{ // 获取包含Hugging Face文本的span元素 const spans = link.querySelectorAll('span.whitespace-nowrap, span.hidden.whitespace-nowrap'); spans.forEach(span => { if (span.textContent && span.textContent.trim().match(/Hugging\s*Face/i)) { span.textContent = 'AI快站'; } }); }); // 替换logo图片的alt属性 document.querySelectorAll('img[alt*="Hugging"], img[alt*="Face"]').forEach(img => { if (img.alt.match(/Hugging\s*Face/i)) { img.alt = 'AI快站 logo'; } }); } // 替换导航栏中的链接 function replaceNavigationLinks() { // 已替换标记,防止重复运行 if (window._navLinksReplaced) { return; } // 已经替换过的链接集合,防止重复替换 const replacedLinks = new Set(); // 只在导航栏区域查找和替换链接 const headerArea = document.querySelector('header') || document.querySelector('nav'); if (!headerArea) { return; } // 在导航区域内查找链接 const navLinks = headerArea.querySelectorAll('a'); navLinks.forEach(link => { // 如果已经替换过,跳过 if (replacedLinks.has(link)) return; const linkText = link.textContent.trim(); const linkHref = link.getAttribute('href') || ''; // 替换Spaces链接 - 仅替换一次 if ( (linkHref.includes('/spaces') || linkHref === '/spaces' || linkText === 'Spaces' || linkText.match(/^s*Spacess*$/i)) && linkText !== 'OCR模型免费转Markdown' && linkText !== 'OCR模型免费转Markdown' ) { link.textContent = 'OCR模型免费转Markdown'; link.href = 'https://fast360.xyz'; link.setAttribute('target', '_blank'); link.setAttribute('rel', 'noopener noreferrer'); replacedLinks.add(link); } // 删除Posts链接 else if ( (linkHref.includes('/posts') || linkHref === '/posts' || linkText === 'Posts' || linkText.match(/^s*Postss*$/i)) ) { if (link.parentNode) { link.parentNode.removeChild(link); } replacedLinks.add(link); } // 替换Docs链接 - 仅替换一次 else if ( (linkHref.includes('/docs') || linkHref === '/docs' || linkText === 'Docs' || linkText.match(/^s*Docss*$/i)) && linkText !== '模型下载攻略' ) { link.textContent = '模型下载攻略'; link.href = '/'; replacedLinks.add(link); } // 删除Enterprise链接 else if ( (linkHref.includes('/enterprise') || linkHref === '/enterprise' || linkText === 'Enterprise' || linkText.match(/^s*Enterprises*$/i)) ) { if (link.parentNode) { link.parentNode.removeChild(link); } replacedLinks.add(link); } }); // 查找可能嵌套的Spaces和Posts文本 const textNodes = []; function findTextNodes(element) { if (element.nodeType === Node.TEXT_NODE) { const text = element.textContent.trim(); if (text === 'Spaces' || text === 'Posts' || text === 'Enterprise') { textNodes.push(element); } } else { for (const child of element.childNodes) { findTextNodes(child); } } } // 只在导航区域内查找文本节点 findTextNodes(headerArea); // 替换找到的文本节点 textNodes.forEach(node => { const text = node.textContent.trim(); if (text === 'Spaces') { node.textContent = node.textContent.replace(/Spaces/g, 'OCR模型免费转Markdown'); } else if (text === 'Posts') { // 删除Posts文本节点 if (node.parentNode) { node.parentNode.removeChild(node); } } else if (text === 'Enterprise') { // 删除Enterprise文本节点 if (node.parentNode) { node.parentNode.removeChild(node); } } }); // 标记已替换完成 window._navLinksReplaced = true; } // 替换代码区域中的域名 function replaceCodeDomains() { // 特别处理span.hljs-string和span.njs-string元素 document.querySelectorAll('span.hljs-string, span.njs-string, span[class*="hljs-string"], span[class*="njs-string"]').forEach(span => { if (span.textContent && span.textContent.includes('huggingface.co')) { span.textContent = span.textContent.replace(/huggingface.co/g, 'aifasthub.com'); } }); // 替换hljs-string类的span中的域名(移除多余的转义符号) document.querySelectorAll('span.hljs-string, span[class*="hljs-string"]').forEach(span => { if (span.textContent && span.textContent.includes('huggingface.co')) { span.textContent = span.textContent.replace(/huggingface.co/g, 'aifasthub.com'); } }); // 替换pre和code标签中包含git clone命令的域名 document.querySelectorAll('pre, code').forEach(element => { if (element.textContent && element.textContent.includes('git clone')) { const text = element.innerHTML; if (text.includes('huggingface.co')) { element.innerHTML = text.replace(/huggingface.co/g, 'aifasthub.com'); } } }); // 处理特定的命令行示例 document.querySelectorAll('pre, code').forEach(element => { const text = element.innerHTML; if (text.includes('huggingface.co')) { // 针对git clone命令的专门处理 if (text.includes('git clone') || text.includes('GIT_LFS_SKIP_SMUDGE=1')) { element.innerHTML = text.replace(/huggingface.co/g, 'aifasthub.com'); } } }); // 特别处理模型下载页面上的代码片段 document.querySelectorAll('.flex.border-t, .svelte_hydrator, .inline-block').forEach(container => { const content = container.innerHTML; if (content && content.includes('huggingface.co')) { container.innerHTML = content.replace(/huggingface.co/g, 'aifasthub.com'); } }); // 特别处理模型仓库克隆对话框中的代码片段 try { // 查找包含"Clone this model repository"标题的对话框 const cloneDialog = document.querySelector('.svelte_hydration_boundary, [data-target="MainHeader"]'); if (cloneDialog) { // 查找对话框中所有的代码片段和命令示例 const codeElements = cloneDialog.querySelectorAll('pre, code, span'); codeElements.forEach(element => { if (element.textContent && element.textContent.includes('huggingface.co')) { if (element.innerHTML.includes('huggingface.co')) { element.innerHTML = element.innerHTML.replace(/huggingface.co/g, 'aifasthub.com'); } else { element.textContent = element.textContent.replace(/huggingface.co/g, 'aifasthub.com'); } } }); } // 更精确地定位克隆命令中的域名 document.querySelectorAll('[data-target]').forEach(container => { const codeBlocks = container.querySelectorAll('pre, code, span.hljs-string'); codeBlocks.forEach(block => { if (block.textContent && block.textContent.includes('huggingface.co')) { if (block.innerHTML.includes('huggingface.co')) { block.innerHTML = block.innerHTML.replace(/huggingface.co/g, 'aifasthub.com'); } else { block.textContent = block.textContent.replace(/huggingface.co/g, 'aifasthub.com'); } } }); }); } catch (e) { // 错误处理但不打印日志 } } // 当DOM加载完成后执行替换 if (document.readyState === 'loading') { document.addEventListener('DOMContentLoaded', () => { replaceHeaderBranding(); replaceNavigationLinks(); replaceCodeDomains(); // 只在必要时执行替换 - 3秒后再次检查 setTimeout(() => { if (!window._navLinksReplaced) { console.log('[Client] 3秒后重新检查导航链接'); replaceNavigationLinks(); } }, 3000); }); } else { replaceHeaderBranding(); replaceNavigationLinks(); replaceCodeDomains(); // 只在必要时执行替换 - 3秒后再次检查 setTimeout(() => { if (!window._navLinksReplaced) { console.log('[Client] 3秒后重新检查导航链接'); replaceNavigationLinks(); } }, 3000); } // 增加一个MutationObserver来处理可能的动态元素加载 const observer = new MutationObserver(mutations => { // 检查是否导航区域有变化 const hasNavChanges = mutations.some(mutation => { // 检查是否存在header或nav元素变化 return Array.from(mutation.addedNodes).some(node => { if (node.nodeType === Node.ELEMENT_NODE) { // 检查是否是导航元素或其子元素 if (node.tagName === 'HEADER' || node.tagName === 'NAV' || node.querySelector('header, nav')) { return true; } // 检查是否在导航元素内部 let parent = node.parentElement; while (parent) { if (parent.tagName === 'HEADER' || parent.tagName === 'NAV') { return true; } parent = parent.parentElement; } } return false; }); }); // 只在导航区域有变化时执行替换 if (hasNavChanges) { // 重置替换状态,允许再次替换 window._navLinksReplaced = false; replaceHeaderBranding(); replaceNavigationLinks(); } }); // 开始观察document.body的变化,包括子节点 if (document.body) { observer.observe(document.body, { childList: true, subtree: true }); } else { document.addEventListener('DOMContentLoaded', () => { observer.observe(document.body, { childList: true, subtree: true }); }); } })(); \n\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076025,"cells":{"text":{"kind":"string","value":"# -*- coding: utf-8 -*-\n\nimport os\n\nimport argparse\n\nimport markdoc\nfrom markdoc.config import Config\n\n\nparser = argparse.ArgumentParser(**{\n 'prog': 'markdoc',\n 'description': 'A lightweight Markdown-based wiki build tool.',\n})\n\nparser.add_argument('-v', '--version', action='version',\n version=markdoc.__version__)\n\nconfig = parser.add_argument('--config', '-c', default=os.getcwd(),\n help=\"Use the specified Markdoc config (a YAML file or a directory \"\n \"containing markdoc.yaml)\")\n\nlog_level = parser.add_argument('--log-level', '-l', metavar='LEVEL',\n default='INFO', choices='DEBUG INFO WARN ERROR'.split(),\n help=\"Choose a log level from DEBUG, INFO (default), WARN or ERROR\")\n\nquiet = parser.add_argument('--quiet', '-q',\n action='store_const', dest='log_level', const='ERROR',\n help=\"Alias for --log-level ERROR\")\n\nverbose = parser.add_argument('--verbose',\n action='store_const', dest='log_level', const='DEBUG',\n help=\"Alias for --log-level DEBUG\")\n\nsubparsers = parser.add_subparsers(dest='command', title='commands', metavar='COMMAND')\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076026,"cells":{"text":{"kind":"string","value":"# -*- coding: utf-8 -*-\n\nimport logging\nimport os\nimport argparse\n\nfrom markdoc.cli import commands\nfrom markdoc.cli.parser import parser\nfrom markdoc.config import Config, ConfigNotFound\n\n\ndef main(cmd_args=None):\n \"\"\"The main entry point for running the Markdoc CLI.\"\"\"\n \n if cmd_args is not None:\n args = parser.parse_args(cmd_args)\n else:\n args = parser.parse_args()\n \n if args.command != 'init':\n try:\n args.config = os.path.abspath(args.config)\n \n if os.path.isdir(args.config):\n config = Config.for_directory(args.config)\n elif os.path.isfile(args.config):\n config = Config.for_file(args.config)\n else:\n raise ConfigNotFound(\"Couldn't locate Markdoc config.\")\n except ConfigNotFound, exc:\n parser.error(str(exc))\n else:\n config = None\n \n logging.getLogger('markdoc').setLevel(getattr(logging, args.log_level))\n \n command = getattr(commands, args.command.replace('-', '_'))\n return command(config, args)\n\n\nif __name__ == '__main__':\n main()\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076027,"cells":{"text":{"kind":"string","value":"# -*- coding: utf-8 -*-\n\nimport codecs\nfrom functools import wraps\nimport logging\nimport os\nimport os.path as p\nimport pprint\nimport re\nimport shutil\nimport subprocess\nimport sys\n\nimport markdoc\nfrom markdoc.builder import Builder\nfrom markdoc.cli.parser import subparsers\n\n\ndef command(function):\n \"\"\"Decorator/wrapper to declare a function as a Markdoc CLI task.\"\"\"\n \n cmd_name = function.__name__.replace('_', '-')\n help = (function.__doc__ or '').rstrip('.') or None\n parser = subparsers.add_parser(cmd_name, help=help)\n \n @wraps(function)\n def wrapper(config, args):\n logging.getLogger('markdoc').debug('Running markdoc.%s' % cmd_name)\n return function(config, args)\n wrapper.parser = parser\n \n return wrapper\n\n\n## Utilities\n\n@command\ndef show_config(config, args):\n \"\"\"Pretty-print the current Markdoc configuration.\"\"\"\n \n pprint.pprint(config)\n\n\n@command\ndef init(_, args):\n \"\"\"Initialize a new Markdoc repository.\"\"\"\n \n log = logging.getLogger('markdoc.init')\n \n if not args.destination:\n log.info('No destination specified; using current directory')\n destination = os.getcwd()\n else:\n destination = p.abspath(args.destination)\n \n if p.exists(destination) and os.listdir(destination):\n init.parser.error(\"destination isn't empty\")\n elif not p.exists(destination):\n log.debug('makedirs %s' % destination)\n os.makedirs(destination)\n elif not p.isdir(destination):\n init.parser.error(\"destination isn't a directory\")\n \n log.debug('mkdir %s/.templates/' % destination)\n os.makedirs(p.join(destination, '.templates'))\n log.debug('mkdir %s/static/' % destination)\n os.makedirs(p.join(destination, 'static'))\n log.debug('mkdir %s/wiki/' % destination)\n os.makedirs(p.join(destination, 'wiki'))\n \n log.debug('Creating markdoc.yaml file')\n config_filename = p.join(destination, 'markdoc.yaml')\n fp = open(config_filename, 'w')\n try:\n fp.write('{}\\n')\n finally:\n fp.close()\n \n if args.vcs_ignore:\n config = markdoc.config.Config.for_directory(destination)\n args = vcs_ignore.parser.parse_args([args.vcs_ignore])\n vcs_ignore(config, args)\n \n log.info('Wiki initialization complete')\n log.info('Your new wiki is at: %s' % destination)\n\ninit.parser.add_argument('destination', default=None,\n help=\"Create wiki here (if omitted, defaults to current directory)\")\ninit.parser.add_argument('--vcs-ignore', choices=['hg', 'git', 'cvs', 'bzr'],\n help=\"Create an ignore file for the specified VCS.\")\n\n\n@command\ndef vcs_ignore(config, args):\n \"\"\"Create a VCS ignore file for a wiki.\"\"\"\n \n log = logging.getLogger('markdoc.vcs-ignore')\n log.debug('Creating ignore file for %s' % args.vcs)\n wiki_root = config['meta.root'] # shorter local alias.\n \n ignore_file_lines = []\n ignore_file_lines.append(p.relpath(config.html_dir, start=wiki_root))\n ignore_file_lines.append(p.relpath(config.temp_dir, start=wiki_root))\n if args.vcs == 'hg':\n ignore_file_lines.insert(0, 'syntax: glob')\n ignore_file_lines.insert(1, '')\n \n if args.output == '-':\n log.debug('Writing ignore file to stdout')\n fp = sys.stdout\n else:\n if not args.output:\n filename = p.join(wiki_root, '.%signore' % args.vcs)\n else:\n filename = p.join(wiki_root, args.output)\n log.info('Writing ignore file to %s' % p.relpath(filename, start=wiki_root))\n fp = open(filename, 'w')\n \n try:\n fp.write('\\n'.join(ignore_file_lines) + '\\n')\n finally:\n if fp is not sys.stdout:\n fp.close()\n \n log.debug('Ignore file written.')\n\nvcs_ignore.parser.add_argument('vcs', default='hg', nargs='?',\n choices=['hg', 'git', 'cvs', 'bzr'],\n help=\"Create ignore file for specified VCS (default 'hg')\")\nvcs_ignore.parser.add_argument('-o', '--output', default=None, metavar='FILENAME',\n help=\"Write output to the specified filename, relative to the wiki root. \"\n \"Default is to generate the filename from the VCS. \"\n \"'-' will write to stdout.\")\n\n\n## Cleanup\n\n@command\ndef clean_html(config, args):\n \"\"\"Clean built HTML from the HTML root.\"\"\"\n \n log = logging.getLogger('markdoc.clean-html')\n \n if p.exists(config.html_dir):\n log.debug('rm -Rf %s' % config.html_dir)\n shutil.rmtree(config.html_dir)\n \n log.debug('makedirs %s' % config.html_dir)\n os.makedirs(config.html_dir)\n\n\n@command\ndef clean_temp(config, args):\n \"\"\"Clean built HTML from the temporary directory.\"\"\"\n \n log = logging.getLogger('markdoc.clean-temp')\n \n if p.exists(config.temp_dir):\n log.debug('rm -Rf %s' % config.temp_dir)\n shutil.rmtree(config.temp_dir)\n \n log.debug('makedirs %s' % config.temp_dir)\n os.makedirs(config.temp_dir)\n\n\n## Synchronization\n\n@command\ndef sync_static(config, args):\n \"\"\"Sync static files into the HTML root.\"\"\"\n \n log = logging.getLogger('markdoc.sync-static')\n \n if not p.exists(config.html_dir):\n log.debug('makedirs %s' % config.html_dir)\n os.makedirs(config.html_dir)\n \n command = ('rsync -vaxq --cvs-exclude --ignore-errors --include=.htaccess --exclude=.* --exclude=_*').split()\n display_cmd = command[:]\n \n if config['use-default-static']:\n # rsync needs the paths to have trailing slashes to work correctly.\n command.append(p.join(markdoc.default_static_dir, ''))\n display_cmd.append(p.basename(markdoc.default_static_dir) + '/')\n \n if not config['cvs-exclude']:\n command.remove('--cvs-exclude')\n display_cmd.remove('--cvs-exclude')\n \n if p.isdir(config.static_dir):\n command.append(p.join(config.static_dir, ''))\n display_cmd.append(p.basename(config.static_dir) + '/')\n \n command.append(p.join(config.html_dir, ''))\n display_cmd.append(p.basename(config.html_dir) + '/')\n \n log.debug(subprocess.list2cmdline(display_cmd))\n \n subprocess.check_call(command)\n \n log.debug('rsync completed')\n\n\n@command\ndef sync_html(config, args):\n \"\"\"Sync built HTML and static media into the HTML root.\"\"\"\n \n log = logging.getLogger('markdoc.sync-html')\n \n if not p.exists(config.html_dir):\n log.debug('makedirs %s' % config.html_dir)\n os.makedirs(config.html_dir)\n \n command = ('rsync -vaxq --cvs-exclude --delete --ignore-errors --include=.htaccess --exclude=.* --exclude=_*').split()\n display_cmd = command[:]\n \n # rsync needs the paths to have trailing slashes to work correctly.\n command.append(p.join(config.temp_dir, ''))\n display_cmd.append(p.basename(config.temp_dir) + '/')\n \n if config['use-default-static']:\n command.append(p.join(markdoc.default_static_dir, ''))\n display_cmd.append(p.basename(markdoc.default_static_dir) + '/')\n \n if not config['cvs-exclude']:\n command.remove('--cvs-exclude')\n display_cmd.remove('--cvs-exclude')\n \n if p.isdir(config.static_dir):\n command.append(p.join(config.static_dir, ''))\n display_cmd.append(p.basename(config.static_dir) + '/')\n \n command.append(p.join(config.html_dir, ''))\n display_cmd.append(p.basename(config.html_dir) + '/')\n \n log.debug(subprocess.list2cmdline(display_cmd))\n \n subprocess.check_call(command)\n \n log.debug('rsync completed')\n\n\n## Building\n\n@command\ndef build(config, args):\n \"\"\"Compile wiki to HTML and sync to the HTML root.\"\"\"\n \n log = logging.getLogger('markdoc.build')\n \n clean_temp(config, args)\n \n builder = Builder(config)\n for rel_filename in builder.walk():\n html = builder.render_document(rel_filename)\n out_filename = p.join(config.temp_dir,\n p.splitext(rel_filename)[0] + p.extsep + 'html')\n \n if not p.exists(p.dirname(out_filename)):\n log.debug('makedirs %s' % p.dirname(out_filename))\n os.makedirs(p.dirname(out_filename))\n \n log.debug('Creating %s' % p.relpath(out_filename, start=config.temp_dir))\n fp = codecs.open(out_filename, 'w', encoding='utf-8')\n try:\n fp.write(html)\n finally:\n fp.close()\n \n sync_html(config, args)\n build_listing(config, args)\n\n\n@command\ndef build_listing(config, args):\n \"\"\"Create listings for all directories in the HTML root (post-build).\"\"\"\n \n log = logging.getLogger('markdoc.build-listing')\n \n list_basename = config['listing-filename']\n builder = Builder(config)\n generate_listing = config.get('generate-listing', 'always').lower()\n always_list = True\n if generate_listing == 'never':\n log.debug(\"No listing generated (generate-listing == never)\")\n return # No need to continue.\n \n for fs_dir, _, _ in os.walk(config.html_dir):\n index_file_exists = any([\n p.exists(p.join(fs_dir, 'index.html')),\n p.exists(p.join(fs_dir, 'index'))])\n \n directory = '/' + '/'.join(p.relpath(fs_dir, start=config.html_dir).split(p.sep))\n if directory == '/' + p.curdir:\n directory = '/'\n \n if (generate_listing == 'sometimes') and index_file_exists:\n log.debug(\"No listing generated for %s\" % directory)\n continue\n \n log.debug(\"Generating listing for %s\" % directory)\n listing = builder.render_listing(directory)\n list_filename = p.join(fs_dir, list_basename)\n \n fp = codecs.open(list_filename, 'w', encoding='utf-8')\n try:\n fp.write(listing)\n finally:\n fp.close()\n \n if not index_file_exists:\n log.debug(\"cp %s/%s %s/%s\" % (directory, list_basename, directory, 'index.html'))\n shutil.copyfile(list_filename, p.join(fs_dir, 'index.html'))\n\n\n## Serving\n\nIPV4_RE = re.compile(r'^(25[0-5]|2[0-4]\\d|[0-1]?\\d?\\d)(\\.(25[0-5]|2[0-4]\\d|[0-1]?\\d?\\d)){3}$')\n\n@command\ndef serve(config, args):\n \"\"\"Serve the built HTML from the HTML root.\"\"\"\n \n # This should be a lazy import, otherwise it'll slow down the whole CLI.\n from markdoc.wsgi import MarkdocWSGIApplication\n \n log = logging.getLogger('markdoc.serve')\n app = MarkdocWSGIApplication(config)\n \n config['server.port'] = args.port\n config['server.num-threads'] = args.num_threads\n if args.server_name:\n config['server.name'] = args.server_name\n config['server.request-queue-size'] = args.queue_size\n config['server.timeout'] = args.timeout\n if args.interface:\n if not IPV4_RE.match(args.interface):\n serve.parser.error('invalid interface specifier: %r' % args.interface)\n config['server.bind'] = args.interface\n \n server = config.server_maker()(app)\n \n try:\n log.info('Serving on http://%s:%d' % server.bind_addr)\n server.start()\n except KeyboardInterrupt:\n log.debug('Interrupted')\n finally:\n log.info('Shutting down gracefully')\n server.stop()\n\nserve.parser.add_argument('-p', '--port', type=int, default=8008,\n help=\"Listen on specified port (default is 8008)\")\nserve.parser.add_argument('-i', '--interface', default=None,\n help=\"Bind to specified interface (defaults to loopback only)\")\nserve.parser.add_argument('-t', '--num-threads', type=int, default=10, metavar='N',\n help=\"Use N threads to handle requests (default is 10)\")\nserve.parser.add_argument('-n', '--server-name', default=None, metavar='NAME',\n help=\"Use an explicit server name (default to an autodetected value)\")\nserve.parser.add_argument('-q', '--queue-size', type=int, default=5, metavar='SIZE',\n help=\"Set request queue size (default is 5)\")\nserve.parser.add_argument('--timeout', type=int, default=10,\n help=\"Set the socket timeout for connections (default is 10)\")\n\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076028,"cells":{"text":{"kind":"string","value":"# -*- coding: utf-8 -*-\n\nfrom builder_fixture import setup_test, teardown_test\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076029,"cells":{"text":{"kind":"string","value":"# -*- coding: utf-8 -*-\n\nfrom builder_fixture import setup_test, teardown_test\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076030,"cells":{"text":{"kind":"string","value":"# -*- coding: utf-8 -*-\n\nimport os.path as p\n\nfrom common import get_temporary_config, clean_temporary_config\n\n\ndef setup_test(test):\n test.globs['CONFIG'] = get_temporary_config()\n test.globs['WIKI_ROOT'] = p.join(test.globs['CONFIG']['meta.root'], '')\n\n\ndef teardown_test(test):\n clean_temporary_config(test.globs['CONFIG'])\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076031,"cells":{"text":{"kind":"string","value":" >>> import os.path as p\n >>> from markdoc.builder import Builder, get_title\n >>> b = Builder(CONFIG)\n\nFilesystem Interaction\n======================\n\nYou can generate breadcrumbs for a document, based on its absolute path (which will be relativized to the wiki root):\n\n >>> b.crumbs(p.join(WIKI_ROOT, 'wiki', 'index.md'))\n [('index', None)]\n \n >>> b.crumbs(p.join(WIKI_ROOT, 'wiki', 'somefile.md'))\n [('index', '/'), ('somefile', None)]\n \n >>> b.crumbs(p.join(WIKI_ROOT, 'wiki', 'somedir', 'index.md'))\n [('index', '/'), ('somedir', None)]\n \n >>> b.crumbs(p.join(WIKI_ROOT, 'wiki', 'somedir', 'something.md'))\n [('index', '/'), ('somedir', '/somedir/'), ('something', None)]\n\nYou can also just use relative paths (relative to `WIKI_ROOT/wiki`):\n\n >>> b.crumbs('index.md')\n [('index', None)]\n \n >>> b.crumbs('somefile.md')\n [('index', '/'), ('somefile', None)]\n \n >>> b.crumbs(p.join('somedir', 'index.md'))\n [('index', '/'), ('somedir', None)]\n \n >>> b.crumbs(p.join('somedir', 'something.md'))\n [('index', '/'), ('somedir', '/somedir/'), ('something', None)]\n\nYou can also walk through all files in the wiki, using the `walk()` method:\n\n >>> import os\n >>> for filepath in b.walk():\n ... print filepath\n an_empty_file.md\n file1.md\n file2.md\n file3.md\n subdir/hello.md\n\nRendering\n=========\n\nYou can render documents with the `Builder.render()` method:\n\n >>> b.render('file1.md')\n u'

Hello

'\n >>> b.render('file2.md')\n u'

World

'\n >>> b.render('file3.md')\n u'

Foo

'\n\nTitles\n------\n\nThe `get_title()` function deals with retrieving titles from files. Initially, the file content itself is used to try to get a title. Either text in a specially formatted HTML comment, like this:\n\n >>> get_title(None, '')\n 'Some Title'\n\nOr the first `

` element:\n\n >>> get_title(None, '

Some Title

')\n 'Some Title'\n\nIf those both fail, the filename is used to produce a title:\n\n >>> get_title('some_title.arbitraryextension', '')\n 'Some Title'\n\nSince this is linked to the documents themselves, you can use the `title()` method on the builder instance to get the title for a given document:\n\n >>> b.title('file1.md')\n u'Hello'\n >>> b.title('file2.md')\n u'World'\n >>> b.title('file3.md')\n u'Foo'\n >>> b.title('an_empty_file.md')\n 'An Empty File'\n\nDocuments\n---------\n\nYou can render whole documents using `Builder.render_document()`:\n\n >>> print b.render_document('file1.md')\n \n \n \n \n Hello\n \n \n \n

Hello

\n \n \n \n >>> print b.render_document('file2.md')\n \n \n \n \n World\n \n \n \n

World

\n \n \n\nThis uses the `document.html` Jinja2 template, by default located in `WIKI_ROOT/.templates/`, to produce the documents.\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076032,"cells":{"text":{"kind":"string","value":"Set up the document cache with a 'root' directory:\n\n >>> import os\n >>> from markdoc.cache import DocumentCache\n >>> cache = DocumentCache(base=CONFIG.wiki_dir)\n\nYou can fetch files from the document cache:\n\n >>> cache.get('file1.md')\n u'# Hello\\n'\n >>> cache.get('file2.md')\n u'# World\\n'\n >>> cache.get('file3.md')\n u'# Foo\\n'\n\nThe contents of these files will then be cached:\n\n >>> print sorted(cache.relative(path) for path in cache.cache)\n ['file1.md', 'file2.md', 'file3.md']\n\nYou can also fetch them without using the cache:\n\n >>> cache.cache.clear()\n >>> cache.cache\n {}\n \n >>> cache.get('file1.md', cache=False)\n u'# Hello\\n'\n >>> cache.get('file2.md', cache=False)\n u'# World\\n'\n >>> cache.get('file3.md', cache=False)\n u'# Foo\\n'\n \n >>> cache.cache\n {}\n\nYou can force the document cache to refresh its cached content for each of these files:\n\n >>> cache.refresh_cache('file1.md')\n >>> cache.refresh_cache('file2.md')\n >>> cache.refresh_cache('file3.md')\n \n >>> len(cache.cache)\n 3\n\nAnd then make sure they actually *have* updated to the latest version:\n\n >>> cache.has_latest_version('file1.md')\n True\n >>> cache.has_latest_version('file2.md')\n True\n >>> cache.has_latest_version('file3.md')\n True\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076033,"cells":{"text":{"kind":"string","value":"To generate listings, we first need to build the wiki.\n\n >>> from markdoc.cli.main import main\n >>> try:\n ... main(['-c', WIKI_ROOT, '--quiet', 'build'])\n ... except SystemExit, exc:\n ... assert exc.code != 0, \"An error occurred building the wiki\"\n\nThe wiki should now be built in the HTML root:\n\n >>> import os\n >>> import os.path as p\n >>> print '\\n'.join(os.listdir(CONFIG.html_dir))\n _list.html\n an_empty_file.html\n example.css\n file1.html\n file2.html\n file3.html\n index.html\n subdir\n\nNow we can try getting some listings. The bulk of the process occurs in the `Builder.listing_context()` method, which builds a template context dictionary for rendering the Jinja2 `listing.html` template. First we have to get a `Builder` instance:\n\n >>> from markdoc.builder import Builder\n >>> b = Builder(CONFIG)\n\nNow we can get the listing for the HTML root itself, just by passing the empty string:\n\n >>> import pprint\n >>> pprint.pprint(b.listing_context('')) # doctest: +ELLIPSIS\n {'directory': '',\n 'files': [{'basename': 'example.css',\n 'href': '/example.css',\n 'humansize': '27B',\n 'size': 27,\n 'slug': 'example'}],\n 'make_relative': at 0x...>,\n 'pages': [{'basename': 'an_empty_file.html',\n 'href': '/an_empty_file',\n 'humansize': '248B',\n 'size': 248,\n 'slug': 'an_empty_file',\n 'title': 'An Empty File'},\n {'basename': 'file3.html',\n 'href': '/file3',\n 'humansize': '250B',\n 'size': 250,\n 'slug': 'file3',\n 'title': u'Foo'},\n {'basename': 'file1.html',\n 'href': '/file1',\n 'humansize': '254B',\n 'size': 254,\n 'slug': 'file1',\n 'title': u'Hello'},\n {'basename': 'file2.html',\n 'href': '/file2',\n 'humansize': '254B',\n 'size': 254,\n 'slug': 'file2',\n 'title': u'World'}],\n 'sub_directories': [{'basename': 'subdir', 'href': '/subdir/'}]}\n\nWe can also get the listings for subdirectories, by passing in their paths, relative to the HTML root:\n\n >>> pprint.pprint(b.listing_context('/subdir')) # doctest: +ELLIPSIS\n {'directory': 'subdir',\n 'files': [],\n 'make_relative': at 0x...>,\n 'pages': [{'basename': 'hello.html',\n 'href': '/subdir/hello',\n 'humansize': '268B',\n 'size': 268,\n 'slug': 'hello',\n 'title': u'Hello again.'}],\n 'sub_directories': []}\n\nNote that these paths are always '/'-delimited, since they are taken to be URL paths and not filesystem paths.\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076034,"cells":{"text":{"kind":"string","value":" >>> from markdoc.config import Config\n >>> EXAMPLE_KEY = '9d03e32c6cb1455388a170e3bb0c2030'\n >>> EXAMPLE_VALUE = '7010d5d5871143d089cb662cb540cbd5'\n\nYou can make a config based on a directory (which will usually be a wiki root):\n\n >>> dir_config = Config.for_directory(WIKI_ROOT)\n >>> dir_config[EXAMPLE_KEY] == EXAMPLE_VALUE\n True\n\nYou can also make one based on a YAML filename:\n\n >>> import os.path as p\n >>> file_config = Config.for_file(p.join(WIKI_ROOT, 'markdoc.yaml'))\n >>> file_config[EXAMPLE_KEY] == EXAMPLE_VALUE\n True\n\nAnd if you like, you can make a complete config manually:\n\n >>> config_dict = {\n ... 'meta': {'root': WIKI_ROOT},\n ... EXAMPLE_KEY: EXAMPLE_VALUE\n ... }\n >>> manual_config = Config(p.join(WIKI_ROOT, 'markdoc.yaml'), config_dict)\n >>> manual_config[EXAMPLE_KEY] == EXAMPLE_VALUE\n True\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076035,"cells":{"text":{"kind":"string","value":"First we have to set up a Python function for running the command-line tool. Since the main entry point is the `markdoc.cli.main.main()` function, we can just call that directly, with some defaults for the current wiki root:\n\n >>> import os\n >>> import os.path as p\n >>> from markdoc.cli.main import main\n >>> def markdoc(*args):\n ... try:\n ... main(['-c', WIKI_ROOT] + list(args))\n ... except SystemExit, exc:\n ... return exc.code\n ... return 0\n\nThe `show-config` command will show the current Markdoc config:\n\n >>> exit_code = markdoc('show-config') # doctest: +ELLIPSIS\n {'9d03e32c6cb1455388a170e3bb0c2030': '7010d5d5871143d089cb662cb540cbd5',\n 'hide-prefix': '_',\n 'meta.config-file': '.../example/markdoc.yaml',\n 'meta.root': '.../example',\n 'use-default-static': False,\n 'use-default-templates': False}\n\n >>> exit_code\n 0\n\n`sync-static` will compile the wiki's static media into the HTML root:\n\n >>> markdoc('--quiet', 'sync-static') # doctest: +ELLIPSIS\n 0\n\nIf you leave out the `--quiet` option, Markdoc will print some additional logging information, including the `rsync` command that's run in the background; the rsync output itself will also be written to the terminal.\n\nThe static media will now be in the HTML root:\n\n >>> os.listdir(CONFIG.html_dir)\n ['example.css']\n\nThere are three other commands -- `clean-html`, `clean-temp`, and `sync-html` -- which are used in the background by the `build` task. `markdoc build` will compile all the HTML, and then synchronize both built HTML and static media into the HTML root (usually `WIKI_ROOT/.html`).\n\n >>> markdoc('--quiet', 'build')\n 0\n \n >>> print '\\n'.join(sorted(os.listdir(CONFIG.html_dir)))\n _list.html\n an_empty_file.html\n example.css\n file1.html\n file2.html\n file3.html\n index.html\n subdir\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076036,"cells":{"text":{"kind":"string","value":"# -*- coding: utf-8 -*-\n\nfrom builder_fixture import setup_test, teardown_test\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076037,"cells":{"text":{"kind":"string","value":"# -*- coding: utf-8 -*-\n\nimport os.path as p\nimport shutil\nimport tempfile\n\nfrom markdoc.config import Config\n\n\ndef get_temporary_config():\n \n \"\"\"\n Return a temporary Markdoc configuration.\n \n The contents of the wiki will be copied from the example Markdoc wiki. After\n you're done with this, you should call `clean_temporary_config()` on the\n config object.\n \"\"\"\n \n own_config_dir = p.join(p.dirname(p.abspath(__file__)), 'example') + p.sep\n temp_config_dir = p.join(tempfile.mkdtemp(), 'example')\n shutil.copytree(own_config_dir, temp_config_dir)\n return Config.for_directory(temp_config_dir)\n\n\ndef clean_temporary_config(config):\n \"\"\"Delete a temporary configuration's wiki root.\"\"\"\n \n shutil.rmtree(p.dirname(config['meta.root']))\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076038,"cells":{"text":{"kind":"string","value":"# -*- coding: utf-8 -*-\n\nimport os.path as p\n\n\ndef setup_test(test):\n test.globs['WIKI_ROOT'] = p.join(p.dirname(p.abspath(__file__)), 'example')\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076039,"cells":{"text":{"kind":"string","value":"hide-prefix: \"_\"\nuse-default-templates: no\nuse-default-static: no\n9d03e32c6cb1455388a170e3bb0c2030: 7010d5d5871143d089cb662cb540cbd5\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076040,"cells":{"text":{"kind":"string","value":"# World\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076041,"cells":{"text":{"kind":"string","value":"# Hello\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076042,"cells":{"text":{"kind":"string","value":"# Foo\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076043,"cells":{"text":{"kind":"string","value":"# Hello again.\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076044,"cells":{"text":{"kind":"string","value":"\n\n\n\n {{ title }}\n \n\n\n {{ content }}\n\n\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076045,"cells":{"text":{"kind":"string","value":"\n\n\n\n ls /{{ directory }}\n \n\n\n \n

Listing for /{{ directory }}

\n \n {% if sub_directories %}\n

Sub-directories

\n \n {% endif %}\n \n {% if pages %}\n

Pages

\n \n {% endif %}\n \n {% if files %}\n

Files

\n \n {% endif %}\n\n\n\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076046,"cells":{"text":{"kind":"string","value":"/* Nothing to see here. */\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076047,"cells":{"text":{"kind":"string","value":"# About Markdoc\n\nMarkdoc is a project which aims to provide a lightweight alternative to large\ndatabase-powered wiki systems. I’ve listed the main goals of the project below;\nI believe that, in its current state, it meets all of these.\n\n\n## Goals & Philosophy\n\n### Wikis\n\n* Wikis should be made up of plain-text files, without requiring a running\n instance of MySQL or even an SQLite database.\n\n* There should only be one simple-to-write plain-text configuration file.\n\n* Wikis should be VCS-friendly, yet VCS-agnostic.\n\n* It should be possible to compile a wiki to static HTML, and then to serve\n this HTML with no wiki-specific software.\n\n\n### Markdown\n\nI chose Markdown as the format for this wiki system because of its simplicity,\nfamiliarity for many writers, and the extensibility of its Python\nimplementation. For example, Pygments syntax highlighting is available through a\nsingle configuration option in the `markdoc.yaml` file. The ability to embed raw\nHTML in Markdown documents gives it power and flexibility.\n\n\n### Command-Line Interface\n\n* The CLI should be intuitive and easy to use.\n\n* There should only be a few different sub-commands, each of which does what\n one would expect it to.\n\n* There should be a full web server included, in the case that setting up a\n large-scale HTTP server is impractical or impossible.\n\n* The CLI should be pure-Python, for portability and extensibility.\n\n\n## License\n\nMarkdoc is [public domain software](http://unlicense.org/).\n\n> This is free and unencumbered software released into the public domain.\n> \n> Anyone is free to copy, modify, publish, use, compile, sell, or distribute\n> this software, either in source code form or as a compiled binary, for any\n> purpose, commercial or non-commercial, and by any means.\n> \n> In jurisdictions that recognize copyright laws, the author or authors of this\n> software dedicate any and all copyright interest in the software to the public\n> domain. We make this dedication for the benefit of the public at large and to\n> the detriment of our heirs and successors. We intend this dedication to be an\n> overt act of relinquishment in perpetuity of all present and future rights to\n> this software under copyright law.\n> \n> THE SOFTWARE IS PROVIDED \"AS IS\", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR\n> IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,\n> FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE\n> AUTHORS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN\n> ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION\n> WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.\n> \n> For more information, please refer to \n\n\nThe bundled Pygments style (it’s the [Github][] syntax highlighting theme) was\ncreated by [Tom Preston-Werner][]; it was sourced from [his blog][] and is\nlicensed under the MIT License:\n\n [github]: http://github.com/\n [tom preston-werner]: http://tom.preston-werner.com/\n [his blog]: http://github.com/mojombo/tpw/\n\n> Copyright © 2010 Tom Preston-Werner\n> \n> Permission is hereby granted, free of charge, to any person\n> obtaining a copy of this software and associated documentation\n> files (the \"Software\"), to deal in the Software without\n> restriction, including without limitation the rights to use,\n> copy, modify, merge, publish, distribute, sublicense, and/or sell\n> copies of the Software, and to permit persons to whom the\n> Software is furnished to do so, subject to the following\n> conditions:\n> \n> The above copyright notice and this permission notice shall be\n> included in all copies or substantial portions of the Software.\n> \n> THE SOFTWARE IS PROVIDED \"AS IS\", WITHOUT WARRANTY OF ANY KIND,\n> EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES\n> OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND\n> NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT\n> HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY,\n> WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING\n> FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR\n> OTHER DEALINGS IN THE SOFTWARE."},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076048,"cells":{"text":{"kind":"string","value":"# Authoring\n\nA wiki would be nothing without pages. In Markdoc, pages are written in\n[Markdown][df-markdown], a plain-text formatting syntax designed by\n[John Gruber][df]. In his own words:\n\n [df]: http://daringfireball.net/\n [df-markdown]: http://daringfireball.net/projects/markdown/\n\n> Markdown allows you to write using an easy-to-read, easy-to-write plain text \n> format, then convert it to structurally valid XHTML (or HTML).\n> \n> [...]\n> \n> The overriding design goal for Markdown’s formatting syntax is to\n> make it as readable as possible. The idea is that a Markdown-formatted\n> document should be publishable as-is, as plain text, without looking\n> like it’s been marked up with tags or formatting instructions.\n\nFor a comprehensive guide to the Markdown syntax, consult the\n[markup reference documentation](/ref/markup). The rest of this document will\ncover the Markdoc-specific conventions and constraints related to writing wiki\npages.\n\n\n## Linking\n\nEvery page in your wiki will likely link to several other pages. Markdoc does\nnot require any special syntax for internal links; the usual Markdown format\nwill work. An example of a link from this very page follows:\n\n :::text\n For a comprehensive guide to the Markdown syntax,\n consult the [markup reference documentation](/ref/markup).\n\nAs you can see, the link href is an absolute path to the document, without any\nextension. Markdoc will process this and convert it into a relative path when\nrendering the corresponding HTML. This means that you can host Markdoc wikis\nunder sub-directories on a web server, and the links will still work properly.\n\nIf you split your wiki up into sub-directories (for example, in this wiki, there\nis an `internals/` directory), the pattern remains the same. A link to the\n[internals/rendering](/internals/rendering) document looks like this:\n\n :::text\n A link to the [internals/rendering](/internals/rendering) document.\n\nNote that links will only be made relative if they begin with a `/` character;\nfor example, a link to `http://www.google.com/` will be left untouched.\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076049,"cells":{"text":{"kind":"string","value":"\n\n# Markdoc\n\nMarkdoc is a lightweight Markdown-based wiki system. It’s been designed to allow\nyou to create and manage wikis as quickly and easily as possible.\n\n\n## What is it good for?\n\nPotential use cases for Markdoc include, but aren’t limited to:\n\nTechnical Documentation/Manuals\n: Markdoc can be used to write and render hand-written guides and manuals for\n software. Such documentation will normally be separate from\n automatically-generated API documentation, and might give a higher-level\n view than API docs alone. It might be used for client documentation for\n web/desktop applications, or even developer documentation for frameworks.\n\nInternal Project Wikis\n: Markdoc wikis consist of a single plain-text file per page. By combining a\n wiki with a DVCS (such as [Mercurial][] or [Git][]), you can collaborate\n with several other people. Use the DVCS to track, share and merge changes\n with one another, and view the wiki’s history.\n \n [Mercurial]: http://mercurial.selenic.com/\n [Git]: http://git-scm.com/\n\nStatic Site Generation\n: Markdoc converts wikis into raw HTML files and media. This allows you to\n manage a blog, personal website or a collection of pages in a Markdoc wiki,\n perhaps with custom CSS styles, and publish the rendered HTML to a website.\n Markdoc need not be installed on the hosting site, since the resultant HTML\n is completely independent.\n\n\n## Cool Features\n\n* Set up [Google Analytics][] tracking in one line of configuration.\n\n* [Barebones][] wikis that just look like directories with Markdown-formatted\n text files in them.\n\n* A built-in HTTP server and WSGI application to serve up a compiled wiki with\n a single command.\n\n* Continuous builds (via `rsync`) mean the server can keep running whilst\n Markdoc re-compiles the wiki. Just refresh your browser to see the changes.\n\n* Add [Pygments][]-powered syntax highlighting to your Markdoc wiki with a\n single [configuration parameter][syntax-highlighting].\n\n* Markdoc is [public domain software][licensing]. It will always be completely\n free to use, and you can redistribute it (in part or in whole) under any\n circumstances (open-source, proprietary or otherwise) with no attribution or\n encumberances.\n\n[google analytics]: /ref/configuration#metadata\n[barebones]: /tips/barebones\n[pygments]: http://pygments.org/\n[syntax-highlighting]: /tips/syntax-highlighting\n[licensing]: /about#license\n\n\n## Where do I start?\n\nThe [quickstart](/quickstart) document has all the information you need to put\ntogether a simple Markdoc wiki. The [authoring](/authoring) guide provides a\nquick introduction to writing Markdoc pages themselves, especially with regards\nto linking between pages.\n\n\n## Reference\n\nSee the [configuration](/ref/configuration) reference for in-depth knowledge on\nwriting your `markdoc.yaml` file. The [layout](/ref/layout) reference describes\nthe basic filesystem layout for a Markdoc wiki, and the [tips](/tips/) directory\ncontains several handy recipes.\n\nThe Markdoc project’s goals and history are described in the [about](/about)\npage. If you’d like to know more about how Markdoc works at a deeper level, take\na look at the [internals directory](/internals/). Developers interested in\nhacking the utility will likely want the [development](/internals/development)\npage.\n\nTo see the complete list of pages in this wiki, you can browse the\n[directory listing](/_list).\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076050,"cells":{"text":{"kind":"string","value":"# Quickstart\n\nThe first step towards using Markdoc is to install it. Luckily, it uses\nsetuptools, so you can install it with relative ease on any system with Python.\nNote that most modern UNIX distributions come with a sufficiently recent version\nof Python, including Mac OS X, Ubuntu (and derivatives) and Fedora.\n\n\n## Requirements\n\nThe minimum requirements to run the Markdoc utility are:\n\n* Python 2.4 or later (2.5+ highly recommended)\n* A UNIX (or at least POSIX-compliant) operating system\n* [rsync](http://www.samba.org/rsync/) — installed out of the box with most\n modern OSes, including Mac OS X and Ubuntu. In the future Markdoc may\n include a pure-Python implementation.\n\n\n## Installation\n\nYou can use either `easy_install` or [pip][] to install Markdoc:\n\n [pip]: http://pip.openplans.org/\n \n :::bash\n $ easy_install Markdoc # OR\n $ pip install Markdoc\n\nNote that you are likely to see a lot of scary-looking output from both\ncommands; nevertheless, you can tell whether installation was successful by\nlooking at the last line of the output. With `easy_install`, this should be:\n\n :::text\n Finished processing dependencies for Markdoc\n\nAnd with `pip install`:\n\n :::text\n Successfully installed ... Markdoc ...\n\n`pip` will list all of the packages it installed, and `Markdoc` should be\namongst them.\n\n\n## Making a Wiki\n\n### Initializing the Wiki\n\nThe `markdoc init` command creates a new wiki. It also accepts a `--vcs-ignore`\noption which will automatically create the appropriate ignore file for your VCS.\n\n :::bash\n $ markdoc init my-wiki --vcs-ignore hg\n markdoc.vcs-ignore: INFO: Writing ignore file to .hgignore\n markdoc.init: INFO: Wiki initialization complete\n markdoc.init: INFO: Your new wiki is at: .../my-wiki\n\nIf you’re using SVN, you have to take a few more steps to set the `svn:ignore`\nproperty on the directory:\n\n :::bash\n $ markdoc init my-wiki --vcs-ignore cvs\n markdoc.vcs-ignore: INFO: Writing ignore file to .cvsignore\n markdoc.init: INFO: Wiki initialization complete\n markdoc.init: INFO: Your new wiki is at: .../my-wiki\n $ cd my-wiki/\n $ svn propset svn:ignore -F .cvsignore\n $ rm .cvsignore\n\n\n### Editing Pages\n\nDocuments in a Markdoc wiki are located under the `wiki/` subdirectory, and are\nplain Markdown files. Typically documents have a `.md` file extension, but in\nthe [wiki configuration](/configuration#building) you can specify others.\n\n :::bash\n $ cd my-wiki/\n $ vim wiki/somefile.md\n # ... write some documents ...\n\n\n### Building\n\nMarkdoc comes with a default set of templates and stylesheets, so you can build\nyour wiki right away. Just run `markdoc build`, and all the HTML will be\ngenerated and output into the `.html/` sub-directory (known as the HTML root).\n\n :::bash\n $ markdoc build\n\n\n### Serving\n\nYou can view all the HTML in a browser easily by running the built-in server.\n`markdoc serve` accepts a large number of options, but on its own will serve\nyour documentation on port 8008.\n\n :::bash\n $ markdoc serve\n markdoc.serve: INFO: Serving on http://127.0.0.1:8008\n\nNow just open in your browser, and see your new\nMarkdoc-powered wiki!\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076051,"cells":{"text":{"kind":"string","value":"# Rendering\n\nThis page will describe the process which documents undergo on their way from Markdoc to XHTML.\n\n## Step 1: Markdown Rendering\n\nEach page is converted from Markdown to XHTML. This uses the Markdown library for Python, which comes with a number of extensions that you can enable in your [configuration](/configuration). For example, I like to use the `codehilite`, `def_list` and `headerid` Markdown extensions, but by default Markdoc wikis will not use any.\n\nThe Markdown conversion results in XHTML data which is not tied to a page, so it’s not enough to display to a browser. That’s where the templating comes in.\n\n## Step 2: Template Rendering\n\nMarkdoc uses [Jinja2][] to render this partial XHTML to full XHTML documents. Jinja2 is a fast and flexible templating system for Python; if you are interested in writing your own templates, it would be wise to first consult its official documentation.\n\n [jinja2]: http://jinja2.pocoo.org\n\nMarkdoc expects only two templates to be defined: `document.html` and `listing.html`. The way it finds these is as follows:\n\n* It first looks for them in the `.templates/` directory inside your wiki.\n* If the `use-default-templates` setting is `true` for your configuration (which it is by default), then search in the `default-templates` directory bundled with Markdoc.\n\nIf `use-default-templates` is `false` and the templates are not defined in your wiki’s template directory, Markdoc will eventually raise an error.\n\n### Documents\n\n`document.html` is used to convert the partial XHTML for a Markdown document into full, browser-ready XHTML. It receives a context much like the following:\n\n :::python\n {\n \"content\": \"

...\", # The XHTML for the document.\n \"title\": \"Some Document\", # The extracted title of the document.\n \"crumbs\": [(\"index\", \"/\"), (\"some-document\", None)] # Breadcrumbs\n }\n\nThe `config` variable is also (globally) set to the configuration dictionary for the current wiki.\n\nTake a look inside the `src/markdoc/static/default-templates/markdoc-default/` directory for examples of complete templates.\n\n### Listings\n\n`listing.html` is used to generate listings for directories. This will only be used if `generate-listing` is set to either `always` or `sometimes` in the configuration (by default it is `always`).\n\nListings are a little more complex to do, so they are generated after the complete set of documents have been rendered and synced (along with static media) to the HTML root. This means you get complete listings for all of your directories, including those which came from static media.\n\nThe `listing.html` template is passed a context like this:\n\n :::python\n {\"directory\": \"somedir\",\n \"crumbs\": [(\"index\", \"/\"),\n (\"somedir\", \"/somedir/\"),\n (jinja2.Markup('list'), None)],\n \"files\": [{\"basename\": \"example.css\",\n \"href\": \"/example.css\",\n \"humansize\": \"27B\",\n \"size\": 27,\n \"slug\": \"example\"}],\n \"pages\": [{\"basename\": \"hello.html\",\n \"href\": \"/subdir/hello\",\n \"humansize\": \"268B\",\n \"size\": 268,\n \"slug\": \"hello\",\n \"title\": u\"Hello again.\"}],\n \"sub_directories\": [{\"basename\": \"subdir\", \"href\": \"/subdir/\"}]}\n\nThe distinction between *files* and *pages* is useful because you can display links to pages with their full titles; if you’re viewing this now in a browser, just head to [/_list](/_list) to see what I mean. The filename which the list is output to can be configured with the `listing-filename` setting; this defaults to `_list.html` (hence `/_list`). You can also try `/media/_list`, et cetera.\n\nThe last crumb is special in that it displays the string `\"list\"` but with a class of `list-crumb`; in the default templates and media this is displayed in a light grey to indicate that it is a special page.\n\nThe semantics of listing generation are determined by the `generate-listing` setting; `always` will always generate a listing (even if it clobbers an existing file called `_list.html`), `sometimes` will only generate a listing when there is no `index.html` file for a directory, and `never` will never generate listings.\n\n## Relative Links\n\nFor portability, all URLs pointing to files and pages within the current Markdoc wiki should be relative. This allows built wiki HTML to be hosted under a sub-directory and still maintain link integrity.\n\nIn practice, this is achieved in two parts:\n\n* A Markdown extension which causes absolute path URLs in links (such as\n `/path/to/somefile`) to be converted to relative ones (like `../somefile`).\n\n* A callable passed to every template context which, when called with an\n absolute path URL, will convert it to a relative one. This variable is\n `make_relative()`, and an example of its use can be seen in this snippet\n from the default base template:\n \n :::text\n \n \n \n {% import \"macros/html\" as html -%}\n \n {{ html.cssimport(make_relative(\"/media/css/reset.css\")) }}\n {{ html.cssimport(make_relative(\"/media/css/layout.css\")) }}\n {{ html.cssimport(make_relative(\"/media/css/typography.css\")) }}\n {{ html.cssimport(make_relative(\"/media/css/pygments.css\")) }}\n \n \n If you override the default templates, make sure to use this callable to \n relativize the media URLs and breadcrumb links.\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076052,"cells":{"text":{"kind":"string","value":"# Development\n\nMarkdoc is actively developed via [GitHub][gh-markdoc].\n\n [gh-markdoc]: http://github.com/zacharyvoase/markdoc\n\n## Working with the Repository\n\nYou’ll need to install [Git][git] first; check your OS’s package manager for a\n`git` or `git-core` package.\n\n [git]: http://git-scm.com/\n\nYou can check out a copy of the repository by cloning it:\n\n :::bash\n $ git clone git://github.com/zacharyvoase/markdoc.git\n $ cd markdoc/\n\n### Repo Structure\n\nThere are several files and directories in the root of the repo:\n\n :::text\n markdoc/\n |-- doc/\n |-- src/\n |-- test/\n |-- UNLICENSE\n |-- MANIFEST.in\n |-- README\n |-- REQUIREMENTS\n |-- distribute_setup.py\n |-- nose.cfg\n `-- setup.py\n\n`doc/`\n: A Markdoc wiki containing Markdoc’s own documentation. How very meta.\n\n`src/`\n: The home of all of Markdoc’s Python code.\n\n`test/`, `nose.cfg`\n: Markdoc’s tests (Python + Doctests) and nose configuration. [Nose][] is a \n Python utility to automate and simplify running complex test suites.\n\n`UNLICENSE`\n: The text of the unlicense which designates Markdoc as public domain software.\n\n`MANIFEST.in`, `setup.py`, `distribute_setup.py`\n: The necessary Python packaging machinery, so you can run\n `easy_install Markdoc`.\n\n`README`\n: Doesn’t need an explanation.\n\n`REQUIREMENTS`\n: A text file listing all of Markdoc’s requirements, suitable for use with\n `pip install -r REQUIREMENTS`. [pip][] is a next-generation `easy_install` \n replacement for Python.\n\n\n [pip]: http://pip.openplans.org/\n [nose]: http://somethingaboutorange.com/mrl/projects/nose/0.11.1/\n\n### Bug Reporting and Feature Requests\n\nAll bugs and feature requests are handled on the [GitHub issues page](http://github.com/zacharyvoase/markdoc/issues).\n\n### Contributing\n\nIf you’re interested in implementing a feature or extension for Markdoc, just fork the GitHub repository, work on the feature, commit your changes, then send me a pull request. If I like what you’ve done, I’ll pull your changes into the official Markdoc release and give you author credit.\n\nRemember that you must be willing to release your changes to the public domain. If you are submitting a non-trivial patch, take a look at [unlicense.org][unlicensing contributions] for detailed instructions; for now, you just need to agree to the following statement:\n\n [unlicensing contributions]: http://unlicense.org/#unlicensing-contributions\n\n :::text\n I dedicate any and all copyright interest in this software to the\n public domain. I make this dedication for the benefit of the public at\n large and to the detriment of my heirs and successors. I intend this\n dedication to be an overt act of relinquishment in perpetuity of all\n present and future rights to this software under copyright law.\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076053,"cells":{"text":{"kind":"string","value":"# Markdown Syntax Guide\n\nAdapted from .\n\n[TOC]\n\n* * *\n\n## Overview\n\n### Philosophy\n\nMarkdown is intended to be as easy-to-read and easy-to-write as is feasible.\n\nReadability, however, is emphasized above all else. A Markdown-formatted\ndocument should be publishable as-is, as plain text, without looking like it's\nbeen marked up with tags or formatting instructions. While Markdown's syntax has\nbeen influenced by several existing text-to-HTML filters -- including\n[Setext] [1], [atx] [2], [Textile] [3], [reStructuredText] [4], [Grutatext] [5],\nand [EtText] [6] -- the single biggest source of inspiration for Markdown's\nsyntax is the format of plain text email.\n\n [1]: http://docutils.sourceforge.net/mirror/setext.html\n [2]: http://www.aaronsw.com/2002/atx/\n [3]: http://textism.com/tools/textile/\n [4]: http://docutils.sourceforge.net/rst.html\n [5]: http://www.triptico.com/software/grutatxt.html\n [6]: http://ettext.taint.org/doc/\n\nTo this end, Markdown's syntax is comprised entirely of punctuation characters,\nwhich punctuation characters have been carefully chosen so as to look like what\nthey mean. E.g., asterisks around a word actually look like \\*emphasis\\*.\nMarkdown lists look like, well, lists. Even blockquotes look like quoted\npassages of text, assuming you've ever used email.\n\n\n\n### Inline HTML\n\nMarkdown's syntax is intended for one purpose: to be used as a format for\n*writing* for the web.\n\nMarkdown is not a replacement for HTML, or even close to it. Its syntax is very\nsmall, corresponding only to a very small subset of HTML tags. The idea is *not*\nto create a syntax that makes it easier to insert HTML tags. In my opinion, HTML\ntags are already easy to insert. The idea for Markdown is to make it easy to\nread, write, and edit prose. HTML is a *publishing* format; Markdown is a\n*writing* format. Thus, Markdown's formatting syntax only addresses issues that\ncan be conveyed in plain text.\n\nFor any markup that is not covered by Markdown's syntax, you simply use HTML\nitself. There's no need to preface it or delimit it to indicate that you're\nswitching from Markdown to HTML; you just use the tags.\n\nThe only restrictions are that block-level HTML elements -- e.g. `
`,\n``, `
`, `

`, etc. -- must be separated from surrounding content by\nblank lines, and the start and end tags of the block should not be indented with\ntabs or spaces. Markdown is smart enough not to add extra (unwanted) `

` tags\naround HTML block-level tags.\n\nFor example, to add an HTML table to a Markdown article:\n\n :::text\n This is a regular paragraph.\n \n

\n \n \n \n
Foo
\n \n This is another regular paragraph.\n\nNote that Markdown formatting syntax is not processed within block-level HTML\ntags. E.g., you can't use Markdown-style `*emphasis*` inside an HTML block.\n\nSpan-level HTML tags -- e.g. ``, ``, or `` -- can be used\nanywhere in a Markdown paragraph, list item, or header. If you want, you can\neven use HTML tags instead of Markdown formatting; e.g. if you'd prefer to use\nHTML `` or `` tags instead of Markdown's link or image syntax, go right\nahead.\n\nUnlike block-level HTML tags, Markdown syntax *is* processed within span-level\ntags.\n\n\n### Automatic Escaping for Special Characters\n\nIn HTML, there are two characters that demand special treatment: `<` and `&`.\nLeft angle brackets are used to start tags; ampersands are used to denote HTML\nentities. If you want to use them as literal characters, you must escape them as\nentities, e.g. `&lt;`, and `&amp;`.\n\nAmpersands in particular are bedeviling for web writers. If you want to write\nabout 'AT&T', you need to write '`AT&amp;T`'. You even need to escape ampersands\nwithin URLs. Thus, if you want to link to:\n\n :::text\n http://images.google.com/images?num=30&q=larry+bird\n\nyou need to encode the URL as:\n\n :::text\n http://images.google.com/images?num=30&amp;q=larry+bird\n\nin your anchor tag `href` attribute. Needless to say, this is easy to forget,\nand is probably the single most common source of HTML validation errors in\notherwise well-marked-up web sites.\n\nMarkdown allows you to use these characters naturally, taking care of all the\nnecessary escaping for you. If you use an ampersand as part of an HTML entity,\nit remains unchanged; otherwise it will be translated into `&amp;`.\n\nSo, if you want to include a copyright symbol in your article, you can write:\n\n :::text\n &copy;\n\nand Markdown will leave it alone. But if you write:\n\n :::text\n AT&T\n\nMarkdown will translate it to:\n\n :::text\n AT&amp;T\n\nSimilarly, because Markdown supports [inline HTML](#inline-html), if you use\nangle brackets as delimiters for HTML tags, Markdown will treat them as such.\nBut if you write:\n\n :::text\n 4 < 5\n\nMarkdown will translate it to:\n\n :::text\n 4 &lt; 5\n\nHowever, inside Markdown code spans and blocks, angle brackets and ampersands\nare *always* encoded automatically. This makes it easy to use Markdown to write\nabout HTML code. (As opposed to raw HTML, which is a terrible format for writing\nabout HTML syntax, because every single `<` and `&` in your example code needs\nto be escaped.)\n\n\n* * *\n\n\n## Block Elements\n\n\n### Paragraphs and Line Breaks\n\nA paragraph is simply one or more consecutive lines of text, separated by one or\nmore blank lines. (A blank line is any line that looks like a blank line -- a\nline containing nothing but spaces or tabs is considered blank.) Normal\nparagraphs should not be indented with spaces or tabs.\n\nThe implication of the \"one or more consecutive lines of text\" rule is that\nMarkdown supports \"hard-wrapped\" text paragraphs. This differs significantly\nfrom most other text-to-HTML formatters (including Movable Type's \"Convert Line\nBreaks\" option) which translate every line break character in a paragraph into a\n`
` tag.\n\nWhen you *do* want to insert a `
` break tag using Markdown, you end a line\nwith two or more spaces, then type return.\n\nYes, this takes a tad more effort to create a `
`, but a simplistic \"every\nline break is a `
`\" rule wouldn't work for Markdown. Markdown's\nemail-style [blockquoting][bq] and multi-paragraph [list items][l] work best --\nand look better -- when you format them with hard breaks.\n\n [bq]: #blockquote\n [l]: #list\n\n\n\n### Headers\n\nMarkdown supports two styles of headers, [Setext] [1] and [atx] [2].\n\nSetext-style headers are \"underlined\" using equal signs (for first-level\nheaders) and dashes (for second-level headers). For example:\n\n :::text\n This is an H1\n =============\n \n This is an H2\n -------------\n\nAny number of underlining `=`'s or `-`'s will work.\n\nAtx-style headers use 1-6 hash characters at the start of the line,\ncorresponding to header levels 1-6. For example:\n\n :::text\n # This is an H1\n \n ## This is an H2\n \n ###### This is an H6\n\nOptionally, you may \"close\" atx-style headers. This is purely cosmetic -- you\ncan use this if you think it looks better. The closing hashes don't even need to\nmatch the number of hashes used to open the header. (The number of opening\nhashes determines the header level.) :\n\n :::text\n # This is an H1 #\n \n ## This is an H2 ##\n \n ### This is an H3 ######\n\n\n### Blockquotes\n\nMarkdown uses email-style `>` characters for blockquoting. If you're familiar\nwith quoting passages of text in an email message, then you know how to create a\nblockquote in Markdown. It looks best if you hard wrap the text and put a `>`\nbefore every line:\n\n :::text\n > This is a blockquote with two paragraphs. Lorem ipsum dolor sit amet,\n > consectetuer adipiscing elit. Aliquam hendrerit mi posuere lectus.\n > Vestibulum enim wisi, viverra nec, fringilla in, laoreet vitae, risus.\n > \n > Donec sit amet nisl. Aliquam semper ipsum sit amet velit. Suspendisse\n > id sem consectetuer libero luctus adipiscing.\n\nMarkdown allows you to be lazy and only put the `>` before the first line of a\nhard-wrapped paragraph:\n\n :::text\n > This is a blockquote with two paragraphs. Lorem ipsum dolor sit amet,\n consectetuer adipiscing elit. Aliquam hendrerit mi posuere lectus.\n Vestibulum enim wisi, viverra nec, fringilla in, laoreet vitae, risus.\n \n > Donec sit amet nisl. Aliquam semper ipsum sit amet velit. Suspendisse\n id sem consectetuer libero luctus adipiscing.\n\nBlockquotes can be nested (i.e. a blockquote-in-a-blockquote) by adding\nadditional levels of `>`:\n\n :::text\n > This is the first level of quoting.\n >\n > > This is nested blockquote.\n >\n > Back to the first level.\n\nBlockquotes can contain other Markdown elements, including headers, lists, and\ncode blocks:\n\n :::text\n > ## This is a header.\n > \n > 1. This is the first list item.\n > 2. This is the second list item.\n > \n > Here's some example code:\n > \n > return shell_exec(\"echo $input | $markdown_script\");\n\nAny decent text editor should make email-style quoting easy. For example, with\nBBEdit, you can make a selection and choose Increase Quote Level from the Text\nmenu.\n\n\n### Lists\n\nMarkdown supports ordered (numbered) and unordered (bulleted) lists.\n\nUnordered lists use asterisks, pluses, and hyphens -- interchangably -- as list\nmarkers:\n\n :::text\n * Red\n * Green\n * Blue\n\nis equivalent to:\n\n :::text\n + Red\n + Green\n + Blue\n\nand:\n\n :::text\n - Red\n - Green\n - Blue\n\nOrdered lists use numbers followed by periods:\n\n :::text\n 1. Bird\n 2. McHale\n 3. Parish\n\nIt's important to note that the actual numbers you use to mark the list have no\neffect on the HTML output Markdown produces. The HTML Markdown produces from the\nabove list is:\n\n :::text\n
    \n
  1. Bird
  2. \n
  3. McHale
  4. \n
  5. Parish
  6. \n
\n\nIf you instead wrote the list in Markdown like this:\n\n :::text\n 1. Bird\n 1. McHale\n 1. Parish\n\nor even:\n\n :::text\n 3. Bird\n 1. McHale\n 8. Parish\n\nyou'd get the exact same HTML output. The point is, if you want to, you can use\nordinal numbers in your ordered Markdown lists, so that the numbers in your\nsource match the numbers in your published HTML. But if you want to be lazy, you\ndon't have to.\n\nIf you do use lazy list numbering, however, you should still start the list with\nthe number 1. At some point in the future, Markdown may support starting ordered\nlists at an arbitrary number.\n\nList markers typically start at the left margin, but may be indented by up to\nthree spaces. List markers must be followed by one or more spaces or a tab.\n\nTo make lists look nice, you can wrap items with hanging indents:\n\n :::text\n * Lorem ipsum dolor sit amet, consectetuer adipiscing elit.\n Aliquam hendrerit mi posuere lectus. Vestibulum enim wisi,\n viverra nec, fringilla in, laoreet vitae, risus.\n * Donec sit amet nisl. Aliquam semper ipsum sit amet velit.\n Suspendisse id sem consectetuer libero luctus adipiscing.\n\nBut if you want to be lazy, you don't have to:\n\n :::text\n * Lorem ipsum dolor sit amet, consectetuer adipiscing elit.\n Aliquam hendrerit mi posuere lectus. Vestibulum enim wisi,\n viverra nec, fringilla in, laoreet vitae, risus.\n * Donec sit amet nisl. Aliquam semper ipsum sit amet velit.\n Suspendisse id sem consectetuer libero luctus adipiscing.\n\nIf list items are separated by blank lines, Markdown will wrap the items in\n`

` tags in the HTML output. For example, this input:\n\n :::text\n * Bird\n * Magic\n\nwill turn into:\n\n :::html\n

    \n
  • Bird
  • \n
  • Magic
  • \n
\n\nBut this:\n\n :::text\n * Bird\n \n * Magic\n\nwill turn into:\n\n :::html\n
    \n
  • Bird

  • \n
  • Magic

  • \n
\n\nList items may consist of multiple paragraphs. Each subsequent paragraph in a\nlist item must be indented by either 4 spaces or one tab:\n\n :::text\n 1. This is a list item with two paragraphs. Lorem ipsum dolor\n sit amet, consectetuer adipiscing elit. Aliquam hendrerit\n mi posuere lectus.\n \n Vestibulum enim wisi, viverra nec, fringilla in, laoreet\n vitae, risus. Donec sit amet nisl. Aliquam semper ipsum\n sit amet velit.\n \n 2. Suspendisse id sem consectetuer libero luctus adipiscing.\n\nIt looks nice if you indent every line of the subsequent paragraphs, but here\nagain, Markdown will allow you to be lazy:\n\n :::text\n * This is a list item with two paragraphs.\n \n This is the second paragraph in the list item. You're\n only required to indent the first line. Lorem ipsum dolor\n sit amet, consectetuer adipiscing elit.\n \n * Another item in the same list.\n\nTo put a blockquote within a list item, the blockquote's `>` delimiters need to\nbe indented:\n\n :::text\n * A list item with a blockquote:\n \n > This is a blockquote\n > inside a list item.\n\nTo put a code block within a list item, the code block needs to be indented\n*twice* -- 8 spaces or two tabs:\n\n :::text\n * A list item with a code block:\n \n \n\n\nIt's worth noting that it's possible to trigger an ordered list by accident, by\nwriting something like this:\n\n :::text\n 1986. What a great season.\n\nIn other words, a *number-period-space* sequence at the beginning of a line. To\navoid this, you can backslash-escape the period:\n\n :::text\n 1986\\. What a great season.\n\n\n\n### Code Blocks\n\nPre-formatted code blocks are used for writing about programming or markup\nsource code. Rather than forming normal paragraphs, the lines of a code block\nare interpreted literally. Markdown wraps a code block in both `
` and\n`` tags.\n\nTo produce a code block in Markdown, simply indent every line of the block by at\nleast 4 spaces or 1 tab. For example, given this input:\n\n    :::text\n    This is a normal paragraph:\n    \n        This is a code block.\n\nMarkdown will generate:\n\n    :::html\n    

This is a normal paragraph:

\n \n
This is a code block.\n    
\n\nOne level of indentation -- 4 spaces or 1 tab -- is removed from each line of\nthe code block. For example, this:\n\n :::text\n Here is an example of AppleScript:\n \n tell application \"Foo\"\n beep\n end tell\n\nwill turn into:\n\n :::html\n

Here is an example of AppleScript:

\n \n
tell application \"Foo\"\n        beep\n    end tell\n    
\n\nA code block continues until it reaches a line that is not indented (or the end\nof the article).\n\nWithin a code block, ampersands (`&`) and angle brackets (`<` and `>`) are\nautomatically converted into HTML entities. This makes it very easy to include\nexample HTML source code using Markdown -- just paste it and indent it, and\nMarkdown will handle the hassle of encoding the ampersands and angle brackets.\nFor example, this:\n\n :::text\n
\n &copy; 2004 Foo Corporation\n
\n\nwill turn into:\n\n :::html\n
&lt;div class=\"footer\"&gt;\n        &amp;copy; 2004 Foo Corporation\n    &lt;/div&gt;\n    
\n\nRegular Markdown syntax is not processed within code blocks. E.g., asterisks are\njust literal asterisks within a code block. This means it's also easy to use\nMarkdown to write about Markdown's own syntax.\n\n\n\n### Horizontal Rules\n\nYou can produce a horizontal rule tag (`
`) by placing three or more\nhyphens, asterisks, or underscores on a line by themselves. If you wish, you may\nuse spaces between the hyphens or asterisks. Each of the following lines will\nproduce a horizontal rule:\n\n :::text\n * * *\n \n ***\n \n *****\n \n - - -\n \n ---------------------------------------\n\n\n* * *\n\n## Span Elements\n\n### Links\n\nMarkdown supports two style of links: *inline* and *reference*.\n\nIn both styles, the link text is delimited by [square brackets].\n\nTo create an inline link, use a set of regular parentheses immediately after the\nlink text's closing square bracket. Inside the parentheses, put the URL where\nyou want the link to point, along with an *optional* title for the link,\nsurrounded in quotes. For example:\n\n :::text\n This is [an example](http://example.com/ \"Title\") inline link.\n \n [This link](http://example.net/) has no title attribute.\n\nWill produce:\n\n :::html\n

This is \n an example inline link.

