bbox.height)
dx, dy = format_deltas(key, dx, dy)
if self.get_aspect() != 'auto':
dx = 0.5 * (dx + dy)
dy = dx
alpha = np.power(10.0, (dx, dy))
start = p.trans_inverse.transform_point((p.x, p.y))
lim_points = p.lim.get_points()
result = start + alpha * (lim_points - start)
result = mtransforms.Bbox(result)
except OverflowError:
warnings.warn('Overflow while panning')
return
self.set_xlim(*result.intervalx)
self.set_ylim(*result.intervaly)
def get_cursor_props(self):
"""
return the cursor propertiess as a (*linewidth*, *color*)
tuple, where *linewidth* is a float and *color* is an RGBA
tuple
"""
return self._cursorProps
def set_cursor_props(self, *args):
"""
Set the cursor property as::
ax.set_cursor_props(linewidth, color)
or::
ax.set_cursor_props((linewidth, color))
ACCEPTS: a (*float*, *color*) tuple
"""
if len(args)==1:
lw, c = args[0]
elif len(args)==2:
lw, c = args
else:
raise ValueError('args must be a (linewidth, color) tuple')
c =mcolors.colorConverter.to_rgba(c)
self._cursorProps = lw, c
def connect(self, s, func):
"""
Register observers to be notified when certain events occur. Register
with callback functions with the following signatures. The function
has the following signature::
func(ax) # where ax is the instance making the callback.
The following events can be connected to:
'xlim_changed','ylim_changed'
The connection id is is returned - you can use this with
disconnect to disconnect from the axes event
"""
raise DeprecationWarning('use the callbacks CallbackRegistry instance '
'instead')
def disconnect(self, cid):
'disconnect from the Axes event.'
raise DeprecationWarning('use the callbacks CallbackRegistry instance '
'instead')
def get_children(self):
'return a list of child artists'
children = []
children.append(self.xaxis)
children.append(self.yaxis)
children.extend(self.lines)
children.extend(self.patches)
children.extend(self.texts)
children.extend(self.tables)
children.extend(self.artists)
children.extend(self.images)
if self.legend_ is not None:
children.append(self.legend_)
children.extend(self.collections)
children.append(self.title)
children.append(self.patch)
children.append(self.frame)
return children
def contains(self,mouseevent):
"""Test whether the mouse event occured in the axes.
Returns T/F, {}
"""
if callable(self._contains): return self._contains(self,mouseevent)
return self.patch.contains(mouseevent)
def pick(self, *args):
"""
call signature::
pick(mouseevent)
each child artist will fire a pick event if mouseevent is over
the artist and the artist has picker set
"""
if len(args)>1:
raise DeprecationWarning('New pick API implemented -- '
'see API_CHANGES in the src distribution')
martist.Artist.pick(self,args[0])
def __pick(self, x, y, trans=None, among=None):
"""
Return the artist under point that is closest to the *x*, *y*.
If *trans* is *None*, *x*, and *y* are in window coords,
(0,0 = lower left). Otherwise, *trans* is a
:class:`~matplotlib.transforms.Transform` that specifies the
coordinate system of *x*, *y*.
The selection of artists from amongst which the pick function
finds an artist can be narrowed using the optional keyword
argument *among*. If provided, this should be either a sequence
of permitted artists or a function taking an artist as its
argument and returning a true value if and only if that artist
can be selected.
Note this algorithm calculates distance to the vertices of the
polygon, so if you want to pick a patch, click on the edge!
"""
# MGDTODO: Needs updating
if trans is not None:
xywin = trans.transform_point((x,y))
else:
xywin = x,y
def dist_points(p1, p2):
'return the distance between two points'
x1, y1 = p1
x2, y2 = p2
return math.sqrt((x1-x2)**2+(y1-y2)**2)
def dist_x_y(p1, x, y):
'*x* and *y* are arrays; return the distance to the closest point'
x1, y1 = p1
return min(np.sqrt((x-x1)**2+(y-y1)**2))
def dist(a):
if isinstance(a, Text):
bbox = a.get_window_extent()
l,b,w,h = bbox.bounds
verts = (l,b), (l,b+h), (l+w,b+h), (l+w, b)
xt, yt = zip(*verts)
elif isinstance(a, Patch):
path = a.get_path()
tverts = a.get_transform().transform_path(path)
xt, yt = zip(*tverts)
elif isinstance(a, mlines.Line2D):
xdata = a.get_xdata(orig=False)
ydata = a.get_ydata(orig=False)
xt, yt = a.get_transform().numerix_x_y(xdata, ydata)
return dist_x_y(xywin, np.asarray(xt), np.asarray(yt))
artists = self.lines + self.patches + self.texts
if callable(among):
artists = filter(test, artists)
elif iterable(among):
amongd = dict([(k,1) for k in among])
artists = [a for a in artists if a in amongd]
elif among is None:
pass
else:
raise ValueError('among must be callable or iterable')
if not len(artists): return None
ds = [ (dist(a),a) for a in artists]
ds.sort()
return ds[0][1]
#### Labelling
def get_title(self):
"""
Get the title text string.
"""
return self.title.get_text()
def set_title(self, label, fontdict=None, **kwargs):
"""
call signature::
set_title(label, fontdict=None, **kwargs):
Set the title for the axes.
kwargs are Text properties:
%(Text)s
ACCEPTS: str
.. seealso::
:meth:`text`:
for information on how override and the optional args work
"""
default = {
'fontsize':rcParams['axes.titlesize'],
'verticalalignment' : 'bottom',
'horizontalalignment' : 'center'
}
self.title.set_text(label)
self.title.update(default)
if fontdict is not None: self.title.update(fontdict)
self.title.update(kwargs)
return self.title
set_title.__doc__ = cbook.dedent(set_title.__doc__) % martist.kwdocd
def get_xlabel(self):
"""
Get the xlabel text string.
"""
label = self.xaxis.get_label()
return label.get_text()
def set_xlabel(self, xlabel, fontdict=None, **kwargs):
"""
call signature::
set_xlabel(xlabel, fontdict=None, **kwargs)
Set the label for the xaxis.
Valid kwargs are Text properties:
%(Text)s
ACCEPTS: str
.. seealso::
:meth:`text`:
for information on how override and the optional args work
"""
label = self.xaxis.get_label()
label.set_text(xlabel)
if fontdict is not None: label.update(fontdict)
label.update(kwargs)
return label
set_xlabel.__doc__ = cbook.dedent(set_xlabel.__doc__) % martist.kwdocd
def get_ylabel(self):
"""
Get the ylabel text string.
"""
label = self.yaxis.get_label()
return label.get_text()
def set_ylabel(self, ylabel, fontdict=None, **kwargs):
"""
call signature::
set_ylabel(ylabel, fontdict=None, **kwargs)
Set the label for the yaxis
Valid kwargs are Text properties:
%(Text)s
ACCEPTS: str
.. seealso::
:meth:`text`:
for information on how override and the optional args work
"""
label = self.yaxis.get_label()
label.set_text(ylabel)
if fontdict is not None: label.update(fontdict)
label.update(kwargs)
return label
set_ylabel.__doc__ = cbook.dedent(set_ylabel.__doc__) % martist.kwdocd
def text(self, x, y, s, fontdict=None,
withdash=False, **kwargs):
"""
call signature::
text(x, y, s, fontdict=None, **kwargs)
Add text in string *s* to axis at location *x*, *y*, data
coordinates.
Keyword arguments:
*fontdict*:
A dictionary to override the default text properties.
If *fontdict* is *None*, the defaults are determined by your rc
parameters.
*withdash*: [ False | True ]
Creates a :class:`~matplotlib.text.TextWithDash` instance
instead of a :class:`~matplotlib.text.Text` instance.
Individual keyword arguments can be used to override any given
parameter::
text(x, y, s, fontsize=12)
The default transform specifies that text is in data coords,
alternatively, you can specify text in axis coords (0,0 is
lower-left and 1,1 is upper-right). The example below places
text in the center of the axes::
text(0.5, 0.5,'matplotlib',
horizontalalignment='center',
verticalalignment='center',
transform = ax.transAxes)
You can put a rectangular box around the text instance (eg. to
set a background color) by using the keyword *bbox*. *bbox* is
a dictionary of :class:`matplotlib.patches.Rectangle`
properties. For example::
text(x, y, s, bbox=dict(facecolor='red', alpha=0.5))
Valid kwargs are :class:`matplotlib.text.Text` properties:
%(Text)s
"""
default = {
'verticalalignment' : 'bottom',
'horizontalalignment' : 'left',
#'verticalalignment' : 'top',
'transform' : self.transData,
}
# At some point if we feel confident that TextWithDash
# is robust as a drop-in replacement for Text and that
# the performance impact of the heavier-weight class
# isn't too significant, it may make sense to eliminate
# the withdash kwarg and simply delegate whether there's
# a dash to TextWithDash and dashlength.
if withdash:
t = mtext.TextWithDash(
x=x, y=y, text=s,
)
else:
t = mtext.Text(
x=x, y=y, text=s,
)
self._set_artist_props(t)
t.update(default)
if fontdict is not None: t.update(fontdict)
t.update(kwargs)
self.texts.append(t)
t._remove_method = lambda h: self.texts.remove(h)
#if t.get_clip_on(): t.set_clip_box(self.bbox)
if 'clip_on' in kwargs: t.set_clip_box(self.bbox)
return t
text.__doc__ = cbook.dedent(text.__doc__) % martist.kwdocd
def annotate(self, *args, **kwargs):
"""
call signature::
annotate(s, xy, xytext=None, xycoords='data',
textcoords='data', arrowprops=None, **kwargs)
Keyword arguments:
%(Annotation)s
.. plot:: mpl_examples/pylab_examples/annotation_demo2.py
"""
a = mtext.Annotation(*args, **kwargs)
a.set_transform(mtransforms.IdentityTransform())
self._set_artist_props(a)
if kwargs.has_key('clip_on'): a.set_clip_path(self.patch)
self.texts.append(a)
return a
annotate.__doc__ = cbook.dedent(annotate.__doc__) % martist.kwdocd
#### Lines and spans
def axhline(self, y=0, xmin=0, xmax=1, **kwargs):
"""
call signature::
axhline(y=0, xmin=0, xmax=1, **kwargs)
Axis Horizontal Line
Draw a horizontal line at *y* from *xmin* to *xmax*. With the
default values of *xmin* = 0 and *xmax* = 1, this line will
always span the horizontal extent of the axes, regardless of
the xlim settings, even if you change them, eg. with the
:meth:`set_xlim` command. That is, the horizontal extent is
in axes coords: 0=left, 0.5=middle, 1.0=right but the *y*
location is in data coordinates.
Return value is the :class:`~matplotlib.lines.Line2D`
instance. kwargs are the same as kwargs to plot, and can be
used to control the line properties. Eg.,
* draw a thick red hline at *y* = 0 that spans the xrange
>>> axhline(linewidth=4, color='r')
* draw a default hline at *y* = 1 that spans the xrange
>>> axhline(y=1)
* draw a default hline at *y* = .5 that spans the the middle half of
the xrange
>>> axhline(y=.5, xmin=0.25, xmax=0.75)
Valid kwargs are :class:`~matplotlib.lines.Line2D` properties:
%(Line2D)s
.. seealso::
:meth:`axhspan`:
for example plot and source code
"""
ymin, ymax = self.get_ybound()
# We need to strip away the units for comparison with
# non-unitized bounds
yy = self.convert_yunits( y )
scaley = (yy<ymin) or (yy>ymax)
trans = mtransforms.blended_transform_factory(
self.transAxes, self.transData)
l = mlines.Line2D([xmin,xmax], [y,y], transform=trans, **kwargs)
l.x_isdata = False
self.add_line(l)
self.autoscale_view(scalex=False, scaley=scaley)
return l
axhline.__doc__ = cbook.dedent(axhline.__doc__) % martist.kwdocd
def axvline(self, x=0, ymin=0, ymax=1, **kwargs):
"""
call signature::
axvline(x=0, ymin=0, ymax=1, **kwargs)
Axis Vertical Line
Draw a vertical line at *x* from *ymin* to *ymax*. With the
default values of *ymin* = 0 and *ymax* = 1, this line will
always span the vertical extent of the axes, regardless of the
xlim settings, even if you change them, eg. with the
:meth:`set_xlim` command. That is, the vertical extent is in
axes coords: 0=bottom, 0.5=middle, 1.0=top but the *x* location
is in data coordinates.
Return value is the :class:`~matplotlib.lines.Line2D`
instance. kwargs are the same as kwargs to plot, and can be
used to control the line properties. Eg.,
* draw a thick red vline at *x* = 0 that spans the yrange
>>> axvline(linewidth=4, color='r')
* draw a default vline at *x* = 1 that spans the yrange
>>> axvline(x=1)
* draw a default vline at *x* = .5 that spans the the middle half of
the yrange
>>> axvline(x=.5, ymin=0.25, ymax=0.75)
Valid kwargs are :class:`~matplotlib.lines.Line2D` properties:
%(Line2D)s
.. seealso::
:meth:`axhspan`:
for example plot and source code
"""
xmin, xmax = self.get_xbound()
# We need to strip away the units for comparison with
# non-unitized bounds
xx = self.convert_xunits( x )
scalex = (xx<xmin) or (xx>xmax)
trans = mtransforms.blended_transform_factory(
self.transData, self.transAxes)
l = mlines.Line2D([x,x], [ymin,ymax] , transform=trans, **kwargs)
l.y_isdata = False
self.add_line(l)
self.autoscale_view(scalex=scalex, scaley=False)
return l
axvline.__doc__ = cbook.dedent(axvline.__doc__) % martist.kwdocd
def axhspan(self, ymin, ymax, xmin=0, xmax=1, **kwargs):
"""
call signature::
axhspan(ymin, ymax, xmin=0, xmax=1, **kwargs)
Axis Horizontal Span.
*y* coords are in data units and *x* coords are in axes (relative
0-1) units.
Draw a horizontal span (rectangle) from *ymin* to *ymax*.
With the default values of *xmin* = 0 and *xmax* = 1, this
always spans the xrange, regardless of the xlim settings, even
if you change them, eg. with the :meth:`set_xlim` command.
That is, the horizontal extent is in axes coords: 0=left,
0.5=middle, 1.0=right but the *y* location is in data
coordinates.
Return value is a :class:`matplotlib.patches.Polygon`
instance.
Examples:
* draw a gray rectangle from *y* = 0.25-0.75 that spans the
horizontal extent of the axes
>>> axhspan(0.25, 0.75, facecolor='0.5', alpha=0.5)
Valid kwargs are :class:`~matplotlib.patches.Polygon` properties:
%(Polygon)s
**Example:**
.. plot:: mpl_examples/pylab_examples/axhspan_demo.py
"""
trans = mtransforms.blended_transform_factory(
self.transAxes, self.transData)
# process the unit information
self._process_unit_info( [xmin, xmax], [ymin, ymax], kwargs=kwargs )
# first we need to strip away the units
xmin, xmax = self.convert_xunits( [xmin, xmax] )
ymin, ymax = self.convert_yunits( [ymin, ymax] )
verts = (xmin, ymin), (xmin, ymax), (xmax, ymax), (xmax, ymin)
p = mpatches.Polygon(verts, **kwargs)
p.set_transform(trans)
p.x_isdata = False
self.add_patch(p)
return p
axhspan.__doc__ = cbook.dedent(axhspan.__doc__) % martist.kwdocd
def axvspan(self, xmin, xmax, ymin=0, ymax=1, **kwargs):
"""
call signature::
axvspan(xmin, xmax, ymin=0, ymax=1, **kwargs)
Axis Vertical Span.
*x* coords are in data units and *y* coords are in axes (relative
0-1) units.
Draw a vertical span (rectangle) from *xmin* to *xmax*. With
the default values of *ymin* = 0 and *ymax* = 1, this always
spans the yrange, regardless of the ylim settings, even if you
change them, eg. with the :meth:`set_ylim` command. That is,
the vertical extent is in axes coords: 0=bottom, 0.5=middle,
1.0=top but the *y* location is in data coordinates.
Return value is the :class:`matplotlib.patches.Polygon`
instance.
Examples:
* draw a vertical green translucent rectangle from x=1.25 to 1.55 that
spans the yrange of the axes
>>> axvspan(1.25, 1.55, facecolor='g', alpha=0.5)
Valid kwargs are :class:`~matplotlib.patches.Polygon`
properties:
%(Polygon)s
.. seealso::
:meth:`axhspan`:
for example plot and source code
"""
trans = mtransforms.blended_transform_factory(
self.transData, self.transAxes)
# process the unit information
self._process_unit_info( [xmin, xmax], [ymin, ymax], kwargs=kwargs )
# first we need to strip away the units
xmin, xmax = self.convert_xunits( [xmin, xmax] )
ymin, ymax = self.convert_yunits( [ymin, ymax] )
verts = [(xmin, ymin), (xmin, ymax), (xmax, ymax), (xmax, ymin)]
p = mpatches.Polygon(verts, **kwargs)
p.set_transform(trans)
p.y_isdata = False
self.add_patch(p)
return p
axvspan.__doc__ = cbook.dedent(axvspan.__doc__) % martist.kwdocd
def hlines(self, y, xmin, xmax, colors='k', linestyles='solid',
label='', **kwargs):
"""
call signature::
hlines(y, xmin, xmax, colors='k', linestyles='solid', **kwargs)
Plot horizontal lines at each *y* from *xmin* to *xmax*.
Returns the :class:`~matplotlib.collections.LineCollection`
that was added.
Required arguments:
*y*:
a 1-D numpy array or iterable.
*xmin* and *xmax*:
can be scalars or ``len(x)`` numpy arrays. If they are
scalars, then the respective values are constant, else the
widths of the lines are determined by *xmin* and *xmax*.
Optional keyword arguments:
*colors*:
a line collections color argument, either a single color
or a ``len(y)`` list of colors
*linestyles*:
[ 'solid' | 'dashed' | 'dashdot' | 'dotted' ]
**Example:**
.. plot:: mpl_examples/pylab_examples/hline_demo.py
"""
if kwargs.get('fmt') is not None:
raise DeprecationWarning('hlines now uses a '
'collections.LineCollection and not a '
'list of Line2D to draw; see API_CHANGES')
# We do the conversion first since not all unitized data is uniform
y = self.convert_yunits( y )
xmin = self.convert_xunits( xmin )
xmax = self.convert_xunits( xmax )
if not iterable(y): y = [y]
if not iterable(xmin): xmin = [xmin]
if not iterable(xmax): xmax = [xmax]
y = np.asarray(y)
xmin = np.asarray(xmin)
xmax = np.asarray(xmax)
if len(xmin)==1:
xmin = np.resize( xmin, y.shape )
if len(xmax)==1:
xmax = np.resize( xmax, y.shape )
if len(xmin)!=len(y):
raise ValueError, 'xmin and y are unequal sized sequences'
if len(xmax)!=len(y):
raise ValueError, 'xmax and y are unequal sized sequences'
verts = [ ((thisxmin, thisy), (thisxmax, thisy))
for thisxmin, thisxmax, thisy in zip(xmin, xmax, y)]
coll = mcoll.LineCollection(verts, colors=colors,
linestyles=linestyles, label=label)
self.add_collection(coll)
coll.update(kwargs)
minx = min(xmin.min(), xmax.min())
maxx = max(xmin.max(), xmax.max())
miny = y.min()
maxy = y.max()
corners = (minx, miny), (maxx, maxy)
self.update_datalim(corners)
self.autoscale_view()
return coll
hlines.__doc__ = cbook.dedent(hlines.__doc__)
def vlines(self, x, ymin, ymax, colors='k', linestyles='solid',
label='', **kwargs):
"""
call signature::
vlines(x, ymin, ymax, color='k', linestyles='solid')
Plot vertical lines at each *x* from *ymin* to *ymax*. *ymin*
or *ymax* can be scalars or len(*x*) numpy arrays. If they are
scalars, then the respective values are constant, else the
heights of the lines are determined by *ymin* and *ymax*.
*colors*
a line collections color args, either a single color
or a len(*x*) list of colors
*linestyles*
one of [ 'solid' | 'dashed' | 'dashdot' | 'dotted' ]
Returns the :class:`matplotlib.collections.LineCollection`
that was added.
kwargs are :class:`~matplotlib.collections.LineCollection` properties:
%(LineCollection)s
"""
if kwargs.get('fmt') is not None:
raise DeprecationWarning('vlines now uses a '
'collections.LineCollection and not a '
'list of Line2D to draw; see API_CHANGES')
self._process_unit_info(xdata=x, ydata=ymin, kwargs=kwargs)
# We do the conversion first since not all unitized data is uniform
x = self.convert_xunits( x )
ymin = self.convert_yunits( ymin )
ymax = self.convert_yunits( ymax )
if not iterable(x): x = [x]
if not iterable(ymin): ymin = [ymin]
if not iterable(ymax): ymax = [ymax]
x = np.asarray(x)
ymin = np.asarray(ymin)
ymax = np.asarray(ymax)
if len(ymin)==1:
ymin = np.resize( ymin, x.shape )
if len(ymax)==1:
ymax = np.resize( ymax, x.shape )
if len(ymin)!=len(x):
raise ValueError, 'ymin and x are unequal sized sequences'
if len(ymax)!=len(x):
raise ValueError, 'ymax and x are unequal sized sequences'
Y = np.array([ymin, ymax]).T
verts = [ ((thisx, thisymin), (thisx, thisymax))
for thisx, (thisymin, thisymax) in zip(x,Y)]
#print 'creating line collection'
coll = mcoll.LineCollection(verts, colors=colors,
linestyles=linestyles, label=label)
self.add_collection(coll)
coll.update(kwargs)
minx = min( x )
maxx = max( x )
miny = min( min(ymin), min(ymax) )
maxy = max( max(ymin), max(ymax) )
corners = (minx, miny), (maxx, maxy)
self.update_datalim(corners)
self.autoscale_view()
return coll
vlines.__doc__ = cbook.dedent(vlines.__doc__) % martist.kwdocd
#### Basic plotting
def plot(self, *args, **kwargs):
"""
Plot lines and/or markers to the
:class:`~matplotlib.axes.Axes`. *args* is a variable length
argument, allowing for multiple *x*, *y* pairs with an
optional format string. For example, each of the following is
legal::
plot(x, y) # plot x and y using default line style and color
plot(x, y, 'bo') # plot x and y using blue circle markers
plot(y) # plot y using x as index array 0..N-1
plot(y, 'r+') # ditto, but with red plusses
If *x* and/or *y* is 2-dimensional, then the corresponding columns
will be plotted.
An arbitrary number of *x*, *y*, *fmt* groups can be
specified, as in::
a.plot(x1, y1, 'g^', x2, y2, 'g-')
Return value is a list of lines that were added.
The following format string characters are accepted to control
the line style or marker:
================ ===============================
character description
================ ===============================
'-' solid line style
'--' dashed line style
'-.' dash-dot line style
':' dotted line style
'.' point marker
',' pixel marker
'o' circle marker
'v' triangle_down marker
'^' triangle_up marker
'<' triangle_left marker
'>' triangle_right marker
'1' tri_down marker
'2' tri_up marker
'3' tri_left marker
'4' tri_right marker
's' square marker
'p' pentagon marker
'*' star marker
'h' hexagon1 marker
'H' hexagon2 marker
'+' plus marker
'x' x marker
'D' diamond marker
'd' thin_diamond marker
'|' vline marker
'_' hline marker
================ ===============================
The following color abbreviations are supported:
========== ========
character color
========== ========
'b' blue
'g' green
'r' red
'c' cyan
'm' magenta
'y' yellow
'k' black
'w' white
========== ========
In addition, you can specify colors in many weird and
wonderful ways, including full names (``'green'``), hex
strings (``'#008000'``), RGB or RGBA tuples (``(0,1,0,1)``) or
grayscale intensities as a string (``'0.8'``). Of these, the
string specifications can be used in place of a ``fmt`` group,
but the tuple forms can be used only as ``kwargs``.
Line styles and colors are combined in a single format string, as in
``'bo'`` for blue circles.
The *kwargs* can be used to set line properties (any property that has
a ``set_*`` method). You can use this to set a line label (for auto
legends), linewidth, anitialising, marker face color, etc. Here is an
example::
plot([1,2,3], [1,2,3], 'go-', label='line 1', linewidth=2)
plot([1,2,3], [1,4,9], 'rs', label='line 2')
axis([0, 4, 0, 10])
legend()
If you make multiple lines with one plot command, the kwargs
apply to all those lines, e.g.::
plot(x1, y1, x2, y2, antialised=False)
Neither line will be antialiased.
You do not need to use format strings, which are just
abbreviations. All of the line properties can be controlled
by keyword arguments. For example, you can set the color,
marker, linestyle, and markercolor with::
plot(x, y, color='green', linestyle='dashed', marker='o',
markerfacecolor='blue', markersize=12). See
:class:`~matplotlib.lines.Line2D` for details.
The kwargs are :class:`~matplotlib.lines.Line2D` properties:
%(Line2D)s
kwargs *scalex* and *scaley*, if defined, are passed on to
:meth:`~matplotlib.axes.Axes.autoscale_view` to determine
whether the *x* and *y* axes are autoscaled; the default is
*True*.
"""
scalex = kwargs.pop( 'scalex', True)
scaley = kwargs.pop( 'scaley', True)
if not self._hold: self.cla()
lines = []
for line in self._get_lines(*args, **kwargs):
self.add_line(line)
lines.append(line)
self.autoscale_view(scalex=scalex, scaley=scaley)
return lines
plot.__doc__ = cbook.dedent(plot.__doc__) % martist.kwdocd
def plot_date(self, x, y, fmt='bo', tz=None, xdate=True, ydate=False,
**kwargs):
"""
call signature::
plot_date(x, y, fmt='bo', tz=None, xdate=True, ydate=False, **kwargs)
Similar to the :func:`~matplotlib.pyplot.plot` command, except
the *x* or *y* (or both) data is considered to be dates, and the
axis is labeled accordingly.
*x* and/or *y* can be a sequence of dates represented as float
days since 0001-01-01 UTC.
Keyword arguments:
*fmt*: string
The plot format string.
*tz*: [ None | timezone string ]
The time zone to use in labeling dates. If *None*, defaults to rc
value.
*xdate*: [ True | False ]
If *True*, the *x*-axis will be labeled with dates.
*ydate*: [ False | True ]
If *True*, the *y*-axis will be labeled with dates.
Note if you are using custom date tickers and formatters, it
may be necessary to set the formatters/locators after the call
to :meth:`plot_date` since :meth:`plot_date` will set the
default tick locator to
:class:`matplotlib.ticker.AutoDateLocator` (if the tick
locator is not already set to a
:class:`matplotlib.ticker.DateLocator` instance) and the
default tick formatter to
:class:`matplotlib.ticker.AutoDateFormatter` (if the tick
formatter is not already set to a
:class:`matplotlib.ticker.DateFormatter` instance).
Valid kwargs are :class:`~matplotlib.lines.Line2D` properties:
%(Line2D)s
.. seealso::
:mod:`~matplotlib.dates`:
for helper functions
:func:`~matplotlib.dates.date2num`,
:func:`~matplotlib.dates.num2date` and
:func:`~matplotlib.dates.drange`:
for help on creating the required floating point
dates.
"""
if not self._hold: self.cla()
ret = self.plot(x, y, fmt, **kwargs)
if xdate:
self.xaxis_date(tz)
if ydate:
self.yaxis_date(tz)
self.autoscale_view()
return ret
plot_date.__doc__ = cbook.dedent(plot_date.__doc__) % martist.kwdocd
def loglog(self, *args, **kwargs):
"""
call signature::
loglog(*args, **kwargs)
Make a plot with log scaling on the *x* and *y* axis.
:func:`~matplotlib.pyplot.loglog` supports all the keyword
arguments of :func:`~matplotlib.pyplot.plot` and
:meth:`matplotlib.axes.Axes.set_xscale` /
:meth:`matplotlib.axes.Axes.set_yscale`.
Notable keyword arguments:
*basex*/*basey*: scalar > 1
base of the *x*/*y* logarithm
*subsx*/*subsy*: [ None | sequence ]
the location of the minor *x*/*y* ticks; *None* defaults
to autosubs, which depend on the number of decades in the
plot; see :meth:`matplotlib.axes.Axes.set_xscale` /
:meth:`matplotlib.axes.Axes.set_yscale` for details
The remaining valid kwargs are
:class:`~matplotlib.lines.Line2D` properties:
%(Line2D)s
**Example:**
.. plot:: mpl_examples/pylab_examples/log_demo.py
"""
if not self._hold: self.cla()
dx = {'basex': kwargs.pop('basex', 10),
'subsx': kwargs.pop('subsx', None),
}
dy = {'basey': kwargs.pop('basey', 10),
'subsy': kwargs.pop('subsy', None),
}
self.set_xscale('log', **dx)
self.set_yscale('log', **dy)
b = self._hold
self._hold = True # we've already processed the hold
l = self.plot(*args, **kwargs)
self._hold = b # restore the hold
return l
loglog.__doc__ = cbook.dedent(loglog.__doc__) % martist.kwdocd
def semilogx(self, *args, **kwargs):
"""
call signature::
semilogx(*args, **kwargs)
Make a plot with log scaling on the *x* axis.