\n \n

This link has no\n title attribute.

\n\nIf you're referring to a local resource on the same server, you can use relative\npaths:\n\n :::text\n See my [About](/about/) page for details. \n\nReference-style links use a second set of square brackets, inside which you\nplace a label of your choosing to identify the link:\n\n :::text\n This is [an example][id] reference-style link.\n\nYou can optionally use a space to separate the sets of brackets:\n\n :::text\n This is [an example] [id] reference-style link.\n\nThen, anywhere in the document, you define your link label like this, on a line\nby itself:\n\n :::text\n [id]: http://example.com/ \"Optional Title Here\"\n\nThat is:\n\n* Square brackets containing the link identifier (optionally indented from the\n left margin using up to three spaces);\n* followed by a colon;\n* followed by one or more spaces (or tabs);\n* followed by the URL for the link;\n* optionally followed by a title attribute for the link, enclosed in double or\n single quotes, or enclosed in parentheses.\n\nThe following three link definitions are equivalent:\n\n :::text\n [foo]: http://example.com/ \"Optional Title Here\"\n [foo]: http://example.com/ 'Optional Title Here'\n [foo]: http://example.com/ (Optional Title Here)\n\nThe link URL may, optionally, be surrounded by angle brackets:\n\n :::text\n [id]: \"Optional Title Here\"\n\nYou can put the title attribute on the next line and use extra spaces or tabs\nfor padding, which tends to look better with longer URLs:\n\n :::text\n [id]: http://example.com/longish/path/to/resource/here\n \"Optional Title Here\"\n\nLink definitions are only used for creating links during Markdown processing,\nand are stripped from your document in the HTML output.\n\nLink definition names may consist of letters, numbers, spaces, and punctuation\n-- but they are *not* case sensitive. E.g. these two links:\n\n :::text\n [link text][a]\n [link text][A]\n\nare equivalent.\n\nThe *implicit link name* shortcut allows you to omit the name of the link, in\nwhich case the link text itself is used as the name. Just use an empty set of\nsquare brackets -- e.g., to link the word \"Google\" to the google.com web site,\nyou could simply write:\n\n :::text\n [Google][]\n\nAnd then define the link:\n\n :::text\n [Google]: http://google.com/\n\nBecause link names may contain spaces, this shortcut even works for multiple\nwords in the link text:\n\n :::text\n Visit [Daring Fireball][] for more information.\n\nAnd then define the link:\n\n :::text\n [Daring Fireball]: http://daringfireball.net/\n\nLink definitions can be placed anywhere in your Markdown document. I tend to put\nthem immediately after each paragraph in which they're used, but if you want,\nyou can put them all at the end of your document, sort of like footnotes.\n\nHere's an example of reference links in action:\n\n :::text\n I get 10 times more traffic from [Google] [1] than from\n [Yahoo] [2] or [MSN] [3].\n \n [1]: http://google.com/ \"Google\"\n [2]: http://search.yahoo.com/ \"Yahoo Search\"\n [3]: http://search.msn.com/ \"MSN Search\"\n\nUsing the implicit link name shortcut, you could instead write:\n\n :::text\n I get 10 times more traffic from [Google][] than from\n [Yahoo][] or [MSN][].\n \n [google]: http://google.com/ \"Google\"\n [yahoo]: http://search.yahoo.com/ \"Yahoo Search\"\n [msn]: http://search.msn.com/ \"MSN Search\"\n\nBoth of the above examples will produce the following HTML output:\n\n :::html\n

I get 10 times more traffic from Google than from\n Yahoo\n or MSN.

\n\nFor comparison, here is the same paragraph written using Markdown's inline link\nstyle:\n\n :::text\n I get 10 times more traffic from [Google](http://google.com/ \"Google\")\n than from [Yahoo](http://search.yahoo.com/ \"Yahoo Search\") or\n [MSN](http://search.msn.com/ \"MSN Search\").\n\nThe point of reference-style links is not that they're easier to write. The\npoint is that with reference-style links, your document source is vastly more\nreadable. Compare the above examples: using reference-style links, the paragraph\nitself is only 81 characters long; with inline-style links, it's 176 characters;\nand as raw HTML, it's 234 characters. In the raw HTML, there's more markup than\nthere is text.\n\nWith Markdown's reference-style links, a source document much more closely\nresembles the final output, as rendered in a browser. By allowing you to move\nthe markup-related metadata out of the paragraph, you can add links without\ninterrupting the narrative flow of your prose.\n\n\n### Emphasis\n\nMarkdown treats asterisks (`*`) and underscores (`_`) as indicators of emphasis.\nText wrapped with one `*` or `_` will be wrapped with an HTML `` tag; double\n`*`'s or `_`'s will be wrapped with an HTML `` tag. E.g., this input:\n\n :::text\n *single asterisks*\n \n _single underscores_\n \n **double asterisks**\n \n __double underscores__\n\nwill produce:\n\n :::html\n single asterisks\n \n single underscores\n \n double asterisks\n \n double underscores\n\nYou can use whichever style you prefer; the lone restriction is that the same\ncharacter must be used to open and close an emphasis span.\n\nEmphasis can be used in the middle of a word:\n\n :::text\n un*frigging*believable\n\nBut if you surround an `*` or `_` with spaces, it'll be treated as a literal\nasterisk or underscore.\n\nTo produce a literal asterisk or underscore at a position where it would\notherwise be used as an emphasis delimiter, you can backslash escape it:\n\n :::text\n \\*this text is surrounded by literal asterisks\\*\n\n\n\n### Code\n\nTo indicate a span of code, wrap it with backtick quotes (`` ` ``). Unlike a\npre-formatted code block, a code span indicates code within a normal paragraph.\nFor example:\n\n :::text\n Use the `printf()` function.\n\nwill produce:\n\n :::html\n

Use the printf() function.

\n\nTo include a literal backtick character within a code span, you can use multiple\nbackticks as the opening and closing delimiters:\n\n :::text\n ``There is a literal backtick (`) here.``\n\nwhich will produce this:\n\n :::html\n

There is a literal backtick (`) here.

\n\nThe backtick delimiters surrounding a code span may include spaces -- one after\nthe opening, one before the closing. This allows you to place literal backtick\ncharacters at the beginning or end of a code span:\n\n :::text\n A single backtick in a code span: `` ` ``\n \n A backtick-delimited string in a code span: `` `foo` ``\n\nwill produce:\n\n :::html\n

A single backtick in a code span: `

\n \n

A backtick-delimited string in a code span: `foo`

\n\nWith a code span, ampersands and angle brackets are encoded as HTML entities\nautomatically, which makes it easy to include example HTML tags. Markdown will\nturn this:\n\n :::text\n Please don't use any `` tags.\n\ninto:\n\n :::html\n

Please don't use any &lt;blink&gt; tags.

\n\nYou can write this:\n\n :::text\n `&#8212;` is the decimal-encoded equivalent of `&mdash;`.\n\nto produce:\n\n :::html\n

&amp;#8212; is the decimal-encoded\n equivalent of &amp;mdash;.

\n\n\n\n### Images\n\nAdmittedly, it's fairly difficult to devise a \"natural\" syntax for placing\nimages into a plain text document format.\n\nMarkdown uses an image syntax that is intended to resemble the syntax for links,\nallowing for two styles: *inline* and *reference*.\n\nInline image syntax looks like this:\n\n :::text\n ![Alt text](/path/to/img.jpg)\n \n ![Alt text](/path/to/img.jpg \"Optional title\")\n\nThat is:\n\n* An exclamation mark: `!`;\n* followed by a set of square brackets, containing the `alt` attribute text\n for the image;\n* followed by a set of parentheses, containing the URL or path to the image,\n and an optional `title` attribute enclosed in double or single quotes.\n\nReference-style image syntax looks like this:\n\n :::text\n ![Alt text][id]\n\nWhere \"id\" is the name of a defined image reference. Image references are\ndefined using syntax identical to link references:\n\n :::text\n [id]: url/to/image \"Optional title attribute\"\n\nAs of this writing, Markdown has no syntax for specifying the dimensions of an\nimage; if this is important to you, you can simply use regular HTML ``\ntags.\n\n\n* * *\n\n\n## Miscellaneous\n\n### Automatic Links\n\nMarkdown supports a shortcut style for creating \"automatic\" links for URLs and\nemail addresses: simply surround the URL or email address with angle brackets.\nWhat this means is that if you want to show the actual text of a URL or email\naddress, and also have it be a clickable link, you can do this:\n\n :::text\n \n\nMarkdown will turn this into:\n\n :::html\n http://example.com/\n\nAutomatic links for email addresses work similarly, except that Markdown will\nalso perform a bit of randomized decimal and hex entity-encoding to help obscure\nyour address from address-harvesting spambots. For example, Markdown will turn\nthis:\n\n :::text\n \n\ninto something like this:\n\n :::html\n &#x61;&#x64;&#x64;&#x72;&#x65;&#115;&#115;&#64;&#101;&#120;&#x61;\n &#109;&#x70;&#x6C;e&#x2E;&#99;&#111;&#109;\n\nwhich will render in a browser as a clickable link to \"address@example.com\".\n\n(This sort of entity-encoding trick will indeed fool many, if not most,\naddress-harvesting bots, but it definitely won't fool all of them. It's better\nthan nothing, but an address published in this way will probably eventually\nstart receiving spam.)\n\n\n\n### Backslash Escapes\n\nMarkdown allows you to use backslash escapes to generate literal characters\nwhich would otherwise have special meaning in Markdown's formatting syntax. For\nexample, if you wanted to surround a word with literal asterisks (instead of an\nHTML `` tag), you can use backslashes before the asterisks, like this:\n\n :::text\n \\*literal asterisks\\*\n\nMarkdown provides backslash escapes for the following characters:\n\n :::text\n \\ backslash\n ` backtick\n * asterisk\n _ underscore\n {} curly braces\n [] square brackets\n () parentheses\n # hash mark\n + plus sign\n - minus sign (hyphen)\n . dot\n ! exclamation mark\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076054,"cells":{"text":{"kind":"string","value":"# Configuration\n\nAll Markdoc wikis are configured via a single `markdoc.yaml` file in the wiki\nroot. This file is formatted with YAML (Yet Another Markup Language); you can\nfind more information on that at [yaml.org](http://yaml.org/). When running the\ncommand-line interface, Markdoc will search for either a `markdoc.yaml` or a\n`.markdoc.yaml` file in the current directory. You can also explicitly specify a\nfile to use with the `-c`/`--config` command-line option.\n\n## Example\n\nHere we’ll go through an example and show how the various settings affect\nMarkdoc’s behavior:\n\n #!yaml\n # Metadata\n wiki-name: \"My Wiki\"\n google-analytics: UA-XXXXXX-X\n \n # Directories\n hide-prefix: \".\"\n wiki-dir: \"wiki\"\n static-dir: \"static\"\n html-dir: \".html\"\n template-dir: \".templates\"\n temp-dir: \".tmp\"\n cvs-exclude: true\n \n # Building\n document-extensions: [.md, .mdown, .markdown, .wiki, .text]\n generate-listing: always\n listing-filename: \"_list.html\"\n use-default-static: true\n use-default-templates: true\n \n # Rendering\n markdown:\n safe-mode: false\n output-format: xhtml1\n extensions: [codehilite, def_list]\n extension-configs:\n codehilite:\n force_linenos: true\n \n # Serving\n server:\n bind: '127.0.0.1'\n port: 8010\n num-threads: 10\n name: 'server.example.com'\n request-queue-size: 5\n timeout: 10\n\nRemember that Markdoc uses sensible defaults for *all* of these options, so it’s\nperfectly OK to have an empty markdoc.yaml file. You still need one though.\n\n* [Metadata](#metadata)\n* [Directories](#directories)\n* [Building](#building)\n* [Rendering](#rendering)\n* [Serving](#serving)\n\n### Metadata\n\nThis is information about your wiki itself. It is currently only used when\nrendering the default set of templates, but custom templates may also use these\nparameters.\n\n`wiki-name` (no default)\n: Specify the human-friendly name of your wiki. If defined, this will appear\n in the title and footer in the default Markdoc templates.\n\n`google-analytics` (no default)\n: Specify a [Google Analytics][] tracking key for your Markdoc site. If given,\n the GA tracking code will be included in every HTML document. Note that this\n should be the full key, in the format `UA-XXXXXX-X`.\n\n [google analytics]: http://google.com/analytics/\n\n### Directories\n\nThese settings affect where Markdoc looks for some pieces of data, and where it\nputs others. You can get more information on the roles of various directories in\nthe [layout documentation](/layout). Note that all `*-dir` parameters are\nresolved relative to the wiki root, and that `'.'` (i.e. the wiki root itself)\nis an acceptable value.\n\n`hide-prefix` (default `.`)\n: This determines how Markdoc finds and writes to hidden directories like\n `.tmp`, `.templates` and `.html`. You may wish to set this to `'_'` if your\n VCS or operating system doesn’t play nicely with period-prefixed filenames.\n If you specify `html-dir`, `temp-dir` and `template-dir`, this setting won’t\n have any effect.\n\n`wiki-dir` (default `\"wiki\"`)\n: This tells Markdoc where to find pages that should be rendered with Markdown\n and output as HTML. Only files in this directory will be rendered.\n\n`static-dir` (default `\"static\"`)\n: Any files in the static directory are synced over to the HTML root as-is\n when building. This tells Markdoc where to find all the static media for\n your wiki.\n\n`html-dir` (default `hide-prefix + \"html\"`)\n: This is where HTML and static media are eventually output during the\n building process. It is also the document root for the Markdoc server. The\n default value is auto-generated using the `hide-prefix` setting.\n\n`template-dir` (default `hide-prefix + \"templates\"`)\n: Markdoc will look in this directory first when searching for the Jinja2\n templates needed to produce HTML.\n\n`temp-dir` (default `hide-prefix + \"tmp\"`)\n: This directory is used as a temporary destination when building HTML.\n\n`cvs-exclude` (default `true`)\n: If this is `true`, Markdoc will pass the `--cvs-exclude` option to `rsync`\n when syncing static media and rendered HTML files. This causes `rsync` to\n skip some common backup/hidden files (e.g. `.git/`, `.svn/`, `*~` and `#*`).\n The full semantics of this option are specified in the\n [`rsync` documentation][rsync-docs].\n\n [rsync-docs]: http://www.samba.org/ftp/rsync/rsync.html\n\n### Building\n\nThese settings affect Markdoc’s behavior during the build process.\n\n`document-extensions` (default `[.md, .mdown, .markdown, .wiki, .text]`)\n: Markdoc will only render files from the document root which have one of\n these extensions. If one of the extensions is an empty string (`''`), then\n all files (including those without an extension) will be considered pages.\n Setting this parameter to the empty list (`[]`) will behave as if it is\n actually `['']`.\n\n`generate-listing` (default `always`)\n: This affects how listings are generated for directories in your Markdoc wiki\n (including the top level). Set this to either `always`, `sometimes` or\n `never`. The semantics are as follows:\n \n * `never` never generates any listings.\n * `sometimes` only generates a listing when there is no `index` or\n `index.html` file in a directory. This listing is saved as both\n `index.html` and the value of the `listing-filename` setting.\n * `always` generates a listing for every directory, and saves it under the\n value of the `listing-filename` setting, and as `index.html` if an index\n file does not already exist.\n\n`listing-filename` (default `_list.html`)\n: This specifies the filename that directory listings are saved under; see the\n documentation for `generate-listing` just above for more information.\n\n`use-default-static` (default `true`)\n: If true, Markdoc’s default set of static media will be synchronized to the\n HTML root when building.\n\n`use-default-templates` (default `true`)\n: If true, Jinja2 will look in Markdoc’s set of default templates when\n rendering documents and listings.\n\n### Rendering\n\nThese settings determine how Markdoc converts Markdown text into XHTML. They are\nall defined as sub-parameters inside the `markdown` dictionary. These parameters\ncorrespond to keyword arguments to the `markdown.Markdown` constructor, although\nhyphens (`-`) are all converted to underscores (`_`) in the key strings.\n\n`extensions` (default `[]`)\n: A list of strings specifying extensions to be used by the Markdown renderer.\n The [Markdown library for Python][markdown-python-lib] comes with the\n following by default:\n \n * `abbr`\n * `codehilite`\n * `def_list`\n * `extra`\n * `fenced_code`\n * `footnotes`\n * `headerid`\n * `html_tidy`\n * `imagelinks`\n * `meta`\n * `rss`\n * `tables`\n * `toc`\n * `wikilinks`\n\n [markdown-python-lib]: http://www.freewisdom.org/projects/python-markdown\n\n`extension-configs` (default `{}`)\n: These are configuration parameters for the extensions — you’ll need to\n consult the official Markdown library documentation for more information.\n\n`safe-mode` (default `false`)\n: Disallow raw HTML in Markdown documents. This can be either `false`,\n `remove`, `replace` or `escape`.\n\n`output-format` (default `xhtml1`)\n: Switch between rendering XHTML or HTML. Can be either `xhtml1`, `xhtml`,\n `html4` or `html` (the general ones will always refer to the latest\n version). It is strongly suggested that you use XHTML.\n\n### Serving\n\nAll of the server configuration parameters exist in the `server` dictionary (as\nwith `markdown` previously).\n\n`bind` (default `127.0.0.1`)\n: Bind to the specified interface. With the default value the server will only\n listen on the loopback interface (localhost).\n\n`port` (default `8008`)\n: Listen on the specified port.\n\n`num-threads` (default `10`)\n: Use this number of threads to handle requests.\n\n`name` (default is autodetected)\n: Specify a server name. The default will be automatically detected from the\n socket the server binds to.\n\n`request-queue-size` (default `5`)\n: Sets the number of queued connections to the server before it will start\n dropping TCP connections (the `backlog` argument to `socket.listen()`).\n\n`timeout` (default `10`)\n: The socket timeout (in seconds) for accepted TCP connections.\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076055,"cells":{"text":{"kind":"string","value":"# Layout\n\nMarkdoc wikis have the following layout:\n\n :::text\n WIKI_ROOT/\n |-- .html/\n |-- .templates/\n |-- .tmp/\n |-- static/\n |-- wiki/\n `-- markdoc.yaml\n\nThe `.html/` and `.tmp/` directories should be excluded from any VCS, since they\ncontain temporary files. Here is a list of the roles of the various files and\nsub-directories, in descending order of significance:\n\n`WIKI_ROOT/`\n: The *wiki root*, containing all of the files required for the `markdoc`\n utility to build and serve the wiki.\n\n`WIKI_ROOT/markdoc.yaml`\n: The *wiki configuration*; the main configuration point for your wiki, in a\n YAML-formatted file. Consult the [configuration docs](/configuration) for\n more information on how to write this.\n\n`WIKI_ROOT/wiki/`\n: The *document root*, which contains the actual *text* of your wiki in\n Markdown-formatted text files. It is assumed they are UTF-8 encoded. Any\n files without a valid extension will be ignored (see the option\n `document-extensions` in [configuration](/configuration)).\n\n`WIKI_ROOT/static/`\n: The *static directory*: static media files (such as CSS and JavaScript)\n should be put here. They will be copied to `.html/` by rsync during the\n build operation. This comes with some default CSS for styling.\n\n`WIKI_ROOT/.templates/`\n: The *template directory*: it contains the Jinja2 templates for documents,\n error pages and directory listings. It comes with some nice defaults, but\n you can override these if you wish.\n\n`WIKI_ROOT/.html/`\n: The *HTML root* (sometimes abbreviated as ‘htroot’). It holds the compiled\n HTML and static files. It is directly served from by the Markdoc webserver.\n\n`WIKI_ROOT/.tmp/`\n: The *temporary directory*: a temporary build destination for rendered\n Markdown files. This directory is then rsync’d to the HTML root along with\n the static directory; the incremental nature of this operation means the\n Markdoc web server can keep running in one process whilst another runs\n `markdoc build`.\n\nNote that all of the default locations for these directories can be overridden\nin the `markdoc.yaml` file. For example, you may wish to use `WIKI_ROOT/pages/`\ninstead of `WIKI_ROOT/wiki/`, or `WIKI_ROOT/.build/` instead of\n`WIKI_ROOT/.html/`. Consult the [configuration documentation](/configuration)\nfor more information.\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076056,"cells":{"text":{"kind":"string","value":"# Barebones Wikis\n\nOut of the box, Markdoc supports relatively complex wikis with custom templates and static files. However, for many cases, the default media and templates are adequate, so why should a vanilla wiki require nesting like the following:\n\n :::text\n some-wiki/\n |-- .templates/\n |-- static/\n |-- wiki/\n | |-- files\n | |-- go\n | `-- here\n `-- markdoc.yaml\n\nFortunately, for very simple cases where you just want to be able to render and serve a collection of Markdown-formatted files, you can do so. Begin by just creating and entering an empty directory:\n\n :::bash\n $ mkdir mywiki/\n $ cd mywiki/\n\nNow create a file called `.markdoc.yaml` containing the following YAML data:\n\n :::yaml\n wiki-name: My Wiki # Set this to whatever you want\n \n wiki-dir: \".\"\n static-dir: \".static\"\n\nYou can add some more configuration parameters if you like, but these are the basic ones you’ll need. So now your directory structure will look like this:\n\n :::text\n mywiki/\n `-- .markdoc.yaml\n\nAnd you can just start creating pages in the directory.\n\n :::text\n mywiki/\n |-- .markdoc.yaml\n |-- page1.md\n |-- page2.md\n `-- page3.md\n\nTo run the build process, just do the usual:\n\n :::bash\n $ markdoc build && markdoc serve\n\n`markdoc` recognizes both `markdoc.yaml` *and* `.markdoc.yaml` implicitly. Because you’ve hidden everything except the actual wiki pages, to most file browsers (including `ls`) the wiki will just look like a directory with a number of text files.\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076057,"cells":{"text":{"kind":"string","value":"# Syntax Highlighting with Pygments\n\n[Markdown for Python][] supports syntax highlighting in your documents using [Pygments][]. Here’s how to set up and use it from Markdoc.\n\n [markdown for python]: http://www.freewisdom.org/projects/python-markdown\n [pygments]: http://pygments.org/\n\nFirst, install the extension in your `markdoc.yaml` file:\n\n :::yaml\n wiki-name: My Wiki\n ## ...other settings...\n markdown:\n extensions:\n - codehilite # the important bit\n\nPygments should have been installed as a dependency when you installed Markdoc.\n\nInitially, syntax highlighting will be applied to every code block Markdown encounters. Pygments will guess which lexer to apply to each block. To specify the language of a block, add a `:::LANG` prefix to blocks of code. For example:\n\n :::text\n :::python\n def hello():\n print \"Hello, World!\"\n\nWill render to:\n\n :::python\n def hello():\n print \"Hello, World!\"\n\nTo switch syntax highlighting off for a block, use `:::text`.\n\nIf you want a block to have line numbers, use `#!LANG` instead. For example:\n\n :::text\n #!ruby\n class Foo\n def bar\n @baz\n end\n end\n\nWill render to:\n\n #!ruby\n class Foo\n def bar\n @baz\n end\n end\n\nIf you add a shebang to a code block, like `#!/bin/bash` or `#!/usr/bin/env python`, the language will be guessed and the shebang included in the output. In the final text. So for example, the following:\n\n :::text\n #!/bin/bash\n echo \"Hello, World\"\n\nWill render to:\n\n #!/bin/bash\n echo \"Hello, World\"\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076058,"cells":{"text":{"kind":"string","value":"# Serving Markdoc Builds With Apache\n\nBy default, you should just serve your HTML root out of Apache; that will work very simply. You will need a few options to your `.htaccess` file get the same semantics as the built-in web server (the one which runs when you do `markdoc serve`):\n\n #!text\n Options +MultiViews\n \n \n ForceType 'application/xhtml+xml; charset=UTF-8'\n \n\nThe first directive will cause requests for `/directory/filename` to look for `directory/filename.html` in your HTML root, allowing for more natural references between pages in your wiki.\n\nThe second part will cause `.html` files to be served as valid UTF-8-encoded XHTML, which Markdoc assumes they are.\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"zacharyvoase/markdoc\",\n \"stars\": \"347\",\n \"repo_language\": \"Python\",\n \"file_name\": \"apache.md\",\n \"mime_type\": \"text/plain\"\n}"}}},{"rowIdx":1076059,"cells":{"text":{"kind":"string","value":"# AdelaiDepth\r\n[![Open In Colab](https://colab.research.google.com/assets/colab-badge.svg)](https://colab.research.google.com/drive/1rDLZBtiUgsFJrrL-xOgTVWxj6PMK9swq?usp=sharing)\r\n\r\nAdelaiDepth is an open source toolbox for monocular depth prediction. Relevant work from our group is open-sourced here.\r\n\r\nAdelaiDepth contains the following algorithms:\r\n* Boosting Depth: [Code](https://github.com/guangkaixu/BoostingDepth), [Towards 3D Scene Reconstruction from Locally Scale-Aligned\r\nMonocular Video Depth (Boosting Monocular Depth Estimation with Sparse Guided Points)](https://arxiv.org/abs/2202.01470)\r\n* 3D Scene Shape (Best Paper Finalist): [Code](https://github.com/aim-uofa/AdelaiDepth/tree/main/LeReS), [Learning to Recover 3D Scene Shape from a Single Image](https://arxiv.org/abs/2012.09365)\r\n* DiverseDepth: [Code](https://github.com/YvanYin/DiverseDepth), [Virtual Normal: Enforcing Geometric Constraints for Accurate and Robust Depth Prediction](https://arxiv.org/abs/2103.04216), [DiverseDepth: Affine-invariant Depth Prediction Using Diverse Data](https://arxiv.org/abs/2002.00569)\r\n* Virtual Normal: [Code](https://github.com/YvanYin/VNL_Monocular_Depth_Prediction), [Enforcing geometric constraints of virtual normal for depth prediction](https://arxiv.org/abs/1907.12209)\r\n* Depth Estimation Using Deep Convolutional Neural Fields: [Code](https://bitbucket.org/fayao/dcnf-fcsp/src/master/), [Learning Depth from Single Monocular Images Using Deep Convolutional Neural Fields, TPAMI'16, CVPR'15](https://arxiv.org/abs/1502.07411)\r\n\r\n## News:\r\n* [May. 31, 2022] Code for local recovery strategy of BoostingDepth is released.\r\n* [May. 31, 2022] Training code and data of LeReS project have been released.\r\n* [Feb. 13, 2022] Training code and data of DiverseDepth project have been released.\r\n* [Jun. 13, 2021] Our \"Learning to Recover 3D Scene Shape from a Single Image\" work is one of the CVPR'21 Best Paper Finalists.\r\n* [Jun. 6, 2021] We have made the training data of DiverseDepth available.\r\n\r\n## Results and Dataset Examples:\r\n1. 3D Scene Shape\r\n \r\n You may want to check [this video](http://www.youtube.com/watch?v=UuT5_GK_TWk) which provides a very brief introduction to the work:\r\n\r\n\r\n \r\n \r\n \r\n \r\n \r\n \r\n \r\n \r\n \r\n \r\n
RGBDepthPoint Cloud
\r\n\r\n\r\n![Depth](./examples/depth.png)\r\n\r\n2. DiverseDepth\r\n\r\n* Results examples:\r\n\r\n![Depth](./examples/diverse_depth.jpg)\r\n\r\n* DiverseDepth dataset examples:\r\n\r\n![DiverseDepth dataset](./examples/diversedepth_dataset_examples.png)\r\n\r\n## BibTeX\r\n\r\n```BibTeX\r\n@article{yin2022towards,\r\n title={Towards Accurate Reconstruction of 3D Scene Shape from A Single Monocular Image},\r\n author={Yin, Wei and Zhang, Jianming and Wang, Oliver and Niklaus, Simon and Chen, Simon and Liu, Yifan and Shen, Chunhua},\r\n journal={IEEE Transactions on Pattern Analysis and Machine Intelligence (TPAMI)},\r\n year={2022}\r\n}\r\n\r\n@inproceedings{Yin2019enforcing,\r\n title = {Enforcing geometric constraints of virtual normal for depth prediction},\r\n author = {Yin, Wei and Liu, Yifan and Shen, Chunhua and Yan, Youliang},\r\n booktitle = {The IEEE International Conference on Computer Vision (ICCV)},\r\n year = {2019}\r\n}\r\n\r\n@inproceedings{Wei2021CVPR,\r\n title = {Learning to Recover 3D Scene Shape from a Single Image},\r\n author = {Wei Yin and Jianming Zhang and Oliver Wang and Simon Niklaus and Long Mai and Simon Chen and Chunhua Shen},\r\n booktitle = {Proc. IEEE Conf. Comp. Vis. Patt. Recogn. (CVPR)},\r\n year = {2021}\r\n}\r\n\r\n@article{yin2021virtual,\r\n title = {Virtual Normal: Enforcing Geometric Constraints for Accurate and Robust Depth Prediction},\r\n author = {Yin, Wei and Liu, Yifan and Shen, Chunhua},\r\n journal = {IEEE Transactions on Pattern Analysis and Machine Intelligence (TPAMI)},\r\n year = {2021}\r\n}\r\n```\r\n\r\n### Contact\r\n* Wei Yin \r\n* Chunhua Shen \r\n\r\n## License\r\n\r\nThe *3D Scene Shape* code is under a non-commercial license from *Adobe Research*. See the [LICENSE file](LeReS/LICENSE) for details.\r\n\r\nOther depth prediction projects are licensed under the 2-clause BSD License for non-commercial use -- see the [LICENSE file](LICENSE) for details. For commercial use, please contact [Chunhua Shen](https://cshen.github.io).\r\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076060,"cells":{"text":{"kind":"string","value":"# We defaulty put all data in the Train/datasets. You can put them anywhere but create softlinks under Train/datasets.\n\n# We provide two way to download data. 1) Cloudstor; 2) Google Drive\n# 1. Download from CloudStor:\n\n# download part-fore\ncd Train/datasets\nmkdir DiverseDepth\ncd DiverseDepth\nwget https://cloudstor.aarnet.edu.au/plus/s/HNfpS4tAz3NePtU/download -O DiverseDepth_d.tar.gz\nwget https://cloudstor.aarnet.edu.au/plus/s/n5bOhKk52fXILp9/download -O DiverseDepth_rgb.zip\ntar -xvf DiverseDepth_d.tar.gz\nunzip DiverseDepth_rgb.zip\n\n\n# download part_in, collected from taskonomy\ncd ..\nmkdir taskonomy\ncd taskonomy\n# (original link) wget https://cloudstor.aarnet.edu.au/plus/s/Q4jqXt2YfqcGZvK/download -O annotations.zip\nwget --no-check-certificate \"https://drive.google.com/uc?export=download&id=1Nhz0BABZBjjE-ITbJoSyVSuaJkD-iWVv\" -O annotations.zip\nwget https://cloudstor.aarnet.edu.au/plus/s/EBv6jRp326zMlf6/download -O taskonomy_rgbs.tar.gz\nwget https://cloudstor.aarnet.edu.au/plus/s/t334giSOJtC97Uq/download -O taskonomy_ins_planes.tar.gz\nwget https://cloudstor.aarnet.edu.au/plus/s/kvLcrVSWfOsERsI/download -O taskonomy_depths.tar.gz\ntar -xvf ./*.tar.gz\nunzip annotations.zip\n\n# HRWSI\ncd ..\nmkdir HRWSI\ncd HRWSI\nwget https://cloudstor.aarnet.edu.au/plus/s/oaWj2Cfvif3WuD0/download -O HRWSI.zip\nunzip HRWSI.zip\n\n# Holopix50k\ncd ..\nmkdir Holopix50k\ncd Holopix50k\nwget https://cloudstor.aarnet.edu.au/plus/s/LuOsawtGq6cDAKr/download -O Holopix50k.zip\nunzip Holopix50k.zip\n\n# The overview of data under Train/datasets are:\n# -Train\n# |--datasets\n# |--DiverseDepth\n# |--annotations\n# |--depths\n# |--rgbs\n# |--taskonomy\n# |--annotations\n# |--depths\n# |--rgbs\n# |--ins_planes\n# |--HRWSI\n# |--Holopix50k\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076061,"cells":{"text":{"kind":"string","value":"matplotlib\r\nopencv-python\r\nplyfile\r\npyyaml\r\ndill\r\ntensorboardX"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076062,"cells":{"text":{"kind":"string","value":"# Best Paper Finalist: [Learning to Recover 3D Scene Shape from a Single Image](https://arxiv.org/abs/2012.09365)\r\n\r\nThis repository contains the source code of the paper:\r\nWei Yin, Jianming Zhang, Oliver Wang, Simon Niklaus, Long Mai, Simon Chen, Chunhua Shen [Learning to Recover 3D Scene Shape from a Single Image](https://arxiv.org/abs/2012.09365). Published in Proc. IEEE Conf. Computer Vision and Pattern Recognition (CVPR) 2021.\r\n\r\n[NEW] Training codes have been released!!\r\n\r\n## Some Results\r\n\r\n \r\n \r\n \r\n \r\n \r\n
\r\n\r\nYou may want to check [this video](http://www.youtube.com/watch?v=UuT5_GK_TWk) which provides a very brief introduction to the work:\r\n\r\n## Prerequisite\r\n\r\n```bash\r\nconda create -n LeReS python=3.7\r\nconda activate LeReS\r\nconda install pytorch==1.6.0 torchvision==0.7.0 cudatoolkit=10.2 -c pytorch\r\npip install -r requirements.txt\r\n```\r\n\r\nIf you only want to test the monocular depth estimation from a single image, you can directly go to 'Quick Start' and follow Step 3. \r\nIf you want to reconstruct 3D shape from a single image, please install [torchsparse](https://github.com/mit-han-lab/torchsparse) packages as follows. If you have any issues with torchsparse, please refer to [torchsparse](https://github.com/mit-han-lab/torchsparse).\r\n\r\n```bash\r\n#torchsparse currently only supports PyTorch 1.6.0 + CUDA 10.2 + CUDNN 7.6.2.\r\nsudo apt-get install libsparsehash-dev\r\npip install --upgrade git+https://github.com/mit-han-lab/torchsparse.git@v1.2.0\r\n```\r\n\r\n\r\n\r\n## Quick Start (Inference)\r\n\r\n1. Download the model weights\r\n * [ResNet50 backbone](https://cloudstor.aarnet.edu.au/plus/s/VVQayrMKPlpVkw9)\r\n * [ResNeXt101 backbone](https://cloudstor.aarnet.edu.au/plus/s/lTIJF4vrvHCAI31)\r\n\r\n2. Prepare data. \r\n * Move the downloaded weights to `LeReS/Minist_Test/` \r\n * Put the testing RGB images to `LeReS/Minist_Test/test_images/`. Predicted depths and reconstructed point cloud are saved under `LeReS/Minist_Test/test_images/outputs`\r\n\r\n3. Test monocular depth prediction. Note that the predicted depths are affine-invariant. \r\n\r\n ```bash\r\n export PYTHONPATH=\"\"\r\n # run the ResNet-50\r\n python ./tools/test_depth.py --load_ckpt res50.pth --backbone resnet50\r\n # run the ResNeXt-101\r\n python ./tools/test_depth.py --load_ckpt res101.pth --backbone resnext101\r\n ```\r\n\r\n4. Test 3D reconstruction from a single image.\r\n\r\n ```bash\r\n export PYTHONPATH=\"\"\r\n # run the ResNet-50\r\n python ./tools/test_shape.py --load_ckpt res50.pth --backbone resnet50\r\n # run the ResNeXt-101\r\n python ./tools/test_shape.py --load_ckpt res101.pth --backbone resnext101\r\n ```\r\n\r\n## Training\r\n\r\n1. (Optional) Run a demo training to verify the python environment.\r\n ```\r\n cd Train/scripts\r\n sh train_demo.sh\r\n ```\r\n\r\n2. Download the training data. Please run 'download_data.sh' to achieve datasets of taskonomy, DiverseDepth, HWRSI and Holopix50k. All data are organized under the `Train/datasets`. The structure of all data are as follows.\r\n\r\n ```\r\n |--Train\r\n | |--data\r\n | |--lib\r\n | |--scripts\r\n | |--tools\r\n | |--datasets\r\n | | |--DiverseDepth\r\n | | | |--annotations\r\n | | | |--depths\r\n | | | |--rgbs\r\n | | |--taskonomy\r\n | | | |--annotations\r\n | | | |--depths\r\n | | | |--rgbs\r\n | | | |--ins_planes\r\n | | |--HRWSI\r\n | | |--Holopix50k\r\n ```\r\n\r\n3. Train the network. The default setting used 4 gpus. If you want to use more gpus, please set `$CUDA_VISIBLE_DEVICES`, such as `export CUDA_VISIBLE_DEVICES=0,1,2,3,4,5,6,7`. The `--batchsize` is the number of samples on a single gpu. \r\n ```\r\n cd Train/scripts\r\n sh train.sh\r\n ```\r\n\r\n4. Test the network on a benchmark. We provide a sample code for testing on NYU. Please download the NYU testing data [test.mat](https://cloudstor.aarnet.edu.au/plus/s/G2ckXCJX3pvrzRU) for evaluation and move it to `Train/datasets/test.mat`. If you want to test on other benchmarks, you can follow the sample code.\r\n ```\r\n cd Train/scripts\r\n sh test.sh\r\n ```\r\n\r\n\r\n## BibTeX\r\n\r\n```BibTeX\r\n@article{yin2022towards,\r\n title={Towards Accurate Reconstruction of 3D Scene Shape from A Single Monocular Image},\r\n author={Yin, Wei and Zhang, Jianming and Wang, Oliver and Niklaus, Simon and Chen, Simon and Liu, Yifan and Shen, Chunhua},\r\n journal={TPAMI},\r\n year={2022}\r\n}\r\n@inproceedings{Wei2021CVPR,\r\n title = {Learning to Recover 3D Scene Shape from a Single Image},\r\n author = {Wei Yin and Jianming Zhang and Oliver Wang and Simon Niklaus and Long Mai and Simon Chen and Chunhua Shen},\r\n booktitle = {Proc. IEEE Conf. Comp. Vis. Patt. Recogn. (CVPR)},\r\n year = {2021}\r\n}\r\n```\r\n\r\n## License\r\n\r\nThis project is under a non-commercial license from Adobe Research. See the [LICENSE file](LICENSE) for details.\r\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076063,"cells":{"text":{"kind":"string","value":"import importlib\r\nimport torch\r\nimport os\r\nfrom collections import OrderedDict\r\n\r\n\r\ndef get_func(func_name):\r\n \"\"\"Helper to return a function object by name. func_name must identify a\r\n function in this module or the path to a function relative to the base\r\n 'modeling' module.\r\n \"\"\"\r\n if func_name == '':\r\n return None\r\n try:\r\n parts = func_name.split('.')\r\n # Refers to a function in this module\r\n if len(parts) == 1:\r\n return globals()[parts[0]]\r\n # Otherwise, assume we're referencing a module under modeling\r\n module_name = 'lib.' + '.'.join(parts[:-1])\r\n module = importlib.import_module(module_name)\r\n return getattr(module, parts[-1])\r\n except Exception:\r\n print('Failed to f1ind function: %s', func_name)\r\n raise\r\n\r\ndef load_ckpt(args, depth_model, shift_model, focal_model):\r\n \"\"\"\r\n Load checkpoint.\r\n \"\"\"\r\n if os.path.isfile(args.load_ckpt):\r\n print(\"loading checkpoint %s\" % args.load_ckpt)\r\n checkpoint = torch.load(args.load_ckpt)\r\n if shift_model is not None:\r\n shift_model.load_state_dict(strip_prefix_if_present(checkpoint['shift_model'], 'module.'),\r\n strict=True)\r\n if focal_model is not None:\r\n focal_model.load_state_dict(strip_prefix_if_present(checkpoint['focal_model'], 'module.'),\r\n strict=True)\r\n depth_model.load_state_dict(strip_prefix_if_present(checkpoint['depth_model'], \"module.\"),\r\n strict=True)\r\n del checkpoint\r\n torch.cuda.empty_cache()\r\n\r\n\r\ndef strip_prefix_if_present(state_dict, prefix):\r\n keys = sorted(state_dict.keys())\r\n if not all(key.startswith(prefix) for key in keys):\r\n return state_dict\r\n stripped_state_dict = OrderedDict()\r\n for key, value in state_dict.items():\r\n stripped_state_dict[key.replace(prefix, \"\")] = value\r\n return stripped_state_dict"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076064,"cells":{"text":{"kind":"string","value":"import torch.nn as nn\r\nimport torchsparse.nn as spnn\r\nfrom torchsparse.point_tensor import PointTensor\r\n\r\nfrom lib.spvcnn_utils import *\r\n__all__ = ['SPVCNN_CLASSIFICATION']\r\n\r\n\r\n\r\nclass BasicConvolutionBlock(nn.Module):\r\n def __init__(self, inc, outc, ks=3, stride=1, dilation=1):\r\n super().__init__()\r\n self.net = nn.Sequential(\r\n spnn.Conv3d(inc,\r\n outc,\r\n kernel_size=ks,\r\n dilation=dilation,\r\n stride=stride),\r\n spnn.BatchNorm(outc),\r\n spnn.ReLU(True))\r\n\r\n def forward(self, x):\r\n out = self.net(x)\r\n return out\r\n\r\n\r\nclass BasicDeconvolutionBlock(nn.Module):\r\n def __init__(self, inc, outc, ks=3, stride=1):\r\n super().__init__()\r\n self.net = nn.Sequential(\r\n spnn.Conv3d(inc,\r\n outc,\r\n kernel_size=ks,\r\n stride=stride,\r\n transpose=True),\r\n spnn.BatchNorm(outc),\r\n spnn.ReLU(True))\r\n\r\n def forward(self, x):\r\n return self.net(x)\r\n\r\n\r\nclass ResidualBlock(nn.Module):\r\n def __init__(self, inc, outc, ks=3, stride=1, dilation=1):\r\n super().__init__()\r\n self.net = nn.Sequential(\r\n spnn.Conv3d(inc,\r\n outc,\r\n kernel_size=ks,\r\n dilation=dilation,\r\n stride=stride), spnn.BatchNorm(outc),\r\n spnn.ReLU(True),\r\n spnn.Conv3d(outc,\r\n outc,\r\n kernel_size=ks,\r\n dilation=dilation,\r\n stride=1),\r\n spnn.BatchNorm(outc)\r\n )\r\n\r\n self.downsample = nn.Sequential() if (inc == outc and stride == 1) else \\\r\n nn.Sequential(\r\n spnn.Conv3d(inc, outc, kernel_size=1, dilation=1, stride=stride),\r\n spnn.BatchNorm(outc)\r\n )\r\n\r\n self.relu = spnn.ReLU(True)\r\n\r\n def forward(self, x):\r\n out = self.relu(self.net(x) + self.downsample(x))\r\n return out\r\n\r\n\r\nclass SPVCNN_CLASSIFICATION(nn.Module):\r\n def __init__(self, **kwargs):\r\n super().__init__()\r\n\r\n cr = kwargs.get('cr', 1.0)\r\n cs = [32, 32, 64, 128, 256, 256, 128, 96, 96]\r\n cs = [int(cr * x) for x in cs]\r\n\r\n if 'pres' in kwargs and 'vres' in kwargs:\r\n self.pres = kwargs['pres']\r\n self.vres = kwargs['vres']\r\n\r\n self.stem = nn.Sequential(\r\n spnn.Conv3d(kwargs['input_channel'], cs[0], kernel_size=3, stride=1),\r\n spnn.BatchNorm(cs[0]),\r\n spnn.ReLU(True),\r\n spnn.Conv3d(cs[0], cs[0], kernel_size=3, stride=1),\r\n spnn.BatchNorm(cs[0]),\r\n spnn.ReLU(True))\r\n\r\n self.stage1 = nn.Sequential(\r\n BasicConvolutionBlock(cs[0], cs[0], ks=2, stride=2, dilation=1),\r\n ResidualBlock(cs[0], cs[1], ks=3, stride=1, dilation=1),\r\n ResidualBlock(cs[1], cs[1], ks=3, stride=1, dilation=1),\r\n )\r\n\r\n self.stage2 = nn.Sequential(\r\n BasicConvolutionBlock(cs[1], cs[1], ks=2, stride=2, dilation=1),\r\n ResidualBlock(cs[1], cs[2], ks=3, stride=1, dilation=1),\r\n ResidualBlock(cs[2], cs[2], ks=3, stride=1, dilation=1),\r\n )\r\n\r\n self.stage3 = nn.Sequential(\r\n BasicConvolutionBlock(cs[2], cs[2], ks=2, stride=2, dilation=1),\r\n ResidualBlock(cs[2], cs[3], ks=3, stride=1, dilation=1),\r\n ResidualBlock(cs[3], cs[3], ks=3, stride=1, dilation=1),\r\n )\r\n\r\n self.stage4 = nn.Sequential(\r\n BasicConvolutionBlock(cs[3], cs[3], ks=2, stride=2, dilation=1),\r\n ResidualBlock(cs[3], cs[4], ks=3, stride=1, dilation=1),\r\n ResidualBlock(cs[4], cs[4], ks=3, stride=1, dilation=1),\r\n )\r\n self.avg_pool = spnn.GlobalAveragePooling()\r\n self.classifier = nn.Sequential(nn.Linear(cs[4], kwargs['num_classes']))\r\n self.point_transforms = nn.ModuleList([\r\n nn.Sequential(\r\n nn.Linear(cs[0], cs[4]),\r\n nn.BatchNorm1d(cs[4]),\r\n nn.ReLU(True),\r\n ),\r\n ])\r\n\r\n self.weight_initialization()\r\n self.dropout = nn.Dropout(0.3, True)\r\n\r\n def weight_initialization(self):\r\n for m in self.modules():\r\n if isinstance(m, nn.BatchNorm1d):\r\n nn.init.constant_(m.weight, 1)\r\n nn.init.constant_(m.bias, 0)\r\n\r\n def forward(self, x):\r\n # x: SparseTensor z: PointTensor\r\n z = PointTensor(x.F, x.C.float())\r\n\r\n x0 = initial_voxelize(z, self.pres, self.vres)\r\n\r\n x0 = self.stem(x0)\r\n z0 = voxel_to_point(x0, z, nearest=False)\r\n z0.F = z0.F\r\n\r\n x1 = point_to_voxel(x0, z0)\r\n x1 = self.stage1(x1)\r\n x2 = self.stage2(x1)\r\n x3 = self.stage3(x2)\r\n x4 = self.stage4(x3)\r\n z1 = voxel_to_point(x4, z0)\r\n z1.F = z1.F + self.point_transforms[0](z0.F)\r\n y1 = point_to_voxel(x4, z1)\r\n pool = self.avg_pool(y1)\r\n out = self.classifier(pool)\r\n\r\n\r\n return out\r\n\r\n\r\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076065,"cells":{"text":{"kind":"string","value":"import os\r\nimport numpy as np\r\nimport torch\r\nfrom torchsparse import SparseTensor\r\nfrom torchsparse.utils import sparse_collate_fn, sparse_quantize\r\nfrom plyfile import PlyData, PlyElement\r\n\r\n\r\ndef init_image_coor(height, width, u0=None, v0=None):\r\n u0 = width / 2.0 if u0 is None else u0\r\n v0 = height / 2.0 if v0 is None else v0\r\n\r\n x_row = np.arange(0, width)\r\n x = np.tile(x_row, (height, 1))\r\n x = x.astype(np.float32)\r\n u_u0 = x - u0\r\n\r\n y_col = np.arange(0, height)\r\n y = np.tile(y_col, (width, 1)).T\r\n y = y.astype(np.float32)\r\n v_v0 = y - v0\r\n return u_u0, v_v0\r\n\r\ndef depth_to_pcd(depth, u_u0, v_v0, f, invalid_value=0):\r\n mask_invalid = depth <= invalid_value\r\n depth[mask_invalid] = 0.0\r\n x = u_u0 / f * depth\r\n y = v_v0 / f * depth\r\n z = depth\r\n pcd = np.stack([x, y, z], axis=2)\r\n return pcd, ~mask_invalid\r\n\r\ndef pcd_to_sparsetensor(pcd, mask_valid, voxel_size=0.01, num_points=100000):\r\n pcd_valid = pcd[mask_valid]\r\n block_ = pcd_valid\r\n block = np.zeros_like(block_)\r\n block[:, :3] = block_[:, :3]\r\n\r\n pc_ = np.round(block_[:, :3] / voxel_size)\r\n pc_ -= pc_.min(0, keepdims=1)\r\n feat_ = block\r\n\r\n # transfer point cloud to voxels\r\n inds = sparse_quantize(pc_,\r\n feat_,\r\n return_index=True,\r\n return_invs=False)\r\n if len(inds) > num_points:\r\n inds = np.random.choice(inds, num_points, replace=False)\r\n\r\n pc = pc_[inds]\r\n feat = feat_[inds]\r\n lidar = SparseTensor(feat, pc)\r\n feed_dict = [{'lidar': lidar}]\r\n inputs = sparse_collate_fn(feed_dict)\r\n return inputs\r\n\r\ndef pcd_uv_to_sparsetensor(pcd, u_u0, v_v0, mask_valid, f= 500.0, voxel_size=0.01, mask_side=None, num_points=100000):\r\n if mask_side is not None:\r\n mask_valid = mask_valid & mask_side\r\n pcd_valid = pcd[mask_valid]\r\n u_u0_valid = u_u0[mask_valid][:, np.newaxis] / f\r\n v_v0_valid = v_v0[mask_valid][:, np.newaxis] / f\r\n\r\n block_ = np.concatenate([pcd_valid, u_u0_valid, v_v0_valid], axis=1)\r\n block = np.zeros_like(block_)\r\n block[:, :] = block_[:, :]\r\n\r\n\r\n pc_ = np.round(block_[:, :3] / voxel_size)\r\n pc_ -= pc_.min(0, keepdims=1)\r\n feat_ = block\r\n\r\n # transfer point cloud to voxels\r\n inds = sparse_quantize(pc_,\r\n feat_,\r\n return_index=True,\r\n return_invs=False)\r\n if len(inds) > num_points:\r\n inds = np.random.choice(inds, num_points, replace=False)\r\n\r\n pc = pc_[inds]\r\n feat = feat_[inds]\r\n lidar = SparseTensor(feat, pc)\r\n feed_dict = [{'lidar': lidar}]\r\n inputs = sparse_collate_fn(feed_dict)\r\n return inputs\r\n\r\n\r\ndef refine_focal_one_step(depth, focal, model, u0, v0):\r\n # reconstruct PCD from depth\r\n u_u0, v_v0 = init_image_coor(depth.shape[0], depth.shape[1], u0=u0, v0=v0)\r\n pcd, mask_valid = depth_to_pcd(depth, u_u0, v_v0, f=focal, invalid_value=0)\r\n # input for the voxelnet\r\n feed_dict = pcd_uv_to_sparsetensor(pcd, u_u0, v_v0, mask_valid, f=focal, voxel_size=0.005, mask_side=None)\r\n inputs = feed_dict['lidar'].cuda()\r\n\r\n outputs = model(inputs)\r\n return outputs\r\n\r\ndef refine_shift_one_step(depth_wshift, model, focal, u0, v0):\r\n # reconstruct PCD from depth\r\n u_u0, v_v0 = init_image_coor(depth_wshift.shape[0], depth_wshift.shape[1], u0=u0, v0=v0)\r\n pcd_wshift, mask_valid = depth_to_pcd(depth_wshift, u_u0, v_v0, f=focal, invalid_value=0)\r\n # input for the voxelnet\r\n feed_dict = pcd_to_sparsetensor(pcd_wshift, mask_valid, voxel_size=0.01)\r\n inputs = feed_dict['lidar'].cuda()\r\n\r\n outputs = model(inputs)\r\n return outputs\r\n\r\ndef refine_focal(depth, focal, model, u0, v0):\r\n last_scale = 1\r\n focal_tmp = np.copy(focal)\r\n for i in range(1):\r\n scale = refine_focal_one_step(depth, focal_tmp, model, u0, v0)\r\n focal_tmp = focal_tmp / scale.item()\r\n last_scale = last_scale * scale\r\n return torch.tensor([[last_scale]])\r\n\r\ndef refine_shift(depth_wshift, model, focal, u0, v0):\r\n depth_wshift_tmp = np.copy(depth_wshift)\r\n last_shift = 0\r\n for i in range(1):\r\n shift = refine_shift_one_step(depth_wshift_tmp, model, focal, u0, v0)\r\n shift = shift if shift.item() < 0.7 else torch.tensor([[0.7]])\r\n depth_wshift_tmp -= shift.item()\r\n last_shift += shift.item()\r\n return torch.tensor([[last_shift]])\r\n\r\ndef reconstruct_3D(depth, f):\r\n \"\"\"\r\n Reconstruct depth to 3D pointcloud with the provided focal length.\r\n Return:\r\n pcd: N X 3 array, point cloud\r\n \"\"\"\r\n cu = depth.shape[1] / 2\r\n cv = depth.shape[0] / 2\r\n width = depth.shape[1]\r\n height = depth.shape[0]\r\n row = np.arange(0, width, 1)\r\n u = np.array([row for i in np.arange(height)])\r\n col = np.arange(0, height, 1)\r\n v = np.array([col for i in np.arange(width)])\r\n v = v.transpose(1, 0)\r\n\r\n if f > 1e5:\r\n print('Infinit focal length!!!')\r\n x = u - cu\r\n y = v - cv\r\n z = depth / depth.max() * x.max()\r\n else:\r\n x = (u - cu) * depth / f\r\n y = (v - cv) * depth / f\r\n z = depth\r\n\r\n x = np.reshape(x, (width * height, 1)).astype(np.float)\r\n y = np.reshape(y, (width * height, 1)).astype(np.float)\r\n z = np.reshape(z, (width * height, 1)).astype(np.float)\r\n pcd = np.concatenate((x, y, z), axis=1)\r\n pcd = pcd.astype(np.int)\r\n return pcd\r\n\r\ndef save_point_cloud(pcd, rgb, filename, binary=True):\r\n \"\"\"Save an RGB point cloud as a PLY file.\r\n\r\n :paras\r\n @pcd: Nx3 matrix, the XYZ coordinates\r\n @rgb: NX3 matrix, the rgb colors for each 3D point\r\n \"\"\"\r\n assert pcd.shape[0] == rgb.shape[0]\r\n\r\n if rgb is None:\r\n gray_concat = np.tile(np.array([128], dtype=np.uint8), (pcd.shape[0], 3))\r\n points_3d = np.hstack((pcd, gray_concat))\r\n else:\r\n points_3d = np.hstack((pcd, rgb))\r\n python_types = (float, float, float, int, int, int)\r\n npy_types = [('x', 'f4'), ('y', 'f4'), ('z', 'f4'), ('red', 'u1'), ('green', 'u1'),\r\n ('blue', 'u1')]\r\n if binary is True:\r\n # Format into NumPy structured array\r\n vertices = []\r\n for row_idx in range(points_3d.shape[0]):\r\n cur_point = points_3d[row_idx]\r\n vertices.append(tuple(dtype(point) for dtype, point in zip(python_types, cur_point)))\r\n vertices_array = np.array(vertices, dtype=npy_types)\r\n el = PlyElement.describe(vertices_array, 'vertex')\r\n\r\n # Write\r\n PlyData([el]).write(filename)\r\n else:\r\n x = np.squeeze(points_3d[:, 0])\r\n y = np.squeeze(points_3d[:, 1])\r\n z = np.squeeze(points_3d[:, 2])\r\n r = np.squeeze(points_3d[:, 3])\r\n g = np.squeeze(points_3d[:, 4])\r\n b = np.squeeze(points_3d[:, 5])\r\n\r\n ply_head = 'ply\\n' \\\r\n 'format ascii 1.0\\n' \\\r\n 'element vertex %d\\n' \\\r\n 'property float x\\n' \\\r\n 'property float y\\n' \\\r\n 'property float z\\n' \\\r\n 'property uchar red\\n' \\\r\n 'property uchar green\\n' \\\r\n 'property uchar blue\\n' \\\r\n 'end_header' % r.shape[0]\r\n # ---- Save ply data to disk\r\n np.savetxt(filename, np.column_stack((x, y, z, r, g, b)), fmt=\"%d %d %d %d %d %d\", header=ply_head, comments='')\r\n\r\ndef reconstruct_depth(depth, rgb, dir, pcd_name, focal):\r\n \"\"\"\r\n para disp: disparity, [h, w]\r\n para rgb: rgb image, [h, w, 3], in rgb format\r\n \"\"\"\r\n rgb = np.squeeze(rgb)\r\n depth = np.squeeze(depth)\r\n\r\n mask = depth < 1e-8\r\n depth[mask] = 0\r\n depth = depth / depth.max() * 10000\r\n\r\n pcd = reconstruct_3D(depth, f=focal)\r\n rgb_n = np.reshape(rgb, (-1, 3))\r\n save_point_cloud(pcd, rgb_n, os.path.join(dir, pcd_name + '.ply'))\r\n\r\n\r\ndef recover_metric_depth(pred, gt):\r\n if type(pred).__module__ == torch.__name__:\r\n pred = pred.cpu().numpy()\r\n if type(gt).__module__ == torch.__name__:\r\n gt = gt.cpu().numpy()\r\n gt = gt.squeeze()\r\n pred = pred.squeeze()\r\n mask = (gt > 1e-8) & (pred > 1e-8)\r\n\r\n gt_mask = gt[mask]\r\n pred_mask = pred[mask]\r\n a, b = np.polyfit(pred_mask, gt_mask, deg=1)\r\n pred_metric = a * pred + b\r\n return pred_metric\r\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076066,"cells":{"text":{"kind":"string","value":"import torch\r\nimport torch.nn as nn\r\n\r\nfrom lib import network_auxi as network\r\nfrom lib.net_tools import get_func\r\n\r\nclass RelDepthModel(nn.Module):\r\n def __init__(self, backbone='resnet50'):\r\n super(RelDepthModel, self).__init__()\r\n if backbone == 'resnet50':\r\n encoder = 'resnet50_stride32'\r\n elif backbone == 'resnext101':\r\n encoder = 'resnext101_stride32x8d'\r\n self.depth_model = DepthModel(encoder)\r\n\r\n def inference(self, rgb):\r\n with torch.no_grad():\r\n input = rgb.cuda()\r\n depth = self.depth_model(input)\r\n pred_depth_out = depth - depth.min() + 0.01\r\n return pred_depth_out\r\n\r\n\r\nclass DepthModel(nn.Module):\r\n def __init__(self, encoder):\r\n super(DepthModel, self).__init__()\r\n backbone = network.__name__.split('.')[-1] + '.' + encoder\r\n self.encoder_modules = get_func(backbone)()\r\n self.decoder_modules = network.Decoder()\r\n\r\n def forward(self, x):\r\n lateral_out = self.encoder_modules(x)\r\n out_logit = self.decoder_modules(lateral_out)\r\n return out_logit"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076067,"cells":{"text":{"kind":"string","value":"#!/usr/bin/env python\r\n# coding: utf-8\r\nimport torch.nn as nn\r\n\r\ntry:\r\n from urllib import urlretrieve\r\nexcept ImportError:\r\n from urllib.request import urlretrieve\r\n\r\n__all__ = ['resnext101_32x8d']\r\n\r\n\r\nmodel_urls = {\r\n 'resnext50_32x4d': 'https://download.pytorch.org/models/resnext50_32x4d-7cdf4587.pth',\r\n 'resnext101_32x8d': 'https://download.pytorch.org/models/resnext101_32x8d-8ba56ff5.pth',\r\n}\r\n\r\n\r\ndef conv3x3(in_planes, out_planes, stride=1, groups=1, dilation=1):\r\n \"\"\"3x3 convolution with padding\"\"\"\r\n return nn.Conv2d(in_planes, out_planes, kernel_size=3, stride=stride,\r\n padding=dilation, groups=groups, bias=False, dilation=dilation)\r\n\r\n\r\ndef conv1x1(in_planes, out_planes, stride=1):\r\n \"\"\"1x1 convolution\"\"\"\r\n return nn.Conv2d(in_planes, out_planes, kernel_size=1, stride=stride, bias=False)\r\n\r\n\r\nclass BasicBlock(nn.Module):\r\n expansion = 1\r\n\r\n def __init__(self, inplanes, planes, stride=1, downsample=None, groups=1,\r\n base_width=64, dilation=1, norm_layer=None):\r\n super(BasicBlock, self).__init__()\r\n if norm_layer is None:\r\n norm_layer = nn.BatchNorm2d\r\n if groups != 1 or base_width != 64:\r\n raise ValueError('BasicBlock only supports groups=1 and base_width=64')\r\n if dilation > 1:\r\n raise NotImplementedError(\"Dilation > 1 not supported in BasicBlock\")\r\n # Both self.conv1 and self.downsample layers downsample the input when stride != 1\r\n self.conv1 = conv3x3(inplanes, planes, stride)\r\n self.bn1 = norm_layer(planes)\r\n self.relu = nn.ReLU(inplace=True)\r\n self.conv2 = conv3x3(planes, planes)\r\n self.bn2 = norm_layer(planes)\r\n self.downsample = downsample\r\n self.stride = stride\r\n\r\n def forward(self, x):\r\n identity = x\r\n\r\n out = self.conv1(x)\r\n out = self.bn1(out)\r\n out = self.relu(out)\r\n\r\n out = self.conv2(out)\r\n out = self.bn2(out)\r\n\r\n if self.downsample is not None:\r\n identity = self.downsample(x)\r\n\r\n out += identity\r\n out = self.relu(out)\r\n\r\n return out\r\n\r\n\r\nclass Bottleneck(nn.Module):\r\n # Bottleneck in torchvision places the stride for downsampling at 3x3 convolution(self.conv2)\r\n # while original implementation places the stride at the first 1x1 convolution(self.conv1)\r\n # according to \"Deep residual learning for image recognition\"https://arxiv.org/abs/1512.03385.\r\n # This variant is also known as ResNet V1.5 and improves accuracy according to\r\n # https://ngc.nvidia.com/catalog/model-scripts/nvidia:resnet_50_v1_5_for_pytorch.\r\n\r\n expansion = 4\r\n\r\n def __init__(self, inplanes, planes, stride=1, downsample=None, groups=1,\r\n base_width=64, dilation=1, norm_layer=None):\r\n super(Bottleneck, self).__init__()\r\n if norm_layer is None:\r\n norm_layer = nn.BatchNorm2d\r\n width = int(planes * (base_width / 64.)) * groups\r\n # Both self.conv2 and self.downsample layers downsample the input when stride != 1\r\n self.conv1 = conv1x1(inplanes, width)\r\n self.bn1 = norm_layer(width)\r\n self.conv2 = conv3x3(width, width, stride, groups, dilation)\r\n self.bn2 = norm_layer(width)\r\n self.conv3 = conv1x1(width, planes * self.expansion)\r\n self.bn3 = norm_layer(planes * self.expansion)\r\n self.relu = nn.ReLU(inplace=True)\r\n self.downsample = downsample\r\n self.stride = stride\r\n\r\n def forward(self, x):\r\n identity = x\r\n\r\n out = self.conv1(x)\r\n out = self.bn1(out)\r\n out = self.relu(out)\r\n\r\n out = self.conv2(out)\r\n out = self.bn2(out)\r\n out = self.relu(out)\r\n\r\n out = self.conv3(out)\r\n out = self.bn3(out)\r\n\r\n if self.downsample is not None:\r\n identity = self.downsample(x)\r\n\r\n out += identity\r\n out = self.relu(out)\r\n\r\n return out\r\n\r\n\r\nclass ResNet(nn.Module):\r\n\r\n def __init__(self, block, layers, num_classes=1000, zero_init_residual=False,\r\n groups=1, width_per_group=64, replace_stride_with_dilation=None,\r\n norm_layer=None):\r\n super(ResNet, self).__init__()\r\n if norm_layer is None:\r\n norm_layer = nn.BatchNorm2d\r\n self._norm_layer = norm_layer\r\n\r\n self.inplanes = 64\r\n self.dilation = 1\r\n if replace_stride_with_dilation is None:\r\n # each element in the tuple indicates if we should replace\r\n # the 2x2 stride with a dilated convolution instead\r\n replace_stride_with_dilation = [False, False, False]\r\n if len(replace_stride_with_dilation) != 3:\r\n raise ValueError(\"replace_stride_with_dilation should be None \"\r\n \"or a 3-element tuple, got {}\".format(replace_stride_with_dilation))\r\n self.groups = groups\r\n self.base_width = width_per_group\r\n self.conv1 = nn.Conv2d(3, self.inplanes, kernel_size=7, stride=2, padding=3,\r\n bias=False)\r\n self.bn1 = norm_layer(self.inplanes)\r\n self.relu = nn.ReLU(inplace=True)\r\n self.maxpool = nn.MaxPool2d(kernel_size=3, stride=2, padding=1)\r\n self.layer1 = self._make_layer(block, 64, layers[0])\r\n self.layer2 = self._make_layer(block, 128, layers[1], stride=2,\r\n dilate=replace_stride_with_dilation[0])\r\n self.layer3 = self._make_layer(block, 256, layers[2], stride=2,\r\n dilate=replace_stride_with_dilation[1])\r\n self.layer4 = self._make_layer(block, 512, layers[3], stride=2,\r\n dilate=replace_stride_with_dilation[2])\r\n #self.avgpool = nn.AdaptiveAvgPool2d((1, 1))\r\n #self.fc = nn.Linear(512 * block.expansion, num_classes)\r\n\r\n for m in self.modules():\r\n if isinstance(m, nn.Conv2d):\r\n nn.init.kaiming_normal_(m.weight, mode='fan_out', nonlinearity='relu')\r\n elif isinstance(m, (nn.BatchNorm2d, nn.GroupNorm)):\r\n nn.init.constant_(m.weight, 1)\r\n nn.init.constant_(m.bias, 0)\r\n\r\n # Zero-initialize the last BN in each residual branch,\r\n # so that the residual branch starts with zeros, and each residual block behaves like an identity.\r\n # This improves the model by 0.2~0.3% according to https://arxiv.org/abs/1706.02677\r\n if zero_init_residual:\r\n for m in self.modules():\r\n if isinstance(m, Bottleneck):\r\n nn.init.constant_(m.bn3.weight, 0)\r\n elif isinstance(m, BasicBlock):\r\n nn.init.constant_(m.bn2.weight, 0)\r\n\r\n def _make_layer(self, block, planes, blocks, stride=1, dilate=False):\r\n norm_layer = self._norm_layer\r\n downsample = None\r\n previous_dilation = self.dilation\r\n if dilate:\r\n self.dilation *= stride\r\n stride = 1\r\n if stride != 1 or self.inplanes != planes * block.expansion:\r\n downsample = nn.Sequential(\r\n conv1x1(self.inplanes, planes * block.expansion, stride),\r\n norm_layer(planes * block.expansion),\r\n )\r\n\r\n layers = []\r\n layers.append(block(self.inplanes, planes, stride, downsample, self.groups,\r\n self.base_width, previous_dilation, norm_layer))\r\n self.inplanes = planes * block.expansion\r\n for _ in range(1, blocks):\r\n layers.append(block(self.inplanes, planes, groups=self.groups,\r\n base_width=self.base_width, dilation=self.dilation,\r\n norm_layer=norm_layer))\r\n\r\n return nn.Sequential(*layers)\r\n\r\n def _forward_impl(self, x):\r\n # See note [TorchScript super()]\r\n features = []\r\n x = self.conv1(x)\r\n x = self.bn1(x)\r\n x = self.relu(x)\r\n x = self.maxpool(x)\r\n\r\n x = self.layer1(x)\r\n features.append(x)\r\n\r\n x = self.layer2(x)\r\n features.append(x)\r\n\r\n x = self.layer3(x)\r\n features.append(x)\r\n\r\n x = self.layer4(x)\r\n features.append(x)\r\n\r\n #x = self.avgpool(x)\r\n #x = torch.flatten(x, 1)\r\n #x = self.fc(x)\r\n\r\n return features\r\n\r\n def forward(self, x):\r\n return self._forward_impl(x)\r\n\r\n\r\n\r\ndef resnext101_32x8d(pretrained=True, **kwargs):\r\n \"\"\"Constructs a ResNet-152 model.\r\n Args:\r\n pretrained (bool): If True, returns a model pre-trained on ImageNet\r\n \"\"\"\r\n kwargs['groups'] = 32\r\n kwargs['width_per_group'] = 8\r\n\r\n model = ResNet(Bottleneck, [3, 4, 23, 3], **kwargs)\r\n return model\r\n\r\n\r\n\r\nif __name__ == '__main__':\r\n import torch\r\n model = resnext101_32x8d(True).cuda()\r\n\r\n rgb = torch.rand((2, 3, 256, 256)).cuda()\r\n out = model(rgb)\r\n print(len(out))\r\n\r\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076068,"cells":{"text":{"kind":"string","value":"\r\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076069,"cells":{"text":{"kind":"string","value":"import torch.nn as nn\r\nimport torch.nn as NN\r\n\r\n__all__ = ['ResNet', 'resnet18', 'resnet34', 'resnet50', 'resnet101',\r\n 'resnet152']\r\n\r\n\r\nmodel_urls = {\r\n 'resnet18': 'https://download.pytorch.org/models/resnet18-5c106cde.pth',\r\n 'resnet34': 'https://download.pytorch.org/models/resnet34-333f7ec4.pth',\r\n 'resnet50': 'https://download.pytorch.org/models/resnet50-19c8e357.pth',\r\n 'resnet101': 'https://download.pytorch.org/models/resnet101-5d3b4d8f.pth',\r\n 'resnet152': 'https://download.pytorch.org/models/resnet152-b121ed2d.pth',\r\n}\r\n\r\n\r\ndef conv3x3(in_planes, out_planes, stride=1):\r\n \"\"\"3x3 convolution with padding\"\"\"\r\n return nn.Conv2d(in_planes, out_planes, kernel_size=3, stride=stride,\r\n padding=1, bias=False)\r\n\r\n\r\nclass BasicBlock(nn.Module):\r\n expansion = 1\r\n\r\n def __init__(self, inplanes, planes, stride=1, downsample=None):\r\n super(BasicBlock, self).__init__()\r\n self.conv1 = conv3x3(inplanes, planes, stride)\r\n self.bn1 = NN.BatchNorm2d(planes) #NN.BatchNorm2d\r\n self.relu = nn.ReLU(inplace=True)\r\n self.conv2 = conv3x3(planes, planes)\r\n self.bn2 = NN.BatchNorm2d(planes) #NN.BatchNorm2d\r\n self.downsample = downsample\r\n self.stride = stride\r\n\r\n def forward(self, x):\r\n residual = x\r\n\r\n out = self.conv1(x)\r\n out = self.bn1(out)\r\n out = self.relu(out)\r\n\r\n out = self.conv2(out)\r\n out = self.bn2(out)\r\n\r\n if self.downsample is not None:\r\n residual = self.downsample(x)\r\n\r\n out += residual\r\n out = self.relu(out)\r\n\r\n return out\r\n\r\n\r\nclass Bottleneck(nn.Module):\r\n expansion = 4\r\n\r\n def __init__(self, inplanes, planes, stride=1, downsample=None):\r\n super(Bottleneck, self).__init__()\r\n self.conv1 = nn.Conv2d(inplanes, planes, kernel_size=1, bias=False)\r\n self.bn1 = NN.BatchNorm2d(planes) #NN.BatchNorm2d\r\n self.conv2 = nn.Conv2d(planes, planes, kernel_size=3, stride=stride,\r\n padding=1, bias=False)\r\n self.bn2 = NN.BatchNorm2d(planes) #NN.BatchNorm2d\r\n self.conv3 = nn.Conv2d(planes, planes * self.expansion, kernel_size=1, bias=False)\r\n self.bn3 = NN.BatchNorm2d(planes * self.expansion) #NN.BatchNorm2d\r\n self.relu = nn.ReLU(inplace=True)\r\n self.downsample = downsample\r\n self.stride = stride\r\n\r\n def forward(self, x):\r\n residual = x\r\n\r\n out = self.conv1(x)\r\n out = self.bn1(out)\r\n out = self.relu(out)\r\n\r\n out = self.conv2(out)\r\n out = self.bn2(out)\r\n out = self.relu(out)\r\n\r\n out = self.conv3(out)\r\n out = self.bn3(out)\r\n\r\n if self.downsample is not None:\r\n residual = self.downsample(x)\r\n\r\n out += residual\r\n out = self.relu(out)\r\n\r\n return out\r\n\r\n\r\nclass ResNet(nn.Module):\r\n\r\n def __init__(self, block, layers, num_classes=1000):\r\n self.inplanes = 64\r\n super(ResNet, self).__init__()\r\n self.conv1 = nn.Conv2d(3, 64, kernel_size=7, stride=2, padding=3,\r\n bias=False)\r\n self.bn1 = NN.BatchNorm2d(64) #NN.BatchNorm2d\r\n self.relu = nn.ReLU(inplace=True)\r\n self.maxpool = nn.MaxPool2d(kernel_size=3, stride=2, padding=1)\r\n self.layer1 = self._make_layer(block, 64, layers[0])\r\n self.layer2 = self._make_layer(block, 128, layers[1], stride=2)\r\n self.layer3 = self._make_layer(block, 256, layers[2], stride=2)\r\n self.layer4 = self._make_layer(block, 512, layers[3], stride=2)\r\n #self.avgpool = nn.AvgPool2d(7, stride=1)\r\n #self.fc = nn.Linear(512 * block.expansion, num_classes)\r\n\r\n for m in self.modules():\r\n if isinstance(m, nn.Conv2d):\r\n nn.init.kaiming_normal_(m.weight, mode='fan_out', nonlinearity='relu')\r\n elif isinstance(m, nn.BatchNorm2d):\r\n nn.init.constant_(m.weight, 1)\r\n nn.init.constant_(m.bias, 0)\r\n\r\n def _make_layer(self, block, planes, blocks, stride=1):\r\n downsample = None\r\n if stride != 1 or self.inplanes != planes * block.expansion:\r\n downsample = nn.Sequential(\r\n nn.Conv2d(self.inplanes, planes * block.expansion,\r\n kernel_size=1, stride=stride, bias=False),\r\n NN.BatchNorm2d(planes * block.expansion), #NN.BatchNorm2d\r\n )\r\n\r\n layers = []\r\n layers.append(block(self.inplanes, planes, stride, downsample))\r\n self.inplanes = planes * block.expansion\r\n for i in range(1, blocks):\r\n layers.append(block(self.inplanes, planes))\r\n\r\n return nn.Sequential(*layers)\r\n\r\n def forward(self, x):\r\n features = []\r\n\r\n x = self.conv1(x)\r\n x = self.bn1(x)\r\n x = self.relu(x)\r\n x = self.maxpool(x)\r\n\r\n x = self.layer1(x)\r\n features.append(x)\r\n x = self.layer2(x)\r\n features.append(x)\r\n x = self.layer3(x)\r\n features.append(x)\r\n x = self.layer4(x)\r\n features.append(x)\r\n\r\n return features\r\n\r\n\r\ndef resnet18(pretrained=True, **kwargs):\r\n \"\"\"Constructs a ResNet-18 model.\r\n Args:\r\n pretrained (bool): If True, returns a model pre-trained on ImageNet\r\n \"\"\"\r\n model = ResNet(BasicBlock, [2, 2, 2, 2], **kwargs)\r\n return model\r\n\r\n\r\ndef resnet34(pretrained=True, **kwargs):\r\n \"\"\"Constructs a ResNet-34 model.\r\n Args:\r\n pretrained (bool): If True, returns a model pre-trained on ImageNet\r\n \"\"\"\r\n model = ResNet(BasicBlock, [3, 4, 6, 3], **kwargs)\r\n return model\r\n\r\n\r\ndef resnet50(pretrained=True, **kwargs):\r\n \"\"\"Constructs a ResNet-50 model.\r\n Args:\r\n pretrained (bool): If True, returns a model pre-trained on ImageNet\r\n \"\"\"\r\n model = ResNet(Bottleneck, [3, 4, 6, 3], **kwargs)\r\n\r\n return model\r\n\r\n\r\ndef resnet101(pretrained=True, **kwargs):\r\n \"\"\"Constructs a ResNet-101 model.\r\n Args:\r\n pretrained (bool): If True, returns a model pre-trained on ImageNet\r\n \"\"\"\r\n model = ResNet(Bottleneck, [3, 4, 23, 3], **kwargs)\r\n\r\n return model\r\n\r\n\r\ndef resnet152(pretrained=True, **kwargs):\r\n \"\"\"Constructs a ResNet-152 model.\r\n Args:\r\n pretrained (bool): If True, returns a model pre-trained on ImageNet\r\n \"\"\"\r\n model = ResNet(Bottleneck, [3, 8, 36, 3], **kwargs)\r\n return model\r\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076070,"cells":{"text":{"kind":"string","value":"import torch\r\nimport torch.nn as nn\r\nimport torch.nn.init as init\r\n\r\nfrom lib import Resnet, Resnext_torch\r\n\r\n\r\ndef resnet50_stride32():\r\n return DepthNet(backbone='resnet', depth=50, upfactors=[2, 2, 2, 2])\r\n\r\ndef resnext101_stride32x8d():\r\n return DepthNet(backbone='resnext101_32x8d', depth=101, upfactors=[2, 2, 2, 2])\r\n\r\n\r\nclass Decoder(nn.Module):\r\n def __init__(self):\r\n super(Decoder, self).__init__()\r\n self.inchannels = [256, 512, 1024, 2048]\r\n self.midchannels = [256, 256, 256, 512]\r\n self.upfactors = [2,2,2,2]\r\n self.outchannels = 1\r\n\r\n self.conv = FTB(inchannels=self.inchannels[3], midchannels=self.midchannels[3])\r\n self.conv1 = nn.Conv2d(in_channels=self.midchannels[3], out_channels=self.midchannels[2], kernel_size=3, padding=1, stride=1, bias=True)\r\n self.upsample = nn.Upsample(scale_factor=self.upfactors[3], mode='bilinear', align_corners=True)\r\n \r\n self.ffm2 = FFM(inchannels=self.inchannels[2], midchannels=self.midchannels[2], outchannels = self.midchannels[2], upfactor=self.upfactors[2])\r\n self.ffm1 = FFM(inchannels=self.inchannels[1], midchannels=self.midchannels[1], outchannels = self.midchannels[1], upfactor=self.upfactors[1])\r\n self.ffm0 = FFM(inchannels=self.inchannels[0], midchannels=self.midchannels[0], outchannels = self.midchannels[0], upfactor=self.upfactors[0])\r\n \r\n self.outconv = AO(inchannels=self.midchannels[0], outchannels=self.outchannels, upfactor=2)\r\n self._init_params()\r\n \r\n def _init_params(self):\r\n for m in self.modules():\r\n if isinstance(m, nn.Conv2d):\r\n init.normal_(m.weight, std=0.01)\r\n if m.bias is not None:\r\n init.constant_(m.bias, 0)\r\n elif isinstance(m, nn.ConvTranspose2d):\r\n init.normal_(m.weight, std=0.01)\r\n if m.bias is not None:\r\n init.constant_(m.bias, 0)\r\n elif isinstance(m, nn.BatchNorm2d): #NN.BatchNorm2d\r\n init.constant_(m.weight, 1)\r\n init.constant_(m.bias, 0)\r\n elif isinstance(m, nn.Linear):\r\n init.normal_(m.weight, std=0.01)\r\n if m.bias is not None:\r\n init.constant_(m.bias, 0)\r\n \r\n def forward(self, features):\r\n x_32x = self.conv(features[3]) # 1/32\r\n x_32 = self.conv1(x_32x)\r\n x_16 = self.upsample(x_32) # 1/16\r\n\r\n x_8 = self.ffm2(features[2], x_16) # 1/8\r\n x_4 = self.ffm1(features[1], x_8) # 1/4\r\n x_2 = self.ffm0(features[0], x_4) # 1/2\r\n #-----------------------------------------\r\n x = self.outconv(x_2) # original size\r\n return x\r\n\r\nclass DepthNet(nn.Module):\r\n __factory = {\r\n 18: Resnet.resnet18,\r\n 34: Resnet.resnet34,\r\n 50: Resnet.resnet50,\r\n 101: Resnet.resnet101,\r\n 152: Resnet.resnet152\r\n }\r\n def __init__(self,\r\n backbone='resnet',\r\n depth=50,\r\n upfactors=[2, 2, 2, 2]):\r\n super(DepthNet, self).__init__()\r\n self.backbone = backbone\r\n self.depth = depth\r\n self.pretrained = False\r\n self.inchannels = [256, 512, 1024, 2048]\r\n self.midchannels = [256, 256, 256, 512]\r\n self.upfactors = upfactors\r\n self.outchannels = 1\r\n\r\n # Build model\r\n if self.backbone == 'resnet':\r\n if self.depth not in DepthNet.__factory:\r\n raise KeyError(\"Unsupported depth:\", self.depth)\r\n self.encoder = DepthNet.__factory[depth](pretrained=self.pretrained)\r\n elif self.backbone == 'resnext101_32x8d':\r\n self.encoder = Resnext_torch.resnext101_32x8d(pretrained=self.pretrained)\r\n else:\r\n self.encoder = Resnext_torch.resnext101(pretrained=self.pretrained)\r\n\r\n def forward(self, x):\r\n x = self.encoder(x) # 1/32, 1/16, 1/8, 1/4\r\n return x\r\n\r\n\r\nclass FTB(nn.Module):\r\n def __init__(self, inchannels, midchannels=512):\r\n super(FTB, self).__init__()\r\n self.in1 = inchannels\r\n self.mid = midchannels\r\n self.conv1 = nn.Conv2d(in_channels=self.in1, out_channels=self.mid, kernel_size=3, padding=1, stride=1,\r\n bias=True)\r\n # NN.BatchNorm2d\r\n self.conv_branch = nn.Sequential(nn.ReLU(inplace=True), \\\r\n nn.Conv2d(in_channels=self.mid, out_channels=self.mid, kernel_size=3,\r\n padding=1, stride=1, bias=True), \\\r\n nn.BatchNorm2d(num_features=self.mid), \\\r\n nn.ReLU(inplace=True), \\\r\n nn.Conv2d(in_channels=self.mid, out_channels=self.mid, kernel_size=3,\r\n padding=1, stride=1, bias=True))\r\n self.relu = nn.ReLU(inplace=True)\r\n\r\n self.init_params()\r\n\r\n def forward(self, x):\r\n x = self.conv1(x)\r\n x = x + self.conv_branch(x)\r\n x = self.relu(x)\r\n\r\n return x\r\n\r\n def init_params(self):\r\n for m in self.modules():\r\n if isinstance(m, nn.Conv2d):\r\n init.normal_(m.weight, std=0.01)\r\n if m.bias is not None:\r\n init.constant_(m.bias, 0)\r\n elif isinstance(m, nn.ConvTranspose2d):\r\n # init.kaiming_normal_(m.weight, mode='fan_out')\r\n init.normal_(m.weight, std=0.01)\r\n # init.xavier_normal_(m.weight)\r\n if m.bias is not None:\r\n init.constant_(m.bias, 0)\r\n elif isinstance(m, nn.BatchNorm2d): # NN.BatchNorm2d\r\n init.constant_(m.weight, 1)\r\n init.constant_(m.bias, 0)\r\n elif isinstance(m, nn.Linear):\r\n init.normal_(m.weight, std=0.01)\r\n if m.bias is not None:\r\n init.constant_(m.bias, 0)\r\n\r\n\r\nclass ATA(nn.Module):\r\n def __init__(self, inchannels, reduction=8):\r\n super(ATA, self).__init__()\r\n self.inchannels = inchannels\r\n self.avg_pool = nn.AdaptiveAvgPool2d(1)\r\n self.fc = nn.Sequential(nn.Linear(self.inchannels * 2, self.inchannels // reduction),\r\n nn.ReLU(inplace=True),\r\n nn.Linear(self.inchannels // reduction, self.inchannels),\r\n nn.Sigmoid())\r\n self.init_params()\r\n\r\n def forward(self, low_x, high_x):\r\n n, c, _, _ = low_x.size()\r\n x = torch.cat([low_x, high_x], 1)\r\n x = self.avg_pool(x)\r\n x = x.view(n, -1)\r\n x = self.fc(x).view(n, c, 1, 1)\r\n x = low_x * x + high_x\r\n\r\n return x\r\n\r\n def init_params(self):\r\n for m in self.modules():\r\n if isinstance(m, nn.Conv2d):\r\n # init.kaiming_normal_(m.weight, mode='fan_out')\r\n # init.normal(m.weight, std=0.01)\r\n init.xavier_normal_(m.weight)\r\n if m.bias is not None:\r\n init.constant_(m.bias, 0)\r\n elif isinstance(m, nn.ConvTranspose2d):\r\n # init.kaiming_normal_(m.weight, mode='fan_out')\r\n # init.normal_(m.weight, std=0.01)\r\n init.xavier_normal_(m.weight)\r\n if m.bias is not None:\r\n init.constant_(m.bias, 0)\r\n elif isinstance(m, nn.BatchNorm2d): # NN.BatchNorm2d\r\n init.constant_(m.weight, 1)\r\n init.constant_(m.bias, 0)\r\n elif isinstance(m, nn.Linear):\r\n init.normal_(m.weight, std=0.01)\r\n if m.bias is not None:\r\n init.constant_(m.bias, 0)\r\n\r\n\r\nclass FFM(nn.Module):\r\n def __init__(self, inchannels, midchannels, outchannels, upfactor=2):\r\n super(FFM, self).__init__()\r\n self.inchannels = inchannels\r\n self.midchannels = midchannels\r\n self.outchannels = outchannels\r\n self.upfactor = upfactor\r\n\r\n self.ftb1 = FTB(inchannels=self.inchannels, midchannels=self.midchannels)\r\n # self.ata = ATA(inchannels = self.midchannels)\r\n self.ftb2 = FTB(inchannels=self.midchannels, midchannels=self.outchannels)\r\n\r\n self.upsample = nn.Upsample(scale_factor=self.upfactor, mode='bilinear', align_corners=True)\r\n\r\n self.init_params()\r\n\r\n def forward(self, low_x, high_x):\r\n x = self.ftb1(low_x)\r\n x = x + high_x\r\n x = self.ftb2(x)\r\n x = self.upsample(x)\r\n\r\n return x\r\n\r\n def init_params(self):\r\n for m in self.modules():\r\n if isinstance(m, nn.Conv2d):\r\n # init.kaiming_normal_(m.weight, mode='fan_out')\r\n init.normal_(m.weight, std=0.01)\r\n # init.xavier_normal_(m.weight)\r\n if m.bias is not None:\r\n init.constant_(m.bias, 0)\r\n elif isinstance(m, nn.ConvTranspose2d):\r\n # init.kaiming_normal_(m.weight, mode='fan_out')\r\n init.normal_(m.weight, std=0.01)\r\n # init.xavier_normal_(m.weight)\r\n if m.bias is not None:\r\n init.constant_(m.bias, 0)\r\n elif isinstance(m, nn.BatchNorm2d): # NN.Batchnorm2d\r\n init.constant_(m.weight, 1)\r\n init.constant_(m.bias, 0)\r\n elif isinstance(m, nn.Linear):\r\n init.normal_(m.weight, std=0.01)\r\n if m.bias is not None:\r\n init.constant_(m.bias, 0)\r\n\r\n\r\nclass AO(nn.Module):\r\n # Adaptive output module\r\n def __init__(self, inchannels, outchannels, upfactor=2):\r\n super(AO, self).