:func:`semilogx` supports all the keyword arguments of
:func:`~matplotlib.pyplot.plot` and
:meth:`matplotlib.axes.Axes.set_xscale`.
Notable keyword arguments:
*basex*: scalar > 1
base of the *x* logarithm
*subsx*: [ None | sequence ]
The location of the minor xticks; *None* defaults to
autosubs, which depend on the number of decades in the
plot; see :meth:`~matplotlib.axes.Axes.set_xscale` for
details.
The remaining valid kwargs are
:class:`~matplotlib.lines.Line2D` properties:
%(Line2D)s
.. seealso::
:meth:`loglog`:
For example code and figure
"""
if not self._hold: self.cla()
d = {'basex': kwargs.pop( 'basex', 10),
'subsx': kwargs.pop( 'subsx', None),
}
self.set_xscale('log', **d)
b = self._hold
self._hold = True # we've already processed the hold
l = self.plot(*args, **kwargs)
self._hold = b # restore the hold
return l
semilogx.__doc__ = cbook.dedent(semilogx.__doc__) % martist.kwdocd
def semilogy(self, *args, **kwargs):
"""
call signature::
semilogy(*args, **kwargs)
Make a plot with log scaling on the *y* axis.
:func:`semilogy` supports all the keyword arguments of
:func:`~matplotlib.pylab.plot` and
:meth:`matplotlib.axes.Axes.set_yscale`.
Notable keyword arguments:
*basey*: scalar > 1
Base of the *y* logarithm
*subsy*: [ None | sequence ]
The location of the minor yticks; *None* defaults to
autosubs, which depend on the number of decades in the
plot; see :meth:`~matplotlib.axes.Axes.set_yscale` for
details.
The remaining valid kwargs are
:class:`~matplotlib.lines.Line2D` properties:
%(Line2D)s
.. seealso::
:meth:`loglog`:
For example code and figure
"""
if not self._hold: self.cla()
d = {'basey': kwargs.pop('basey', 10),
'subsy': kwargs.pop('subsy', None),
}
self.set_yscale('log', **d)
b = self._hold
self._hold = True # we've already processed the hold
l = self.plot(*args, **kwargs)
self._hold = b # restore the hold
return l
semilogy.__doc__ = cbook.dedent(semilogy.__doc__) % martist.kwdocd
def acorr(self, x, **kwargs):
"""
call signature::
acorr(x, normed=False, detrend=mlab.detrend_none, usevlines=False,
maxlags=None, **kwargs)
Plot the autocorrelation of *x*. If *normed* = *True*,
normalize the data by the autocorrelation at 0-th lag. *x* is
detrended by the *detrend* callable (default no normalization).
Data are plotted as ``plot(lags, c, **kwargs)``
Return value is a tuple (*lags*, *c*, *line*) where:
- *lags* are a length 2*maxlags+1 lag vector
- *c* is the 2*maxlags+1 auto correlation vector
- *line* is a :class:`~matplotlib.lines.Line2D` instance
returned by :meth:`plot`
The default *linestyle* is None and the default *marker* is
``'o'``, though these can be overridden with keyword args.
The cross correlation is performed with
:func:`numpy.correlate` with *mode* = 2.
If *usevlines* is *True*, :meth:`~matplotlib.axes.Axes.vlines`
rather than :meth:`~matplotlib.axes.Axes.plot` is used to draw
vertical lines from the origin to the acorr. Otherwise, the
plot style is determined by the kwargs, which are
:class:`~matplotlib.lines.Line2D` properties.
*maxlags* is a positive integer detailing the number of lags
to show. The default value of *None* will return all
:math:`2 \mathrm{len}(x) - 1` lags.
The return value is a tuple (*lags*, *c*, *linecol*, *b*)
where
- *linecol* is the
:class:`~matplotlib.collections.LineCollection`
- *b* is the *x*-axis.
.. seealso::
:meth:`~matplotlib.axes.Axes.plot` or
:meth:`~matplotlib.axes.Axes.vlines`: For documentation on
valid kwargs.
**Example:**
:func:`~matplotlib.pyplot.xcorr` above, and
:func:`~matplotlib.pyplot.acorr` below.
**Example:**
.. plot:: mpl_examples/pylab_examples/xcorr_demo.py
"""
return self.xcorr(x, x, **kwargs)
acorr.__doc__ = cbook.dedent(acorr.__doc__) % martist.kwdocd
def xcorr(self, x, y, normed=False, detrend=mlab.detrend_none,
usevlines=False, maxlags=None, **kwargs):
"""
call signature::
xcorr(x, y, normed=False, detrend=mlab.detrend_none,
usevlines=False, **kwargs):
Plot the cross correlation between *x* and *y*. If *normed* =
*True*, normalize the data by the cross correlation at 0-th
lag. *x* and y are detrended by the *detrend* callable
(default no normalization). *x* and *y* must be equal length.
Data are plotted as ``plot(lags, c, **kwargs)``
Return value is a tuple (*lags*, *c*, *line*) where:
- *lags* are a length ``2*maxlags+1`` lag vector
- *c* is the ``2*maxlags+1`` auto correlation vector
- *line* is a :class:`~matplotlib.lines.Line2D` instance
returned by :func:`~matplotlib.pyplot.plot`.
The default *linestyle* is *None* and the default *marker* is
'o', though these can be overridden with keyword args. The
cross correlation is performed with :func:`numpy.correlate`
with *mode* = 2.
If *usevlines* is *True*:
:func:`~matplotlib.pyplot.vlines`
rather than :func:`~matplotlib.pyplot.plot` is used to draw
vertical lines from the origin to the xcorr. Otherwise the
plotstyle is determined by the kwargs, which are
:class:`~matplotlib.lines.Line2D` properties.
The return value is a tuple (*lags*, *c*, *linecol*, *b*)
where *linecol* is the
:class:`matplotlib.collections.LineCollection` instance and
*b* is the *x*-axis.
*maxlags* is a positive integer detailing the number of lags to show.
The default value of *None* will return all ``(2*len(x)-1)`` lags.
**Example:**
:func:`~matplotlib.pyplot.xcorr` above, and
:func:`~matplotlib.pyplot.acorr` below.
**Example:**
.. plot:: mpl_examples/pylab_examples/xcorr_demo.py
"""
Nx = len(x)
if Nx!=len(y):
raise ValueError('x and y must be equal length')
x = detrend(np.asarray(x))
y = detrend(np.asarray(y))
c = np.correlate(x, y, mode=2)
if normed: c/= np.sqrt(np.dot(x,x) * np.dot(y,y))
if maxlags is None: maxlags = Nx - 1
if maxlags >= Nx or maxlags < 1:
raise ValueError('maglags must be None or strictly '
'positive < %d'%Nx)
lags = np.arange(-maxlags,maxlags+1)
c = c[Nx-1-maxlags:Nx+maxlags]
if usevlines:
a = self.vlines(lags, [0], c, **kwargs)
b = self.axhline(**kwargs)
else:
kwargs.setdefault('marker', 'o')
kwargs.setdefault('linestyle', 'None')
a, = self.plot(lags, c, **kwargs)
b = None
return lags, c, a, b
xcorr.__doc__ = cbook.dedent(xcorr.__doc__) % martist.kwdocd
def legend(self, *args, **kwargs):
"""
call signature::
legend(*args, **kwargs)
Place a legend on the current axes at location *loc*. Labels are a
sequence of strings and *loc* can be a string or an integer specifying
the legend location.
To make a legend with existing lines::
legend()
:meth:`legend` by itself will try and build a legend using the label
property of the lines/patches/collections. You can set the label of
a line by doing::
plot(x, y, label='my data')
or::
line.set_label('my data').
If label is set to '_nolegend_', the item will not be shown in
legend.
To automatically generate the legend from labels::
legend( ('label1', 'label2', 'label3') )
To make a legend for a list of lines and labels::
legend( (line1, line2, line3), ('label1', 'label2', 'label3') )
To make a legend at a given location, using a location argument::
legend( ('label1', 'label2', 'label3'), loc='upper left')
or::
legend( (line1, line2, line3), ('label1', 'label2', 'label3'), loc=2)
The location codes are
=============== =============
Location String Location Code
=============== =============
'best' 0
'upper right' 1
'upper left' 2
'lower left' 3
'lower right' 4
'right' 5
'center left' 6
'center right' 7
'lower center' 8
'upper center' 9
'center' 10
=============== =============
If none of these are locations are suitable, loc can be a 2-tuple
giving x,y in axes coords, ie::
loc = 0, 1 # left top
loc = 0.5, 0.5 # center
Keyword arguments:
*isaxes*: [ True | False ]
Indicates that this is an axes legend
*numpoints*: integer
The number of points in the legend line, default is 4
*prop*: [ None | FontProperties ]
A :class:`matplotlib.font_manager.FontProperties`
instance, or *None* to use rc settings.
*pad*: [ None | scalar ]
The fractional whitespace inside the legend border, between 0 and 1.
If *None*, use rc settings.
*markerscale*: [ None | scalar ]
The relative size of legend markers vs. original. If *None*, use rc
settings.
*shadow*: [ None | False | True ]
If *True*, draw a shadow behind legend. If *None*, use rc settings.
*labelsep*: [ None | scalar ]
The vertical space between the legend entries. If *None*, use rc
settings.
*handlelen*: [ None | scalar ]
The length of the legend lines. If *None*, use rc settings.
*handletextsep*: [ None | scalar ]
The space between the legend line and legend text. If *None*, use rc
settings.
*axespad*: [ None | scalar ]
The border between the axes and legend edge. If *None*, use rc
settings.
**Example:**
.. plot:: mpl_examples/api/legend_demo.py
"""
def get_handles():
handles = self.lines[:]
handles.extend(self.patches)
handles.extend([c for c in self.collections
if isinstance(c, mcoll.LineCollection)])
handles.extend([c for c in self.collections
if isinstance(c, mcoll.RegularPolyCollection)])
return handles
if len(args)==0:
handles = []
labels = []
for handle in get_handles():
label = handle.get_label()
if (label is not None and
label != '' and not label.startswith('_')):
handles.append(handle)
labels.append(label)
if len(handles) == 0:
warnings.warn("No labeled objects found. "
"Use label='...' kwarg on individual plots.")
return None
elif len(args)==1:
# LABELS
labels = args[0]
handles = [h for h, label in zip(get_handles(), labels)]
elif len(args)==2:
if is_string_like(args[1]) or isinstance(args[1], int):
# LABELS, LOC
labels, loc = args
handles = [h for h, label in zip(get_handles(), labels)]
kwargs['loc'] = loc
else:
# LINES, LABELS
handles, labels = args
elif len(args)==3:
# LINES, LABELS, LOC
handles, labels, loc = args
kwargs['loc'] = loc
else:
raise TypeError('Invalid arguments to legend')
handles = cbook.flatten(handles)
self.legend_ = mlegend.Legend(self, handles, labels, **kwargs)
return self.legend_
#### Specialized plotting
def step(self, x, y, *args, **kwargs):
'''
call signature::
step(x, y, *args, **kwargs)
Make a step plot. Additional keyword args to :func:`step` are the same
as those for :func:`~matplotlib.pyplot.plot`.
*x* and *y* must be 1-D sequences, and it is assumed, but not checked,
that *x* is uniformly increasing.
Keyword arguments:
*where*: [ 'pre' | 'post' | 'mid' ]
If 'pre', the interval from x[i] to x[i+1] has level y[i]
If 'post', that interval has level y[i+1]
If 'mid', the jumps in *y* occur half-way between the
*x*-values.
'''
where = kwargs.pop('where', 'pre')
if where not in ('pre', 'post', 'mid'):
raise ValueError("'where' argument to step must be "
"'pre', 'post' or 'mid'")
kwargs['linestyle'] = 'steps-' + where
return self.plot(x, y, *args, **kwargs)
def bar(self, left, height, width=0.8, bottom=None,
color=None, edgecolor=None, linewidth=None,
yerr=None, xerr=None, ecolor=None, capsize=3,
align='edge', orientation='vertical', log=False,
**kwargs
):
"""
call signature::
bar(left, height, width=0.8, bottom=0,
color=None, edgecolor=None, linewidth=None,
yerr=None, xerr=None, ecolor=None, capsize=3,
align='edge', orientation='vertical', log=False)
Make a bar plot with rectangles bounded by:
*left*, *left* + *width*, *bottom*, *bottom* + *height*
(left, right, bottom and top edges)
*left*, *height*, *width*, and *bottom* can be either scalars
or sequences
Return value is a list of
:class:`matplotlib.patches.Rectangle` instances.
Required arguments:
======== ===============================================
Argument Description
======== ===============================================
*left* the x coordinates of the left sides of the bars
*height* the heights of the bars
======== ===============================================
Optional keyword arguments:
=============== ==========================================
Keyword Description
=============== ==========================================
*width* the widths of the bars
*bottom* the y coordinates of the bottom edges of
the bars
*color* the colors of the bars
*edgecolor* the colors of the bar edges
*linewidth* width of bar edges; None means use default
linewidth; 0 means don't draw edges.
*xerr* if not None, will be used to generate
errorbars on the bar chart
*yerr* if not None, will be used to generate
errorbars on the bar chart
*ecolor* specifies the color of any errorbar
*capsize* (default 3) determines the length in
points of the error bar caps
*align* 'edge' (default) | 'center'
*orientation* 'vertical' | 'horizontal'
*log* [False|True] False (default) leaves the
orientation axis as-is; True sets it to
log scale
=============== ==========================================
For vertical bars, *align* = 'edge' aligns bars by their left
edges in left, while *align* = 'center' interprets these
values as the *x* coordinates of the bar centers. For
horizontal bars, *align* = 'edge' aligns bars by their bottom
edges in bottom, while *align* = 'center' interprets these
values as the *y* coordinates of the bar centers.
The optional arguments *color*, *edgecolor*, *linewidth*,
*xerr*, and *yerr* can be either scalars or sequences of
length equal to the number of bars. This enables you to use
bar as the basis for stacked bar charts, or candlestick plots.
Other optional kwargs:
%(Rectangle)s
**Example:** A stacked bar chart.
.. plot:: mpl_examples/pylab_examples/bar_stacked.py
"""
if not self._hold: self.cla()
label = kwargs.pop('label', '')
def make_iterable(x):
if not iterable(x):
return [x]
else:
return x
# make them safe to take len() of
_left = left
left = make_iterable(left)
height = make_iterable(height)
width = make_iterable(width)
_bottom = bottom
bottom = make_iterable(bottom)
linewidth = make_iterable(linewidth)
adjust_ylim = False
adjust_xlim = False
if orientation == 'vertical':
self._process_unit_info(xdata=left, ydata=height, kwargs=kwargs)
if log:
self.set_yscale('log')
# size width and bottom according to length of left
if _bottom is None:
if self.get_yscale() == 'log':
bottom = [1e-100]
adjust_ylim = True
else:
bottom = [0]
nbars = len(left)
if len(width) == 1:
width *= nbars
if len(bottom) == 1:
bottom *= nbars
elif orientation == 'horizontal':
self._process_unit_info(xdata=width, ydata=bottom, kwargs=kwargs)
if log:
self.set_xscale('log')
# size left and height according to length of bottom
if _left is None:
if self.get_xscale() == 'log':
left = [1e-100]
adjust_xlim = True
else:
left = [0]
nbars = len(bottom)
if len(left) == 1:
left *= nbars
if len(height) == 1:
height *= nbars
else:
raise ValueError, 'invalid orientation: %s' % orientation
# do not convert to array here as unit info is lost
#left = np.asarray(left)
#height = np.asarray(height)
#width = np.asarray(width)
#bottom = np.asarray(bottom)
if len(linewidth) < nbars:
linewidth *= nbars
if color is None:
color = [None] * nbars
else:
color = list(mcolors.colorConverter.to_rgba_array(color))
if len(color) < nbars:
color *= nbars
if edgecolor is None:
edgecolor = [None] * nbars
else:
edgecolor = list(mcolors.colorConverter.to_rgba_array(edgecolor))
if len(edgecolor) < nbars:
edgecolor *= nbars
if yerr is not None:
if not iterable(yerr):
yerr = [yerr]*nbars
if xerr is not None:
if not iterable(xerr):
xerr = [xerr]*nbars
# FIXME: convert the following to proper input validation
# raising ValueError; don't use assert for this.
assert len(left)==nbars, "argument 'left' must be %d or scalar" % nbars
assert len(height)==nbars, ("argument 'height' must be %d or scalar" %
nbars)
assert len(width)==nbars, ("argument 'width' must be %d or scalar" %
nbars)
assert len(bottom)==nbars, ("argument 'bottom' must be %d or scalar" %
nbars)
if yerr is not None and len(yerr)!=nbars:
raise ValueError(
"bar() argument 'yerr' must be len(%s) or scalar" % nbars)
if xerr is not None and len(xerr)!=nbars:
raise ValueError(
"bar() argument 'xerr' must be len(%s) or scalar" % nbars)
patches = []
# lets do some conversions now since some types cannot be
# subtracted uniformly
if self.xaxis is not None:
xconv = self.xaxis.converter
if xconv is not None:
units = self.xaxis.get_units()
left = xconv.convert( left, units )
width = xconv.convert( width, units )
if self.yaxis is not None:
yconv = self.yaxis.converter
if yconv is not None :
units = self.yaxis.get_units()
bottom = yconv.convert( bottom, units )
height = yconv.convert( height, units )
if align == 'edge':
pass
elif align == 'center':
if orientation == 'vertical':
left = [left[i] - width[i]/2. for i in xrange(len(left))]
elif orientation == 'horizontal':
bottom = [bottom[i] - height[i]/2. for i in xrange(len(bottom))]
else:
raise ValueError, 'invalid alignment: %s' % align
args = zip(left, bottom, width, height, color, edgecolor, linewidth)
for l, b, w, h, c, e, lw in args:
if h<0:
b += h
h = abs(h)
if w<0:
l += w
w = abs(w)
r = mpatches.Rectangle(
xy=(l, b), width=w, height=h,
facecolor=c,
edgecolor=e,
linewidth=lw,
label=label
)
label = '_nolegend_'
r.update(kwargs)
#print r.get_label(), label, 'label' in kwargs
self.add_patch(r)
patches.append(r)
holdstate = self._hold
self.hold(True) # ensure hold is on before plotting errorbars
if xerr is not None or yerr is not None:
if orientation == 'vertical':
# using list comps rather than arrays to preserve unit info
x = [l+0.5*w for l, w in zip(left, width)]
y = [b+h for b,h in zip(bottom, height)]
elif orientation == 'horizontal':
# using list comps rather than arrays to preserve unit info
x = [l+w for l,w in zip(left, width)]
y = [b+0.5*h for b,h in zip(bottom, height)]
self.errorbar(
x, y,
yerr=yerr, xerr=xerr,
fmt=None, ecolor=ecolor, capsize=capsize)
self.hold(holdstate) # restore previous hold state
if adjust_xlim:
xmin, xmax = self.dataLim.intervalx
xmin = np.amin(width[width!=0]) # filter out the 0 width rects
if xerr is not None:
xmin = xmin - np.amax(xerr)
xmin = max(xmin*0.9, 1e-100)
self.dataLim.intervalx = (xmin, xmax)
if adjust_ylim:
ymin, ymax = self.dataLim.intervaly
ymin = np.amin(height[height!=0]) # filter out the 0 height rects
if yerr is not None:
ymin = ymin - np.amax(yerr)
ymin = max(ymin*0.9, 1e-100)
self.dataLim.intervaly = (ymin, ymax)
self.autoscale_view()
return patches
bar.__doc__ = cbook.dedent(bar.__doc__) % martist.kwdocd
def barh(self, bottom, width, height=0.8, left=None, **kwargs):
"""
call signature::
barh(bottom, width, height=0.8, left=0, **kwargs)
Make a horizontal bar plot with rectangles bounded by:
*left*, *left* + *width*, *bottom*, *bottom* + *height*
(left, right, bottom and top edges)
*bottom*, *width*, *height*, and *left* can be either scalars
or sequences
Return value is a list of
:class:`matplotlib.patches.Rectangle` instances.
Required arguments:
======== ======================================================
Argument Description
======== ======================================================
*bottom* the vertical positions of the bottom edges of the bars
*width* the lengths of the bars
======== ======================================================
Optional keyword arguments:
=============== ==========================================
Keyword Description
=============== ==========================================
*height* the heights (thicknesses) of the bars
*left* the x coordinates of the left edges of the
bars
*color* the colors of the bars
*edgecolor* the colors of the bar edges
*linewidth* width of bar edges; None means use default
linewidth; 0 means don't draw edges.
*xerr* if not None, will be used to generate
errorbars on the bar chart
*yerr* if not None, will be used to generate
errorbars on the bar chart
*ecolor* specifies the color of any errorbar
*capsize* (default 3) determines the length in
points of the error bar caps
*align* 'edge' (default) | 'center'
*log* [False|True] False (default) leaves the
horizontal axis as-is; True sets it to log
scale
=============== ==========================================
Setting *align* = 'edge' aligns bars by their bottom edges in
bottom, while *align* = 'center' interprets these values as
the *y* coordinates of the bar centers.
The optional arguments *color*, *edgecolor*, *linewidth*,
*xerr*, and *yerr* can be either scalars or sequences of
length equal to the number of bars. This enables you to use
barh as the basis for stacked bar charts, or candlestick
plots.
other optional kwargs:
%(Rectangle)s
"""
patches = self.bar(left=left, height=height, width=width, bottom=bottom,
orientation='horizontal', **kwargs)
return patches
barh.__doc__ = cbook.dedent(barh.__doc__) % martist.kwdocd
def broken_barh(self, xranges, yrange, **kwargs):
"""
call signature::
broken_barh(self, xranges, yrange, **kwargs)
A collection of horizontal bars spanning *yrange* with a sequence of
*xranges*.
Required arguments:
========= ==============================
Argument Description
========= ==============================
*xranges* sequence of (*xmin*, *xwidth*)
*yrange* sequence of (*ymin*, *ywidth*)
========= ==============================
kwargs are
:class:`matplotlib.collections.BrokenBarHCollection`
properties:
%(BrokenBarHCollection)s
these can either be a single argument, ie::
facecolors = 'black'
or a sequence of arguments for the various bars, ie::
facecolors = ('black', 'red', 'green')
**Example:**
.. plot:: mpl_examples/pylab_examples/broken_barh.py
"""
col = mcoll.BrokenBarHCollection(xranges, yrange, **kwargs)
self.add_collection(col, autolim=True)
self.autoscale_view()
return col
broken_barh.__doc__ = cbook.dedent(broken_barh.__doc__) % martist.kwdocd
def stem(self, x, y, linefmt='b-', markerfmt='bo', basefmt='r-'):
"""
call signature::
stem(x, y, linefmt='b-', markerfmt='bo', basefmt='r-')
A stem plot plots vertical lines (using *linefmt*) at each *x*
location from the baseline to *y*, and places a marker there
using *markerfmt*. A horizontal line at 0 is is plotted using
*basefmt*.
Return value is a tuple (*markerline*, *stemlines*,
*baseline*).
.. seealso::
`this document`__ for details
:file:`examples/pylab_examples/stem_plot.py`:
for a demo
__ http://www.mathworks.com/access/helpdesk/help/techdoc/ref/stem.html
"""
remember_hold=self._hold
if not self._hold: self.cla()
self.hold(True)
markerline, = self.plot(x, y, markerfmt)
stemlines = []
for thisx, thisy in zip(x, y):
l, = self.plot([thisx,thisx], [0, thisy], linefmt)
stemlines.append(l)
baseline, = self.plot([np.amin(x), np.amax(x)], [0,0], basefmt)
self.hold(remember_hold)
return markerline, stemlines, baseline
def pie(self, x, explode=None, labels=None, colors=None,
autopct=None, pctdistance=0.6, shadow=False,
labeldistance=1.1):
r"""
call signature::
pie(x, explode=None, labels=None,
colors=('b', 'g', 'r', 'c', 'm', 'y', 'k', 'w'),
autopct=None, pctdistance=0.6, labeldistance=1.1, shadow=False)
Make a pie chart of array *x*. The fractional area of each
wedge is given by x/sum(x). If sum(x) <= 1, then the values
of x give the fractional area directly and the array will not
be normalized.
Keyword arguments:
*explode*: [ None | len(x) sequence ]
If not *None*, is a len(*x*) array which specifies the
fraction of the radius with which to offset each wedge.
*colors*: [ None | color sequence ]
A sequence of matplotlib color args through which the pie chart
will cycle.
*labels*: [ None | len(x) sequence of strings ]
A sequence of strings providing the labels for each wedge
*autopct*: [ None | format string | format function ]
If not *None*, is a string or function used to label the
wedges with their numeric value. The label will be placed inside
the wedge. If it is a format string, the label will be ``fmt%pct``.
If it is a function, it will be called.
*pctdistance*: scalar
The ratio between the center of each pie slice and the
start of the text generated by *autopct*. Ignored if
*autopct* is *None*; default is 0.6.
*labeldistance*: scalar
The radial distance at which the pie labels are drawn
*shadow*: [ False | True ]
Draw a shadow beneath the pie.
The pie chart will probably look best if the figure and axes are
square. Eg.::
figure(figsize=(8,8))
ax = axes([0.1, 0.1, 0.8, 0.8])
Return value:
If *autopct* is None, return the tuple (*patches*, *texts*):
- *patches* is a sequence of
:class:`matplotlib.patches.Wedge` instances
- *texts* is a list of the label
:class:`matplotlib.text.Text` instances.
If *autopct* is not *None*, return the tuple (*patches*,
*texts*, *autotexts*), where *patches* and *texts* are as
above, and *autotexts* is a list of
:class:`~matplotlib.text.Text` instances for the numeric
labels.
"""
self.set_frame_on(False)
x = np.asarray(x).astype(np.float32)
sx = float(x.sum())
if sx>1: x = np.divide(x,sx)
if labels is None: labels = ['']*len(x)
if explode is None: explode = [0]*len(x)
assert(len(x)==len(labels))
assert(len(x)==len(explode))
if colors is None: colors = ('b', 'g', 'r', 'c', 'm', 'y', 'k', 'w')
center = 0,0
radius = 1
theta1 = 0
i = 0
texts = []
slices = []
autotexts = []
for frac, label, expl in cbook.safezip(x,labels, explode):
x, y = center
theta2 = theta1 + frac
thetam = 2*math.pi*0.5*(theta1+theta2)
x += expl*math.cos(thetam)
y += expl*math.sin(thetam)
w = mpatches.Wedge((x,y), radius, 360.*theta1, 360.*theta2,
facecolor=colors[i%len(colors)])
slices.append(w)
self.add_patch(w)
w.set_label(label)
if shadow:
# make sure to add a shadow after the call to
# add_patch so the figure and transform props will be
# set
shad = mpatches.Shadow(w, -0.02, -0.02,
#props={'facecolor':w.get_facecolor()}
)
shad.set_zorder(0.9*w.get_zorder())
self.add_patch(shad)
xt = x + labeldistance*radius*math.cos(thetam)
yt = y + labeldistance*radius*math.sin(thetam)
label_alignment = xt > 0 and 'left' or 'right'
t = self.text(xt, yt, label,
size=rcParams['xtick.labelsize'],
horizontalalignment=label_alignment,
verticalalignment='center')
texts.append(t)
if autopct is not None:
xt = x + pctdistance*radius*math.cos(thetam)
yt = y + pctdistance*radius*math.sin(thetam)
if is_string_like(autopct):
s = autopct%(100.*frac)
elif callable(autopct):
s = autopct(100.*frac)
else:
raise TypeError(
'autopct must be callable or a format string')
t = self.text(xt, yt, s,
horizontalalignment='center',
verticalalignment='center')
autotexts.append(t)
theta1 = theta2
i += 1
self.set_xlim((-1.25, 1.25))
self.set_ylim((-1.25, 1.25))
self.set_xticks([])
self.set_yticks([])
if autopct is None: return slices, texts
else: return slices, texts, autotexts
def errorbar(self, x, y, yerr=None, xerr=None,
fmt='-', ecolor=None, elinewidth=None, capsize=3,
barsabove=False, lolims=False, uplims=False,
xlolims=False, xuplims=False, **kwargs):
"""
call signature::
errorbar(x, y, yerr=None, xerr=None,
fmt='-', ecolor=None, elinewidth=None, capsize=3,
barsabove=False, lolims=False, uplims=False,
xlolims=False, xuplims=False)
Plot *x* versus *y* with error deltas in *yerr* and *xerr*.