__init__()\r\n self.inchannels = inchannels\r\n self.outchannels = outchannels\r\n self.upfactor = upfactor\r\n\r\n self.adapt_conv = nn.Sequential(\r\n nn.Conv2d(in_channels=self.inchannels, out_channels=self.inchannels // 2, kernel_size=3, padding=1,\r\n stride=1, bias=True), \\\r\n nn.BatchNorm2d(num_features=self.inchannels // 2), \\\r\n nn.ReLU(inplace=True), \\\r\n nn.Conv2d(in_channels=self.inchannels // 2, out_channels=self.outchannels, kernel_size=3, padding=1,\r\n stride=1, bias=True), \\\r\n nn.Upsample(scale_factor=self.upfactor, mode='bilinear', align_corners=True))\r\n\r\n self.init_params()\r\n\r\n def forward(self, x):\r\n x = self.adapt_conv(x)\r\n return x\r\n\r\n def init_params(self):\r\n for m in self.modules():\r\n if isinstance(m, nn.Conv2d):\r\n # init.kaiming_normal_(m.weight, mode='fan_out')\r\n init.normal_(m.weight, std=0.01)\r\n # init.xavier_normal_(m.weight)\r\n if m.bias is not None:\r\n init.constant_(m.bias, 0)\r\n elif isinstance(m, nn.ConvTranspose2d):\r\n # init.kaiming_normal_(m.weight, mode='fan_out')\r\n init.normal_(m.weight, std=0.01)\r\n # init.xavier_normal_(m.weight)\r\n if m.bias is not None:\r\n init.constant_(m.bias, 0)\r\n elif isinstance(m, nn.BatchNorm2d): # NN.Batchnorm2d\r\n init.constant_(m.weight, 1)\r\n init.constant_(m.bias, 0)\r\n elif isinstance(m, nn.Linear):\r\n init.normal_(m.weight, std=0.01)\r\n if m.bias is not None:\r\n init.constant_(m.bias, 0)\r\n\r\n\r\n\r\n# ==============================================================================================================\r\n\r\n\r\nclass ResidualConv(nn.Module):\r\n def __init__(self, inchannels):\r\n super(ResidualConv, self).__init__()\r\n # NN.BatchNorm2d\r\n self.conv = nn.Sequential(\r\n # nn.BatchNorm2d(num_features=inchannels),\r\n nn.ReLU(inplace=False),\r\n # nn.Conv2d(in_channels=inchannels, out_channels=inchannels, kernel_size=3, padding=1, stride=1, groups=inchannels,bias=True),\r\n # nn.Conv2d(in_channels=inchannels, out_channels=inchannels, kernel_size=1, padding=0, stride=1, groups=1,bias=True)\r\n nn.Conv2d(in_channels=inchannels, out_channels=inchannels / 2, kernel_size=3, padding=1, stride=1,\r\n bias=False),\r\n nn.BatchNorm2d(num_features=inchannels / 2),\r\n nn.ReLU(inplace=False),\r\n nn.Conv2d(in_channels=inchannels / 2, out_channels=inchannels, kernel_size=3, padding=1, stride=1,\r\n bias=False)\r\n )\r\n self.init_params()\r\n\r\n def forward(self, x):\r\n x = self.conv(x) + x\r\n return x\r\n\r\n def init_params(self):\r\n for m in self.modules():\r\n if isinstance(m, nn.Conv2d):\r\n # init.kaiming_normal_(m.weight, mode='fan_out')\r\n init.normal_(m.weight, std=0.01)\r\n # init.xavier_normal_(m.weight)\r\n if m.bias is not None:\r\n init.constant_(m.bias, 0)\r\n elif isinstance(m, nn.ConvTranspose2d):\r\n # init.kaiming_normal_(m.weight, mode='fan_out')\r\n init.normal_(m.weight, std=0.01)\r\n # init.xavier_normal_(m.weight)\r\n if m.bias is not None:\r\n init.constant_(m.bias, 0)\r\n elif isinstance(m, nn.BatchNorm2d): # NN.BatchNorm2d\r\n init.constant_(m.weight, 1)\r\n init.constant_(m.bias, 0)\r\n elif isinstance(m, nn.Linear):\r\n init.normal_(m.weight, std=0.01)\r\n if m.bias is not None:\r\n init.constant_(m.bias, 0)\r\n\r\n\r\nclass FeatureFusion(nn.Module):\r\n def __init__(self, inchannels, outchannels):\r\n super(FeatureFusion, self).__init__()\r\n self.conv = ResidualConv(inchannels=inchannels)\r\n # NN.BatchNorm2d\r\n self.up = nn.Sequential(ResidualConv(inchannels=inchannels),\r\n nn.ConvTranspose2d(in_channels=inchannels, out_channels=outchannels, kernel_size=3,\r\n stride=2, padding=1, output_padding=1),\r\n nn.BatchNorm2d(num_features=outchannels),\r\n nn.ReLU(inplace=True))\r\n\r\n def forward(self, lowfeat, highfeat):\r\n return self.up(highfeat + self.conv(lowfeat))\r\n\r\n def init_params(self):\r\n for m in self.modules():\r\n if isinstance(m, nn.Conv2d):\r\n # init.kaiming_normal_(m.weight, mode='fan_out')\r\n init.normal_(m.weight, std=0.01)\r\n # init.xavier_normal_(m.weight)\r\n if m.bias is not None:\r\n init.constant_(m.bias, 0)\r\n elif isinstance(m, nn.ConvTranspose2d):\r\n # init.kaiming_normal_(m.weight, mode='fan_out')\r\n init.normal_(m.weight, std=0.01)\r\n # init.xavier_normal_(m.weight)\r\n if m.bias is not None:\r\n init.constant_(m.bias, 0)\r\n elif isinstance(m, nn.BatchNorm2d): # NN.BatchNorm2d\r\n init.constant_(m.weight, 1)\r\n init.constant_(m.bias, 0)\r\n elif isinstance(m, nn.Linear):\r\n init.normal_(m.weight, std=0.01)\r\n if m.bias is not None:\r\n init.constant_(m.bias, 0)\r\n\r\n\r\nclass SenceUnderstand(nn.Module):\r\n def __init__(self, channels):\r\n super(SenceUnderstand, self).__init__()\r\n self.channels = channels\r\n self.conv1 = nn.Sequential(nn.Conv2d(in_channels=512, out_channels=512, kernel_size=3, padding=1),\r\n nn.ReLU(inplace=True))\r\n self.pool = nn.AdaptiveAvgPool2d(8)\r\n self.fc = nn.Sequential(nn.Linear(512 * 8 * 8, self.channels),\r\n nn.ReLU(inplace=True))\r\n self.conv2 = nn.Sequential(\r\n nn.Conv2d(in_channels=self.channels, out_channels=self.channels, kernel_size=1, padding=0),\r\n nn.ReLU(inplace=True))\r\n self.initial_params()\r\n\r\n def forward(self, x):\r\n n, c, h, w = x.size()\r\n x = self.conv1(x)\r\n x = self.pool(x)\r\n x = x.view(n, -1)\r\n x = self.fc(x)\r\n x = x.view(n, self.channels, 1, 1)\r\n x = self.conv2(x)\r\n x = x.repeat(1, 1, h, w)\r\n return x\r\n\r\n def initial_params(self, dev=0.01):\r\n for m in self.modules():\r\n if isinstance(m, nn.Conv2d):\r\n # print torch.sum(m.weight)\r\n m.weight.data.normal_(0, dev)\r\n if m.bias is not None:\r\n m.bias.data.fill_(0)\r\n elif isinstance(m, nn.ConvTranspose2d):\r\n # print torch.sum(m.weight)\r\n m.weight.data.normal_(0, dev)\r\n if m.bias is not None:\r\n m.bias.data.fill_(0)\r\n elif isinstance(m, nn.Linear):\r\n m.weight.data.normal_(0, dev)\r\n\r\n\r\nif __name__ == '__main__':\r\n net = DepthNet(depth=50, pretrained=True)\r\n print(net)\r\n inputs = torch.ones(4,3,128,128)\r\n out = net(inputs)\r\n print(out.size())\r\n\r\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076071,"cells":{"text":{"kind":"string","value":"import torchsparse.nn.functional as spf\r\nfrom torchsparse.point_tensor import PointTensor\r\nfrom torchsparse.utils.kernel_region import *\r\nfrom torchsparse.utils.helpers import *\r\n\r\n\r\n__all__ = ['initial_voxelize', 'point_to_voxel', 'voxel_to_point']\r\n\r\n\r\n# z: PointTensor\r\n# return: SparseTensor\r\ndef initial_voxelize(z, init_res, after_res):\r\n new_float_coord = torch.cat(\r\n [(z.C[:, :3] * init_res) / after_res, z.C[:, -1].view(-1, 1)], 1)\r\n\r\n pc_hash = spf.sphash(torch.floor(new_float_coord).int())\r\n sparse_hash = torch.unique(pc_hash)\r\n idx_query = spf.sphashquery(pc_hash, sparse_hash)\r\n counts = spf.spcount(idx_query.int(), len(sparse_hash))\r\n\r\n inserted_coords = spf.spvoxelize(torch.floor(new_float_coord), idx_query,\r\n counts)\r\n inserted_coords = torch.round(inserted_coords).int()\r\n inserted_feat = spf.spvoxelize(z.F, idx_query, counts)\r\n\r\n new_tensor = SparseTensor(inserted_feat, inserted_coords, 1)\r\n new_tensor.check()\r\n z.additional_features['idx_query'][1] = idx_query\r\n z.additional_features['counts'][1] = counts\r\n z.C = new_float_coord\r\n\r\n return new_tensor\r\n\r\n\r\n# x: SparseTensor, z: PointTensor\r\n# return: SparseTensor\r\ndef point_to_voxel(x, z):\r\n if z.additional_features is None or z.additional_features.get('idx_query') is None\\\r\n or z.additional_features['idx_query'].get(x.s) is None:\r\n #pc_hash = hash_gpu(torch.floor(z.C).int())\r\n pc_hash = spf.sphash(\r\n torch.cat([\r\n torch.floor(z.C[:, :3] / x.s).int() * x.s,\r\n z.C[:, -1].int().view(-1, 1)\r\n ], 1))\r\n sparse_hash = spf.sphash(x.C)\r\n idx_query = spf.sphashquery(pc_hash, sparse_hash)\r\n counts = spf.spcount(idx_query.int(), x.C.shape[0])\r\n z.additional_features['idx_query'][x.s] = idx_query\r\n z.additional_features['counts'][x.s] = counts\r\n else:\r\n idx_query = z.additional_features['idx_query'][x.s]\r\n counts = z.additional_features['counts'][x.s]\r\n\r\n inserted_feat = spf.spvoxelize(z.F, idx_query, counts)\r\n new_tensor = SparseTensor(inserted_feat, x.C, x.s)\r\n new_tensor.coord_maps = x.coord_maps\r\n new_tensor.kernel_maps = x.kernel_maps\r\n\r\n return new_tensor\r\n\r\n\r\n# x: SparseTensor, z: PointTensor\r\n# return: PointTensor\r\ndef voxel_to_point(x, z, nearest=False):\r\n if z.idx_query is None or z.weights is None or z.idx_query.get(\r\n x.s) is None or z.weights.get(x.s) is None:\r\n kr = KernelRegion(2, x.s, 1)\r\n off = kr.get_kernel_offset().to(z.F.device)\r\n #old_hash = kernel_hash_gpu(torch.floor(z.C).int(), off)\r\n old_hash = spf.sphash(\r\n torch.cat([\r\n torch.floor(z.C[:, :3] / x.s).int() * x.s,\r\n z.C[:, -1].int().view(-1, 1)\r\n ], 1), off)\r\n pc_hash = spf.sphash(x.C.to(z.F.device))\r\n idx_query = spf.sphashquery(old_hash, pc_hash)\r\n weights = spf.calc_ti_weights(z.C, idx_query,\r\n scale=x.s).transpose(0, 1).contiguous()\r\n idx_query = idx_query.transpose(0, 1).contiguous()\r\n if nearest:\r\n weights[:, 1:] = 0.\r\n idx_query[:, 1:] = -1\r\n new_feat = spf.spdevoxelize(x.F, idx_query, weights)\r\n new_tensor = PointTensor(new_feat,\r\n z.C,\r\n idx_query=z.idx_query,\r\n weights=z.weights)\r\n new_tensor.additional_features = z.additional_features\r\n new_tensor.idx_query[x.s] = idx_query\r\n new_tensor.weights[x.s] = weights\r\n z.idx_query[x.s] = idx_query\r\n z.weights[x.s] = weights\r\n\r\n else:\r\n new_feat = spf.spdevoxelize(x.F, z.idx_query.get(x.s), z.weights.get(x.s))\r\n new_tensor = PointTensor(new_feat,\r\n z.C,\r\n idx_query=z.idx_query,\r\n weights=z.weights)\r\n new_tensor.additional_features = z.additional_features\r\n\r\n return new_tensor\r\n\r\n\r\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076072,"cells":{"text":{"kind":"string","value":"import cv2\r\nimport os\r\nimport argparse\r\nimport numpy as np\r\nimport torch\r\nimport matplotlib.pyplot as plt\r\nimport torchvision.transforms as transforms\r\n\r\nfrom lib.multi_depth_model_woauxi import RelDepthModel\r\nfrom lib.net_tools import load_ckpt\r\n\r\ndef parse_args():\r\n parser = argparse.ArgumentParser(\r\n description='Configs for LeReS')\r\n parser.add_argument('--load_ckpt', default='./res50.pth', help='Checkpoint path to load')\r\n parser.add_argument('--backbone', default='resnext101', help='Checkpoint path to load')\r\n\r\n args = parser.parse_args()\r\n return args\r\n\r\ndef scale_torch(img):\r\n \"\"\"\r\n Scale the image and output it in torch.tensor.\r\n :param img: input rgb is in shape [H, W, C], input depth/disp is in shape [H, W]\r\n :param scale: the scale factor. float\r\n :return: img. [C, H, W]\r\n \"\"\"\r\n if len(img.shape) == 2:\r\n img = img[np.newaxis, :, :]\r\n if img.shape[2] == 3:\r\n transform = transforms.Compose([transforms.ToTensor(),\r\n\t\t transforms.Normalize((0.485, 0.456, 0.406) , (0.229, 0.224, 0.225) )])\r\n img = transform(img)\r\n else:\r\n img = img.astype(np.float32)\r\n img = torch.from_numpy(img)\r\n return img\r\n\r\n\r\nif __name__ == '__main__':\r\n\r\n args = parse_args()\r\n\r\n # create depth model\r\n depth_model = RelDepthModel(backbone=args.backbone)\r\n depth_model.eval()\r\n\r\n # load checkpoint\r\n load_ckpt(args, depth_model, None, None)\r\n depth_model.cuda()\r\n\r\n image_dir = os.path.dirname(os.path.dirname(__file__)) + '/test_images/'\r\n imgs_list = os.listdir(image_dir)\r\n imgs_list.sort()\r\n imgs_path = [os.path.join(image_dir, i) for i in imgs_list if i != 'outputs']\r\n image_dir_out = image_dir + '/outputs'\r\n os.makedirs(image_dir_out, exist_ok=True)\r\n\r\n for i, v in enumerate(imgs_path):\r\n print('processing (%04d)-th image... %s' % (i, v))\r\n rgb = cv2.imread(v)\r\n rgb_c = rgb[:, :, ::-1].copy()\r\n gt_depth = None\r\n A_resize = cv2.resize(rgb_c, (448, 448))\r\n rgb_half = cv2.resize(rgb, (rgb.shape[1]//2, rgb.shape[0]//2), interpolation=cv2.INTER_LINEAR)\r\n\r\n img_torch = scale_torch(A_resize)[None, :, :, :]\r\n pred_depth = depth_model.inference(img_torch).cpu().numpy().squeeze()\r\n pred_depth_ori = cv2.resize(pred_depth, (rgb.shape[1], rgb.shape[0]))\r\n\r\n # if GT depth is available, uncomment the following part to recover the metric depth\r\n #pred_depth_metric = recover_metric_depth(pred_depth_ori, gt_depth)\r\n\r\n img_name = v.split('/')[-1]\r\n cv2.imwrite(os.path.join(image_dir_out, img_name), rgb)\r\n # save depth\r\n plt.imsave(os.path.join(image_dir_out, img_name[:-4]+'-depth.png'), pred_depth_ori, cmap='rainbow')\r\n cv2.imwrite(os.path.join(image_dir_out, img_name[:-4]+'-depth_raw.png'), (pred_depth_ori/pred_depth_ori.max() * 60000).astype(np.uint16))\r\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076073,"cells":{"text":{"kind":"string","value":"\nimport os\nimport torch\nimport torch.nn.functional as F\nimport matplotlib.pyplot as plt\nfrom skimage.io import imread\n\n# Util function for loading point clouds|\nimport numpy as np\nfrom plyfile import PlyData, PlyElement\n\n# Data structures and functions for rendering\nfrom pytorch3d.structures import Pointclouds\nfrom pytorch3d.vis.plotly_vis import AxisArgs, plot_batch_individually, plot_scene\nfrom pytorch3d.renderer import (\n look_at_view_transform,\n FoVOrthographicCameras,\n PerspectiveCameras,\n PointsRasterizationSettings,\n PointsRenderer,\n PulsarPointsRenderer,\n PointsRasterizer,\n AlphaCompositor,\n NormWeightedCompositor,\n look_at_rotation,\n FoVPerspectiveCameras,\n)\nimport imageio\n\n\ndevice = torch.device(\"cuda:0\")\n\n\ndef load_pcd_color(path):\n #pointcloud = np.load(path)\n pointcloud = PlyData.read(path).elements[0].data\n\n verts = np.array([[data[0], data[1], data[2]] for data in pointcloud])\n rgb = np.array([[data[3], data[4], data[5]] for data in pointcloud]) / 256.0\n verts[:, 1] = -verts[:, 1]\n verts[:, 0] = -verts[:, 0]\n\n verts /= verts.max()\n verts = verts - verts.mean(axis=0)\n\n verts = torch.Tensor(verts).to(device)\n rgb = torch.Tensor(rgb).to(device)\n\n point_cloud = Pointclouds(points=[verts], features=[rgb])\n return point_cloud\n\ndef load_pcd_color2(path):\n #pointcloud = np.load(path)\n # Load point cloud\n pointcloud = np.load(path)\n verts = torch.Tensor(pointcloud['verts']).to(device)\n\n rgb = torch.Tensor(pointcloud['rgb']).to(device)\n\n point_cloud = Pointclouds(points=[verts], features=[rgb])\n return point_cloud\n\ndef rotate_pcd(point_cloud, angle):\n rotate_matrix = np.array([[np.cos(angle), 0, np.sin(angle)],\n [0, 1, 0]\n [-np.sin(angle), 0, np.cos(angle)]])\n #cnt = point_cloud.mean(axis=)\n\ndef render_single(point_cloud, azim=0):\n # Initialize a camera.\n R, T = look_at_view_transform(0.5, 10, azim=azim)\n #cameras = FoVOrthographicCameras(device=device, R=R, T=T, znear=0.01)\n cameras = FoVPerspectiveCameras(fov=50.0, device=device, R=R, T=T)\n # Define the settings for rasterization and shading. Here we set the output image to be of size\n # 512x512. As we are rendering images for visualization purposes only we will set faces_per_pixel=1\n # and blur_radius=0.0. Refer to raster_points.py for explanations of these parameters.\n raster_settings = PointsRasterizationSettings(\n image_size=512,\n radius=0.008,\n points_per_pixel=50\n )\n\n # Create a points renderer by compositing points using an alpha compositor (nearer points\n # are weighted more heavily). See [1] for an explanation.\n rasterizer = PointsRasterizer(cameras=cameras, raster_settings=raster_settings)\n renderer = PointsRenderer(\n rasterizer=rasterizer,\n compositor=AlphaCompositor()\n )\n images = renderer(point_cloud)\n # plt.figure(figsize=(10, 10))\n # plt.imshow(images[0, ..., :3].cpu().numpy())\n # plt.grid(\"off\")\n # plt.axis(\"off\")\n # plt.show()\n img_out = images[0, ...].cpu().numpy()\n img_out = (img_out * 256).astype(np.uint8)\n return img_out\n\ndef render_batches(point_cloud):\n # Initialize a camera.\n batch_size = 10\n point_clouds = point_cloud.extend(batch_size)\n azim = torch.linspace(-180, 180, batch_size)\n\n R, T = look_at_view_transform(-1, 0, azim=azim)\n #cameras = FoVOrthographicCameras(device=device, R=R, T=T, znear=0.01)\n cameras = FoVPerspectiveCameras(fov=50.0, device=device, R=R, T=T)\n # Define the settings for rasterization and shading. Here we set the output image to be of size\n # 512x512. As we are rendering images for visualization purposes only we will set faces_per_pixel=1\n # and blur_radius=0.0. Refer to raster_points.py for explanations of these parameters.\n raster_settings = PointsRasterizationSettings(\n image_size=512,\n radius=0.008,\n points_per_pixel=50\n )\n\n # Create a points renderer by compositing points using an alpha compositor (nearer points\n # are weighted more heavily). See [1] for an explanation.\n rasterizer = PointsRasterizer(cameras=cameras, raster_settings=raster_settings)\n renderer = PointsRenderer(\n rasterizer=rasterizer,\n compositor=AlphaCompositor()\n )\n images = renderer(point_clouds)\n plt.figure(figsize=(10, 10))\n plt.imshow(images[0, ..., :3].cpu().numpy())\n plt.grid(\"off\")\n plt.axis(\"off\")\n plt.show()\n\ndef render_create_GIF(point_cloud, filename):\n # We will save images periodically and compose them into a GIF.\n filename_output = filename + \".gif\"\n writer = imageio.get_writer(filename_output, mode='I', duration=0.01)\n for i in range(-180, 180, 2):\n image = render_single(point_cloud, i)\n writer.append_data(image)\n writer.close()\n\nif __name__ == '__main__':\n # path = '/mnt/data/WeiYin/publications/cvpr2021/first_page_fig/first_page_fig_results/8-rgb-recovershift.ply'\n path = '/home/gk-ai/code/mesh710.ply'\n point_cloud = load_pcd_color(path)\n name = path.split('/')[-1][:-4]\n #point_cloud = load_pcd_color2('/home/yvan/DeepLearning/Depth/MultiDepth/A-othertools/Render_PCD/data/PittsburghBridge/pointcloud.npz')\n #render_single(point_cloud)\n render_create_GIF(point_cloud, name)"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076074,"cells":{"text":{"kind":"string","value":"import cv2\r\nimport os\r\nimport argparse\r\nimport numpy as np\r\nimport torch\r\nimport matplotlib.pyplot as plt\r\nimport torchvision.transforms as transforms\r\n\r\nfrom lib.test_utils import refine_focal, refine_shift\r\nfrom lib.multi_depth_model_woauxi import RelDepthModel\r\nfrom lib.net_tools import load_ckpt\r\nfrom lib.spvcnn_classsification import SPVCNN_CLASSIFICATION\r\nfrom lib.test_utils import reconstruct_depth\r\n\r\ndef parse_args():\r\n parser = argparse.ArgumentParser(\r\n description='Configs for LeReS')\r\n parser.add_argument('--load_ckpt', default='./res50.pth', help='Checkpoint path to load')\r\n parser.add_argument('--backbone', default='resnext101', help='Checkpoint path to load')\r\n\r\n args = parser.parse_args()\r\n return args\r\n\r\ndef scale_torch(img):\r\n \"\"\"\r\n Scale the image and output it in torch.tensor.\r\n :param img: input rgb is in shape [H, W, C], input depth/disp is in shape [H, W]\r\n :param scale: the scale factor. float\r\n :return: img. [C, H, W]\r\n \"\"\"\r\n if len(img.shape) == 2:\r\n img = img[np.newaxis, :, :]\r\n if img.shape[2] == 3:\r\n transform = transforms.Compose([transforms.ToTensor(),\r\n\t\t transforms.Normalize((0.485, 0.456, 0.406) , (0.229, 0.224, 0.225) )])\r\n img = transform(img)\r\n else:\r\n img = img.astype(np.float32)\r\n img = torch.from_numpy(img)\r\n return img\r\n\r\ndef make_shift_focallength_models():\r\n shift_model = SPVCNN_CLASSIFICATION(input_channel=3,\r\n num_classes=1,\r\n cr=1.0,\r\n pres=0.01,\r\n vres=0.01\r\n )\r\n focal_model = SPVCNN_CLASSIFICATION(input_channel=5,\r\n num_classes=1,\r\n cr=1.0,\r\n pres=0.01,\r\n vres=0.01\r\n )\r\n shift_model.eval()\r\n focal_model.eval()\r\n return shift_model, focal_model\r\n\r\ndef reconstruct3D_from_depth(rgb, pred_depth, shift_model, focal_model):\r\n cam_u0 = rgb.shape[1] / 2.0\r\n cam_v0 = rgb.shape[0] / 2.0\r\n pred_depth_norm = pred_depth - pred_depth.min() + 0.5\r\n\r\n dmax = np.percentile(pred_depth_norm, 98)\r\n pred_depth_norm = pred_depth_norm / dmax\r\n\r\n # proposed focal length, FOV is 60', Note that 60~80' are acceptable.\r\n proposed_scaled_focal = (rgb.shape[0] // 2 / np.tan((60/2.0)*np.pi/180))\r\n\r\n # recover focal\r\n focal_scale_1 = refine_focal(pred_depth_norm, proposed_scaled_focal, focal_model, u0=cam_u0, v0=cam_v0)\r\n predicted_focal_1 = proposed_scaled_focal / focal_scale_1.item()\r\n\r\n # recover shift\r\n shift_1 = refine_shift(pred_depth_norm, shift_model, predicted_focal_1, cam_u0, cam_v0)\r\n shift_1 = shift_1 if shift_1.item() < 0.6 else torch.tensor([0.6])\r\n depth_scale_1 = pred_depth_norm - shift_1.item()\r\n\r\n # recover focal\r\n focal_scale_2 = refine_focal(depth_scale_1, predicted_focal_1, focal_model, u0=cam_u0, v0=cam_v0)\r\n predicted_focal_2 = predicted_focal_1 / focal_scale_2.item()\r\n\r\n return shift_1, predicted_focal_2, depth_scale_1\r\n\r\nif __name__ == '__main__':\r\n\r\n args = parse_args()\r\n\r\n # create depth model\r\n depth_model = RelDepthModel(backbone=args.backbone)\r\n depth_model.eval()\r\n\r\n # create shift and focal length model\r\n shift_model, focal_model = make_shift_focallength_models()\r\n\r\n # load checkpoint\r\n load_ckpt(args, depth_model, shift_model, focal_model)\r\n depth_model.cuda()\r\n shift_model.cuda()\r\n focal_model.cuda()\r\n\r\n image_dir = os.path.dirname(os.path.dirname(__file__)) + '/test_images/'\r\n imgs_list = os.listdir(image_dir)\r\n imgs_list.sort()\r\n imgs_path = [os.path.join(image_dir, i) for i in imgs_list if i != 'outputs']\r\n image_dir_out = image_dir + '/outputs'\r\n os.makedirs(image_dir_out, exist_ok=True)\r\n\r\n for i, v in enumerate(imgs_path):\r\n print('processing (%04d)-th image... %s' % (i, v))\r\n rgb = cv2.imread(v)\r\n rgb_c = rgb[:, :, ::-1].copy()\r\n gt_depth = None\r\n A_resize = cv2.resize(rgb_c, (448, 448))\r\n rgb_half = cv2.resize(rgb, (rgb.shape[1]//2, rgb.shape[0]//2), interpolation=cv2.INTER_LINEAR)\r\n\r\n img_torch = scale_torch(A_resize)[None, :, :, :]\r\n pred_depth = depth_model.inference(img_torch).cpu().numpy().squeeze()\r\n pred_depth_ori = cv2.resize(pred_depth, (rgb.shape[1], rgb.shape[0]))\r\n\r\n # recover focal length, shift, and scale-invariant depth\r\n shift, focal_length, depth_scaleinv = reconstruct3D_from_depth(rgb, pred_depth_ori,\r\n shift_model, focal_model)\r\n disp = 1 / depth_scaleinv\r\n disp = (disp / disp.max() * 60000).astype(np.uint16)\r\n\r\n # if GT depth is available, uncomment the following part to recover the metric depth\r\n #pred_depth_metric = recover_metric_depth(pred_depth_ori, gt_depth)\r\n\r\n img_name = v.split('/')[-1]\r\n cv2.imwrite(os.path.join(image_dir_out, img_name), rgb)\r\n # save depth\r\n plt.imsave(os.path.join(image_dir_out, img_name[:-4]+'-depth.png'), pred_depth_ori, cmap='rainbow')\r\n cv2.imwrite(os.path.join(image_dir_out, img_name[:-4]+'-depth_raw.png'), (pred_depth_ori/pred_depth_ori.max() * 60000).astype(np.uint16))\r\n # save disp\r\n cv2.imwrite(os.path.join(image_dir_out, img_name[:-4]+'.png'), disp)\r\n\r\n # reconstruct point cloud from the depth\r\n reconstruct_depth(depth_scaleinv, rgb[:, :, ::-1], image_dir_out, img_name[:-4]+'-pcd', focal=focal_length)\r\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076075,"cells":{"text":{"kind":"string","value":"export PYTHONPATH=../../Train:${PYTHONPATH}\n\npython ../tools/train.py \\\n--dataroot datasets \\\n--backbone resnet50 \\\n--dataset_list demo \\\n--batchsize 2 \\\n--base_lr 0.001 \\\n--use_tfboard \\\n--thread 4 \\\n--loss_mode _ranking-edge_pairwise-normal-regress-edge_msgil-normal_meanstd-tanh_pairwise-normal-regress-plane_ranking-edge-auxi_meanstd-tanh-auxi_ \\\n--epoch 2 \\\n--lr_scheduler_multiepochs 1 \\\n--val_step 50 \\\n--snapshot_iters 50 \\\n--log_interval 5 \n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076076,"cells":{"text":{"kind":"string","value":"\nexport PYTHONPATH=../../Train:${PYTHONPATH}\nexport CUDA_VISIBLE_DEVICES=0,1,2,3\n\n\npython ../tools/train.py \\\n--dataroot datasets \\\n--backbone resnet50 \\\n--dataset_list taskonomy DiverseDepth HRWSI Holopix50k \\\n--batchsize 16 \\\n--base_lr 0.001 \\\n--use_tfboard \\\n--thread 4 \\\n--loss_mode _ranking-edge_pairwise-normal-regress-edge_msgil-normal_meanstd-tanh_pairwise-normal-regress-plane_ranking-edge-auxi_meanstd-tanh-auxi_ \\\n--epoch 50 \\\n--lr_scheduler_multiepochs 10 25 40 \\\n--val_step 5000 \\\n--snapshot_iters 5000 \\\n--log_interval 10\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076077,"cells":{"text":{"kind":"string","value":"\nexport PYTHONPATH=../../Train:${PYTHONPATH}\nexport CUDA_VISIBLE_DEVICES=0\n\nTIME=`date +%Y-%m-%d_%H-%M-%S`\n\nLOG=\"./$TIME.txt\"\n\npython ../tools/test_multiauxiv2_nyu.py \\\n--dataroot ./datasets \\\n--batchsize 1 \\\n--load_ckpt path_to_ckpt.pth \\\n$1 2>&1 | tee $LOG\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076078,"cells":{"text":{"kind":"string","value":"import torch\r\nimport torch.nn as nn\r\n\r\n\r\n\r\nclass MSGIL_NORM_Loss(nn.Module):\r\n \"\"\"\r\n Our proposed GT normalized Multi-scale Gradient Loss Fuction.\r\n \"\"\"\r\n def __init__(self, scale=4, valid_threshold=-1e-8, max_threshold=1e8):\r\n super(MSGIL_NORM_Loss, self).__init__()\r\n self.scales_num = scale\r\n self.valid_threshold = valid_threshold\r\n self.max_threshold = max_threshold\r\n self.EPSILON = 1e-6\r\n\r\n def one_scale_gradient_loss(self, pred_scale, gt, mask):\r\n mask_float = mask.to(dtype=pred_scale.dtype, device=pred_scale.device)\r\n\r\n d_diff = pred_scale - gt\r\n\r\n v_mask = torch.mul(mask_float[:, :, :-2, :], mask_float[:, :, 2:, :])\r\n v_gradient = torch.abs(d_diff[:, :, :-2, :] - d_diff[:, :, 2:, :])\r\n v_gradient = torch.mul(v_gradient, v_mask)\r\n\r\n h_gradient = torch.abs(d_diff[:, :, :, :-2] - d_diff[:, :, :, 2:])\r\n h_mask = torch.mul(mask_float[:, :, :, :-2], mask_float[:, :, :, 2:])\r\n h_gradient = torch.mul(h_gradient, h_mask)\r\n\r\n valid_num = torch.sum(h_mask) + torch.sum(v_mask)\r\n\r\n gradient_loss = torch.sum(h_gradient) + torch.sum(v_gradient)\r\n gradient_loss = gradient_loss / (valid_num + 1e-8)\r\n\r\n return gradient_loss\r\n\r\n def transform(self, gt):\r\n # Get mean and standard deviation\r\n data_mean = []\r\n data_std_dev = []\r\n for i in range(gt.shape[0]):\r\n gt_i = gt[i]\r\n mask = gt_i > 0\r\n depth_valid = gt_i[mask]\r\n if depth_valid.shape[0] < 10:\r\n data_mean.append(torch.tensor(0).cuda())\r\n data_std_dev.append(torch.tensor(1).cuda())\r\n continue\r\n size = depth_valid.shape[0]\r\n depth_valid_sort, _ = torch.sort(depth_valid, 0)\r\n depth_valid_mask = depth_valid_sort[int(size*0.1): -int(size*0.1)]\r\n data_mean.append(depth_valid_mask.mean())\r\n data_std_dev.append(depth_valid_mask.std())\r\n data_mean = torch.stack(data_mean, dim=0).cuda()\r\n data_std_dev = torch.stack(data_std_dev, dim=0).cuda()\r\n\r\n return data_mean, data_std_dev\r\n\r\n def forward(self, pred, gt):\r\n mask = gt > self.valid_threshold\r\n grad_term = 0.0\r\n gt_mean, gt_std = self.transform(gt)\r\n gt_trans = (gt - gt_mean[:, None, None, None]) / (gt_std[:, None, None, None] + 1e-8)\r\n for i in range(self.scales_num):\r\n step = pow(2, i)\r\n d_gt = gt_trans[:, :, ::step, ::step]\r\n d_pred = pred[:, :, ::step, ::step]\r\n d_mask = mask[:, :, ::step, ::step]\r\n grad_term += self.one_scale_gradient_loss(d_pred, d_gt, d_mask)\r\n return grad_term\r\n\r\n\r\nif __name__ == '__main__':\r\n msgi_loss = MSGIL_NORM_Loss()\r\n pred_depth = torch.rand([2, 1, 385, 513]).cuda()\r\n gt_depth = torch.rand([2, 1, 385, 513]).cuda()\r\n loss = msgi_loss(pred_depth, gt_depth)\r\n print(loss)\r\n\r\n\r\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076079,"cells":{"text":{"kind":"string","value":"import torch\r\nimport torch.nn as nn\r\n\r\n\r\nclass MEADSTD_TANH_NORM_Loss(nn.Module):\r\n \"\"\"\r\n loss = MAE((d-u)/s - d') + MAE(tanh(0.01*(d-u)/s) - tanh(0.01*d'))\r\n \"\"\"\r\n def __init__(self, valid_threshold=-1e-8, max_threshold=1e8):\r\n super(MEADSTD_TANH_NORM_Loss, self).__init__()\r\n self.valid_threshold = valid_threshold\r\n self.max_threshold = max_threshold\r\n #self.thres1 = 0.9\r\n\r\n def transform(self, gt):\r\n # Get mean and standard deviation\r\n data_mean = []\r\n data_std_dev = []\r\n for i in range(gt.shape[0]):\r\n gt_i = gt[i]\r\n mask = gt_i > 0\r\n depth_valid = gt_i[mask]\r\n if depth_valid.shape[0] < 10:\r\n data_mean.append(torch.tensor(0).cuda())\r\n data_std_dev.append(torch.tensor(1).cuda())\r\n continue\r\n size = depth_valid.shape[0]\r\n depth_valid_sort, _ = torch.sort(depth_valid, 0)\r\n depth_valid_mask = depth_valid_sort[int(size*0.1): -int(size*0.1)]\r\n data_mean.append(depth_valid_mask.mean())\r\n data_std_dev.append(depth_valid_mask.std())\r\n data_mean = torch.stack(data_mean, dim=0).cuda()\r\n data_std_dev = torch.stack(data_std_dev, dim=0).cuda()\r\n\r\n return data_mean, data_std_dev\r\n\r\n def forward(self, pred, gt):\r\n \"\"\"\r\n Calculate loss.\r\n \"\"\"\r\n mask = (gt > self.valid_threshold) & (gt < self.max_threshold) # [b, c, h, w]\r\n mask_sum = torch.sum(mask, dim=(1, 2, 3))\r\n # mask invalid batches\r\n mask_batch = mask_sum > 100\r\n if True not in mask_batch:\r\n return torch.tensor(0.0, dtype=torch.float).cuda()\r\n mask_maskbatch = mask[mask_batch]\r\n pred_maskbatch = pred[mask_batch]\r\n gt_maskbatch = gt[mask_batch]\r\n\r\n gt_mean, gt_std = self.transform(gt_maskbatch)\r\n gt_trans = (gt_maskbatch - gt_mean[:, None, None, None]) / (gt_std[:, None, None, None] + 1e-8)\r\n\r\n B, C, H, W = gt_maskbatch.shape\r\n loss = 0\r\n loss_tanh = 0\r\n for i in range(B):\r\n mask_i = mask_maskbatch[i, ...]\r\n pred_depth_i = pred_maskbatch[i, ...][mask_i]\r\n gt_trans_i = gt_trans[i, ...][mask_i]\r\n\r\n depth_diff = torch.abs(gt_trans_i - pred_depth_i)\r\n loss += torch.mean(depth_diff)\r\n\r\n tanh_norm_gt = torch.tanh(0.01*gt_trans_i)\r\n tanh_norm_pred = torch.tanh(0.01*pred_depth_i)\r\n loss_tanh += torch.mean(torch.abs(tanh_norm_gt - tanh_norm_pred))\r\n loss_out = loss/B + loss_tanh/B\r\n return loss_out.float()\r\n\r\nif __name__ == '__main__':\r\n ilnr_loss = MEADSTD_TANH_NORM_Loss()\r\n pred_depth = torch.rand([3, 1, 385, 513]).cuda()\r\n gt_depth = torch.rand([3, 1, 385, 513]).cuda()\r\n\r\n loss = ilnr_loss(pred_depth, gt_depth)\r\n print(loss)\r\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076080,"cells":{"text":{"kind":"string","value":"import torch\r\nfrom torch import nn\r\nimport numpy as np\r\nimport torch.nn.functional as F\r\n\r\n\r\n\"\"\"\r\nSampling strategies: RS (Random Sampling), EGS (Edge-Guided Sampling), and IGS (Instance-Guided Sampling)\r\n\"\"\"\r\n###########\r\n# RANDOM SAMPLING\r\n# input:\r\n# inputs[i,:], targets[i, :], masks[i, :], self.mask_value, self.point_pairs\r\n# return:\r\n# inputs_A, inputs_B, targets_A, targets_B, consistent_masks_A, consistent_masks_B\r\n###########\r\ndef randomSampling(inputs, targets, masks, threshold, sample_num):\r\n\r\n # find A-B point pairs from predictions\r\n inputs_index = torch.masked_select(inputs, targets.gt(threshold))\r\n num_effect_pixels = len(inputs_index)\r\n shuffle_effect_pixels = torch.randperm(num_effect_pixels).cuda()\r\n inputs_A = inputs_index[shuffle_effect_pixels[0:sample_num*2:2]]\r\n inputs_B = inputs_index[shuffle_effect_pixels[1:sample_num*2:2]]\r\n # find corresponding pairs from GT\r\n target_index = torch.masked_select(targets, targets.gt(threshold))\r\n targets_A = target_index[shuffle_effect_pixels[0:sample_num*2:2]]\r\n targets_B = target_index[shuffle_effect_pixels[1:sample_num*2:2]]\r\n # only compute the losses of point pairs with valid GT\r\n consistent_masks_index = torch.masked_select(masks, targets.gt(threshold))\r\n consistent_masks_A = consistent_masks_index[shuffle_effect_pixels[0:sample_num*2:2]]\r\n consistent_masks_B = consistent_masks_index[shuffle_effect_pixels[1:sample_num*2:2]]\r\n\r\n # The amount of A and B should be the same!!\r\n if len(targets_A) > len(targets_B):\r\n targets_A = targets_A[:-1]\r\n inputs_A = inputs_A[:-1]\r\n consistent_masks_A = consistent_masks_A[:-1]\r\n\r\n return inputs_A, inputs_B, targets_A, targets_B, consistent_masks_A, consistent_masks_B\r\n\r\n###########\r\n# EDGE-GUIDED SAMPLING\r\n# input:\r\n# inputs[i,:], targets[i, :], masks[i, :], edges_img[i], thetas_img[i], masks[i, :], h, w\r\n# return:\r\n# inputs_A, inputs_B, targets_A, targets_B, masks_A, masks_B\r\n###########\r\ndef ind2sub(idx, cols):\r\n r = idx / cols\r\n c = idx - r * cols\r\n return r, c\r\n\r\ndef sub2ind(r, c, cols):\r\n idx = r * cols + c\r\n return idx\r\n\r\ndef edgeGuidedSampling(inputs, targets, edges_img, thetas_img, masks, h, w):\r\n\r\n # find edges\r\n edges_max = edges_img.max()\r\n edges_mask = edges_img.ge(edges_max*0.1)\r\n edges_loc = edges_mask.nonzero()\r\n\r\n inputs_edge = torch.masked_select(inputs, edges_mask)\r\n targets_edge = torch.masked_select(targets, edges_mask)\r\n thetas_edge = torch.masked_select(thetas_img, edges_mask)\r\n minlen = inputs_edge.size()[0]\r\n\r\n # find anchor points (i.e, edge points)\r\n sample_num = minlen\r\n index_anchors = torch.randint(0, minlen, (sample_num,), dtype=torch.long).cuda()\r\n anchors = torch.gather(inputs_edge, 0, index_anchors)\r\n theta_anchors = torch.gather(thetas_edge, 0, index_anchors)\r\n row_anchors, col_anchors = ind2sub(edges_loc[index_anchors].squeeze(1), w)\r\n ## compute the coordinates of 4-points, distances are from [2, 30]\r\n distance_matrix = torch.randint(2, 31, (4,sample_num)).cuda()\r\n pos_or_neg = torch.ones(4, sample_num).cuda()\r\n pos_or_neg[:2,:] = -pos_or_neg[:2,:]\r\n distance_matrix = distance_matrix.float() * pos_or_neg\r\n col = col_anchors.unsqueeze(0).expand(4, sample_num).long() + torch.round(distance_matrix.double() * torch.cos(theta_anchors).unsqueeze(0)).long()\r\n row = row_anchors.unsqueeze(0).expand(4, sample_num).long() + torch.round(distance_matrix.double() * torch.sin(theta_anchors).unsqueeze(0)).long()\r\n\r\n # constrain 0=w-1] = w-1\r\n row[row<0] = 0\r\n row[row>h-1] = h-1\r\n\r\n # a-b, b-c, c-d\r\n a = sub2ind(row[0,:], col[0,:], w)\r\n b = sub2ind(row[1,:], col[1,:], w)\r\n c = sub2ind(row[2,:], col[2,:], w)\r\n d = sub2ind(row[3,:], col[3,:], w)\r\n A = torch.cat((a,b,c), 0)\r\n B = torch.cat((b,c,d), 0)\r\n\r\n inputs_A = torch.gather(inputs, 0, A.long())\r\n inputs_B = torch.gather(inputs, 0, B.long())\r\n targets_A = torch.gather(targets, 0, A.long())\r\n targets_B = torch.gather(targets, 0, B.long())\r\n masks_A = torch.gather(masks, 0, A.long())\r\n masks_B = torch.gather(masks, 0, B.long())\r\n\r\n return inputs_A, inputs_B, targets_A, targets_B, masks_A, masks_B, sample_num\r\n\r\n######################################################\r\n# EdgeguidedRankingLoss (with regularization term)\r\n# Please comment regularization_loss if you don't want to use multi-scale gradient matching term\r\n#####################################################\r\nclass EdgeguidedRankingLoss(nn.Module):\r\n def __init__(self, point_pairs=10000, sigma=0.03, alpha=1.0, mask_value=-1e-8):\r\n super(EdgeguidedRankingLoss, self).__init__()\r\n self.point_pairs = point_pairs # number of point pairs\r\n self.sigma = sigma # used for determining the ordinal relationship between a selected pair\r\n self.alpha = alpha # used for balancing the effect of = and (<,>)\r\n self.mask_value = mask_value\r\n #self.regularization_loss = GradientLoss(scales=4)\r\n\r\n def getEdge(self, images):\r\n n,c,h,w = images.size()\r\n a = torch.Tensor([[-1, 0, 1], [-2, 0, 2], [-1, 0, 1]]).cuda().view((1,1,3,3)).repeat(1, 1, 1, 1)\r\n b = torch.Tensor([[1, 2, 1], [0, 0, 0], [-1, -2, -1]]).cuda().view((1,1,3,3)).repeat(1, 1, 1, 1)\r\n if c == 3:\r\n gradient_x = F.conv2d(images[:,0,:,:].unsqueeze(1), a)\r\n gradient_y = F.conv2d(images[:,0,:,:].unsqueeze(1), b)\r\n else:\r\n gradient_x = F.conv2d(images, a)\r\n gradient_y = F.conv2d(images, b)\r\n edges = torch.sqrt(torch.pow(gradient_x,2)+ torch.pow(gradient_y,2))\r\n edges = F.pad(edges, (1,1,1,1), \"constant\", 0)\r\n thetas = torch.atan2(gradient_y, gradient_x)\r\n thetas = F.pad(thetas, (1,1,1,1), \"constant\", 0)\r\n\r\n return edges, thetas\r\n\r\n def forward(self, inputs, targets, images, masks=None):\r\n if masks == None:\r\n masks = targets > self.mask_value\r\n # Comment this line if you don't want to use the multi-scale gradient matching term !!!\r\n # regularization_loss = self.regularization_loss(inputs.squeeze(1), targets.squeeze(1), masks.squeeze(1))\r\n # find edges from RGB\r\n edges_img, thetas_img = self.getEdge(images)\r\n\r\n #=============================\r\n n,c,h,w = targets.size()\r\n if n != 1:\r\n inputs = inputs.view(n, -1).double()\r\n targets = targets.view(n, -1).double()\r\n masks = masks.view(n, -1).double()\r\n edges_img = edges_img.view(n, -1).double()\r\n thetas_img = thetas_img.view(n, -1).double()\r\n\r\n else:\r\n inputs = inputs.contiguous().view(1, -1).double()\r\n targets = targets.contiguous().view(1, -1).double()\r\n masks = masks.contiguous().view(1, -1).double()\r\n edges_img = edges_img.contiguous().view(1, -1).double()\r\n thetas_img = thetas_img.contiguous().view(1, -1).double()\r\n\r\n # initialization\r\n loss = torch.DoubleTensor([0.0]).cuda()\r\n\r\n\r\n for i in range(n):\r\n # Edge-Guided sampling\r\n inputs_A, inputs_B, targets_A, targets_B, masks_A, masks_B, sample_num = edgeGuidedSampling(inputs[i,:], targets[i, :], edges_img[i], thetas_img[i], masks[i, :], h, w)\r\n # Random Sampling\r\n random_sample_num = sample_num\r\n random_inputs_A, random_inputs_B, random_targets_A, random_targets_B, random_masks_A, random_masks_B = randomSampling(inputs[i,:], targets[i, :], masks[i, :], self.mask_value, random_sample_num)\r\n\r\n # Combine EGS + RS\r\n inputs_A = torch.cat((inputs_A, random_inputs_A), 0)\r\n inputs_B = torch.cat((inputs_B, random_inputs_B), 0)\r\n targets_A = torch.cat((targets_A, random_targets_A), 0)\r\n targets_B = torch.cat((targets_B, random_targets_B), 0)\r\n masks_A = torch.cat((masks_A, random_masks_A), 0)\r\n masks_B = torch.cat((masks_B, random_masks_B), 0)\r\n\r\n #GT ordinal relationship\r\n target_ratio = torch.div(targets_A+1e-6, targets_B+1e-6)\r\n mask_eq = target_ratio.lt(1.0 + self.sigma) * target_ratio.gt(1.0/(1.0+self.sigma))\r\n labels = torch.zeros_like(target_ratio)\r\n labels[target_ratio.ge(1.0 + self.sigma)] = 1\r\n labels[target_ratio.le(1.0/(1.0+self.sigma))] = -1\r\n\r\n # consider forward-backward consistency checking, i.e, only compute losses of point pairs with valid GT\r\n consistency_mask = masks_A * masks_B\r\n\r\n equal_loss = (inputs_A - inputs_B).pow(2) * mask_eq.double() * consistency_mask\r\n unequal_loss = torch.log(1 + torch.exp((-inputs_A + inputs_B) * labels)) * (~mask_eq).double() * consistency_mask\r\n\r\n # Please comment the regularization term if you don't want to use the multi-scale gradient matching loss !!!\r\n loss = loss + self.alpha * equal_loss.mean() + 1.0 * unequal_loss.mean() #+ 0.2 * regularization_loss.double()\r\n\r\n return loss[0].float()/n\r\n\r\n\r\n\r\nif __name__ == '__main__':\r\n import cv2\r\n\r\n rank_loss = EdgeguidedRankingLoss()\r\n pred_depth = np.random.randn(2, 1, 480, 640)\r\n gt_depth = np.random.randn(2, 1, 480, 640)\r\n # gt_depth = cv2.imread('/hardware/yifanliu/SUNRGBD/sunrgbd-meta-data/sunrgbd_test_depth/2.png', -1)\r\n # gt_depth = gt_depth[None, :, :, None]\r\n # pred_depth = gt_depth[:, :, ::-1, :]\r\n gt_depth = torch.tensor(np.asarray(gt_depth, np.float32)).cuda()\r\n pred_depth = torch.tensor(np.asarray(pred_depth, np.float32)).cuda()\r\n loss = rank_loss(pred_depth, gt_depth)\r\n print(loss)\r\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076081,"cells":{"text":{"kind":"string","value":"import torch\r\nimport torch.nn as nn\r\nimport numpy as np\r\n\r\n\r\nclass PWNPlanesLoss(nn.Module):\r\n \"\"\"\r\n Virtual Normal Loss Function.\r\n \"\"\"\r\n def __init__(self, focal_x, focal_y, input_size,\r\n delta_cos=0.867, delta_diff_x=0.007,\r\n delta_diff_y=0.007, sample_groups=5000, xyz_mode = 'uvd'):\r\n \"\"\"\r\n Virtual normal planes loss, which constrain points to be on the same 3D plane.\r\n :para focal_x: folcal length fx\r\n :para focal_y: folcal length fy\r\n :para input_size: input image size\r\n :para delta_cos: a threshold for the angle among three point, three points should not be on the same plane\r\n :para delta_diff_x: a threshold for the distance among three points along the x axis\r\n :para delta_diff_y: a threshold for the distance among three points along the y axis\r\n :para sample_groups: sample groups number, each group with 3 points can construct a plane\r\n :para xyz_mode: using (u, v, d) or (x, y, z) to construct the virtual planes\r\n \"\"\"\r\n super(PWNPlanesLoss, self).__init__()\r\n self.fx = torch.tensor([focal_x], dtype=torch.float32).cuda()\r\n self.fy = torch.tensor([focal_y], dtype=torch.float32).cuda()\r\n self.input_size = input_size\r\n self.u0 = torch.tensor(input_size[1] // 2, dtype=torch.float32).cuda()\r\n self.v0 = torch.tensor(input_size[0] // 2, dtype=torch.float32).cuda()\r\n self.init_image_coor()\r\n self.delta_cos = delta_cos\r\n self.delta_diff_x = delta_diff_x\r\n self.delta_diff_y = delta_diff_y\r\n self.sample_groups = sample_groups\r\n self.xyz_mode = xyz_mode\r\n\r\n def init_image_coor(self):\r\n x_row = np.arange(0, self.input_size[1])\r\n x = np.tile(x_row, (self.input_size[0], 1))\r\n x = x[np.newaxis, :, :]\r\n x = x.astype(np.float32)\r\n x = torch.from_numpy(x.copy()).cuda()\r\n self.u_u0 = x - self.u0\r\n\r\n y_col = np.arange(0, self.input_size[0]) # y_col = np.arange(0, height)\r\n y = np.tile(y_col, (self.input_size[1], 1)).T\r\n y = y[np.newaxis, :, :]\r\n y = y.astype(np.float32)\r\n y = torch.from_numpy(y.copy()).cuda()\r\n self.v_v0 = y - self.v0\r\n\r\n def transfer_uvz(self, depth):\r\n max_uv = self.u_u0.max()\r\n u = self.u_u0.repeat((depth.shape[0], 1, 1, 1)) / max_uv\r\n v = self.v_v0.repeat((depth.shape[0], 1, 1, 1)) / max_uv\r\n z = depth\r\n pw = torch.cat([u, v, z], 1).permute(0, 2, 3, 1) # [b, h, w, c]\r\n return pw\r\n\r\n def transfer_xyz(self, depth):\r\n x = self.u_u0 * torch.abs(depth) / self.fx\r\n y = self.v_v0 * torch.abs(depth) / self.fy\r\n z = depth\r\n pw = torch.cat([x, y, z], 1).permute(0, 2, 3, 1) # [b, h, w, c]\r\n return pw\r\n\r\n def select_index(self, mask_kp):\r\n x, _, h, w = mask_kp.shape\r\n\r\n select_size = int(3 * self.sample_groups)\r\n p1_x = []\r\n p1_y = []\r\n p2_x = []\r\n p2_y = []\r\n p3_x = []\r\n p3_y = []\r\n valid_batch = torch.ones((x, 1), dtype=torch.bool)\r\n for i in range(x):\r\n mask_kp_i = mask_kp[i, 0, :, :]\r\n valid_points = torch.nonzero(mask_kp_i)\r\n\r\n if valid_points.shape[0] < select_size * 0.6:\r\n valid_points = torch.nonzero(~mask_kp_i.to(torch.uint8))\r\n valid_batch[i, :] = False\r\n elif valid_points.shape[0] < select_size:\r\n repeat_idx = torch.randperm(valid_points.shape[0])[:select_size - valid_points.shape[0]]\r\n valid_repeat = valid_points[repeat_idx]\r\n valid_points = torch.cat((valid_points, valid_repeat), 0)\r\n else:\r\n valid_points = valid_points\r\n \"\"\"\r\n \r\n if valid_points.shape[0] <= select_size:\r\n valid_points = torch.nonzero(~mask_kp_i.to(torch.uint8))\r\n valid_batch[i, :] = False\r\n \"\"\"\r\n select_indx = torch.randperm(valid_points.size(0))\r\n\r\n p1 = valid_points[select_indx[0:select_size:3]]\r\n p2 = valid_points[select_indx[1:select_size:3]]\r\n p3 = valid_points[select_indx[2:select_size:3]]\r\n\r\n p1_x.append(p1[:, 1])\r\n p1_y.append(p1[:, 0])\r\n\r\n p2_x.append(p2[:, 1])\r\n p2_y.append(p2[:, 0])\r\n\r\n p3_x.append(p3[:, 1])\r\n p3_y.append(p3[:, 0])\r\n p123 = {'p1_x': torch.stack(p1_x), 'p1_y': torch.stack(p1_y),\r\n 'p2_x': torch.stack(p2_x), 'p2_y': torch.stack(p2_y),\r\n 'p3_x': torch.stack(p3_x), 'p3_y': torch.stack(p3_y),\r\n 'valid_batch': valid_batch}\r\n return p123\r\n\r\n def form_pw_groups(self, p123, pw):\r\n \"\"\"\r\n Form 3D points groups, with 3 points in each grouup.\r\n :param p123: points index\r\n :param pw: 3D points, # [1, h, w, c]\r\n :return:\r\n \"\"\"\r\n p1_x = p123['p1_x']\r\n p1_y = p123['p1_y']\r\n p2_x = p123['p2_x']\r\n p2_y = p123['p2_y']\r\n p3_x = p123['p3_x']\r\n p3_y = p123['p3_y']\r\n batch_list = np.arange(0, p1_x.shape[0])[:, np.newaxis]\r\n pw = pw.repeat((p1_x.shape[0], 1, 1, 1))\r\n pw1 = pw[batch_list, p1_y, p1_x, :]\r\n pw2 = pw[batch_list, p2_y, p2_x, :]\r\n pw3 = pw[batch_list, p3_y, p3_x, :]\r\n \r\n # [B, N, 3(x,y,z), 3(p1,p2,p3)]\r\n pw_groups = torch.cat([pw1[:, :, :, np.newaxis], pw2[:, :, :, np.newaxis], pw3[:, :, :, np.newaxis]], 3)\r\n return pw_groups\r\n\r\n def filter_mask(self, pw_pred):\r\n \"\"\"\r\n :param pw_pred: constructed 3d vector (x, y, disp), [B, N, 3(x,y,z), 3(p1,p2,p3)]\r\n \"\"\"\r\n xy12 = pw_pred[:, :, 0:2, 1] - pw_pred[:, :, 0:2, 0]\r\n xy13 = pw_pred[:, :, 0:2, 2] - pw_pred[:, :, 0:2, 0]\r\n xy23 = pw_pred[:, :, 0:2, 2] - pw_pred[:, :, 0:2, 1]\r\n # Ignore linear\r\n xy_diff = torch.cat([xy12[:, :, :, np.newaxis], xy13[:, :, :, np.newaxis], xy23[:, :, :, np.newaxis]],\r\n 3) # [b, n, 2(xy), 3]\r\n m_batchsize, groups, coords, index = xy_diff.shape\r\n proj_query = xy_diff.view(m_batchsize * groups, -1, index).permute(0, 2, 1) # [bn, 3(p123), 2(xy)]\r\n proj_key = xy_diff.view(m_batchsize * groups, -1, index) # [bn, 2(xy), 3(p123)]\r\n q_norm = proj_query.norm(2, dim=2) # [bn, 3(p123)]\r\n nm = torch.bmm(q_norm.view(m_batchsize * groups, index, 1), q_norm.view(m_batchsize * groups, 1, index)) # []\r\n energy = torch.bmm(proj_query, proj_key) # transpose check [bn, 3(p123), 3(p123)]\r\n norm_energy = energy / (nm + 1e-8)\r\n norm_energy = norm_energy.view(m_batchsize * groups, -1) # [bn, 9(p123)]\r\n mask_cos = torch.sum((norm_energy > self.delta_cos) + (norm_energy < -self.delta_cos), 1) > 3 # igonre\r\n mask_cos = mask_cos.view(m_batchsize, groups) # [b, n] # igonre\r\n\r\n #ignore near\r\n mask_x = torch.sum(torch.abs(xy_diff[:, :, 0, :]) < self.delta_diff_x, 2) > 0\r\n mask_y = torch.sum(torch.abs(xy_diff[:, :, 1, :]) < self.delta_diff_y, 2) > 0\r\n mask_near = mask_x & mask_y\r\n mask_valid_pts = ~(mask_cos | mask_near)\r\n return mask_valid_pts\r\n\r\n def select_points_groups(self, pred_depth, mask_kp):\r\n p123 = self.select_index(mask_kp) # p1_x: [x, N]\r\n\r\n uvz_pred = self.transfer_uvz(pred_depth) #[1, h, w, 3(xyz)]\r\n uvz_groups_pred = self.form_pw_groups(p123, uvz_pred) # [x, N, 3(x,y,z), 3(p1,p2,p3)]\r\n # mask:[b, n]\r\n mask_valid_pts = (self.filter_mask(uvz_groups_pred)).to(torch.bool) # [x, n]\r\n mask_valid_batch = p123['valid_batch'].repeat(1, mask_valid_pts.shape[1]) # [x, n]\r\n mask_valid = mask_valid_pts & mask_valid_batch.cuda() # [x, n]\r\n\r\n if self.xyz_mode == 'uvd':\r\n pw_groups_pred = uvz_groups_pred\r\n else:\r\n xyz_pred = self.transfer_xyz(pred_depth) # [1, h, w, 3(xyz)]\r\n pw_groups_pred = self.form_pw_groups(p123, xyz_pred) # [x, N, 3(x,y,z), 3(p1,p2,p3)]\r\n return pw_groups_pred, mask_valid\r\n\r\n def constrain_a_plane_loss(self, pw_groups_pre_i, mask_valid_i):\r\n \"\"\"\r\n pw_groups_pre: selected points groups for the i-th plane,\r\n \"\"\"\r\n if torch.sum(mask_valid_i) < 2:\r\n return [0.0, 0]\r\n pw_groups_pred_i = pw_groups_pre_i[mask_valid_i] # [n, 3, 3]\r\n p12 = pw_groups_pred_i[:, :, 1] - pw_groups_pred_i[:, :, 0]\r\n p13 = pw_groups_pred_i[:, :, 2] - pw_groups_pred_i[:, :, 0]\r\n virtual_normal = torch.cross(p12, p13, dim=1) # [n, 3]\r\n norm = torch.norm(virtual_normal, 2, dim=1, keepdim=True)\r\n virtual_normal = virtual_normal / (norm + 1e-8)\r\n\r\n # re-orient normals consistently\r\n orient_mask = torch.sum(torch.squeeze(virtual_normal) * torch.squeeze(pw_groups_pred_i[:, :, 0]), dim=1) > 0\r\n virtual_normal[orient_mask] *= -1\r\n #direct = virtual_normal[:, 2] / torch.abs(virtual_normal[:, 2])\r\n #virtual_normal = virtual_normal / direct[:, None] # [n, 3]\r\n\r\n aver_normal = torch.sum(virtual_normal, dim=0)\r\n aver_norm = torch.norm(aver_normal, 2, dim=0, keepdim=True)\r\n aver_normal = aver_normal / (aver_norm + 1e-5) # [3]\r\n\r\n cos_diff = 1.0 - torch.sum(virtual_normal * aver_normal, dim=1)\r\n loss = torch.sum(cos_diff, dim=0)\r\n valid_num = cos_diff.numel()\r\n return loss, valid_num\r\n\r\n def forward(self, gt_depth, pred_depth, mask, focal_length=None):\r\n \"\"\"\r\n Virtual normal loss.\r\n :param pred_depth: predicted depth map, [B,C,H,W]\r\n :param mask: mask for planes, each plane is noted with a value, [B, C, H, W]\r\n :param focal_length: focal length\r\n \"\"\"\r\n B, _, _, _ = pred_depth.shape\r\n loss = torch.tensor(0.0).cuda()\r\n valid_planes_num = 0\r\n for i in range(B):\r\n self.fx = focal_length[i] if focal_length is not None else 256.0\r\n self.fy = focal_length[i] if focal_length is not None else 256.0\r\n\r\n pred_depth_i = pred_depth[i, :]\r\n mask_i = mask[i, :][None, :, :]\r\n unique_planes = torch.unique(mask_i)\r\n planes = [mask_i == m for m in unique_planes if m != 0] #[x, 1, h, w] x is the planes number\r\n if len(planes) == 0:\r\n continue\r\n mask_planes = torch.stack(planes, dim=0) #torch.cat(planes, dim=0) #\r\n pw_groups_pred, mask_valid = self.select_points_groups(pred_depth_i[None, :, :, :], mask_planes) # [x, N, 3(x,y,z), 3(p1,p2,p3)]\r\n for j in range(unique_planes.numel()-1):\r\n mask_valid_j = mask_valid[j, :]\r\n pw_groups_pred_j = pw_groups_pred[j, :]\r\n loss_tmp, valid_angles = self.constrain_a_plane_loss(pw_groups_pred_j, mask_valid_j)\r\n valid_planes_num += valid_angles\r\n loss += loss_tmp\r\n loss /= (valid_planes_num + 1e-8)\r\n return loss\r\n\r\n\r\nif __name__ == '__main__':\r\n import cv2\r\n vnl_loss = PWN_Planes_Loss(500.0, 500.0, (385, 513), xyz_mode='uvd')\r\n pred_depth = torch.rand([2, 1, 385, 513]).cuda()\r\n gt_depth = torch.rand([2, 1, 385, 513]).cuda()\r\n gt_depth[:, :, 3:20, 40:60] = 0\r\n mask_kp1 = pred_depth > 0.9\r\n mask_kp2 = pred_depth < 0.5\r\n mask = torch.zeros_like(gt_depth, dtype=torch.uint8)\r\n mask = 1*mask_kp1 + 2* mask_kp2\r\n #gt_depth = cv2.imread('/hardware/yifanliu/SUNRGBD/sunrgbd-meta-data/sunrgbd_test_depth/2.png', -1)\r\n #gt_depth = gt_depth[None, :, :, None]\r\n #pred_depth = gt_depth[:, :, ::-1, :]\r\n loss = vnl_loss(gt_depth, gt_depth, mask)\r\n print(loss)\r\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076082,"cells":{"text":{"kind":"string","value":"import torch\nimport numpy as np\nimport torch.nn as nn\n\n\ndef init_image_coor(height, width):\n x_row = np.arange(0, width)\n x = np.tile(x_row, (height, 1))\n x = x[np.newaxis, :, :]\n x = x.astype(np.float32)\n x = torch.from_numpy(x.copy()).cuda()\n u_u0 = x - width/2.0\n\n y_col = np.arange(0, height) # y_col = np.arange(0, height)\n y = np.tile(y_col, (width, 1)).T\n y = y[np.newaxis, :, :]\n y = y.astype(np.float32)\n y = torch.from_numpy(y.copy()).cuda()\n v_v0 = y - height/2.0\n return u_u0, v_v0\n\n\ndef depth_to_xyz(depth, focal_length):\n b, c, h, w = depth.shape\n u_u0, v_v0 = init_image_coor(h, w)\n x = u_u0 * depth / focal_length\n y = v_v0 * depth / focal_length\n z = depth\n pw = torch.cat([x, y, z], 1).permute(0, 2, 3, 1) # [b, h, w, c]\n return pw\n\n\ndef get_surface_normal(xyz, patch_size=5):\n # xyz: [1, h, w, 3]\n x, y, z = torch.unbind(xyz, dim=3)\n x = torch.unsqueeze(x, 0)\n y = torch.unsqueeze(y, 0)\n z = torch.unsqueeze(z, 0)\n\n xx = x * x\n yy = y * y\n zz = z * z\n xy = x * y\n xz = x * z\n yz = y * z\n patch_weight = torch.ones((1, 1, patch_size, patch_size), requires_grad=False).cuda()\n xx_patch = nn.functional.conv2d(xx, weight=patch_weight, padding=int(patch_size / 2))\n yy_patch = nn.functional.conv2d(yy, weight=patch_weight, padding=int(patch_size / 2))\n zz_patch = nn.functional.conv2d(zz, weight=patch_weight, padding=int(patch_size / 2))\n xy_patch = nn.functional.conv2d(xy, weight=patch_weight, padding=int(patch_size / 2))\n xz_patch = nn.functional.conv2d(xz, weight=patch_weight, padding=int(patch_size / 2))\n yz_patch = nn.functional.conv2d(yz, weight=patch_weight, padding=int(patch_size / 2))\n ATA = torch.stack([xx_patch, xy_patch, xz_patch, xy_patch, yy_patch, yz_patch, xz_patch, yz_patch, zz_patch],\n dim=4)\n ATA = torch.squeeze(ATA)\n ATA = torch.reshape(ATA, (ATA.size(0), ATA.size(1), 3, 3))\n eps_identity = 1e-6 * torch.eye(3, device=ATA.device, dtype=ATA.dtype)[None, None, :, :].repeat([ATA.size(0), ATA.size(1), 1, 1])\n ATA = ATA + eps_identity\n x_patch = nn.functional.conv2d(x, weight=patch_weight, padding=int(patch_size / 2))\n y_patch = nn.functional.conv2d(y, weight=patch_weight, padding=int(patch_size / 2))\n z_patch = nn.functional.conv2d(z, weight=patch_weight, padding=int(patch_size / 2))\n AT1 = torch.stack([x_patch, y_patch, z_patch], dim=4)\n AT1 = torch.squeeze(AT1)\n AT1 = torch.unsqueeze(AT1, 3)\n\n patch_num = 4\n patch_x = int(AT1.size(1) / patch_num)\n patch_y = int(AT1.size(0) / patch_num)\n n_img = torch.randn(AT1.shape).cuda()\n overlap = patch_size // 2 + 1\n for x in range(int(patch_num)):\n for y in range(int(patch_num)):\n left_flg = 0 if x == 0 else 1\n right_flg = 0 if x == patch_num -1 else 1\n top_flg = 0 if y == 0 else 1\n btm_flg = 0 if y == patch_num - 1 else 1\n at1 = AT1[y * patch_y - top_flg * overlap:(y + 1) * patch_y + btm_flg * overlap,\n x * patch_x - left_flg * overlap:(x + 1) * patch_x + right_flg * overlap]\n ata = ATA[y * patch_y - top_flg * overlap:(y + 1) * patch_y + btm_flg * overlap,\n x * patch_x - left_flg * overlap:(x + 1) * patch_x + right_flg * overlap]\n n_img_tmp, _ = torch.solve(at1, ata)\n\n n_img_tmp_select = n_img_tmp[top_flg * overlap:patch_y + top_flg * overlap, left_flg * overlap:patch_x + left_flg * overlap, :, :]\n n_img[y * patch_y:y * patch_y + patch_y, x * patch_x:x * patch_x + patch_x, :, :] = n_img_tmp_select\n\n n_img_L2 = torch.sqrt(torch.sum(n_img ** 2, dim=2, keepdim=True))\n n_img_norm = n_img / n_img_L2\n\n # re-orient normals consistently\n orient_mask = torch.sum(torch.squeeze(n_img_norm) * torch.squeeze(xyz), dim=2) > 0\n n_img_norm[orient_mask] *= -1\n return n_img_norm\n\ndef get_surface_normalv2(xyz, patch_size=5):\n \"\"\"\n xyz: xyz coordinates\n patch: [p1, p2, p3,\n p4, p5, p6,\n p7, p8, p9]\n surface_normal = [(p9-p1) x (p3-p7)] + [(p6-p4) - (p8-p2)]\n return: normal [h, w, 3, b]\n \"\"\"\n b, h, w, c = xyz.shape\n half_patch = patch_size // 2\n xyz_pad = torch.zeros((b, h + patch_size - 1, w + patch_size - 1, c), dtype=xyz.dtype, device=xyz.device)\n xyz_pad[:, half_patch:-half_patch, half_patch:-half_patch, :] = xyz\n\n # xyz_left_top = xyz_pad[:, :h, :w, :] # p1\n # xyz_right_bottom = xyz_pad[:, -h:, -w:, :]# p9\n # xyz_left_bottom = xyz_pad[:, -h:, :w, :] # p7\n # xyz_right_top = xyz_pad[:, :h, -w:, :] # p3\n # xyz_cross1 = xyz_left_top - xyz_right_bottom # p1p9\n # xyz_cross2 = xyz_left_bottom - xyz_right_top # p7p3\n\n xyz_left = xyz_pad[:, half_patch:half_patch + h, :w, :] # p4\n xyz_right = xyz_pad[:, half_patch:half_patch + h, -w:, :] # p6\n xyz_top = xyz_pad[:, :h, half_patch:half_patch + w, :] # p2\n xyz_bottom = xyz_pad[:, -h:, half_patch:half_patch + w, :] # p8\n xyz_horizon = xyz_left - xyz_right # p4p6\n xyz_vertical = xyz_top - xyz_bottom # p2p8\n\n xyz_left_in = xyz_pad[:, half_patch:half_patch + h, 1:w+1, :] # p4\n xyz_right_in = xyz_pad[:, half_patch:half_patch + h, patch_size-1:patch_size-1+w, :] # p6\n xyz_top_in = xyz_pad[:, 1:h+1, half_patch:half_patch + w, :] # p2\n xyz_bottom_in = xyz_pad[:, patch_size-1:patch_size-1+h, half_patch:half_patch + w, :] # p8\n xyz_horizon_in = xyz_left_in - xyz_right_in # p4p6\n xyz_vertical_in = xyz_top_in - xyz_bottom_in # p2p8\n\n n_img_1 = torch.cross(xyz_horizon_in, xyz_vertical_in, dim=3)\n n_img_2 = torch.cross(xyz_horizon, xyz_vertical, dim=3)\n\n # re-orient normals consistently\n orient_mask = torch.sum(n_img_1 * xyz, dim=3) > 0\n n_img_1[orient_mask] *= -1\n orient_mask = torch.sum(n_img_2 * xyz, dim=3) > 0\n n_img_2[orient_mask] *= -1\n\n n_img1_L2 = torch.sqrt(torch.sum(n_img_1 ** 2, dim=3, keepdim=True))\n n_img1_norm = n_img_1 / (n_img1_L2 + 1e-8)\n\n n_img2_L2 = torch.sqrt(torch.sum(n_img_2 ** 2, dim=3, keepdim=True))\n n_img2_norm = n_img_2 / (n_img2_L2 + 1e-8)\n\n # average 2 norms\n n_img_aver = n_img1_norm + n_img2_norm\n n_img_aver_L2 = torch.sqrt(torch.sum(n_img_aver ** 2, dim=3, keepdim=True))\n n_img_aver_norm = n_img_aver / (n_img_aver_L2 + 1e-8)\n # re-orient normals consistently\n orient_mask = torch.sum(n_img_aver_norm * xyz, dim=3) > 0\n n_img_aver_norm[orient_mask] *= -1\n n_img_aver_norm_out = n_img_aver_norm.permute((1, 2, 3, 0)) # [h, w, c, b]\n\n # a = torch.sum(n_img1_norm_out*n_img2_norm_out, dim=2).cpu().numpy().squeeze()\n # plt.imshow(np.abs(a), cmap='rainbow')\n # plt.show()\n return n_img_aver_norm_out#n_img1_norm.permute((1, 2, 3, 0))\n\ndef surface_normal_from_depth(depth, focal_length, valid_mask=None):\n # para depth: depth map, [b, c, h, w]\n b, c, h, w = depth.shape\n focal_length = focal_length[:, None, None, None]\n depth_filter = nn.functional.avg_pool2d(depth, kernel_size=3, stride=1, padding=1)\n depth_filter = nn.functional.avg_pool2d(depth_filter, kernel_size=3, stride=1, padding=1)\n xyz = depth_to_xyz(depth_filter, focal_length)\n sn_batch = []\n for i in range(b):\n xyz_i = xyz[i, :][None, :, :, :]\n normal = get_surface_normalv2(xyz_i)\n sn_batch.append(normal)\n sn_batch = torch.cat(sn_batch, dim=3).permute((3, 2, 0, 1)) # [b, c, h, w]\n mask_invalid = (~valid_mask).repeat(1, 3, 1, 1)\n sn_batch[mask_invalid] = 0.0\n\n return sn_batch\n\n\ndef vis_normal(normal):\n \"\"\"\n Visualize surface normal. Transfer surface normal value from [-1, 1] to [0, 255]\n @para normal: surface normal, [h, w, 3], numpy.array\n \"\"\"\n n_img_L2 = np.sqrt(np.sum(normal ** 2, axis=2, keepdims=True))\n n_img_norm = normal / (n_img_L2 + 1e-8)\n normal_vis = n_img_norm * 127\n normal_vis += 128\n normal_vis = normal_vis.astype(np.uint8)\n return normal_vis\n\n\ndef vis_normal2(normals):\n '''\n Montage of normal maps. Vectors are unit length and backfaces thresholded.\n '''\n x = normals[:, :, 0] # horizontal; pos right\n y = normals[:, :, 1] # depth; pos far\n z = normals[:, :, 2] # vertical; pos up\n backfacing = (z > 0)\n norm = np.sqrt(np.sum(normals**2, axis=2))\n zero = (norm < 1e-5)\n x += 1.0; x *= 0.5\n y += 1.0; y *= 0.5\n z = np.abs(z)\n x[zero] = 0.0\n y[zero] = 0.0\n z[zero] = 0.0\n normals[:, :, 0] = x # horizontal; pos right\n normals[:, :, 1] = y # depth; pos far\n normals[:, :, 2] = z # vertical; pos up\n return normals\n\nif __name__ == '__main__':\n import cv2, os\n\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076083,"cells":{"text":{"kind":"string","value":"#!/usr/bin/env python\n# coding: utf-8\n\n\"\"\"\nhttps://github.com/CSAILVision/semantic-segmentation-pytorch\n\"\"\"\nimport os\nimport sys\nimport torch\nimport torch.nn as nn\nimport math\nimport torch.utils.model_zoo as model_zoo\n\nfrom lib.configs.config import cfg\n\n\ntry:\n from urllib import urlretrieve\nexcept ImportError:\n from urllib.request import urlretrieve\n\n__all__ = ['resnext101_32x8d']\n\n\nmodel_urls = {\n 'resnext50_32x4d': 'https://download.pytorch.org/models/resnext50_32x4d-7cdf4587.pth',\n 'resnext101_32x8d': 'https://download.pytorch.org/models/resnext101_32x8d-8ba56ff5.pth',\n #'resnext101': 'http://sceneparsing.csail.mit.edu/model/pretrained_resnet/resnext101-imagenet.pth'\n}\n\n\ndef conv3x3(in_planes, out_planes, stride=1, groups=1, dilation=1):\n \"\"\"3x3 convolution with padding\"\"\"\n return nn.Conv2d(in_planes, out_planes, kernel_size=3, stride=stride,\n padding=dilation, groups=groups, bias=False, dilation=dilation)\n\n\ndef conv1x1(in_planes, out_planes, stride=1):\n \"\"\"1x1 convolution\"\"\"\n return nn.Conv2d(in_planes, out_planes, kernel_size=1, stride=stride, bias=False)\n\n\nclass BasicBlock(nn.Module):\n expansion = 1\n\n def __init__(self, inplanes, planes, stride=1, downsample=None, groups=1,\n base_width=64, dilation=1, norm_layer=None):\n super(BasicBlock, self).__init__()\n if norm_layer is None:\n norm_layer = nn.BatchNorm2d\n if groups != 1 or base_width != 64:\n raise ValueError('BasicBlock only supports groups=1 and base_width=64')\n if dilation > 1:\n raise NotImplementedError(\"Dilation > 1 not supported in BasicBlock\")\n # Both self.conv1 and self.downsample layers downsample the input when stride != 1\n self.conv1 = conv3x3(inplanes, planes, stride)\n self.bn1 = norm_layer(planes)\n self.relu = nn.ReLU(inplace=True)\n self.conv2 = conv3x3(planes, planes)\n self.bn2 = norm_layer(planes)\n self.downsample = downsample\n self.stride = stride\n\n def forward(self, x):\n identity = x\n\n out = self.conv1(x)\n out = self.bn1(out)\n out = self.relu(out)\n\n out = self.conv2(out)\n out = self.bn2(out)\n\n if self.downsample is not None:\n identity = self.downsample(x)\n\n out += identity\n out = self.relu(out)\n\n return out\n\n\nclass Bottleneck(nn.Module):\n # Bottleneck in torchvision places the stride for downsampling at 3x3 convolution(self.conv2)\n # while original implementation places the stride at the first 1x1 convolution(self.conv1)\n # according to \"Deep residual learning for image recognition\"https://arxiv.org/abs/1512.03385.\n # This variant is also known as ResNet V1.5 and improves accuracy according to\n # https://ngc.nvidia.com/catalog/model-scripts/nvidia:resnet_50_v1_5_for_pytorch.\n\n expansion = 4\n\n def __init__(self, inplanes, planes, stride=1, downsample=None, groups=1,\n base_width=64, dilation=1, norm_layer=None):\n super(Bottleneck, self).__init__()\n if norm_layer is None:\n norm_layer = nn.BatchNorm2d\n width = int(planes * (base_width / 64.)) * groups\n # Both self.conv2 and self.downsample layers downsample the input when stride != 1\n self.conv1 = conv1x1(inplanes, width)\n self.bn1 = norm_layer(width)\n self.conv2 = conv3x3(width, width, stride, groups, dilation)\n self.bn2 = norm_layer(width)\n self.conv3 = conv1x1(width, planes * self.expansion)\n self.bn3 = norm_layer(planes * self.expansion)\n self.relu = nn.ReLU(inplace=True)\n self.downsample = downsample\n self.stride = stride\n\n def forward(self, x):\n identity = x\n\n out = self.conv1(x)\n out = self.bn1(out)\n out = self.relu(out)\n\n out = self.conv2(out)\n out = self.bn2(out)\n out = self.relu(out)\n\n out = self.conv3(out)\n out = self.bn3(out)\n\n if self.downsample is not None:\n identity = self.downsample(x)\n\n out += identity\n out = self.relu(out)\n\n return out\n\n\nclass ResNet(nn.Module):\n\n def __init__(self, block, layers, num_classes=1000, zero_init_residual=False,\n groups=1, width_per_group=64, replace_stride_with_dilation=None,\n norm_layer=None):\n super(ResNet, self).__init__()\n if norm_layer is None:\n norm_layer = nn.BatchNorm2d\n self._norm_layer = norm_layer\n\n self.inplanes = 64\n self.dilation = 1\n if replace_stride_with_dilation is None:\n # each element in the tuple indicates if we should replace\n # the 2x2 stride with a dilated convolution instead\n replace_stride_with_dilation = [False, False, False]\n if len(replace_stride_with_dilation) != 3:\n raise ValueError(\"replace_stride_with_dilation should be None \"\n \"or a 3-element tuple, got {}\".format(replace_stride_with_dilation))\n self.groups = groups\n self.base_width = width_per_group\n self.conv1 = nn.Conv2d(3, self.inplanes, kernel_size=7, stride=2, padding=3,\n bias=False)\n self.bn1 = norm_layer(self.inplanes)\n self.relu = nn.ReLU(inplace=True)\n self.maxpool = nn.MaxPool2d(kernel_size=3, stride=2, padding=1)\n self.layer1 = self._make_layer(block, 64, layers[0])\n self.layer2 = self._make_layer(block, 128, layers[1], stride=2,\n dilate=replace_stride_with_dilation[0])\n self.layer3 = self._make_layer(block, 256, layers[2], stride=2,\n dilate=replace_stride_with_dilation[1])\n self.layer4 = self._make_layer(block, 512, layers[3], stride=2,\n dilate=replace_stride_with_dilation[2])\n #self.avgpool = nn.AdaptiveAvgPool2d((1, 1))\n #self.fc = nn.Linear(512 * block.expansion, num_classes)\n\n for m in self.modules():\n if isinstance(m, nn.Conv2d):\n nn.init.kaiming_normal_(m.weight, mode='fan_out', nonlinearity='relu')\n elif isinstance(m, (nn.BatchNorm2d, nn.GroupNorm)):\n nn.init.constant_(m.weight, 1)\n nn.init.constant_(m.bias, 0)\n\n # Zero-initialize the last BN in each residual branch,\n # so that the residual branch starts with zeros, and each residual block behaves like an identity.\n # This improves the model by 0.2~0.3% according to https://arxiv.org/abs/1706.02677\n if zero_init_residual:\n for m in self.modules():\n if isinstance(m, Bottleneck):\n nn.init.constant_(m.bn3.weight, 0)\n elif isinstance(m, BasicBlock):\n nn.init.constant_(m.bn2.weight, 0)\n\n def _make_layer(self, block, planes, blocks, stride=1, dilate=False):\n norm_layer = self._norm_layer\n downsample = None\n previous_dilation = self.dilation\n if dilate:\n self.dilation *= stride\n stride = 1\n if stride != 1 or self.inplanes != planes * block.expansion:\n downsample = nn.Sequential(\n conv1x1(self.inplanes, planes * block.expansion, stride),\n norm_layer(planes * block.expansion),\n )\n\n layers = []\n layers.append(block(self.inplanes, planes, stride, downsample, self.groups,\n self.base_width, previous_dilation, norm_layer))\n self.inplanes = planes * block.expansion\n for _ in range(1, blocks):\n layers.append(block(self.inplanes, planes, groups=self.groups,\n base_width=self.base_width, dilation=self.dilation,\n norm_layer=norm_layer))\n\n return nn.Sequential(*layers)\n\n def _forward_impl(self, x):\n # See note [TorchScript super()]\n features = []\n x = self.conv1(x)\n x = self.bn1(x)\n x = self.relu(x)\n x = self.maxpool(x)\n\n x = self.layer1(x)\n features.append(x)\n\n x = self.layer2(x)\n features.append(x)\n\n x = self.layer3(x)\n features.append(x)\n\n x = self.layer4(x)\n features.append(x)\n\n #x = self.avgpool(x)\n #x = torch.flatten(x, 1)\n #x = self.fc(x)\n\n return features\n\n def forward(self, x):\n return self._forward_impl(x)\n\n\n\ndef resnext101_32x8d(pretrained=True, **kwargs):\n \"\"\"Constructs a ResNet-152 model.\n Args:\n pretrained (bool): If True, returns a model pre-trained on ImageNet\n \"\"\"\n kwargs['groups'] = 32\n kwargs['width_per_group'] = 8\n\n model = ResNet(Bottleneck, [3, 4, 23, 3], **kwargs)\n if pretrained:\n pretrained_dict = model_zoo.load_url(model_urls['resnext101_32x8d'], cfg.ROOT_DIR + '/' + cfg.MODEL.MODEL_REPOSITORY)\n #pretrained_model = torchvision.models.resnet152(pretrained=True)\n #pretrained_model = gcv.models.resnet152(pretrained=True)\n #pretrained_dict = pretrained_model.state_dict()\n model_dict = model.state_dict()\n pretrained_dict = {k:v for k, v in pretrained_dict.items() if k in model_dict}\n model_dict.update(pretrained_dict)\n model.load_state_dict(model_dict)\n return model\n\n\n\nif __name__ == '__main__':\n import torch\n model = resnext101_32x8d(True).cuda()\n\n rgb = torch.rand((2, 3, 256, 256)).cuda()\n out = model(rgb)\n print(len(out))\n\n\n\n\"\"\"\n\ndef load_url(url, model_dir='./pretrained', map_location=None):\n if not os.path.exists(model_dir):\n os.makedirs(model_dir)\n filename = url.split('/')[-1]\n cached_file = os.path.join(model_dir, filename)\n if not os.path.exists(cached_file):\n sys.stderr.write('Downloading: \"{}\" to {}\\n'.format(url, cached_file))\n urlretrieve(url, cached_file)\n return torch.load(cached_file, map_location=map_location)\n\n\ndef conv3x3(in_planes, out_planes, stride=1):\n \"3x3 convolution with padding\"\n return nn.Conv2d(in_planes, out_planes, kernel_size=3, stride=stride,\n padding=1, bias=False)\n\n\nclass GroupBottleneck(nn.Module):\n expansion = 2\n\n def __init__(self, inplanes, planes, stride=1, groups=1, downsample=None):\n super(GroupBottleneck, self).