Vertical errorbars are plotted if *yerr* is not *None*.
Horizontal errorbars are plotted if *xerr* is not *None*.
*x*, *y*, *xerr*, and *yerr* can all be scalars, which plots a
single error bar at *x*, *y*.
Optional keyword arguments:
*xerr*/*yerr*: [ scalar | N, Nx1, Nx2 array-like ]
If a scalar number, len(N) array-like object, or an Nx1 array-like
object, errorbars are drawn +/- value.
If a rank-1, Nx2 Numpy array, errorbars are drawn at -column1 and
+column2
*fmt*: '-'
The plot format symbol for *y*. If *fmt* is *None*, just plot the
errorbars with no line symbols. This can be useful for creating a
bar plot with errorbars.
*ecolor*: [ None | mpl color ]
a matplotlib color arg which gives the color the errorbar lines; if
*None*, use the marker color.
*elinewidth*: scalar
the linewidth of the errorbar lines. If *None*, use the linewidth.
*capsize*: scalar
the size of the error bar caps in points
*barsabove*: [ True | False ]
if *True*, will plot the errorbars above the plot
symbols. Default is below.
*lolims*/*uplims*/*xlolims*/*xuplims*: [ False | True ]
These arguments can be used to indicate that a value gives
only upper/lower limits. In that case a caret symbol is
used to indicate this. lims-arguments may be of the same
type as *xerr* and *yerr*.
All other keyword arguments are passed on to the plot command for the
markers, so you can add additional key=value pairs to control the
errorbar markers. For example, this code makes big red squares with
thick green edges::
x,y,yerr = rand(3,10)
errorbar(x, y, yerr, marker='s',
mfc='red', mec='green', ms=20, mew=4)
where *mfc*, *mec*, *ms* and *mew* are aliases for the longer
property names, *markerfacecolor*, *markeredgecolor*, *markersize*
and *markeredgewith*.
valid kwargs for the marker properties are
%(Line2D)s
Return value is a length 3 tuple. The first element is the
:class:`~matplotlib.lines.Line2D` instance for the *y* symbol
lines. The second element is a list of error bar cap lines,
the third element is a list of
:class:`~matplotlib.collections.LineCollection` instances for
the horizontal and vertical error ranges.
**Example:**
.. plot:: mpl_examples/pylab_examples/errorbar_demo.py
"""
self._process_unit_info(xdata=x, ydata=y, kwargs=kwargs)
if not self._hold: self.cla()
# make sure all the args are iterable; use lists not arrays to
# preserve units
if not iterable(x):
x = [x]
if not iterable(y):
y = [y]
if xerr is not None:
if not iterable(xerr):
xerr = [xerr]*len(x)
if yerr is not None:
if not iterable(yerr):
yerr = [yerr]*len(y)
l0 = None
if barsabove and fmt is not None:
l0, = self.plot(x,y,fmt,**kwargs)
barcols = []
caplines = []
lines_kw = {'label':'_nolegend_'}
if elinewidth:
lines_kw['linewidth'] = elinewidth
else:
if 'linewidth' in kwargs:
lines_kw['linewidth']=kwargs['linewidth']
if 'lw' in kwargs:
lines_kw['lw']=kwargs['lw']
if 'transform' in kwargs:
lines_kw['transform'] = kwargs['transform']
# arrays fine here, they are booleans and hence not units
if not iterable(lolims):
lolims = np.asarray([lolims]*len(x), bool)
else: lolims = np.asarray(lolims, bool)
if not iterable(uplims): uplims = np.array([uplims]*len(x), bool)
else: uplims = np.asarray(uplims, bool)
if not iterable(xlolims): xlolims = np.array([xlolims]*len(x), bool)
else: xlolims = np.asarray(xlolims, bool)
if not iterable(xuplims): xuplims = np.array([xuplims]*len(x), bool)
else: xuplims = np.asarray(xuplims, bool)
def xywhere(xs, ys, mask):
"""
return xs[mask], ys[mask] where mask is True but xs and
ys are not arrays
"""
assert len(xs)==len(ys)
assert len(xs)==len(mask)
xs = [thisx for thisx, b in zip(xs, mask) if b]
ys = [thisy for thisy, b in zip(ys, mask) if b]
return xs, ys
if capsize > 0:
plot_kw = {
'ms':2*capsize,
'label':'_nolegend_'}
if 'markeredgewidth' in kwargs:
plot_kw['markeredgewidth']=kwargs['markeredgewidth']
if 'mew' in kwargs:
plot_kw['mew']=kwargs['mew']
if 'transform' in kwargs:
plot_kw['transform'] = kwargs['transform']
if xerr is not None:
if (iterable(xerr) and len(xerr)==2 and
iterable(xerr[0]) and iterable(xerr[1])):
# using list comps rather than arrays to preserve units
left = [thisx-thiserr for (thisx, thiserr)
in cbook.safezip(x,xerr[0])]
right = [thisx+thiserr for (thisx, thiserr)
in cbook.safezip(x,xerr[1])]
else:
# using list comps rather than arrays to preserve units
left = [thisx-thiserr for (thisx, thiserr)
in cbook.safezip(x,xerr)]
right = [thisx+thiserr for (thisx, thiserr)
in cbook.safezip(x,xerr)]
barcols.append( self.hlines(y, left, right, **lines_kw ) )
if capsize > 0:
if xlolims.any():
# can't use numpy logical indexing since left and
# y are lists
leftlo, ylo = xywhere(left, y, xlolims)
caplines.extend(
self.plot(leftlo, ylo, ls='None',
marker=mlines.CARETLEFT, **plot_kw) )
xlolims = ~xlolims
leftlo, ylo = xywhere(left, y, xlolims)
caplines.extend( self.plot(leftlo, ylo, 'k|', **plot_kw) )
else:
caplines.extend( self.plot(left, y, 'k|', **plot_kw) )
if xuplims.any():
rightup, yup = xywhere(right, y, xuplims)
caplines.extend(
self.plot(rightup, yup, ls='None',
marker=mlines.CARETRIGHT, **plot_kw) )
xuplims = ~xuplims
rightup, yup = xywhere(right, y, xuplims)
caplines.extend( self.plot(rightup, yup, 'k|', **plot_kw) )
else:
caplines.extend( self.plot(right, y, 'k|', **plot_kw) )
if yerr is not None:
if (iterable(yerr) and len(yerr)==2 and
iterable(yerr[0]) and iterable(yerr[1])):
# using list comps rather than arrays to preserve units
lower = [thisy-thiserr for (thisy, thiserr)
in cbook.safezip(y,yerr[0])]
upper = [thisy+thiserr for (thisy, thiserr)
in cbook.safezip(y,yerr[1])]
else:
# using list comps rather than arrays to preserve units
lower = [thisy-thiserr for (thisy, thiserr)
in cbook.safezip(y,yerr)]
upper = [thisy+thiserr for (thisy, thiserr)
in cbook.safezip(y,yerr)]
barcols.append( self.vlines(x, lower, upper, **lines_kw) )
if capsize > 0:
if lolims.any():
xlo, lowerlo = xywhere(x, lower, lolims)
caplines.extend(
self.plot(xlo, lowerlo, ls='None',
marker=mlines.CARETDOWN, **plot_kw) )
lolims = ~lolims
xlo, lowerlo = xywhere(x, lower, lolims)
caplines.extend( self.plot(xlo, lowerlo, 'k_', **plot_kw) )
else:
caplines.extend( self.plot(x, lower, 'k_', **plot_kw) )
if uplims.any():
xup, upperup = xywhere(x, upper, uplims)
caplines.extend(
self.plot(xup, upperup, ls='None',
marker=mlines.CARETUP, **plot_kw) )
uplims = ~uplims
xup, upperup = xywhere(x, upper, uplims)
caplines.extend( self.plot(xup, upperup, 'k_', **plot_kw) )
else:
caplines.extend( self.plot(x, upper, 'k_', **plot_kw) )
if not barsabove and fmt is not None:
l0, = self.plot(x,y,fmt,**kwargs)
if ecolor is None:
if l0 is None:
ecolor = self._get_lines._get_next_cycle_color()
else:
ecolor = l0.get_color()
for l in barcols:
l.set_color(ecolor)
for l in caplines:
l.set_color(ecolor)
self.autoscale_view()
return (l0, caplines, barcols)
errorbar.__doc__ = cbook.dedent(errorbar.__doc__) % martist.kwdocd
def boxplot(self, x, notch=0, sym='b+', vert=1, whis=1.5,
positions=None, widths=None):
"""
call signature::
boxplot(x, notch=0, sym='+', vert=1, whis=1.5,
positions=None, widths=None)
Make a box and whisker plot for each column of *x* or each
vector in sequence *x*. The box extends from the lower to
upper quartile values of the data, with a line at the median.
The whiskers extend from the box to show the range of the
data. Flier points are those past the end of the whiskers.
- *notch* = 0 (default) produces a rectangular box plot.
- *notch* = 1 will produce a notched box plot
*sym* (default 'b+') is the default symbol for flier points.
Enter an empty string ('') if you don't want to show fliers.
- *vert* = 1 (default) makes the boxes vertical.
- *vert* = 0 makes horizontal boxes. This seems goofy, but
that's how Matlab did it.
*whis* (default 1.5) defines the length of the whiskers as
a function of the inner quartile range. They extend to the
most extreme data point within ( ``whis*(75%-25%)`` ) data range.
*positions* (default 1,2,...,n) sets the horizontal positions of
the boxes. The ticks and limits are automatically set to match
the positions.
*widths* is either a scalar or a vector and sets the width of
each box. The default is 0.5, or ``0.15*(distance between extreme
positions)`` if that is smaller.
*x* is an array or a sequence of vectors.
Returns a dictionary mapping each component of the boxplot
to a list of the :class:`matplotlib.lines.Line2D`
instances created.
**Example:**
.. plot:: pyplots/boxplot_demo.py
"""
if not self._hold: self.cla()
holdStatus = self._hold
whiskers, caps, boxes, medians, fliers = [], [], [], [], []
# convert x to a list of vectors
if hasattr(x, 'shape'):
if len(x.shape) == 1:
if hasattr(x[0], 'shape'):
x = list(x)
else:
x = [x,]
elif len(x.shape) == 2:
nr, nc = x.shape
if nr == 1:
x = [x]
elif nc == 1:
x = [x.ravel()]
else:
x = [x[:,i] for i in xrange(nc)]
else:
raise ValueError, "input x can have no more than 2 dimensions"
if not hasattr(x[0], '__len__'):
x = [x]
col = len(x)
# get some plot info
if positions is None:
positions = range(1, col + 1)
if widths is None:
distance = max(positions) - min(positions)
widths = min(0.15*max(distance,1.0), 0.5)
if isinstance(widths, float) or isinstance(widths, int):
widths = np.ones((col,), float) * widths
# loop through columns, adding each to plot
self.hold(True)
for i,pos in enumerate(positions):
d = np.ravel(x[i])
row = len(d)
# get median and quartiles
q1, med, q3 = mlab.prctile(d,[25,50,75])
# get high extreme
iq = q3 - q1
hi_val = q3 + whis*iq
wisk_hi = np.compress( d <= hi_val , d )
if len(wisk_hi) == 0:
wisk_hi = q3
else:
wisk_hi = max(wisk_hi)
# get low extreme
lo_val = q1 - whis*iq
wisk_lo = np.compress( d >= lo_val, d )
if len(wisk_lo) == 0:
wisk_lo = q1
else:
wisk_lo = min(wisk_lo)
# get fliers - if we are showing them
flier_hi = []
flier_lo = []
flier_hi_x = []
flier_lo_x = []
if len(sym) != 0:
flier_hi = np.compress( d > wisk_hi, d )
flier_lo = np.compress( d < wisk_lo, d )
flier_hi_x = np.ones(flier_hi.shape[0]) * pos
flier_lo_x = np.ones(flier_lo.shape[0]) * pos
# get x locations for fliers, whisker, whisker cap and box sides
box_x_min = pos - widths[i] * 0.5
box_x_max = pos + widths[i] * 0.5
wisk_x = np.ones(2) * pos
cap_x_min = pos - widths[i] * 0.25
cap_x_max = pos + widths[i] * 0.25
cap_x = [cap_x_min, cap_x_max]
# get y location for median
med_y = [med, med]
# calculate 'regular' plot
if notch == 0:
# make our box vectors
box_x = [box_x_min, box_x_max, box_x_max, box_x_min, box_x_min ]
box_y = [q1, q1, q3, q3, q1 ]
# make our median line vectors
med_x = [box_x_min, box_x_max]
# calculate 'notch' plot
else:
notch_max = med + 1.57*iq/np.sqrt(row)
notch_min = med - 1.57*iq/np.sqrt(row)
if notch_max > q3:
notch_max = q3
if notch_min < q1:
notch_min = q1
# make our notched box vectors
box_x = [box_x_min, box_x_max, box_x_max, cap_x_max, box_x_max,
box_x_max, box_x_min, box_x_min, cap_x_min, box_x_min,
box_x_min ]
box_y = [q1, q1, notch_min, med, notch_max, q3, q3, notch_max,
med, notch_min, q1]
# make our median line vectors
med_x = [cap_x_min, cap_x_max]
med_y = [med, med]
# vertical or horizontal plot?
if vert:
def doplot(*args):
return self.plot(*args)
else:
def doplot(*args):
shuffled = []
for i in xrange(0, len(args), 3):
shuffled.extend([args[i+1], args[i], args[i+2]])
return self.plot(*shuffled)
whiskers.extend(doplot(wisk_x, [q1, wisk_lo], 'b--',
wisk_x, [q3, wisk_hi], 'b--'))
caps.extend(doplot(cap_x, [wisk_hi, wisk_hi], 'k-',
cap_x, [wisk_lo, wisk_lo], 'k-'))
boxes.extend(doplot(box_x, box_y, 'b-'))
medians.extend(doplot(med_x, med_y, 'r-'))
fliers.extend(doplot(flier_hi_x, flier_hi, sym,
flier_lo_x, flier_lo, sym))
# fix our axes/ticks up a little
if 1 == vert:
setticks, setlim = self.set_xticks, self.set_xlim
else:
setticks, setlim = self.set_yticks, self.set_ylim
newlimits = min(positions)-0.5, max(positions)+0.5
setlim(newlimits)
setticks(positions)
# reset hold status
self.hold(holdStatus)
return dict(whiskers=whiskers, caps=caps, boxes=boxes,
medians=medians, fliers=fliers)
def scatter(self, x, y, s=20, c='b', marker='o', cmap=None, norm=None,
vmin=None, vmax=None, alpha=1.0, linewidths=None,
faceted=True, verts=None,
**kwargs):
"""
call signatures::
scatter(x, y, s=20, c='b', marker='o', cmap=None, norm=None,
vmin=None, vmax=None, alpha=1.0, linewidths=None,
verts=None, **kwargs)
Make a scatter plot of *x* versus *y*, where *x*, *y* are 1-D
sequences of the same length, *N*.
Keyword arguments:
*s*:
size in points^2. It is a scalar or an array of the same
length as *x* and *y*.
*c*:
a color. *c* can be a single color format string, or a
sequence of color specifications of length *N*, or a
sequence of *N* numbers to be mapped to colors using the
*cmap* and *norm* specified via kwargs (see below). Note
that *c* should not be a single numeric RGB or RGBA
sequence because that is indistinguishable from an array
of values to be colormapped. *c* can be a 2-D array in
which the rows are RGB or RGBA, however.
*marker*:
can be one of:
===== ==============
Value Description
===== ==============
's' square
'o' circle
'^' triangle up
'>' triangle right
'v' triangle down
'<' triangle left
'd' diamond
'p' pentagram
'h' hexagon
'8' octagon
'+' plus
'x' cross
===== ==============
The marker can also be a tuple (*numsides*, *style*,
*angle*), which will create a custom, regular symbol.
*numsides*:
the number of sides
*style*:
the style of the regular symbol:
===== =============================================
Value Description
===== =============================================
0 a regular polygon
1 a star-like symbol
2 an asterisk
3 a circle (*numsides* and *angle* is ignored)
===== =============================================
*angle*:
the angle of rotation of the symbol
Finally, *marker* can be (*verts*, 0): *verts* is a
sequence of (*x*, *y*) vertices for a custom scatter
symbol. Alternatively, use the kwarg combination
*marker* = *None*, *verts* = *verts*.
Any or all of *x*, *y*, *s*, and *c* may be masked arrays, in
which case all masks will be combined and only unmasked points
will be plotted.
Other keyword arguments: the color mapping and normalization
arguments will be used only if *c* is an array of floats.
*cmap*: [ None | Colormap ]
A :class:`matplotlib.colors.Colormap` instance. If *None*,
defaults to rc ``image.cmap``. *cmap* is only used if *c*
is an array of floats.
*norm*: [ None | Normalize ]
A :class:`matplotlib.colors.Normalize` instance is used to
scale luminance data to 0, 1. If *None*, use the default
:func:`normalize`. *norm* is only used if *c* is an array
of floats.
*vmin*/*vmax*:
*vmin* and *vmax* are used in conjunction with norm to
normalize luminance data. If either are None, the min and
max of the color array *C* is used. Note if you pass a
*norm* instance, your settings for *vmin* and *vmax* will
be ignored.
*alpha*: 0 <= scalar <= 1
The alpha value for the patches
*linewidths*: [ None | scalar | sequence ]
If *None*, defaults to (lines.linewidth,). Note that this
is a tuple, and if you set the linewidths argument you
must set it as a sequence of floats, as required by
:class:`~matplotlib.collections.RegularPolyCollection`.
Optional kwargs control the
:class:`~matplotlib.collections.Collection` properties; in
particular:
*edgecolors*:
'none' to plot faces with no outlines
*facecolors*:
'none' to plot unfilled outlines
Here are the standard descriptions of all the
:class:`~matplotlib.collections.Collection` kwargs:
%(Collection)s
A :class:`~matplotlib.collections.Collection` instance is
returned.
"""
if not self._hold: self.cla()
syms = { # a dict from symbol to (numsides, angle)
's' : (4,math.pi/4.0,0), # square
'o' : (20,3,0), # circle
'^' : (3,0,0), # triangle up
'>' : (3,math.pi/2.0,0), # triangle right
'v' : (3,math.pi,0), # triangle down
'<' : (3,3*math.pi/2.0,0), # triangle left
'd' : (4,0,0), # diamond
'p' : (5,0,0), # pentagram
'h' : (6,0,0), # hexagon
'8' : (8,0,0), # octagon
'+' : (4,0,2), # plus
'x' : (4,math.pi/4.0,2) # cross
}
self._process_unit_info(xdata=x, ydata=y, kwargs=kwargs)
x, y, s, c = cbook.delete_masked_points(x, y, s, c)
if is_string_like(c) or cbook.is_sequence_of_strings(c):
colors = mcolors.colorConverter.to_rgba_array(c, alpha)
else:
sh = np.shape(c)
# The inherent ambiguity is resolved in favor of color
# mapping, not interpretation as rgb or rgba:
if len(sh) == 1 and sh[0] == len(x):
colors = None # use cmap, norm after collection is created
else:
colors = mcolors.colorConverter.to_rgba_array(c, alpha)
if not iterable(s):
scales = (s,)
else:
scales = s
if faceted:
edgecolors = None
else:
edgecolors = 'none'
warnings.warn(
'''replace "faceted=False" with "edgecolors='none'"''',
DeprecationWarning) #2008/04/18
sym = None
symstyle = 0
# to be API compatible
if marker is None and not (verts is None):
marker = (verts, 0)
verts = None
if is_string_like(marker):
# the standard way to define symbols using a string character
sym = syms.get(marker)
if sym is None and verts is None:
raise ValueError('Unknown marker symbol to scatter')
numsides, rotation, symstyle = syms[marker]
elif iterable(marker):
# accept marker to be:
# (numsides, style, [angle])
# or
# (verts[], style, [angle])
if len(marker)<2 or len(marker)>3:
raise ValueError('Cannot create markersymbol from marker')
if cbook.is_numlike(marker[0]):
# (numsides, style, [angle])
if len(marker)==2:
numsides, rotation = marker[0], 0.
elif len(marker)==3:
numsides, rotation = marker[0], marker[2]
sym = True
if marker[1] in (1,2):
symstyle = marker[1]
else:
verts = np.asarray(marker[0])
if sym is not None:
if symstyle==0:
collection = mcoll.RegularPolyCollection(
numsides, rotation, scales,
facecolors = colors,
edgecolors = edgecolors,
linewidths = linewidths,
offsets = zip(x,y),
transOffset = self.transData,
)
elif symstyle==1:
collection = mcoll.StarPolygonCollection(
numsides, rotation, scales,
facecolors = colors,
edgecolors = edgecolors,
linewidths = linewidths,
offsets = zip(x,y),
transOffset = self.transData,
)
elif symstyle==2:
collection = mcoll.AsteriskPolygonCollection(
numsides, rotation, scales,
facecolors = colors,
edgecolors = edgecolors,
linewidths = linewidths,
offsets = zip(x,y),
transOffset = self.transData,
)
elif symstyle==3:
collection = mcoll.CircleCollection(
scales,
facecolors = colors,
edgecolors = edgecolors,
linewidths = linewidths,
offsets = zip(x,y),
transOffset = self.transData,
)
else:
rescale = np.sqrt(max(verts[:,0]**2+verts[:,1]**2))
verts /= rescale
collection = mcoll.PolyCollection(
(verts,), scales,
facecolors = colors,
edgecolors = edgecolors,
linewidths = linewidths,
offsets = zip(x,y),
transOffset = self.transData,
)
collection.set_transform(mtransforms.IdentityTransform())
collection.set_alpha(alpha)
collection.update(kwargs)
if colors is None:
if norm is not None: assert(isinstance(norm, mcolors.Normalize))
if cmap is not None: assert(isinstance(cmap, mcolors.Colormap))
collection.set_array(np.asarray(c))
collection.set_cmap(cmap)
collection.set_norm(norm)
if vmin is not None or vmax is not None:
collection.set_clim(vmin, vmax)
else:
collection.autoscale_None()
temp_x = x
temp_y = y
minx = np.amin(temp_x)
maxx = np.amax(temp_x)
miny = np.amin(temp_y)
maxy = np.amax(temp_y)
w = maxx-minx
h = maxy-miny
# the pad is a little hack to deal with the fact that we don't
# want to transform all the symbols whose scales are in points
# to data coords to get the exact bounding box for efficiency
# reasons. It can be done right if this is deemed important
padx, pady = 0.05*w, 0.05*h
corners = (minx-padx, miny-pady), (maxx+padx, maxy+pady)
self.update_datalim( corners)
self.autoscale_view()
# add the collection last
self.add_collection(collection)
return collection
scatter.__doc__ = cbook.dedent(scatter.__doc__) % martist.kwdocd
def hexbin(self, x, y, C = None, gridsize = 100, bins = None,
xscale = 'linear', yscale = 'linear',
cmap=None, norm=None, vmin=None, vmax=None,
alpha=1.0, linewidths=None, edgecolors='none',
reduce_C_function = np.mean,
**kwargs):
"""
call signature::
hexbin(x, y, C = None, gridsize = 100, bins = None,
xscale = 'linear', yscale = 'linear',
cmap=None, norm=None, vmin=None, vmax=None,
alpha=1.0, linewidths=None, edgecolors='none'
reduce_C_function = np.mean,
**kwargs)
Make a hexagonal binning plot of *x* versus *y*, where *x*,
*y* are 1-D sequences of the same length, *N*. If *C* is None
(the default), this is a histogram of the number of occurences
of the observations at (x[i],y[i]).
If *C* is specified, it specifies values at the coordinate
(x[i],y[i]). These values are accumulated for each hexagonal
bin and then reduced according to *reduce_C_function*, which
defaults to numpy's mean function (np.mean). (If *C* is
specified, it must also be a 1-D sequence of the same length
as *x* and *y*.)
*x*, *y* and/or *C* may be masked arrays, in which case only
unmasked points will be plotted.
Optional keyword arguments:
*gridsize*: [ 100 | integer ]
The number of hexagons in the *x*-direction, default is
100. The corresponding number of hexagons in the
*y*-direction is chosen such that the hexagons are
approximately regular. Alternatively, gridsize can be a
tuple with two elements specifying the number of hexagons
in the *x*-direction and the *y*-direction.
*bins*: [ None | 'log' | integer | sequence ]
If *None*, no binning is applied; the color of each hexagon
directly corresponds to its count value.
If 'log', use a logarithmic scale for the color
map. Internally, :math:`log_{10}(i+1)` is used to
determine the hexagon color.
If an integer, divide the counts in the specified number
of bins, and color the hexagons accordingly.
If a sequence of values, the values of the lower bound of
the bins to be used.
*xscale*: [ 'linear' | 'log' ]
Use a linear or log10 scale on the horizontal axis.
*scale*: [ 'linear' | 'log' ]
Use a linear or log10 scale on the vertical axis.
Other keyword arguments controlling color mapping and normalization
arguments:
*cmap*: [ None | Colormap ]
a :class:`matplotlib.cm.Colormap` instance. If *None*,
defaults to rc ``image.cmap``.
*norm*: [ None | Normalize ]
:class:`matplotlib.colors.Normalize` instance is used to
scale luminance data to 0,1.
*vmin*/*vmax*: scalar
*vmin* and *vmax* are used in conjunction with *norm* to normalize
luminance data. If either are *None*, the min and max of the color
array *C* is used. Note if you pass a norm instance, your settings
for *vmin* and *vmax* will be ignored.
*alpha*: scalar
the alpha value for the patches
*linewidths*: [ None | scalar ]
If *None*, defaults to rc lines.linewidth. Note that this
is a tuple, and if you set the linewidths argument you
must set it as a sequence of floats, as required by
:class:`~matplotlib.collections.RegularPolyCollection`.
Other keyword arguments controlling the Collection properties:
*edgecolors*: [ None | mpl color | color sequence ]
If 'none', draws the edges in the same color as the fill color.
This is the default, as it avoids unsightly unpainted pixels
between the hexagons.
If *None*, draws the outlines in the default color.
If a matplotlib color arg or sequence of rgba tuples, draws the
outlines in the specified color.
Here are the standard descriptions of all the
:class:`~matplotlib.collections.Collection` kwargs:
%(Collection)s
The return value is a
:class:`~matplotlib.collections.PolyCollection` instance; use
:meth:`~matplotlib.collection.PolyCollection.get_array` on
this :class:`~matplotlib.collections.PolyCollection` to get
the counts in each hexagon.