__init__()\n self.conv1 = nn.Conv2d(inplanes, planes, kernel_size=1, bias=False)\n self.bn1 = nn.BatchNorm2d(planes)\n self.conv2 = nn.Conv2d(planes, planes, kernel_size=3, stride=stride,\n padding=1, groups=groups, bias=False)\n self.bn2 = nn.BatchNorm2d(planes)\n self.conv3 = nn.Conv2d(planes, planes * 2, kernel_size=1, bias=False)\n self.bn3 = nn.BatchNorm2d(planes * 2)\n self.relu = nn.ReLU(inplace=True)\n self.downsample = downsample\n self.stride = stride\n\n def forward(self, x):\n residual = x\n\n out = self.conv1(x)\n out = self.bn1(out)\n out = self.relu(out)\n\n out = self.conv2(out)\n out = self.bn2(out)\n out = self.relu(out)\n\n out = self.conv3(out)\n out = self.bn3(out)\n\n if self.downsample is not None:\n residual = self.downsample(x)\n\n out += residual\n out = self.relu(out)\n\n return out\n\n\nclass ResNeXt(nn.Module):\n\n def __init__(self, block, layers, groups=32, num_classes=1000):\n self.inplanes = 128\n super(ResNeXt, self).__init__()\n self.conv1 = conv3x3(3, 64, stride=2)\n self.bn1 = nn.BatchNorm2d(64)\n self.relu1 = nn.ReLU(inplace=True)\n self.conv2 = conv3x3(64, 64)\n self.bn2 = nn.BatchNorm2d(64)\n self.relu2 = nn.ReLU(inplace=True)\n self.conv3 = conv3x3(64, 128)\n self.bn3 = nn.BatchNorm2d(128)\n self.relu3 = nn.ReLU(inplace=True)\n self.maxpool = nn.MaxPool2d(kernel_size=3, stride=2, padding=1)\n\n self.layer1 = self._make_layer(block, 128, layers[0], groups=groups)\n self.layer2 = self._make_layer(block, 256, layers[1], stride=2, groups=groups)\n self.layer3 = self._make_layer(block, 512, layers[2], stride=2, groups=groups)\n self.layer4 = self._make_layer(block, 1024, layers[3], stride=2, groups=groups)\n\n #self.avgpool = nn.AvgPool2d(7, stride=1)\n #self.fc = nn.Linear(1024 * block.expansion, num_classes)\n\n for m in self.modules():\n if isinstance(m, nn.Conv2d):\n n = m.kernel_size[0] * m.kernel_size[1] * m.out_channels // m.groups\n m.weight.data.normal_(0, math.sqrt(2. / n))\n elif isinstance(m, nn.BatchNorm2d):\n m.weight.data.fill_(1)\n m.bias.data.zero_()\n\n def _make_layer(self, block, planes, blocks, stride=1, groups=1):\n downsample = None\n if stride != 1 or self.inplanes != planes * block.expansion:\n downsample = nn.Sequential(\n nn.Conv2d(self.inplanes, planes * block.expansion,\n kernel_size=1, stride=stride, bias=False),\n nn.BatchNorm2d(planes * block.expansion),\n )\n\n layers = []\n layers.append(block(self.inplanes, planes, stride, groups, downsample))\n self.inplanes = planes * block.expansion\n for i in range(1, blocks):\n layers.append(block(self.inplanes, planes, groups=groups))\n\n return nn.Sequential(*layers)\n\n def forward(self, x):\n features = []\n\n x = self.relu1(self.bn1(self.conv1(x)))\n x = self.relu2(self.bn2(self.conv2(x)))\n x = self.relu3(self.bn3(self.conv3(x)))\n x = self.maxpool(x)\n\n x = self.layer1(x)\n features.append(x)\n x = self.layer2(x)\n features.append(x)\n x = self.layer3(x)\n features.append(x)\n x = self.layer4(x)\n features.append(x)\n return features\n\ndef resnext101(pretrained=True, **kwargs):\n '''\n Constructs a resnext-101 model.\n #Args:\n pretrained (bool): If True, returns a model pre-trained on Places\n '''\n model = ResNeXt(GroupBottleneck, [3, 4, 23, 3], **kwargs)\n if pretrained:\n model.load_state_dict(load_url(), strict=False)\n #model.load_state_dict(torch.load('./pretrained/resnet101-imagenet.pth', map_location=None), strict=False)\n return model\n\"\"\"\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076084,"cells":{"text":{"kind":"string","value":"import torch\r\nimport torch.nn.functional\r\n\r\nfrom . import network_auxi as network\r\nfrom lib.configs.config import cfg\r\nfrom lib.utils.net_tools import *\r\nfrom lib.models.PWN_planes import PWNPlanesLoss\r\nfrom lib.models.PWN_edges import EdgeguidedNormalRegressionLoss\r\nfrom lib.models.ranking_loss import EdgeguidedRankingLoss\r\nfrom lib.models.ILNR_loss import MEADSTD_TANH_NORM_Loss\r\nfrom lib.models.MSGIL_loss import MSGIL_NORM_Loss\r\n\r\n\r\nclass RelDepthModel(nn.Module):\r\n def __init__(self):\r\n super(RelDepthModel, self).__init__()\r\n self.depth_model = DepthModel()\r\n self.losses = ModelLoss()\r\n\r\n def forward(self, data, is_train=True):\r\n # Input data is a_real, predicted data is b_fake, groundtruth is b_real\r\n self.inputs = data['rgb'].cuda()\r\n self.logit, self.auxi = self.depth_model(self.inputs)\r\n if is_train:\r\n self.losses_dict = self.losses.criterion(self.logit, self.auxi, data)\r\n else:\r\n self.losses_dict = {'total_loss': torch.tensor(0.0, dtype=torch.float).cuda()}\r\n return {'decoder': self.logit, 'auxi': self.auxi, 'losses': self.losses_dict}\r\n\r\n def inference(self, data):\r\n with torch.no_grad():\r\n out = self.forward(data, is_train=False)\r\n pred_depth = out['decoder']\r\n pred_disp = out['auxi']\r\n pred_depth_out = pred_depth\r\n return {'pred_depth': pred_depth_out, 'pred_disp': pred_disp}\r\n\r\n\r\nclass ModelLoss(nn.Module):\r\n def __init__(self):\r\n super(ModelLoss, self).__init__()\r\n\r\n ################Loss for the main branch, i.e. on the depth map#################\r\n # Geometry Loss\r\n self.pn_plane = PWNPlanesLoss(focal_x=cfg.DATASET.FOCAL_X, focal_y=cfg.DATASET.FOCAL_Y,\r\n input_size=cfg.DATASET.CROP_SIZE, sample_groups=5000, xyz_mode='xyz')\r\n self.pn_edge = EdgeguidedNormalRegressionLoss(mask_value=-1e-8, max_threshold=10.1)\r\n # self.surface_normal_loss = SurfaceNormalLoss()\r\n\r\n # the scale can be adjusted\r\n self.msg_normal_loss = MSGIL_NORM_Loss(scale=4, valid_threshold=-1e-8)\r\n\r\n # Scale shift invariant. SSIMAEL_Loss is MIDAS loss. MEADSTD_TANH_NORM_Loss is our normalization loss.\r\n self.meanstd_tanh_loss = MEADSTD_TANH_NORM_Loss(valid_threshold=-1e-8)\r\n\r\n self.ranking_edge_loss = EdgeguidedRankingLoss(mask_value=-1e-8)\r\n\r\n\r\n ################Loss for the auxi branch, i.e. on the disp map#################\r\n # the scale can be adjusted\r\n self.msg_normal_auxiloss = MSGIL_NORM_Loss(scale=4, valid_threshold=-1e-8)\r\n\r\n # Scale shift invariant. SSIMAEL_Loss is MIDAS loss. MEADSTD_TANH_NORM_Loss is our normalization loss.\r\n self.meanstd_tanh_auxiloss = MEADSTD_TANH_NORM_Loss(valid_threshold=-1e-8)\r\n\r\n self.ranking_edge_auxiloss = EdgeguidedRankingLoss(mask_value=-1e-8)\r\n\r\n def criterion(self, pred_logit, auxi, data):\r\n loss1 = self.decoder_loss(pred_logit, data)\r\n loss2 = self.auxi_loss(auxi, data)\r\n loss = {}\r\n loss.update(loss1)\r\n loss.update(loss2)\r\n loss['total_loss'] = loss1['total_loss'] + loss2['total_loss']\r\n return loss\r\n\r\n def auxi_loss(self, auxi, data):\r\n loss = {}\r\n if 'disp' not in data:\r\n return {'total_loss': torch.tensor(0.0).cuda()}\r\n\r\n gt_disp = data['disp'].to(device=auxi.device)\r\n\r\n mask_mid_quality = data['quality_flg'] >= 2\r\n gt_disp_mid = gt_disp[mask_mid_quality]\r\n auxi_mid = auxi[mask_mid_quality]\r\n\r\n if '_ranking-edge-auxi_' in cfg.TRAIN.LOSS_MODE.lower():\r\n loss['ranking-edge_auxiloss'] = self.ranking_edge_auxiloss(auxi, gt_disp, data['rgb'])\r\n\r\n if '_msgil-normal-auxi_' in cfg.TRAIN.LOSS_MODE.lower():\r\n loss['msg_normal_auxiloss'] = (self.msg_normal_auxiloss(auxi_mid, gt_disp_mid) * 0.5).float()\r\n\r\n if '_meanstd-tanh-auxi_' in cfg.TRAIN.LOSS_MODE.lower():\r\n loss['meanstd-tanh_auxiloss'] = self.meanstd_tanh_auxiloss(auxi_mid, gt_disp_mid)\r\n\r\n total_loss = sum(loss.values())\r\n loss['total_loss'] = total_loss * cfg.TRAIN.LOSS_AUXI_WEIGHT\r\n return loss\r\n\r\n def decoder_loss(self, pred_logit, data):\r\n pred_depth = pred_logit\r\n\r\n gt_depth = data['depth'].to(device=pred_depth.device)\r\n\r\n # High-quality data, except webstereo data\r\n mask_high_quality = data['quality_flg'] ==3\r\n mask_mid_quality = data['quality_flg'] >= 2\r\n # gt_depth_high = gt_depth[mask_high_quality]\r\n # pred_depth_high = pred_depth[mask_high_quality]\r\n\r\n gt_depth_mid = gt_depth[mask_mid_quality]\r\n pred_depth_mid = pred_depth[mask_mid_quality]\r\n\r\n\r\n #gt_depth_filter = data['mask_highquality']]\r\n #pred_depth_filter = pred_depth[data['mask_highquality']]\r\n #focal_length_filter = data['focal_length'][data['mask_highquality']]\r\n\r\n # if gt_depth_high.ndim == 3:\r\n # gt_depth_high = gt_depth_high[None, :, :, :]\r\n # pred_depth_high = pred_depth_high[None, :, :, :]\r\n if gt_depth_mid.ndim == 3:\r\n gt_depth_mid = gt_depth_mid[None, :, :, :]\r\n pred_depth_mid = pred_depth_mid[None, :, :, :]\r\n loss = {}\r\n\r\n if '_pairwise-normal-regress-edge_' in cfg.TRAIN.LOSS_MODE.lower() or \\\r\n '_pairwise-normal-regress-plane_' in cfg.TRAIN.LOSS_MODE.lower():\r\n pred_ssinv = recover_scale_shift_depth(pred_depth, gt_depth, min_threshold=-1e-8, max_threshold=10.1)\r\n else:\r\n pred_ssinv = None\r\n\r\n # Geometry Loss\r\n if '_pairwise-normal-regress-plane_' in cfg.TRAIN.LOSS_MODE.lower():\r\n focal_length = data['focal_length'] if 'focal_length' in data else None\r\n loss['pairwise-normal-regress-plane_loss'] = self.pn_plane(gt_depth,\r\n pred_ssinv,\r\n data['planes'],\r\n focal_length)\r\n if '_pairwise-normal-regress-edge_' in cfg.TRAIN.LOSS_MODE.lower():\r\n if mask_high_quality.sum():\r\n loss['pairwise-normal-regress-edge_loss'] = self.pn_edge(pred_ssinv[mask_high_quality],\r\n gt_depth[mask_high_quality],\r\n data['rgb'][mask_high_quality],\r\n focal_length=data['focal_length'][mask_high_quality])\r\n else:\r\n loss['pairwise-normal-regress-edge_loss'] = pred_ssinv.sum() * 0.\r\n\r\n # Scale-shift Invariant Loss\r\n if '_meanstd-tanh_' in cfg.TRAIN.LOSS_MODE.lower():\r\n if mask_mid_quality.sum():\r\n loss_ssi = self.meanstd_tanh_loss(pred_depth_mid, gt_depth_mid)\r\n loss['meanstd-tanh_loss'] = loss_ssi\r\n else:\r\n loss['meanstd-tanh_loss'] = pred_depth.sum() * 0.\r\n\r\n if '_ranking-edge_' in cfg.TRAIN.LOSS_MODE.lower():\r\n loss['ranking-edge_loss'] = self.ranking_edge_loss(pred_depth, gt_depth, data['rgb'])\r\n\r\n # Multi-scale Gradient Loss\r\n if '_msgil-normal_' in cfg.TRAIN.LOSS_MODE.lower():\r\n if mask_mid_quality.sum():\r\n loss['msg_normal_loss'] = (self.msg_normal_loss(pred_depth_mid, gt_depth_mid) * 0.5).float()\r\n else:\r\n loss['msg_normal_loss'] = pred_depth.sum() * 0.\r\n\r\n total_loss = sum(loss.values())\r\n loss['total_loss'] = total_loss\r\n return loss\r\n\r\n\r\nclass ModelOptimizer(object):\r\n def __init__(self, model):\r\n super(ModelOptimizer, self).__init__()\r\n encoder_params = []\r\n encoder_params_names = []\r\n decoder_params = []\r\n decoder_params_names = []\r\n nograd_param_names = []\r\n\r\n for key, value in model.named_parameters():\r\n if value.requires_grad:\r\n if 'res' in key:\r\n encoder_params.append(value)\r\n encoder_params_names.append(key)\r\n else:\r\n decoder_params.append(value)\r\n decoder_params_names.append(key)\r\n else:\r\n nograd_param_names.append(key)\r\n\r\n lr_encoder = cfg.TRAIN.BASE_LR\r\n lr_decoder = cfg.TRAIN.BASE_LR * cfg.TRAIN.SCALE_DECODER_LR\r\n weight_decay = 0.0005\r\n\r\n net_params = [\r\n {'params': encoder_params,\r\n 'lr': lr_encoder,\r\n 'weight_decay': weight_decay},\r\n {'params': decoder_params,\r\n 'lr': lr_decoder,\r\n 'weight_decay': weight_decay},\r\n ]\r\n self.optimizer = torch.optim.SGD(net_params, momentum=0.9)\r\n self.model = model\r\n\r\n def optim(self, loss):\r\n self.optimizer.zero_grad()\r\n loss_all = loss['total_loss']\r\n loss_all.backward()\r\n torch.nn.utils.clip_grad_norm_(self.model.parameters(), 10)\r\n self.optimizer.step()\r\n\r\n\r\nclass DepthModel(nn.Module):\r\n def __init__(self):\r\n super(DepthModel, self).__init__()\r\n backbone = network.__name__.split('.')[-1] + '.' + cfg.MODEL.ENCODER\r\n self.encoder_modules = get_func(backbone)()\r\n self.decoder_modules = network.Decoder()\r\n self.auxi_modules = network.AuxiNetV2()\r\n\r\n def forward(self, x):\r\n lateral_out = self.encoder_modules(x)\r\n out_logit, auxi_input = self.decoder_modules(lateral_out)\r\n out_auxi = self.auxi_modules(auxi_input)\r\n return out_logit, out_auxi\r\n\r\n\r\ndef recover_scale_shift_depth(pred, gt, min_threshold=1e-8, max_threshold=1e8):\r\n b, c, h, w = pred.shape\r\n mask = (gt > min_threshold) & (gt < max_threshold) # [b, c, h, w]\r\n EPS = 1e-6 * torch.eye(2, dtype=pred.dtype, device=pred.device)\r\n scale_shift_batch = []\r\n ones_img = torch.ones((1, h, w), dtype=pred.dtype, device=pred.device)\r\n for i in range(b):\r\n mask_i = mask[i, ...]\r\n pred_valid_i = pred[i, ...][mask_i]\r\n ones_i = ones_img[mask_i]\r\n pred_valid_ones_i = torch.stack((pred_valid_i, ones_i), dim=0) # [c+1, n]\r\n A_i = torch.matmul(pred_valid_ones_i, pred_valid_ones_i.permute(1, 0)) # [2, 2]\r\n A_inverse = torch.inverse(A_i + EPS)\r\n\r\n gt_i = gt[i, ...][mask_i]\r\n B_i = torch.matmul(pred_valid_ones_i, gt_i)[:, None] # [2, 1]\r\n scale_shift_i = torch.matmul(A_inverse, B_i) # [2, 1]\r\n scale_shift_batch.append(scale_shift_i)\r\n scale_shift_batch = torch.stack(scale_shift_batch, dim=0) # [b, 2, 1]\r\n ones = torch.ones_like(pred)\r\n pred_ones = torch.cat((pred, ones), dim=1) # [b, 2, h, w]\r\n pred_scale_shift = torch.matmul(pred_ones.permute(0, 2, 3, 1).reshape(b, h * w, 2), scale_shift_batch) # [b, h*w, 1]\r\n pred_scale_shift = pred_scale_shift.permute(0, 2, 1).reshape((b, c, h, w))\r\n return pred_scale_shift\r\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076085,"cells":{"text":{"kind":"string","value":"\r\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076086,"cells":{"text":{"kind":"string","value":"import torch.nn as nn\nimport torch.utils.model_zoo as model_zoo\nimport torchvision\nfrom lib.configs.config import cfg\n\nimport torch.nn as NN\n\n__all__ = ['ResNet', 'resnet18', 'resnet34', 'resnet50', 'resnet101',\n 'resnet152']\n\n\nmodel_urls = {\n 'resnet18': 'https://download.pytorch.org/models/resnet18-5c106cde.pth',\n 'resnet34': 'https://download.pytorch.org/models/resnet34-333f7ec4.pth',\n 'resnet50': 'https://download.pytorch.org/models/resnet50-19c8e357.pth',\n 'resnet101': 'https://download.pytorch.org/models/resnet101-5d3b4d8f.pth',\n 'resnet152': 'https://download.pytorch.org/models/resnet152-b121ed2d.pth',\n}\n\n\ndef conv3x3(in_planes, out_planes, stride=1):\n \"\"\"3x3 convolution with padding\"\"\"\n return nn.Conv2d(in_planes, out_planes, kernel_size=3, stride=stride,\n padding=1, bias=False)\n\n\nclass BasicBlock(nn.Module):\n expansion = 1\n\n def __init__(self, inplanes, planes, stride=1, downsample=None):\n super(BasicBlock, self).__init__()\n self.conv1 = conv3x3(inplanes, planes, stride)\n self.bn1 = NN.BatchNorm2d(planes) #NN.BatchNorm2d\n self.relu = nn.ReLU(inplace=True)\n self.conv2 = conv3x3(planes, planes)\n self.bn2 = NN.BatchNorm2d(planes) #NN.BatchNorm2d\n self.downsample = downsample\n self.stride = stride\n\n def forward(self, x):\n residual = x\n\n out = self.conv1(x)\n out = self.bn1(out)\n out = self.relu(out)\n\n out = self.conv2(out)\n out = self.bn2(out)\n\n if self.downsample is not None:\n residual = self.downsample(x)\n\n out += residual\n out = self.relu(out)\n\n return out\n\n\nclass Bottleneck(nn.Module):\n expansion = 4\n\n def __init__(self, inplanes, planes, stride=1, downsample=None):\n super(Bottleneck, self).__init__()\n self.conv1 = nn.Conv2d(inplanes, planes, kernel_size=1, bias=False)\n self.bn1 = NN.BatchNorm2d(planes) #NN.BatchNorm2d\n self.conv2 = nn.Conv2d(planes, planes, kernel_size=3, stride=stride,\n padding=1, bias=False)\n self.bn2 = NN.BatchNorm2d(planes) #NN.BatchNorm2d\n self.conv3 = nn.Conv2d(planes, planes * self.expansion, kernel_size=1, bias=False)\n self.bn3 = NN.BatchNorm2d(planes * self.expansion) #NN.BatchNorm2d\n self.relu = nn.ReLU(inplace=True)\n self.downsample = downsample\n self.stride = stride\n\n def forward(self, x):\n residual = x\n\n out = self.conv1(x)\n out = self.bn1(out)\n out = self.relu(out)\n\n out = self.conv2(out)\n out = self.bn2(out)\n out = self.relu(out)\n\n out = self.conv3(out)\n out = self.bn3(out)\n\n if self.downsample is not None:\n residual = self.downsample(x)\n\n out += residual\n out = self.relu(out)\n\n return out\n\n\nclass ResNet(nn.Module):\n\n def __init__(self, block, layers, num_classes=1000):\n self.inplanes = 64\n super(ResNet, self).__init__()\n self.conv1 = nn.Conv2d(3, 64, kernel_size=7, stride=2, padding=3,\n bias=False)\n self.bn1 = NN.BatchNorm2d(64) #NN.BatchNorm2d\n self.relu = nn.ReLU(inplace=True)\n self.maxpool = nn.MaxPool2d(kernel_size=3, stride=2, padding=1)\n self.layer1 = self._make_layer(block, 64, layers[0])\n self.layer2 = self._make_layer(block, 128, layers[1], stride=2)\n self.layer3 = self._make_layer(block, 256, layers[2], stride=2)\n self.layer4 = self._make_layer(block, 512, layers[3], stride=2)\n #self.avgpool = nn.AvgPool2d(7, stride=1)\n #self.fc = nn.Linear(512 * block.expansion, num_classes)\n\n for m in self.modules():\n if isinstance(m, nn.Conv2d):\n nn.init.kaiming_normal_(m.weight, mode='fan_out', nonlinearity='relu')\n elif isinstance(m, nn.BatchNorm2d):\n nn.init.constant_(m.weight, 1)\n nn.init.constant_(m.bias, 0)\n\n def _make_layer(self, block, planes, blocks, stride=1):\n downsample = None\n if stride != 1 or self.inplanes != planes * block.expansion:\n downsample = nn.Sequential(\n nn.Conv2d(self.inplanes, planes * block.expansion,\n kernel_size=1, stride=stride, bias=False),\n NN.BatchNorm2d(planes * block.expansion), #NN.BatchNorm2d\n )\n\n layers = []\n layers.append(block(self.inplanes, planes, stride, downsample))\n self.inplanes = planes * block.expansion\n for i in range(1, blocks):\n layers.append(block(self.inplanes, planes))\n\n return nn.Sequential(*layers)\n\n def forward(self, x):\n features = []\n\n x = self.conv1(x)\n x = self.bn1(x)\n x = self.relu(x)\n x = self.maxpool(x)\n\n x = self.layer1(x)\n features.append(x)\n x = self.layer2(x)\n features.append(x)\n x = self.layer3(x)\n features.append(x)\n x = self.layer4(x)\n features.append(x)\n\n return features\n\n\ndef resnet18(pretrained=True, **kwargs):\n \"\"\"Constructs a ResNet-18 model.\n Args:\n pretrained (bool): If True, returns a model pre-trained on ImageNet\n \"\"\"\n model = ResNet(BasicBlock, [2, 2, 2, 2], **kwargs)\n if pretrained:\n pretrained_dict = model_zoo.load_url(model_urls['resnet18'], cfg.ROOT_DIR + '/' + cfg.MODEL.MODEL_REPOSITORY)\n #pretrained_model = torchvision.models.resnet18(pretrained=True)\n #pretrained_dict = pretrained_model.state_dict()\n model_dict = model.state_dict()\n pretrained_dict = {k:v for k, v in pretrained_dict.items() if k in model_dict}\n model_dict.update(pretrained_dict)\n model.load_state_dict(model_dict)\n\n return model\n\n\ndef resnet34(pretrained=True, **kwargs):\n \"\"\"Constructs a ResNet-34 model.\n Args:\n pretrained (bool): If True, returns a model pre-trained on ImageNet\n \"\"\"\n model = ResNet(BasicBlock, [3, 4, 6, 3], **kwargs)\n if pretrained:\n pretrained_dict = model_zoo.load_url(model_urls['resnet34'], cfg.ROOT_DIR + '/' + cfg.MODEL.MODEL_REPOSITORY)\n #pretrained_model = torchvision.models.resnet34(pretrained=True)\n #pretrained_dict = pretrained_model.state_dict()\n model_dict = model.state_dict()\n pretrained_dict = {k:v for k, v in pretrained_dict.items() if k in model_dict}\n model_dict.update(pretrained_dict)\n model.load_state_dict(model_dict)\n\n return model\n\n\ndef resnet50(pretrained=True, **kwargs):\n \"\"\"Constructs a ResNet-50 model.\n Args:\n pretrained (bool): If True, returns a model pre-trained on ImageNet\n \"\"\"\n model = ResNet(Bottleneck, [3, 4, 6, 3], **kwargs)\n if pretrained:\n pretrained_dict = model_zoo.load_url(model_urls['resnet50'], cfg.ROOT_DIR + '/' + cfg.MODEL.MODEL_REPOSITORY)\n #pretrained_model = torchvision.models.resnet50(pretrained=True)\n #pretrained_model = gcv.models.resnet50(pretrained=True)\n #pretrained_dict = pretrained_model.state_dict()\n model_dict = model.state_dict()\n pretrained_dict = {k:v for k, v in pretrained_dict.items() if k in model_dict}\n model_dict.update(pretrained_dict)\n model.load_state_dict(model_dict)\n\n return model\n\n\ndef resnet101(pretrained=True, **kwargs):\n \"\"\"Constructs a ResNet-101 model.\n Args:\n pretrained (bool): If True, returns a model pre-trained on ImageNet\n \"\"\"\n model = ResNet(Bottleneck, [3, 4, 23, 3], **kwargs)\n if pretrained:\n pretrained_dict = model_zoo.load_url(model_urls['resnet101'], cfg.ROOT_DIR + '/' + cfg.MODEL.MODEL_REPOSITORY)\n #pretrained_model = torchvision.models.resnet101(pretrained=True)\n #pretrained_model = gcv.models.resnet101(pretrained=True)\n #pretrained_dict = pretrained_model.state_dict()\n model_dict = model.state_dict()\n pretrained_dict = {k:v for k, v in pretrained_dict.items() if k in model_dict}\n model_dict.update(pretrained_dict)\n model.load_state_dict(model_dict)\n\n return model\n\n\ndef resnet152(pretrained=True, **kwargs):\n \"\"\"Constructs a ResNet-152 model.\n Args:\n pretrained (bool): If True, returns a model pre-trained on ImageNet\n \"\"\"\n model = ResNet(Bottleneck, [3, 8, 36, 3], **kwargs)\n if pretrained:\n pretrained_dict = model_zoo.load_url(model_urls['resnet152'], cfg.ROOT_DIR + '/' + cfg.MODEL.MODEL_REPOSITORY)\n #pretrained_model = torchvision.models.resnet152(pretrained=True)\n #pretrained_model = gcv.models.resnet152(pretrained=True)\n #pretrained_dict = pretrained_model.state_dict()\n model_dict = model.state_dict()\n pretrained_dict = {k:v for k, v in pretrained_dict.items() if k in model_dict}\n model_dict.update(pretrained_dict)\n model.load_state_dict(model_dict)\n\n return model\n\n\nif __name__ == '__main__':\n import torch\n model = resnet50(True).cuda()\n\n rgb = torch.rand((2, 3, 256, 256)).cuda()\n out = model(rgb)\n print(len(out))\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076087,"cells":{"text":{"kind":"string","value":"import torch\r\nfrom torch import nn\r\nimport numpy as np\r\nimport torch.nn.functional as F\r\n\r\n\r\nfrom lib.models.Surface_normal import surface_normal_from_depth, vis_normal\r\n\"\"\"\r\nSampling strategies: RS (Random Sampling), EGS (Edge-Guided Sampling), and IGS (Instance-Guided Sampling)\r\n\"\"\"\r\n###########\r\n# RANDOM SAMPLING\r\n# input:\r\n# inputs[i,:], targets[i, :], masks[i, :], self.mask_value, self.point_pairs\r\n# return:\r\n# inputs_A, inputs_B, targets_A, targets_B, consistent_masks_A, consistent_masks_B\r\n###########\r\ndef randomSamplingNormal(inputs, targets, masks, sample_num):\r\n\r\n # find A-B point pairs from predictions\r\n num_effect_pixels = torch.sum(masks)\r\n shuffle_effect_pixels = torch.randperm(num_effect_pixels).cuda()\r\n valid_inputs = inputs[:, masks]\r\n valid_targes = targets[:, masks]\r\n inputs_A = valid_inputs[:, shuffle_effect_pixels[0:sample_num*2:2]]\r\n inputs_B = valid_inputs[:, shuffle_effect_pixels[1:sample_num*2:2]]\r\n # find corresponding pairs from GT\r\n targets_A = valid_targes[:, shuffle_effect_pixels[0:sample_num*2:2]]\r\n targets_B = valid_targes[:, shuffle_effect_pixels[1:sample_num*2:2]]\r\n if inputs_A.shape[1] != inputs_B.shape[1]:\r\n num_min = min(targets_A.shape[1], targets_B.shape[1])\r\n inputs_A = inputs_A[:, :num_min]\r\n inputs_B = inputs_B[:, :num_min]\r\n targets_A = targets_A[:, :num_min]\r\n targets_B = targets_B[:, :num_min]\r\n return inputs_A, inputs_B, targets_A, targets_B\r\n\r\n###########\r\n# EDGE-GUIDED SAMPLING\r\n# input:\r\n# inputs[i,:], targets[i, :], masks[i, :], edges_img[i], thetas_img[i], masks[i, :], h, w\r\n# return:\r\n# inputs_A, inputs_B, targets_A, targets_B, masks_A, masks_B\r\n###########\r\ndef ind2sub(idx, cols):\r\n r = idx / cols\r\n c = idx - r * cols\r\n return r, c\r\n\r\ndef sub2ind(r, c, cols):\r\n idx = r * cols + c\r\n return idx\r\n\r\n\r\ndef edgeGuidedSampling(inputs, targets, edges_img, thetas_img, masks, h, w):\r\n # find edges\r\n edges_max = edges_img.max()\r\n edges_min = edges_img.min()\r\n edges_mask = edges_img.ge(edges_max*0.1)\r\n edges_loc = edges_mask.nonzero()\r\n\r\n thetas_edge = torch.masked_select(thetas_img, edges_mask)\r\n minlen = thetas_edge.size()[0]\r\n\r\n # find anchor points (i.e, edge points)\r\n sample_num = minlen\r\n index_anchors = torch.randint(0, minlen, (sample_num,), dtype=torch.long).cuda()\r\n theta_anchors = torch.gather(thetas_edge, 0, index_anchors)\r\n row_anchors, col_anchors = ind2sub(edges_loc[index_anchors].squeeze(1), w)\r\n ## compute the coordinates of 4-points, distances are from [2, 30]\r\n distance_matrix = torch.randint(3, 20, (4,sample_num)).cuda()\r\n pos_or_neg = torch.ones(4,sample_num).cuda()\r\n pos_or_neg[:2,:] = -pos_or_neg[:2,:]\r\n distance_matrix = distance_matrix.float() * pos_or_neg\r\n col = col_anchors.unsqueeze(0).expand(4, sample_num).long() + torch.round(distance_matrix.double() * torch.cos(theta_anchors).unsqueeze(0)).long()\r\n row = row_anchors.unsqueeze(0).expand(4, sample_num).long() + torch.round(distance_matrix.double() * torch.sin(theta_anchors).unsqueeze(0)).long()\r\n\r\n # constrain 0=w-1] = w-1\r\n row[row<0] = 0\r\n row[row>h-1] = h-1\r\n\r\n # a-b, b-c, c-d\r\n a = sub2ind(row[0,:], col[0,:], w)\r\n b = sub2ind(row[1,:], col[1,:], w)\r\n c = sub2ind(row[2,:], col[2,:], w)\r\n d = sub2ind(row[3,:], col[3,:], w)\r\n A = torch.cat((a,b,c), 0)\r\n B = torch.cat((b,c,d), 0)\r\n\r\n inputs_A = inputs[:, A]\r\n inputs_B = inputs[:, B]\r\n targets_A = targets[:, A]\r\n targets_B = targets[:, B]\r\n masks_A = torch.gather(masks, 0, A.long())\r\n masks_B = torch.gather(masks, 0, B.long())\r\n return inputs_A, inputs_B, targets_A, targets_B, masks_A, masks_B, sample_num, row, col\r\n\r\n\r\nclass EdgeguidedNormalRegressionLoss(nn.Module):\r\n def __init__(self, point_pairs=10000, cos_theta1=0.3, cos_theta2=0.95, cos_theta3=0.5, cos_theta4=0.86, mask_value=-1e-8, max_threshold=10.1):\r\n super(EdgeguidedNormalRegressionLoss, self).__init__()\r\n self.point_pairs = point_pairs # number of point pairs\r\n self.mask_value = mask_value\r\n self.max_threshold = max_threshold\r\n self.cos_theta1 = cos_theta1 # 75 degree\r\n self.cos_theta2 = cos_theta2 # 10 degree\r\n self.cos_theta3 = cos_theta3 # 60 degree\r\n self.cos_theta4 = cos_theta4 # 30 degree\r\n self.kernel = torch.tensor(np.array([[1, 1, 1], [1, 1, 1], [1, 1, 1]], dtype=np.float32), requires_grad=False)[None, None, :, :].cuda()\r\n\r\n def scale_shift_pred_depth(self, pred, gt):\r\n b, c, h, w = pred.shape\r\n mask = (gt > self.mask_value) & (gt < self.max_threshold) # [b, c, h, w]\r\n EPS = 1e-6 * torch.eye(2, dtype=pred.dtype, device=pred.device)\r\n scale_shift_batch = []\r\n ones_img = torch.ones((1, h, w), dtype=pred.dtype, device=pred.device)\r\n for i in range(b):\r\n mask_i = mask[i, ...]\r\n pred_valid_i = pred[i, ...][mask_i]\r\n ones_i = ones_img[mask_i]\r\n pred_valid_ones_i = torch.stack((pred_valid_i, ones_i), dim=0) # [c+1, n]\r\n A_i = torch.matmul(pred_valid_ones_i, pred_valid_ones_i.permute(1, 0)) # [2, 2]\r\n A_inverse = torch.inverse(A_i + EPS)\r\n\r\n gt_i = gt[i, ...][mask_i]\r\n B_i = torch.matmul(pred_valid_ones_i, gt_i)[:, None] # [2, 1]\r\n scale_shift_i = torch.matmul(A_inverse, B_i) # [2, 1]\r\n scale_shift_batch.append(scale_shift_i)\r\n scale_shift_batch = torch.stack(scale_shift_batch, dim=0) # [b, 2, 1]\r\n ones = torch.ones_like(pred)\r\n pred_ones = torch.cat((pred, ones), dim=1) # [b, 2, h, w]\r\n pred_scale_shift = torch.matmul(pred_ones.permute(0, 2, 3, 1).reshape(b, h * w, 2), scale_shift_batch) # [b, h*w, 1]\r\n pred_scale_shift = pred_scale_shift.permute(0, 2, 1).reshape((b, c, h, w))\r\n return pred_scale_shift\r\n\r\n def getEdge(self, images):\r\n n,c,h,w = images.size()\r\n a = torch.Tensor([[-1, 0, 1], [-2, 0, 2], [-1, 0, 1]]).cuda().view((1,1,3,3)).repeat(1, 1, 1, 1)\r\n b = torch.Tensor([[1, 2, 1], [0, 0, 0], [-1, -2, -1]]).cuda().view((1,1,3,3)).repeat(1, 1, 1, 1)\r\n if c == 3:\r\n gradient_x = F.conv2d(images[:,0,:,:].unsqueeze(1), a)\r\n gradient_y = F.conv2d(images[:,0,:,:].unsqueeze(1), b)\r\n else:\r\n gradient_x = F.conv2d(images, a)\r\n gradient_y = F.conv2d(images, b)\r\n edges = torch.sqrt(torch.pow(gradient_x,2)+ torch.pow(gradient_y,2))\r\n edges = F.pad(edges, (1,1,1,1), \"constant\", 0)\r\n thetas = torch.atan2(gradient_y, gradient_x)\r\n thetas = F.pad(thetas, (1,1,1,1), \"constant\", 0)\r\n return edges, thetas\r\n\r\n def getNormalEdge(self, normals):\r\n n,c,h,w = normals.size()\r\n a = torch.Tensor([[-1, 0, 1], [-2, 0, 2], [-1, 0, 1]]).cuda().view((1,1,3,3)).repeat(3, 1, 1, 1)\r\n b = torch.Tensor([[1, 2, 1], [0, 0, 0], [-1, -2, -1]]).cuda().view((1,1,3,3)).repeat(3, 1, 1, 1)\r\n gradient_x = torch.abs(F.conv2d(normals, a, groups=c))\r\n gradient_y = torch.abs(F.conv2d(normals, b, groups=c))\r\n gradient_x = gradient_x.mean(dim=1, keepdim=True)\r\n gradient_y = gradient_y.mean(dim=1, keepdim=True)\r\n edges = torch.sqrt(torch.pow(gradient_x,2)+ torch.pow(gradient_y,2))\r\n edges = F.pad(edges, (1,1,1,1), \"constant\", 0)\r\n thetas = torch.atan2(gradient_y, gradient_x)\r\n thetas = F.pad(thetas, (1,1,1,1), \"constant\", 0)\r\n return edges, thetas\r\n\r\n def forward(self, pred_depths, gt_depths, images, focal_length):\r\n \"\"\"\r\n inputs and targets: surface normal image\r\n images: rgb images\r\n \"\"\"\r\n masks = gt_depths > self.mask_value\r\n #pred_depths_ss = self.scale_shift_pred_depth(pred_depths, gt_depths)\r\n inputs = surface_normal_from_depth(pred_depths, focal_length, valid_mask=masks)\r\n targets = surface_normal_from_depth(gt_depths, focal_length, valid_mask=masks)\r\n # find edges from RGB\r\n edges_img, thetas_img = self.getEdge(images)\r\n # find edges from normals\r\n edges_normal, thetas_normal = self.getNormalEdge(targets)\r\n mask_img_border = torch.ones_like(edges_normal) # normals on the borders\r\n mask_img_border[:, :, 5:-5, 5:-5] = 0\r\n edges_normal[mask_img_border.bool()] = 0\r\n # find edges from depth\r\n edges_depth, _ = self.getEdge(gt_depths)\r\n edges_depth_mask = edges_depth.ge(edges_depth.max() * 0.1)\r\n edges_mask_dilate = torch.clamp(torch.nn.functional.conv2d(edges_depth_mask.float(), self.kernel, padding=(1, 1)), 0,\r\n 1).bool()\r\n edges_normal[edges_mask_dilate] = 0\r\n edges_img[edges_mask_dilate] = 0\r\n #=============================\r\n n,c,h,w = targets.size()\r\n\r\n inputs = inputs.contiguous().view(n, c, -1).double()\r\n targets = targets.contiguous().view(n, c, -1).double()\r\n masks = masks.contiguous().view(n, -1)\r\n edges_img = edges_img.contiguous().view(n, -1).double()\r\n thetas_img = thetas_img.contiguous().view(n, -1).double()\r\n edges_normal = edges_normal.view(n, -1).double()\r\n thetas_normal = thetas_normal.view(n, -1).double()\r\n\r\n # initialization\r\n loss = torch.DoubleTensor([0.0]).cuda()\r\n\r\n for i in range(n):\r\n # Edge-Guided sampling\r\n inputs_A, inputs_B, targets_A, targets_B, masks_A, masks_B, sample_num, row_img, col_img = edgeGuidedSampling(inputs[i,:], targets[i, :], edges_img[i], thetas_img[i], masks[i, :], h, w)\r\n normal_inputs_A, normal_inputs_B, normal_targets_A, normal_targets_B, normal_masks_A, normal_masks_B, normal_sample_num, row_normal, col_normal = edgeGuidedSampling(inputs[i,:], targets[i, :], edges_normal[i], thetas_normal[i], masks[i, :], h, w)\r\n\r\n\r\n # Combine EGS + EGNS\r\n inputs_A = torch.cat((inputs_A, normal_inputs_A), 1)\r\n inputs_B = torch.cat((inputs_B, normal_inputs_B), 1)\r\n targets_A = torch.cat((targets_A, normal_targets_A), 1)\r\n targets_B = torch.cat((targets_B, normal_targets_B), 1)\r\n masks_A = torch.cat((masks_A, normal_masks_A), 0)\r\n masks_B = torch.cat((masks_B, normal_masks_B), 0)\r\n\r\n # consider forward-backward consistency checking, i.e, only compute losses of point pairs with valid GT\r\n consistency_mask = masks_A & masks_B\r\n\r\n #GT ordinal relationship\r\n target_cos = torch.abs(torch.sum(targets_A * targets_B, dim=0))\r\n input_cos = torch.abs(torch.sum(inputs_A * inputs_B, dim=0))\r\n # ranking regression\r\n #loss += torch.mean(torch.abs(target_cos[consistency_mask] - input_cos[consistency_mask]))\r\n\r\n # Ranking for samples\r\n mask_cos75 = target_cos < self.cos_theta1\r\n mask_cos10 = target_cos > self.cos_theta2\r\n # Regression for samples\r\n loss += torch.sum(torch.abs(target_cos[mask_cos75 & consistency_mask] - input_cos[mask_cos75 & consistency_mask])) / (torch.sum(mask_cos75 & consistency_mask)+1e-8)\r\n loss += torch.sum(torch.abs(target_cos[mask_cos10 & consistency_mask] - input_cos[mask_cos10 & consistency_mask])) / (torch.sum(mask_cos10 & consistency_mask)+1e-8)\r\n\r\n # Random Sampling regression\r\n random_sample_num = torch.sum(mask_cos10 & consistency_mask) + torch.sum(torch.sum(mask_cos75 & consistency_mask))\r\n random_inputs_A, random_inputs_B, random_targets_A, random_targets_B = randomSamplingNormal(inputs[i,:], targets[i, :], masks[i, :], random_sample_num)\r\n #GT ordinal relationship\r\n random_target_cos = torch.abs(torch.sum(random_targets_A * random_targets_B, dim=0))\r\n random_input_cos = torch.abs(torch.sum(random_inputs_A * random_inputs_B, dim=0))\r\n loss += torch.sum(torch.abs(random_target_cos - random_input_cos)) / (random_target_cos.shape[0] + 1e-8)\r\n\r\n if loss[0] != 0:\r\n return loss[0].float() / n\r\n else:\r\n return pred_depths.sum() * 0.0\r\n\r\n\r\n\r\n\r\nif __name__ == '__main__':\r\n import cv2\r\n rank_loss = EdgeguidedNormalRegressionLoss()\r\n pred_depth = np.random.randn(2, 1, 480, 640)\r\n gt_depth = np.random.randn(2, 1, 480, 640)\r\n # gt_depth = cv2.imread('/hardware/yifanliu/SUNRGBD/sunrgbd-meta-data/sunrgbd_test_depth/2.png', -1)\r\n # gt_depth = gt_depth[None, :, :, None]\r\n # pred_depth = gt_depth[:, :, ::-1, :]\r\n gt_depth = torch.tensor(np.asarray(gt_depth, np.float32)).cuda()\r\n pred_depth = torch.tensor(np.asarray(pred_depth, np.float32)).cuda()\r\n loss = rank_loss(pred_depth, gt_depth)\r\n print(loss)\r\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076088,"cells":{"text":{"kind":"string","value":"#!/usr/bin/env python2\n# coding: utf-8\n\n\"\"\"\nThis network structure follows Ke Xian's work, \"Structure-guided Ranking Loss for Single Image Depth Prediction\".\n\"\"\"\nimport torch\nimport torch.nn as nn\nimport torch.nn.init as init\nimport torch.nn.functional as F\n\nfrom lib.configs.config import cfg\nfrom lib.models import Resnet, Resnext_torch\n\n\ndef resnet18_stride32():\n return DepthNet(backbone='resnet', depth=18, upfactors=[2, 2, 2, 2])\ndef resnet34_stride32():\n return DepthNet(backbone='resnet', depth=34, upfactors=[2, 2, 2, 2])\ndef resnet50_stride32():\n return DepthNet(backbone='resnet', depth=50, upfactors=[2, 2, 2, 2])\ndef resnet101_stride32():\n return DepthNet(backbone='resnet', depth=101, upfactors=[2, 2, 2, 2])\ndef resnet152_stride32():\n return DepthNet(backbone='resnet', depth=152, upfactors=[2, 2, 2, 2])\n\ndef resnext101_stride32x8d():\n return DepthNet(backbone='resnext101_32x8d', depth=101, upfactors=[2, 2, 2, 2])\n\ndef mobilenetv2():\n return DepthNet(backbone='mobilenetv2', depth=00, upfactors=[2, 2, 2, 2])\n\nclass AuxiBlock(nn.Module):\n def __init__(self, dim_in, dim_out):\n super().__init__()\n self.dim_in = dim_in\n self.dim_out = dim_out\n self.conv1 = nn.Conv2d(self.dim_in, self.dim_out, 1, stride=1, padding=0, bias=False)\n self.conv2 = nn.Conv2d(self.dim_out, self.dim_out, 3, stride=1, padding=1, dilation=1, bias=True)\n self.bn1 = nn.BatchNorm2d(self.dim_out, momentum=0.5)\n self.bn2 = nn.BatchNorm2d(self.dim_out, momentum=0.5)\n self.relu = nn.ReLU(inplace=True)\n def forward(self, top, lateral):\n if lateral.shape[2] != top.shape[2]:\n h, w = lateral.size(2), lateral.size(3)\n top = F.interpolate(input=top, size=(h, w), mode='bilinear',align_corners=True)\n out = torch.cat((lateral, top), dim=1)\n out = self.relu(self.bn1(self.conv1(out)))\n out = self.relu(self.bn2(self.conv2(out)))\n return out\n\nclass AuxiNetV2(nn.Module):\n def __init__(self):\n super().__init__()\n self.inchannels = cfg.MODEL.RESNET_BOTTLENECK_DIM[1:] # [256, 512, 1024, 2048]\n self.midchannels = cfg.MODEL.LATERAL_OUT[::-1] # [256, 256, 256, 512]\n\n self.auxi_block1 = AuxiBlock(self.midchannels[2]+self.midchannels[3], 128)\n self.auxi_block2 = AuxiBlock(128 + self.midchannels[2], 128)\n self.auxi_block3 = AuxiBlock(128 + self.midchannels[2], 128)\n self.auxi_block4 = AuxiBlock(128 + self.midchannels[1], 128)\n self.auxi_block5 = AuxiBlock(128 + self.midchannels[0], 128)\n self.out_conv = AO(128, 1, 2)\n self._init_weights()\n\n def _init_weights(self):\n def init_func(m):\n if isinstance(m, nn.Conv2d):\n init.normal_(m.weight, std=0.01)\n if m.bias is not None:\n init.constant_(m.bias, 0)\n elif isinstance(m, nn.ConvTranspose2d):\n init.normal_(m.weight, std=0.01)\n if m.bias is not None:\n init.constant_(m.bias, 0)\n elif isinstance(m, nn.BatchNorm2d): # NN.BatchNorm2d\n init.constant_(m.weight, 1)\n init.constant_(m.bias, 0)\n elif isinstance(m, nn.Linear):\n init.normal_(m.weight, std=0.01)\n if m.bias is not None:\n init.constant_(m.bias, 0)\n\n def init_model_weight(m):\n for child_m in m.children():\n if not isinstance(child_m, nn.ModuleList):\n child_m.apply(init_func)\n\n init_model_weight(self)\n\n def forward(self, auxi_in):\n out = self.auxi_block1(auxi_in[0], auxi_in[1]) # 1/32\n out = self.auxi_block2(out, auxi_in[2]) # 1/16\n out = self.auxi_block3(out, auxi_in[3]) # 1/8\n out = self.auxi_block4(out, auxi_in[4]) # 1/4\n out = self.auxi_block5(out, auxi_in[5]) # 1/2\n out = self.out_conv(out)\n return out\n\nclass AuxiNet(nn.Module):\n def __init__(self):\n super().__init__()\n self.inchannels = cfg.MODEL.RESNET_BOTTLENECK_DIM[1:] # [256, 512, 1024, 2048]\n self.midchannels = cfg.MODEL.LATERAL_OUT[::-1] # [256, 256, 256, 512]\n\n self.auxi_block1 = AuxiBlock(self.midchannels[2]+self.midchannels[3], 256)\n self.auxi_block2 = AuxiBlock(256 + self.midchannels[2], 256)\n self.auxi_block3 = AuxiBlock(256 + self.midchannels[2], 256)\n self.auxi_block4 = AuxiBlock(256 + self.midchannels[1], 256)\n self.auxi_block5 = AuxiBlock(256 + self.midchannels[0], 256)\n self.out_conv = AO(256, 1, 2)\n self._init_weights()\n\n def _init_weights(self):\n def init_func(m):\n if isinstance(m, nn.Conv2d):\n init.normal_(m.weight, std=0.01)\n if m.bias is not None:\n init.constant_(m.bias, 0)\n elif isinstance(m, nn.ConvTranspose2d):\n init.normal_(m.weight, std=0.01)\n if m.bias is not None:\n init.constant_(m.bias, 0)\n elif isinstance(m, nn.BatchNorm2d): # NN.BatchNorm2d\n init.constant_(m.weight, 1)\n init.constant_(m.bias, 0)\n elif isinstance(m, nn.Linear):\n init.normal_(m.weight, std=0.01)\n if m.bias is not None:\n init.constant_(m.bias, 0)\n\n def init_model_weight(m):\n for child_m in m.children():\n if not isinstance(child_m, nn.ModuleList):\n child_m.apply(init_func)\n\n init_model_weight(self)\n\n def forward(self, auxi_in):\n out = self.auxi_block1(auxi_in[0], auxi_in[1]) # 1/32\n out = self.auxi_block2(out, auxi_in[2]) # 1/16\n out = self.auxi_block3(out, auxi_in[3]) # 1/8\n out = self.auxi_block4(out, auxi_in[4]) # 1/4\n out = self.auxi_block5(out, auxi_in[5]) # 1/2\n out = self.out_conv(out)\n return out\n\nclass Decoder(nn.Module):\n def __init__(self):\n super(Decoder, self).__init__()\n self.inchannels = cfg.MODEL.RESNET_BOTTLENECK_DIM[1:] # [256, 512, 1024, 2048]\n self.midchannels = cfg.MODEL.LATERAL_OUT[::-1] # [256, 256, 256, 512]\n self.upfactors = [2,2,2,2]\n self.outchannels = cfg.MODEL.DECODER_OUTPUT_C # 1\n\n self.conv = FTB(inchannels=self.inchannels[3], midchannels=self.midchannels[3])\n self.conv1 = nn.Conv2d(in_channels=self.midchannels[3], out_channels=self.midchannels[2], kernel_size=3, padding=1, stride=1, bias=True)\n self.upsample = nn.Upsample(scale_factor=self.upfactors[3], mode='bilinear', align_corners=True)\n \n self.ffm2 = FFM(inchannels=self.inchannels[2], midchannels=self.midchannels[2], outchannels = self.midchannels[2], upfactor=self.upfactors[2])\n self.ffm1 = FFM(inchannels=self.inchannels[1], midchannels=self.midchannels[1], outchannels = self.midchannels[1], upfactor=self.upfactors[1])\n self.ffm0 = FFM(inchannels=self.inchannels[0], midchannels=self.midchannels[0], outchannels = self.midchannels[0], upfactor=self.upfactors[0])\n \n #self.outconv = nn.Conv2d(in_channels=self.inchannels[0], out_channels=self.outchannels, kernel_size=3, padding=1, stride=1, bias=True)\n self.outconv = AO(inchannels=self.midchannels[0], outchannels=self.outchannels, upfactor=2)\n self._init_params()\n \n def _init_params(self):\n for m in self.modules():\n if isinstance(m, nn.Conv2d):\n init.normal_(m.weight, std=0.01)\n if m.bias is not None:\n init.constant_(m.bias, 0)\n elif isinstance(m, nn.ConvTranspose2d):\n init.normal_(m.weight, std=0.01)\n if m.bias is not None:\n init.constant_(m.bias, 0)\n elif isinstance(m, nn.BatchNorm2d): #NN.BatchNorm2d\n init.constant_(m.weight, 1)\n init.constant_(m.bias, 0)\n elif isinstance(m, nn.Linear):\n init.normal_(m.weight, std=0.01)\n if m.bias is not None:\n init.constant_(m.bias, 0)\n \n def forward(self, features):\n # features' shape: # 1/32, 1/16, 1/8, 1/4\n # _,_,h,w = features[3].size()\n x_32x = self.conv(features[3]) # 1/32\n x_32 = self.conv1(x_32x)\n x_16 = self.upsample(x_32) # 1/16\n\n x_8 = self.ffm2(features[2], x_16) # 1/8\n #print('ffm2:', x.size())\n x_4 = self.ffm1(features[1], x_8) # 1/4\n #print('ffm1:', x.size())\n x_2 = self.ffm0(features[0], x_4) # 1/2\n #print('ffm0:', x.size())\n #-----------------------------------------\n x = self.outconv(x_2) # original size\n auxi_input = [x_32x, x_32, x_16, x_8, x_4, x_2]\n return x, auxi_input\n\nclass DepthNet(nn.Module):\n __factory = {\n 18: Resnet.resnet18,\n 34: Resnet.resnet34,\n 50: Resnet.resnet50,\n 101: Resnet.resnet101,\n 152: Resnet.resnet152\n }\n def __init__(self,\n backbone='resnet',\n depth=50,\n upfactors=[2, 2, 2, 2]):\n super(DepthNet, self).__init__()\n self.backbone = backbone\n self.depth = depth\n self.pretrained = cfg.MODEL.LOAD_IMAGENET_PRETRAINED_WEIGHTS # True\n self.inchannels = cfg.MODEL.RESNET_BOTTLENECK_DIM[1:] # [256, 512, 1024, 2048]\n self.midchannels = cfg.MODEL.LATERAL_OUT[::-1] # [256, 256, 256, 512]\n self.upfactors = upfactors\n self.outchannels = cfg.MODEL.DECODER_OUTPUT_C # 1\n \n # Build model\n if self.backbone == 'resnet':\n if self.depth not in DepthNet.__factory:\n raise KeyError(\"Unsupported depth:\", self.depth)\n self.encoder = DepthNet.__factory[depth](pretrained=self.pretrained)\n elif self.backbone == 'resnext101_32x8d':\n self.encoder = Resnext_torch.resnext101_32x8d(pretrained=self.pretrained)\n elif self.backbone == 'mobilenetv2':\n self.encoder = MobileNet_torch.mobilenet_v2(pretrained=self.pretrained)\n else:\n self.encoder = Resnext_torch.resnext101(pretrained=self.pretrained)\n\n def forward(self, x):\n x = self.encoder(x) # 1/32, 1/16, 1/8, 1/4\n return x\n\n\nclass FTB(nn.Module):\n def __init__(self, inchannels, midchannels=512):\n super(FTB, self).__init__()\n self.in1 = inchannels\n self.mid = midchannels\n self.conv1 = nn.Conv2d(in_channels=self.in1, out_channels=self.mid, kernel_size=3, padding=1, stride=1,\n bias=True)\n # NN.BatchNorm2d\n # self.sample_conv = nn.Sequential(nn.Conv2d(in_channels=self.mid, out_channels=self.mid, kernel_size=3, padding=1, stride=1, bias=True),\n # nn.ReLU(inplace=True),\n # nn.BatchNorm2d(num_features=self.mid),\n # nn.Conv2d(in_channels=self.mid, out_channels= self.mid, kernel_size=3, padding=1, stride=1, bias=True))\n self.conv_branch = nn.Sequential(nn.ReLU(inplace=True), \\\n nn.Conv2d(in_channels=self.mid, out_channels=self.mid, kernel_size=3,\n padding=1, stride=1, bias=True), \\\n nn.BatchNorm2d(num_features=self.mid), \\\n nn.ReLU(inplace=True), \\\n nn.Conv2d(in_channels=self.mid, out_channels=self.mid, kernel_size=3,\n padding=1, stride=1, bias=True))\n self.relu = nn.ReLU(inplace=True)\n\n self.init_params()\n\n def forward(self, x):\n x = self.conv1(x)\n x = x + self.conv_branch(x)\n x = self.relu(x)\n\n return x\n\n def init_params(self):\n for m in self.modules():\n if isinstance(m, nn.Conv2d):\n init.normal_(m.weight, std=0.01)\n if m.bias is not None:\n init.constant_(m.bias, 0)\n elif isinstance(m, nn.ConvTranspose2d):\n # init.kaiming_normal_(m.weight, mode='fan_out')\n init.normal_(m.weight, std=0.01)\n # init.xavier_normal_(m.weight)\n if m.bias is not None:\n init.constant_(m.bias, 0)\n elif isinstance(m, nn.BatchNorm2d): # NN.BatchNorm2d\n init.constant_(m.weight, 1)\n init.constant_(m.bias, 0)\n elif isinstance(m, nn.Linear):\n init.normal_(m.weight, std=0.01)\n if m.bias is not None:\n init.constant_(m.bias, 0)\n\n\nclass ATA(nn.Module):\n def __init__(self, inchannels, reduction=8):\n super(ATA, self).__init__()\n self.inchannels = inchannels\n self.avg_pool = nn.AdaptiveAvgPool2d(1)\n self.fc = nn.Sequential(nn.Linear(self.inchannels * 2, self.inchannels // reduction),\n nn.ReLU(inplace=True),\n nn.Linear(self.inchannels // reduction, self.inchannels),\n nn.Sigmoid())\n self.init_params()\n\n def forward(self, low_x, high_x):\n n, c, _, _ = low_x.size()\n x = torch.cat([low_x, high_x], 1)\n x = self.avg_pool(x)\n x = x.view(n, -1)\n x = self.fc(x).view(n, c, 1, 1)\n x = low_x * x + high_x\n\n return x\n\n def init_params(self):\n for m in self.modules():\n if isinstance(m, nn.Conv2d):\n # init.kaiming_normal_(m.weight, mode='fan_out')\n # init.normal(m.weight, std=0.01)\n init.xavier_normal_(m.weight)\n if m.bias is not None:\n init.constant_(m.bias, 0)\n elif isinstance(m, nn.ConvTranspose2d):\n # init.kaiming_normal_(m.weight, mode='fan_out')\n # init.normal_(m.weight, std=0.01)\n init.xavier_normal_(m.weight)\n if m.bias is not None:\n init.constant_(m.bias, 0)\n elif isinstance(m, nn.BatchNorm2d): # NN.BatchNorm2d\n init.constant_(m.weight, 1)\n init.constant_(m.bias, 0)\n elif isinstance(m, nn.Linear):\n init.normal_(m.weight, std=0.01)\n if m.bias is not None:\n init.constant_(m.bias, 0)\n\n\nclass FFM(nn.Module):\n def __init__(self, inchannels, midchannels, outchannels, upfactor=2):\n super(FFM, self).__init__()\n self.inchannels = inchannels\n self.midchannels = midchannels\n self.outchannels = outchannels\n self.upfactor = upfactor\n\n self.ftb1 = FTB(inchannels=self.inchannels, midchannels=self.midchannels)\n # self.ata = ATA(inchannels = self.midchannels)\n self.ftb2 = FTB(inchannels=self.midchannels, midchannels=self.outchannels)\n\n self.upsample = nn.Upsample(scale_factor=self.upfactor, mode='bilinear', align_corners=True)\n\n self.init_params()\n\n def forward(self, low_x, high_x):\n x = self.ftb1(low_x)\n x = x + high_x\n x = self.ftb2(x)\n x = self.upsample(x)\n\n return x\n\n def init_params(self):\n for m in self.modules():\n if isinstance(m, nn.Conv2d):\n # init.kaiming_normal_(m.weight, mode='fan_out')\n init.normal_(m.weight, std=0.01)\n # init.xavier_normal_(m.weight)\n if m.bias is not None:\n init.constant_(m.bias, 0)\n elif isinstance(m, nn.ConvTranspose2d):\n # init.kaiming_normal_(m.weight, mode='fan_out')\n init.normal_(m.weight, std=0.01)\n # init.xavier_normal_(m.weight)\n if m.bias is not None:\n init.constant_(m.bias, 0)\n elif isinstance(m, nn.BatchNorm2d): # NN.Batchnorm2d\n init.constant_(m.weight, 1)\n init.constant_(m.bias, 0)\n elif isinstance(m, nn.Linear):\n init.normal_(m.weight, std=0.01)\n if m.bias is not None:\n init.constant_(m.bias, 0)\n\n\nclass AO(nn.Module):\n # Adaptive output module\n def __init__(self, inchannels, outchannels, upfactor=2):\n super(AO, self).__init__()\n self.inchannels = inchannels\n self.outchannels = outchannels\n self.upfactor = upfactor\n\n self.adapt_conv = nn.Sequential(\n nn.Conv2d(in_channels=self.inchannels, out_channels=self.inchannels // 2, kernel_size=3, padding=1,\n stride=1, bias=True), \\\n nn.BatchNorm2d(num_features=self.inchannels // 2), \\\n nn.ReLU(inplace=True), \\\n nn.Conv2d(in_channels=self.inchannels // 2, out_channels=self.outchannels, kernel_size=3, padding=1,\n stride=1, bias=True), \\\n nn.Upsample(scale_factor=self.upfactor, mode='bilinear', align_corners=True))\n\n self.init_params()\n\n def forward(self, x):\n x = self.adapt_conv(x)\n return x\n\n def init_params(self):\n for m in self.modules():\n if isinstance(m, nn.Conv2d):\n # init.kaiming_normal_(m.weight, mode='fan_out')\n init.normal_(m.weight, std=0.01)\n # init.xavier_normal_(m.weight)\n if m.bias is not None:\n init.constant_(m.bias, 0)\n elif isinstance(m, nn.ConvTranspose2d):\n # init.kaiming_normal_(m.weight, mode='fan_out')\n init.normal_(m.weight, std=0.01)\n # init.xavier_normal_(m.weight)\n if m.bias is not None:\n init.constant_(m.bias, 0)\n elif isinstance(m, nn.BatchNorm2d): # NN.Batchnorm2d\n init.constant_(m.weight, 1)\n init.constant_(m.bias, 0)\n elif isinstance(m, nn.Linear):\n init.normal_(m.weight, std=0.01)\n if m.bias is not None:\n init.constant_(m.bias, 0)\n\n\nclass ASPP(nn.Module):\n def __init__(self, inchannels=256, planes=128, rates=[1, 6, 12, 18]):\n super(ASPP, self).__init__()\n self.inchannels = inchannels\n self.planes = planes\n self.rates = rates\n self.kernel_sizes = []\n self.paddings = []\n for rate in self.rates:\n if rate == 1:\n self.kernel_sizes.append(1)\n self.paddings.append(0)\n else:\n self.kernel_sizes.append(3)\n self.paddings.append(rate)\n self.atrous_0 = nn.Sequential(\n nn.Conv2d(in_channels=self.inchannels, out_channels=self.planes, kernel_size=self.kernel_sizes[0],\n stride=1, padding=self.paddings[0], dilation=self.rates[0], bias=True),\n nn.ReLU(inplace=True),\n nn.BatchNorm2d(num_features=self.planes)\n )\n self.atrous_1 = nn.Sequential(\n nn.Conv2d(in_channels=self.inchannels, out_channels=self.planes, kernel_size=self.kernel_sizes[1],\n stride=1, padding=self.paddings[1], dilation=self.rates[1], bias=True),\n nn.ReLU(inplace=True),\n nn.BatchNorm2d(num_features=self.planes),\n )\n self.atrous_2 = nn.Sequential(\n nn.Conv2d(in_channels=self.inchannels, out_channels=self.planes, kernel_size=self.kernel_sizes[2],\n stride=1, padding=self.paddings[2], dilation=self.rates[2], bias=True),\n nn.ReLU(inplace=True),\n nn.BatchNorm2d(num_features=self.planes),\n )\n self.atrous_3 = nn.Sequential(\n nn.Conv2d(in_channels=self.inchannels, out_channels=self.planes, kernel_size=self.kernel_sizes[3],\n stride=1, padding=self.paddings[3], dilation=self.rates[3], bias=True),\n nn.ReLU(inplace=True),\n nn.BatchNorm2d(num_features=self.planes),\n )\n\n # self.conv = nn.Conv2d(in_channels=self.planes * 4, out_channels=self.inchannels, kernel_size=3, padding=1, stride=1, bias=True)\n\n def forward(self, x):\n x = torch.cat([self.atrous_0(x), self.atrous_1(x), self.atrous_2(x), self.atrous_3(x)], 1)\n # x = self.conv(x)\n\n return x\n\n\n# ==============================================================================================================\n\n\nclass ResidualConv(nn.Module):\n def __init__(self, inchannels):\n super(ResidualConv, self).__init__()\n # NN.BatchNorm2d\n self.conv = nn.Sequential(\n # nn.BatchNorm2d(num_features=inchannels),\n nn.ReLU(inplace=False),\n # nn.Conv2d(in_channels=inchannels, out_channels=inchannels, kernel_size=3, padding=1, stride=1, groups=inchannels,bias=True),\n # nn.Conv2d(in_channels=inchannels, out_channels=inchannels, kernel_size=1, padding=0, stride=1, groups=1,bias=True)\n nn.Conv2d(in_channels=inchannels, out_channels=inchannels / 2, kernel_size=3, padding=1, stride=1,\n bias=False),\n nn.BatchNorm2d(num_features=inchannels / 2),\n nn.ReLU(inplace=False),\n nn.Conv2d(in_channels=inchannels / 2, out_channels=inchannels, kernel_size=3, padding=1, stride=1,\n bias=False)\n )\n self.init_params()\n\n def forward(self, x):\n x = self.conv(x) + x\n return x\n\n def init_params(self):\n for m in self.modules():\n if isinstance(m, nn.Conv2d):\n # init.kaiming_normal_(m.weight, mode='fan_out')\n init.normal_(m.weight, std=0.01)\n # init.xavier_normal_(m.weight)\n if m.bias is not None:\n init.constant_(m.bias, 0)\n elif isinstance(m, nn.ConvTranspose2d):\n # init.kaiming_normal_(m.weight, mode='fan_out')\n init.normal_(m.weight, std=0.01)\n # init.xavier_normal_(m.weight)\n if m.bias is not None:\n init.constant_(m.bias, 0)\n elif isinstance(m, nn.BatchNorm2d): # NN.BatchNorm2d\n init.constant_(m.weight, 1)\n init.constant_(m.bias, 0)\n elif isinstance(m, nn.Linear):\n init.normal_(m.weight, std=0.01)\n if m.bias is not None:\n init.constant_(m.bias, 0)\n\n\nclass FeatureFusion(nn.Module):\n def __init__(self, inchannels, outchannels):\n super(FeatureFusion, self).__init__()\n self.conv = ResidualConv(inchannels=inchannels)\n # NN.BatchNorm2d\n self.up = nn.Sequential(ResidualConv(inchannels=inchannels),\n nn.ConvTranspose2d(in_channels=inchannels, out_channels=outchannels, kernel_size=3,\n stride=2, padding=1, output_padding=1),\n nn.BatchNorm2d(num_features=outchannels),\n nn.ReLU(inplace=True))\n\n def forward(self, lowfeat, highfeat):\n return self.up(highfeat + self.conv(lowfeat))\n\n def init_params(self):\n for m in self.modules():\n if isinstance(m, nn.Conv2d):\n # init.kaiming_normal_(m.weight, mode='fan_out')\n init.normal_(m.weight, std=0.01)\n # init.xavier_normal_(m.weight)\n if m.bias is not None:\n init.constant_(m.bias, 0)\n elif isinstance(m, nn.ConvTranspose2d):\n # init.kaiming_normal_(m.weight, mode='fan_out')\n init.normal_(m.weight, std=0.01)\n # init.xavier_normal_(m.weight)\n if m.bias is not None:\n init.constant_(m.bias, 0)\n elif isinstance(m, nn.BatchNorm2d): # NN.BatchNorm2d\n init.constant_(m.weight, 1)\n init.constant_(m.bias, 0)\n elif isinstance(m, nn.Linear):\n init.normal_(m.weight, std=0.01)\n if m.bias is not None:\n init.constant_(m.bias, 0)\n\n\nclass SenceUnderstand(nn.Module):\n def __init__(self, channels):\n super(SenceUnderstand, self).__init__()\n self.channels = channels\n self.conv1 = nn.Sequential(nn.Conv2d(in_channels=512, out_channels=512, kernel_size=3, padding=1),\n nn.ReLU(inplace=True))\n self.pool = nn.AdaptiveAvgPool2d(8)\n self.fc = nn.Sequential(nn.Linear(512 * 8 * 8, self.channels),\n nn.ReLU(inplace=True))\n self.conv2 = nn.Sequential(\n nn.Conv2d(in_channels=self.channels, out_channels=self.channels, kernel_size=1, padding=0),\n nn.ReLU(inplace=True))\n self.initial_params()\n\n def forward(self, x):\n n, c, h, w = x.size()\n x = self.conv1(x)\n x = self.pool(x)\n x = x.view(n, -1)\n x = self.fc(x)\n x = x.view(n, self.channels, 1, 1)\n x = self.conv2(x)\n x = x.repeat(1, 1, h, w)\n return x\n\n def initial_params(self, dev=0.01):\n for m in self.modules():\n if isinstance(m, nn.Conv2d):\n # print torch.sum(m.weight)\n m.weight.data.normal_(0, dev)\n if m.bias is not None:\n m.bias.data.fill_(0)\n elif isinstance(m, nn.ConvTranspose2d):\n # print torch.sum(m.weight)\n m.weight.data.normal_(0, dev)\n if m.bias is not None:\n m.bias.data.fill_(0)\n elif isinstance(m, nn.Linear):\n m.weight.data.normal_(0, dev)\n\n\nif __name__ == '__main__':\n net = DepthNet(depth=50, pretrained=True)\n print(net)\n inputs = torch.ones(4,3,128,128)\n out = net(inputs)\n print(out.size())\n\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076089,"cells":{"text":{"kind":"string","value":"from __future__ import absolute_import\nfrom __future__ import division\nfrom __future__ import print_function\nfrom __future__ import unicode_literals\nfrom multiprocessing.sharedctypes import Value\n\nimport os\nimport six\nimport yaml\nimport copy\nimport numpy as np\nfrom ast import literal_eval\n\nfrom lib.utils.collections import AttrDict\nfrom lib.utils.misc import get_run_name\n\n\n__C = AttrDict()\n# Consumers can get config by:\ncfg = __C\n\n# Root directory of project\n__C.ROOT_DIR = os.path.dirname(os.path.dirname(os.path.dirname(os.path.abspath(__file__))))\n\n# ---------------------------------------------------------------------------- #\n# Data configurations\n# ---------------------------------------------------------------------------- #\n__C.DATASET = AttrDict()\n__C.DATASET.NAME = 'diversedepth'\n__C.DATASET.RGB_PIXEL_MEANS = (0.485, 0.456, 0.406) # (102.9801, 115.9465, 122.7717)\n__C.DATASET.RGB_PIXEL_VARS = (0.229, 0.224, 0.225) # (1, 1, 1)\n# Scale the depth map\n#__C.DATASET.DEPTH_SCALE = 10.0\n__C.DATASET.CROP_SIZE = (448, 448) # (height, width)\n\n# Camera Parameters\n__C.DATASET.FOCAL_X = 256.0\n__C.DATASET.FOCAL_Y = 256.0\n\n# ---------------------------------------------------------------------------- #\n# Models configurations\n# ---------------------------------------------------------------------------- #\n__C.MODEL = AttrDict()\n__C.MODEL.INIT_TYPE = 'xavier'\n# Configure the model type for the encoder, e.g.ResNeXt50_32x4d_body_stride16\n__C.MODEL.ENCODER = 'resnet50_stride32'\n__C.MODEL.MODEL_REPOSITORY = 'datasets/pretrained_model'\n__C.MODEL.PRETRAINED_WEIGHTS = 'resnext50_32x4d.pth'\n__C.MODEL.LOAD_IMAGENET_PRETRAINED_WEIGHTS = True\n\n# Configure resnext\n__C.MODEL.RESNET_BOTTLENECK_DIM = [64, 256, 512, 1024, 2048]\n__C.MODEL.RESNET_BLOCK_DIM = [64, 64, 128, 256, 512]\n\n# Configure the decoder\n__C.MODEL.FCN_DIM_IN = [512, 256, 256, 256, 256, 256]\n__C.MODEL.FCN_DIM_OUT = [256, 256, 256, 256, 256]\n__C.MODEL.LATERAL_OUT = [512, 256, 256, 256]\n\n# Configure input and output channel of the model\n__C.MODEL.ENCODER_INPUT_C = 3\n__C.MODEL.DECODER_OUTPUT_C = 1\n# Configure weight for different losses\n__C.MODEL.FREEZE_BACKBONE_BN = False\n#__C.MODEL.USE_SYNCBN = True\n__C.MODEL.DEVICE = \"cuda\"\n# ---------------------------------------------------------------------------- #\n# Training configurations\n# ---------------------------------------------------------------------------- #\n__C.TRAIN = AttrDict()\n# Load run name, which is the combination of running time and host name\n__C.TRAIN.RUN_NAME = get_run_name()\n__C.TRAIN.OUTPUT_DIR = './outputs'\n# Dir for checkpoint and logs\n__C.TRAIN.LOG_DIR = os.path.join(__C.TRAIN.OUTPUT_DIR, cfg.TRAIN.RUN_NAME)\n# Differ the learning rate between encoder and decoder\n__C.TRAIN.SCALE_DECODER_LR = 1\n__C.TRAIN.BASE_LR = 0.001\n__C.TRAIN.MAX_ITER = 0\n# Set training epoches, end at the last epoch of list\n__C.TRAIN.EPOCH = 50\n__C.TRAIN.MAX_ITER = 0\n__C.TRAIN.LR_SCHEDULER_MULTISTEPS = [30000, 120000, 200000]\n__C.TRAIN.LR_SCHEDULER_GAMMA = 0.1\n__C.TRAIN.WARMUP_FACTOR = 1.0 / 3\n__C.TRAIN.WARMUP_ITERS = 500 # Need to change\n__C.TRAIN.WARMUP_METHOD = \"linear\"\n# Snapshot (model checkpoint) period\n__C.TRAIN.SNAPSHOT_ITERS = 5000\n__C.TRAIN.VAL_STEP = 5000\n__C.TRAIN.BATCHSIZE = 4\n__C.TRAIN.GPU_NUM = 1\n# Steps for LOG interval\n__C.TRAIN.LOG_INTERVAL = 10\n__C.TRAIN.LOAD_CKPT = None\n# Configs for loss\n__C.TRAIN.LOSS_MODE = '_vnl_ssil_ranking_'\n__C.TRAIN.LOSS_AUXI_WEIGHT = 0.5\n#__C.TRAIN.DIFF_LOSS_WEIGHT = 5\n\n__C.TRAIN.OPTIM = 'SGD'\n\ndef print_configs(cfg):\n import logging\n logger = logging.getLogger(__name__)\n\n message = ''\n message += '----------------- Configs ---------------\\n'\n for k, kv in cfg.items():\n if isinstance(kv, AttrDict):\n name1 = '.'.join(['cfg', k])\n message += '{:>50}: \\n'.format(name1)\n for k_, v_ in kv.items():\n name2 = '.'.join([name1, k_])\n message += '{:>50}: {:<30}\\n'.format(str(name2), str(v_))\n else:\n message += '{:>50}: {:<30}\\n'.format(k, kv)\n\n message += '----------------- End -------------------'\n logger.info(message)\n\n\ndef merge_cfg_from_file(train_args):\n \"\"\"Load a yaml config file and merge it into the global config.\"\"\"\n # cfg_filename = train_args.cfg_file\n # cfg_file = os.path.join(__C.ROOT_DIR, cfg_filename + '.yaml')\n # with open(cfg_file, 'r') as f:\n # yaml_cfg = AttrDict(yaml.safe_load(f))\n # _merge_a_into_b(yaml_cfg, __C)\n # __C.DATASET.DEPTH_MIN_LOG = np.log10(__C.DATASET.DEPTH_MIN)\n # # Modify some configs\n # __C.DATASET.DEPTH_BIN_INTERVAL = (np.log10(__C.DATASET.DEPTH_MAX) - np.log10(\n # __C.DATASET.DEPTH_MIN)) / __C.MODEL.DECODER_OUTPUT_C\n\n # # The boundary of each bin\n # __C.DATASET.DEPTH_BIN_BORDER = np.array([__C.DATASET.DEPTH_MIN_LOG + __C.DATASET.DEPTH_BIN_INTERVAL * (i + 0.5)\n # for i in range(__C.MODEL.DECODER_OUTPUT_C)])\n # __C.DATASET.WCE_LOSS_WEIGHT = [[np.exp(-0.2 * (i - j) ** 2) for i in range(__C.MODEL.DECODER_OUTPUT_C)]\n # for j in np.arange(__C.MODEL.DECODER_OUTPUT_C)]\n\n if train_args.backbone == 'resnet50':\n __C.MODEL.ENCODER = 'resnet50_stride32'\n __C.MODEL.PRETRAINED_WEIGHTS = 'resnext50_32x4d.pth'\n elif train_args.backbone == 'resnext101':\n __C.MODEL.ENCODER = 'resnext101_stride32x8d'\n __C.MODEL.PRETRAINED_WEIGHTS = 'resnext101_stride32x8d.pth'\n else:\n raise ValueError\n\n for k, v in vars(train_args).items():\n if k.upper() in __C.TRAIN.keys():\n __C.TRAIN[k.upper()] = getattr(train_args, k)\n \n __C.TRAIN.LOG_DIR = os.path.join(__C.TRAIN.OUTPUT_DIR, cfg.TRAIN.RUN_NAME)\n\n\ndef _merge_a_into_b(a, b, stack=None):\n \"\"\"Merge config dictionary a into config dictionary b, clobbering the\n options in b whenever they are also specified in a.\n \"\"\"\n assert isinstance(a, AttrDict), 'Argument `a` must be an AttrDict'\n assert isinstance(b, AttrDict), 'Argument `b` must be an AttrDict'\n\n for k, v_ in a.items():\n full_key = '.'.join(stack) + '.' + k if stack is not None else k\n # a must specify keys that are in b\n if k not in b:\n # if _key_is_deprecated(full_key):\n # continue\n # elif _key_is_renamed(full_key):\n # _raise_key_rename_error(full_key)\n # else:\n raise KeyError('Non-existent config key: {}'.format(full_key))\n\n v = copy.deepcopy(v_)\n v = _decode_cfg_value(v)\n v = _check_and_coerce_cfg_value_type(v, b[k], k, full_key)\n\n # Recursively merge dicts\n if isinstance(v, AttrDict):\n try:\n stack_push = [k] if stack is None else stack + [k]\n _merge_a_into_b(v, b[k], stack=stack_push)\n except BaseException:\n raise\n else:\n b[k] = v\n\n\ndef _decode_cfg_value(v):\n \"\"\"Decodes a raw config value (e.g., from a yaml config files or command\n line argument) into a Python object.\n \"\"\"\n # Configs parsed from raw yaml will contain dictionary keys that need to be\n # converted to AttrDict objects\n if isinstance(v, dict):\n return AttrDict(v)\n # All remaining processing is only applied to strings\n if not isinstance(v, six.string_types):\n return v\n # Try to interpret `v` as a:\n # string, number, tuple, list, dict, boolean, or None\n try:\n v = literal_eval(v)\n # The following two excepts allow v to pass through when it represents a\n # string.\n #\n # Longer explanation:\n # The type of v is always a string (before calling literal_eval), but\n # sometimes it *represents* a string and other times a data structure, like\n # a list. In the case that v represents a string, what we got back from the\n # yaml parser is 'foo' *without quotes* (so, not '\"foo\"'). literal_eval is\n # ok with '\"foo\"', but will raise a ValueError if given 'foo'. In other\n # cases, like paths (v = 'foo/bar' and not v = '\"foo/bar\"'), literal_eval\n # will raise a SyntaxError.\n except ValueError:\n pass\n except SyntaxError:\n pass\n return v\n\n\ndef _check_and_coerce_cfg_value_type(value_a, value_b, key, full_key):\n \"\"\"Checks that `value_a`, which is intended to replace `value_b` is of the\n right type. The type is correct if it matches exactly or is one of a few\n cases in which the type can be easily coerced.\n \"\"\"\n # The types must match (with some exceptions)\n type_b = type(value_b)\n type_a = type(value_a)\n if type_a is type_b:\n return value_a\n\n # Exceptions: numpy arrays, strings, tuple<->list\n if isinstance(value_b, np.ndarray):\n value_a = np.array(value_a, dtype=value_b.dtype)\n elif isinstance(value_b, six.string_types):\n value_a = str(value_a)\n elif isinstance(value_a, tuple) and isinstance(value_b, list):\n value_a = list(value_a)\n elif isinstance(value_a, list) and isinstance(value_b, tuple):\n value_a = tuple(value_a)\n else:\n raise ValueError(\n 'Type mismatch ({} vs. {}) with values ({} vs. {}) for config '\n 'key: {}'.format(type_b, type_a, value_b, value_a, full_key)\n )\n return value_a\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076090,"cells":{"text":{"kind":"string","value":"import importlib\nimport os\nimport dill\nimport logging\nimport cv2\nimport numpy as np\nimport torch\nimport torch.nn as nn\nimport matplotlib.pyplot as plt\nfrom collections import OrderedDict\n\nfrom lib.configs.config import cfg\n\nlogger = logging.getLogger(__name__)\n\ndef get_func(func_name):\n \"\"\"Helper to return a function object by name. func_name must identify a\n function in this module or the path to a function relative to the base\n 'modeling' module.\n \"\"\"\n if func_name == '':\n return None\n try:\n parts = func_name.split('.')\n # Refers to a function in this module\n if len(parts) == 1:\n return globals()[parts[0]]\n # Otherwise, assume we're referencing a module under modeling\n module_name = 'lib.models.' + '.'.join(parts[:-1])\n module = importlib.import_module(module_name)\n return getattr(module, parts[-1])\n except Exception:\n logger.error('Failed to f1ind function: %s', func_name)\n raise\n\ndef load_ckpt(args, model, optimizer=None, scheduler=None, val_err=[]):\n \"\"\"\n Load checkpoint.\n \"\"\"\n if os.path.isfile(args.load_ckpt):\n logger.info(\"loading checkpoint %s\", args.load_ckpt)\n checkpoint = torch.load(args.load_ckpt, map_location=lambda storage, loc: storage, pickle_module=dill)\n model_state_dict_keys = model.state_dict().keys()\n checkpoint_state_dict_noprefix = strip_prefix_if_present(checkpoint['model_state_dict'], \"module.\")\n\n if all(key.startswith('module.') for key in model_state_dict_keys):\n model.module.load_state_dict(checkpoint_state_dict_noprefix)\n else:\n model.load_state_dict(checkpoint_state_dict_noprefix)\n if args.resume:\n #args.batchsize = checkpoint['batch_size']\n args.start_step = checkpoint['step']\n args.start_epoch = checkpoint['epoch']\n optimizer.load_state_dict(checkpoint['optimizer'])\n scheduler.load_state_dict(checkpoint['scheduler'])\n scheduler.__setattr__('last_epoch', checkpoint['step'])\n if 'val_err' in checkpoint: # For backward compatibility\n val_err[0] = checkpoint['val_err']\n del checkpoint\n torch.cuda.empty_cache()\n\n\ndef strip_prefix_if_present(state_dict, prefix):\n keys = sorted(state_dict.keys())\n if not all(key.startswith(prefix) for key in keys):\n return state_dict\n stripped_state_dict = OrderedDict()\n for key, value in state_dict.items():\n stripped_state_dict[key.replace(prefix, \"\")] = value\n return stripped_state_dict\n\n\ndef save_ckpt(args, step, epoch, model, optimizer, scheduler, val_err={}):\n \"\"\"Save checkpoint\"\"\"\n ckpt_dir = os.path.join(cfg.TRAIN.LOG_DIR, 'ckpt')\n if not os.path.exists(ckpt_dir):\n os.makedirs(ckpt_dir)\n save_name = os.path.join(ckpt_dir, 'epoch%d_step%d.pth' %(epoch, step))\n if isinstance(model, nn.DataParallel):\n model = model.module\n torch.save({\n 'step': step,\n 'epoch': epoch,\n 'batch_size': args.batchsize,\n 'scheduler': scheduler.state_dict(),\n 'val_err': val_err,\n 'model_state_dict': model.state_dict(),\n 'optimizer': optimizer.state_dict()},\n save_name, pickle_module=dill)\n logger.info('save model: %s', save_name)\n\n\n# save image to the disk\ndef save_images(data, pred, scale=60000.):\n rgb = data['A_raw']\n gt = data['B_raw']\n if type(rgb).