**Example:**
.. plot:: mpl_examples/pylab_examples/hexbin_demo.py
"""
if not self._hold: self.cla()
self._process_unit_info(xdata=x, ydata=y, kwargs=kwargs)
x, y, C = cbook.delete_masked_points(x, y, C)
# Set the size of the hexagon grid
if iterable(gridsize):
nx, ny = gridsize
else:
nx = gridsize
ny = int(nx/math.sqrt(3))
# Count the number of data in each hexagon
x = np.array(x, float)
y = np.array(y, float)
if xscale=='log':
x = np.log10(x)
if yscale=='log':
y = np.log10(y)
xmin = np.amin(x)
xmax = np.amax(x)
ymin = np.amin(y)
ymax = np.amax(y)
# In the x-direction, the hexagons exactly cover the region from
# xmin to xmax. Need some padding to avoid roundoff errors.
padding = 1.e-9 * (xmax - xmin)
xmin -= padding
xmax += padding
sx = (xmax-xmin) / nx
sy = (ymax-ymin) / ny
x = (x-xmin)/sx
y = (y-ymin)/sy
ix1 = np.round(x).astype(int)
iy1 = np.round(y).astype(int)
ix2 = np.floor(x).astype(int)
iy2 = np.floor(y).astype(int)
nx1 = nx + 1
ny1 = ny + 1
nx2 = nx
ny2 = ny
n = nx1*ny1+nx2*ny2
d1 = (x-ix1)**2 + 3.0 * (y-iy1)**2
d2 = (x-ix2-0.5)**2 + 3.0 * (y-iy2-0.5)**2
bdist = (d1<d2)
if C is None:
accum = np.zeros(n)
# Create appropriate views into "accum" array.
lattice1 = accum[:nx1*ny1]
lattice2 = accum[nx1*ny1:]
lattice1.shape = (nx1,ny1)
lattice2.shape = (nx2,ny2)
for i in xrange(len(x)):
if bdist[i]:
lattice1[ix1[i], iy1[i]]+=1
else:
lattice2[ix2[i], iy2[i]]+=1
else:
# create accumulation arrays
lattice1 = np.empty((nx1,ny1),dtype=object)
for i in xrange(nx1):
for j in xrange(ny1):
lattice1[i,j] = []
lattice2 = np.empty((nx2,ny2),dtype=object)
for i in xrange(nx2):
for j in xrange(ny2):
lattice2[i,j] = []
for i in xrange(len(x)):
if bdist[i]:
lattice1[ix1[i], iy1[i]].append( C[i] )
else:
lattice2[ix2[i], iy2[i]].append( C[i] )
for i in xrange(nx1):
for j in xrange(ny1):
vals = lattice1[i,j]
if len(vals):
lattice1[i,j] = reduce_C_function( vals )
else:
lattice1[i,j] = np.nan
for i in xrange(nx2):
for j in xrange(ny2):
vals = lattice2[i,j]
if len(vals):
lattice2[i,j] = reduce_C_function( vals )
else:
lattice2[i,j] = np.nan
accum = np.hstack((
lattice1.astype(float).ravel(), lattice2.astype(float).ravel()))
good_idxs = ~np.isnan(accum)
px = xmin + sx * np.array([ 0.5, 0.5, 0.0, -0.5, -0.5, 0.0])
py = ymin + sy * np.array([-0.5, 0.5, 1.0, 0.5, -0.5, -1.0]) / 3.0
polygons = np.zeros((6, n, 2), float)
polygons[:,:nx1*ny1,0] = np.repeat(np.arange(nx1), ny1)
polygons[:,:nx1*ny1,1] = np.tile(np.arange(ny1), nx1)
polygons[:,nx1*ny1:,0] = np.repeat(np.arange(nx2) + 0.5, ny2)
polygons[:,nx1*ny1:,1] = np.tile(np.arange(ny2), nx2) + 0.5
if C is not None:
# remove accumulation bins with no data
polygons = polygons[:,good_idxs,:]
accum = accum[good_idxs]
polygons = np.transpose(polygons, axes=[1,0,2])
polygons[:,:,0] *= sx
polygons[:,:,1] *= sy
polygons[:,:,0] += px
polygons[:,:,1] += py
if xscale=='log':
polygons[:,:,0] = 10**(polygons[:,:,0])
xmin = 10**xmin
xmax = 10**xmax
self.set_xscale('log')
if yscale=='log':
polygons[:,:,1] = 10**(polygons[:,:,1])
ymin = 10**ymin
ymax = 10**ymax
self.set_yscale('log')
if edgecolors=='none':
edgecolors = 'face'
collection = mcoll.PolyCollection(
polygons,
edgecolors = edgecolors,
linewidths = linewidths,
transOffset = self.transData,
)
# Transform accum if needed
if bins=='log':
accum = np.log10(accum+1)
elif bins!=None:
if not iterable(bins):
minimum, maximum = min(accum), max(accum)
bins-=1 # one less edge than bins
bins = minimum + (maximum-minimum)*np.arange(bins)/bins
bins = np.sort(bins)
accum = bins.searchsorted(accum)
if norm is not None: assert(isinstance(norm, mcolors.Normalize))
if cmap is not None: assert(isinstance(cmap, mcolors.Colormap))
collection.set_array(accum)
collection.set_cmap(cmap)
collection.set_norm(norm)
collection.set_alpha(alpha)
collection.update(kwargs)
if vmin is not None or vmax is not None:
collection.set_clim(vmin, vmax)
else:
collection.autoscale_None()
corners = ((xmin, ymin), (xmax, ymax))
self.update_datalim( corners)
self.autoscale_view()
# add the collection last
self.add_collection(collection)
return collection
hexbin.__doc__ = cbook.dedent(hexbin.__doc__) % martist.kwdocd
def arrow(self, x, y, dx, dy, **kwargs):
"""
call signature::
arrow(x, y, dx, dy, **kwargs)
Draws arrow on specified axis from (*x*, *y*) to (*x* + *dx*,
*y* + *dy*).
Optional kwargs control the arrow properties:
%(FancyArrow)s
**Example:**
.. plot:: mpl_examples/pylab_examples/arrow_demo.py
"""
a = mpatches.FancyArrow(x, y, dx, dy, **kwargs)
self.add_artist(a)
return a
arrow.__doc__ = cbook.dedent(arrow.__doc__) % martist.kwdocd
def quiverkey(self, *args, **kw):
qk = mquiver.QuiverKey(*args, **kw)
self.add_artist(qk)
return qk
quiverkey.__doc__ = mquiver.QuiverKey.quiverkey_doc
def quiver(self, *args, **kw):
if not self._hold: self.cla()
q = mquiver.Quiver(self, *args, **kw)
self.add_collection(q, False)
self.update_datalim(q.XY)
self.autoscale_view()
return q
quiver.__doc__ = mquiver.Quiver.quiver_doc
def barbs(self, *args, **kw):
"""
%(barbs_doc)s
**Example:**
.. plot:: mpl_examples/pylab_examples/barb_demo.py
"""
if not self._hold: self.cla()
b = mquiver.Barbs(self, *args, **kw)
self.add_collection(b)
self.update_datalim(b.get_offsets())
self.autoscale_view()
return b
barbs.__doc__ = cbook.dedent(barbs.__doc__) % {
'barbs_doc': mquiver.Barbs.barbs_doc}
def fill(self, *args, **kwargs):
"""
call signature::
fill(*args, **kwargs)
Plot filled polygons. *args* is a variable length argument,
allowing for multiple *x*, *y* pairs with an optional color
format string; see :func:`~matplotlib.pyplot.plot` for details
on the argument parsing. For example, to plot a polygon with
vertices at *x*, *y* in blue.::
ax.fill(x,y, 'b' )
An arbitrary number of *x*, *y*, *color* groups can be specified::
ax.fill(x1, y1, 'g', x2, y2, 'r')
Return value is a list of :class:`~matplotlib.patches.Patch`
instances that were added.
The same color strings that :func:`~matplotlib.pyplot.plot`
supports are supported by the fill format string.
If you would like to fill below a curve, eg. shade a region
between 0 and *y* along *x*, use :meth:`fill_between`
The *closed* kwarg will close the polygon when *True* (default).
kwargs control the Polygon properties:
%(Polygon)s
**Example:**
.. plot:: mpl_examples/pylab_examples/fill_demo.py
"""
if not self._hold: self.cla()
patches = []
for poly in self._get_patches_for_fill(*args, **kwargs):
self.add_patch( poly )
patches.append( poly )
self.autoscale_view()
return patches
fill.__doc__ = cbook.dedent(fill.__doc__) % martist.kwdocd
def fill_between(self, x, y1, y2=0, where=None, **kwargs):
"""
call signature::
fill_between(x, y1, y2=0, where=None, **kwargs)
Create a :class:`~matplotlib.collections.PolyCollection`
filling the regions between *y1* and *y2* where
``where==True``
*x*
an N length np array of the x data
*y1*
an N length scalar or np array of the x data
*y2*
an N length scalar or np array of the x data
*where*
if None, default to fill between everywhere. If not None,
it is a a N length numpy boolean array and the fill will
only happen over the regions where ``where==True``
*kwargs*
keyword args passed on to the :class:`PolyCollection`
kwargs control the Polygon properties:
%(PolyCollection)s
.. plot:: mpl_examples/pylab_examples/fill_between.py
"""
# Handle united data, such as dates
self._process_unit_info(xdata=x, ydata=y1, kwargs=kwargs)
self._process_unit_info(ydata=y2)
# Convert the arrays so we can work with them
x = np.asarray(self.convert_xunits(x))
y1 = np.asarray(self.convert_yunits(y1))
y2 = np.asarray(self.convert_yunits(y2))
if not cbook.iterable(y1):
y1 = np.ones_like(x)*y1
if not cbook.iterable(y2):
y2 = np.ones_like(x)*y2
if where is None:
where = np.ones(len(x), np.bool)
where = np.asarray(where)
assert( (len(x)==len(y1)) and (len(x)==len(y2)) and len(x)==len(where))
polys = []
for ind0, ind1 in mlab.contiguous_regions(where):
theseverts = []
xslice = x[ind0:ind1]
y1slice = y1[ind0:ind1]
y2slice = y2[ind0:ind1]
if not len(xslice):
continue
N = len(xslice)
X = np.zeros((2*N+2, 2), np.float)
# the purpose of the next two lines is for when y2 is a
# scalar like 0 and we want the fill to go all the way
# down to 0 even if none of the y1 sample points do
X[0] = xslice[0], y2slice[0]
X[N+1] = xslice[-1], y2slice[-1]
X[1:N+1,0] = xslice
X[1:N+1,1] = y1slice
X[N+2:,0] = xslice[::-1]
X[N+2:,1] = y2slice[::-1]
polys.append(X)
collection = mcoll.PolyCollection(polys, **kwargs)
# now update the datalim and autoscale
XY1 = np.array([x[where], y1[where]]).T
XY2 = np.array([x[where], y2[where]]).T
self.dataLim.update_from_data_xy(XY1, self.ignore_existing_data_limits,
updatex=True, updatey=True)
self.dataLim.update_from_data_xy(XY2, self.ignore_existing_data_limits,
updatex=False, updatey=True)
self.add_collection(collection)
self.autoscale_view()
return collection
fill_between.__doc__ = cbook.dedent(fill_between.__doc__) % martist.kwdocd
#### plotting z(x,y): imshow, pcolor and relatives, contour
def imshow(self, X, cmap=None, norm=None, aspect=None,
interpolation=None, alpha=1.0, vmin=None, vmax=None,
origin=None, extent=None, shape=None, filternorm=1,
filterrad=4.0, imlim=None, resample=None, url=None, **kwargs):
"""
call signature::
imshow(X, cmap=None, norm=None, aspect=None, interpolation=None,
alpha=1.0, vmin=None, vmax=None, origin=None, extent=None,
**kwargs)
Display the image in *X* to current axes. *X* may be a float
array, a uint8 array or a PIL image. If *X* is an array, *X*
can have the following shapes:
* MxN -- luminance (grayscale, float array only)
* MxNx3 -- RGB (float or uint8 array)
* MxNx4 -- RGBA (float or uint8 array)
The value for each component of MxNx3 and MxNx4 float arrays should be
in the range 0.0 to 1.0; MxN float arrays may be normalised.
An :class:`matplotlib.image.AxesImage` instance is returned.
Keyword arguments:
*cmap*: [ None | Colormap ]
A :class:`matplotlib.cm.Colormap` instance, eg. cm.jet.
If *None*, default to rc ``image.cmap`` value.
*cmap* is ignored when *X* has RGB(A) information
*aspect*: [ None | 'auto' | 'equal' | scalar ]
If 'auto', changes the image aspect ratio to match that of the axes
If 'equal', and *extent* is *None*, changes the axes
aspect ratio to match that of the image. If *extent* is
not *None*, the axes aspect ratio is changed to match that
of the extent.
If *None*, default to rc ``image.aspect`` value.
*interpolation*:
Acceptable values are *None*, 'nearest', 'bilinear',
'bicubic', 'spline16', 'spline36', 'hanning', 'hamming',
'hermite', 'kaiser', 'quadric', 'catrom', 'gaussian',
'bessel', 'mitchell', 'sinc', 'lanczos',
If *interpolation* is *None*, default to rc
``image.interpolation``. See also the *filternorm* and
*filterrad* parameters
*norm*: [ None | Normalize ]
An :class:`matplotlib.colors.Normalize` instance; if
*None*, default is ``normalization()``. This scales
luminance -> 0-1
*norm* is only used for an MxN float array.
*vmin*/*vmax*: [ None | scalar ]
Used to scale a luminance image to 0-1. If either is
*None*, the min and max of the luminance values will be
used. Note if *norm* is not *None*, the settings for
*vmin* and *vmax* will be ignored.
*alpha*: scalar
The alpha blending value, between 0 (transparent) and 1 (opaque)
*origin*: [ None | 'upper' | 'lower' ]
Place the [0,0] index of the array in the upper left or lower left
corner of the axes. If *None*, default to rc ``image.origin``.
*extent*: [ None | scalars (left, right, bottom, top) ]
Eata values of the axes. The default assigns zero-based row,
column indices to the *x*, *y* centers of the pixels.
*shape*: [ None | scalars (columns, rows) ]
For raw buffer images
*filternorm*:
A parameter for the antigrain image resize filter. From the
antigrain documentation, if *filternorm* = 1, the filter normalizes
integer values and corrects the rounding errors. It doesn't do
anything with the source floating point values, it corrects only
integers according to the rule of 1.0 which means that any sum of
pixel weights must be equal to 1.0. So, the filter function must
produce a graph of the proper shape.
*filterrad*:
The filter radius for filters that have a radius
parameter, i.e. when interpolation is one of: 'sinc',
'lanczos' or 'blackman'
Additional kwargs are :class:`~matplotlib.artist.Artist` properties:
%(Artist)s
**Example:**
.. plot:: mpl_examples/pylab_examples/image_demo.py
"""
if not self._hold: self.cla()
if norm is not None: assert(isinstance(norm, mcolors.Normalize))
if cmap is not None: assert(isinstance(cmap, mcolors.Colormap))
if aspect is None: aspect = rcParams['image.aspect']
self.set_aspect(aspect)
im = mimage.AxesImage(self, cmap, norm, interpolation, origin, extent,
filternorm=filternorm,
filterrad=filterrad, resample=resample, **kwargs)
im.set_data(X)
im.set_alpha(alpha)
self._set_artist_props(im)
im.set_clip_path(self.patch)
#if norm is None and shape is None:
# im.set_clim(vmin, vmax)
if vmin is not None or vmax is not None:
im.set_clim(vmin, vmax)
else:
im.autoscale_None()
im.set_url(url)
xmin, xmax, ymin, ymax = im.get_extent()
corners = (xmin, ymin), (xmax, ymax)
self.update_datalim(corners)
if self._autoscaleon:
self.set_xlim((xmin, xmax))
self.set_ylim((ymin, ymax))
self.images.append(im)
return im
imshow.__doc__ = cbook.dedent(imshow.__doc__) % martist.kwdocd
def _pcolorargs(self, funcname, *args):
if len(args)==1:
C = args[0]
numRows, numCols = C.shape
X, Y = np.meshgrid(np.arange(numCols+1), np.arange(numRows+1) )
elif len(args)==3:
X, Y, C = args
else:
raise TypeError(
'Illegal arguments to %s; see help(%s)' % (funcname, funcname))
Nx = X.shape[-1]
Ny = Y.shape[0]
if len(X.shape) <> 2 or X.shape[0] == 1:
x = X.reshape(1,Nx)
X = x.repeat(Ny, axis=0)
if len(Y.shape) <> 2 or Y.shape[1] == 1:
y = Y.reshape(Ny, 1)
Y = y.repeat(Nx, axis=1)
if X.shape != Y.shape:
raise TypeError(
'Incompatible X, Y inputs to %s; see help(%s)' % (
funcname, funcname))
return X, Y, C
def pcolor(self, *args, **kwargs):
"""
call signatures::
pcolor(C, **kwargs)
pcolor(X, Y, C, **kwargs)
Create a pseudocolor plot of a 2-D array.
*C* is the array of color values.
*X* and *Y*, if given, specify the (*x*, *y*) coordinates of
the colored quadrilaterals; the quadrilateral for C[i,j] has
corners at::
(X[i, j], Y[i, j]),
(X[i, j+1], Y[i, j+1]),
(X[i+1, j], Y[i+1, j]),
(X[i+1, j+1], Y[i+1, j+1]).
Ideally the dimensions of *X* and *Y* should be one greater
than those of *C*; if the dimensions are the same, then the
last row and column of *C* will be ignored.
Note that the the column index corresponds to the
*x*-coordinate, and the row index corresponds to *y*; for
details, see the :ref:`Grid Orientation
<axes-pcolor-grid-orientation>` section below.
If either or both of *X* and *Y* are 1-D arrays or column vectors,
they will be expanded as needed into the appropriate 2-D arrays,
making a rectangular grid.
*X*, *Y* and *C* may be masked arrays. If either C[i, j], or one
of the vertices surrounding C[i,j] (*X* or *Y* at [i, j], [i+1, j],
[i, j+1],[i+1, j+1]) is masked, nothing is plotted.
Keyword arguments:
*cmap*: [ None | Colormap ]
A :class:`matplotlib.cm.Colormap` instance. If *None*, use
rc settings.
norm: [ None | Normalize ]
An :class:`matplotlib.colors.Normalize` instance is used
to scale luminance data to 0,1. If *None*, defaults to
:func:`normalize`.
*vmin*/*vmax*: [ None | scalar ]
*vmin* and *vmax* are used in conjunction with *norm* to
normalize luminance data. If either are *None*, the min
and max of the color array *C* is used. If you pass a
*norm* instance, *vmin* and *vmax* will be ignored.
*shading*: [ 'flat' | 'faceted' ]
If 'faceted', a black grid is drawn around each rectangle; if
'flat', edges are not drawn. Default is 'flat', contrary to
Matlab(TM).
This kwarg is deprecated; please use 'edgecolors' instead:
* shading='flat' -- edgecolors='None'
* shading='faceted -- edgecolors='k'
*edgecolors*: [ None | 'None' | color | color sequence]
If *None*, the rc setting is used by default.
If 'None', edges will not be visible.
An mpl color or sequence of colors will set the edge color
*alpha*: 0 <= scalar <= 1
the alpha blending value
Return value is a :class:`matplotlib.collection.Collection`
instance.
.. _axes-pcolor-grid-orientation:
The grid orientation follows the Matlab(TM) convention: an
array *C* with shape (*nrows*, *ncolumns*) is plotted with
the column number as *X* and the row number as *Y*, increasing
up; hence it is plotted the way the array would be printed,
except that the *Y* axis is reversed. That is, *C* is taken
as *C*(*y*, *x*).
Similarly for :func:`~matplotlib.pyplot.meshgrid`::
x = np.arange(5)
y = np.arange(3)
X, Y = meshgrid(x,y)
is equivalent to:
X = array([[0, 1, 2, 3, 4],
[0, 1, 2, 3, 4],
[0, 1, 2, 3, 4]])
Y = array([[0, 0, 0, 0, 0],
[1, 1, 1, 1, 1],
[2, 2, 2, 2, 2]])
so if you have::
C = rand( len(x), len(y))
then you need::
pcolor(X, Y, C.T)
or::
pcolor(C.T)
Matlab :func:`pcolor` always discards the last row and column
of *C*, but matplotlib displays the last row and column if *X* and
*Y* are not specified, or if *X* and *Y* have one more row and
column than *C*.
kwargs can be used to control the
:class:`~matplotlib.collection.PolyCollection` properties:
%(PolyCollection)s
"""
if not self._hold: self.cla()
alpha = kwargs.pop('alpha', 1.0)
norm = kwargs.pop('norm', None)
cmap = kwargs.pop('cmap', None)
vmin = kwargs.pop('vmin', None)
vmax = kwargs.pop('vmax', None)
shading = kwargs.pop('shading', 'flat')
X, Y, C = self._pcolorargs('pcolor', *args)
Ny, Nx = X.shape
# convert to MA, if necessary.
C = ma.asarray(C)
X = ma.asarray(X)
Y = ma.asarray(Y)
mask = ma.getmaskarray(X)+ma.getmaskarray(Y)
xymask = mask[0:-1,0:-1]+mask[1:,1:]+mask[0:-1,1:]+mask[1:,0:-1]
# don't plot if C or any of the surrounding vertices are masked.
mask = ma.getmaskarray(C)[0:Ny-1,0:Nx-1]+xymask
newaxis = np.newaxis
compress = np.compress
ravelmask = (mask==0).ravel()
X1 = compress(ravelmask, ma.filled(X[0:-1,0:-1]).ravel())
Y1 = compress(ravelmask, ma.filled(Y[0:-1,0:-1]).ravel())
X2 = compress(ravelmask, ma.filled(X[1:,0:-1]).ravel())
Y2 = compress(ravelmask, ma.filled(Y[1:,0:-1]).ravel())
X3 = compress(ravelmask, ma.filled(X[1:,1:]).ravel())
Y3 = compress(ravelmask, ma.filled(Y[1:,1:]).ravel())
X4 = compress(ravelmask, ma.filled(X[0:-1,1:]).ravel())
Y4 = compress(ravelmask, ma.filled(Y[0:-1,1:]).ravel())
npoly = len(X1)
xy = np.concatenate((X1[:,newaxis], Y1[:,newaxis],
X2[:,newaxis], Y2[:,newaxis],
X3[:,newaxis], Y3[:,newaxis],
X4[:,newaxis], Y4[:,newaxis],
X1[:,newaxis], Y1[:,newaxis]),
axis=1)
verts = xy.reshape((npoly, 5, 2))
#verts = zip(zip(X1,Y1),zip(X2,Y2),zip(X3,Y3),zip(X4,Y4))
C = compress(ravelmask, ma.filled(C[0:Ny-1,0:Nx-1]).ravel())
if shading == 'faceted':
edgecolors = (0,0,0,1),
linewidths = (0.25,)
else:
edgecolors = 'face'
linewidths = (1.0,)
kwargs.setdefault('edgecolors', edgecolors)
kwargs.setdefault('antialiaseds', (0,))
kwargs.setdefault('linewidths', linewidths)
collection = mcoll.PolyCollection(verts, **kwargs)
collection.set_alpha(alpha)
collection.set_array(C)
if norm is not None: assert(isinstance(norm, mcolors.Normalize))
if cmap is not None: assert(isinstance(cmap, mcolors.Colormap))
collection.set_cmap(cmap)
collection.set_norm(norm)
if vmin is not None or vmax is not None:
collection.set_clim(vmin, vmax)
else:
collection.autoscale_None()
self.grid(False)
x = X.compressed()
y = Y.compressed()
minx = np.amin(x)
maxx = np.amax(x)
miny = np.amin(y)
maxy = np.amax(y)
corners = (minx, miny), (maxx, maxy)
self.update_datalim( corners)
self.autoscale_view()
self.add_collection(collection)
return collection
pcolor.__doc__ = cbook.dedent(pcolor.__doc__) % martist.kwdocd
def pcolormesh(self, *args, **kwargs):
"""
call signatures::
pcolormesh(C)
pcolormesh(X, Y, C)
pcolormesh(C, **kwargs)
*C* may be a masked array, but *X* and *Y* may not. Masked
array support is implemented via *cmap* and *norm*; in
contrast, :func:`~matplotlib.pyplot.pcolor` simply does not
draw quadrilaterals with masked colors or vertices.
Keyword arguments:
*cmap*: [ None | Colormap ]
A :class:`matplotlib.cm.Colormap` instance. If None, use
rc settings.
*norm*: [ None | Normalize ]
A :class:`matplotlib.colors.Normalize` instance is used to
scale luminance data to 0,1. If None, defaults to
:func:`normalize`.
*vmin*/*vmax*: [ None | scalar ]
*vmin* and *vmax* are used in conjunction with *norm* to
normalize luminance data. If either are *None*, the min
and max of the color array *C* is used. If you pass a
*norm* instance, *vmin* and *vmax* will be ignored.
*shading*: [ 'flat' | 'faceted' ]
If 'faceted', a black grid is drawn around each rectangle; if
'flat', edges are not drawn. Default is 'flat', contrary to
Matlab(TM).
This kwarg is deprecated; please use 'edgecolors' instead:
* shading='flat' -- edgecolors='None'
* shading='faceted -- edgecolors='k'
*edgecolors*: [ None | 'None' | color | color sequence]
If None, the rc setting is used by default.
If 'None', edges will not be visible.
An mpl color or sequence of colors will set the edge color
*alpha*: 0 <= scalar <= 1
the alpha blending value
Return value is a :class:`matplotlib.collection.QuadMesh`
object.
kwargs can be used to control the
:class:`matplotlib.collections.QuadMesh`
properties:
%(QuadMesh)s
.. seealso::
:func:`~matplotlib.pyplot.pcolor`:
For an explanation of the grid orientation and the
expansion of 1-D *X* and/or *Y* to 2-D arrays.
"""
if not self._hold: self.cla()
alpha = kwargs.pop('alpha', 1.0)
norm = kwargs.pop('norm', None)
cmap = kwargs.pop('cmap', None)
vmin = kwargs.pop('vmin', None)
vmax = kwargs.pop('vmax', None)
shading = kwargs.pop('shading', 'flat')
edgecolors = kwargs.pop('edgecolors', 'None')
antialiased = kwargs.pop('antialiased', False)
X, Y, C = self._pcolorargs('pcolormesh', *args)
Ny, Nx = X.shape
# convert to one dimensional arrays
C = ma.ravel(C[0:Ny-1, 0:Nx-1]) # data point in each cell is value at
# lower left corner
X = X.ravel()
Y = Y.ravel()
coords = np.zeros(((Nx * Ny), 2), dtype=float)
coords[:, 0] = X
coords[:, 1] = Y
if shading == 'faceted' or edgecolors != 'None':
showedges = 1
else:
showedges = 0
collection = mcoll.QuadMesh(
Nx - 1, Ny - 1, coords, showedges,
antialiased=antialiased) # kwargs are not used
collection.set_alpha(alpha)
collection.set_array(C)
if norm is not None: assert(isinstance(norm, mcolors.Normalize))
if cmap is not None: assert(isinstance(cmap, mcolors.Colormap))
collection.set_cmap(cmap)
collection.set_norm(norm)
if vmin is not None or vmax is not None:
collection.set_clim(vmin, vmax)
else:
collection.autoscale_None()
self.grid(False)
minx = np.amin(X)
maxx = np.amax(X)
miny = np.amin(Y)
maxy = np.amax(Y)
corners = (minx, miny), (maxx, maxy)
self.update_datalim( corners)
self.autoscale_view()
self.add_collection(collection)
return collection
pcolormesh.__doc__ = cbook.dedent(pcolormesh.__doc__) % martist.kwdocd
def pcolorfast(self, *args, **kwargs):
"""
pseudocolor plot of a 2-D array
Experimental; this is a version of pcolor that
does not draw lines, that provides the fastest
possible rendering with the Agg backend, and that
can handle any quadrilateral grid.
Call signatures::
pcolor(C, **kwargs)
pcolor(xr, yr, C, **kwargs)
pcolor(x, y, C, **kwargs)
pcolor(X, Y, C, **kwargs)
C is the 2D array of color values corresponding to quadrilateral
cells. Let (nr, nc) be its shape. C may be a masked array.
``pcolor(C, **kwargs)`` is equivalent to
``pcolor([0,nc], [0,nr], C, **kwargs)``
*xr*, *yr* specify the ranges of *x* and *y* corresponding to the
rectangular region bounding *C*. If::
xr = [x0, x1]
and::
yr = [y0,y1]
then *x* goes from *x0* to *x1* as the second index of *C* goes
from 0 to *nc*, etc. (*x0*, *y0*) is the outermost corner of
cell (0,0), and (*x1*, *y1*) is the outermost corner of cell
(*nr*-1, *nc*-1). All cells are rectangles of the same size.
This is the fastest version.
*x*, *y* are 1D arrays of length *nc* +1 and *nr* +1, respectively,
giving the x and y boundaries of the cells. Hence the cells are
rectangular but the grid may be nonuniform. The speed is
intermediate. (The grid is checked, and if found to be
uniform the fast version is used.)
*X* and *Y* are 2D arrays with shape (*nr* +1, *nc* +1) that specify
the (x,y) coordinates of the corners of the colored
quadrilaterals; the quadrilateral for C[i,j] has corners at
(X[i,j],Y[i,j]), (X[i,j+1],Y[i,j+1]), (X[i+1,j],Y[i+1,j]),
(X[i+1,j+1],Y[i+1,j+1]). The cells need not be rectangular.
This is the most general, but the slowest to render. It may
produce faster and more compact output using ps, pdf, and
svg backends, however.
Note that the the column index corresponds to the x-coordinate,
and the row index corresponds to y; for details, see
the "Grid Orientation" section below.
Optional keyword arguments:
*cmap*: [ None | Colormap ]
A cm Colormap instance from cm. If None, use rc settings.
*norm*: [ None | Normalize ]
An mcolors.Normalize instance is used to scale luminance data to
0,1. If None, defaults to normalize()
*vmin*/*vmax*: [ None | scalar ]
*vmin* and *vmax* are used in conjunction with norm to normalize
luminance data. If either are *None*, the min and max of the color
array *C* is used. If you pass a norm instance, *vmin* and *vmax*
will be *None*.