__module__ != np.__name__:\n rgb = rgb.cpu().numpy()\n rgb = np.squeeze(rgb)\n rgb = rgb[:, :, ::-1]\n if type(gt).__module__ != np.__name__:\n gt = gt.cpu().numpy()\n gt = np.squeeze(gt)\n if type(pred).__module__ != np.__name__:\n pred = pred.cpu().numpy()\n pred = np.squeeze(pred)\n model_name = (cfg.DATA.LOAD_MODEL_NAME.split('/')[-1]).split('.')[0]\n image_dir = os.path.join(cfg.TRAIN.OUTPUT_ROOT_DIR, '../evaluation', model_name)\n if not os.path.exists(image_dir):\n os.makedirs(image_dir)\n\n\n if 'kitti' in cfg.DATASET:\n name = data['A_paths'][0].split('/')[-4] + '-' + data['A_paths'][0].split('/')[-1].split('.')[0]\n else:\n name = data['A_paths'][0].split('/')[-1].split('.')[0]\n rgb_name = '%s_%s.png' % (name, 'rgb')\n gt_name = '%s_%s.png' % (name, 'gt')\n gt_raw_name = '%s_%s.png' % (name, 'gt-raw')\n pred_name = '%s_%s.png' % (name, 'pred')\n pred_raw_name = '%s_%s.png' % (name, 'pred-raw')\n\n plt.imsave(os.path.join(image_dir, rgb_name), rgb)\n if len(data['B_raw'].shape) != 2:\n plt.imsave(os.path.join(image_dir, gt_name), gt, cmap='rainbow')\n gt_scale = gt * scale\n gt_scale = gt_scale.astype('uint16')\n cv2.imwrite(os.path.join(image_dir, gt_raw_name), gt_scale)\n plt.imsave(os.path.join(image_dir, pred_name), pred, cmap='rainbow')\n pred_raw = pred * scale\n pred_raw = pred_raw.astype('uint16')\n cv2.imwrite(os.path.join(image_dir, pred_raw_name), pred_raw)"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076091,"cells":{"text":{"kind":"string","value":"\n\"\"\"Utilities for training.\"\"\"\n\nfrom __future__ import absolute_import\nfrom __future__ import division\nfrom __future__ import print_function\nfrom __future__ import unicode_literals\n\nfrom collections import defaultdict, OrderedDict\nimport datetime\n\nfrom lib.configs.config import cfg\nfrom lib.utils.logging import log_stats\nfrom lib.utils.logging import SmoothedValue\nfrom lib.utils.timer import Timer\n\n\n\nclass TrainingStats(object):\n \"\"\"Track vital training statistics.\"\"\"\n def __init__(self, args, log_period=20, tensorboard_logger=None):\n # Output logging period in SGD iterations\n self.args = args\n self.log_period = log_period\n self.tblogger = tensorboard_logger\n self.tb_ignored_keys = ['iter', 'eta', 'epoch', 'time']\n self.iter_timer = Timer()\n # Window size for smoothing tracked values (with median filtering)\n self.filter_size = log_period\n def create_smoothed_value():\n return SmoothedValue(self.filter_size)\n self.smoothed_losses = defaultdict(create_smoothed_value)\n self.smoothed_metrics = defaultdict(create_smoothed_value)\n self.smoothed_total_loss = SmoothedValue(self.filter_size)\n\n\n def IterTic(self):\n self.iter_timer.tic()\n\n def IterToc(self):\n return self.iter_timer.toc(average=False)\n\n def ResetIterTimer(self):\n self.iter_timer.reset()\n\n def UpdateIterStats(self, loss):\n \"\"\"Update tracked iteration statistics.\"\"\"\n total_loss = 0\n for k in loss:\n # all losses except the total loss: loss['all']\n if k != 'total_loss':\n self.smoothed_losses[k].AddValue(float(loss[k]))\n\n total_loss += loss['total_loss']\n self.smoothed_total_loss.AddValue(float(total_loss))\n\n def LogIterStats(self, cur_iter, cur_epoch, optimizer, val_err={}):\n \"\"\"Log the tracked statistics.\"\"\"\n if (cur_iter % self.log_period == 0):\n stats = self.GetStats(cur_iter, cur_epoch, optimizer, val_err)\n log_stats(stats, self.args)\n if self.tblogger:\n self.tb_log_stats(stats, cur_iter)\n\n def tb_log_stats(self, stats, cur_iter):\n \"\"\"Log the tracked statistics to tensorboard\"\"\"\n for k in stats:\n if k not in self.tb_ignored_keys:\n v = stats[k]\n if isinstance(v, dict):\n self.tb_log_stats(v, cur_iter)\n else:\n self.tblogger.add_scalar(k, v, cur_iter)\n\n\n def GetStats(self, cur_iter, cur_epoch, optimizer, val_err = {}):\n eta_seconds = self.iter_timer.average_time * (\n cfg.TRAIN.MAX_ITER - cur_iter\n )\n eta = str(datetime.timedelta(seconds=int(eta_seconds)))\n stats = OrderedDict(\n iter=cur_iter, # 1-indexed\n time=self.iter_timer.average_time,\n eta=eta,\n total_loss=self.smoothed_total_loss.GetMedianValue(),\n epoch=cur_epoch,\n )\n optimizer_state_dict = optimizer.state_dict()\n lr = {}\n for i in range(len(optimizer_state_dict['param_groups'])):\n lr_name = 'group%d_lr' % i\n lr[lr_name] = optimizer_state_dict['param_groups'][i]['lr']\n\n stats['lr'] = OrderedDict(lr)\n for k, v in self.smoothed_losses.items():\n stats[k] = OrderedDict([(k, v.GetMedianValue())])\n\n stats['val_err'] = OrderedDict(val_err)\n return stats\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076092,"cells":{"text":{"kind":"string","value":"import os\nimport socket\nfrom datetime import datetime\n\n\ndef get_run_name():\n \"\"\" A unique name for each run \"\"\"\n return datetime.now().strftime(\n '%b%d-%H-%M-%S') + '_' + socket.gethostname()\n\n\nIMG_EXTENSIONS = ['.jpg', '.jpeg', '.png', '.ppm', '.bmp', '.pgm']\n\n\ndef is_image_file(filename):\n \"\"\"Checks if a file is an image.\n Args:\n filename (string): path to a file\n Returns:\n bool: True if the filename ends with a known image extension\n \"\"\"\n filename_lower = filename.lower()\n return any(filename_lower.endswith(ext) for ext in IMG_EXTENSIONS)\n\n\ndef get_imagelist_from_dir(dirpath):\n images = []\n for f in os.listdir(dirpath):\n if is_image_file(f):\n images.append(os.path.join(dirpath, f))\n return images\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076093,"cells":{"text":{"kind":"string","value":"\"\"\"\nThis file contains primitives for multi-gpu communication.\nThis is useful when doing distributed training.\n\"\"\"\n\nimport pickle\n\nimport torch\nimport torch.distributed as dist\n\n\ndef get_world_size():\n if not dist.is_available():\n return 1\n if not dist.is_initialized():\n return 1\n return dist.get_world_size()\n\n\ndef get_rank():\n if not dist.is_available():\n return 0\n if not dist.is_initialized():\n return 0\n return dist.get_rank()\n\n\ndef is_main_process():\n return get_rank() == 0\n\n\ndef synchronize():\n \"\"\"\n Helper function to synchronize (barrier) among all processes when\n using distributed training\n \"\"\"\n if not dist.is_available():\n return\n if not dist.is_initialized():\n return\n world_size = dist.get_world_size()\n if world_size == 1:\n return\n dist.barrier()\n\n\ndef all_gather(data):\n \"\"\"\n Run all_gather on arbitrary picklable data (not necessarily tensors)\n Args:\n data: any picklable object\n Returns:\n list[data]: list of data gathered from each rank\n \"\"\"\n world_size = get_world_size()\n if world_size == 1:\n return [data]\n\n # serialized to a Tensor\n buffer = pickle.dumps(data)\n storage = torch.ByteStorage.from_buffer(buffer)\n tensor = torch.ByteTensor(storage).to(\"cuda\")\n\n # obtain Tensor size of each rank\n local_size = torch.IntTensor([tensor.numel()]).to(\"cuda\")\n size_list = [torch.IntTensor([0]).to(\"cuda\") for _ in range(world_size)]\n dist.all_gather(size_list, local_size)\n size_list = [int(size.item()) for size in size_list]\n max_size = max(size_list)\n\n # receiving Tensor from all ranks\n # we pad the tensor because torch all_gather does not support\n # gathering tensors of different shapes\n tensor_list = []\n for _ in size_list:\n tensor_list.append(torch.ByteTensor(size=(max_size,)).to(\"cuda\"))\n if local_size != max_size:\n padding = torch.ByteTensor(size=(max_size - local_size,)).to(\"cuda\")\n tensor = torch.cat((tensor, padding), dim=0)\n dist.all_gather(tensor_list, tensor)\n\n data_list = []\n for size, tensor in zip(size_list, tensor_list):\n buffer = tensor.cpu().numpy().tobytes()[:size]\n data_list.append(pickle.loads(buffer))\n\n return data_list\n\n\ndef reduce_dict(input_dict, average=True):\n \"\"\"\n Args:\n input_dict (dict): all the values will be reduced\n average (bool): whether to do average or sum\n Reduce the values in the dictionary from all processes so that process with rank\n 0 has the averaged results. Returns a dict with the same fields as\n input_dict, after reduction.\n \"\"\"\n world_size = get_world_size()\n if world_size < 2:\n return input_dict\n with torch.no_grad():\n names = []\n values = []\n # sort the keys so that they are consistent across processes\n for k in sorted(input_dict.keys()):\n names.append(k)\n values.append(input_dict[k])\n values = torch.stack(values, dim=0)\n dist.reduce(values, dst=0)\n if dist.get_rank() == 0 and average:\n # only main process gets accumulated, so only divide by\n # world_size in this case\n values /= world_size\n reduced_dict = {k: v for k, v in zip(names, values)}\n return reduced_dict\n\n\ndef is_pytorch_1_1_0_or_later():\n return [int(_) for _ in torch.__version__.split(\"+\")[0].split(\".\")[:3]] >= [1, 1, 0]\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076094,"cells":{"text":{"kind":"string","value":"\"\"\"Utilities for logging.\"\"\"\n\nfrom __future__ import absolute_import\nfrom __future__ import division\nfrom __future__ import print_function\nfrom __future__ import unicode_literals\n\nfrom collections import deque\nimport logging\nimport numpy as np\nimport sys\nimport os\nfrom lib.configs.config import cfg\n\n\ndef log_stats(stats, args):\n logger = logging.getLogger(__name__)\n \"\"\"Log training statistics to terminal\"\"\"\n lines = \"[Step %d/%d] [Epoch %d/%d] [%s]\\n\" % (\n stats['iter'], cfg.TRAIN.MAX_ITER, stats['epoch'], args.epoch, args.dataset)\n\n lines += \"\\t\\tloss: %.3f, time: %.6f, eta: %s\\n\" % (\n stats['total_loss'], stats['time'], stats['eta'])\n\n for k in stats:\n if 'loss' in k and 'total_loss' not in k:\n lines += \"\\t\\t\" + \", \".join(\"%s: %.3f\" % (k, v) for k, v in stats[k].items()) + \", \"\n\n # validate criteria\n lines += \"\\t\\t\" + \", \".join(\"%s: %.6f\" % (k, v) for k, v in stats['val_err'].items()) + \", \"\n lines += '\\n'\n\n # lr in different groups\n lines += \"\\t\\t\" + \", \".join(\"%s: %.6f\" % (k, v) for k, v in stats['lr'].items()) + \", \"\n lines += '\\n'\n logger.info(lines[:-1]) # remove last new linen_pxl\n\n\nclass SmoothedValue(object):\n \"\"\"Track a series of values and provide access to smoothed values over a\n window or the global series average.\n \"\"\"\n def __init__(self, window_size):\n self.deque = deque(maxlen=window_size)\n self.series = []\n self.total = 0.0\n self.count = 0\n\n def AddValue(self, value, size=1):\n self.deque.append(value)\n self.series.append(value)\n self.count += size\n self.total += value\n\n def GetMedianValue(self):\n return np.median(self.deque)\n\n def GetAverageValue(self):\n return np.mean(self.deque)\n\n def GetGlobalAverageValue(self):\n return self.total / self.count\n\n def ClearValue(self):\n self.count = 0\n self.total = 0\n\n\ndef setup_logging(name):\n FORMAT = '%(levelname)s %(filename)s:%(lineno)4d: %(message)s'\n # Manually clear root loggers to prevent any module that may have called\n # logging.basicConfig() from blocking our logging setup\n logging.root.handlers = []\n logging.basicConfig(level=logging.INFO, format=FORMAT, stream=sys.stdout)\n logger = logging.getLogger(name)\n return logger\n\n\ndef setup_distributed_logger(name, save_dir, distributed_rank, filename=\"log.txt\"):\n logger = logging.getLogger(name)\n logger.setLevel(logging.DEBUG)\n # don't log results for the non-master process\n if distributed_rank > 0:\n return logger\n ch = logging.StreamHandler(stream=sys.stdout)\n ch.setLevel(logging.DEBUG)\n formatter = logging.Formatter(\"%(asctime)s %(name)s %(levelname)s: %(message)s\")\n ch.setFormatter(formatter)\n logger.addHandler(ch)\n\n if save_dir:\n fh = logging.FileHandler(os.path.join(save_dir, filename))\n fh.setLevel(logging.DEBUG)\n fh.setFormatter(formatter)\n logger.addHandler(fh)\n return logger\n\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076095,"cells":{"text":{"kind":"string","value":"import torch\nfrom bisect import bisect_right\n\ndef make_lr_scheduler(cfg, optimizer):\n return WarmupMultiStepLR(\n optimizer,\n cfg.TRAIN.LR_SCHEDULER_MULTISTEPS,\n cfg.TRAIN.LR_SCHEDULER_GAMMA,\n warmup_factor=cfg.TRAIN.WARMUP_FACTOR,\n warmup_iters=cfg.TRAIN.WARMUP_ITERS,\n warmup_method=cfg.TRAIN.WARMUP_METHOD,\n )\n\nclass WarmupMultiStepLR(torch.optim.lr_scheduler._LRScheduler):\n def __init__(\n self,\n optimizer,\n milestones,\n gamma=0.1,\n warmup_factor=1.0 / 3,\n warmup_iters=500,\n warmup_method=\"linear\",\n last_epoch=-1,\n ):\n if not list(milestones) == sorted(milestones):\n raise ValueError(\n \"Milestones should be a list of\" \" increasing integers. Got {}\",\n milestones,\n )\n\n if warmup_method not in (\"constant\", \"linear\"):\n raise ValueError(\n \"Only 'constant' or 'linear' warmup_method accepted\"\n \"got {}\".format(warmup_method)\n )\n self.milestones = milestones\n self.gamma = gamma\n self.warmup_factor = warmup_factor\n self.warmup_iters = warmup_iters\n self.warmup_method = warmup_method\n super(WarmupMultiStepLR, self).__init__(optimizer, last_epoch)\n\n def get_lr(self):\n warmup_factor = 1\n if self.last_epoch < self.warmup_iters:\n if self.warmup_method == \"constant\":\n warmup_factor = self.warmup_factor\n elif self.warmup_method == \"linear\":\n alpha = float(self.last_epoch) / self.warmup_iters\n warmup_factor = self.warmup_factor * (1 - alpha) + alpha\n return [\n base_lr\n * warmup_factor\n * self.gamma ** bisect_right(self.milestones, self.last_epoch)\n for base_lr in self.base_lrs\n ]"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076096,"cells":{"text":{"kind":"string","value":"from __future__ import absolute_import\nfrom __future__ import division\nfrom __future__ import print_function\nfrom __future__ import unicode_literals\n\nimport time\n\n\nclass Timer(object):\n \"\"\"A simple timer.\"\"\"\n\n def __init__(self):\n self.reset()\n\n def tic(self):\n # using time.time instead of time.clock because time time.clock\n # does not normalize for multithreading\n self.start_time = time.time()\n\n def toc(self, average=True):\n self.diff = time.time() - self.start_time\n self.total_time += self.diff\n self.calls += 1\n self.average_time = self.total_time / self.calls\n if average:\n return self.average_time\n else:\n return self.diff\n\n def reset(self):\n self.total_time = 0.\n self.calls = 0\n self.start_time = 0.\n self.diff = 0.\n self.average_time = 0.\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076097,"cells":{"text":{"kind":"string","value":"\"\"\"A simple attribute dictionary used for representing configuration options.\"\"\"\n\nfrom __future__ import absolute_import\nfrom __future__ import division\nfrom __future__ import print_function\nfrom __future__ import unicode_literals\n\n\nclass AttrDict(dict):\n\n IMMUTABLE = '__immutable__'\n\n def __init__(self, *args, **kwargs):\n super(AttrDict, self).__init__(*args, **kwargs)\n self.__dict__[AttrDict.IMMUTABLE] = False\n\n def __getattr__(self, name):\n if name in self.__dict__:\n return self.__dict__[name]\n elif name in self:\n return self[name]\n else:\n raise AttributeError(name)\n\n def __setattr__(self, name, value):\n if not self.__dict__[AttrDict.IMMUTABLE]:\n if name in self.__dict__:\n self.__dict__[name] = value\n else:\n self[name] = value\n else:\n raise AttributeError(\n 'Attempted to set \"{}\" to \"{}\", but AttrDict is immutable'.\n format(name, value)\n )\n\n def immutable(self, is_immutable):\n \"\"\"Set immutability to is_immutable and recursively apply the setting\n to all nested AttrDicts.\n \"\"\"\n self.__dict__[AttrDict.IMMUTABLE] = is_immutable\n # Recursively set immutable state\n for v in self.__dict__.values():\n if isinstance(v, AttrDict):\n v.immutable(is_immutable)\n for v in self.values():\n if isinstance(v, AttrDict):\n v.immutable(is_immutable)\n\n def is_immutable(self):\n return self.__dict__[AttrDict.IMMUTABLE]\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076098,"cells":{"text":{"kind":"string","value":"import logging\nimport torch\nimport numpy as np\nlogger = logging.getLogger(__name__)\n\n\ndef recover_metric_depth(pred, gt, mask0=None):\n if type(pred).__module__ == torch.__name__:\n pred = pred.cpu().numpy()\n if type(gt).__module__ == torch.__name__:\n gt = gt.cpu().numpy()\n gt = gt.squeeze()\n pred = pred.squeeze()\n mask = (gt > 1e-8) #& (pred > 1e-8)\n if mask0 is not None and mask0.sum() > 0:\n if type(mask0).__module__ == torch.__name__:\n mask0 = mask0.cpu().numpy()\n mask0 = mask0.squeeze()\n mask0 = mask0 > 0\n mask = mask & mask0\n gt_mask = gt[mask]\n pred_mask = pred[mask]\n a, b = np.polyfit(pred_mask, gt_mask, deg=1)\n if a > 0:\n pred_metric = a * pred + b\n else:\n pred_mean = np.mean(pred_mask)\n gt_mean = np.mean(gt_mask)\n pred_metric = pred * (gt_mean / pred_mean)\n return pred_metric\n\n\ndef validate_rel_depth_err(pred, gt, smoothed_criteria, mask=None, scale=10.):\n if type(pred).__module__ == torch.__name__:\n pred = pred.cpu().numpy()\n if type(gt).__module__ == torch.__name__:\n gt = gt.cpu().numpy()\n gt = np.squeeze(gt)\n pred = np.squeeze(pred)\n if mask is not None:\n gt = gt[mask[0]:mask[1], mask[2]:mask[3]]\n pred = pred[mask[0]:mask[1], mask[2]:mask[3]]\n if pred.shape != gt.shape:\n logger.info('The shapes of dt and gt are not same!')\n return -1\n mask2 = gt > 0\n gt = gt[mask2]\n pred = pred[mask2]\n\n # invalid evaluation image\n if gt.size < 10:\n return smoothed_criteria\n\n # Scale matching\n #pred = recover_metric_depth(pred, gt)\n\n n_pxl = gt.size\n gt_scale = gt * scale\n pred_scale = pred * scale\n\n # Mean Absolute Relative Error\n rel = np.abs(gt_scale - pred_scale) / gt_scale # compute errors\n abs_rel_sum = np.sum(rel)\n smoothed_criteria['err_absRel'].AddValue(np.float64(abs_rel_sum), n_pxl)\n\n # WHDR error\n whdr_err_sum, eval_num = weighted_human_disagreement_rate(gt_scale, pred_scale)\n smoothed_criteria['err_whdr'].AddValue(np.float64(whdr_err_sum), eval_num)\n return smoothed_criteria\n\n\n\ndef evaluate_rel_err(pred, gt, smoothed_criteria, mask_invalid=None, scale=10.0 ):\n if type(pred).__module__ != np.__name__:\n pred = pred.cpu().numpy()\n if type(gt).__module__ != np.__name__:\n gt = gt.cpu().numpy()\n\n pred = np.squeeze(pred)\n gt = np.squeeze(gt)\n if pred.shape != gt.shape:\n logger.info('The shapes of dt and gt are not same!')\n return -1\n if mask_invalid is not None:\n gt = gt[~mask_invalid]\n pred = pred[~mask_invalid]\n\n mask = (gt > 1e-9) & (pred > 1e-9)\n gt = gt[mask]\n pred = pred[mask]\n n_pxl = gt.size\n gt_scale = gt * scale\n pred_scale = pred * scale\n\n # invalid evaluation image\n if gt_scale.size < 10:\n print('Valid pixel size:', gt_scale.size, 'Invalid evaluation!!!!')\n return smoothed_criteria\n\n #Mean Absolute Relative Error\n rel = np.abs(gt - pred) / gt# compute errors\n abs_rel_sum = np.sum(rel)\n smoothed_criteria['err_absRel'].AddValue(np.float64(abs_rel_sum), n_pxl)\n\n #Square Mean Relative Error\n s_rel = ((gt_scale - pred_scale) * (gt_scale - pred_scale)) / (gt_scale * gt_scale)# compute errors\n squa_rel_sum = np.sum(s_rel)\n smoothed_criteria['err_squaRel'].AddValue(np.float64(squa_rel_sum), n_pxl)\n\n #Root Mean Square error\n square = (gt_scale - pred_scale) ** 2\n rms_squa_sum = np.sum(square)\n smoothed_criteria['err_rms'].AddValue(np.float64(rms_squa_sum), n_pxl)\n\n #Log Root Mean Square error\n log_square = (np.log(gt_scale) - np.log(pred_scale)) **2\n log_rms_sum = np.sum(log_square)\n smoothed_criteria['err_logRms'].AddValue(np.float64(log_rms_sum), n_pxl)\n\n # Scale invariant error\n diff_log = np.log(pred_scale) - np.log(gt_scale)\n diff_log_sum = np.sum(diff_log)\n smoothed_criteria['err_silog'].AddValue(np.float64(diff_log_sum), n_pxl)\n diff_log_2 = diff_log ** 2\n diff_log_2_sum = np.sum(diff_log_2)\n smoothed_criteria['err_silog2'].AddValue(np.float64(diff_log_2_sum), n_pxl)\n\n # Mean log10 error\n log10_sum = np.sum(np.abs(np.log10(gt) - np.log10(pred)))\n smoothed_criteria['err_log10'].AddValue(np.float64(log10_sum), n_pxl)\n\n #Delta\n gt_pred = gt_scale / pred_scale\n pred_gt = pred_scale / gt_scale\n gt_pred = np.reshape(gt_pred, (1, -1))\n pred_gt = np.reshape(pred_gt, (1, -1))\n gt_pred_gt = np.concatenate((gt_pred, pred_gt), axis=0)\n ratio_max = np.amax(gt_pred_gt, axis=0)\n\n delta_1_sum = np.sum(ratio_max < 1.25)\n smoothed_criteria['err_delta1'].AddValue(np.float64(delta_1_sum), n_pxl)\n delta_2_sum = np.sum(ratio_max < 1.25**2)\n smoothed_criteria['err_delta2'].AddValue(np.float64(delta_2_sum), n_pxl)\n delta_3_sum = np.sum(ratio_max < 1.25**3)\n smoothed_criteria['err_delta3'].AddValue(np.float64(delta_3_sum), n_pxl)\n\n # WHDR error\n whdr_err_sum, eval_num = weighted_human_disagreement_rate(gt_scale, pred_scale)\n smoothed_criteria['err_whdr'].AddValue(np.float64(whdr_err_sum), eval_num)\n\n return smoothed_criteria\n\n\ndef weighted_human_disagreement_rate(gt, pred):\n p12_index = select_index(gt)\n gt_reshape = np.reshape(gt, gt.size)\n pred_reshape = np.reshape(pred, pred.size)\n mask = gt > 0\n gt_p1 = gt_reshape[mask][p12_index['p1']]\n gt_p2 = gt_reshape[mask][p12_index['p2']]\n pred_p1 = pred_reshape[mask][p12_index['p1']]\n pred_p2 = pred_reshape[mask][p12_index['p2']]\n\n p12_rank_gt = np.zeros_like(gt_p1)\n p12_rank_gt[gt_p1 > gt_p2] = 1\n p12_rank_gt[gt_p1 < gt_p2] = -1\n\n p12_rank_pred = np.zeros_like(gt_p1)\n p12_rank_pred[pred_p1 > pred_p2] = 1\n p12_rank_pred[pred_p1 < pred_p2] = -1\n\n err = np.sum(p12_rank_gt != p12_rank_pred)\n valid_pixels = gt_p1.size\n return err, valid_pixels\n\n\ndef select_index(gt_depth, select_size=10000):\n valid_size = np.sum(gt_depth>0)\n try:\n p = np.random.choice(valid_size, select_size*2, replace=False)\n except:\n p = np.random.choice(valid_size, select_size*2*2, replace=True)\n np.random.shuffle(p)\n p1 = p[0:select_size*2:2]\n p2 = p[1:select_size*2:2]\n\n p12_index = {'p1': p1, 'p2': p2}\n return p12_index\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}},{"rowIdx":1076099,"cells":{"text":{"kind":"string","value":"import importlib\r\nimport math\r\nimport logging\r\nimport numpy as np\r\nimport torch.utils.data\r\n\r\nimport torch.distributed as dist\r\n\r\nlogger = logging.getLogger(__name__)\r\n\r\n# class MultipleDataLoaderDistributed():\r\n# def __init__(self, opt, sample_ratio=0.1):\r\n# self.opt = opt\r\n# self.multi_datasets, self.dataset_indices_list = create_multiple_dataset(opt)\r\n# self.datasizes = [len(dataset) for dataset in self.multi_datasets]\r\n# self.merged_dataset = torch.utils.data.ConcatDataset(self.multi_datasets)\r\n# #self.custom_multi_sampler_dist = CustomerMultiDataSamples(self.dataset_indices_list, sample_ratio, self.opt)\r\n# self.custom_multi_sampler_dist = CustomerMultiDataSampler(opt, self.merged_dataset, opt.world_size, opt.phase)\r\n# self.curr_sample_size = self.custom_multi_sampler_dist.num_samples\r\n# self.dist_sample_size = self.custom_multi_sampler_dist.num_dist_samples\r\n# self.dataloader = torch.utils.data.DataLoader(\r\n# dataset=self.merged_dataset,\r\n# batch_size=opt.batchsize,\r\n# num_workers=opt.thread,\r\n# sampler=self.custom_multi_sampler_dist,\r\n# drop_last=True)\r\n#\r\n# def load_data(self):\r\n# return self\r\n#\r\n# def __len__(self):\r\n# return np.sum(self.datasizes)\r\n#\r\n# def __iter__(self):\r\n# for i, data in enumerate(self.dataloader):\r\n# if i * self.opt.batchsize >= float(\"inf\"):\r\n# break\r\n# yield data\r\n\r\ndef MultipleDataLoaderDistributed(opt, sample_ratio=1):\r\n opt = opt\r\n #multi_datasets, dataset_indices_list = create_multiple_dataset(opt)\r\n multi_datasets = create_multiple_dataset(opt)\r\n #multi_datasizes = [len(dataset) for dataset in multi_datasets]\r\n merged_dataset = torch.utils.data.ConcatDataset(multi_datasets)\r\n #custom_multi_sampler_dist = CustomerMultiDataSamples(dataset_indices_list, sample_ratio, opt)\r\n custom_multi_sampler_dist = CustomerMultiDataSampler(opt, merged_dataset, opt.world_size, opt.phase)\r\n curr_sample_size = custom_multi_sampler_dist.num_samples\r\n dist_sample_size = custom_multi_sampler_dist.num_dist_samples\r\n dataloader = torch.utils.data.DataLoader(\r\n dataset=merged_dataset,\r\n batch_size=opt.batchsize,\r\n num_workers=opt.thread,\r\n sampler=custom_multi_sampler_dist,\r\n drop_last=True)\r\n\r\n return dataloader, curr_sample_size\r\n\r\nclass CustomerMultiDataSampler(torch.utils.data.Sampler):\r\n \"\"\"\r\n Construct a sample method. Sample former ratio_samples of datasets randomly.\r\n \"\"\"\r\n\r\n def __init__(self, args, multi_dataset, num_replicas, split, sample_ratio=1.0):\r\n self.args = args\r\n self.num_replicas = num_replicas\r\n self.phase = split\r\n self.rank = args.global_rank\r\n #self.logger = logger\r\n\r\n self.multi_dataset = multi_dataset\r\n self.create_samplers()\r\n\r\n self.num_indices = np.array([len(i) for i in self.extended_indices_list])\r\n #self.num_samples = self.num_indices.astype(np.uint32)\r\n self.num_samples = (self.num_indices * sample_ratio).astype(np.uint32)\r\n self.max_indices = np.array([max(i) for i in self.extended_indices_list])\r\n self.total_sampled_size = np.sum(self.num_samples)\r\n self.num_dist_samples = int(\r\n math.ceil(self.total_sampled_size * 1.0 / self.num_replicas)\r\n )\r\n self.total_dist_size = self.num_dist_samples * self.num_replicas\r\n\r\n logstr = \",\".join([\"%s sampled data size: %d\" % (args.dataset_list[i], self.num_samples[i])\r\n for i in range(self.num_indices.size)]\r\n )\r\n logger.info(logstr)\r\n\r\n def __iter__(self):\r\n self.create_samplers()\r\n cum_sum = np.cumsum(np.append([0], self.max_indices))\r\n indices_array = [[self.extended_indices_list[data_i][i] + cum_sum[data_i]\r\n for i in range(int(num))]for data_i, num in enumerate(self.num_samples)]\r\n\r\n if \"train\" in self.phase:\r\n # data list is mapped to the order [A, B, C, A, B, C....]\r\n indices_array = np.array(indices_array).transpose(1, 0).reshape(-1)\r\n else:\r\n indices_array = np.concatenate(indices_array[:])\r\n\r\n # add extra samples to make it evenly divisible\r\n diff_size = int(self.total_dist_size - self.total_sampled_size)\r\n if diff_size > 0:\r\n extended_indices_dist = np.append(indices_array, indices_array[:diff_size])\r\n else:\r\n extended_indices_dist = indices_array\r\n assert extended_indices_dist.size == self.total_dist_size\r\n\r\n # subsample\r\n offset = self.num_dist_samples * self.rank\r\n rank_indices = extended_indices_dist[offset : offset + self.num_dist_samples]\r\n assert rank_indices.size == self.num_dist_samples\r\n for id in rank_indices:\r\n yield id\r\n\r\n def __len__(self):\r\n return self.total_sampled_size\r\n\r\n def create_samplers(self):\r\n self.extended_indices_list = []\r\n\r\n dataset_indices_lists = []\r\n indices_len = []\r\n datasets_num = len(self.multi_dataset.datasets)\r\n for dataset_i in self.multi_dataset.datasets:\r\n # The list of indices of each dataset\r\n dataset_indices_lists.append(np.random.permutation(np.arange(len(dataset_i.curriculum_list))))\r\n indices_len.append(len(dataset_i.curriculum_list))\r\n\r\n # the max size of all datasets\r\n max_len = np.max(indices_len)\r\n\r\n if \"train\" == self.phase:\r\n for data_list in dataset_indices_lists:\r\n cp = max_len // data_list.size\r\n size_i = data_list.size\r\n tmp = data_list\r\n for i in range(cp-1):\r\n tmp = np.concatenate((tmp, np.random.permutation(data_list)), axis=None)\r\n tmp = np.concatenate((tmp, np.random.choice(data_list, max_len % size_i, replace=False)), axis=None)\r\n self.extended_indices_list.append(list(tmp))\r\n else:\r\n self.extended_indices_list = dataset_indices_lists\r\n logstr = \"\\n\".join([\"Split %s, %s: %d -(extend to)-> %d\" %\r\n (self.phase, self.args.dataset_list[i], len(dataset_indices_lists[i]),\r\n len(self.extended_indices_list[i]))\r\n for i in range(datasets_num)]\r\n )\r\n logger.info(logstr)\r\n\r\n\r\n\r\n# class CustomerMultiDataSamples(torch.utils.data.Sampler):\r\n# \"\"\"\r\n# Construct a sample method. Sample former ratio_samples of datasets randomly.\r\n# \"\"\"\r\n# def __init__(self, multi_data_indices, ratio_samples, opt, rank=None, num_replicas=None):\r\n# logger = logging.getLogger(__name__)\r\n\r\n# self.multi_data_indices = multi_data_indices\r\n# self.num_indices = np.array([len(i) for i in self.multi_data_indices])\r\n# self.num_samples = (self.num_indices * ratio_samples).astype(np.uint32)\r\n# self.max_indices = np.array([max(i) for i in self.multi_data_indices])\r\n# self.total_sampled_size = np.sum(self.num_samples)\r\n# self.phase = opt.phase\r\n# if num_replicas is None:\r\n# if not dist.is_available():\r\n# raise RuntimeError(\"Requires distributed package to be available\")\r\n# num_replicas = dist.get_world_size()\r\n# self.num_replicas = num_replicas\r\n# if rank is None:\r\n# if not dist.is_available():\r\n# raise RuntimeError(\"Requires distributed package to be available\")\r\n# rank = dist.get_rank()\r\n# self.rank = rank\r\n# self.num_dist_samples = int(math.ceil(self.total_sampled_size * 1.0 / self.num_replicas))\r\n# self.total_dist_size = self.num_dist_samples * self.num_replicas\r\n# logger.info('Sample %02f, sampled dataset sizes are %s' % (ratio_samples, ','.join(map(str, self.num_samples))))\r\n\r\n# def __iter__(self):\r\n# cum_sum = np.cumsum(np.append([0], self.max_indices))\r\n# if 'train' in self.phase:\r\n# indices_array = [[self.multi_data_indices[idx][i] + cum_sum[idx] for i in torch.randperm(int(num))] for\r\n# idx, num in\r\n# enumerate(self.num_samples)]\r\n# else:\r\n# indices_array = [[self.multi_data_indices[idx][i] + cum_sum[idx] for i in range(int(num))] for\r\n# idx, num in enumerate(self.num_samples)]\r\n# if 'train' in self.phase:\r\n# # data list is reshaped in [A, B, C, A, B, C....]\r\n# indices_array = np.array(indices_array).transpose(1, 0).reshape(-1)\r\n# else:\r\n# indices_array = np.concatenate(indices_array[:])\r\n\r\n# # add extra samples to make it evenly divisible\r\n# diff_size = int(self.total_dist_size - self.total_sampled_size)\r\n# if diff_size > 0:\r\n# extended_indices_dist = np.append(indices_array, indices_array[:diff_size])\r\n# else:\r\n# extended_indices_dist = indices_array\r\n# assert extended_indices_dist.size == self.total_dist_size\r\n\r\n# # subsample\r\n# offset = self.num_dist_samples * self.rank\r\n# rank_indices = extended_indices_dist[offset: offset + self.num_dist_samples]\r\n# assert rank_indices.size == self.num_dist_samples\r\n\r\n# return iter(rank_indices)\r\n\r\n\r\n# def create_dataset(opt):\r\n# logger = logging.getLogger(__name__)\r\n\r\n# dataset = find_dataset_lib(opt.dataset)()\r\n# dataset.initialize(opt)\r\n# logger.info(\"%s is created.\" % opt.dataset)\r\n# return dataset\r\n\r\n\r\ndef create_multiple_dataset(opt):\r\n all_datasets = []\r\n dataset_indices_lists = []\r\n indices_len = []\r\n for name in opt.dataset_list:\r\n dataset = find_dataset_lib(opt.dataset)(opt, name)\r\n #dataset.initialize(opt, name)\r\n logger.info(\"%s : %s is loaded, the data size is %d\" % (opt.phase, name, len(dataset)))\r\n all_datasets.append(dataset)\r\n assert dataset.curriculum_list is not None, \"Curriculum is None!!!\"\r\n dataset_indices_lists.append(dataset.curriculum_list)\r\n indices_len.append(len(dataset.curriculum_list))\r\n assert len(dataset.curriculum_list) == dataset.data_size, \"Curriculum list size not equal the data size!!!\"\r\n max_len = np.max(indices_len)\r\n # if 'train' in opt.phase:\r\n # extended_indices_list = [i * (max_len // len(i)) + list(np.random.choice(i, max_len % len(i), replace=False)) for i in dataset_indices_lists]\r\n # #extended_indices_list = [i + list(np.random.choice(i, max_len-len(i))) for i in dataset_indices_lists]\r\n # else:\r\n # extended_indices_list = dataset_indices_lists\r\n logger.info(\"%s are merged!\" % opt.dataset_list)\r\n return all_datasets#, extended_indices_list\r\n\r\n\r\ndef find_dataset_lib(dataset_name):\r\n \"\"\"\r\n Give the option --dataset [datasetname], import \"data/datasetname_dataset.py\"\r\n :param dataset_name: --dataset\r\n :return: \"data/datasetname_dataset.py\"\r\n \"\"\"\r\n logger = logging.getLogger(__name__)\r\n dataset_filename = \"data.\" + dataset_name + \"_dataset\"\r\n datasetlib = importlib.import_module(dataset_filename)\r\n\r\n dataset = None\r\n target_dataset_name = dataset_name.replace('_', '') + 'dataset'\r\n for name, cls in datasetlib.__dict__.items():\r\n if name.lower() == target_dataset_name.lower():\r\n dataset = cls\r\n if dataset is None:\r\n logger.info(\"In %s.py, there should be a class name that matches %s in lowercase.\" % (\r\n dataset_filename, target_dataset_name))\r\n exit(0)\r\n return dataset\r\n\r\n"},"meta":{"kind":"string","value":"{\n \"repo_name\": \"aim-uofa/AdelaiDepth\",\n \"stars\": \"926\",\n \"repo_language\": \"Python\",\n \"file_name\": \"train.py\",\n \"mime_type\": \"text/x-script.python\"\n}"}}}],"truncated":false,"partial":false},"paginationData":{"pageIndex":10760,"numItemsPerPage":100,"numTotalItems":1076617,"offset":1076000,"length":100}},"jwt":"eyJhbGciOiJFZERTQSJ9.eyJyZWFkIjp0cnVlLCJwZXJtaXNzaW9ucyI6eyJyZXBvLmNvbnRlbnQucmVhZCI6dHJ1ZX0sImlhdCI6MTc1NTk1NzA4Miwic3ViIjoiL2RhdGFzZXRzL0tvYWxhQUkvR2l0SHViLUNDMCIsImV4cCI6MTc1NTk2MDY4MiwiaXNzIjoiaHR0cHM6Ly9odWdnaW5nZmFjZS5jbyJ9.oyhVDingNrv_3LIZtVxfqalLVUrGHy4zvaJSsTkN73cLODllABOd_BLSad1ReYz0lIPII0BG0NGjnxt4tf5-CQ","displayUrls":true},"discussionsStats":{"closed":0,"open":0,"total":0},"fullWidth":true,"hasGatedAccess":true,"hasFullAccess":true,"isEmbedded":false,"savedQueries":{"community":[],"user":[]}}">
text
stringlengths
2
104M
meta
dict
# -*- coding: utf-8 -*- from markdoc.config import Config Config.register_default('server.bind', '127.0.0.1') Config.register_default('server.port', 8008) Config.register_default('server.num-threads', 10) Config.register_default('server.name', None) Config.register_default('server.request-queue-size', 5) Config.register_default('server.timeout', 10) def server_maker(config, **extra_config): """ Return a server-making callable to create a CherryPy WSGI server. The server-making callable should be passed a WSGI application, and it will return an instance of `cherrypy.wsgiserver.CherryPyWSGIServer`. You can optionally override any of the hardwired configuration parameters by passing in keyword arguments which will be passed along to the `CherryPyWSGIServer` constructor. """ from cherrypy.wsgiserver import CherryPyWSGIServer bind_addr = (config['server.bind'], config['server.port']) kwargs = dict( numthreads=config['server.num-threads'], server_name=config['server.name'], request_queue_size=config['server.request-queue-size'], timeout=config['server.timeout']) kwargs.update(extra_config) return lambda wsgi_app: CherryPyWSGIServer(bind_addr, wsgi_app, **kwargs) Config.server_maker = server_maker
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# -*- coding: utf-8 -*- import os.path as p from markdoc.config import Config def html_dir(config): return p.abspath(p.join(config['meta.root'], config.get('html-dir', config['hide-prefix'] + 'html'))) def static_dir(config): return p.abspath(p.join(config['meta.root'], config.get('static-dir', 'static'))) def wiki_dir(config): return p.abspath(p.join(config['meta.root'], config.get('wiki-dir', 'wiki'))) def temp_dir(config): return p.abspath(p.join(config['meta.root'], config.get('temp-dir', config['hide-prefix'] + 'tmp'))) def template_dir(config): return p.abspath(p.join(config['meta.root'], config.get('template-dir', config['hide-prefix'] + 'templates'))) Config.register_default('hide-prefix', '.') Config.register_default('use-default-static', True) Config.register_default('cvs-exclude', True) Config.register_func_default('html-dir', lambda cfg, key: html_dir(cfg)) Config.register_func_default('static-dir', lambda cfg, key: static_dir(cfg)) Config.register_func_default('wiki-dir', lambda cfg, key: wiki_dir(cfg)) Config.register_func_default('temp-dir', lambda cfg, key: temp_dir(cfg)) Config.register_func_default('template-dir', lambda cfg, key: template_dir(cfg)) Config.html_dir = property(html_dir) Config.static_dir = property(static_dir) Config.wiki_dir = property(wiki_dir) Config.temp_dir = property(temp_dir) Config.template_dir = property(template_dir)
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# -*- coding: utf-8 -*- import os import os.path as p import operator import re from markdoc.cache import DocumentCache, RenderCache, read_from from markdoc.config import Config from markdoc.render import make_relative Config.register_default('listing-filename', '_list.html') class Builder(object): """An object to handle all the parts of the wiki building process.""" def __init__(self, config): self.config = config self.doc_cache = DocumentCache(base=self.config.wiki_dir) def render_func(path, doc): level = len(path.lstrip('/').split('/')) - 1 return self.config.markdown(curr_path=path).convert(doc) self.render_cache = RenderCache(render_func, self.doc_cache) render_doc_func = lambda path, doc: self.render_document(path, cache=False) self.document_render_cache = RenderCache(render_doc_func, self.render_cache) def crumbs(self, path): """ Produce a breadcrumbs list for the given filename. The crumbs are calculated based on the wiki root and the absolute path to the current file. Examples -------- Assuming a wiki root of `/a/b/c`: * `a/b/c/wiki/index.md` => `[('index', None)]` * `a/b/c/wiki/subdir/index.md` => `[('index', '/'), ('subdir', None)]` * `a/b/c/wiki/subdir/file.md` => `[('index', '/'), ('subdir', '/subdir/'), ('file', None)] """ if p.isabs(path): path = self.doc_cache.relative(path) rel_components = path.split(p.sep) terminus = p.splitext(rel_components.pop())[0] if not rel_components: if terminus == 'index': return [('index', None)] return [('index', '/'), (terminus, None)] elif terminus == 'index': terminus = p.splitext(rel_components.pop())[0] crumbs = [('index', '/')] for component in rel_components: path = '%s%s/' % (crumbs[-1][1], component) crumbs.append((component, path)) crumbs.append((terminus, None)) return crumbs def walk(self): """ Walk through the wiki, yielding info for each document. For each document encountered, a `(filename, crumbs)` tuple will be yielded. """ if not self.config['document-extensions']: self.config['document-extensions'].append('') def valid_extension(filename): return any(filename.endswith(valid_ext) for valid_ext in self.config['document-extensions']) for dirpath, subdirs, files in os.walk(self.config.wiki_dir): remove_hidden(subdirs); subdirs.sort() remove_hidden(files); files.sort() for filename in filter(valid_extension, files): full_filename = p.join(dirpath, filename) yield p.relpath(full_filename, start=self.config.wiki_dir) def listing_context(self, directory): """ Generate the template context for a directory listing. This method accepts a relative path, with the base assumed to be the HTML root. This means listings must be generated after the wiki is built, allowing them to list static media too. Directories should always be '/'-delimited when specified, since it is assumed that they are URL paths, not filesystem paths. For information on what the produced context will look like, consult the `listing` doctest. """ # Ensure the directory name ends with '/'. directory = directory.strip('/') # Resolve to filesystem paths. fs_rel_dir = p.sep.join(directory.split('/')) fs_abs_dir = p.join(self.config.html_dir, fs_rel_dir) skip_files = set([self.config['listing-filename'], 'index.html']) sub_directories, pages, files = [], [], [] for basename in os.listdir(fs_abs_dir): fs_abs_path = p.join(fs_abs_dir, basename) file_dict = { 'basename': basename, 'href': directory + '/' + basename} if not file_dict['href'].startswith('/'): file_dict['href'] = '/' + file_dict['href'] if p.isdir(fs_abs_path): file_dict['href'] += '/' sub_directories.append(file_dict) else: if (basename in skip_files or basename.startswith('.') or basename.startswith('_')): continue file_dict['slug'] = p.splitext(basename)[0] file_dict['size'] = p.getsize(fs_abs_path) file_dict['humansize'] = humansize(file_dict['size']) if p.splitext(basename)[1] == (p.extsep + 'html'): # Get the title from the file. contents = read_from(fs_abs_path) file_dict['title'] = get_title(file_dict['slug'], contents) # Remove .html from the end of the href. file_dict['href'] = p.splitext(file_dict['href'])[0] pages.append(file_dict) else: files.append(file_dict) sub_directories.sort(key=lambda directory: directory['basename']) pages.sort(key=lambda page: page['title']) files.sort(key=lambda file_: file_['basename']) return { 'directory': directory, 'sub_directories': sub_directories, 'pages': pages, 'files': files, 'make_relative': lambda href: make_relative(directory, href), } def render(self, path, cache=True): return self.render_cache.render(path, cache=cache) def title(self, path, cache=True): return get_title(path, self.render(path, cache=cache)) def render_document(self, path, cache=True): if cache: return self.document_render_cache.render(path) context = {} context['content'] = self.render(path) context['title'] = self.title(path) context['crumbs'] = self.crumbs(path) context['make_relative'] = lambda href: make_relative(path, href) template = self.config.template_env.get_template('document.html') return template.render(context) def render_listing(self, path): import jinja2 context = self.listing_context(path) crumbs = [('index', '/')] if path not in ['', '/']: current_dir = '' for component in path.strip('/').split('/'): crumbs.append((component, '%s/%s/' % (current_dir, component))) current_dir += '/' + component crumbs.append((jinja2.Markup('<span class="list-crumb">list</span>'), None)) context['crumbs'] = crumbs context['make_relative'] = lambda href: make_relative(path + '/', href) template = self.config.template_env.get_template('listing.html') return template.render(context) def remove_hidden(names): """Remove (in-place) all strings starting with a '.' in the given list.""" i = 0 while i < len(names): if names[i].startswith('.'): names.pop(i) else: i += 1 return names def get_title(filename, data): """Try to retrieve a title from a filename and its contents.""" match = re.search(r'<!-- ?title:(.+)-->', data, re.IGNORECASE) if match: return match.group(1).strip() match = re.search(r'<h1[^>]*>([^<]+)</h1>', data, re.IGNORECASE) if match: return match.group(1) name, extension = p.splitext(p.basename(filename)) return re.sub(r'[-_]+', ' ', name).title() def humansize(size, base=1024): import decimal import math if size == 0: return '0B' i = int(math.log(size, base)) prefix = 'BKMGTPEZY'[i] number = decimal.Decimal(size) / (base ** i) return str(number.to_integral()) + prefix
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# -*- coding: utf-8 -*- import os.path as p import jinja2 import markdoc from markdoc.config import Config Config.register_default('use-default-templates', True) def build_template_env(config): """Build a Jinja2 template environment for a given config.""" load_path = [] if p.isdir(config.template_dir): load_path.append(config.template_dir) if config['use-default-templates']: load_path.append(markdoc.default_template_dir) environment = jinja2.Environment(loader=jinja2.FileSystemLoader(load_path)) environment.globals['config'] = config return environment def template_env(config): if not getattr(config, '_template_env', None): config._template_env = build_template_env(config) return config._template_env Config.template_env = property(template_env)
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# -*- coding: utf-8 -*- import codecs from functools import wraps import os import os.path as p import time class DocumentCache(object): """ A high-level document cache for caching the content of files. This is a read-only cache which uses the OS-reported modification timestamps for files (via `os.stat()`) to determine cache dirtiness, and then refreshes its cache behind the scenes when files are requested. You can access values via `.get()` (which supports several options) or via simple subscription syntax (i.e. `cache[path]`). The cache is configured with a 'root' on instantiation, by which all relative paths are resolved. """ def __init__(self, base=None, cache=None, encoding='utf-8'): if cache is None: cache = {} self.cache = cache if base is None: base = os.getcwd() self.base = base self.encoding = encoding absolute = lambda self, relpath: p.join(self.base, relpath) relative = lambda self, abspath: p.relpath(abspath, start=self.base) def has_latest_version(self, path): """Determine whether the cache for a path is up to date.""" # No-op for already-absolute paths. path = self.absolute(path) if path not in self.cache: return False cached_mtime = self.cache[path][0] return os.stat(path).st_mtime <= cached_mtime def refresh_cache(self, path, encoding=None): """Refresh the cache, no matter what, with an optional encoding.""" path = self.absolute(path) encoding = encoding or self.encoding data = read_from(path, encoding=encoding) mtime = os.stat(path).st_mtime self.cache[path] = (mtime, data) def update_to_latest_version(self, path): """If necessary, refresh the cache's copy of a file.""" if not self.has_latest_version(path): self.refresh_cache(path) def get(self, path, cache=True, encoding=None): """Retrieve the data for a given path, optionally using the cache.""" path = self.absolute(path) if cache: self.update_to_latest_version(path) return self.cache[path][1] # (mtime, data)[1] if not p.isfile(path): return None if encoding is None: encoding = self.encoding return read_from(path, encoding=encoding) def __getitem__(self, path): result = self.get(path) if result is None: raise KeyError(path) return result class RenderCache(object): def __init__(self, render_func, document_cache): self.render_func = render_func self.doc_cache = document_cache # The two-cache structure allows us to garbage collect rendered results # for old versions of documents. # pathname => document hash self.hash_cache = {} # document hash => rendered results self.result_cache = {} def render(self, path, cache=True): """Render the contents of a filename, optionally using the cache.""" document = self.doc_cache.get(path, cache=cache) if cache: doc_hash = (hash(path), hash(document)) if path in self.hash_cache and self.hash_cache[path] != doc_hash: self.result_cache.pop(self.hash_cache[path], None) self.hash_cache[path] = doc_hash if doc_hash not in self.result_cache: self.result_cache[doc_hash] = self.render_func(path, document) return self.result_cache[doc_hash] else: return self.render_func(document) get = render # For compatibility with the document cache. def read_from(filename, encoding='utf-8'): """Read data from a filename, optionally with an encoding.""" if encoding is None: fp = open(filename) else: fp = codecs.open(filename, encoding=encoding) try: return fp.read() finally: fp.close()
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# -*- coding: utf-8 -*- import logging import os import os.path as p __version__ = '0.6.6' static_dir = p.join(p.dirname(__file__), 'static') default_static_dir = p.join(static_dir, 'default-static') default_template_dir = p.join(static_dir, 'default-templates') if not hasattr(p, 'relpath'): def relpath(path, start=p.curdir): """Return a relative version of a path""" if not path: raise ValueError("no path specified") start_list = p.abspath(start).split(p.sep) path_list = p.abspath(path).split(p.sep) # Work out how much of the filepath is shared by start and path. i = len(p.commonprefix([start_list, path_list])) rel_list = [p.pardir] * (len(start_list)-i) + path_list[i:] if not rel_list: return p.curdir return p.join(*rel_list) p.relpath = relpath default_formatter = logging.Formatter( u'%(name)s: %(levelname)s: %(message)s') console_handler = logging.StreamHandler() # By default, outputs to stderr. console_handler.setFormatter(default_formatter) console_handler.setLevel(logging.DEBUG) logging.getLogger('markdoc').addHandler(console_handler) logging.getLogger('markdoc').setLevel(logging.INFO) # Default level. # These modules all initialize various default config values, so need to be # imported straight away. import markdoc.builder import markdoc.directories import markdoc.render import markdoc.server import markdoc.templates
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# -*- coding: utf-8 -*- import logging import mimetypes import os.path as p import webob from markdoc.render import make_relative if not mimetypes.inited: mimetypes.init() # Assume all HTML files are XHTML. mimetypes.types_map['.html'] = mimetypes.types_map['.xhtml'] class MarkdocWSGIApplication(object): """ A WSGI application which will serve up a Markdoc wiki. Note that this application is not specifically reserved for Markdoc wikis, but was designed especially for them. The handling of requests is simple, and is based on the request path: /[a/b/.../c/]filename * If the file exists relative to the docroot, serve it; else * If the filename with the extension 'html' exists relative to the docroot, serve it; else * If a directory exists with that name, return a redirect to it (with a trailing slash); else * Return a HTTP 404 ‘Not Found’. /[a/b/.../c/]directory/ (including the index, '/') * If the directory exists, look for an 'index.html' file inside it, and serve it if it exists; else * If a file of the same name exists in the parent directory, return a redirect to it (without the trailing slash); else * Return a HTTP 404 ‘Not Found’. In the context of Markdoc, if a directory does not contain an 'index.md' file, a listing will be generated and saved as the 'index.html' file for that directory. """ def __init__(self, config): self.config = config self.log = logging.getLogger('markdoc.wsgi') def __call__(self, environ, start_response): request = webob.Request(environ) response = self.get_response(request) self.log.info('%s %s - %d' % (request.method, request.path_info, response.status_int)) return response(environ, start_response) def is_safe(self, directory): """Make sure the given absolute path does not point above the htroot.""" return p.pardir not in p.relpath(directory, start=self.config.html_dir).split(p.sep) def get_response(self, request): if request.path_info.endswith('/'): return self.directory(request) return self.file(request) def directory(self, request): """ Serve a request which points to a directory. * If the directory exists, look for an 'index.html' file inside it, and serve it if it exists; else * If a file of the same name exists in the parent directory, return a redirect to it (without the trailing slash); else * If a file of the same name with a 'html' extension exists in the parent directory, redirect to it (without the trailing slash); else * Return a HTTP 404 ‘Not Found’. """ path_parts = request.path_info.strip('/').split('/') index_filename = p.join(self.config.html_dir, *(path_parts + ['index.html'])) if p.exists(index_filename) and self.is_safe(index_filename): return serve_file(index_filename) directory_filename = p.join(self.config.html_dir, *path_parts) if p.isfile(directory_filename) or p.isfile(directory_filename + p.extsep + 'html'): return temp_redirect(request.path_info.rstrip('/')) return self.not_found(request) def file(self, request): """ Serve a request which points to a file. * If the file exists relative to the docroot, serve it; else * If the filename with the extension 'html' exists relative to the docroot, serve it; else * If a directory exists with that name, return a redirect to it (with a trailing slash); else * Return a HTTP 404 ‘Not Found’. """ path_parts = request.path_info.strip('/').split('/') filename = p.abspath(p.join(self.config.html_dir, *path_parts)) if not self.is_safe(filename): return self.forbidden(request) if p.isfile(filename): pass elif p.isfile(filename + p.extsep + 'html'): filename = filename + p.extsep + 'html' else: if p.isdir(filename): return temp_redirect(request.path_info + '/') return self.not_found(request) return serve_file(filename) def error(self, request, status): """ Serve a page for a given HTTP error. This works by rendering a template based on the HTTP error code; so an error of '404 Not Found' will render the '404.html' template. The context passed to the template is as follows: `request` : The `webob.Request` object for this HTTP request. `is_index` : A boolean indicating whether or not this is the index page. This may be useful in error pages where you want to link back to the home page; such a link will be useless in the index. `status` : An integer representing the HTTP status code of this error. `reason` : A string of the HTTP status 'reason', such as 'Not Found' for 404. The template is assumed to be valid XHTML. Note that the templating machinery is only invoked when the browser is expecting HTML. This is determined by calling `request.accept.accept_html()`. If not, an empty response (i.e. one without a content body) is returned. """ response = webob.Response() response.status = status if request.accept.accept_html(): context = {} context['request'] = request context['is_index'] = request.path_info in ['/', '/index.html'] context['make_relative'] = lambda href: make_relative(request.path_info, href) context['status'] = status context['reason'] = webob.util.status_reasons[status] template = self.config.template_env.get_template('%d.html' % status) response.unicode_body = template.render(context) response.content_type = mimetypes.types_map['.xhtml'] else: del response.content_length del response.content_type return response forbidden = lambda self, request: self.error(request, 403) not_found = lambda self, request: self.error(request, 404) def redirect(location, permanent=False): """Issue an optionally-permanent redirect to another location.""" response = webob.Response() response.status = 301 if permanent else 302 response.location = location del response.content_type del response.content_length return response temp_redirect = lambda location: redirect(location, permanent=False) perm_redirect = lambda location: redirect(location, permanent=True) def serve_file(filename, content_type=None, chunk_size=4096): """ Serve the specified file as a chunked response. Return a `webob.Response` instance which will serve up the file in chunks, as specified by the `chunk_size` parameter (default 4KB). You can also specify a content type with the `content_type` keyword argument. If you do not, the content type will be inferred from the filename; so 'index.html' will be interpreted as 'application/xhtml+xml', 'file.mp3' as 'audio/mpeg', et cetera. If none can be guessed, the content type will be reported as 'application/octet-stream'. """ if content_type is None: content_type = mimetypes.guess_type(filename)[0] or 'application/octet-stream' if content_type.startswith('text/html'): content_type = content_type.replace('text/html', 'application/xhtml+xml') def chunked_read(chunk_size=4096): fp = open(filename, 'rb') try: data = fp.read(chunk_size) while data: yield data data = fp.read(chunk_size) finally: fp.close() response = webob.Response(content_type=content_type) response.app_iter = chunked_read() response.content_length = p.getsize(filename) return response
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# -*- coding: utf-8 -*- """Utilities for working with Markdoc configurations.""" import copy import os import os.path as p import markdown import yaml import markdoc.exc class ConfigNotFound(markdoc.exc.AbortError): """The configuration file was not found.""" pass class ConfigMeta(type): def __new__(mcls, name, bases, attrs): cls = type.__new__(mcls, name, bases, attrs) cls._defaults = {} cls._func_defaults = {} return cls def register_default(cls, key, default_value): """Register a default value for a given key.""" cls._defaults[key] = default_value def register_func_default(cls, key, function): """Register a callable as a functional default for a key.""" cls._func_defaults[key] = function def func_default_for(cls, key): """Decorator to define a functional default for a given key.""" return lambda function: [cls.register_func_default(key, function), function][1] class Config(dict): """ A dictionary which represents a single wiki's Markdoc configuration. When instantiating this dictionary, if you aren't using an actual configuration file, just remember to set `config['meta.root']` to the wiki root; you can use `None` as the value for config_file. For example: # With a filename: config = Config('filename.yaml', {...}) # Without a filename: config = Config(None, {'meta': {'root': '/path/to/wiki/root/'}, ...}) """ __metaclass__ = ConfigMeta def __init__(self, config_file, config): super(Config, self).__init__(flatten(config)) self['meta.config-file'] = config_file self['meta.root'] = p.dirname(config_file) def __getitem__(self, key): try: return dict.__getitem__(self, key) except KeyError: if key in self._defaults: self[key] = copy.copy(self._defaults[key]) elif key in self._func_defaults: self[key] = self._func_defaults[key](self, key) else: raise return dict.__getitem__(self, key) def __delitem__(self, key): if (key not in self): return # fail silently. return dict.__delitem__(self, key) @classmethod def for_directory(cls, directory=None): """ Get the configuration from the 'markdoc.yaml' file in a directory. If you do not specify a directory, this method will use the current working directory. """ if directory is None: directory = os.getcwd() if p.exists(p.join(directory, 'markdoc.yaml')): return cls.for_file(p.join(directory, 'markdoc.yaml')) elif p.exists(p.join(directory, '.markdoc.yaml')): return cls.for_file(p.join(directory, '.markdoc.yaml')) raise ConfigNotFound("A markdoc configuration could not be found.") @classmethod def for_file(cls, filename): """Get the configuration from a given YAML file.""" if not p.exists(filename): relpath = p.relpath(p.dirname(filename), start=os.getcwd()) basename = p.basename(filename) if relpath == '.': raise ConfigNotFound("%s was not found in the current directory" % basename) raise ConfigNotFound("%s was not found in %s" % (basename, relpath)) fp = open(filename) try: config = yaml.load(fp) or {} finally: fp.close() return cls(filename, config) def flatten(dictionary, prefix=''): """ Flatten nested dictionaries into dotted keys. >>> d = { ... 'a': { ... 'b': 1, ... 'c': { ... 'd': 2, ... 'e': { ... 'f': 3 ... } ... } ... }, ... 'g': 4, ... } >>> sorted(flatten(d).items()) [('a.b', 1), ('a.c.d', 2), ('a.c.e.f', 3), ('g', 4)] """ for key in dictionary.keys(): value = dictionary.pop(key) if not isinstance(value, dict): dictionary[prefix + key] = value else: for key2 in value.keys(): value2 = value.pop(key2) if not isinstance(value2, dict): dictionary[prefix + key + '.' + key2] = value2 else: dictionary.update(flatten(value2, prefix=(prefix + key + '.' + key2 + '.'))) return dictionary
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# -*- coding: utf-8 -*- import os.path as p from markdoc.config import Config import markdown Config.register_default('markdown.extensions', ()) Config.register_func_default('markdown.extension-configs', lambda cfg, key: {}) Config.register_default('markdown.safe-mode', False) Config.register_default('markdown.output-format', 'xhtml1') Config.register_default('document-extensions', frozenset(['.md', '.mdown', '.markdown', '.wiki', '.text'])) class RelativeLinksTreeProcessor(markdown.treeprocessors.Treeprocessor): """A Markdown tree processor to relativize wiki links.""" def __init__(self, curr_path='/'): self.curr_path = curr_path def make_relative(self, href): return make_relative(self.curr_path, href) def run(self, tree): links = tree.getiterator('a') for link in links: if link.attrib['href'].startswith('/'): link.attrib['href'] = self.make_relative(link.attrib['href']) return tree def make_relative(curr_path, href): """Given a current path and a href, return an equivalent relative path.""" curr_list = curr_path.lstrip('/').split('/') href_list = href.lstrip('/').split('/') # How many path components are shared between the two paths? i = len(p.commonprefix([curr_list, href_list])) rel_list = (['..'] * (len(curr_list) - i - 1)) + href_list[i:] if not rel_list or rel_list == ['']: return './' return '/'.join(rel_list) def unflatten_extension_configs(config): """Unflatten the markdown extension configs from the config dictionary.""" configs = config['markdown.extension-configs'] for key, value in config.iteritems(): if not key.startswith('markdown.extension-configs.'): continue parts = key[len('markdown.extension-configs.'):].split('.') extension_config = configs for part in parts[:-1]: extension_config = extension_config.setdefault(part, {}) extension_config[parts[-1]] = value return configs def get_markdown_instance(config, curr_path='/', **extra_config): """Return a `markdown.Markdown` instance for a given configuration.""" mdconfig = dict( extensions=config['markdown.extensions'], extension_configs=unflatten_extension_configs(config), safe_mode=config['markdown.safe-mode'], output_format=config['markdown.output-format']) mdconfig.update(extra_config) # Include any extra kwargs. md_instance = markdown.Markdown(**mdconfig) md_instance.treeprocessors['relative_links'] = RelativeLinksTreeProcessor(curr_path=curr_path) return md_instance # Add it as a method to `markdoc.config.Config`. Config.markdown = get_markdown_instance
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# -*- coding: utf-8 -*- class MarkdocError(Exception): """An error occurred whilst running the markdoc utility.""" pass class AbortError(MarkdocError): """An exception occurred which should cause Markdoc to abort.""" pass
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
.codehilite { background: #ffffff; } .codehilite .c { color: #999988; font-style: italic } /* Comment */ .codehilite .err { color: #a61717; background-color: #e3d2d2 } /* Error */ .codehilite .k { font-weight: bold } /* Keyword */ .codehilite .o { font-weight: bold } /* Operator */ .codehilite .cm { color: #999988; font-style: italic } /* Comment.Multiline */ .codehilite .cp { color: #999999; font-weight: bold } /* Comment.Preproc */ .codehilite .c1 { color: #999988; font-style: italic } /* Comment.Single */ .codehilite .cs { color: #999999; font-weight: bold; font-style: italic } /* Comment.Special */ .codehilite .gd { color: #000000; background-color: #ffdddd } /* Generic.Deleted */ .codehilite .gd .x { color: #000000; background-color: #ffaaaa } /* Generic.Deleted.Specific */ .codehilite .ge { font-style: italic } /* Generic.Emph */ .codehilite .gr { color: #aa0000 } /* Generic.Error */ .codehilite .gh { color: #999999 } /* Generic.Heading */ .codehilite .gi { color: #000000; background-color: #ddffdd } /* Generic.Inserted */ .codehilite .gi .x { color: #000000; background-color: #aaffaa } /* Generic.Inserted.Specific */ .codehilite .go { color: #888888 } /* Generic.Output */ .codehilite .gp { color: #555555 } /* Generic.Prompt */ .codehilite .gs { font-weight: bold } /* Generic.Strong */ .codehilite .gu { color: #aaaaaa } /* Generic.Subheading */ .codehilite .gt { color: #aa0000 } /* Generic.Traceback */ .codehilite .kc { font-weight: bold } /* Keyword.Constant */ .codehilite .kd { font-weight: bold } /* Keyword.Declaration */ .codehilite .kp { font-weight: bold } /* Keyword.Pseudo */ .codehilite .kr { font-weight: bold } /* Keyword.Reserved */ .codehilite .kt { color: #445588; font-weight: bold } /* Keyword.Type */ .codehilite .m { color: #009999 } /* Literal.Number */ .codehilite .s { color: #d14 } /* Literal.String */ .codehilite .na { color: #008080 } /* Name.Attribute */ .codehilite .nb { color: #0086B3 } /* Name.Builtin */ .codehilite .nc { color: #445588; font-weight: bold } /* Name.Class */ .codehilite .no { color: #008080 } /* Name.Constant */ .codehilite .ni { color: #800080 } /* Name.Entity */ .codehilite .ne { color: #990000; font-weight: bold } /* Name.Exception */ .codehilite .nf { color: #990000; font-weight: bold } /* Name.Function */ .codehilite .nn { color: #555555 } /* Name.Namespace */ .codehilite .nt { color: #000080 } /* Name.Tag */ .codehilite .nv { color: #008080 } /* Name.Variable */ .codehilite .ow { font-weight: bold } /* Operator.Word */ .codehilite .w { color: #bbbbbb } /* Text.Whitespace */ .codehilite .mf { color: #009999 } /* Literal.Number.Float */ .codehilite .mh { color: #009999 } /* Literal.Number.Hex */ .codehilite .mi { color: #009999 } /* Literal.Number.Integer */ .codehilite .mo { color: #009999 } /* Literal.Number.Oct */ .codehilite .sb { color: #d14 } /* Literal.String.Backtick */ .codehilite .sc { color: #d14 } /* Literal.String.Char */ .codehilite .sd { color: #d14 } /* Literal.String.Doc */ .codehilite .s2 { color: #d14 } /* Literal.String.Double */ .codehilite .se { color: #d14 } /* Literal.String.Escape */ .codehilite .sh { color: #d14 } /* Literal.String.Heredoc */ .codehilite .si { color: #d14 } /* Literal.String.Interpol */ .codehilite .sx { color: #d14 } /* Literal.String.Other */ .codehilite .sr { color: #009926 } /* Literal.String.Regex */ .codehilite .s1 { color: #d14 } /* Literal.String.Single */ .codehilite .ss { color: #990073 } /* Literal.String.Symbol */ .codehilite .bp { color: #999999 } /* Name.Builtin.Pseudo */ .codehilite .vc { color: #008080 } /* Name.Variable.Class */ .codehilite .vg { color: #008080 } /* Name.Variable.Global */ .codehilite .vi { color: #008080 } /* Name.Variable.Instance */ .codehilite .il { color: #009999 } /* Literal.Number.Integer.Long */
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