*alpha*: 0 <= scalar <= 1
the alpha blending value
Return value is an image if a regular or rectangular grid
is specified, and a QuadMesh collection in the general
quadrilateral case.
"""
if not self._hold: self.cla()
alpha = kwargs.pop('alpha', 1.0)
norm = kwargs.pop('norm', None)
cmap = kwargs.pop('cmap', None)
vmin = kwargs.pop('vmin', None)
vmax = kwargs.pop('vmax', None)
if norm is not None: assert(isinstance(norm, mcolors.Normalize))
if cmap is not None: assert(isinstance(cmap, mcolors.Colormap))
C = args[-1]
nr, nc = C.shape
if len(args) == 1:
style = "image"
x = [0, nc]
y = [0, nr]
elif len(args) == 3:
x, y = args[:2]
x = np.asarray(x)
y = np.asarray(y)
if x.ndim == 1 and y.ndim == 1:
if x.size == 2 and y.size == 2:
style = "image"
else:
dx = np.diff(x)
dy = np.diff(y)
if (np.ptp(dx) < 0.01*np.abs(dx.mean()) and
np.ptp(dy) < 0.01*np.abs(dy.mean())):
style = "image"
else:
style = "pcolorimage"
elif x.ndim == 2 and y.ndim == 2:
style = "quadmesh"
else:
raise TypeError("arguments do not match valid signatures")
else:
raise TypeError("need 1 argument or 3 arguments")
if style == "quadmesh":
# convert to one dimensional arrays
# This should also be moved to the QuadMesh class
C = ma.ravel(C) # data point in each cell is value
# at lower left corner
X = x.ravel()
Y = y.ravel()
Nx = nc+1
Ny = nr+1
# The following needs to be cleaned up; the renderer
# requires separate contiguous arrays for X and Y,
# but the QuadMesh class requires the 2D array.
coords = np.empty(((Nx * Ny), 2), np.float64)
coords[:, 0] = X
coords[:, 1] = Y
# The QuadMesh class can also be changed to
# handle relevant superclass kwargs; the initializer
# should do much more than it does now.
collection = mcoll.QuadMesh(nc, nr, coords, 0)
collection.set_alpha(alpha)
collection.set_array(C)
collection.set_cmap(cmap)
collection.set_norm(norm)
self.add_collection(collection)
xl, xr, yb, yt = X.min(), X.max(), Y.min(), Y.max()
ret = collection
else:
# One of the image styles:
xl, xr, yb, yt = x[0], x[-1], y[0], y[-1]
if style == "image":
im = mimage.AxesImage(self, cmap, norm,
interpolation='nearest',
origin='lower',
extent=(xl, xr, yb, yt),
**kwargs)
im.set_data(C)
im.set_alpha(alpha)
self.images.append(im)
ret = im
if style == "pcolorimage":
im = mimage.PcolorImage(self, x, y, C,
cmap=cmap,
norm=norm,
alpha=alpha,
**kwargs)
self.images.append(im)
ret = im
self._set_artist_props(ret)
if vmin is not None or vmax is not None:
ret.set_clim(vmin, vmax)
else:
ret.autoscale_None()
self.update_datalim(np.array([[xl, yb], [xr, yt]]))
self.autoscale_view(tight=True)
return ret
def contour(self, *args, **kwargs):
if not self._hold: self.cla()
kwargs['filled'] = False
return mcontour.ContourSet(self, *args, **kwargs)
contour.__doc__ = mcontour.ContourSet.contour_doc
def contourf(self, *args, **kwargs):
if not self._hold: self.cla()
kwargs['filled'] = True
return mcontour.ContourSet(self, *args, **kwargs)
contourf.__doc__ = mcontour.ContourSet.contour_doc
def clabel(self, CS, *args, **kwargs):
return CS.clabel(*args, **kwargs)
clabel.__doc__ = mcontour.ContourSet.clabel.__doc__
def table(self, **kwargs):
"""
call signature::
table(cellText=None, cellColours=None,
cellLoc='right', colWidths=None,
rowLabels=None, rowColours=None, rowLoc='left',
colLabels=None, colColours=None, colLoc='center',
loc='bottom', bbox=None):
Add a table to the current axes. Returns a
:class:`matplotlib.table.Table` instance. For finer grained
control over tables, use the :class:`~matplotlib.table.Table`
class and add it to the axes with
:meth:`~matplotlib.axes.Axes.add_table`.
Thanks to John Gill for providing the class and table.
kwargs control the :class:`~matplotlib.table.Table`
properties:
%(Table)s
"""
return mtable.table(self, **kwargs)
table.__doc__ = cbook.dedent(table.__doc__) % martist.kwdocd
def twinx(self):
"""
call signature::
ax = twinx()
create a twin of Axes for generating a plot with a sharex
x-axis but independent y axis. The y-axis of self will have
ticks on left and the returned axes will have ticks on the
right
"""
ax2 = self.figure.add_axes(self.get_position(True), sharex=self,
frameon=False)
ax2.yaxis.tick_right()
ax2.yaxis.set_label_position('right')
self.yaxis.tick_left()
return ax2
def twiny(self):
"""
call signature::
ax = twiny()
create a twin of Axes for generating a plot with a shared
y-axis but independent x axis. The x-axis of self will have
ticks on bottom and the returned axes will have ticks on the
top
"""
ax2 = self.figure.add_axes(self.get_position(True), sharey=self,
frameon=False)
ax2.xaxis.tick_top()
ax2.xaxis.set_label_position('top')
self.xaxis.tick_bottom()
return ax2
def get_shared_x_axes(self):
'Return a copy of the shared axes Grouper object for x axes'
return self._shared_x_axes
def get_shared_y_axes(self):
'Return a copy of the shared axes Grouper object for y axes'
return self._shared_y_axes
#### Data analysis
def hist(self, x, bins=10, range=None, normed=False, cumulative=False,
bottom=None, histtype='bar', align='mid',
orientation='vertical', rwidth=None, log=False, **kwargs):
"""
call signature::
hist(x, bins=10, range=None, normed=False, cumulative=False,
bottom=None, histtype='bar', align='mid',
orientation='vertical', rwidth=None, log=False, **kwargs)
Compute and draw the histogram of *x*. The return value is a
tuple (*n*, *bins*, *patches*) or ([*n0*, *n1*, ...], *bins*,
[*patches0*, *patches1*,...]) if the input contains multiple
data.
Keyword arguments:
*bins*:
Either an integer number of bins or a sequence giving the
bins. *x* are the data to be binned. *x* can be an array,
a 2D array with multiple data in its columns, or a list of
arrays with data of different length. Note, if *bins*
is an integer input argument=numbins, *bins* + 1 bin edges
will be returned, compatible with the semantics of
:func:`numpy.histogram` with the *new* = True argument.
Unequally spaced bins are supported if *bins* is a sequence.
*range*:
The lower and upper range of the bins. Lower and upper outliers
are ignored. If not provided, *range* is (x.min(), x.max()).
Range has no effect if *bins* is a sequence.
If *bins* is a sequence or *range* is specified, autoscaling is
set off (*autoscale_on* is set to *False*) and the xaxis limits
are set to encompass the full specified bin range.
*normed*:
If *True*, the first element of the return tuple will
be the counts normalized to form a probability density, i.e.,
``n/(len(x)*dbin)``. In a probability density, the integral of
the histogram should be 1; you can verify that with a
trapezoidal integration of the probability density function::
pdf, bins, patches = ax.hist(...)
print np.sum(pdf * np.diff(bins))
*cumulative*:
If *True*, then a histogram is computed where each bin
gives the counts in that bin plus all bins for smaller values.
The last bin gives the total number of datapoints. If *normed*
is also *True* then the histogram is normalized such that the
last bin equals 1. If *cumulative* evaluates to less than 0
(e.g. -1), the direction of accumulation is reversed. In this
case, if *normed* is also *True*, then the histogram is normalized
such that the first bin equals 1.
*histtype*: [ 'bar' | 'barstacked' | 'step' | 'stepfilled' ]
The type of histogram to draw.
- 'bar' is a traditional bar-type histogram. If multiple data
are given the bars are aranged side by side.
- 'barstacked' is a bar-type histogram where multiple
data are stacked on top of each other.
- 'step' generates a lineplot that is by default
unfilled.
- 'stepfilled' generates a lineplot that is by default
filled.
*align*: ['left' | 'mid' | 'right' ]
Controls how the histogram is plotted.
- 'left': bars are centered on the left bin edges.
- 'mid': bars are centered between the bin edges.
- 'right': bars are centered on the right bin edges.
*orientation*: [ 'horizontal' | 'vertical' ]
If 'horizontal', :func:`~matplotlib.pyplot.barh` will be
used for bar-type histograms and the *bottom* kwarg will be
the left edges.
*rwidth*:
The relative width of the bars as a fraction of the bin
width. If *None*, automatically compute the width. Ignored
if *histtype* = 'step' or 'stepfilled'.
*log*:
If *True*, the histogram axis will be set to a log scale.
If *log* is *True* and *x* is a 1D array, empty bins will
be filtered out and only the non-empty (*n*, *bins*,
*patches*) will be returned.
kwargs are used to update the properties of the hist
:class:`~matplotlib.patches.Rectangle` instances:
%(Rectangle)s
You can use labels for your histogram, and only the first
:class:`~matplotlib.patches.Rectangle` gets the label (the
others get the magic string '_nolegend_'. This will make the
histograms work in the intuitive way for bar charts::
ax.hist(10+2*np.random.randn(1000), label='men')
ax.hist(12+3*np.random.randn(1000), label='women', alpha=0.5)
ax.legend()
**Example:**
.. plot:: mpl_examples/pylab_examples/histogram_demo.py
"""
if not self._hold: self.cla()
# NOTE: the range keyword overwrites the built-in func range !!!
# needs to be fixed in with numpy !!!
if kwargs.get('width') is not None:
raise DeprecationWarning(
'hist now uses the rwidth to give relative width '
'and not absolute width')
try:
# make sure a copy is created: don't use asarray
x = np.transpose(np.array(x))
if len(x.shape)==1:
x.shape = (1,x.shape[0])
elif len(x.shape)==2 and x.shape[1]<x.shape[0]:
warnings.warn('2D hist should be nsamples x nvariables; '
'this looks transposed')
except ValueError:
# multiple hist with data of different length
if iterable(x[0]) and not is_string_like(x[0]):
tx = []
for i in xrange(len(x)):
tx.append( np.array(x[i]) )
x = tx
else:
raise ValueError, 'Can not use providet data to create a histogram'
# Check whether bins or range are given explicitly. In that
# case do not autoscale axes.
binsgiven = (cbook.iterable(bins) or range != None)
# check the version of the numpy
if np.__version__ < "1.3": # version 1.1 and 1.2
hist_kwargs = dict(range=range,
normed=bool(normed), new=True)
else: # version 1.3 and later, drop new=True
hist_kwargs = dict(range=range,
normed=bool(normed))
n = []
for i in xrange(len(x)):
# this will automatically overwrite bins,
# so that each histogram uses the same bins
m, bins = np.histogram(x[i], bins, **hist_kwargs)
n.append(m)
if cumulative:
slc = slice(None)
if cbook.is_numlike(cumulative) and cumulative < 0:
slc = slice(None,None,-1)
if normed:
n = [(m * np.diff(bins))[slc].cumsum()[slc] for m in n]
else:
n = [m[slc].cumsum()[slc] for m in n]
patches = []
if histtype.startswith('bar'):
totwidth = np.diff(bins)
stacked = False
if rwidth is not None: dr = min(1., max(0., rwidth))
elif len(n)>1: dr = 0.8
else: dr = 1.0
if histtype=='bar':
width = dr*totwidth/len(n)
dw = width
if len(n)>1:
boffset = -0.5*dr*totwidth*(1.-1./len(n))
else:
boffset = 0.0
elif histtype=='barstacked':
width = dr*totwidth
boffset, dw = 0.0, 0.0
stacked = True
else:
raise ValueError, 'invalid histtype: %s' % histtype
if align == 'mid' or align == 'edge':
boffset += 0.5*totwidth
elif align == 'right':
boffset += totwidth
elif align != 'left' and align != 'center':
raise ValueError, 'invalid align: %s' % align
if orientation == 'horizontal':
for m in n:
color = self._get_lines._get_next_cycle_color()
patch = self.barh(bins[:-1]+boffset, m, height=width,
left=bottom, align='center', log=log,
color=color)
patches.append(patch)
if stacked:
if bottom is None: bottom = 0.0
bottom += m
boffset += dw
elif orientation == 'vertical':
for m in n:
color = self._get_lines._get_next_cycle_color()
patch = self.bar(bins[:-1]+boffset, m, width=width,
bottom=bottom, align='center', log=log,
color=color)
patches.append(patch)
if stacked:
if bottom is None: bottom = 0.0
bottom += m
boffset += dw
else:
raise ValueError, 'invalid orientation: %s' % orientation
elif histtype.startswith('step'):
x = np.zeros( 2*len(bins), np.float )
y = np.zeros( 2*len(bins), np.float )
x[0::2], x[1::2] = bins, bins
if align == 'left' or align == 'center':
x -= 0.5*(bins[1]-bins[0])
elif align == 'right':
x += 0.5*(bins[1]-bins[0])
elif align != 'mid' and align != 'edge':
raise ValueError, 'invalid align: %s' % align
if log:
y[0],y[-1] = 1e-100, 1e-100
if orientation == 'horizontal':
self.set_xscale('log')
elif orientation == 'vertical':
self.set_yscale('log')
fill = False
if histtype == 'stepfilled':
fill = True
elif histtype != 'step':
raise ValueError, 'invalid histtype: %s' % histtype
for m in n:
y[1:-1:2], y[2::2] = m, m
if orientation == 'horizontal':
x,y = y,x
elif orientation != 'vertical':
raise ValueError, 'invalid orientation: %s' % orientation
color = self._get_lines._get_next_cycle_color()
if fill:
patches.append( self.fill(x, y,
closed=False, facecolor=color) )
else:
patches.append( self.fill(x, y,
closed=False, edgecolor=color, fill=False) )
# adopted from adjust_x/ylim part of the bar method
if orientation == 'horizontal':
xmin, xmax = 0, self.dataLim.intervalx[1]
for m in n:
xmin = np.amin(m[m!=0]) # filter out the 0 height bins
xmin = max(xmin*0.9, 1e-100)
self.dataLim.intervalx = (xmin, xmax)
elif orientation == 'vertical':
ymin, ymax = 0, self.dataLim.intervaly[1]
for m in n:
ymin = np.amin(m[m!=0]) # filter out the 0 height bins
ymin = max(ymin*0.9, 1e-100)
self.dataLim.intervaly = (ymin, ymax)
self.autoscale_view()
else:
raise ValueError, 'invalid histtype: %s' % histtype
label = kwargs.pop('label', '')
for patch in patches:
for p in patch:
p.update(kwargs)
p.set_label(label)
label = '_nolegend_'
if binsgiven:
self.set_autoscale_on(False)
if orientation == 'vertical':
self.autoscale_view(scalex=False, scaley=True)
XL = self.xaxis.get_major_locator().view_limits(bins[0], bins[-1])
self.set_xbound(XL)
else:
self.autoscale_view(scalex=True, scaley=False)
YL = self.yaxis.get_major_locator().view_limits(bins[0], bins[-1])
self.set_ybound(YL)
if len(n)==1:
return n[0], bins, cbook.silent_list('Patch', patches[0])
else:
return n, bins, cbook.silent_list('Lists of Patches', patches)
hist.__doc__ = cbook.dedent(hist.__doc__) % martist.kwdocd
def psd(self, x, NFFT=256, Fs=2, Fc=0, detrend=mlab.detrend_none,
window=mlab.window_hanning, noverlap=0, pad_to=None,
sides='default', scale_by_freq=None, **kwargs):
"""
call signature::
psd(x, NFFT=256, Fs=2, Fc=0, detrend=mlab.detrend_none,
window=mlab.window_hanning, noverlap=0, pad_to=None,
sides='default', scale_by_freq=None, **kwargs)
The power spectral density by Welch's average periodogram
method. The vector *x* is divided into *NFFT* length
segments. Each segment is detrended by function *detrend* and
windowed by function *window*. *noverlap* gives the length of
the overlap between segments. The :math:`|\mathrm{fft}(i)|^2`
of each segment :math:`i` are averaged to compute *Pxx*, with a
scaling to correct for power loss due to windowing. *Fs* is the
sampling frequency.
%(PSD)s
*Fc*: integer
The center frequency of *x* (defaults to 0), which offsets
the x extents of the plot to reflect the frequency range used
when a signal is acquired and then filtered and downsampled to
baseband.
Returns the tuple (*Pxx*, *freqs*).
For plotting, the power is plotted as
:math:`10\log_{10}(P_{xx})` for decibels, though *Pxx* itself
is returned.
References:
Bendat & Piersol -- Random Data: Analysis and Measurement
Procedures, John Wiley & Sons (1986)
kwargs control the :class:`~matplotlib.lines.Line2D` properties:
%(Line2D)s
**Example:**
.. plot:: mpl_examples/pylab_examples/psd_demo.py
"""
if not self._hold: self.cla()
pxx, freqs = mlab.psd(x, NFFT, Fs, detrend, window, noverlap, pad_to,
sides, scale_by_freq)
pxx.shape = len(freqs),
freqs += Fc
if scale_by_freq in (None, True):
psd_units = 'dB/Hz'
else:
psd_units = 'dB'
self.plot(freqs, 10*np.log10(pxx), **kwargs)
self.set_xlabel('Frequency')
self.set_ylabel('Power Spectral Density (%s)' % psd_units)
self.grid(True)
vmin, vmax = self.viewLim.intervaly
intv = vmax-vmin
logi = int(np.log10(intv))
if logi==0: logi=.1
step = 10*logi
#print vmin, vmax, step, intv, math.floor(vmin), math.ceil(vmax)+1
ticks = np.arange(math.floor(vmin), math.ceil(vmax)+1, step)
self.set_yticks(ticks)
return pxx, freqs
psd_doc_dict = dict()
psd_doc_dict.update(martist.kwdocd)
psd_doc_dict.update(mlab.kwdocd)
psd_doc_dict['PSD'] = cbook.dedent(psd_doc_dict['PSD'])
psd.__doc__ = cbook.dedent(psd.__doc__) % psd_doc_dict
def csd(self, x, y, NFFT=256, Fs=2, Fc=0, detrend=mlab.detrend_none,
window=mlab.window_hanning, noverlap=0, pad_to=None,
sides='default', scale_by_freq=None, **kwargs):
"""
call signature::
csd(x, y, NFFT=256, Fs=2, Fc=0, detrend=mlab.detrend_none,
window=mlab.window_hanning, noverlap=0, pad_to=None,
sides='default', scale_by_freq=None, **kwargs)
The cross spectral density :math:`P_{xy}` by Welch's average
periodogram method. The vectors *x* and *y* are divided into
*NFFT* length segments. Each segment is detrended by function
*detrend* and windowed by function *window*. The product of
the direct FFTs of *x* and *y* are averaged over each segment
to compute :math:`P_{xy}`, with a scaling to correct for power
loss due to windowing.
Returns the tuple (*Pxy*, *freqs*). *P* is the cross spectrum
(complex valued), and :math:`10\log_{10}|P_{xy}|` is
plotted.
%(PSD)s
*Fc*: integer
The center frequency of *x* (defaults to 0), which offsets
the x extents of the plot to reflect the frequency range used
when a signal is acquired and then filtered and downsampled to
baseband.
References:
Bendat & Piersol -- Random Data: Analysis and Measurement
Procedures, John Wiley & Sons (1986)
kwargs control the Line2D properties:
%(Line2D)s
**Example:**
.. plot:: mpl_examples/pylab_examples/csd_demo.py
.. seealso:
:meth:`psd`
For a description of the optional parameters.
"""
if not self._hold: self.cla()
pxy, freqs = mlab.csd(x, y, NFFT, Fs, detrend, window, noverlap,
pad_to, sides, scale_by_freq)
pxy.shape = len(freqs),
# pxy is complex
freqs += Fc
self.plot(freqs, 10*np.log10(np.absolute(pxy)), **kwargs)
self.set_xlabel('Frequency')
self.set_ylabel('Cross Spectrum Magnitude (dB)')
self.grid(True)
vmin, vmax = self.viewLim.intervaly
intv = vmax-vmin
step = 10*int(np.log10(intv))
ticks = np.arange(math.floor(vmin), math.ceil(vmax)+1, step)
self.set_yticks(ticks)
return pxy, freqs
csd.__doc__ = cbook.dedent(csd.__doc__) % psd_doc_dict
def cohere(self, x, y, NFFT=256, Fs=2, Fc=0, detrend=mlab.detrend_none,
window=mlab.window_hanning, noverlap=0, pad_to=None,
sides='default', scale_by_freq=None, **kwargs):
"""
call signature::
cohere(x, y, NFFT=256, Fs=2, Fc=0, detrend = mlab.detrend_none,
window = mlab.window_hanning, noverlap=0, pad_to=None,
sides='default', scale_by_freq=None, **kwargs)
cohere the coherence between *x* and *y*. Coherence is the normalized
cross spectral density:
.. math::
C_{xy} = \\frac{|P_{xy}|^2}{P_{xx}P_{yy}}
%(PSD)s
*Fc*: integer
The center frequency of *x* (defaults to 0), which offsets
the x extents of the plot to reflect the frequency range used
when a signal is acquired and then filtered and downsampled to
baseband.
The return value is a tuple (*Cxy*, *f*), where *f* are the
frequencies of the coherence vector.
kwargs are applied to the lines.
References:
* Bendat & Piersol -- Random Data: Analysis and Measurement
Procedures, John Wiley & Sons (1986)
kwargs control the :class:`~matplotlib.lines.Line2D`
properties of the coherence plot:
%(Line2D)s
**Example:**
.. plot:: mpl_examples/pylab_examples/cohere_demo.py
"""
if not self._hold: self.cla()
cxy, freqs = mlab.cohere(x, y, NFFT, Fs, detrend, window, noverlap,
scale_by_freq)
freqs += Fc
self.plot(freqs, cxy, **kwargs)
self.set_xlabel('Frequency')
self.set_ylabel('Coherence')
self.grid(True)
return cxy, freqs
cohere.__doc__ = cbook.dedent(cohere.__doc__) % psd_doc_dict
def specgram(self, x, NFFT=256, Fs=2, Fc=0, detrend=mlab.detrend_none,
window=mlab.window_hanning, noverlap=128,
cmap=None, xextent=None, pad_to=None, sides='default',
scale_by_freq=None):
"""
call signature::
specgram(x, NFFT=256, Fs=2, Fc=0, detrend=mlab.detrend_none,
window=mlab.window_hanning, noverlap=128,
cmap=None, xextent=None, pad_to=None, sides='default',
scale_by_freq=None)
Compute a spectrogram of data in *x*. Data are split into
*NFFT* length segments and the PSD of each section is
computed. The windowing function *window* is applied to each
segment, and the amount of overlap of each segment is
specified with *noverlap*.
%(PSD)s
*Fc*: integer
The center frequency of *x* (defaults to 0), which offsets
the y extents of the plot to reflect the frequency range used
when a signal is acquired and then filtered and downsampled to
baseband.
*cmap*:
A :class:`matplotlib.cm.Colormap` instance; if *None* use
default determined by rc
*xextent*:
The image extent along the x-axis. xextent = (xmin,xmax)
The default is (0,max(bins)), where bins is the return
value from :func:`mlab.specgram`
Return value is (*Pxx*, *freqs*, *bins*, *im*):
- *bins* are the time points the spectrogram is calculated over
- *freqs* is an array of frequencies
- *Pxx* is a len(times) x len(freqs) array of power
- *im* is a :class:`matplotlib.image.AxesImage` instance
Note: If *x* is real (i.e. non-complex), only the positive
spectrum is shown. If *x* is complex, both positive and
negative parts of the spectrum are shown. This can be
overridden using the *sides* keyword argument.
**Example:**
.. plot:: mpl_examples/pylab_examples/specgram_demo.py
"""
if not self._hold: self.cla()
Pxx, freqs, bins = mlab.specgram(x, NFFT, Fs, detrend,
window, noverlap, pad_to, sides, scale_by_freq)
Z = 10. * np.log10(Pxx)
Z = np.flipud(Z)
if xextent is None: xextent = 0, np.amax(bins)
xmin, xmax = xextent
freqs += Fc
extent = xmin, xmax, freqs[0], freqs[-1]
im = self.imshow(Z, cmap, extent=extent)
self.axis('auto')
return Pxx, freqs, bins, im
specgram.__doc__ = cbook.dedent(specgram.__doc__) % psd_doc_dict
del psd_doc_dict #So that this does not become an Axes attribute
def spy(self, Z, precision=0, marker=None, markersize=None,
aspect='equal', **kwargs):
"""
call signature::
spy(Z, precision=0, marker=None, markersize=None,
aspect='equal', **kwargs)
``spy(Z)`` plots the sparsity pattern of the 2-D array *Z*.
If *precision* is 0, any non-zero value will be plotted;
else, values of :math:`|Z| > precision` will be plotted.
For :class:`scipy.sparse.spmatrix` instances, there is a
special case: if *precision* is 'present', any value present in
the array will be plotted, even if it is identically zero.
The array will be plotted as it would be printed, with
the first index (row) increasing down and the second
index (column) increasing to the right.
By default aspect is 'equal', so that each array element
occupies a square space; set the aspect kwarg to 'auto'
to allow the plot to fill the plot box, or to any scalar
number to specify the aspect ratio of an array element
directly.
Two plotting styles are available: image or marker. Both
are available for full arrays, but only the marker style
works for :class:`scipy.sparse.spmatrix` instances.
If *marker* and *markersize* are *None*, an image will be
returned and any remaining kwargs are passed to
:func:`~matplotlib.pyplot.imshow`; else, a
:class:`~matplotlib.lines.Line2D` object will be returned with
the value of marker determining the marker type, and any
remaining kwargs passed to the
:meth:`~matplotlib.axes.Axes.plot` method.
If *marker* and *markersize* are *None*, useful kwargs include:
* *cmap*
* *alpha*
.. seealso::
:func:`~matplotlib.pyplot.imshow`
For controlling colors, e.g. cyan background and red marks,
use::
cmap = mcolors.ListedColormap(['c','r'])
If *marker* or *markersize* is not *None*, useful kwargs include:
* *marker*
* *markersize*
* *color*
Useful values for *marker* include:
* 's' square (default)
* 'o' circle
* '.' point
* ',' pixel
.. seealso::
:func:`~matplotlib.pyplot.plot`
"""
if precision is None:
precision = 0
warnings.DeprecationWarning("Use precision=0 instead of None")
# 2008/10/03
if marker is None and markersize is None and hasattr(Z, 'tocoo'):
marker = 's'
if marker is None and markersize is None:
Z = np.asarray(Z)
mask = np.absolute(Z)>precision
if 'cmap' not in kwargs:
kwargs['cmap'] = mcolors.ListedColormap(['w', 'k'],
name='binary')
nr, nc = Z.shape
extent = [-0.5, nc-0.5, nr-0.5, -0.5]
ret = self.imshow(mask, interpolation='nearest', aspect=aspect,
extent=extent, origin='upper', **kwargs)
else:
if hasattr(Z, 'tocoo'):
c = Z.tocoo()
if precision == 'present':
y = c.row
x = c.col
else:
nonzero = np.absolute(c.data) > precision
y = c.row[nonzero]
x = c.col[nonzero]
else:
Z = np.asarray(Z)
nonzero = np.absolute(Z)>precision
y, x = np.nonzero(nonzero)
if marker is None: marker = 's'
if markersize is None: markersize = 10
marks = mlines.Line2D(x, y, linestyle='None',
marker=marker, markersize=markersize, **kwargs)
self.add_line(marks)
nr, nc = Z.shape
self.set_xlim(xmin=-0.5, xmax=nc-0.5)
self.set_ylim(ymin=nr-0.5, ymax=-0.5)
self.set_aspect(aspect)
ret = marks
self.title.set_y(1.05)
self.xaxis.tick_top()
self.xaxis.set_ticks_position('both')
self.xaxis.set_major_locator(mticker.MaxNLocator(nbins=9,
steps=[1, 2, 5, 10],
integer=True))
self.yaxis.set_major_locator(mticker.MaxNLocator(nbins=9,
steps=[1, 2, 5, 10],
integer=True))
return ret
def matshow(self, Z, **kwargs):
'''
Plot a matrix or array as an image.
The matrix will be shown the way it would be printed,
with the first row at the top. Row and column numbering
is zero-based.
Argument:
*Z* anything that can be interpreted as a 2-D array
kwargs all are passed to :meth:`~matplotlib.axes.Axes.imshow`.