html { background-color: #f6f6f6; } body { background-color: white; margin: 0 auto; width: 650px; } body #breadcrumbs, body #content, body #footer { background-color: white; clear: both; float: left; overflow: hidden; padding: 0 20px; width: 610px; } body #breadcrumbs { border-bottom: 2px solid #f6f6f6; height: 28px; margin: 0; padding: 0; width: 650px; } body #breadcrumbs li { float: left; list-style: none; margin: 0; padding: 0; } body #breadcrumbs li a { display: block; float: left; padding: 0 8px; } body #breadcrumbs li.last { padding: 0 8px; } body #breadcrumbs li.not-last:after { content: "»"; float: right; } body #footer { border-top: 8px solid #f6f6f6; padding-top: 13px; } body .clear { clear: both; border-width: 0; margin: 0; visibility: hidden; } body.listing table#pages tr, body.listing table#subdirs tr, body.listing table#files tr { border-bottom: 1px solid #777; border-top: 1px solid #777; } body.listing table#pages td, body.listing table#subdirs td, body.listing table#files td { border: none; } body.listing table#pages td.size, body.listing table#subdirs td.size, body.listing table#files td.size { background-color: #f6f6f6; } body.listing table#pages td.name, body.listing table#subdirs td.name, body.listing table#files td.name { padding: 0; } body.listing table#pages td.name a, body.listing table#subdirs td.name a, body.listing table#files td.name a { display: block; margin: 0; padding: 4px 8px; } blockquote { background-color: #f6f6f6; padding: 13px; padding-bottom: 1px; } hr { border-style: solid; border: none; border-top: 1px solid #777; margin: 28px 0; } dl { margin-left: 0; } dl dd { margin-bottom: 13px; margin-left: 13px; } ul { margin-top: 0; } ul li { list-style: square outside; } ul ul { margin-bottom: 0; } pre { border-left: 1px solid gray; margin-bottom: 13px; margin-left: 30px; padding-left: 12px; } .codehilite { border-left: 1px solid gray; margin-bottom: 13px; margin-left: 30px; padding-left: 12px; } .codehilite pre { border: none; margin: 0; padding: 0; } .codehilitetable { margin-left: 0; padding-left: 0; } .codehilitetable tr td { border: none; padding: 3px 5px 0 5px; } .codehilitetable tr td.linenos { background-color: #f6f6f6; border-right: 1px solid gray; margin: 0; padding-right: 6px; text-align: right; width: 19px; } .codehilitetable tr td.linenos .linenodiv pre { border: none; margin: 0; padding: 0; } .codehilitetable tr td.code { margin: 0; padding-left: 12px; } .codehilitetable tr td.code .codehilite { border: none; margin: 0; padding: 0; } body { font-family: 'Helvetica Neue', Helvetica, Arial, Geneva, sans-serif; line-height: 21px; } body #breadcrumbs li { color: #aaa; font-size: 13px; font-weight: bold; line-height: 28px; } body #breadcrumbs li a { text-decoration: none; } body #breadcrumbs li .list-crumb { font-weight: normal; } body #footer { color: #777; font-size: 13px; text-transform: lowercase; } body.listing table#pages td.size, body.listing table#subdirs td.size { font-family: Menlo, 'DejaVu Sans Mono', 'Bitstream Vera Sans Mono', Courier, 'Courier 10 Pitch', 'Courier New', monospace; text-align: right; } body.listing table#subdirs td.name { font-family: Courier, 'Courier 10 Pitch', 'Courier New', monospace; } h1, h2, h3, h4, h5, h6 { line-height: 21px; } h1 { font-size: 21px; } h2 { font-size: 18px; } h3 { font-size: 15px; } h4, h5, h6 { font-size: 13px; } a { color: #990000; text-decoration: none; } a:hover { color: #4c0000; } a[href^="http:"] { text-decoration: underline; } dl dt { font-weight: bold; } code { font-family: Courier, 'Courier 10 Pitch', 'Courier New', monospace; line-height: 18px; } pre { font-family: Menlo, 'DejaVu Sans Mono', 'Bitstream Vera Sans Mono', Courier, 'Courier 10 Pitch', 'Courier New', monospace; font-size: 11px; line-height: 18px; }
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
html :background-color #f6f6f6 body :background-color white :margin 0 auto :width 650px #breadcrumbs, #content, #footer :background-color white :clear both :float left :overflow hidden :padding 0 20px :width= 650px - (20px + 20px) #breadcrumbs :border-bottom 2px solid #f6f6f6 :height 28px :margin 0 :padding 0 :width 650px li :float left :list-style none :margin 0 :padding 0 a :display block :float left :padding 0 8px &.last :padding 0 8px &.not-last:after :content "»" :float right #footer :border-top 8px solid #f6f6f6 :padding-top 13px .clear :clear both :border-width 0 :margin 0 :visibility hidden body.listing table#pages, table#subdirs, table#files tr :border-bottom 1px solid #777 :border-top 1px solid #777 td :border none &.size :background-color #f6f6f6 &.name :padding 0 a :display block :margin 0 :padding 4px 8px // Common elements blockquote :background-color #f6f6f6 :padding 13px :padding-bottom 1px hr :border-style solid :border none :border-top 1px solid #777 :margin 28px 0 // Lists dl :margin-left 0 dd :margin-bottom 13px :margin-left 13px ul :margin-top 0 li :list-style square outside ul :margin-bottom 0 // Code blocks =codeblock :border-left 1px solid gray :margin-bottom 13px :margin-left 30px :padding-left 12px pre +codeblock .codehilite +codeblock pre :border none :margin 0 :padding 0 .codehilitetable :margin-left 0 :padding-left 0 tr td :border none :padding 3px 5px 0 5px &.linenos :background-color #f6f6f6 :border-right 1px solid gray :margin 0 :padding-right 6px :text-align right :width= 30px - (5px + 6px) .linenodiv pre :border none :margin 0 :padding 0 &.code :margin 0 :padding-left 12px .codehilite :border none :margin 0 :padding 0
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
@import _layout.sass @import _typography.sass
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
!monospace_fonts_block = "Menlo", "'DejaVu Sans Mono'", "'Bitstream Vera Sans Mono'", "Courier", "'Courier 10 Pitch'", "'Courier New'", "monospace" !monospace_fonts_inline = "Courier", "'Courier 10 Pitch'", "'Courier New'", "monospace" !sans_serif_fonts = "'Helvetica Neue'", "Helvetica", "Arial", "Geneva", "sans-serif" body :font-family= !sans_serif_fonts :line-height 21px #breadcrumbs li :color #aaa :font-size 13px :font-weight bold :line-height 28px a :text-decoration none .list-crumb :font-weight normal #footer :color #777 :font-size 13px :text-transform lowercase &.listing table#pages, table#subdirs td.size :font-family= !monospace_fonts_block :text-align right table#subdirs td.name :font-family= !monospace_fonts_inline // Headers h1, h2, h3, h4, h5, h6 :line-height 21px h1 :font-size 21px h2 :font-size 18px h3 :font-size 15px h4, h5, h6 :font-size 13px // Links !link_color = #900 a :color= !link_color :text-decoration none &:hover :color= !link_color * 0.5 &[href^="http:"] :text-decoration underline // Lists dl dt :font-weight bold // Code code :font-family= !monospace_fonts_inline :line-height 18px pre :font-family= !monospace_fonts_block :font-size 11px :line-height 18px
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
{% extends 'markdoc-default/404.html' %}
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
{% extends 'markdoc-default/document.html' %}
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
{% extends 'markdoc-default/listing.html' %}
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
{% extends 'markdoc-default/base.html' %}
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
{% macro crumbs(breadcrumbs) %} {% if breadcrumbs %} <ol id="breadcrumbs"> {% for name, href in breadcrumbs %} <li class="crumb-{{ loop.index0 }} {% if loop.last %}last{% else %}not-last{% endif %}"> {% if not href %} {{ name|e }} {% else %} <a href="{{ make_relative(href)|e }}">{{ name|e }}</a> {% endif %} </li> {% endfor %} </ol> <!-- ol#breadcrumbs --> {% endif %} {% endmacro %}
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
{% macro cssimport(css_href, media="screen, projection") -%} <link rel="stylesheet" type="text/css" href="{{ css_href }}" {% if media %}media="{{ media }}" {% endif %}/> {%- endmacro %} {% macro css() -%} <style type="text/css"> {{ caller() }} </style> {%- endmacro %} {% macro jsimport(js_href) -%} <script type="application/javascript" src="{{ js_href }}"></script> {%- endmacro %} {% macro js() -%} <script type="text/javascript"> {{ caller() }} </script> {%- endmacro %}
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
{% extends 'base.html' %} {% block title %}Not Found: {{ request.path_info|e }}{% endblock %} {% block content %} <h1>Not Found: <code>{{ request.path_info|e }}</code></h1> <p> We couldn’t find what you were looking for. {% if not is_index %}You could try going <a href="/">home</a>.{% endif %} </p> {% endblock %}
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
{% extends 'base.html' %} {% block content %}{{ content }}{% endblock %}
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
{% extends 'base.html' %} {% block title %}ls /{{ directory|e }}{% endblock %} {% block body_attrs %}class="listing"{% endblock %} {% block content %} <h1><code>ls /{{ directory|e }}</code></h1> {% if sub_directories %} <h2>Directories</h2> <table id="subdirs"> {% for subdir in sub_directories %} <tr> <td class="name"> <a class="dirlink" href="{{ make_relative(subdir.href)|e }}"> {{ subdir.basename|e }}/ </a> </td> </tr> {% endfor %} </table> {% endif %} {% if pages %} <h2>Pages</h2> <table id="pages"> {% for page in pages %} <tr> <td class="size">{{ page.humansize }}</td> <td class="name"> <a href="{{ make_relative(page.href)|e }}" title="{{ page.title|e }}"> {{ page.title|e }} </a> </td> </tr> {% endfor %} </table> {% endif %} {% if files %} <h2>Files</h2> <table id="files"> {% for file in files %} <tr> <td class="size">{{ file.humansize }}</td> <td class="name"> <a href="{{ make_relative(file.href)|e }}"> <code>{{ file.basename|e }}</code> </a> </td> </tr> {% endfor %} </table> {% endif %} {% endblock %}
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
<?xml version="1.0" encoding="UTF-8"?> <!DOCTYPE html PUBLIC "-//W3C//DTD XHTML+RDFa 1.0//EN" "http://www.w3.org/MarkUp/DTD/xhtml-rdfa-1.dtd"> <html xmlns="http://www.w3.org/1999/xhtml" xml:lang="en" {% block xmlns -%} xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#" xmlns:rdfs="http://www.w3.org/2000/01/rdf-schema#" xmlns:dc="http://purl.org/dc/elements/1.1/" xmlns:foaf="http://xmlns.com/foaf/0.1/" {%- endblock %}> {% import "macros/html" as html -%} {% import "macros/crumbs" as breadcrumbs with context -%} <head> {% block head %} {% block meta %} <meta http-equiv="Content-Type" content="application/xhtml+xml; charset=UTF-8" /> {% endblock %} <title> {% block title_prefix -%} {% if 'wiki-name' in config %}{{ config['wiki-name']|e }} » {% endif %} {%- endblock %} {% block title -%} {{ title }} {%- endblock %} </title> {% block css %} <!-- YUI CSS reset, fonts, base --> {{ html.cssimport(("http://yui.yahooapis.com/combo?" + "3.0.0/build/cssreset/reset-min.css&" + "3.0.0/build/cssfonts/fonts-min.css&" + "3.0.0/build/cssbase/base-min.css") | e) }} {{ html.cssimport(make_relative("/media/css/style.css")) }} {{ html.cssimport(make_relative("/media/css/pygments.css")) }} {% endblock %} {% block js %}{% endblock %} {% block analytics %} {% if 'google-analytics' in config %} <!-- Google Analytics --> <script type="text/javascript"> var _gaq = _gaq || []; _gaq.push(['_setAccount', '{{ config['google-analytics'] }}']); _gaq.push(['_trackPageview']); (function() { var ga = document.createElement('script'); ga.type = 'text/javascript'; ga.async = true; ga.src = ('https:' == document.location.protocol ? 'https://ssl' : 'http://www') + '.google-analytics.com/ga.js'; (document.getElementsByTagName('head')[0] || document.getElementsByTagName('body')[0]).appendChild(ga); })(); </script> {% endif %} {% endblock analytics %} {% endblock head %} </head> <body {% block body_attrs %}{% endblock %}> {% block body %} {% block body_header %} {% block crumbs %} {{ breadcrumbs.crumbs(crumbs) }} {% endblock crumbs %} {% endblock body_header %} <div id="content"> {% block content_header %} {% endblock content_header %} {% block content %} {% endblock content %} {% block content_footer %} {% endblock content_footer %} <hr class="clear" /> </div> <!-- div#content --> {% block body_footer %} <div id="footer"> <p> {% if 'wiki-name' in config %} {{ config['wiki-name']|e }} — {% endif %} Powered by <a href="http://markdoc.org/">Markdoc</a>. </p> </div> {% endblock body_footer %} {% endblock body %} <hr class="clear" /> </body> </html>
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# -*- coding: utf-8 -*- import os import argparse import markdoc from markdoc.config import Config parser = argparse.ArgumentParser(**{ 'prog': 'markdoc', 'description': 'A lightweight Markdown-based wiki build tool.', }) parser.add_argument('-v', '--version', action='version', version=markdoc.__version__) config = parser.add_argument('--config', '-c', default=os.getcwd(), help="Use the specified Markdoc config (a YAML file or a directory " "containing markdoc.yaml)") log_level = parser.add_argument('--log-level', '-l', metavar='LEVEL', default='INFO', choices='DEBUG INFO WARN ERROR'.split(), help="Choose a log level from DEBUG, INFO (default), WARN or ERROR") quiet = parser.add_argument('--quiet', '-q', action='store_const', dest='log_level', const='ERROR', help="Alias for --log-level ERROR") verbose = parser.add_argument('--verbose', action='store_const', dest='log_level', const='DEBUG', help="Alias for --log-level DEBUG") subparsers = parser.add_subparsers(dest='command', title='commands', metavar='COMMAND')
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# -*- coding: utf-8 -*- import logging import os import argparse from markdoc.cli import commands from markdoc.cli.parser import parser from markdoc.config import Config, ConfigNotFound def main(cmd_args=None): """The main entry point for running the Markdoc CLI.""" if cmd_args is not None: args = parser.parse_args(cmd_args) else: args = parser.parse_args() if args.command != 'init': try: args.config = os.path.abspath(args.config) if os.path.isdir(args.config): config = Config.for_directory(args.config) elif os.path.isfile(args.config): config = Config.for_file(args.config) else: raise ConfigNotFound("Couldn't locate Markdoc config.") except ConfigNotFound, exc: parser.error(str(exc)) else: config = None logging.getLogger('markdoc').setLevel(getattr(logging, args.log_level)) command = getattr(commands, args.command.replace('-', '_')) return command(config, args) if __name__ == '__main__': main()
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# -*- coding: utf-8 -*- import codecs from functools import wraps import logging import os import os.path as p import pprint import re import shutil import subprocess import sys import markdoc from markdoc.builder import Builder from markdoc.cli.parser import subparsers def command(function): """Decorator/wrapper to declare a function as a Markdoc CLI task.""" cmd_name = function.__name__.replace('_', '-') help = (function.__doc__ or '').rstrip('.') or None parser = subparsers.add_parser(cmd_name, help=help) @wraps(function) def wrapper(config, args): logging.getLogger('markdoc').debug('Running markdoc.%s' % cmd_name) return function(config, args) wrapper.parser = parser return wrapper ## Utilities @command def show_config(config, args): """Pretty-print the current Markdoc configuration.""" pprint.pprint(config) @command def init(_, args): """Initialize a new Markdoc repository.""" log = logging.getLogger('markdoc.init') if not args.destination: log.info('No destination specified; using current directory') destination = os.getcwd() else: destination = p.abspath(args.destination) if p.exists(destination) and os.listdir(destination): init.parser.error("destination isn't empty") elif not p.exists(destination): log.debug('makedirs %s' % destination) os.makedirs(destination) elif not p.isdir(destination): init.parser.error("destination isn't a directory") log.debug('mkdir %s/.templates/' % destination) os.makedirs(p.join(destination, '.templates')) log.debug('mkdir %s/static/' % destination) os.makedirs(p.join(destination, 'static')) log.debug('mkdir %s/wiki/' % destination) os.makedirs(p.join(destination, 'wiki')) log.debug('Creating markdoc.yaml file') config_filename = p.join(destination, 'markdoc.yaml') fp = open(config_filename, 'w') try: fp.write('{}\n') finally: fp.close() if args.vcs_ignore: config = markdoc.config.Config.for_directory(destination) args = vcs_ignore.parser.parse_args([args.vcs_ignore]) vcs_ignore(config, args) log.info('Wiki initialization complete') log.info('Your new wiki is at: %s' % destination) init.parser.add_argument('destination', default=None, help="Create wiki here (if omitted, defaults to current directory)") init.parser.add_argument('--vcs-ignore', choices=['hg', 'git', 'cvs', 'bzr'], help="Create an ignore file for the specified VCS.") @command def vcs_ignore(config, args): """Create a VCS ignore file for a wiki.""" log = logging.getLogger('markdoc.vcs-ignore') log.debug('Creating ignore file for %s' % args.vcs) wiki_root = config['meta.root'] # shorter local alias. ignore_file_lines = [] ignore_file_lines.append(p.relpath(config.html_dir, start=wiki_root)) ignore_file_lines.append(p.relpath(config.temp_dir, start=wiki_root)) if args.vcs == 'hg': ignore_file_lines.insert(0, 'syntax: glob') ignore_file_lines.insert(1, '') if args.output == '-': log.debug('Writing ignore file to stdout') fp = sys.stdout else: if not args.output: filename = p.join(wiki_root, '.%signore' % args.vcs) else: filename = p.join(wiki_root, args.output) log.info('Writing ignore file to %s' % p.relpath(filename, start=wiki_root)) fp = open(filename, 'w') try: fp.write('\n'.join(ignore_file_lines) + '\n') finally: if fp is not sys.stdout: fp.close() log.debug('Ignore file written.') vcs_ignore.parser.add_argument('vcs', default='hg', nargs='?', choices=['hg', 'git', 'cvs', 'bzr'], help="Create ignore file for specified VCS (default 'hg')") vcs_ignore.parser.add_argument('-o', '--output', default=None, metavar='FILENAME', help="Write output to the specified filename, relative to the wiki root. " "Default is to generate the filename from the VCS. " "'-' will write to stdout.") ## Cleanup @command def clean_html(config, args): """Clean built HTML from the HTML root.""" log = logging.getLogger('markdoc.clean-html') if p.exists(config.html_dir): log.debug('rm -Rf %s' % config.html_dir) shutil.rmtree(config.html_dir) log.debug('makedirs %s' % config.html_dir) os.makedirs(config.html_dir) @command def clean_temp(config, args): """Clean built HTML from the temporary directory.""" log = logging.getLogger('markdoc.clean-temp') if p.exists(config.temp_dir): log.debug('rm -Rf %s' % config.temp_dir) shutil.rmtree(config.temp_dir) log.debug('makedirs %s' % config.temp_dir) os.makedirs(config.temp_dir) ## Synchronization @command def sync_static(config, args): """Sync static files into the HTML root.""" log = logging.getLogger('markdoc.sync-static') if not p.exists(config.html_dir): log.debug('makedirs %s' % config.html_dir) os.makedirs(config.html_dir) command = ('rsync -vaxq --cvs-exclude --ignore-errors --include=.htaccess --exclude=.* --exclude=_*').split() display_cmd = command[:] if config['use-default-static']: # rsync needs the paths to have trailing slashes to work correctly. command.append(p.join(markdoc.default_static_dir, '')) display_cmd.append(p.basename(markdoc.default_static_dir) + '/') if not config['cvs-exclude']: command.remove('--cvs-exclude') display_cmd.remove('--cvs-exclude') if p.isdir(config.static_dir): command.append(p.join(config.static_dir, '')) display_cmd.append(p.basename(config.static_dir) + '/') command.append(p.join(config.html_dir, '')) display_cmd.append(p.basename(config.html_dir) + '/') log.debug(subprocess.list2cmdline(display_cmd)) subprocess.check_call(command) log.debug('rsync completed') @command def sync_html(config, args): """Sync built HTML and static media into the HTML root.""" log = logging.getLogger('markdoc.sync-html') if not p.exists(config.html_dir): log.debug('makedirs %s' % config.html_dir) os.makedirs(config.html_dir) command = ('rsync -vaxq --cvs-exclude --delete --ignore-errors --include=.htaccess --exclude=.* --exclude=_*').split() display_cmd = command[:] # rsync needs the paths to have trailing slashes to work correctly. command.append(p.join(config.temp_dir, '')) display_cmd.append(p.basename(config.temp_dir) + '/') if config['use-default-static']: command.append(p.join(markdoc.default_static_dir, '')) display_cmd.append(p.basename(markdoc.default_static_dir) + '/') if not config['cvs-exclude']: command.remove('--cvs-exclude') display_cmd.remove('--cvs-exclude') if p.isdir(config.static_dir): command.append(p.join(config.static_dir, '')) display_cmd.append(p.basename(config.static_dir) + '/') command.append(p.join(config.html_dir, '')) display_cmd.append(p.basename(config.html_dir) + '/') log.debug(subprocess.list2cmdline(display_cmd)) subprocess.check_call(command) log.debug('rsync completed') ## Building @command def build(config, args): """Compile wiki to HTML and sync to the HTML root.""" log = logging.getLogger('markdoc.build') clean_temp(config, args) builder = Builder(config) for rel_filename in builder.walk(): html = builder.render_document(rel_filename) out_filename = p.join(config.temp_dir, p.splitext(rel_filename)[0] + p.extsep + 'html') if not p.exists(p.dirname(out_filename)): log.debug('makedirs %s' % p.dirname(out_filename)) os.makedirs(p.dirname(out_filename)) log.debug('Creating %s' % p.relpath(out_filename, start=config.temp_dir)) fp = codecs.open(out_filename, 'w', encoding='utf-8') try: fp.write(html) finally: fp.close() sync_html(config, args) build_listing(config, args) @command def build_listing(config, args): """Create listings for all directories in the HTML root (post-build).""" log = logging.getLogger('markdoc.build-listing') list_basename = config['listing-filename'] builder = Builder(config) generate_listing = config.get('generate-listing', 'always').lower() always_list = True if generate_listing == 'never': log.debug("No listing generated (generate-listing == never)") return # No need to continue. for fs_dir, _, _ in os.walk(config.html_dir): index_file_exists = any([ p.exists(p.join(fs_dir, 'index.html')), p.exists(p.join(fs_dir, 'index'))]) directory = '/' + '/'.join(p.relpath(fs_dir, start=config.html_dir).split(p.sep)) if directory == '/' + p.curdir: directory = '/' if (generate_listing == 'sometimes') and index_file_exists: log.debug("No listing generated for %s" % directory) continue log.debug("Generating listing for %s" % directory) listing = builder.render_listing(directory) list_filename = p.join(fs_dir, list_basename) fp = codecs.open(list_filename, 'w', encoding='utf-8') try: fp.write(listing) finally: fp.close() if not index_file_exists: log.debug("cp %s/%s %s/%s" % (directory, list_basename, directory, 'index.html')) shutil.copyfile(list_filename, p.join(fs_dir, 'index.html')) ## Serving IPV4_RE = re.compile(r'^(25[0-5]|2[0-4]\d|[0-1]?\d?\d)(\.(25[0-5]|2[0-4]\d|[0-1]?\d?\d)){3}$') @command def serve(config, args): """Serve the built HTML from the HTML root.""" # This should be a lazy import, otherwise it'll slow down the whole CLI. from markdoc.wsgi import MarkdocWSGIApplication log = logging.getLogger('markdoc.serve') app = MarkdocWSGIApplication(config) config['server.port'] = args.port config['server.num-threads'] = args.num_threads if args.server_name: config['server.name'] = args.server_name config['server.request-queue-size'] = args.queue_size config['server.timeout'] = args.timeout if args.interface: if not IPV4_RE.match(args.interface): serve.parser.error('invalid interface specifier: %r' % args.interface) config['server.bind'] = args.interface server = config.server_maker()(app) try: log.info('Serving on http://%s:%d' % server.bind_addr) server.start() except KeyboardInterrupt: log.debug('Interrupted') finally: log.info('Shutting down gracefully') server.stop() serve.parser.add_argument('-p', '--port', type=int, default=8008, help="Listen on specified port (default is 8008)") serve.parser.add_argument('-i', '--interface', default=None, help="Bind to specified interface (defaults to loopback only)") serve.parser.add_argument('-t', '--num-threads', type=int, default=10, metavar='N', help="Use N threads to handle requests (default is 10)") serve.parser.add_argument('-n', '--server-name', default=None, metavar='NAME', help="Use an explicit server name (default to an autodetected value)") serve.parser.add_argument('-q', '--queue-size', type=int, default=5, metavar='SIZE', help="Set request queue size (default is 5)") serve.parser.add_argument('--timeout', type=int, default=10, help="Set the socket timeout for connections (default is 10)")
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# -*- coding: utf-8 -*- from builder_fixture import setup_test, teardown_test
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# -*- coding: utf-8 -*- from builder_fixture import setup_test, teardown_test
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# -*- coding: utf-8 -*- import os.path as p from common import get_temporary_config, clean_temporary_config def setup_test(test): test.globs['CONFIG'] = get_temporary_config() test.globs['WIKI_ROOT'] = p.join(test.globs['CONFIG']['meta.root'], '') def teardown_test(test): clean_temporary_config(test.globs['CONFIG'])
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
>>> import os.path as p >>> from markdoc.builder import Builder, get_title >>> b = Builder(CONFIG) Filesystem Interaction ====================== You can generate breadcrumbs for a document, based on its absolute path (which will be relativized to the wiki root): >>> b.crumbs(p.join(WIKI_ROOT, 'wiki', 'index.md')) [('index', None)] >>> b.crumbs(p.join(WIKI_ROOT, 'wiki', 'somefile.md')) [('index', '/'), ('somefile', None)] >>> b.crumbs(p.join(WIKI_ROOT, 'wiki', 'somedir', 'index.md')) [('index', '/'), ('somedir', None)] >>> b.crumbs(p.join(WIKI_ROOT, 'wiki', 'somedir', 'something.md')) [('index', '/'), ('somedir', '/somedir/'), ('something', None)] You can also just use relative paths (relative to `WIKI_ROOT/wiki`): >>> b.crumbs('index.md') [('index', None)] >>> b.crumbs('somefile.md') [('index', '/'), ('somefile', None)] >>> b.crumbs(p.join('somedir', 'index.md')) [('index', '/'), ('somedir', None)] >>> b.crumbs(p.join('somedir', 'something.md')) [('index', '/'), ('somedir', '/somedir/'), ('something', None)] You can also walk through all files in the wiki, using the `walk()` method: >>> import os >>> for filepath in b.walk(): ... print filepath an_empty_file.md file1.md file2.md file3.md subdir/hello.md Rendering ========= You can render documents with the `Builder.render()` method: >>> b.render('file1.md') u'<h1>Hello</h1>' >>> b.render('file2.md') u'<h1>World</h1>' >>> b.render('file3.md') u'<h1>Foo</h1>' Titles ------ The `get_title()` function deals with retrieving titles from files. Initially, the file content itself is used to try to get a title. Either text in a specially formatted HTML comment, like this: >>> get_title(None, '<!-- title: Some Title -->') 'Some Title' Or the first `<h1>` element: >>> get_title(None, '<h1>Some Title</h1>') 'Some Title' If those both fail, the filename is used to produce a title: >>> get_title('some_title.arbitraryextension', '') 'Some Title' Since this is linked to the documents themselves, you can use the `title()` method on the builder instance to get the title for a given document: >>> b.title('file1.md') u'Hello' >>> b.title('file2.md') u'World' >>> b.title('file3.md') u'Foo' >>> b.title('an_empty_file.md') 'An Empty File' Documents --------- You can render whole documents using `Builder.render_document()`: >>> print b.render_document('file1.md') <?xml version="1.0" encoding="utf-8"?> <!DOCTYPE html> <html xmlns="http://www.w3.org/1999/xhtml" xml:lang="en"> <head> <title>Hello</title> <link rel="stylesheet" type="text/css" href="/example.css" /> </head> <body> <h1>Hello</h1> </body> </html> >>> print b.render_document('file2.md') <?xml version="1.0" encoding="utf-8"?> <!DOCTYPE html> <html xmlns="http://www.w3.org/1999/xhtml" xml:lang="en"> <head> <title>World</title> <link rel="stylesheet" type="text/css" href="/example.css" /> </head> <body> <h1>World</h1> </body> </html> This uses the `document.html` Jinja2 template, by default located in `WIKI_ROOT/.templates/`, to produce the documents.
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
Set up the document cache with a 'root' directory: >>> import os >>> from markdoc.cache import DocumentCache >>> cache = DocumentCache(base=CONFIG.wiki_dir) You can fetch files from the document cache: >>> cache.get('file1.md') u'# Hello\n' >>> cache.get('file2.md') u'# World\n' >>> cache.get('file3.md') u'# Foo\n' The contents of these files will then be cached: >>> print sorted(cache.relative(path) for path in cache.cache) ['file1.md', 'file2.md', 'file3.md'] You can also fetch them without using the cache: >>> cache.cache.clear() >>> cache.cache {} >>> cache.get('file1.md', cache=False) u'# Hello\n' >>> cache.get('file2.md', cache=False) u'# World\n' >>> cache.get('file3.md', cache=False) u'# Foo\n' >>> cache.cache {} You can force the document cache to refresh its cached content for each of these files: >>> cache.refresh_cache('file1.md') >>> cache.refresh_cache('file2.md') >>> cache.refresh_cache('file3.md') >>> len(cache.cache) 3 And then make sure they actually *have* updated to the latest version: >>> cache.has_latest_version('file1.md') True >>> cache.has_latest_version('file2.md') True >>> cache.has_latest_version('file3.md') True
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
To generate listings, we first need to build the wiki. >>> from markdoc.cli.main import main >>> try: ... main(['-c', WIKI_ROOT, '--quiet', 'build']) ... except SystemExit, exc: ... assert exc.code != 0, "An error occurred building the wiki" The wiki should now be built in the HTML root: >>> import os >>> import os.path as p >>> print '\n'.join(os.listdir(CONFIG.html_dir)) _list.html an_empty_file.html example.css file1.html file2.html file3.html index.html subdir Now we can try getting some listings. The bulk of the process occurs in the `Builder.listing_context()` method, which builds a template context dictionary for rendering the Jinja2 `listing.html` template. First we have to get a `Builder` instance: >>> from markdoc.builder import Builder >>> b = Builder(CONFIG) Now we can get the listing for the HTML root itself, just by passing the empty string: >>> import pprint >>> pprint.pprint(b.listing_context('')) # doctest: +ELLIPSIS {'directory': '', 'files': [{'basename': 'example.css', 'href': '/example.css', 'humansize': '27B', 'size': 27, 'slug': 'example'}], 'make_relative': <function <lambda> at 0x...>, 'pages': [{'basename': 'an_empty_file.html', 'href': '/an_empty_file', 'humansize': '248B', 'size': 248, 'slug': 'an_empty_file', 'title': 'An Empty File'}, {'basename': 'file3.html', 'href': '/file3', 'humansize': '250B', 'size': 250, 'slug': 'file3', 'title': u'Foo'}, {'basename': 'file1.html', 'href': '/file1', 'humansize': '254B', 'size': 254, 'slug': 'file1', 'title': u'Hello'}, {'basename': 'file2.html', 'href': '/file2', 'humansize': '254B', 'size': 254, 'slug': 'file2', 'title': u'World'}], 'sub_directories': [{'basename': 'subdir', 'href': '/subdir/'}]} We can also get the listings for subdirectories, by passing in their paths, relative to the HTML root: >>> pprint.pprint(b.listing_context('/subdir')) # doctest: +ELLIPSIS {'directory': 'subdir', 'files': [], 'make_relative': <function <lambda> at 0x...>, 'pages': [{'basename': 'hello.html', 'href': '/subdir/hello', 'humansize': '268B', 'size': 268, 'slug': 'hello', 'title': u'Hello again.'}], 'sub_directories': []} Note that these paths are always '/'-delimited, since they are taken to be URL paths and not filesystem paths.
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
>>> from markdoc.config import Config >>> EXAMPLE_KEY = '9d03e32c6cb1455388a170e3bb0c2030' >>> EXAMPLE_VALUE = '7010d5d5871143d089cb662cb540cbd5' You can make a config based on a directory (which will usually be a wiki root): >>> dir_config = Config.for_directory(WIKI_ROOT) >>> dir_config[EXAMPLE_KEY] == EXAMPLE_VALUE True You can also make one based on a YAML filename: >>> import os.path as p >>> file_config = Config.for_file(p.join(WIKI_ROOT, 'markdoc.yaml')) >>> file_config[EXAMPLE_KEY] == EXAMPLE_VALUE True And if you like, you can make a complete config manually: >>> config_dict = { ... 'meta': {'root': WIKI_ROOT}, ... EXAMPLE_KEY: EXAMPLE_VALUE ... } >>> manual_config = Config(p.join(WIKI_ROOT, 'markdoc.yaml'), config_dict) >>> manual_config[EXAMPLE_KEY] == EXAMPLE_VALUE True
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
First we have to set up a Python function for running the command-line tool. Since the main entry point is the `markdoc.cli.main.main()` function, we can just call that directly, with some defaults for the current wiki root: >>> import os >>> import os.path as p >>> from markdoc.cli.main import main >>> def markdoc(*args): ... try: ... main(['-c', WIKI_ROOT] + list(args)) ... except SystemExit, exc: ... return exc.code ... return 0 The `show-config` command will show the current Markdoc config: >>> exit_code = markdoc('show-config') # doctest: +ELLIPSIS {'9d03e32c6cb1455388a170e3bb0c2030': '7010d5d5871143d089cb662cb540cbd5', 'hide-prefix': '_', 'meta.config-file': '.../example/markdoc.yaml', 'meta.root': '.../example', 'use-default-static': False, 'use-default-templates': False} >>> exit_code 0 `sync-static` will compile the wiki's static media into the HTML root: >>> markdoc('--quiet', 'sync-static') # doctest: +ELLIPSIS 0 If you leave out the `--quiet` option, Markdoc will print some additional logging information, including the `rsync` command that's run in the background; the rsync output itself will also be written to the terminal. The static media will now be in the HTML root: >>> os.listdir(CONFIG.html_dir) ['example.css'] There are three other commands -- `clean-html`, `clean-temp`, and `sync-html` -- which are used in the background by the `build` task. `markdoc build` will compile all the HTML, and then synchronize both built HTML and static media into the HTML root (usually `WIKI_ROOT/.html`). >>> markdoc('--quiet', 'build') 0 >>> print '\n'.join(sorted(os.listdir(CONFIG.html_dir))) _list.html an_empty_file.html example.css file1.html file2.html file3.html index.html subdir
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# -*- coding: utf-8 -*- from builder_fixture import setup_test, teardown_test
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# -*- coding: utf-8 -*- import os.path as p import shutil import tempfile from markdoc.config import Config def get_temporary_config(): """ Return a temporary Markdoc configuration. The contents of the wiki will be copied from the example Markdoc wiki. After you're done with this, you should call `clean_temporary_config()` on the config object. """ own_config_dir = p.join(p.dirname(p.abspath(__file__)), 'example') + p.sep temp_config_dir = p.join(tempfile.mkdtemp(), 'example') shutil.copytree(own_config_dir, temp_config_dir) return Config.for_directory(temp_config_dir) def clean_temporary_config(config): """Delete a temporary configuration's wiki root.""" shutil.rmtree(p.dirname(config['meta.root']))
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# -*- coding: utf-8 -*- import os.path as p def setup_test(test): test.globs['WIKI_ROOT'] = p.join(p.dirname(p.abspath(__file__)), 'example')
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
hide-prefix: "_" use-default-templates: no use-default-static: no 9d03e32c6cb1455388a170e3bb0c2030: 7010d5d5871143d089cb662cb540cbd5
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# World
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# Hello
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# Foo
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# Hello again.
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
<?xml version="1.0" encoding="utf-8"?> <!DOCTYPE html> <html xmlns="http://www.w3.org/1999/xhtml" xml:lang="en"> <head> <title>{{ title }}</title> <link rel="stylesheet" type="text/css" href="/example.css" /> </head> <body> {{ content }} </body> </html>
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
<?xml version="1.0" encoding="utf-8"?> <!DOCTYPE html> <html xmlns="http://www.w3.org/1999/xhtml" xml:lang="en"> <head> <title>ls /{{ directory }}</title> <link rel="stylesheet" type="text/css" href="/example.css" /> </head> <body> <h1>Listing for /{{ directory }}</h1> {% if sub_directories %} <h2>Sub-directories</h2> <ul id="subdirs"> {% for sub_dir in sub_directories %} <li><a href="{{ sub_dir.href }}">{{ sub_dir.basename }}</a></li> {% endfor %} </ul> {% endif %} {% if pages %} <h2>Pages</h2> <ul id="pages"> {% for page in pages %} <li><a href="{{ page.href }}">{{ page.title }}</a></li> {% endfor %} </ul> {% endif %} {% if files %} <h2>Files</h2> <ul id="files"> {% for file in files %} <li><a href="{{ file.href }}">{{ file.basename }}</a></li> {% endfor %} </ul> {% endif %} </body> </html>
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
/* Nothing to see here. */
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# About Markdoc Markdoc is a project which aims to provide a lightweight alternative to large database-powered wiki systems. I’ve listed the main goals of the project below; I believe that, in its current state, it meets all of these. ## Goals & Philosophy ### Wikis * Wikis should be made up of plain-text files, without requiring a running instance of MySQL or even an SQLite database. * There should only be one simple-to-write plain-text configuration file. * Wikis should be VCS-friendly, yet VCS-agnostic. * It should be possible to compile a wiki to static HTML, and then to serve this HTML with no wiki-specific software. ### Markdown I chose Markdown as the format for this wiki system because of its simplicity, familiarity for many writers, and the extensibility of its Python implementation. For example, Pygments syntax highlighting is available through a single configuration option in the `markdoc.yaml` file. The ability to embed raw HTML in Markdown documents gives it power and flexibility. ### Command-Line Interface * The CLI should be intuitive and easy to use. * There should only be a few different sub-commands, each of which does what one would expect it to. * There should be a full web server included, in the case that setting up a large-scale HTTP server is impractical or impossible. * The CLI should be pure-Python, for portability and extensibility. ## License Markdoc is [public domain software](http://unlicense.org/). > This is free and unencumbered software released into the public domain. > > Anyone is free to copy, modify, publish, use, compile, sell, or distribute > this software, either in source code form or as a compiled binary, for any > purpose, commercial or non-commercial, and by any means. > > In jurisdictions that recognize copyright laws, the author or authors of this > software dedicate any and all copyright interest in the software to the public > domain. We make this dedication for the benefit of the public at large and to > the detriment of our heirs and successors. We intend this dedication to be an > overt act of relinquishment in perpetuity of all present and future rights to > this software under copyright law. > > THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR > IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, > FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE > AUTHORS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN > ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION > WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. > > For more information, please refer to <http://unlicense.org/> The bundled Pygments style (it’s the [Github][] syntax highlighting theme) was created by [Tom Preston-Werner][]; it was sourced from [his blog][] and is licensed under the MIT License: [github]: http://github.com/ [tom preston-werner]: http://tom.preston-werner.com/ [his blog]: http://github.com/mojombo/tpw/ > Copyright © 2010 Tom Preston-Werner > > Permission is hereby granted, free of charge, to any person > obtaining a copy of this software and associated documentation > files (the "Software"), to deal in the Software without > restriction, including without limitation the rights to use, > copy, modify, merge, publish, distribute, sublicense, and/or sell > copies of the Software, and to permit persons to whom the > Software is furnished to do so, subject to the following > conditions: > > The above copyright notice and this permission notice shall be > included in all copies or substantial portions of the Software. > > THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, > EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES > OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND > NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT > HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, > WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING > FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR > OTHER DEALINGS IN THE SOFTWARE.
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# Authoring A wiki would be nothing without pages. In Markdoc, pages are written in [Markdown][df-markdown], a plain-text formatting syntax designed by [John Gruber][df]. In his own words: [df]: http://daringfireball.net/ [df-markdown]: http://daringfireball.net/projects/markdown/ > Markdown allows you to write using an easy-to-read, easy-to-write plain text > format, then convert it to structurally valid XHTML (or HTML). > > [...] > > The overriding design goal for Markdown’s formatting syntax is to > make it as readable as possible. The idea is that a Markdown-formatted > document should be publishable as-is, as plain text, without looking > like it’s been marked up with tags or formatting instructions. For a comprehensive guide to the Markdown syntax, consult the [markup reference documentation](/ref/markup). The rest of this document will cover the Markdoc-specific conventions and constraints related to writing wiki pages. ## Linking Every page in your wiki will likely link to several other pages. Markdoc does not require any special syntax for internal links; the usual Markdown format will work. An example of a link from this very page follows: :::text For a comprehensive guide to the Markdown syntax, consult the [markup reference documentation](/ref/markup). As you can see, the link href is an absolute path to the document, without any extension. Markdoc will process this and convert it into a relative path when rendering the corresponding HTML. This means that you can host Markdoc wikis under sub-directories on a web server, and the links will still work properly. If you split your wiki up into sub-directories (for example, in this wiki, there is an `internals/` directory), the pattern remains the same. A link to the [internals/rendering](/internals/rendering) document looks like this: :::text A link to the [internals/rendering](/internals/rendering) document. Note that links will only be made relative if they begin with a `/` character; for example, a link to `http://www.google.com/` will be left untouched.
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
<!-- title: Index --> # Markdoc Markdoc is a lightweight Markdown-based wiki system. It’s been designed to allow you to create and manage wikis as quickly and easily as possible. ## What is it good for? Potential use cases for Markdoc include, but aren’t limited to: Technical Documentation/Manuals : Markdoc can be used to write and render hand-written guides and manuals for software. Such documentation will normally be separate from automatically-generated API documentation, and might give a higher-level view than API docs alone. It might be used for client documentation for web/desktop applications, or even developer documentation for frameworks. Internal Project Wikis : Markdoc wikis consist of a single plain-text file per page. By combining a wiki with a DVCS (such as [Mercurial][] or [Git][]), you can collaborate with several other people. Use the DVCS to track, share and merge changes with one another, and view the wiki’s history. [Mercurial]: http://mercurial.selenic.com/ [Git]: http://git-scm.com/ Static Site Generation : Markdoc converts wikis into raw HTML files and media. This allows you to manage a blog, personal website or a collection of pages in a Markdoc wiki, perhaps with custom CSS styles, and publish the rendered HTML to a website. Markdoc need not be installed on the hosting site, since the resultant HTML is completely independent. ## Cool Features * Set up [Google Analytics][] tracking in one line of configuration. * [Barebones][] wikis that just look like directories with Markdown-formatted text files in them. * A built-in HTTP server and WSGI application to serve up a compiled wiki with a single command. * Continuous builds (via `rsync`) mean the server can keep running whilst Markdoc re-compiles the wiki. Just refresh your browser to see the changes. * Add [Pygments][]-powered syntax highlighting to your Markdoc wiki with a single [configuration parameter][syntax-highlighting]. * Markdoc is [public domain software][licensing]. It will always be completely free to use, and you can redistribute it (in part or in whole) under any circumstances (open-source, proprietary or otherwise) with no attribution or encumberances. [google analytics]: /ref/configuration#metadata [barebones]: /tips/barebones [pygments]: http://pygments.org/ [syntax-highlighting]: /tips/syntax-highlighting [licensing]: /about#license ## Where do I start? The [quickstart](/quickstart) document has all the information you need to put together a simple Markdoc wiki. The [authoring](/authoring) guide provides a quick introduction to writing Markdoc pages themselves, especially with regards to linking between pages. ## Reference See the [configuration](/ref/configuration) reference for in-depth knowledge on writing your `markdoc.yaml` file. The [layout](/ref/layout) reference describes the basic filesystem layout for a Markdoc wiki, and the [tips](/tips/) directory contains several handy recipes. The Markdoc project’s goals and history are described in the [about](/about) page. If you’d like to know more about how Markdoc works at a deeper level, take a look at the [internals directory](/internals/). Developers interested in hacking the utility will likely want the [development](/internals/development) page. To see the complete list of pages in this wiki, you can browse the [directory listing](/_list).
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# Quickstart The first step towards using Markdoc is to install it. Luckily, it uses setuptools, so you can install it with relative ease on any system with Python. Note that most modern UNIX distributions come with a sufficiently recent version of Python, including Mac OS X, Ubuntu (and derivatives) and Fedora. ## Requirements The minimum requirements to run the Markdoc utility are: * Python 2.4 or later (2.5+ highly recommended) * A UNIX (or at least POSIX-compliant) operating system * [rsync](http://www.samba.org/rsync/) — installed out of the box with most modern OSes, including Mac OS X and Ubuntu. In the future Markdoc may include a pure-Python implementation. ## Installation You can use either `easy_install` or [pip][] to install Markdoc: [pip]: http://pip.openplans.org/ :::bash $ easy_install Markdoc # OR $ pip install Markdoc Note that you are likely to see a lot of scary-looking output from both commands; nevertheless, you can tell whether installation was successful by looking at the last line of the output. With `easy_install`, this should be: :::text Finished processing dependencies for Markdoc And with `pip install`: :::text Successfully installed ... Markdoc ... `pip` will list all of the packages it installed, and `Markdoc` should be amongst them. ## Making a Wiki ### Initializing the Wiki The `markdoc init` command creates a new wiki. It also accepts a `--vcs-ignore` option which will automatically create the appropriate ignore file for your VCS. :::bash $ markdoc init my-wiki --vcs-ignore hg markdoc.vcs-ignore: INFO: Writing ignore file to .hgignore markdoc.init: INFO: Wiki initialization complete markdoc.init: INFO: Your new wiki is at: .../my-wiki If you’re using SVN, you have to take a few more steps to set the `svn:ignore` property on the directory: :::bash $ markdoc init my-wiki --vcs-ignore cvs markdoc.vcs-ignore: INFO: Writing ignore file to .cvsignore markdoc.init: INFO: Wiki initialization complete markdoc.init: INFO: Your new wiki is at: .../my-wiki $ cd my-wiki/ $ svn propset svn:ignore -F .cvsignore $ rm .cvsignore ### Editing Pages Documents in a Markdoc wiki are located under the `wiki/` subdirectory, and are plain Markdown files. Typically documents have a `.md` file extension, but in the [wiki configuration](/configuration#building) you can specify others. :::bash $ cd my-wiki/ $ vim wiki/somefile.md # ... write some documents ... ### Building Markdoc comes with a default set of templates and stylesheets, so you can build your wiki right away. Just run `markdoc build`, and all the HTML will be generated and output into the `.html/` sub-directory (known as the HTML root). :::bash $ markdoc build ### Serving You can view all the HTML in a browser easily by running the built-in server. `markdoc serve` accepts a large number of options, but on its own will serve your documentation on port 8008. :::bash $ markdoc serve markdoc.serve: INFO: Serving on http://127.0.0.1:8008 Now just open <http://localhost:8008/> in your browser, and see your new Markdoc-powered wiki!
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# Rendering This page will describe the process which documents undergo on their way from Markdoc to XHTML. ## Step 1: Markdown Rendering Each page is converted from Markdown to XHTML. This uses the Markdown library for Python, which comes with a number of extensions that you can enable in your [configuration](/configuration). For example, I like to use the `codehilite`, `def_list` and `headerid` Markdown extensions, but by default Markdoc wikis will not use any. The Markdown conversion results in XHTML data which is not tied to a page, so it’s not enough to display to a browser. That’s where the templating comes in. ## Step 2: Template Rendering Markdoc uses [Jinja2][] to render this partial XHTML to full XHTML documents. Jinja2 is a fast and flexible templating system for Python; if you are interested in writing your own templates, it would be wise to first consult its official documentation. [jinja2]: http://jinja2.pocoo.org Markdoc expects only two templates to be defined: `document.html` and `listing.html`. The way it finds these is as follows: * It first looks for them in the `.templates/` directory inside your wiki. * If the `use-default-templates` setting is `true` for your configuration (which it is by default), then search in the `default-templates` directory bundled with Markdoc. If `use-default-templates` is `false` and the templates are not defined in your wiki’s template directory, Markdoc will eventually raise an error. ### Documents `document.html` is used to convert the partial XHTML for a Markdown document into full, browser-ready XHTML. It receives a context much like the following: :::python { "content": "<h1>...", # The XHTML for the document. "title": "Some Document", # The extracted title of the document. "crumbs": [("index", "/"), ("some-document", None)] # Breadcrumbs } The `config` variable is also (globally) set to the configuration dictionary for the current wiki. Take a look inside the `src/markdoc/static/default-templates/markdoc-default/` directory for examples of complete templates. ### Listings `listing.html` is used to generate listings for directories. This will only be used if `generate-listing` is set to either `always` or `sometimes` in the configuration (by default it is `always`). Listings are a little more complex to do, so they are generated after the complete set of documents have been rendered and synced (along with static media) to the HTML root. This means you get complete listings for all of your directories, including those which came from static media. The `listing.html` template is passed a context like this: :::python {"directory": "somedir", "crumbs": [("index", "/"), ("somedir", "/somedir/"), (jinja2.Markup('<span class="list-crumb">list</span>'), None)], "files": [{"basename": "example.css", "href": "/example.css", "humansize": "27B", "size": 27, "slug": "example"}], "pages": [{"basename": "hello.html", "href": "/subdir/hello", "humansize": "268B", "size": 268, "slug": "hello", "title": u"Hello again."}], "sub_directories": [{"basename": "subdir", "href": "/subdir/"}]} The distinction between *files* and *pages* is useful because you can display links to pages with their full titles; if you’re viewing this now in a browser, just head to [/_list](/_list) to see what I mean. The filename which the list is output to can be configured with the `listing-filename` setting; this defaults to `_list.html` (hence `/_list`). You can also try `/media/_list`, et cetera. The last crumb is special in that it displays the string `"list"` but with a class of `list-crumb`; in the default templates and media this is displayed in a light grey to indicate that it is a special page. The semantics of listing generation are determined by the `generate-listing` setting; `always` will always generate a listing (even if it clobbers an existing file called `_list.html`), `sometimes` will only generate a listing when there is no `index.html` file for a directory, and `never` will never generate listings. ## Relative Links For portability, all URLs pointing to files and pages within the current Markdoc wiki should be relative. This allows built wiki HTML to be hosted under a sub-directory and still maintain link integrity. In practice, this is achieved in two parts: * A Markdown extension which causes absolute path URLs in links (such as `/path/to/somefile`) to be converted to relative ones (like `../somefile`). * A callable passed to every template context which, when called with an absolute path URL, will convert it to a relative one. This variable is `make_relative()`, and an example of its use can be seen in this snippet from the default base template: :::text <head> <!--...snip...--> {% import "macros/html" as html -%} {{ html.cssimport(make_relative("/media/css/reset.css")) }} {{ html.cssimport(make_relative("/media/css/layout.css")) }} {{ html.cssimport(make_relative("/media/css/typography.css")) }} {{ html.cssimport(make_relative("/media/css/pygments.css")) }} </head> If you override the default templates, make sure to use this callable to relativize the media URLs and breadcrumb links.
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# Development Markdoc is actively developed via [GitHub][gh-markdoc]. [gh-markdoc]: http://github.com/zacharyvoase/markdoc ## Working with the Repository You’ll need to install [Git][git] first; check your OS’s package manager for a `git` or `git-core` package. [git]: http://git-scm.com/ You can check out a copy of the repository by cloning it: :::bash $ git clone git://github.com/zacharyvoase/markdoc.git $ cd markdoc/ ### Repo Structure There are several files and directories in the root of the repo: :::text markdoc/ |-- doc/ |-- src/ |-- test/ |-- UNLICENSE |-- MANIFEST.in |-- README |-- REQUIREMENTS |-- distribute_setup.py |-- nose.cfg `-- setup.py `doc/` : A Markdoc wiki containing Markdoc’s own documentation. How very meta. `src/` : The home of all of Markdoc’s Python code. `test/`, `nose.cfg` : Markdoc’s tests (Python + Doctests) and nose configuration. [Nose][] is a Python utility to automate and simplify running complex test suites. `UNLICENSE` : The text of the unlicense which designates Markdoc as public domain software. `MANIFEST.in`, `setup.py`, `distribute_setup.py` : The necessary Python packaging machinery, so you can run `easy_install Markdoc`. `README` : Doesn’t need an explanation. `REQUIREMENTS` : A text file listing all of Markdoc’s requirements, suitable for use with `pip install -r REQUIREMENTS`. [pip][] is a next-generation `easy_install` replacement for Python. [pip]: http://pip.openplans.org/ [nose]: http://somethingaboutorange.com/mrl/projects/nose/0.11.1/ ### Bug Reporting and Feature Requests All bugs and feature requests are handled on the [GitHub issues page](http://github.com/zacharyvoase/markdoc/issues). ### Contributing If you’re interested in implementing a feature or extension for Markdoc, just fork the GitHub repository, work on the feature, commit your changes, then send me a pull request. If I like what you’ve done, I’ll pull your changes into the official Markdoc release and give you author credit. Remember that you must be willing to release your changes to the public domain. If you are submitting a non-trivial patch, take a look at [unlicense.org][unlicensing contributions] for detailed instructions; for now, you just need to agree to the following statement: [unlicensing contributions]: http://unlicense.org/#unlicensing-contributions :::text I dedicate any and all copyright interest in this software to the public domain. I make this dedication for the benefit of the public at large and to the detriment of my heirs and successors. I intend this dedication to be an overt act of relinquishment in perpetuity of all present and future rights to this software under copyright law.
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# Markdown Syntax Guide Adapted from <http://daringfireball.net/projects/markdown/syntax>. [TOC] * * * ## Overview ### Philosophy Markdown is intended to be as easy-to-read and easy-to-write as is feasible. Readability, however, is emphasized above all else. A Markdown-formatted document should be publishable as-is, as plain text, without looking like it's been marked up with tags or formatting instructions. While Markdown's syntax has been influenced by several existing text-to-HTML filters -- including [Setext] [1], [atx] [2], [Textile] [3], [reStructuredText] [4], [Grutatext] [5], and [EtText] [6] -- the single biggest source of inspiration for Markdown's syntax is the format of plain text email. [1]: http://docutils.sourceforge.net/mirror/setext.html [2]: http://www.aaronsw.com/2002/atx/ [3]: http://textism.com/tools/textile/ [4]: http://docutils.sourceforge.net/rst.html [5]: http://www.triptico.com/software/grutatxt.html [6]: http://ettext.taint.org/doc/ To this end, Markdown's syntax is comprised entirely of punctuation characters, which punctuation characters have been carefully chosen so as to look like what they mean. E.g., asterisks around a word actually look like \*emphasis\*. Markdown lists look like, well, lists. Even blockquotes look like quoted passages of text, assuming you've ever used email. ### Inline HTML Markdown's syntax is intended for one purpose: to be used as a format for *writing* for the web. Markdown is not a replacement for HTML, or even close to it. Its syntax is very small, corresponding only to a very small subset of HTML tags. The idea is *not* to create a syntax that makes it easier to insert HTML tags. In my opinion, HTML tags are already easy to insert. The idea for Markdown is to make it easy to read, write, and edit prose. HTML is a *publishing* format; Markdown is a *writing* format. Thus, Markdown's formatting syntax only addresses issues that can be conveyed in plain text. For any markup that is not covered by Markdown's syntax, you simply use HTML itself. There's no need to preface it or delimit it to indicate that you're switching from Markdown to HTML; you just use the tags. The only restrictions are that block-level HTML elements -- e.g. `<div>`, `<table>`, `<pre>`, `<p>`, etc. -- must be separated from surrounding content by blank lines, and the start and end tags of the block should not be indented with tabs or spaces. Markdown is smart enough not to add extra (unwanted) `<p>` tags around HTML block-level tags. For example, to add an HTML table to a Markdown article: :::text This is a regular paragraph. <table> <tr> <td>Foo</td> </tr> </table> This is another regular paragraph. Note that Markdown formatting syntax is not processed within block-level HTML tags. E.g., you can't use Markdown-style `*emphasis*` inside an HTML block. Span-level HTML tags -- e.g. `<span>`, `<cite>`, or `<del>` -- can be used anywhere in a Markdown paragraph, list item, or header. If you want, you can even use HTML tags instead of Markdown formatting; e.g. if you'd prefer to use HTML `<a>` or `<img>` tags instead of Markdown's link or image syntax, go right ahead. Unlike block-level HTML tags, Markdown syntax *is* processed within span-level tags. ### Automatic Escaping for Special Characters In HTML, there are two characters that demand special treatment: `<` and `&`. Left angle brackets are used to start tags; ampersands are used to denote HTML entities. If you want to use them as literal characters, you must escape them as entities, e.g. `&lt;`, and `&amp;`. Ampersands in particular are bedeviling for web writers. If you want to write about 'AT&T', you need to write '`AT&amp;T`'. You even need to escape ampersands within URLs. Thus, if you want to link to: :::text http://images.google.com/images?num=30&q=larry+bird you need to encode the URL as: :::text http://images.google.com/images?num=30&amp;q=larry+bird in your anchor tag `href` attribute. Needless to say, this is easy to forget, and is probably the single most common source of HTML validation errors in otherwise well-marked-up web sites. Markdown allows you to use these characters naturally, taking care of all the necessary escaping for you. If you use an ampersand as part of an HTML entity, it remains unchanged; otherwise it will be translated into `&amp;`. So, if you want to include a copyright symbol in your article, you can write: :::text &copy; and Markdown will leave it alone. But if you write: :::text AT&T Markdown will translate it to: :::text AT&amp;T Similarly, because Markdown supports [inline HTML](#inline-html), if you use angle brackets as delimiters for HTML tags, Markdown will treat them as such. But if you write: :::text 4 < 5 Markdown will translate it to: :::text 4 &lt; 5 However, inside Markdown code spans and blocks, angle brackets and ampersands are *always* encoded automatically. This makes it easy to use Markdown to write about HTML code. (As opposed to raw HTML, which is a terrible format for writing about HTML syntax, because every single `<` and `&` in your example code needs to be escaped.) * * * ## Block Elements ### Paragraphs and Line Breaks A paragraph is simply one or more consecutive lines of text, separated by one or more blank lines. (A blank line is any line that looks like a blank line -- a line containing nothing but spaces or tabs is considered blank.) Normal paragraphs should not be indented with spaces or tabs. The implication of the "one or more consecutive lines of text" rule is that Markdown supports "hard-wrapped" text paragraphs. This differs significantly from most other text-to-HTML formatters (including Movable Type's "Convert Line Breaks" option) which translate every line break character in a paragraph into a `<br />` tag. When you *do* want to insert a `<br />` break tag using Markdown, you end a line with two or more spaces, then type return. Yes, this takes a tad more effort to create a `<br />`, but a simplistic "every line break is a `<br />`" rule wouldn't work for Markdown. Markdown's email-style [blockquoting][bq] and multi-paragraph [list items][l] work best -- and look better -- when you format them with hard breaks. [bq]: #blockquote [l]: #list ### Headers Markdown supports two styles of headers, [Setext] [1] and [atx] [2]. Setext-style headers are "underlined" using equal signs (for first-level headers) and dashes (for second-level headers). For example: :::text This is an H1 ============= This is an H2 ------------- Any number of underlining `=`'s or `-`'s will work. Atx-style headers use 1-6 hash characters at the start of the line, corresponding to header levels 1-6. For example: :::text # This is an H1 ## This is an H2 ###### This is an H6 Optionally, you may "close" atx-style headers. This is purely cosmetic -- you can use this if you think it looks better. The closing hashes don't even need to match the number of hashes used to open the header. (The number of opening hashes determines the header level.) : :::text # This is an H1 # ## This is an H2 ## ### This is an H3 ###### ### Blockquotes Markdown uses email-style `>` characters for blockquoting. If you're familiar with quoting passages of text in an email message, then you know how to create a blockquote in Markdown. It looks best if you hard wrap the text and put a `>` before every line: :::text > This is a blockquote with two paragraphs. Lorem ipsum dolor sit amet, > consectetuer adipiscing elit. Aliquam hendrerit mi posuere lectus. > Vestibulum enim wisi, viverra nec, fringilla in, laoreet vitae, risus. > > Donec sit amet nisl. Aliquam semper ipsum sit amet velit. Suspendisse > id sem consectetuer libero luctus adipiscing. Markdown allows you to be lazy and only put the `>` before the first line of a hard-wrapped paragraph: :::text > This is a blockquote with two paragraphs. Lorem ipsum dolor sit amet, consectetuer adipiscing elit. Aliquam hendrerit mi posuere lectus. Vestibulum enim wisi, viverra nec, fringilla in, laoreet vitae, risus. > Donec sit amet nisl. Aliquam semper ipsum sit amet velit. Suspendisse id sem consectetuer libero luctus adipiscing. Blockquotes can be nested (i.e. a blockquote-in-a-blockquote) by adding additional levels of `>`: :::text > This is the first level of quoting. > > > This is nested blockquote. > > Back to the first level. Blockquotes can contain other Markdown elements, including headers, lists, and code blocks: :::text > ## This is a header. > > 1. This is the first list item. > 2. This is the second list item. > > Here's some example code: > > return shell_exec("echo $input | $markdown_script"); Any decent text editor should make email-style quoting easy. For example, with BBEdit, you can make a selection and choose Increase Quote Level from the Text menu. ### Lists Markdown supports ordered (numbered) and unordered (bulleted) lists. Unordered lists use asterisks, pluses, and hyphens -- interchangably -- as list markers: :::text * Red * Green * Blue is equivalent to: :::text + Red + Green + Blue and: :::text - Red - Green - Blue Ordered lists use numbers followed by periods: :::text 1. Bird 2. McHale 3. Parish It's important to note that the actual numbers you use to mark the list have no effect on the HTML output Markdown produces. The HTML Markdown produces from the above list is: :::text <ol> <li>Bird</li> <li>McHale</li> <li>Parish</li> </ol> If you instead wrote the list in Markdown like this: :::text 1. Bird 1. McHale 1. Parish or even: :::text 3. Bird 1. McHale 8. Parish you'd get the exact same HTML output. The point is, if you want to, you can use ordinal numbers in your ordered Markdown lists, so that the numbers in your source match the numbers in your published HTML. But if you want to be lazy, you don't have to. If you do use lazy list numbering, however, you should still start the list with the number 1. At some point in the future, Markdown may support starting ordered lists at an arbitrary number. List markers typically start at the left margin, but may be indented by up to three spaces. List markers must be followed by one or more spaces or a tab. To make lists look nice, you can wrap items with hanging indents: :::text * Lorem ipsum dolor sit amet, consectetuer adipiscing elit. Aliquam hendrerit mi posuere lectus. Vestibulum enim wisi, viverra nec, fringilla in, laoreet vitae, risus. * Donec sit amet nisl. Aliquam semper ipsum sit amet velit. Suspendisse id sem consectetuer libero luctus adipiscing. But if you want to be lazy, you don't have to: :::text * Lorem ipsum dolor sit amet, consectetuer adipiscing elit. Aliquam hendrerit mi posuere lectus. Vestibulum enim wisi, viverra nec, fringilla in, laoreet vitae, risus. * Donec sit amet nisl. Aliquam semper ipsum sit amet velit. Suspendisse id sem consectetuer libero luctus adipiscing. If list items are separated by blank lines, Markdown will wrap the items in `<p>` tags in the HTML output. For example, this input: :::text * Bird * Magic will turn into: :::html <ul> <li>Bird</li> <li>Magic</li> </ul> But this: :::text * Bird * Magic will turn into: :::html <ul> <li><p>Bird</p></li> <li><p>Magic</p></li> </ul> List items may consist of multiple paragraphs. Each subsequent paragraph in a list item must be indented by either 4 spaces or one tab: :::text 1. This is a list item with two paragraphs. Lorem ipsum dolor sit amet, consectetuer adipiscing elit. Aliquam hendrerit mi posuere lectus. Vestibulum enim wisi, viverra nec, fringilla in, laoreet vitae, risus. Donec sit amet nisl. Aliquam semper ipsum sit amet velit. 