:meth:`matshow` sets defaults for *extent*, *origin*,
*interpolation*, and *aspect*; use care in overriding the
*extent* and *origin* kwargs, because they interact. (Also,
if you want to change them, you probably should be using
imshow directly in your own version of matshow.)
Returns: an :class:`matplotlib.image.AxesImage` instance.
'''
Z = np.asarray(Z)
nr, nc = Z.shape
extent = [-0.5, nc-0.5, nr-0.5, -0.5]
kw = {'extent': extent,
'origin': 'upper',
'interpolation': 'nearest',
'aspect': 'equal'} # (already the imshow default)
kw.update(kwargs)
im = self.imshow(Z, **kw)
self.title.set_y(1.05)
self.xaxis.tick_top()
self.xaxis.set_ticks_position('both')
self.xaxis.set_major_locator(mticker.MaxNLocator(nbins=9,
steps=[1, 2, 5, 10],
integer=True))
self.yaxis.set_major_locator(mticker.MaxNLocator(nbins=9,
steps=[1, 2, 5, 10],
integer=True))
return im
class SubplotBase:
"""
Base class for subplots, which are :class:`Axes` instances with
additional methods to facilitate generating and manipulating a set
of :class:`Axes` within a figure.
"""
def __init__(self, fig, *args, **kwargs):
"""
*fig* is a :class:`matplotlib.figure.Figure` instance.
*args* is the tuple (*numRows*, *numCols*, *plotNum*), where
the array of subplots in the figure has dimensions *numRows*,
*numCols*, and where *plotNum* is the number of the subplot
being created. *plotNum* starts at 1 in the upper left
corner and increases to the right.
If *numRows* <= *numCols* <= *plotNum* < 10, *args* can be the
decimal integer *numRows* * 100 + *numCols* * 10 + *plotNum*.
"""
self.figure = fig
if len(args)==1:
s = str(args[0])
if len(s) != 3:
raise ValueError('Argument to subplot must be a 3 digits long')
rows, cols, num = map(int, s)
elif len(args)==3:
rows, cols, num = args
else:
raise ValueError( 'Illegal argument to subplot')
total = rows*cols
num -= 1 # convert from matlab to python indexing
# ie num in range(0,total)
if num >= total:
raise ValueError( 'Subplot number exceeds total subplots')
self._rows = rows
self._cols = cols
self._num = num
self.update_params()
# _axes_class is set in the subplot_class_factory
self._axes_class.__init__(self, fig, self.figbox, **kwargs)
def get_geometry(self):
'get the subplot geometry, eg 2,2,3'
return self._rows, self._cols, self._num+1
# COVERAGE NOTE: Never used internally or from examples
def change_geometry(self, numrows, numcols, num):
'change subplot geometry, eg. from 1,1,1 to 2,2,3'
self._rows = numrows
self._cols = numcols
self._num = num-1
self.update_params()
self.set_position(self.figbox)
def update_params(self):
'update the subplot position from fig.subplotpars'
rows = self._rows
cols = self._cols
num = self._num
pars = self.figure.subplotpars
left = pars.left
right = pars.right
bottom = pars.bottom
top = pars.top
wspace = pars.wspace
hspace = pars.hspace
totWidth = right-left
totHeight = top-bottom
figH = totHeight/(rows + hspace*(rows-1))
sepH = hspace*figH
figW = totWidth/(cols + wspace*(cols-1))
sepW = wspace*figW
rowNum, colNum = divmod(num, cols)
figBottom = top - (rowNum+1)*figH - rowNum*sepH
figLeft = left + colNum*(figW + sepW)
self.figbox = mtransforms.Bbox.from_bounds(figLeft, figBottom,
figW, figH)
self.rowNum = rowNum
self.colNum = colNum
self.numRows = rows
self.numCols = cols
if 0:
print 'rcn', rows, cols, num
print 'lbrt', left, bottom, right, top
print 'self.figBottom', self.figBottom
print 'self.figLeft', self.figLeft
print 'self.figW', self.figW
print 'self.figH', self.figH
print 'self.rowNum', self.rowNum
print 'self.colNum', self.colNum
print 'self.numRows', self.numRows
print 'self.numCols', self.numCols
def is_first_col(self):
return self.colNum==0
def is_first_row(self):
return self.rowNum==0
def is_last_row(self):
return self.rowNum==self.numRows-1
def is_last_col(self):
return self.colNum==self.numCols-1
# COVERAGE NOTE: Never used internally or from examples
def label_outer(self):
"""
set the visible property on ticklabels so xticklabels are
visible only if the subplot is in the last row and yticklabels
are visible only if the subplot is in the first column
"""
lastrow = self.is_last_row()
firstcol = self.is_first_col()
for label in self.get_xticklabels():
label.set_visible(lastrow)
for label in self.get_yticklabels():
label.set_visible(firstcol)
_subplot_classes = {}
def subplot_class_factory(axes_class=None):
# This makes a new class that inherits from SubclassBase and the
# given axes_class (which is assumed to be a subclass of Axes).
# This is perhaps a little bit roundabout to make a new class on
# the fly like this, but it means that a new Subplot class does
# not have to be created for every type of Axes.
if axes_class is None:
axes_class = Axes
new_class = _subplot_classes.get(axes_class)
if new_class is None:
new_class = new.classobj("%sSubplot" % (axes_class.__name__),
(SubplotBase, axes_class),
{'_axes_class': axes_class})
_subplot_classes[axes_class] = new_class
return new_class
# This is provided for backward compatibility
Subplot = subplot_class_factory()
martist.kwdocd['Axes'] = martist.kwdocd['Subplot'] = martist.kwdoc(Axes)
"""
# this is some discarded code I was using to find the minimum positive
# data point for some log scaling fixes. I realized there was a
# cleaner way to do it, but am keeping this around as an example for
# how to get the data out of the axes. Might want to make something
# like this a method one day, or better yet make get_verts an Artist
# method
minx, maxx = self.get_xlim()
if minx<=0 or maxx<=0:
# find the min pos value in the data
xs = []
for line in self.lines:
xs.extend(line.get_xdata(orig=False))
for patch in self.patches:
xs.extend([x for x,y in patch.get_verts()])
for collection in self.collections:
xs.extend([x for x,y in collection.get_verts()])
posx = [x for x in xs if x>0]
if len(posx):
minx = min(posx)
maxx = max(posx)
# warning, probably breaks inverted axis
self.set_xlim((0.1*minx, maxx))
"""
|
agpl-3.0
|
nvoron23/scikit-learn
|
doc/sphinxext/numpy_ext/docscrape_sphinx.py
|
408
|
8061
|
import re
import inspect
import textwrap
import pydoc
from .docscrape import NumpyDocString
from .docscrape import FunctionDoc
from .docscrape import ClassDoc
class SphinxDocString(NumpyDocString):
def __init__(self, docstring, config=None):
config = {} if config is None else config
self.use_plots = config.get('use_plots', False)
NumpyDocString.__init__(self, docstring, config=config)
# string conversion routines
def _str_header(self, name, symbol='`'):
return ['.. rubric:: ' + name, '']
def _str_field_list(self, name):
return [':' + name + ':']
def _str_indent(self, doc, indent=4):
out = []
for line in doc:
out += [' ' * indent + line]
return out
def _str_signature(self):
return ['']
if self['Signature']:
return ['``%s``' % self['Signature']] + ['']
else:
return ['']
def _str_summary(self):
return self['Summary'] + ['']
def _str_extended_summary(self):
return self['Extended Summary'] + ['']
def _str_param_list(self, name):
out = []
if self[name]:
out += self._str_field_list(name)
out += ['']
for param, param_type, desc in self[name]:
out += self._str_indent(['**%s** : %s' % (param.strip(),
param_type)])
out += ['']
out += self._str_indent(desc, 8)
out += ['']
return out
@property
def _obj(self):
if hasattr(self, '_cls'):
return self._cls
elif hasattr(self, '_f'):
return self._f
return None
def _str_member_list(self, name):
"""
Generate a member listing, autosummary:: table where possible,
and a table where not.
"""
out = []
if self[name]:
out += ['.. rubric:: %s' % name, '']
prefix = getattr(self, '_name', '')
if prefix:
prefix = '~%s.' % prefix
autosum = []
others = []
for param, param_type, desc in self[name]:
param = param.strip()
if not self._obj or hasattr(self._obj, param):
autosum += [" %s%s" % (prefix, param)]
else:
others.append((param, param_type, desc))
if autosum:
# GAEL: Toctree commented out below because it creates
# hundreds of sphinx warnings
# out += ['.. autosummary::', ' :toctree:', '']
out += ['.. autosummary::', '']
out += autosum
if others:
maxlen_0 = max([len(x[0]) for x in others])
maxlen_1 = max([len(x[1]) for x in others])
hdr = "=" * maxlen_0 + " " + "=" * maxlen_1 + " " + "=" * 10
fmt = '%%%ds %%%ds ' % (maxlen_0, maxlen_1)
n_indent = maxlen_0 + maxlen_1 + 4
out += [hdr]
for param, param_type, desc in others:
out += [fmt % (param.strip(), param_type)]
out += self._str_indent(desc, n_indent)
out += [hdr]
out += ['']
return out
def _str_section(self, name):
out = []
if self[name]:
out += self._str_header(name)
out += ['']
content = textwrap.dedent("\n".join(self[name])).split("\n")
out += content
out += ['']
return out
def _str_see_also(self, func_role):
out = []
if self['See Also']:
see_also = super(SphinxDocString, self)._str_see_also(func_role)
out = ['.. seealso::', '']
out += self._str_indent(see_also[2:])
return out
def _str_warnings(self):
out = []
if self['Warnings']:
out = ['.. warning::', '']
out += self._str_indent(self['Warnings'])
return out
def _str_index(self):
idx = self['index']
out = []
if len(idx) == 0:
return out
out += ['.. index:: %s' % idx.get('default', '')]
for section, references in idx.iteritems():
if section == 'default':
continue
elif section == 'refguide':
out += [' single: %s' % (', '.join(references))]
else:
out += [' %s: %s' % (section, ','.join(references))]
return out
def _str_references(self):
out = []
if self['References']:
out += self._str_header('References')
if isinstance(self['References'], str):
self['References'] = [self['References']]
out.extend(self['References'])
out += ['']
# Latex collects all references to a separate bibliography,
# so we need to insert links to it
import sphinx # local import to avoid test dependency
if sphinx.__version__ >= "0.6":
out += ['.. only:: latex', '']
else:
out += ['.. latexonly::', '']
items = []
for line in self['References']:
m = re.match(r'.. \[([a-z0-9._-]+)\]', line, re.I)
if m:
items.append(m.group(1))
out += [' ' + ", ".join(["[%s]_" % item for item in items]), '']
return out
def _str_examples(self):
examples_str = "\n".join(self['Examples'])
if (self.use_plots and 'import matplotlib' in examples_str
and 'plot::' not in examples_str):
out = []
out += self._str_header('Examples')
out += ['.. plot::', '']
out += self._str_indent(self['Examples'])
out += ['']
return out
else:
return self._str_section('Examples')
def __str__(self, indent=0, func_role="obj"):
out = []
out += self._str_signature()
out += self._str_index() + ['']
out += self._str_summary()
out += self._str_extended_summary()
for param_list in ('Parameters', 'Returns', 'Raises', 'Attributes'):
out += self._str_param_list(param_list)
out += self._str_warnings()
out += self._str_see_also(func_role)
out += self._str_section('Notes')
out += self._str_references()
out += self._str_examples()
for param_list in ('Methods',):
out += self._str_member_list(param_list)
out = self._str_indent(out, indent)
return '\n'.join(out)
class SphinxFunctionDoc(SphinxDocString, FunctionDoc):
def __init__(self, obj, doc=None, config={}):
self.use_plots = config.get('use_plots', False)
FunctionDoc.__init__(self, obj, doc=doc, config=config)
class SphinxClassDoc(SphinxDocString, ClassDoc):
def __init__(self, obj, doc=None, func_doc=None, config={}):
self.use_plots = config.get('use_plots', False)
ClassDoc.__init__(self, obj, doc=doc, func_doc=None, config=config)
class SphinxObjDoc(SphinxDocString):
def __init__(self, obj, doc=None, config=None):
self._f = obj
SphinxDocString.__init__(self, doc, config=config)
def get_doc_object(obj, what=None, doc=None, config={}):
if what is None:
if inspect.isclass(obj):
what = 'class'
elif inspect.ismodule(obj):
what = 'module'
elif callable(obj):
what = 'function'
else:
what = 'object'
if what == 'class':
return SphinxClassDoc(obj, func_doc=SphinxFunctionDoc, doc=doc,
config=config)
elif what in ('function', 'method'):
return SphinxFunctionDoc(obj, doc=doc, config=config)
else:
if doc is None:
doc = pydoc.getdoc(obj)
return SphinxObjDoc(obj, doc, config=config)
|
bsd-3-clause
|
MJuddBooth/pandas
|
pandas/tests/frame/test_rank.py
|
1
|
11364
|
# -*- coding: utf-8 -*-
from datetime import datetime, timedelta
from distutils.version import LooseVersion
import numpy as np
import pytest
from pandas import DataFrame, Series
from pandas.tests.frame.common import TestData
import pandas.util.testing as tm
from pandas.util.testing import assert_frame_equal
class TestRank(TestData):
s = Series([1, 3, 4, 2, np.nan, 2, 1, 5, np.nan, 3])
df = DataFrame({'A': s, 'B': s})
results = {
'average': np.array([1.5, 5.5, 7.0, 3.5, np.nan,
3.5, 1.5, 8.0, np.nan, 5.5]),
'min': np.array([1, 5, 7, 3, np.nan, 3, 1, 8, np.nan, 5]),
'max': np.array([2, 6, 7, 4, np.nan, 4, 2, 8, np.nan, 6]),
'first': np.array([1, 5, 7, 3, np.nan, 4, 2, 8, np.nan, 6]),
'dense': np.array([1, 3, 4, 2, np.nan, 2, 1, 5, np.nan, 3]),
}
@pytest.fixture(params=['average', 'min', 'max', 'first', 'dense'])
def method(self, request):
"""
Fixture for trying all rank methods
"""
return request.param
def test_rank(self):
rankdata = pytest.importorskip('scipy.stats.rankdata')
self.frame['A'][::2] = np.nan
self.frame['B'][::3] = np.nan
self.frame['C'][::4] = np.nan
self.frame['D'][::5] = np.nan
ranks0 = self.frame.rank()
ranks1 = self.frame.rank(1)
mask = np.isnan(self.frame.values)
fvals = self.frame.fillna(np.inf).values
exp0 = np.apply_along_axis(rankdata, 0, fvals)
exp0[mask] = np.nan
exp1 = np.apply_along_axis(rankdata, 1, fvals)
exp1[mask] = np.nan
tm.assert_almost_equal(ranks0.values, exp0)
tm.assert_almost_equal(ranks1.values, exp1)
# integers
df = DataFrame(np.random.randint(0, 5, size=40).reshape((10, 4)))
result = df.rank()
exp = df.astype(float).rank()
tm.assert_frame_equal(result, exp)
result = df.rank(1)
exp = df.astype(float).rank(1)
tm.assert_frame_equal(result, exp)
def test_rank2(self):
df = DataFrame([[1, 3, 2], [1, 2, 3]])
expected = DataFrame([[1.0, 3.0, 2.0], [1, 2, 3]]) / 3.0
result = df.rank(1, pct=True)
tm.assert_frame_equal(result, expected)
df = DataFrame([[1, 3, 2], [1, 2, 3]])
expected = df.rank(0) / 2.0
result = df.rank(0, pct=True)
tm.assert_frame_equal(result, expected)
df = DataFrame([['b', 'c', 'a'], ['a', 'c', 'b']])
expected = DataFrame([[2.0, 3.0, 1.0], [1, 3, 2]])
result = df.rank(1, numeric_only=False)
tm.assert_frame_equal(result, expected)
expected = DataFrame([[2.0, 1.5, 1.0], [1, 1.5, 2]])
result = df.rank(0, numeric_only=False)
tm.assert_frame_equal(result, expected)
df = DataFrame([['b', np.nan, 'a'], ['a', 'c', 'b']])
expected = DataFrame([[2.0, np.nan, 1.0], [1.0, 3.0, 2.0]])
result = df.rank(1, numeric_only=False)
tm.assert_frame_equal(result, expected)
expected = DataFrame([[2.0, np.nan, 1.0], [1.0, 1.0, 2.0]])
result = df.rank(0, numeric_only=False)
tm.assert_frame_equal(result, expected)
# f7u12, this does not work without extensive workaround
data = [[datetime(2001, 1, 5), np.nan, datetime(2001, 1, 2)],
[datetime(2000, 1, 2), datetime(2000, 1, 3),
datetime(2000, 1, 1)]]
df = DataFrame(data)
# check the rank
expected = DataFrame([[2., np.nan, 1.],
[2., 3., 1.]])
result = df.rank(1, numeric_only=False, ascending=True)
tm.assert_frame_equal(result, expected)
expected = DataFrame([[1., np.nan, 2.],
[2., 1., 3.]])
result = df.rank(1, numeric_only=False, ascending=False)
tm.assert_frame_equal(result, expected)
# mixed-type frames
self.mixed_frame['datetime'] = datetime.now()
self.mixed_frame['timedelta'] = timedelta(days=1, seconds=1)
result = self.mixed_frame.rank(1)
expected = self.mixed_frame.rank(1, numeric_only=True)
tm.assert_frame_equal(result, expected)
df = DataFrame({"a": [1e-20, -5, 1e-20 + 1e-40, 10,
1e60, 1e80, 1e-30]})
exp = DataFrame({"a": [3.5, 1., 3.5, 5., 6., 7., 2.]})
tm.assert_frame_equal(df.rank(), exp)
def test_rank_na_option(self):
rankdata = pytest.importorskip('scipy.stats.rankdata')
self.frame['A'][::2] = np.nan
self.frame['B'][::3] = np.nan
self.frame['C'][::4] = np.nan
self.frame['D'][::5] = np.nan
# bottom
ranks0 = self.frame.rank(na_option='bottom')
ranks1 = self.frame.rank(1, na_option='bottom')
fvals = self.frame.fillna(np.inf).values
exp0 = np.apply_along_axis(rankdata, 0, fvals)
exp1 = np.apply_along_axis(rankdata, 1, fvals)
tm.assert_almost_equal(ranks0.values, exp0)
tm.assert_almost_equal(ranks1.values, exp1)
# top
ranks0 = self.frame.rank(na_option='top')
ranks1 = self.frame.rank(1, na_option='top')
fval0 = self.frame.fillna((self.frame.min() - 1).to_dict()).values
fval1 = self.frame.T
fval1 = fval1.fillna((fval1.min() - 1).to_dict()).T
fval1 = fval1.fillna(np.inf).values
exp0 = np.apply_along_axis(rankdata, 0, fval0)
exp1 = np.apply_along_axis(rankdata, 1, fval1)
tm.assert_almost_equal(ranks0.values, exp0)
tm.assert_almost_equal(ranks1.values, exp1)
# descending
# bottom
ranks0 = self.frame.rank(na_option='top', ascending=False)
ranks1 = self.frame.rank(1, na_option='top', ascending=False)
fvals = self.frame.fillna(np.inf).values
exp0 = np.apply_along_axis(rankdata, 0, -fvals)
exp1 = np.apply_along_axis(rankdata, 1, -fvals)
tm.assert_almost_equal(ranks0.values, exp0)
tm.assert_almost_equal(ranks1.values, exp1)
# descending
# top
ranks0 = self.frame.rank(na_option='bottom', ascending=False)
ranks1 = self.frame.rank(1, na_option='bottom', ascending=False)
fval0 = self.frame.fillna((self.frame.min() - 1).to_dict()).values
fval1 = self.frame.T
fval1 = fval1.fillna((fval1.min() - 1).to_dict()).T
fval1 = fval1.fillna(np.inf).values
exp0 = np.apply_along_axis(rankdata, 0, -fval0)
exp1 = np.apply_along_axis(rankdata, 1, -fval1)
tm.assert_numpy_array_equal(ranks0.values, exp0)
tm.assert_numpy_array_equal(ranks1.values, exp1)
# bad values throw error
msg = "na_option must be one of 'keep', 'top', or 'bottom'"
with pytest.raises(ValueError, match=msg):
self.frame.rank(na_option='bad', ascending=False)
# invalid type
with pytest.raises(ValueError, match=msg):
self.frame.rank(na_option=True, ascending=False)
def test_rank_axis(self):
# check if using axes' names gives the same result
df = DataFrame([[2, 1], [4, 3]])
tm.assert_frame_equal(df.rank(axis=0), df.rank(axis='index'))
tm.assert_frame_equal(df.rank(axis=1), df.rank(axis='columns'))
def test_rank_methods_frame(self):
pytest.importorskip('scipy.stats.special')
rankdata = pytest.importorskip('scipy.stats.rankdata')
import scipy
xs = np.random.randint(0, 21, (100, 26))
xs = (xs - 10.0) / 10.0
cols = [chr(ord('z') - i) for i in range(xs.shape[1])]
for vals in [xs, xs + 1e6, xs * 1e-6]:
df = DataFrame(vals, columns=cols)
for ax in [0, 1]:
for m in ['average', 'min', 'max', 'first', 'dense']:
result = df.rank(axis=ax, method=m)
sprank = np.apply_along_axis(
rankdata, ax, vals,
m if m != 'first' else 'ordinal')
sprank = sprank.astype(np.float64)
expected = DataFrame(sprank, columns=cols)
if (LooseVersion(scipy.__version__) >=
LooseVersion('0.17.0')):
expected = expected.astype('float64')
tm.assert_frame_equal(result, expected)
@pytest.mark.parametrize('dtype', ['O', 'f8', 'i8'])
def test_rank_descending(self, method, dtype):
if 'i' in dtype:
df = self.df.dropna()
else:
df = self.df.astype(dtype)
res = df.rank(ascending=False)
expected = (df.max() - df).rank()
assert_frame_equal(res, expected)
if method == 'first' and dtype == 'O':
return
expected = (df.max() - df).rank(method=method)
if dtype != 'O':
res2 = df.rank(method=method, ascending=False,
numeric_only=True)
assert_frame_equal(res2, expected)
res3 = df.rank(method=method, ascending=False,
numeric_only=False)
assert_frame_equal(res3, expected)
@pytest.mark.parametrize('axis', [0, 1])
@pytest.mark.parametrize('dtype', [None, object])
def test_rank_2d_tie_methods(self, method, axis, dtype):
df = self.df
def _check2d(df, expected, method='average', axis=0):
exp_df = DataFrame({'A': expected, 'B': expected})
if axis == 1:
df = df.T
exp_df = exp_df.T
result = df.rank(method=method, axis=axis)
assert_frame_equal(result, exp_df)
disabled = {(object, 'first')}
if (dtype, method) in disabled:
return
frame = df if dtype is None else df.astype(dtype)
_check2d(frame, self.results[method], method=method, axis=axis)
@pytest.mark.parametrize(
"method,exp", [("dense",
[[1., 1., 1.],
[1., 0.5, 2. / 3],
[1., 0.5, 1. / 3]]),
("min",
[[1. / 3, 1., 1.],
[1. / 3, 1. / 3, 2. / 3],
[1. / 3, 1. / 3, 1. / 3]]),
("max",
[[1., 1., 1.],
[1., 2. / 3, 2. / 3],
[1., 2. / 3, 1. / 3]]),
("average",
[[2. / 3, 1., 1.],
[2. / 3, 0.5, 2. / 3],
[2. / 3, 0.5, 1. / 3]]),
("first",
[[1. / 3, 1., 1.],
[2. / 3, 1. / 3, 2. / 3],
[3. / 3, 2. / 3, 1. / 3]])])
def test_rank_pct_true(self, method, exp):
# see gh-15630.
df = DataFrame([[2012, 66, 3], [2012, 65, 2], [2012, 65, 1]])
result = df.rank(method=method, pct=True)
expected = DataFrame(exp)
tm.assert_frame_equal(result, expected)
@pytest.mark.single
@pytest.mark.high_memory
def test_pct_max_many_rows(self):
# GH 18271
df = DataFrame({'A': np.arange(2**24 + 1),
'B': np.arange(2**24 + 1, 0, -1)})
result = df.rank(pct=True).max()
assert (result == 1).all()
|
bsd-3-clause
|
frank-tancf/scikit-learn
|
sklearn/linear_model/tests/test_logistic.py
|
24
|
39507
|
import numpy as np
import scipy.sparse as sp
from scipy import linalg, optimize, sparse
from sklearn.utils.testing import assert_almost_equal
from sklearn.utils.testing import assert_array_equal
from sklearn.utils.testing import assert_array_almost_equal
from sklearn.utils.testing import assert_equal
from sklearn.utils.testing import assert_greater
from sklearn.utils.testing import assert_raises
from sklearn.utils.testing import assert_true
from sklearn.utils.testing import assert_warns
from sklearn.utils.testing import assert_warns_message
from sklearn.utils.testing import raises
from sklearn.utils.testing import ignore_warnings
from sklearn.utils.testing import assert_raise_message
from sklearn.exceptions import ConvergenceWarning
from sklearn.utils import compute_class_weight
from sklearn.utils.fixes import sp_version
from sklearn.linear_model.logistic import (
LogisticRegression,
logistic_regression_path, LogisticRegressionCV,
_logistic_loss_and_grad, _logistic_grad_hess,
_multinomial_grad_hess, _logistic_loss,
)
from sklearn.model_selection import StratifiedKFold
from sklearn.datasets import load_iris, make_classification
from sklearn.metrics import log_loss
X = [[-1, 0], [0, 1], [1, 1]]
X_sp = sp.csr_matrix(X)
Y1 = [0, 1, 1]
Y2 = [2, 1, 0]
iris = load_iris()
def check_predictions(clf, X, y):
"""Check that the model is able to fit the classification data"""
n_samples = len(y)
classes = np.unique(y)
n_classes = classes.shape[0]
predicted = clf.fit(X, y).predict(X)
assert_array_equal(clf.classes_, classes)
assert_equal(predicted.shape, (n_samples,))
assert_array_equal(predicted, y)
probabilities = clf.predict_proba(X)
assert_equal(probabilities.shape, (n_samples, n_classes))
assert_array_almost_equal(probabilities.sum(axis=1), np.ones(n_samples))
assert_array_equal(probabilities.argmax(axis=1), y)
def test_predict_2_classes():
# Simple sanity check on a 2 classes dataset
# Make sure it predicts the correct result on simple datasets.
check_predictions(LogisticRegression(random_state=0), X, Y1)
check_predictions(LogisticRegression(random_state=0), X_sp, Y1)
check_predictions(LogisticRegression(C=100, random_state=0), X, Y1)
check_predictions(LogisticRegression(C=100, random_state=0), X_sp, Y1)
check_predictions(LogisticRegression(fit_intercept=False,
random_state=0), X, Y1)
check_predictions(LogisticRegression(fit_intercept=False,
random_state=0), X_sp, Y1)
def test_error():
# Test for appropriate exception on errors
msg = "Penalty term must be positive"
assert_raise_message(ValueError, msg,
LogisticRegression(C=-1).fit, X, Y1)
assert_raise_message(ValueError, msg,
LogisticRegression(C="test").fit, X, Y1)
for LR in [LogisticRegression, LogisticRegressionCV]:
msg = "Tolerance for stopping criteria must be positive"
assert_raise_message(ValueError, msg, LR(tol=-1).fit, X, Y1)
assert_raise_message(ValueError, msg, LR(tol="test").fit, X, Y1)
msg = "Maximum number of iteration must be positive"
assert_raise_message(ValueError, msg, LR(max_iter=-1).fit, X, Y1)
assert_raise_message(ValueError, msg, LR(max_iter="test").fit, X, Y1)
def test_predict_3_classes():
check_predictions(LogisticRegression(C=10), X, Y2)
check_predictions(LogisticRegression(C=10), X_sp, Y2)
def test_predict_iris():
# Test logistic regression with the iris dataset
n_samples, n_features = iris.data.shape
target = iris.target_names[iris.target]
# Test that both multinomial and OvR solvers handle
# multiclass data correctly and give good accuracy
# score (>0.95) for the training data.
for clf in [LogisticRegression(C=len(iris.data)),
LogisticRegression(C=len(iris.data), solver='lbfgs',
multi_class='multinomial'),
LogisticRegression(C=len(iris.data), solver='newton-cg',
multi_class='multinomial'),
LogisticRegression(C=len(iris.data), solver='sag', tol=1e-2,
multi_class='ovr', random_state=42)]:
clf.fit(iris.data, target)
assert_array_equal(np.unique(target), clf.classes_)
pred = clf.predict(iris.data)
assert_greater(np.mean(pred == target), .95)
probabilities = clf.predict_proba(iris.data)
assert_array_almost_equal(probabilities.sum(axis=1),
np.ones(n_samples))
pred = iris.target_names[probabilities.argmax(axis=1)]
assert_greater(np.mean(pred == target), .95)
def test_multinomial_validation():
for solver in ['lbfgs', 'newton-cg', 'sag']:
lr = LogisticRegression(C=-1, solver=solver, multi_class='multinomial')
assert_raises(ValueError, lr.fit, [[0, 1], [1, 0]], [0, 1])
def test_check_solver_option():
X, y = iris.data, iris.target
for LR in [LogisticRegression, LogisticRegressionCV]:
msg = ("Logistic Regression supports only liblinear, newton-cg, lbfgs"
" and sag solvers, got wrong_name")
lr = LR(solver="wrong_name")
assert_raise_message(ValueError, msg, lr.fit, X, y)
msg = "multi_class should be either multinomial or ovr, got wrong_name"
lr = LR(solver='newton-cg', multi_class="wrong_name")
assert_raise_message(ValueError, msg, lr.fit, X, y)
# only 'liblinear' solver
msg = "Solver liblinear does not support a multinomial backend."
lr = LR(solver='liblinear', multi_class='multinomial')
assert_raise_message(ValueError, msg, lr.fit, X, y)
# all solvers except 'liblinear'
for solver in ['newton-cg', 'lbfgs', 'sag']:
msg = ("Solver %s supports only l2 penalties, got l1 penalty." %
solver)
lr = LR(solver=solver, penalty='l1')
assert_raise_message(ValueError, msg, lr.fit, X, y)
msg = ("Solver %s supports only dual=False, got dual=True" %
solver)
lr = LR(solver=solver, dual=True)
assert_raise_message(ValueError, msg, lr.fit, X, y)
def test_multinomial_binary():
# Test multinomial LR on a binary problem.
target = (iris.target > 0).astype(np.intp)
target = np.array(["setosa", "not-setosa"])[target]
for solver in ['lbfgs', 'newton-cg', 'sag']:
clf = LogisticRegression(solver=solver, multi_class='multinomial',
random_state=42, max_iter=2000)
clf.fit(iris.data, target)
assert_equal(clf.coef_.shape, (1, iris.data.shape[1]))
assert_equal(clf.intercept_.shape, (1,))
assert_array_equal(clf.predict(iris.data), target)
mlr = LogisticRegression(solver=solver, multi_class='multinomial',
random_state=42, fit_intercept=False)
mlr.fit(iris.data, target)
pred = clf.classes_[np.argmax(clf.predict_log_proba(iris.data),
axis=1)]
assert_greater(np.mean(pred == target), .9)
def test_sparsify():
# Test sparsify and densify members.
n_samples, n_features = iris.data.shape
target = iris.target_names[iris.target]
clf = LogisticRegression(random_state=0).fit(iris.data, target)
pred_d_d = clf.decision_function(iris.data)
clf.sparsify()
assert_true(sp.issparse(clf.coef_))
pred_s_d = clf.decision_function(iris.data)
sp_data = sp.coo_matrix(iris.data)
pred_s_s = clf.decision_function(sp_data)
clf.densify()
pred_d_s = clf.decision_function(sp_data)
assert_array_almost_equal(pred_d_d, pred_s_d)
assert_array_almost_equal(pred_d_d, pred_s_s)
assert_array_almost_equal(pred_d_d, pred_d_s)
def test_inconsistent_input():
# Test that an exception is raised on inconsistent input
rng = np.random.RandomState(0)
X_ = rng.random_sample((5, 10))
y_ = np.ones(X_.shape[0])
y_[0] = 0
clf = LogisticRegression(random_state=0)
# Wrong dimensions for training data
y_wrong = y_[:-1]
assert_raises(ValueError, clf.fit, X, y_wrong)
# Wrong dimensions for test data
assert_raises(ValueError, clf.fit(X_, y_).predict,
rng.random_sample((3, 12)))
def test_write_parameters():
# Test that we can write to coef_ and intercept_
clf = LogisticRegression(random_state=0)
clf.fit(X, Y1)
clf.coef_[:] = 0
clf.intercept_[:] = 0
assert_array_almost_equal(clf.decision_function(X), 0)
@raises(ValueError)
def test_nan():
# Test proper NaN handling.
# Regression test for Issue #252: fit used to go into an infinite loop.
Xnan = np.array(X, dtype=np.float64)
Xnan[0, 1] = np.nan
LogisticRegression(random_state=0).fit(Xnan, Y1)
def test_consistency_path():
# Test that the path algorithm is consistent
rng = np.random.RandomState(0)
X = np.concatenate((rng.randn(100, 2) + [1, 1], rng.randn(100, 2)))
y = [1] * 100 + [-1] * 100
Cs = np.logspace(0, 4, 10)
f = ignore_warnings
# can't test with fit_intercept=True since LIBLINEAR
# penalizes the intercept
for solver in ('lbfgs', 'newton-cg', 'liblinear', 'sag'):
coefs, Cs, _ = f(logistic_regression_path)(
X, y, Cs=Cs, fit_intercept=False, tol=1e-5, solver=solver,
random_state=0)
for i, C in enumerate(Cs):
lr = LogisticRegression(C=C, fit_intercept=False, tol=1e-5,
random_state=0)
lr.fit(X, y)
lr_coef = lr.coef_.ravel()
assert_array_almost_equal(lr_coef, coefs[i], decimal=4,
err_msg="with solver = %s" % solver)
# test for fit_intercept=True
for solver in ('lbfgs', 'newton-cg', 'liblinear', 'sag'):
Cs = [1e3]
coefs, Cs, _ = f(logistic_regression_path)(
X, y, Cs=Cs, fit_intercept=True, tol=1e-6, solver=solver,
intercept_scaling=10000., random_state=0)
lr = LogisticRegression(C=Cs[0], fit_intercept=True, tol=1e-4,
intercept_scaling=10000., random_state=0)
lr.fit(X, y)
lr_coef = np.concatenate([lr.coef_.ravel(), lr.intercept_])
assert_array_almost_equal(lr_coef, coefs[0], decimal=4,
err_msg="with solver = %s" % solver)
def test_liblinear_dual_random_state():
# random_state is relevant for liblinear solver only if dual=True
X, y = make_classification(n_samples=20)
lr1 = LogisticRegression(random_state=0, dual=True, max_iter=1, tol=1e-15)
lr1.fit(X, y)
lr2 = LogisticRegression(random_state=0, dual=True, max_iter=1, tol=1e-15)
lr2.fit(X, y)
lr3 = LogisticRegression(random_state=8, dual=True, max_iter=1, tol=1e-15)
lr3.fit(X, y)
# same result for same random state
assert_array_almost_equal(lr1.coef_, lr2.coef_)
# different results for different random states
msg = "Arrays are not almost equal to 6 decimals"
assert_raise_message(AssertionError, msg,
assert_array_almost_equal, lr1.coef_, lr3.coef_)
def test_logistic_loss_and_grad():
X_ref, y = make_classification(n_samples=20)
n_features = X_ref.shape[1]
X_sp = X_ref.copy()
X_sp[X_sp < .1] = 0
X_sp = sp.csr_matrix(X_sp)
for X in (X_ref, X_sp):
w = np.zeros(n_features)
# First check that our derivation of the grad is correct
loss, grad = _logistic_loss_and_grad(w, X, y, alpha=1.)
approx_grad = optimize.approx_fprime(
w, lambda w: _logistic_loss_and_grad(w, X, y, alpha=1.)[0], 1e-3
)
assert_array_almost_equal(grad, approx_grad, decimal=2)
# Second check that our intercept implementation is good
w = np.zeros(n_features + 1)
loss_interp, grad_interp = _logistic_loss_and_grad(
w, X, y, alpha=1.
)
assert_array_almost_equal(loss, loss_interp)
approx_grad = optimize.approx_fprime(
w, lambda w: _logistic_loss_and_grad(w, X, y, alpha=1.)[0], 1e-3
)
assert_array_almost_equal(grad_interp, approx_grad, decimal=2)
def test_logistic_grad_hess():
rng = np.random.RandomState(0)
n_samples, n_features = 50, 5
X_ref = rng.randn(n_samples, n_features)
y = np.sign(X_ref.dot(5 * rng.randn(n_features)))
X_ref -= X_ref.mean()
X_ref /= X_ref.std()
X_sp = X_ref.copy()
X_sp[X_sp < .1] = 0
X_sp = sp.csr_matrix(X_sp)
for X in (X_ref, X_sp):
w = .1 * np.ones(n_features)
# First check that _logistic_grad_hess is consistent
# with _logistic_loss_and_grad
loss, grad = _logistic_loss_and_grad(w, X, y, alpha=1.)
grad_2, hess = _logistic_grad_hess(w, X, y, alpha=1.)
assert_array_almost_equal(grad, grad_2)
# Now check our hessian along the second direction of the grad
vector = np.zeros_like(grad)
vector[1] = 1
hess_col = hess(vector)
# Computation of the Hessian is particularly fragile to numerical
# errors when doing simple finite differences. Here we compute the
# grad along a path in the direction of the vector and then use a
# least-square regression to estimate the slope
e = 1e-3
d_x = np.linspace(-e, e, 30)
d_grad = np.array([
_logistic_loss_and_grad(w + t * vector, X, y, alpha=1.)[1]
for t in d_x
])
d_grad -= d_grad.mean(axis=0)
approx_hess_col = linalg.lstsq(d_x[:, np.newaxis], d_grad)[0].ravel()
assert_array_almost_equal(approx_hess_col, hess_col, decimal=3)
# Second check that our intercept implementation is good
w = np.zeros(n_features + 1)
loss_interp, grad_interp = _logistic_loss_and_grad(w, X, y, alpha=1.)
loss_interp_2 = _logistic_loss(w, X, y, alpha=1.)
grad_interp_2, hess = _logistic_grad_hess(w, X, y, alpha=1.)
assert_array_almost_equal(loss_interp, loss_interp_2)
assert_array_almost_equal(grad_interp, grad_interp_2)
def test_logistic_cv():
# test for LogisticRegressionCV object
n_samples, n_features = 50, 5
rng = np.random.RandomState(0)
X_ref = rng.randn(n_samples, n_features)
y = np.sign(X_ref.dot(5 * rng.randn(n_features)))
X_ref -= X_ref.mean()
X_ref /= X_ref.std()
lr_cv = LogisticRegressionCV(Cs=[1.], fit_intercept=False,
solver='liblinear')
lr_cv.fit(X_ref, y)
lr = LogisticRegression(C=1., fit_intercept=False)
lr.fit(X_ref, y)
assert_array_almost_equal(lr.coef_, lr_cv.coef_)
assert_array_equal(lr_cv.coef_.shape, (1, n_features))
assert_array_equal(lr_cv.classes_, [-1, 1])
assert_equal(len(lr_cv.classes_), 2)
coefs_paths = np.asarray(list(lr_cv.coefs_paths_.values()))
assert_array_equal(coefs_paths.shape, (1, 3, 1, n_features))
assert_array_equal(lr_cv.Cs_.shape, (1, ))
scores = np.asarray(list(lr_cv.scores_.values()))
assert_array_equal(scores.shape, (1, 3, 1))
def test_logistic_cv_sparse():
X, y = make_classification(n_samples=50, n_features=5,
random_state=0)
X[X < 1.0] = 0.0
csr = sp.csr_matrix(X)
clf = LogisticRegressionCV(fit_intercept=True)
clf.fit(X, y)
clfs = LogisticRegressionCV(fit_intercept=True)
clfs.fit(csr, y)
assert_array_almost_equal(clfs.coef_, clf.coef_)
assert_array_almost_equal(clfs.intercept_, clf.intercept_)
assert_equal(clfs.C_, clf.C_)
def test_intercept_logistic_helper():
n_samples, n_features = 10, 5
X, y = make_classification(n_samples=n_samples, n_features=n_features,
random_state=0)
# Fit intercept case.
alpha = 1.
w = np.ones(n_features + 1)
grad_interp, hess_interp = _logistic_grad_hess(w, X, y, alpha)
loss_interp = _logistic_loss(w, X, y, alpha)
# Do not fit intercept. This can be considered equivalent to adding
# a feature vector of ones, i.e column of one vectors.
X_ = np.hstack((X, np.ones(10)[:, np.newaxis]))
grad, hess = _logistic_grad_hess(w, X_, y, alpha)
loss = _logistic_loss(w, X_, y, alpha)
# In the fit_intercept=False case, the feature vector of ones is
# penalized. This should be taken care of.
assert_almost_equal(loss_interp + 0.5 * (w[-1] ** 2), loss)
# Check gradient.
assert_array_almost_equal(grad_interp[:n_features], grad[:n_features])
assert_almost_equal(grad_interp[-1] + alpha * w[-1], grad[-1])
rng = np.random.RandomState(0)
grad = rng.rand(n_features + 1)
hess_interp = hess_interp(grad)
hess = hess(grad)
assert_array_almost_equal(hess_interp[:n_features], hess[:n_features])
assert_almost_equal(hess_interp[-1] + alpha * grad[-1], hess[-1])
def test_ovr_multinomial_iris():
# Test that OvR and multinomial are correct using the iris dataset.
train, target = iris.data, iris.target
n_samples, n_features = train.shape
# The cv indices from stratified kfold (where stratification is done based
# on the fine-grained iris classes, i.e, before the classes 0 and 1 are
# conflated) is used for both clf and clf1
n_cv = 2
cv = StratifiedKFold(n_cv)
precomputed_folds = list(cv.split(train, target))
# Train clf on the original dataset where classes 0 and 1 are separated
clf = LogisticRegressionCV(cv=precomputed_folds)
clf.fit(train, target)
# Conflate classes 0 and 1 and train clf1 on this modified dataset
clf1 = LogisticRegressionCV(cv=precomputed_folds)
target_copy = target.copy()
target_copy[target_copy == 0] = 1
clf1.fit(train, target_copy)
# Ensure that what OvR learns for class2 is same regardless of whether
# classes 0 and 1 are separated or not
assert_array_almost_equal(clf.scores_[2], clf1.scores_[2])
assert_array_almost_equal(clf.intercept_[2:], clf1.intercept_)
assert_array_almost_equal(clf.coef_[2][np.newaxis, :], clf1.coef_)
# Test the shape of various attributes.
assert_equal(clf.coef_.shape, (3, n_features))
assert_array_equal(clf.classes_, [0, 1, 2])
coefs_paths = np.asarray(list(clf.coefs_paths_.values()))
assert_array_almost_equal(coefs_paths.shape, (3, n_cv, 10, n_features + 1))
assert_equal(clf.Cs_.shape, (10, ))
scores = np.asarray(list(clf.scores_.values()))
assert_equal(scores.shape, (3, n_cv, 10))
# Test that for the iris data multinomial gives a better accuracy than OvR
for solver in ['lbfgs', 'newton-cg', 'sag']:
max_iter = 100 if solver == 'sag' else 15
clf_multi = LogisticRegressionCV(
solver=solver, multi_class='multinomial', max_iter=max_iter,
random_state=42, tol=1e-2, cv=2)
clf_multi.fit(train, target)
multi_score = clf_multi.score(train, target)
ovr_score = clf.score(train, target)
assert_greater(multi_score, ovr_score)
# Test attributes of LogisticRegressionCV
assert_equal(clf.coef_.shape, clf_multi.coef_.shape)
assert_array_equal(clf_multi.classes_, [0, 1, 2])
coefs_paths = np.asarray(list(clf_multi.coefs_paths_.values()))
assert_array_almost_equal(coefs_paths.shape, (3, n_cv, 10,
n_features + 1))
assert_equal(clf_multi.Cs_.shape, (10, ))
scores = np.asarray(list(clf_multi.scores_.values()))
assert_equal(scores.shape, (3, n_cv, 10))
def test_logistic_regression_solvers():
X, y = make_classification(n_features=10, n_informative=5, random_state=0)
ncg = LogisticRegression(solver='newton-cg', fit_intercept=False)
lbf = LogisticRegression(solver='lbfgs', fit_intercept=False)
lib = LogisticRegression(fit_intercept=False)
sag = LogisticRegression(solver='sag', fit_intercept=False,
random_state=42)
ncg.fit(X, y)
lbf.fit(X, y)
sag.fit(X, y)
lib.fit(X, y)
assert_array_almost_equal(ncg.coef_, lib.coef_, decimal=3)
assert_array_almost_equal(lib.coef_, lbf.coef_, decimal=3)
assert_array_almost_equal(ncg.coef_, lbf.coef_, decimal=3)
assert_array_almost_equal(sag.coef_, lib.coef_, decimal=3)
assert_array_almost_equal(sag.coef_, ncg.coef_, decimal=3)
assert_array_almost_equal(sag.coef_, lbf.coef_, decimal=3)
def test_logistic_regression_solvers_multiclass():
X, y = make_classification(n_samples=20, n_features=20, n_informative=10,
n_classes=3, random_state=0)
tol = 1e-6
ncg = LogisticRegression(solver='newton-cg', fit_intercept=False, tol=tol)
lbf = LogisticRegression(solver='lbfgs', fit_intercept=False, tol=tol)
lib = LogisticRegression(fit_intercept=False, tol=tol)
sag = LogisticRegression(solver='sag', fit_intercept=False, tol=tol,
max_iter=1000, random_state=42)
ncg.fit(X, y)
lbf.fit(X, y)
sag.fit(X, y)
lib.fit(X, y)
assert_array_almost_equal(ncg.coef_, lib.coef_, decimal=4)
assert_array_almost_equal(lib.coef_, lbf.coef_, decimal=4)
assert_array_almost_equal(ncg.coef_, lbf.coef_, decimal=4)
assert_array_almost_equal(sag.coef_, lib.coef_, decimal=4)
assert_array_almost_equal(sag.coef_, ncg.coef_, decimal=4)
assert_array_almost_equal(sag.coef_, lbf.coef_, decimal=4)
def test_logistic_regressioncv_class_weights():
X, y = make_classification(n_samples=20, n_features=20, n_informative=10,
n_classes=3, random_state=0)
msg = ("In LogisticRegressionCV the liblinear solver cannot handle "
"multiclass with class_weight of type dict. Use the lbfgs, "
"newton-cg or sag solvers or set class_weight='balanced'")
clf_lib = LogisticRegressionCV(class_weight={0: 0.1, 1: 0.2},
solver='liblinear')
assert_raise_message(ValueError, msg, clf_lib.fit, X, y)
y_ = y.copy()
y_[y == 2] = 1
clf_lib.fit(X, y_)
assert_array_equal(clf_lib.classes_, [0, 1])
# Test for class_weight=balanced
X, y = make_classification(n_samples=20, n_features=20, n_informative=10,
random_state=0)
clf_lbf = LogisticRegressionCV(solver='lbfgs', fit_intercept=False,
class_weight='balanced')
clf_lbf.fit(X, y)
clf_lib = LogisticRegressionCV(solver='liblinear', fit_intercept=False,
class_weight='balanced')
clf_lib.fit(X, y)
clf_sag = LogisticRegressionCV(solver='sag', fit_intercept=False,
class_weight='balanced', max_iter=2000)
clf_sag.fit(X, y)
assert_array_almost_equal(clf_lib.coef_, clf_lbf.coef_, decimal=4)
assert_array_almost_equal(clf_sag.coef_, clf_lbf.coef_, decimal=4)
assert_array_almost_equal(clf_lib.coef_, clf_sag.coef_, decimal=4)
def test_logistic_regression_sample_weights():
X, y = make_classification(n_samples=20, n_features=5, n_informative=3,
n_classes=2, random_state=0)
sample_weight = y + 1
for LR in [LogisticRegression, LogisticRegressionCV]:
# Test that passing sample_weight as ones is the same as
# not passing them at all (default None)
for solver in ['lbfgs', 'liblinear']:
clf_sw_none = LR(solver=solver, fit_intercept=False)
clf_sw_none.fit(X, y)
clf_sw_ones = LR(solver=solver, fit_intercept=False)
clf_sw_ones.fit(X, y, sample_weight=np.ones(y.shape[0]))
assert_array_almost_equal(
clf_sw_none.coef_, clf_sw_ones.coef_, decimal=4)
# Test that sample weights work the same with the lbfgs,
# newton-cg, and 'sag' solvers
clf_sw_lbfgs = LR(solver='lbfgs', fit_intercept=False)
clf_sw_lbfgs.fit(X, y, sample_weight=sample_weight)
clf_sw_n = LR(solver='newton-cg', fit_intercept=False)
clf_sw_n.fit(X, y, sample_weight=sample_weight)
clf_sw_sag = LR(solver='sag', fit_intercept=False, tol=1e-10)
# ignore convergence warning due to small dataset
with ignore_warnings():
clf_sw_sag.fit(X, y, sample_weight=sample_weight)
clf_sw_liblinear = LR(solver='liblinear', fit_intercept=False)
clf_sw_liblinear.fit(X, y, sample_weight=sample_weight)
assert_array_almost_equal(
clf_sw_lbfgs.coef_, clf_sw_n.coef_, decimal=4)
assert_array_almost_equal(
clf_sw_lbfgs.coef_, clf_sw_sag.coef_, decimal=4)
assert_array_almost_equal(
clf_sw_lbfgs.coef_, clf_sw_liblinear.coef_, decimal=4)
# Test that passing class_weight as [1,2] is the same as
# passing class weight = [1,1] but adjusting sample weights
# to be 2 for all instances of class 2
for solver in ['lbfgs', 'liblinear']:
clf_cw_12 = LR(solver=solver, fit_intercept=False,
class_weight={0: 1, 1: 2})
clf_cw_12.fit(X, y)
clf_sw_12 = LR(solver=solver, fit_intercept=False)
clf_sw_12.fit(X, y, sample_weight=sample_weight)
assert_array_almost_equal(
clf_cw_12.coef_, clf_sw_12.coef_, decimal=4)
# Test the above for l1 penalty and l2 penalty with dual=True.
# since the patched liblinear code is different.
clf_cw = LogisticRegression(
solver="liblinear", fit_intercept=False, class_weight={0: 1, 1: 2},
penalty="l1")
clf_cw.fit(X, y)
clf_sw = LogisticRegression(
solver="liblinear", fit_intercept=False, penalty="l1")
clf_sw.fit(X, y, sample_weight)
assert_array_almost_equal(clf_cw.coef_, clf_sw.coef_, decimal=4)
clf_cw = LogisticRegression(
solver="liblinear", fit_intercept=False, class_weight={0: 1, 1: 2},
penalty="l2", dual=True)
clf_cw.fit(X, y)
clf_sw = LogisticRegression(
solver="liblinear", fit_intercept=False, penalty="l2", dual=True)
clf_sw.fit(X, y, sample_weight)
assert_array_almost_equal(clf_cw.coef_, clf_sw.coef_, decimal=4)
def _compute_class_weight_dictionary(y):
# helper for returning a dictionary instead of an array
classes = np.unique(y)
class_weight = compute_class_weight("balanced", classes, y)
class_weight_dict = dict(zip(classes, class_weight))
return class_weight_dict
def test_logistic_regression_class_weights():
# Multinomial case: remove 90% of class 0
X = iris.data[45:, :]
y = iris.target[45:]
solvers = ("lbfgs", "newton-cg")
class_weight_dict = _compute_class_weight_dictionary(y)
for solver in solvers:
clf1 = LogisticRegression(solver=solver, multi_class="multinomial",
class_weight="balanced")
clf2 = LogisticRegression(solver=solver, multi_class="multinomial",
class_weight=class_weight_dict)
clf1.fit(X, y)
clf2.fit(X, y)
assert_array_almost_equal(clf1.coef_, clf2.coef_, decimal=4)
# Binary case: remove 90% of class 0 and 100% of class 2
X = iris.data[45:100, :]
y = iris.target[45:100]
solvers = ("lbfgs", "newton-cg", "liblinear")
class_weight_dict = _compute_class_weight_dictionary(y)
for solver in solvers:
clf1 = LogisticRegression(solver=solver, multi_class="ovr",
class_weight="balanced")
clf2 = LogisticRegression(solver=solver, multi_class="ovr",
class_weight=class_weight_dict)
clf1.fit(X, y)
clf2.fit(X, y)
assert_array_almost_equal(clf1.coef_, clf2.coef_, decimal=6)
def test_multinomial_logistic_regression_with_classweight_auto():
X, y = iris.data, iris.target
model = LogisticRegression(multi_class='multinomial',
class_weight='auto', solver='lbfgs')
# 'auto' is deprecated and will be removed in 0.19
assert_warns_message(DeprecationWarning,
"class_weight='auto' heuristic is deprecated",
model.fit, X, y)
def test_logistic_regression_convergence_warnings():
# Test that warnings are raised if model does not converge
X, y = make_classification(n_samples=20, n_features=20)
clf_lib = LogisticRegression(solver='liblinear', max_iter=2, verbose=1)
assert_warns(ConvergenceWarning, clf_lib.fit, X, y)
assert_equal(clf_lib.n_iter_, 2)
def test_logistic_regression_multinomial():
# Tests for the multinomial option in logistic regression
# Some basic attributes of Logistic Regression
n_samples, n_features, n_classes = 50, 20, 3
X, y = make_classification(n_samples=n_samples,
n_features=n_features,
n_informative=10,
n_classes=n_classes, random_state=0)
# 'lbfgs' is used as a referenced
solver = 'lbfgs'
ref_i = LogisticRegression(solver=solver, multi_class='multinomial')
ref_w = LogisticRegression(solver=solver, multi_class='multinomial',
fit_intercept=False)
ref_i.fit(X, y)
ref_w.fit(X, y)
assert_array_equal(ref_i.coef_.shape, (n_classes, n_features))
assert_array_equal(ref_w.coef_.shape, (n_classes, n_features))
for solver in ['sag', 'newton-cg']:
clf_i = LogisticRegression(solver=solver, multi_class='multinomial',
random_state=42, max_iter=1000, tol=1e-6)
clf_w = LogisticRegression(solver=solver, multi_class='multinomial',
random_state=42, max_iter=1000, tol=1e-6,
fit_intercept=False)
clf_i.fit(X, y)
clf_w.fit(X, y)
assert_array_equal(clf_i.coef_.shape, (n_classes, n_features))
assert_array_equal(clf_w.coef_.shape, (n_classes, n_features))
# Compare solutions between lbfgs and the other solvers
assert_almost_equal(ref_i.coef_, clf_i.coef_, decimal=3)
assert_almost_equal(ref_w.coef_, clf_w.coef_, decimal=3)
assert_almost_equal(ref_i.intercept_, clf_i.intercept_, decimal=3)
# Test that the path give almost the same results. However since in this
# case we take the average of the coefs after fitting across all the
# folds, it need not be exactly the same.
for solver in ['lbfgs', 'newton-cg', 'sag']:
clf_path = LogisticRegressionCV(solver=solver, max_iter=2000, tol=1e-6,
multi_class='multinomial', Cs=[1.])
clf_path.fit(X, y)
assert_array_almost_equal(clf_path.coef_, ref_i.coef_, decimal=3)
assert_almost_equal(clf_path.intercept_, ref_i.intercept_, decimal=3)
def test_multinomial_grad_hess():
rng = np.random.RandomState(0)
n_samples, n_features, n_classes = 100, 5, 3
X = rng.randn(n_samples, n_features)
w = rng.rand(n_classes, n_features)
Y = np.zeros((n_samples, n_classes))
ind = np.argmax(np.dot(X, w.T), axis=1)
Y[range(0, n_samples), ind] = 1
w = w.ravel()
sample_weights = np.ones(X.shape[0])
grad, hessp = _multinomial_grad_hess(w, X, Y, alpha=1.,
sample_weight=sample_weights)
# extract first column of hessian matrix
vec = np.zeros(n_features * n_classes)
vec[0] = 1
hess_col = hessp(vec)
# Estimate hessian using least squares as done in
# test_logistic_grad_hess
e = 1e-3
d_x = np.linspace(-e, e, 30)
d_grad = np.array([
_multinomial_grad_hess(w + t * vec, X, Y, alpha=1.,
sample_weight=sample_weights)[0]
for t in d_x
])
d_grad -= d_grad.mean(axis=0)
approx_hess_col = linalg.lstsq(d_x[:, np.newaxis], d_grad)[0].ravel()
assert_array_almost_equal(hess_col, approx_hess_col)
def test_liblinear_decision_function_zero():
# Test negative prediction when decision_function values are zero.
# Liblinear predicts the positive class when decision_function values
# are zero. This is a test to verify that we do not do the same.
# See Issue: https://github.com/scikit-learn/scikit-learn/issues/3600
# and the PR https://github.com/scikit-learn/scikit-learn/pull/3623
X, y = make_classification(n_samples=5, n_features=5)
clf = LogisticRegression(fit_intercept=False)
clf.fit(X, y)
# Dummy data such that the decision function becomes zero.
X = np.zeros((5, 5))
assert_array_equal(clf.predict(X), np.zeros(5))
def test_liblinear_logregcv_sparse():
# Test LogRegCV with solver='liblinear' works for sparse matrices
X, y = make_classification(n_samples=10, n_features=5)
clf = LogisticRegressionCV(solver='liblinear')
clf.fit(sparse.csr_matrix(X), y)
def test_logreg_intercept_scaling():
# Test that the right error message is thrown when intercept_scaling <= 0
for i in [-1, 0]:
clf = LogisticRegression(intercept_scaling=i)
msg = ('Intercept scaling is %r but needs to be greater than 0.'
' To disable fitting an intercept,'
' set fit_intercept=False.' % clf.intercept_scaling)
assert_raise_message(ValueError, msg, clf.fit, X, Y1)
def test_logreg_intercept_scaling_zero():
# Test that intercept_scaling is ignored when fit_intercept is False
clf = LogisticRegression(fit_intercept=False)
clf.fit(X, Y1)
assert_equal(clf.intercept_, 0.)
def test_logreg_cv_penalty():
# Test that the correct penalty is passed to the final fit.
X, y = make_classification(n_samples=50, n_features=20, random_state=0)
lr_cv = LogisticRegressionCV(penalty="l1", Cs=[1.0], solver='liblinear')
lr_cv.fit(X, y)
lr = LogisticRegression(penalty="l1", C=1.0, solver='liblinear')
lr.fit(X, y)
assert_equal(np.count_nonzero(lr_cv.coef_), np.count_nonzero(lr.coef_))
def test_logreg_predict_proba_multinomial():
X, y = make_classification(n_samples=10, n_features=20, random_state=0,
n_classes=3, n_informative=10)
# Predicted probabilites using the true-entropy loss should give a
# smaller loss than those using the ovr method.
clf_multi = LogisticRegression(multi_class="multinomial", solver="lbfgs")
clf_multi.fit(X, y)
clf_multi_loss = log_loss(y, clf_multi.predict_proba(X))
clf_ovr = LogisticRegression(multi_class="ovr", solver="lbfgs")
clf_ovr.fit(X, y)
clf_ovr_loss = log_loss(y, clf_ovr.predict_proba(X))
assert_greater(clf_ovr_loss, clf_multi_loss)
# Predicted probabilites using the soft-max function should give a
# smaller loss than those using the logistic function.
clf_multi_loss = log_loss(y, clf_multi.predict_proba(X))
clf_wrong_loss = log_loss(y, clf_multi._predict_proba_lr(X))
assert_greater(clf_wrong_loss, clf_multi_loss)
@ignore_warnings
def test_max_iter():
# Test that the maximum number of iteration is reached
X, y_bin = iris.data, iris.target.copy()
y_bin[y_bin == 2] = 0
solvers = ['newton-cg', 'liblinear', 'sag']
# old scipy doesn't have maxiter
if sp_version >= (0, 12):
solvers.append('lbfgs')
for max_iter in range(1, 5):
for solver in solvers:
for multi_class in ['ovr', 'multinomial']:
if solver == 'liblinear' and multi_class == 'multinomial':
continue
lr = LogisticRegression(max_iter=max_iter, tol=1e-15,
multi_class=multi_class,
random_state=0, solver=solver)
lr.fit(X, y_bin)
assert_equal(lr.n_iter_[0], max_iter)
def test_n_iter():
# Test that self.n_iter_ has the correct format.
X, y = iris.data, iris.target
y_bin = y.copy()
y_bin[y_bin == 2] = 0
n_Cs = 4
n_cv_fold = 2
for solver in ['newton-cg', 'liblinear', 'sag', 'lbfgs']:
# OvR case
n_classes = 1 if solver == 'liblinear' else np.unique(y).shape[0]
clf = LogisticRegression(tol=1e-2, multi_class='ovr',
solver=solver, C=1.,
random_state=42, max_iter=100)
clf.fit(X, y)
assert_equal(clf.n_iter_.shape, (n_classes,))
n_classes = np.unique(y).shape[0]
clf = LogisticRegressionCV(tol=1e-2, multi_class='ovr',
solver=solver, Cs=n_Cs, cv=n_cv_fold,
random_state=42, max_iter=100)
clf.fit(X, y)
assert_equal(clf.n_iter_.shape, (n_classes, n_cv_fold, n_Cs))
clf.fit(X, y_bin)
assert_equal(clf.n_iter_.shape, (1, n_cv_fold, n_Cs))
# multinomial case
n_classes = 1
if solver in ('liblinear', 'sag'):
break
clf = LogisticRegression(tol=1e-2, multi_class='multinomial',
solver=solver, C=1.,
random_state=42, max_iter=100)
clf.fit(X, y)
assert_equal(clf.n_iter_.shape, (n_classes,))
clf = LogisticRegressionCV(tol=1e-2, multi_class='multinomial',
solver=solver, Cs=n_Cs, cv=n_cv_fold,
random_state=42, max_iter=100)
clf.fit(X, y)
assert_equal(clf.n_iter_.shape, (n_classes, n_cv_fold, n_Cs))
clf.fit(X, y_bin)
assert_equal(clf.n_iter_.shape, (1, n_cv_fold, n_Cs))
@ignore_warnings
def test_warm_start():
# A 1-iteration second fit on same data should give almost same result
# with warm starting, and quite different result without warm starting.
# Warm starting does not work with liblinear solver.
X, y = iris.data, iris.target
solvers = ['newton-cg', 'sag']
# old scipy doesn't have maxiter
if sp_version >= (0, 12):
solvers.append('lbfgs')
for warm_start in [True, False]:
for fit_intercept in [True, False]:
for solver in solvers:
for multi_class in ['ovr', 'multinomial']:
clf = LogisticRegression(tol=1e-4, multi_class=multi_class,
warm_start=warm_start,
solver=solver,
random_state=42, max_iter=100,
fit_intercept=fit_intercept)
clf.fit(X, y)
coef_1 = clf.coef_
clf.max_iter = 1
with ignore_warnings():
clf.fit(X, y)
cum_diff = np.sum(np.abs(coef_1 - clf.coef_))
msg = ("Warm starting issue with %s solver in %s mode "
"with fit_intercept=%s and warm_start=%s"
% (solver, multi_class, str(fit_intercept),
str(warm_start)))
if warm_start:
assert_greater(2.0, cum_diff, msg)
else:
assert_greater(cum_diff, 2.0, msg)
|
bsd-3-clause
|
sanghack81/SDCIT
|
experiments/draw_figures.py
|
1
|
18832
|
import collections
import matplotlib.pyplot as plt
import numpy as np
import pandas as pd
import scipy
import scipy.stats
import seaborn as sns
from os.path import exists
from experiments.exp_setup import SDCIT_RESULT_DIR, SDCIT_FIGURE_DIR
from sdcit.utils import AUPC
names_chsic_chaotic = ['independent', 'gamma', 'noise', 'trial', 'N', 'runtime', 'statistic', 'pvalue']
names_chsic_postnonlinear = ['independent', 'noise', 'trial', 'N', 'runtime', 'statistic', 'pvalue']
names_kcit_chaotic = ['independent', 'gamma', 'noise', 'trial', 'N', 'runtime', 'statistic', 'boot_p_value', 'appr_p_value']
names_kcit_postnonlinear = ['independent', 'noise', 'trial', 'N', 'runtime', 'statistic', 'boot_p_value', 'appr_p_value']
names_sdcit_chaotic = ['independent', 'gamma', 'trial', 'N', 'statistic', 'pvalue']
names_sdcit_postnonlinear = ['independent', 'noise', 'trial', 'N', 'statistic', 'pvalue']
names_kcipt_chaotic = ['independent', 'gamma', 'trial', 'N', 'statistic', 'pvalue', 'B']
names_kcipt_postnonlinear = ['independent', 'noise', 'trial', 'N', 'statistic', 'pvalue', 'B']
names = {('CHSIC', 'chaotic'): names_chsic_chaotic,
('CHSIC', 'postnonlinear'): names_chsic_postnonlinear,
('KCIT', 'chaotic'): names_kcit_chaotic,
('KCIT', 'postnonlinear'): names_kcit_postnonlinear,
('KCIT2', 'chaotic'): names_kcit_chaotic,
('KCIT2', 'postnonlinear'): names_kcit_postnonlinear,
('SDCIT', 'chaotic'): names_sdcit_chaotic,
('SDCIT', 'postnonlinear'): names_sdcit_postnonlinear,
('KCIPT', 'chaotic'): names_kcipt_chaotic,
('KCIPT', 'postnonlinear'): names_kcipt_postnonlinear,
}
pvalue_column = collections.defaultdict(lambda: 'pvalue')
pvalue_column['KCIT'] = 'boot_p_value'
pvalue_column['KCIT2'] = 'boot_p_value'
color_palettes = sns.color_palette('Paired', 10)
method_color_codes = {'KCIT': 3, 'SDCIT': 5, 'KCIPT': 1, 'CHSIC': 9, 'KCIT2': 2}
markers = collections.defaultdict(lambda: 'o')
markers.update({'KCIT': 'o', 'SDCIT': 's', 'KCIPT': '*', 'CHSIC': '^', 'KCIT2': 'o'})
all_algos = ['KCIT', 'SDCIT', 'KCIPT', 'CHSIC', 'KCIT2']
def algo_name(org_name):
map = {'KCIT2': 'KCIT', 'KCIT': 'KCIT (org.)'}
if org_name in map:
return map[org_name]
else:
return org_name
def draw_aupc_chaotic():
data = 'chaotic'
aupc_data = []
for algo in all_algos:
df = pd.read_csv(SDCIT_RESULT_DIR + '/' + algo.lower() + '_' + data + '.csv', names=names[(algo, data)])
for group_key, group_df in df.groupby(by=['gamma', 'independent', 'N']):
group_key = (int(group_key[0] * 10) / 10, *group_key[1:])
if group_key[1] == 0:
aupc_data.append([algo, *group_key, AUPC(group_df[pvalue_column[algo]])])
print(draw_aupc_chaotic.__name__)
[print(xx) for xx in aupc_data]
aupc_data = np.array(aupc_data)
aupc_df = pd.DataFrame({'algorithm': aupc_data[:, 0],
'gamma': aupc_data[:, 1],
'independent': aupc_data[:, 2],
'N': aupc_data[:, 3],
'AUPC': aupc_data[:, 4]})
aupc_df['gamma'] = aupc_df['gamma'].astype(float)
aupc_df['independent'] = aupc_df['independent'].astype(int)
aupc_df['N'] = aupc_df['N'].map(int)
aupc_df['AUPC'] = aupc_df['AUPC'].astype(float)
aupc_df = aupc_df[aupc_df['independent'] == 0]
aupc_df["algo-N"] = aupc_df["algorithm"].map(str) + aupc_df["N"].map(lambda xxx: ' (' + str(xxx) + ')')
sns_setting()
for k, gdf in aupc_df.groupby(['algorithm', 'N']):
print('chaotic', k, gdf['AUPC'])
if k[1] == 400:
plt.plot(gdf['gamma'], gdf['AUPC'], markers[(k[0])], c=color_palettes[method_color_codes[k[0]]] if k[1] == 400 else color_palettes[-0 + method_color_codes[k[0]]],
ls='-' if k[1] == 400 else ':', label=algo_name(str(k[0])))
else:
plt.plot(gdf['gamma'], gdf['AUPC'], markers[(k[0])], c=color_palettes[method_color_codes[k[0]]] if k[1] == 400 else color_palettes[-0 + method_color_codes[k[0]]],
ls='-' if k[1] == 400 else ':', label='_nolegend_')
plt.axes().set_xlabel(r'$\gamma$')
plt.axes().set_ylabel('Area Under Power Curve')
plt.axes().set_ylim([0.45, 1.05])
handles, labels = plt.axes().get_legend_handles_labels()
# plt.axes().legend(handles[::-1], labels[::-1])
sns.despine()
plt.savefig(SDCIT_FIGURE_DIR + '/{}_aupc.pdf'.format(data), transparent=True, bbox_inches='tight', pad_inches=0.02)
plt.close()
def draw_calib_chaotic():
data = 'chaotic'
calib_data = []
for algo in all_algos:
df = pd.read_csv(SDCIT_RESULT_DIR + '/' + algo.lower() + '_' + data + '.csv', names=names[(algo, data)])
for k, gdf in df.groupby(by=['independent', 'gamma', 'N']):
if float(k[0]) == 1:
D, _ = scipy.stats.kstest(gdf[pvalue_column[algo]], 'uniform')
calib_data.append([algo, float(k[1]), int(k[2]), D])
print(draw_calib_chaotic.__name__)
[print(xx) for xx in calib_data]
df = pd.DataFrame(calib_data, columns=['algo', 'gamma', 'N', 'D'])
df['gamma'] = df['gamma'].astype(float)
df['N'] = df['N'].map(int)
df['D'] = df['D'].astype(float)
sns_setting()
for k, gdf in df.groupby(['algo', 'N']):
if k[1] == 400:
plt.plot(gdf['gamma'], gdf['D'], markers[(k[0])], c=color_palettes[method_color_codes[k[0]]] if k[1] == 400 else color_palettes[-0 + method_color_codes[k[0]]],
ls='-' if k[1] == 400 else ':', label=algo_name(str(k[0])))
else:
plt.plot(gdf['gamma'], gdf['D'], markers[(k[0])], c=color_palettes[method_color_codes[k[0]]] if k[1] == 400 else color_palettes[-0 + method_color_codes[k[0]]],
ls='-' if k[1] == 400 else ':', label='_nolegend_')
handles, labels = plt.axes().get_legend_handles_labels()
plt.axes().legend(handles[::-1], labels[::-1], ncol=2)
plt.axes().set_xlabel(r'$\gamma$')
plt.axes().set_ylabel('KS test statistic')
plt.axes().set_ylim([0.0, 0.5])
plt.axes().invert_yaxis()
plt.axes().set_yticks([0.0, 0.1, 0.2, 0.3, 0.4, 0.5])
handles, labels = plt.axes().get_legend_handles_labels()
# plt.axes().legend(handles[::-1], labels[::-1])
sns.despine()
plt.savefig(SDCIT_FIGURE_DIR + '/chaotic_calib.pdf', transparent=True, bbox_inches='tight', pad_inches=0.02)
plt.close()
def draw_type_I_error_chaotic():
data = 'chaotic'
calib_data = []
for algo in all_algos:
df = pd.read_csv(SDCIT_RESULT_DIR + '/' + algo.lower() + '_' + data + '.csv', names=names[(algo, data)])
for k, gdf in df.groupby(by=['independent', 'gamma', 'N']):
if float(k[0]) == 1:
calib_data.append([algo, float(k[1]), int(k[2]), np.mean(gdf[pvalue_column[algo]] <= 0.05)])
print(draw_type_I_error_chaotic.__name__)
[print(xx) for xx in calib_data]
df = pd.DataFrame(calib_data, columns=['algo', 'gamma', 'N', 'D'])
df['gamma'] = df['gamma'].astype(float)
df['N'] = df['N'].map(int)
df['D'] = df['D'].astype(float)
sns_setting()
for k, gdf in df.groupby(['algo', 'N']):
if k[1] == 400:
plt.plot(gdf['gamma'], gdf['D'], markers[(k[0])], c=color_palettes[method_color_codes[k[0]]] if k[1] == 400 else color_palettes[-0 + method_color_codes[k[0]]],
ls='-' if k[1] == 400 else ':', label=algo_name(str(k[0])))
else:
plt.plot(gdf['gamma'], gdf['D'], markers[(k[0])], c=color_palettes[method_color_codes[k[0]]] if k[1] == 400 else color_palettes[-0 + method_color_codes[k[0]]],
ls='-' if k[1] == 400 else ':', label='_nolegend_')
plt.axes().set_xlabel(r'$\gamma$')
plt.axes().set_xticks([0.0, 0.1, 0.2, 0.3, 0.4, 0.5])
plt.axes().set_ylabel('Type I error')
plt.axes().set_ylim([0.0, 0.2])
sns.despine()
plt.savefig(SDCIT_FIGURE_DIR + '/chaotic_type_I.pdf', transparent=True, bbox_inches='tight', pad_inches=0.02)
plt.close()
def draw_aupc_postnonlinear():
data = 'postnonlinear'
aupc_data = []
for algo in all_algos:
df = pd.read_csv(SDCIT_RESULT_DIR + '/' + algo.lower() + '_' + data + '.csv', names=names[(algo, data)])
for group_key, group_df in df.groupby(by=['noise', 'independent', 'N']):
group_key = (int(group_key[0] * 10) / 10, int(group_key[1]), int(group_key[2]))
aupc_data.append([algo, *group_key, AUPC(group_df[pvalue_column[algo]])])
print(draw_aupc_postnonlinear.__name__)
[print(xx) for xx in aupc_data]
aupc_data = np.array(aupc_data)
aupc_df = pd.DataFrame({'algorithm': [str(v) for v in aupc_data[:, 0]],
'noise': [int(float(v)) for v in aupc_data[:, 1]],
'independent': [int(v) for v in aupc_data[:, 2]],
'N': [int(v) for v in aupc_data[:, 3]],
'AUPC': [float(v) for v in aupc_data[:, 4]]})
aupc_df['dimension'] = (aupc_df['noise'] + 1).astype(int)
aupc_df = aupc_df[aupc_df['independent'] == 0]
aupc_df["algo-N"] = aupc_df["algorithm"].map(str) + aupc_df["N"].map(lambda xxx: ' (' + str(xxx) + ')')
sns_setting()
for k, gdf in aupc_df.groupby(['algorithm', 'N']):
gdf = gdf[gdf['dimension'] <= 5]
if k[1] == 400:
plt.plot(gdf['dimension'], gdf['AUPC'], markers[(k[0])], c=color_palettes[method_color_codes[k[0]]] if k[1] == 400 else color_palettes[-0 + method_color_codes[k[0]]],
ls='-' if k[1] == 400 else ':', label=algo_name(str(k[0])))
else:
plt.plot(gdf['dimension'], gdf['AUPC'], markers[(k[0])], c=color_palettes[method_color_codes[k[0]]] if k[1] == 400 else color_palettes[-0 + method_color_codes[k[0]]],
ls='-' if k[1] == 400 else ':', label='_nolegend_')
plt.axes().set_xlabel('dimension')
plt.axes().set_ylabel('Area Under Power Curve')
plt.axes().set_ylim([0.45, 1.05])
sns.despine()
plt.savefig(SDCIT_FIGURE_DIR + '/postnonlinear_aupc.pdf', transparent=True, bbox_inches='tight', pad_inches=0.02)
plt.close()
def draw_aupc_postnonlinear_highdim():
data = 'postnonlinear'
aupc_data = []
for algo in all_algos:
df = pd.read_csv(SDCIT_RESULT_DIR + '/' + algo.lower() + '_' + data + '.csv', names=names[(algo, data)])
for group_key, group_df in df.groupby(by=['noise', 'independent', 'N']):
group_key = (int(group_key[0] * 10) / 10, int(group_key[1]), int(group_key[2]))
aupc_data.append([algo, *group_key, AUPC(group_df[pvalue_column[algo]])])
print(draw_aupc_postnonlinear_highdim.__name__)
[print(xx) for xx in aupc_data]
aupc_data = np.array(aupc_data)
aupc_df = pd.DataFrame({'algorithm': [str(v) for v in aupc_data[:, 0]],
'noise': [int(float(v)) for v in aupc_data[:, 1]],
'independent': [int(v) for v in aupc_data[:, 2]],
'N': [int(v) for v in aupc_data[:, 3]],
'AUPC': [float(v) for v in aupc_data[:, 4]]})
aupc_df['dimension'] = (aupc_df['noise'] + 1).astype(int)
aupc_df = aupc_df[aupc_df['independent'] == 0]
aupc_df["algo-N"] = aupc_df["algorithm"].map(str) + aupc_df["N"].map(lambda xxx: ' (' + str(xxx) + ')')
sns_setting()
for k, gdf in aupc_df.groupby(['algorithm', 'N']):
if k[1] == 400:
plt.plot([int(v) for v in gdf['dimension']], gdf['AUPC'], markers[(k[0])], c=color_palettes[method_color_codes[k[0]]] if k[1] == 400 else color_palettes[-0 + method_color_codes[k[0]]],
ls='-' if k[1] == 400 else ':',
label=algo_name(str(k[0])))
plt.axes().set_xlabel('dimension')
plt.axes().set_ylabel('Area Under Power Curve')
plt.axes().set_ylim([0.95, 1.01])
plt.axes().set_xscale('log')
plt.xticks([1, 5, 10, 20, 50], [1, 5, 10, 20, 50])
sns.despine()
plt.savefig(SDCIT_FIGURE_DIR + '/postnonlinear_aupc_highdim.pdf', transparent=True, bbox_inches='tight', pad_inches=0.02)
plt.close()
def draw_calib_postnonlinear():
data = 'postnonlinear'
calib_data = []
for algo in all_algos:
df = pd.read_csv(SDCIT_RESULT_DIR + '/' + algo.lower() + '_' + data + '.csv', names=names[(algo, data)])
for k, gdf in df.groupby(by=['independent', 'noise', 'N']):
if float(k[0]) == 1:
D, _ = scipy.stats.kstest(gdf[pvalue_column[algo]], 'uniform')
calib_data.append([algo, float(k[1]), int(k[2]), D])
print(draw_calib_postnonlinear.__name__)
[print(xx) for xx in calib_data]
df = pd.DataFrame(calib_data, columns=['algo', 'noise', 'N', 'D'])
df['noise'] = df['noise'].map(int)
df['dimension'] = (df['noise'] + 1).astype(int)
df['N'] = df['N'].map(int)
df['D'] = df['D'].astype(float)
sns_setting()
for k, gdf in df.groupby(['algo', 'N']):
gdf = gdf[gdf['dimension'] <= 5]
if k[1] == 400:
plt.plot([int(v) for v in gdf['dimension']], gdf['D'], markers[(k[0])], c=color_palettes[method_color_codes[k[0]]] if k[1] == 400 else color_palettes[-0 + method_color_codes[k[0]]],
ls='-' if k[1] == 400 else ':',
label=algo_name(str(k[0])))
else:
plt.plot([int(v) for v in gdf['dimension']], gdf['D'], markers[(k[0])], c=color_palettes[method_color_codes[k[0]]] if k[1] == 400 else color_palettes[-0 + method_color_codes[k[0]]],
ls='-' if k[1] == 400 else ':',
label='_nolegend_')
plt.axes().set_xlabel('dimension')
plt.axes().set_ylabel('KS test statistic')
plt.axes().set_ylim([0.0, 0.5])
plt.axes().invert_yaxis()
plt.axes().set_yticks([0.0, 0.1, 0.2, 0.3, 0.4, 0.5])
sns.despine()
plt.savefig(SDCIT_FIGURE_DIR + '/postnonlinear_calib.pdf', transparent=True, bbox_inches='tight', pad_inches=0.02)
plt.close()
def sns_setting():
paper_rc = {'lines.linewidth': 1, 'lines.markersize': 2}
sns.set_context("paper", rc=paper_rc)
sns.set(style='white', font_scale=1.4)
plt.figure(figsize=[4, 3])
plt.rc('text', usetex=True)
plt.rc('text.latex', preamble=r'\usepackage{cmbright}')
def draw_calib_postnonlinear_highdim():
data = 'postnonlinear'
calib_data = []
for algo in all_algos:
df = pd.read_csv(SDCIT_RESULT_DIR + '/' + algo.lower() + '_' + data + '.csv', names=names[(algo, data)])
for k, gdf in df.groupby(by=['independent', 'noise', 'N']):
if float(k[0]) == 1 and k[2] == 400:
dd, _ = scipy.stats.kstest(gdf[pvalue_column[algo]], 'uniform')
calib_data.append([algo, float(k[1]), int(k[2]), dd])
print(draw_calib_postnonlinear_highdim.__name__)
[print(xx) for xx in calib_data]
df = pd.DataFrame(calib_data, columns=['algo', 'noise', 'N', 'D'])
df['noise'] = df['noise'].map(int)
df['dimension'] = (df['noise'] + 1).astype(int)
df['N'] = df['N'].map(int)
df['D'] = df['D'].astype(float)
sns_setting()
for k, gdf in df.groupby(['algo', 'N']):
print('postnonlinear', k, gdf['D'])
if k[1] == 400:
plt.plot(gdf['dimension'], gdf['D'], markers[(k[0])], c=color_palettes[method_color_codes[k[0]]] if k[1] == 400 else color_palettes[-0 + method_color_codes[k[0]]],
ls='-' if k[1] == 400 else ':', label=algo_name(str(k[0])))
else:
plt.plot(gdf['dimension'], gdf['D'], markers[(k[0])], c=color_palettes[method_color_codes[k[0]]] if k[1] == 400 else color_palettes[-0 + method_color_codes[k[0]]],
ls='-' if k[1] == 400 else ':', label='_nolegend_')
plt.axes().set_xlabel('dimension')
plt.axes().set_ylabel('KS test statistic')
plt.axes().set_xscale('log')
plt.axes().set_ylim([0.0, 0.5])
plt.axes().invert_yaxis()
plt.xticks([1, 5, 10, 20, 50], [1, 5, 10, 20, 50])
plt.axes().set_yticks([0.0, 0.1, 0.2, 0.3, 0.4, 0.5])
sns.despine()
plt.savefig(SDCIT_FIGURE_DIR + '/postnonlinear_calib_highdim.pdf', transparent=True, bbox_inches='tight', pad_inches=0.02)
plt.close()
def draw_type_I_postnonlinear_highdim():
data = 'postnonlinear'
calib_data = []
for algo in all_algos:
df = pd.read_csv(SDCIT_RESULT_DIR + '/' + algo.lower() + '_' + data + '.csv', names=names[(algo, data)])
for k, gdf in df.groupby(by=['independent', 'noise', 'N']):
if float(k[0]) == 1 and k[2] == 400:
dd = np.mean(gdf[pvalue_column[algo]] <= 0.05)
calib_data.append([algo, float(k[1]), int(k[2]), dd])
print(draw_type_I_postnonlinear_highdim.__name__)
[print(xx) for xx in calib_data]
df = pd.DataFrame(calib_data, columns=['algo', 'noise', 'N', 'D'])
df['noise'] = df['noise'].map(int)
df['dimension'] = (df['noise'] + 1).astype(int)
df['N'] = df['N'].map(int)
df['D'] = df['D'].astype(float)
sns_setting()
for k, gdf in df.groupby(['algo', 'N']):
if k[1] == 400:
plt.plot(gdf['dimension'], gdf['D'], markers[(k[0])], c=color_palettes[method_color_codes[k[0]]] if k[1] == 400 else color_palettes[-0 + method_color_codes[k[0]]],
ls='-' if k[1] == 400 else ':', label=algo_name(str(k[0])))
else:
plt.plot(gdf['dimension'], gdf['D'], markers[(k[0])], c=color_palettes[method_color_codes[k[0]]] if k[1] == 400 else color_palettes[-0 + method_color_codes[k[0]]],
ls='-' if k[1] == 400 else ':', label='_nolegend_')
plt.axes().set_xlabel('dimension')
plt.axes().set_xscale('log')
plt.xticks([1, 5, 10, 20, 50], [1, 5, 10, 20, 50])
plt.axes().set_ylim([0.0, 0.2])
handles, labels = plt.axes().get_legend_handles_labels()
plt.axes().legend(handles[::-1], labels[::-1])
sns.despine()
plt.savefig(SDCIT_FIGURE_DIR + '/postnonlinear_type_I_highdim.pdf', transparent=True, bbox_inches='tight', pad_inches=0.02)
plt.close()
if __name__ == '__main__':
for data in ['chaotic', 'postnonlinear']:
for algo in all_algos:
assert exists(SDCIT_RESULT_DIR + '/' + algo.lower() + '_' + data + '.csv'), 'run tests first -- missing {}'.format(algo.lower() + '_' + data + '.csv')
if True:
# chaotic series
draw_aupc_chaotic()
draw_calib_chaotic()
# postnonlinear-noise
draw_aupc_postnonlinear()
draw_calib_postnonlinear()
draw_aupc_postnonlinear_highdim()
draw_calib_postnonlinear_highdim()
# type I for both
draw_type_I_error_chaotic()
draw_type_I_postnonlinear_highdim()
|
mit
|
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.