2. Suspendisse id sem consectetuer libero luctus adipiscing. It looks nice if you indent every line of the subsequent paragraphs, but here again, Markdown will allow you to be lazy: :::text * This is a list item with two paragraphs. This is the second paragraph in the list item. You're only required to indent the first line. Lorem ipsum dolor sit amet, consectetuer adipiscing elit. * Another item in the same list. To put a blockquote within a list item, the blockquote's `>` delimiters need to be indented: :::text * A list item with a blockquote: > This is a blockquote > inside a list item. To put a code block within a list item, the code block needs to be indented *twice* -- 8 spaces or two tabs: :::text * A list item with a code block: <code goes here> It's worth noting that it's possible to trigger an ordered list by accident, by writing something like this: :::text 1986. What a great season. In other words, a *number-period-space* sequence at the beginning of a line. To avoid this, you can backslash-escape the period: :::text 1986\. What a great season. ### Code Blocks Pre-formatted code blocks are used for writing about programming or markup source code. Rather than forming normal paragraphs, the lines of a code block are interpreted literally. Markdown wraps a code block in both `<pre>` and `<code>` tags. To produce a code block in Markdown, simply indent every line of the block by at least 4 spaces or 1 tab. For example, given this input: :::text This is a normal paragraph: This is a code block. Markdown will generate: :::html <p>This is a normal paragraph:</p> <pre><code>This is a code block. </code></pre> One level of indentation -- 4 spaces or 1 tab -- is removed from each line of the code block. For example, this: :::text Here is an example of AppleScript: tell application "Foo" beep end tell will turn into: :::html <p>Here is an example of AppleScript:</p> <pre><code>tell application "Foo" beep end tell </code></pre> A code block continues until it reaches a line that is not indented (or the end of the article). Within a code block, ampersands (`&`) and angle brackets (`<` and `>`) are automatically converted into HTML entities. This makes it very easy to include example HTML source code using Markdown -- just paste it and indent it, and Markdown will handle the hassle of encoding the ampersands and angle brackets. For example, this: :::text <div class="footer"> &copy; 2004 Foo Corporation </div> will turn into: :::html <pre><code>&lt;div class="footer"&gt; &amp;copy; 2004 Foo Corporation &lt;/div&gt; </code></pre> Regular Markdown syntax is not processed within code blocks. E.g., asterisks are just literal asterisks within a code block. This means it's also easy to use Markdown to write about Markdown's own syntax. ### Horizontal Rules You can produce a horizontal rule tag (`<hr />`) by placing three or more hyphens, asterisks, or underscores on a line by themselves. If you wish, you may use spaces between the hyphens or asterisks. Each of the following lines will produce a horizontal rule: :::text * * * *** ***** - - - --------------------------------------- * * * ## Span Elements ### Links Markdown supports two style of links: *inline* and *reference*. In both styles, the link text is delimited by [square brackets]. To create an inline link, use a set of regular parentheses immediately after the link text's closing square bracket. Inside the parentheses, put the URL where you want the link to point, along with an *optional* title for the link, surrounded in quotes. For example: :::text This is [an example](http://example.com/ "Title") inline link. [This link](http://example.net/) has no title attribute. Will produce: :::html <p>This is <a href="http://example.com/" title="Title"> an example</a> inline link.</p> <p><a href="http://example.net/">This link</a> has no title attribute.</p> If you're referring to a local resource on the same server, you can use relative paths: :::text See my [About](/about/) page for details. Reference-style links use a second set of square brackets, inside which you place a label of your choosing to identify the link: :::text This is [an example][id] reference-style link. You can optionally use a space to separate the sets of brackets: :::text This is [an example] [id] reference-style link. Then, anywhere in the document, you define your link label like this, on a line by itself: :::text [id]: http://example.com/ "Optional Title Here" That is: * Square brackets containing the link identifier (optionally indented from the left margin using up to three spaces); * followed by a colon; * followed by one or more spaces (or tabs); * followed by the URL for the link; * optionally followed by a title attribute for the link, enclosed in double or single quotes, or enclosed in parentheses. The following three link definitions are equivalent: :::text [foo]: http://example.com/ "Optional Title Here" [foo]: http://example.com/ 'Optional Title Here' [foo]: http://example.com/ (Optional Title Here) The link URL may, optionally, be surrounded by angle brackets: :::text [id]: <http://example.com/> "Optional Title Here" You can put the title attribute on the next line and use extra spaces or tabs for padding, which tends to look better with longer URLs: :::text [id]: http://example.com/longish/path/to/resource/here "Optional Title Here" Link definitions are only used for creating links during Markdown processing, and are stripped from your document in the HTML output. Link definition names may consist of letters, numbers, spaces, and punctuation -- but they are *not* case sensitive. E.g. these two links: :::text [link text][a] [link text][A] are equivalent. The *implicit link name* shortcut allows you to omit the name of the link, in which case the link text itself is used as the name. Just use an empty set of square brackets -- e.g., to link the word "Google" to the google.com web site, you could simply write: :::text [Google][] And then define the link: :::text [Google]: http://google.com/ Because link names may contain spaces, this shortcut even works for multiple words in the link text: :::text Visit [Daring Fireball][] for more information. And then define the link: :::text [Daring Fireball]: http://daringfireball.net/ Link definitions can be placed anywhere in your Markdown document. I tend to put them immediately after each paragraph in which they're used, but if you want, you can put them all at the end of your document, sort of like footnotes. Here's an example of reference links in action: :::text I get 10 times more traffic from [Google] [1] than from [Yahoo] [2] or [MSN] [3]. [1]: http://google.com/ "Google" [2]: http://search.yahoo.com/ "Yahoo Search" [3]: http://search.msn.com/ "MSN Search" Using the implicit link name shortcut, you could instead write: :::text I get 10 times more traffic from [Google][] than from [Yahoo][] or [MSN][]. [google]: http://google.com/ "Google" [yahoo]: http://search.yahoo.com/ "Yahoo Search" [msn]: http://search.msn.com/ "MSN Search" Both of the above examples will produce the following HTML output: :::html <p>I get 10 times more traffic from <a href="http://google.com/" title="Google">Google</a> than from <a href="http://search.yahoo.com/" title="Yahoo Search">Yahoo</a> or <a href="http://search.msn.com/" title="MSN Search">MSN</a>.</p> For comparison, here is the same paragraph written using Markdown's inline link style: :::text I get 10 times more traffic from [Google](http://google.com/ "Google") than from [Yahoo](http://search.yahoo.com/ "Yahoo Search") or [MSN](http://search.msn.com/ "MSN Search"). The point of reference-style links is not that they're easier to write. The point is that with reference-style links, your document source is vastly more readable. Compare the above examples: using reference-style links, the paragraph itself is only 81 characters long; with inline-style links, it's 176 characters; and as raw HTML, it's 234 characters. In the raw HTML, there's more markup than there is text. With Markdown's reference-style links, a source document much more closely resembles the final output, as rendered in a browser. By allowing you to move the markup-related metadata out of the paragraph, you can add links without interrupting the narrative flow of your prose. ### Emphasis Markdown treats asterisks (`*`) and underscores (`_`) as indicators of emphasis. Text wrapped with one `*` or `_` will be wrapped with an HTML `<em>` tag; double `*`'s or `_`'s will be wrapped with an HTML `<strong>` tag. E.g., this input: :::text *single asterisks* _single underscores_ **double asterisks** __double underscores__ will produce: :::html <em>single asterisks</em> <em>single underscores</em> <strong>double asterisks</strong> <strong>double underscores</strong> You can use whichever style you prefer; the lone restriction is that the same character must be used to open and close an emphasis span. Emphasis can be used in the middle of a word: :::text un*frigging*believable But if you surround an `*` or `_` with spaces, it'll be treated as a literal asterisk or underscore. To produce a literal asterisk or underscore at a position where it would otherwise be used as an emphasis delimiter, you can backslash escape it: :::text \*this text is surrounded by literal asterisks\* ### Code To indicate a span of code, wrap it with backtick quotes (`` ` ``). Unlike a pre-formatted code block, a code span indicates code within a normal paragraph. For example: :::text Use the `printf()` function. will produce: :::html <p>Use the <code>printf()</code> function.</p> To include a literal backtick character within a code span, you can use multiple backticks as the opening and closing delimiters: :::text ``There is a literal backtick (`) here.`` which will produce this: :::html <p><code>There is a literal backtick (`) here.</code></p> The backtick delimiters surrounding a code span may include spaces -- one after the opening, one before the closing. This allows you to place literal backtick characters at the beginning or end of a code span: :::text A single backtick in a code span: `` ` `` A backtick-delimited string in a code span: `` `foo` `` will produce: :::html <p>A single backtick in a code span: <code>`</code></p> <p>A backtick-delimited string in a code span: <code>`foo`</code></p> With a code span, ampersands and angle brackets are encoded as HTML entities automatically, which makes it easy to include example HTML tags. Markdown will turn this: :::text Please don't use any `<blink>` tags. into: :::html <p>Please don't use any <code>&lt;blink&gt;</code> tags.</p> You can write this: :::text `&#8212;` is the decimal-encoded equivalent of `&mdash;`. to produce: :::html <p><code>&amp;#8212;</code> is the decimal-encoded equivalent of <code>&amp;mdash;</code>.</p> ### Images Admittedly, it's fairly difficult to devise a "natural" syntax for placing images into a plain text document format. Markdown uses an image syntax that is intended to resemble the syntax for links, allowing for two styles: *inline* and *reference*. Inline image syntax looks like this: :::text ![Alt text](/path/to/img.jpg) ![Alt text](/path/to/img.jpg "Optional title") That is: * An exclamation mark: `!`; * followed by a set of square brackets, containing the `alt` attribute text for the image; * followed by a set of parentheses, containing the URL or path to the image, and an optional `title` attribute enclosed in double or single quotes. Reference-style image syntax looks like this: :::text ![Alt text][id] Where "id" is the name of a defined image reference. Image references are defined using syntax identical to link references: :::text [id]: url/to/image "Optional title attribute" As of this writing, Markdown has no syntax for specifying the dimensions of an image; if this is important to you, you can simply use regular HTML `<img>` tags. * * * ## Miscellaneous ### Automatic Links Markdown supports a shortcut style for creating "automatic" links for URLs and email addresses: simply surround the URL or email address with angle brackets. What this means is that if you want to show the actual text of a URL or email address, and also have it be a clickable link, you can do this: :::text <http://example.com/> Markdown will turn this into: :::html <a href="http://example.com/">http://example.com/</a> Automatic links for email addresses work similarly, except that Markdown will also perform a bit of randomized decimal and hex entity-encoding to help obscure your address from address-harvesting spambots. For example, Markdown will turn this: :::text <[email protected]> into something like this: :::html <a href="&#x6D;&#x61;i&#x6C;&#x74;&#x6F;:&#x61;&#x64;&#x64;&#x72;&#x65; &#115;&#115;&#64;&#101;&#120;&#x61;&#109;&#x70;&#x6C;e&#x2E;&#99;&#111; &#109;">&#x61;&#x64;&#x64;&#x72;&#x65;&#115;&#115;&#64;&#101;&#120;&#x61; &#109;&#x70;&#x6C;e&#x2E;&#99;&#111;&#109;</a> which will render in a browser as a clickable link to "[email protected]". (This sort of entity-encoding trick will indeed fool many, if not most, address-harvesting bots, but it definitely won't fool all of them. It's better than nothing, but an address published in this way will probably eventually start receiving spam.) ### Backslash Escapes Markdown allows you to use backslash escapes to generate literal characters which would otherwise have special meaning in Markdown's formatting syntax. For example, if you wanted to surround a word with literal asterisks (instead of an HTML `<em>` tag), you can use backslashes before the asterisks, like this: :::text \*literal asterisks\* Markdown provides backslash escapes for the following characters: :::text \ backslash ` backtick * asterisk _ underscore {} curly braces [] square brackets () parentheses # hash mark + plus sign - minus sign (hyphen) . dot ! exclamation mark
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# Configuration All Markdoc wikis are configured via a single `markdoc.yaml` file in the wiki root. This file is formatted with YAML (Yet Another Markup Language); you can find more information on that at [yaml.org](http://yaml.org/). When running the command-line interface, Markdoc will search for either a `markdoc.yaml` or a `.markdoc.yaml` file in the current directory. You can also explicitly specify a file to use with the `-c`/`--config` command-line option. ## Example Here we’ll go through an example and show how the various settings affect Markdoc’s behavior: #!yaml # Metadata wiki-name: "My Wiki" google-analytics: UA-XXXXXX-X # Directories hide-prefix: "." wiki-dir: "wiki" static-dir: "static" html-dir: ".html" template-dir: ".templates" temp-dir: ".tmp" cvs-exclude: true # Building document-extensions: [.md, .mdown, .markdown, .wiki, .text] generate-listing: always listing-filename: "_list.html" use-default-static: true use-default-templates: true # Rendering markdown: safe-mode: false output-format: xhtml1 extensions: [codehilite, def_list] extension-configs: codehilite: force_linenos: true # Serving server: bind: '127.0.0.1' port: 8010 num-threads: 10 name: 'server.example.com' request-queue-size: 5 timeout: 10 Remember that Markdoc uses sensible defaults for *all* of these options, so it’s perfectly OK to have an empty markdoc.yaml file. You still need one though. * [Metadata](#metadata) * [Directories](#directories) * [Building](#building) * [Rendering](#rendering) * [Serving](#serving) ### Metadata This is information about your wiki itself. It is currently only used when rendering the default set of templates, but custom templates may also use these parameters. `wiki-name` (no default) : Specify the human-friendly name of your wiki. If defined, this will appear in the title and footer in the default Markdoc templates. `google-analytics` (no default) : Specify a [Google Analytics][] tracking key for your Markdoc site. If given, the GA tracking code will be included in every HTML document. Note that this should be the full key, in the format `UA-XXXXXX-X`. [google analytics]: http://google.com/analytics/ ### Directories These settings affect where Markdoc looks for some pieces of data, and where it puts others. You can get more information on the roles of various directories in the [layout documentation](/layout). Note that all `*-dir` parameters are resolved relative to the wiki root, and that `'.'` (i.e. the wiki root itself) is an acceptable value. `hide-prefix` (default `.`) : This determines how Markdoc finds and writes to hidden directories like `.tmp`, `.templates` and `.html`. You may wish to set this to `'_'` if your VCS or operating system doesn’t play nicely with period-prefixed filenames. If you specify `html-dir`, `temp-dir` and `template-dir`, this setting won’t have any effect. `wiki-dir` (default `"wiki"`) : This tells Markdoc where to find pages that should be rendered with Markdown and output as HTML. Only files in this directory will be rendered. `static-dir` (default `"static"`) : Any files in the static directory are synced over to the HTML root as-is when building. This tells Markdoc where to find all the static media for your wiki. `html-dir` (default `hide-prefix + "html"`) : This is where HTML and static media are eventually output during the building process. It is also the document root for the Markdoc server. The default value is auto-generated using the `hide-prefix` setting. `template-dir` (default `hide-prefix + "templates"`) : Markdoc will look in this directory first when searching for the Jinja2 templates needed to produce HTML. `temp-dir` (default `hide-prefix + "tmp"`) : This directory is used as a temporary destination when building HTML. `cvs-exclude` (default `true`) : If this is `true`, Markdoc will pass the `--cvs-exclude` option to `rsync` when syncing static media and rendered HTML files. This causes `rsync` to skip some common backup/hidden files (e.g. `.git/`, `.svn/`, `*~` and `#*`). The full semantics of this option are specified in the [`rsync` documentation][rsync-docs]. [rsync-docs]: http://www.samba.org/ftp/rsync/rsync.html ### Building These settings affect Markdoc’s behavior during the build process. `document-extensions` (default `[.md, .mdown, .markdown, .wiki, .text]`) : Markdoc will only render files from the document root which have one of these extensions. If one of the extensions is an empty string (`''`), then all files (including those without an extension) will be considered pages. Setting this parameter to the empty list (`[]`) will behave as if it is actually `['']`. `generate-listing` (default `always`) : This affects how listings are generated for directories in your Markdoc wiki (including the top level). Set this to either `always`, `sometimes` or `never`. The semantics are as follows: * `never` never generates any listings. * `sometimes` only generates a listing when there is no `index` or `index.html` file in a directory. This listing is saved as both `index.html` and the value of the `listing-filename` setting. * `always` generates a listing for every directory, and saves it under the value of the `listing-filename` setting, and as `index.html` if an index file does not already exist. `listing-filename` (default `_list.html`) : This specifies the filename that directory listings are saved under; see the documentation for `generate-listing` just above for more information. `use-default-static` (default `true`) : If true, Markdoc’s default set of static media will be synchronized to the HTML root when building. `use-default-templates` (default `true`) : If true, Jinja2 will look in Markdoc’s set of default templates when rendering documents and listings. ### Rendering These settings determine how Markdoc converts Markdown text into XHTML. They are all defined as sub-parameters inside the `markdown` dictionary. These parameters correspond to keyword arguments to the `markdown.Markdown` constructor, although hyphens (`-`) are all converted to underscores (`_`) in the key strings. `extensions` (default `[]`) : A list of strings specifying extensions to be used by the Markdown renderer. The [Markdown library for Python][markdown-python-lib] comes with the following by default: * `abbr` * `codehilite` * `def_list` * `extra` * `fenced_code` * `footnotes` * `headerid` * `html_tidy` * `imagelinks` * `meta` * `rss` * `tables` * `toc` * `wikilinks` [markdown-python-lib]: http://www.freewisdom.org/projects/python-markdown `extension-configs` (default `{}`) : These are configuration parameters for the extensions — you’ll need to consult the official Markdown library documentation for more information. `safe-mode` (default `false`) : Disallow raw HTML in Markdown documents. This can be either `false`, `remove`, `replace` or `escape`. `output-format` (default `xhtml1`) : Switch between rendering XHTML or HTML. Can be either `xhtml1`, `xhtml`, `html4` or `html` (the general ones will always refer to the latest version). It is strongly suggested that you use XHTML. ### Serving All of the server configuration parameters exist in the `server` dictionary (as with `markdown` previously). `bind` (default `127.0.0.1`) : Bind to the specified interface. With the default value the server will only listen on the loopback interface (localhost). `port` (default `8008`) : Listen on the specified port. `num-threads` (default `10`) : Use this number of threads to handle requests. `name` (default is autodetected) : Specify a server name. The default will be automatically detected from the socket the server binds to. `request-queue-size` (default `5`) : Sets the number of queued connections to the server before it will start dropping TCP connections (the `backlog` argument to `socket.listen()`). `timeout` (default `10`) : The socket timeout (in seconds) for accepted TCP connections.
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# Layout Markdoc wikis have the following layout: :::text WIKI_ROOT/ |-- .html/ |-- .templates/ |-- .tmp/ |-- static/ |-- wiki/ `-- markdoc.yaml The `.html/` and `.tmp/` directories should be excluded from any VCS, since they contain temporary files. Here is a list of the roles of the various files and sub-directories, in descending order of significance: `WIKI_ROOT/` : The *wiki root*, containing all of the files required for the `markdoc` utility to build and serve the wiki. `WIKI_ROOT/markdoc.yaml` : The *wiki configuration*; the main configuration point for your wiki, in a YAML-formatted file. Consult the [configuration docs](/configuration) for more information on how to write this. `WIKI_ROOT/wiki/` : The *document root*, which contains the actual *text* of your wiki in Markdown-formatted text files. It is assumed they are UTF-8 encoded. Any files without a valid extension will be ignored (see the option `document-extensions` in [configuration](/configuration)). `WIKI_ROOT/static/` : The *static directory*: static media files (such as CSS and JavaScript) should be put here. They will be copied to `.html/` by rsync during the build operation. This comes with some default CSS for styling. `WIKI_ROOT/.templates/` : The *template directory*: it contains the Jinja2 templates for documents, error pages and directory listings. It comes with some nice defaults, but you can override these if you wish. `WIKI_ROOT/.html/` : The *HTML root* (sometimes abbreviated as ‘htroot’). It holds the compiled HTML and static files. It is directly served from by the Markdoc webserver. `WIKI_ROOT/.tmp/` : The *temporary directory*: a temporary build destination for rendered Markdown files. This directory is then rsync’d to the HTML root along with the static directory; the incremental nature of this operation means the Markdoc web server can keep running in one process whilst another runs `markdoc build`. Note that all of the default locations for these directories can be overridden in the `markdoc.yaml` file. For example, you may wish to use `WIKI_ROOT/pages/` instead of `WIKI_ROOT/wiki/`, or `WIKI_ROOT/.build/` instead of `WIKI_ROOT/.html/`. Consult the [configuration documentation](/configuration) for more information.
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# Barebones Wikis Out of the box, Markdoc supports relatively complex wikis with custom templates and static files. However, for many cases, the default media and templates are adequate, so why should a vanilla wiki require nesting like the following: :::text some-wiki/ |-- .templates/ |-- static/ |-- wiki/ | |-- files | |-- go | `-- here `-- markdoc.yaml Fortunately, for very simple cases where you just want to be able to render and serve a collection of Markdown-formatted files, you can do so. Begin by just creating and entering an empty directory: :::bash $ mkdir mywiki/ $ cd mywiki/ Now create a file called `.markdoc.yaml` containing the following YAML data: :::yaml wiki-name: My Wiki # Set this to whatever you want wiki-dir: "." static-dir: ".static" You can add some more configuration parameters if you like, but these are the basic ones you’ll need. So now your directory structure will look like this: :::text mywiki/ `-- .markdoc.yaml And you can just start creating pages in the directory. :::text mywiki/ |-- .markdoc.yaml |-- page1.md |-- page2.md `-- page3.md To run the build process, just do the usual: :::bash $ markdoc build && markdoc serve `markdoc` recognizes both `markdoc.yaml` *and* `.markdoc.yaml` implicitly. Because you’ve hidden everything except the actual wiki pages, to most file browsers (including `ls`) the wiki will just look like a directory with a number of text files.
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# Syntax Highlighting with Pygments [Markdown for Python][] supports syntax highlighting in your documents using [Pygments][]. Here’s how to set up and use it from Markdoc. [markdown for python]: http://www.freewisdom.org/projects/python-markdown [pygments]: http://pygments.org/ First, install the extension in your `markdoc.yaml` file: :::yaml wiki-name: My Wiki ## ...other settings... markdown: extensions: - codehilite # the important bit Pygments should have been installed as a dependency when you installed Markdoc. Initially, syntax highlighting will be applied to every code block Markdown encounters. Pygments will guess which lexer to apply to each block. To specify the language of a block, add a `:::LANG` prefix to blocks of code. For example: :::text :::python def hello(): print "Hello, World!" Will render to: :::python def hello(): print "Hello, World!" To switch syntax highlighting off for a block, use `:::text`. If you want a block to have line numbers, use `#!LANG` instead. For example: :::text #!ruby class Foo def bar @baz end end Will render to: #!ruby class Foo def bar @baz end end If you add a shebang to a code block, like `#!/bin/bash` or `#!/usr/bin/env python`, the language will be guessed and the shebang included in the output. In the final text. So for example, the following: :::text #!/bin/bash echo "Hello, World" Will render to: #!/bin/bash echo "Hello, World"
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# Serving Markdoc Builds With Apache By default, you should just serve your HTML root out of Apache; that will work very simply. You will need a few options to your `.htaccess` file get the same semantics as the built-in web server (the one which runs when you do `markdoc serve`): #!text Options +MultiViews <FilesMatch "\.html$"> ForceType 'application/xhtml+xml; charset=UTF-8' </FilesMatch> The first directive will cause requests for `/directory/filename` to look for `directory/filename.html` in your HTML root, allowing for more natural references between pages in your wiki. The second part will cause `.html` files to be served as valid UTF-8-encoded XHTML, which Markdoc assumes they are.
{ "repo_name": "zacharyvoase/markdoc", "stars": "347", "repo_language": "Python", "file_name": "apache.md", "mime_type": "text/plain" }
# AdelaiDepth [![Open In Colab](https://colab.research.google.com/assets/colab-badge.svg)](https://colab.research.google.com/drive/1rDLZBtiUgsFJrrL-xOgTVWxj6PMK9swq?usp=sharing) AdelaiDepth is an open source toolbox for monocular depth prediction. Relevant work from our group is open-sourced here. AdelaiDepth contains the following algorithms: * Boosting Depth: [Code](https://github.com/guangkaixu/BoostingDepth), [Towards 3D Scene Reconstruction from Locally Scale-Aligned Monocular Video Depth (Boosting Monocular Depth Estimation with Sparse Guided Points)](https://arxiv.org/abs/2202.01470) * 3D Scene Shape (Best Paper Finalist): [Code](https://github.com/aim-uofa/AdelaiDepth/tree/main/LeReS), [Learning to Recover 3D Scene Shape from a Single Image](https://arxiv.org/abs/2012.09365) * DiverseDepth: [Code](https://github.com/YvanYin/DiverseDepth), [Virtual Normal: Enforcing Geometric Constraints for Accurate and Robust Depth Prediction](https://arxiv.org/abs/2103.04216), [DiverseDepth: Affine-invariant Depth Prediction Using Diverse Data](https://arxiv.org/abs/2002.00569) * Virtual Normal: [Code](https://github.com/YvanYin/VNL_Monocular_Depth_Prediction), [Enforcing geometric constraints of virtual normal for depth prediction](https://arxiv.org/abs/1907.12209) * Depth Estimation Using Deep Convolutional Neural Fields: [Code](https://bitbucket.org/fayao/dcnf-fcsp/src/master/), [Learning Depth from Single Monocular Images Using Deep Convolutional Neural Fields, TPAMI'16, CVPR'15](https://arxiv.org/abs/1502.07411) ## News: * [May. 31, 2022] Code for local recovery strategy of BoostingDepth is released. * [May. 31, 2022] Training code and data of LeReS project have been released. * [Feb. 13, 2022] Training code and data of DiverseDepth project have been released. * [Jun. 13, 2021] Our "Learning to Recover 3D Scene Shape from a Single Image" work is one of the CVPR'21 Best Paper Finalists. * [Jun. 6, 2021] We have made the training data of DiverseDepth available. ## Results and Dataset Examples: 1. 3D Scene Shape You may want to check [this video](http://www.youtube.com/watch?v=UuT5_GK_TWk) which provides a very brief introduction to the work: <table> <tr> <td>RGB</td> <td>Depth</td> <td>Point Cloud</td> </tr> <tr> <td><img src="examples/2-rgb.jpg" height=300></td> <td><img src="examples/2.jpg" height=300></td> <td><img src="examples/2.gif" height=300></td> </tr> </table> ![Depth](./examples/depth.png) 2. DiverseDepth * Results examples: ![Depth](./examples/diverse_depth.jpg) * DiverseDepth dataset examples: ![DiverseDepth dataset](./examples/diversedepth_dataset_examples.png) ## BibTeX ```BibTeX @article{yin2022towards, title={Towards Accurate Reconstruction of 3D Scene Shape from A Single Monocular Image}, author={Yin, Wei and Zhang, Jianming and Wang, Oliver and Niklaus, Simon and Chen, Simon and Liu, Yifan and Shen, Chunhua}, journal={IEEE Transactions on Pattern Analysis and Machine Intelligence (TPAMI)}, year={2022} } @inproceedings{Yin2019enforcing, title = {Enforcing geometric constraints of virtual normal for depth prediction}, author = {Yin, Wei and Liu, Yifan and Shen, Chunhua and Yan, Youliang}, booktitle = {The IEEE International Conference on Computer Vision (ICCV)}, year = {2019} } @inproceedings{Wei2021CVPR, title = {Learning to Recover 3D Scene Shape from a Single Image}, author = {Wei Yin and Jianming Zhang and Oliver Wang and Simon Niklaus and Long Mai and Simon Chen and Chunhua Shen}, booktitle = {Proc. IEEE Conf. Comp. Vis. Patt. Recogn. (CVPR)}, year = {2021} } @article{yin2021virtual, title = {Virtual Normal: Enforcing Geometric Constraints for Accurate and Robust Depth Prediction}, author = {Yin, Wei and Liu, Yifan and Shen, Chunhua}, journal = {IEEE Transactions on Pattern Analysis and Machine Intelligence (TPAMI)}, year = {2021} } ``` ### Contact * Wei Yin <https://yvanyin.net/> * Chunhua Shen <https://cshen.github.io> ## License The *3D Scene Shape* code is under a non-commercial license from *Adobe Research*. See the [LICENSE file](LeReS/LICENSE) for details. Other depth prediction projects are licensed under the 2-clause BSD License for non-commercial use -- see the [LICENSE file](LICENSE) for details. For commercial use, please contact [Chunhua Shen](https://cshen.github.io).
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
# We defaulty put all data in the Train/datasets. You can put them anywhere but create softlinks under Train/datasets. # We provide two way to download data. 1) Cloudstor; 2) Google Drive # 1. Download from CloudStor: # download part-fore cd Train/datasets mkdir DiverseDepth cd DiverseDepth wget https://cloudstor.aarnet.edu.au/plus/s/HNfpS4tAz3NePtU/download -O DiverseDepth_d.tar.gz wget https://cloudstor.aarnet.edu.au/plus/s/n5bOhKk52fXILp9/download -O DiverseDepth_rgb.zip tar -xvf DiverseDepth_d.tar.gz unzip DiverseDepth_rgb.zip # download part_in, collected from taskonomy cd .. mkdir taskonomy cd taskonomy # (original link) wget https://cloudstor.aarnet.edu.au/plus/s/Q4jqXt2YfqcGZvK/download -O annotations.zip wget --no-check-certificate "https://drive.google.com/uc?export=download&id=1Nhz0BABZBjjE-ITbJoSyVSuaJkD-iWVv" -O annotations.zip wget https://cloudstor.aarnet.edu.au/plus/s/EBv6jRp326zMlf6/download -O taskonomy_rgbs.tar.gz wget https://cloudstor.aarnet.edu.au/plus/s/t334giSOJtC97Uq/download -O taskonomy_ins_planes.tar.gz wget https://cloudstor.aarnet.edu.au/plus/s/kvLcrVSWfOsERsI/download -O taskonomy_depths.tar.gz tar -xvf ./*.tar.gz unzip annotations.zip # HRWSI cd .. mkdir HRWSI cd HRWSI wget https://cloudstor.aarnet.edu.au/plus/s/oaWj2Cfvif3WuD0/download -O HRWSI.zip unzip HRWSI.zip # Holopix50k cd .. mkdir Holopix50k cd Holopix50k wget https://cloudstor.aarnet.edu.au/plus/s/LuOsawtGq6cDAKr/download -O Holopix50k.zip unzip Holopix50k.zip # The overview of data under Train/datasets are: # -Train # |--datasets # |--DiverseDepth # |--annotations # |--depths # |--rgbs # |--taskonomy # |--annotations # |--depths # |--rgbs # |--ins_planes # |--HRWSI # |--Holopix50k
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
matplotlib opencv-python plyfile pyyaml dill tensorboardX
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
# Best Paper Finalist: [Learning to Recover 3D Scene Shape from a Single Image](https://arxiv.org/abs/2012.09365) This repository contains the source code of the paper: Wei Yin, Jianming Zhang, Oliver Wang, Simon Niklaus, Long Mai, Simon Chen, Chunhua Shen [Learning to Recover 3D Scene Shape from a Single Image](https://arxiv.org/abs/2012.09365). Published in Proc. IEEE Conf. Computer Vision and Pattern Recognition (CVPR) 2021. [NEW] Training codes have been released!! ## Some Results <table> <tr> <td><img src="../examples/1.gif" width=400 height=300></td> <td><img src="../examples/2.gif" width=400 height=300></td> <td><img src="../examples/3.gif" width=400 height=300></td> </tr> </table> You may want to check [this video](http://www.youtube.com/watch?v=UuT5_GK_TWk) which provides a very brief introduction to the work: ## Prerequisite ```bash conda create -n LeReS python=3.7 conda activate LeReS conda install pytorch==1.6.0 torchvision==0.7.0 cudatoolkit=10.2 -c pytorch pip install -r requirements.txt ``` If you only want to test the monocular depth estimation from a single image, you can directly go to 'Quick Start' and follow Step 3. If you want to reconstruct 3D shape from a single image, please install [torchsparse](https://github.com/mit-han-lab/torchsparse) packages as follows. If you have any issues with torchsparse, please refer to [torchsparse](https://github.com/mit-han-lab/torchsparse). ```bash #torchsparse currently only supports PyTorch 1.6.0 + CUDA 10.2 + CUDNN 7.6.2. sudo apt-get install libsparsehash-dev pip install --upgrade git+https://github.com/mit-han-lab/[email protected] ``` ## Quick Start (Inference) 1. Download the model weights * [ResNet50 backbone](https://cloudstor.aarnet.edu.au/plus/s/VVQayrMKPlpVkw9) * [ResNeXt101 backbone](https://cloudstor.aarnet.edu.au/plus/s/lTIJF4vrvHCAI31) 2. Prepare data. * Move the downloaded weights to `LeReS/Minist_Test/` * Put the testing RGB images to `LeReS/Minist_Test/test_images/`. Predicted depths and reconstructed point cloud are saved under `LeReS/Minist_Test/test_images/outputs` 3. Test monocular depth prediction. Note that the predicted depths are affine-invariant. ```bash export PYTHONPATH="<PATH to Minist_Test>" # run the ResNet-50 python ./tools/test_depth.py --load_ckpt res50.pth --backbone resnet50 # run the ResNeXt-101 python ./tools/test_depth.py --load_ckpt res101.pth --backbone resnext101 ``` 4. Test 3D reconstruction from a single image. ```bash export PYTHONPATH="<PATH to Minist_Test>" # run the ResNet-50 python ./tools/test_shape.py --load_ckpt res50.pth --backbone resnet50 # run the ResNeXt-101 python ./tools/test_shape.py --load_ckpt res101.pth --backbone resnext101 ``` ## Training 1. (Optional) Run a demo training to verify the python environment. ``` cd Train/scripts sh train_demo.sh ``` 2. Download the training data. Please run 'download_data.sh' to achieve datasets of taskonomy, DiverseDepth, HWRSI and Holopix50k. All data are organized under the `Train/datasets`. The structure of all data are as follows. ``` |--Train | |--data | |--lib | |--scripts | |--tools | |--datasets | | |--DiverseDepth | | | |--annotations | | | |--depths | | | |--rgbs | | |--taskonomy | | | |--annotations | | | |--depths | | | |--rgbs | | | |--ins_planes | | |--HRWSI | | |--Holopix50k ``` 3. Train the network. The default setting used 4 gpus. If you want to use more gpus, please set `$CUDA_VISIBLE_DEVICES`, such as `export CUDA_VISIBLE_DEVICES=0,1,2,3,4,5,6,7`. The `--batchsize` is the number of samples on a single gpu. ``` cd Train/scripts sh train.sh ``` 4. Test the network on a benchmark. We provide a sample code for testing on NYU. Please download the NYU testing data [test.mat](https://cloudstor.aarnet.edu.au/plus/s/G2ckXCJX3pvrzRU) for evaluation and move it to `Train/datasets/test.mat`. If you want to test on other benchmarks, you can follow the sample code. ``` cd Train/scripts sh test.sh ``` ## BibTeX ```BibTeX @article{yin2022towards, title={Towards Accurate Reconstruction of 3D Scene Shape from A Single Monocular Image}, author={Yin, Wei and Zhang, Jianming and Wang, Oliver and Niklaus, Simon and Chen, Simon and Liu, Yifan and Shen, Chunhua}, journal={TPAMI}, year={2022} } @inproceedings{Wei2021CVPR, title = {Learning to Recover 3D Scene Shape from a Single Image}, author = {Wei Yin and Jianming Zhang and Oliver Wang and Simon Niklaus and Long Mai and Simon Chen and Chunhua Shen}, booktitle = {Proc. IEEE Conf. Comp. Vis. Patt. Recogn. (CVPR)}, year = {2021} } ``` ## License This project is under a non-commercial license from Adobe Research. See the [LICENSE file](LICENSE) for details.
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
import importlib import torch import os from collections import OrderedDict def get_func(func_name): """Helper to return a function object by name. func_name must identify a function in this module or the path to a function relative to the base 'modeling' module. """ if func_name == '': return None try: parts = func_name.split('.') # Refers to a function in this module if len(parts) == 1: return globals()[parts[0]] # Otherwise, assume we're referencing a module under modeling module_name = 'lib.' + '.'.join(parts[:-1]) module = importlib.import_module(module_name) return getattr(module, parts[-1]) except Exception: print('Failed to f1ind function: %s', func_name) raise def load_ckpt(args, depth_model, shift_model, focal_model): """ Load checkpoint. """ if os.path.isfile(args.load_ckpt): print("loading checkpoint %s" % args.load_ckpt) checkpoint = torch.load(args.load_ckpt) if shift_model is not None: shift_model.load_state_dict(strip_prefix_if_present(checkpoint['shift_model'], 'module.'), strict=True) if focal_model is not None: focal_model.load_state_dict(strip_prefix_if_present(checkpoint['focal_model'], 'module.'), strict=True) depth_model.load_state_dict(strip_prefix_if_present(checkpoint['depth_model'], "module."), strict=True) del checkpoint torch.cuda.empty_cache() def strip_prefix_if_present(state_dict, prefix): keys = sorted(state_dict.keys()) if not all(key.startswith(prefix) for key in keys): return state_dict stripped_state_dict = OrderedDict() for key, value in state_dict.items(): stripped_state_dict[key.replace(prefix, "")] = value return stripped_state_dict
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
import torch.nn as nn import torchsparse.nn as spnn from torchsparse.point_tensor import PointTensor from lib.spvcnn_utils import * __all__ = ['SPVCNN_CLASSIFICATION'] class BasicConvolutionBlock(nn.Module): def __init__(self, inc, outc, ks=3, stride=1, dilation=1): super().__init__() self.net = nn.Sequential( spnn.Conv3d(inc, outc, kernel_size=ks, dilation=dilation, stride=stride), spnn.BatchNorm(outc), spnn.ReLU(True)) def forward(self, x): out = self.net(x) return out class BasicDeconvolutionBlock(nn.Module): def __init__(self, inc, outc, ks=3, stride=1): super().__init__() self.net = nn.Sequential( spnn.Conv3d(inc, outc, kernel_size=ks, stride=stride, transpose=True), spnn.BatchNorm(outc), spnn.ReLU(True)) def forward(self, x): return self.net(x) class ResidualBlock(nn.Module): def __init__(self, inc, outc, ks=3, stride=1, dilation=1): super().__init__() self.net = nn.Sequential( spnn.Conv3d(inc, outc, kernel_size=ks, dilation=dilation, stride=stride), spnn.BatchNorm(outc), spnn.ReLU(True), spnn.Conv3d(outc, outc, kernel_size=ks, dilation=dilation, stride=1), spnn.BatchNorm(outc) ) self.downsample = nn.Sequential() if (inc == outc and stride == 1) else \ nn.Sequential( spnn.Conv3d(inc, outc, kernel_size=1, dilation=1, stride=stride), spnn.BatchNorm(outc) ) self.relu = spnn.ReLU(True) def forward(self, x): out = self.relu(self.net(x) + self.downsample(x)) return out class SPVCNN_CLASSIFICATION(nn.Module): def __init__(self, **kwargs): super().__init__() cr = kwargs.get('cr', 1.0) cs = [32, 32, 64, 128, 256, 256, 128, 96, 96] cs = [int(cr * x) for x in cs] if 'pres' in kwargs and 'vres' in kwargs: self.pres = kwargs['pres'] self.vres = kwargs['vres'] self.stem = nn.Sequential( spnn.Conv3d(kwargs['input_channel'], cs[0], kernel_size=3, stride=1), spnn.BatchNorm(cs[0]), spnn.ReLU(True), spnn.Conv3d(cs[0], cs[0], kernel_size=3, stride=1), spnn.BatchNorm(cs[0]), spnn.ReLU(True)) self.stage1 = nn.Sequential( BasicConvolutionBlock(cs[0], cs[0], ks=2, stride=2, dilation=1), ResidualBlock(cs[0], cs[1], ks=3, stride=1, dilation=1), ResidualBlock(cs[1], cs[1], ks=3, stride=1, dilation=1), ) self.stage2 = nn.Sequential( BasicConvolutionBlock(cs[1], cs[1], ks=2, stride=2, dilation=1), ResidualBlock(cs[1], cs[2], ks=3, stride=1, dilation=1), ResidualBlock(cs[2], cs[2], ks=3, stride=1, dilation=1), ) self.stage3 = nn.Sequential( BasicConvolutionBlock(cs[2], cs[2], ks=2, stride=2, dilation=1), ResidualBlock(cs[2], cs[3], ks=3, stride=1, dilation=1), ResidualBlock(cs[3], cs[3], ks=3, stride=1, dilation=1), ) self.stage4 = nn.Sequential( BasicConvolutionBlock(cs[3], cs[3], ks=2, stride=2, dilation=1), ResidualBlock(cs[3], cs[4], ks=3, stride=1, dilation=1), ResidualBlock(cs[4], cs[4], ks=3, stride=1, dilation=1), ) self.avg_pool = spnn.GlobalAveragePooling() self.classifier = nn.Sequential(nn.Linear(cs[4], kwargs['num_classes'])) self.point_transforms = nn.ModuleList([ nn.Sequential( nn.Linear(cs[0], cs[4]), nn.BatchNorm1d(cs[4]), nn.ReLU(True), ), ]) self.weight_initialization() self.dropout = nn.Dropout(0.3, True) def weight_initialization(self): for m in self.modules(): if isinstance(m, nn.BatchNorm1d): nn.init.constant_(m.weight, 1) nn.init.constant_(m.bias, 0) def forward(self, x): # x: SparseTensor z: PointTensor z = PointTensor(x.F, x.C.float()) x0 = initial_voxelize(z, self.pres, self.vres) x0 = self.stem(x0) z0 = voxel_to_point(x0, z, nearest=False) z0.F = z0.F x1 = point_to_voxel(x0, z0) x1 = self.stage1(x1) x2 = self.stage2(x1) x3 = self.stage3(x2) x4 = self.stage4(x3) z1 = voxel_to_point(x4, z0) z1.F = z1.F + self.point_transforms[0](z0.F) y1 = point_to_voxel(x4, z1) pool = self.avg_pool(y1) out = self.classifier(pool) return out
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
import os import numpy as np import torch from torchsparse import SparseTensor from torchsparse.utils import sparse_collate_fn, sparse_quantize from plyfile import PlyData, PlyElement def init_image_coor(height, width, u0=None, v0=None): u0 = width / 2.0 if u0 is None else u0 v0 = height / 2.0 if v0 is None else v0 x_row = np.arange(0, width) x = np.tile(x_row, (height, 1)) x = x.astype(np.float32) u_u0 = x - u0 y_col = np.arange(0, height) y = np.tile(y_col, (width, 1)).T y = y.astype(np.float32) v_v0 = y - v0 return u_u0, v_v0 def depth_to_pcd(depth, u_u0, v_v0, f, invalid_value=0): mask_invalid = depth <= invalid_value depth[mask_invalid] = 0.0 x = u_u0 / f * depth y = v_v0 / f * depth z = depth pcd = np.stack([x, y, z], axis=2) return pcd, ~mask_invalid def pcd_to_sparsetensor(pcd, mask_valid, voxel_size=0.01, num_points=100000): pcd_valid = pcd[mask_valid] block_ = pcd_valid block = np.zeros_like(block_) block[:, :3] = block_[:, :3] pc_ = np.round(block_[:, :3] / voxel_size) pc_ -= pc_.min(0, keepdims=1) feat_ = block # transfer point cloud to voxels inds = sparse_quantize(pc_, feat_, return_index=True, return_invs=False) if len(inds) > num_points: inds = np.random.choice(inds, num_points, replace=False) pc = pc_[inds] feat = feat_[inds] lidar = SparseTensor(feat, pc) feed_dict = [{'lidar': lidar}] inputs = sparse_collate_fn(feed_dict) return inputs def pcd_uv_to_sparsetensor(pcd, u_u0, v_v0, mask_valid, f= 500.0, voxel_size=0.01, mask_side=None, num_points=100000): if mask_side is not None: mask_valid = mask_valid & mask_side pcd_valid = pcd[mask_valid] u_u0_valid = u_u0[mask_valid][:, np.newaxis] / f v_v0_valid = v_v0[mask_valid][:, np.newaxis] / f block_ = np.concatenate([pcd_valid, u_u0_valid, v_v0_valid], axis=1) block = np.zeros_like(block_) block[:, :] = block_[:, :] pc_ = np.round(block_[:, :3] / voxel_size) pc_ -= pc_.min(0, keepdims=1) feat_ = block # transfer point cloud to voxels inds = sparse_quantize(pc_, feat_, return_index=True, return_invs=False) if len(inds) > num_points: inds = np.random.choice(inds, num_points, replace=False) pc = pc_[inds] feat = feat_[inds] lidar = SparseTensor(feat, pc) feed_dict = [{'lidar': lidar}] inputs = sparse_collate_fn(feed_dict) return inputs def refine_focal_one_step(depth, focal, model, u0, v0): # reconstruct PCD from depth u_u0, v_v0 = init_image_coor(depth.shape[0], depth.shape[1], u0=u0, v0=v0) pcd, mask_valid = depth_to_pcd(depth, u_u0, v_v0, f=focal, invalid_value=0) # input for the voxelnet feed_dict = pcd_uv_to_sparsetensor(pcd, u_u0, v_v0, mask_valid, f=focal, voxel_size=0.005, mask_side=None) inputs = feed_dict['lidar'].cuda() outputs = model(inputs) return outputs def refine_shift_one_step(depth_wshift, model, focal, u0, v0): # reconstruct PCD from depth u_u0, v_v0 = init_image_coor(depth_wshift.shape[0], depth_wshift.shape[1], u0=u0, v0=v0) pcd_wshift, mask_valid = depth_to_pcd(depth_wshift, u_u0, v_v0, f=focal, invalid_value=0) # input for the voxelnet feed_dict = pcd_to_sparsetensor(pcd_wshift, mask_valid, voxel_size=0.01) inputs = feed_dict['lidar'].cuda() outputs = model(inputs) return outputs def refine_focal(depth, focal, model, u0, v0): last_scale = 1 focal_tmp = np.copy(focal) for i in range(1): scale = refine_focal_one_step(depth, focal_tmp, model, u0, v0) focal_tmp = focal_tmp / scale.item() last_scale = last_scale * scale return torch.tensor([[last_scale]]) def refine_shift(depth_wshift, model, focal, u0, v0): depth_wshift_tmp = np.copy(depth_wshift) last_shift = 0 for i in range(1): shift = refine_shift_one_step(depth_wshift_tmp, model, focal, u0, v0) shift = shift if shift.item() < 0.7 else torch.tensor([[0.7]]) depth_wshift_tmp -= shift.item() last_shift += shift.item() return torch.tensor([[last_shift]]) def reconstruct_3D(depth, f): """ Reconstruct depth to 3D pointcloud with the provided focal length. Return: pcd: N X 3 array, point cloud """ cu = depth.shape[1] / 2 cv = depth.shape[0] / 2 width = depth.shape[1] height = depth.shape[0] row = np.arange(0, width, 1) u = np.array([row for i in np.arange(height)]) col = np.arange(0, height, 1) v = np.array([col for i in np.arange(width)]) v = v.transpose(1, 0) if f > 1e5: print('Infinit focal length!!!') x = u - cu y = v - cv z = depth / depth.max() * x.max() else: x = (u - cu) * depth / f y = (v - cv) * depth / f z = depth x = np.reshape(x, (width * height, 1)).astype(np.float) y = np.reshape(y, (width * height, 1)).astype(np.float) z = np.reshape(z, (width * height, 1)).astype(np.float) pcd = np.concatenate((x, y, z), axis=1) pcd = pcd.astype(np.int) return pcd def save_point_cloud(pcd, rgb, filename, binary=True): """Save an RGB point cloud as a PLY file. :paras @pcd: Nx3 matrix, the XYZ coordinates @rgb: NX3 matrix, the rgb colors for each 3D point """ assert pcd.shape[0] == rgb.shape[0] if rgb is None: gray_concat = np.tile(np.array([128], dtype=np.uint8), (pcd.shape[0], 3)) points_3d = np.hstack((pcd, gray_concat)) else: points_3d = np.hstack((pcd, rgb)) python_types = (float, float, float, int, int, int) npy_types = [('x', 'f4'), ('y', 'f4'), ('z', 'f4'), ('red', 'u1'), ('green', 'u1'), ('blue', 'u1')] if binary is True: # Format into NumPy structured array vertices = [] for row_idx in range(points_3d.shape[0]): cur_point = points_3d[row_idx] vertices.append(tuple(dtype(point) for dtype, point in zip(python_types, cur_point))) vertices_array = np.array(vertices, dtype=npy_types) el = PlyElement.describe(vertices_array, 'vertex') # Write PlyData([el]).write(filename) else: x = np.squeeze(points_3d[:, 0]) y = np.squeeze(points_3d[:, 1]) z = np.squeeze(points_3d[:, 2]) r = np.squeeze(points_3d[:, 3]) g = np.squeeze(points_3d[:, 4]) b = np.squeeze(points_3d[:, 5]) ply_head = 'ply\n' \ 'format ascii 1.0\n' \ 'element vertex %d\n' \ 'property float x\n' \ 'property float y\n' \ 'property float z\n' \ 'property uchar red\n' \ 'property uchar green\n' \ 'property uchar blue\n' \ 'end_header' % r.shape[0] # ---- Save ply data to disk np.savetxt(filename, np.column_stack((x, y, z, r, g, b)), fmt="%d %d %d %d %d %d", header=ply_head, comments='') def reconstruct_depth(depth, rgb, dir, pcd_name, focal): """ para disp: disparity, [h, w] para rgb: rgb image, [h, w, 3], in rgb format """ rgb = np.squeeze(rgb) depth = np.squeeze(depth) mask = depth < 1e-8 depth[mask] = 0 depth = depth / depth.max() * 10000 pcd = reconstruct_3D(depth, f=focal) rgb_n = np.reshape(rgb, (-1, 3)) save_point_cloud(pcd, rgb_n, os.path.join(dir, pcd_name + '.ply')) def recover_metric_depth(pred, gt): if type(pred).__module__ == torch.__name__: pred = pred.cpu().numpy() if type(gt).__module__ == torch.__name__: gt = gt.cpu().numpy() gt = gt.squeeze() pred = pred.squeeze() mask = (gt > 1e-8) & (pred > 1e-8) gt_mask = gt[mask] pred_mask = pred[mask] a, b = np.polyfit(pred_mask, gt_mask, deg=1) pred_metric = a * pred + b return pred_metric
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
import torch import torch.nn as nn from lib import network_auxi as network from lib.net_tools import get_func class RelDepthModel(nn.Module): def __init__(self, backbone='resnet50'): super(RelDepthModel, self).__init__() if backbone == 'resnet50': encoder = 'resnet50_stride32' elif backbone == 'resnext101': encoder = 'resnext101_stride32x8d' self.depth_model = DepthModel(encoder) def inference(self, rgb): with torch.no_grad(): input = rgb.cuda() depth = self.depth_model(input) pred_depth_out = depth - depth.min() + 0.01 return pred_depth_out class DepthModel(nn.Module): def __init__(self, encoder): super(DepthModel, self).__init__() backbone = network.__name__.split('.')[-1] + '.' + encoder self.encoder_modules = get_func(backbone)() self.decoder_modules = network.Decoder() def forward(self, x): lateral_out = self.encoder_modules(x) out_logit = self.decoder_modules(lateral_out) return out_logit
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
#!/usr/bin/env python # coding: utf-8 import torch.nn as nn try: from urllib import urlretrieve except ImportError: from urllib.request import urlretrieve __all__ = ['resnext101_32x8d'] model_urls = { 'resnext50_32x4d': 'https://download.pytorch.org/models/resnext50_32x4d-7cdf4587.pth', 'resnext101_32x8d': 'https://download.pytorch.org/models/resnext101_32x8d-8ba56ff5.pth', } def conv3x3(in_planes, out_planes, stride=1, groups=1, dilation=1): """3x3 convolution with padding""" return nn.Conv2d(in_planes, out_planes, kernel_size=3, stride=stride, padding=dilation, groups=groups, bias=False, dilation=dilation) def conv1x1(in_planes, out_planes, stride=1): """1x1 convolution""" return nn.Conv2d(in_planes, out_planes, kernel_size=1, stride=stride, bias=False) class BasicBlock(nn.Module): expansion = 1 def __init__(self, inplanes, planes, stride=1, downsample=None, groups=1, base_width=64, dilation=1, norm_layer=None): super(BasicBlock, self).__init__() if norm_layer is None: norm_layer = nn.BatchNorm2d if groups != 1 or base_width != 64: raise ValueError('BasicBlock only supports groups=1 and base_width=64') if dilation > 1: raise NotImplementedError("Dilation > 1 not supported in BasicBlock") # Both self.conv1 and self.downsample layers downsample the input when stride != 1 self.conv1 = conv3x3(inplanes, planes, stride) self.bn1 = norm_layer(planes) self.relu = nn.ReLU(inplace=True) self.conv2 = conv3x3(planes, planes) self.bn2 = norm_layer(planes) self.downsample = downsample self.stride = stride def forward(self, x): identity = x out = self.conv1(x) out = self.bn1(out) out = self.relu(out) out = self.conv2(out) out = self.bn2(out) if self.downsample is not None: identity = self.downsample(x) out += identity out = self.relu(out) return out class Bottleneck(nn.Module): # Bottleneck in torchvision places the stride for downsampling at 3x3 convolution(self.conv2) # while original implementation places the stride at the first 1x1 convolution(self.conv1) # according to "Deep residual learning for image recognition"https://arxiv.org/abs/1512.03385. # This variant is also known as ResNet V1.5 and improves accuracy according to # https://ngc.nvidia.com/catalog/model-scripts/nvidia:resnet_50_v1_5_for_pytorch. expansion = 4 def __init__(self, inplanes, planes, stride=1, downsample=None, groups=1, base_width=64, dilation=1, norm_layer=None): super(Bottleneck, self).__init__() if norm_layer is None: norm_layer = nn.BatchNorm2d width = int(planes * (base_width / 64.)) * groups # Both self.conv2 and self.downsample layers downsample the input when stride != 1 self.conv1 = conv1x1(inplanes, width) self.bn1 = norm_layer(width) self.conv2 = conv3x3(width, width, stride, groups, dilation) self.bn2 = norm_layer(width) self.conv3 = conv1x1(width, planes * self.expansion) self.bn3 = norm_layer(planes * self.expansion) self.relu = nn.ReLU(inplace=True) self.downsample = downsample self.stride = stride def forward(self, x): identity = x out = self.conv1(x) out = self.bn1(out) out = self.relu(out) out = self.conv2(out) out = self.bn2(out) out = self.relu(out) out = self.conv3(out) out = self.bn3(out) if self.downsample is not None: identity = self.downsample(x) out += identity out = self.relu(out) return out class ResNet(nn.Module): def __init__(self, block, layers, num_classes=1000, zero_init_residual=False, groups=1, width_per_group=64, replace_stride_with_dilation=None, norm_layer=None): super(ResNet, self).__init__() if norm_layer is None: norm_layer = nn.BatchNorm2d self._norm_layer = norm_layer self.inplanes = 64 self.dilation = 1 if replace_stride_with_dilation is None: # each element in the tuple indicates if we should replace # the 2x2 stride with a dilated convolution instead replace_stride_with_dilation = [False, False, False] if len(replace_stride_with_dilation) != 3: raise ValueError("replace_stride_with_dilation should be None " "or a 3-element tuple, got {}".format(replace_stride_with_dilation)) self.groups = groups self.base_width = width_per_group self.conv1 = nn.Conv2d(3, self.inplanes, kernel_size=7, stride=2, padding=3, bias=False) self.bn1 = norm_layer(self.inplanes) self.relu = nn.ReLU(inplace=True) self.maxpool = nn.MaxPool2d(kernel_size=3, stride=2, padding=1) self.layer1 = self._make_layer(block, 64, layers[0]) self.layer2 = self._make_layer(block, 128, layers[1], stride=2, dilate=replace_stride_with_dilation[0]) self.layer3 = self._make_layer(block, 256, layers[2], stride=2, dilate=replace_stride_with_dilation[1]) self.layer4 = self._make_layer(block, 512, layers[3], stride=2, dilate=replace_stride_with_dilation[2]) #self.avgpool = nn.AdaptiveAvgPool2d((1, 1)) #self.fc = nn.Linear(512 * block.expansion, num_classes) for m in self.modules(): if isinstance(m, nn.Conv2d): nn.init.kaiming_normal_(m.weight, mode='fan_out', nonlinearity='relu') elif isinstance(m, (nn.BatchNorm2d, nn.GroupNorm)): nn.init.constant_(m.weight, 1) nn.init.constant_(m.bias, 0) # Zero-initialize the last BN in each residual branch, # so that the residual branch starts with zeros, and each residual block behaves like an identity. # This improves the model by 0.2~0.3% according to https://arxiv.org/abs/1706.02677 if zero_init_residual: for m in self.modules(): if isinstance(m, Bottleneck): nn.init.constant_(m.bn3.weight, 0) elif isinstance(m, BasicBlock): nn.init.constant_(m.bn2.weight, 0) def _make_layer(self, block, planes, blocks, stride=1, dilate=False): norm_layer = self._norm_layer downsample = None previous_dilation = self.dilation if dilate: self.dilation *= stride stride = 1 if stride != 1 or self.inplanes != planes * block.expansion: downsample = nn.Sequential( conv1x1(self.inplanes, planes * block.expansion, stride), norm_layer(planes * block.expansion), ) layers = [] layers.append(block(self.inplanes, planes, stride, downsample, self.groups, self.base_width, previous_dilation, norm_layer)) self.inplanes = planes * block.expansion for _ in range(1, blocks): layers.append(block(self.inplanes, planes, groups=self.groups, base_width=self.base_width, dilation=self.dilation, norm_layer=norm_layer)) return nn.Sequential(*layers) def _forward_impl(self, x): # See note [TorchScript super()] features = [] x = self.conv1(x) x = self.bn1(x) x = self.relu(x) x = self.maxpool(x) x = self.layer1(x) features.append(x) x = self.layer2(x) features.append(x) x = self.layer3(x) features.append(x) x = self.layer4(x) features.append(x) #x = self.avgpool(x) #x = torch.flatten(x, 1) #x = self.fc(x) return features def forward(self, x): return self._forward_impl(x) def resnext101_32x8d(pretrained=True, **kwargs): """Constructs a ResNet-152 model. Args: pretrained (bool): If True, returns a model pre-trained on ImageNet """ kwargs['groups'] = 32 kwargs['width_per_group'] = 8 model = ResNet(Bottleneck, [3, 4, 23, 3], **kwargs) return model if __name__ == '__main__': import torch model = resnext101_32x8d(True).cuda() rgb = torch.rand((2, 3, 256, 256)).cuda() out = model(rgb) print(len(out))
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
import torch.nn as nn import torch.nn as NN __all__ = ['ResNet', 'resnet18', 'resnet34', 'resnet50', 'resnet101', 'resnet152'] model_urls = { 'resnet18': 'https://download.pytorch.org/models/resnet18-5c106cde.pth', 'resnet34': 'https://download.pytorch.org/models/resnet34-333f7ec4.pth', 'resnet50': 'https://download.pytorch.org/models/resnet50-19c8e357.pth', 'resnet101': 'https://download.pytorch.org/models/resnet101-5d3b4d8f.pth', 'resnet152': 'https://download.pytorch.org/models/resnet152-b121ed2d.pth', } def conv3x3(in_planes, out_planes, stride=1): """3x3 convolution with padding""" return nn.Conv2d(in_planes, out_planes, kernel_size=3, stride=stride, padding=1, bias=False) class BasicBlock(nn.Module): expansion = 1 def __init__(self, inplanes, planes, stride=1, downsample=None): super(BasicBlock, self).__init__() self.conv1 = conv3x3(inplanes, planes, stride) self.bn1 = NN.BatchNorm2d(planes) #NN.BatchNorm2d self.relu = nn.ReLU(inplace=True) self.conv2 = conv3x3(planes, planes) self.bn2 = NN.BatchNorm2d(planes) #NN.BatchNorm2d self.downsample = downsample self.stride = stride def forward(self, x): residual = x out = self.conv1(x) out = self.bn1(out) out = self.relu(out) out = self.conv2(out) out = self.bn2(out) if self.downsample is not None: residual = self.downsample(x) out += residual out = self.relu(out) return out class Bottleneck(nn.Module): expansion = 4 def __init__(self, inplanes, planes, stride=1, downsample=None): super(Bottleneck, self).__init__() self.conv1 = nn.Conv2d(inplanes, planes, kernel_size=1, bias=False) self.bn1 = NN.BatchNorm2d(planes) #NN.BatchNorm2d self.conv2 = nn.Conv2d(planes, planes, kernel_size=3, stride=stride, padding=1, bias=False) self.bn2 = NN.BatchNorm2d(planes) #NN.BatchNorm2d self.conv3 = nn.Conv2d(planes, planes * self.expansion, kernel_size=1, bias=False) self.bn3 = NN.BatchNorm2d(planes * self.expansion) #NN.BatchNorm2d self.relu = nn.ReLU(inplace=True) self.downsample = downsample self.stride = stride def forward(self, x): residual = x out = self.conv1(x) out = self.bn1(out) out = self.relu(out) out = self.conv2(out) out = self.bn2(out) out = self.relu(out) out = self.conv3(out) out = self.bn3(out) if self.downsample is not None: residual = self.downsample(x) out += residual out = self.relu(out) return out class ResNet(nn.Module): def __init__(self, block, layers, num_classes=1000): self.inplanes = 64 super(ResNet, self).__init__() self.conv1 = nn.Conv2d(3, 64, kernel_size=7, stride=2, padding=3, bias=False) self.bn1 = NN.BatchNorm2d(64) #NN.BatchNorm2d self.relu = nn.ReLU(inplace=True) self.maxpool = nn.MaxPool2d(kernel_size=3, stride=2, padding=1) self.layer1 = self._make_layer(block, 64, layers[0]) self.layer2 = self._make_layer(block, 128, layers[1], stride=2) self.layer3 = self._make_layer(block, 256, layers[2], stride=2) self.layer4 = self._make_layer(block, 512, layers[3], stride=2) #self.avgpool = nn.AvgPool2d(7, stride=1) #self.fc = nn.Linear(512 * block.expansion, num_classes) for m in self.modules(): if isinstance(m, nn.Conv2d): nn.init.kaiming_normal_(m.weight, mode='fan_out', nonlinearity='relu') elif isinstance(m, nn.BatchNorm2d): nn.init.constant_(m.weight, 1) nn.init.constant_(m.bias, 0) def _make_layer(self, block, planes, blocks, stride=1): downsample = None if stride != 1 or self.inplanes != planes * block.expansion: downsample = nn.Sequential( nn.Conv2d(self.inplanes, planes * block.expansion, kernel_size=1, stride=stride, bias=False), NN.BatchNorm2d(planes * block.expansion), #NN.BatchNorm2d ) layers = [] layers.append(block(self.inplanes, planes, stride, downsample)) self.inplanes = planes * block.expansion for i in range(1, blocks): layers.append(block(self.inplanes, planes)) return nn.Sequential(*layers) def forward(self, x): features = [] x = self.conv1(x) x = self.bn1(x) x = self.relu(x) x = self.maxpool(x) x = self.layer1(x) features.append(x) x = self.layer2(x) features.append(x) x = self.layer3(x) features.append(x) x = self.layer4(x) features.append(x) return features def resnet18(pretrained=True, **kwargs): """Constructs a ResNet-18 model. Args: pretrained (bool): If True, returns a model pre-trained on ImageNet """ model = ResNet(BasicBlock, [2, 2, 2, 2], **kwargs) return model def resnet34(pretrained=True, **kwargs): """Constructs a ResNet-34 model. Args: pretrained (bool): If True, returns a model pre-trained on ImageNet """ model = ResNet(BasicBlock, [3, 4, 6, 3], **kwargs) return model def resnet50(pretrained=True, **kwargs): """Constructs a ResNet-50 model. Args: pretrained (bool): If True, returns a model pre-trained on ImageNet """ model = ResNet(Bottleneck, [3, 4, 6, 3], **kwargs) return model def resnet101(pretrained=True, **kwargs): """Constructs a ResNet-101 model. Args: pretrained (bool): If True, returns a model pre-trained on ImageNet """ model = ResNet(Bottleneck, [3, 4, 23, 3], **kwargs) return model def resnet152(pretrained=True, **kwargs): """Constructs a ResNet-152 model. Args: pretrained (bool): If True, returns a model pre-trained on ImageNet """ model = ResNet(Bottleneck, [3, 8, 36, 3], **kwargs) return model
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
import torch import torch.nn as nn import torch.nn.init as init from lib import Resnet, Resnext_torch def resnet50_stride32(): return DepthNet(backbone='resnet', depth=50, upfactors=[2, 2, 2, 2]) def resnext101_stride32x8d(): return DepthNet(backbone='resnext101_32x8d', depth=101, upfactors=[2, 2, 2, 2]) class Decoder(nn.Module): def __init__(self): super(Decoder, self).__init__() self.inchannels = [256, 512, 1024, 2048] self.midchannels = [256, 256, 256, 512] self.upfactors = [2,2,2,2] self.outchannels = 1 self.conv = FTB(inchannels=self.inchannels[3], midchannels=self.midchannels[3]) self.conv1 = nn.Conv2d(in_channels=self.midchannels[3], out_channels=self.midchannels[2], kernel_size=3, padding=1, stride=1, bias=True) self.upsample = nn.Upsample(scale_factor=self.upfactors[3], mode='bilinear', align_corners=True) self.ffm2 = FFM(inchannels=self.inchannels[2], midchannels=self.midchannels[2], outchannels = self.midchannels[2], upfactor=self.upfactors[2]) self.ffm1 = FFM(inchannels=self.inchannels[1], midchannels=self.midchannels[1], outchannels = self.midchannels[1], upfactor=self.upfactors[1]) self.ffm0 = FFM(inchannels=self.inchannels[0], midchannels=self.midchannels[0], outchannels = self.midchannels[0], upfactor=self.upfactors[0]) self.outconv = AO(inchannels=self.midchannels[0], outchannels=self.outchannels, upfactor=2) self._init_params() def _init_params(self): for m in self.modules(): if isinstance(m, nn.Conv2d): init.normal_(m.weight, std=0.01) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.ConvTranspose2d): init.normal_(m.weight, std=0.01) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.BatchNorm2d): #NN.BatchNorm2d init.constant_(m.weight, 1) init.constant_(m.bias, 0) elif isinstance(m, nn.Linear): init.normal_(m.weight, std=0.01) if m.bias is not None: init.constant_(m.bias, 0) def forward(self, features): x_32x = self.conv(features[3]) # 1/32 x_32 = self.conv1(x_32x) x_16 = self.upsample(x_32) # 1/16 x_8 = self.ffm2(features[2], x_16) # 1/8 x_4 = self.ffm1(features[1], x_8) # 1/4 x_2 = self.ffm0(features[0], x_4) # 1/2 #----------------------------------------- x = self.outconv(x_2) # original size return x class DepthNet(nn.Module): __factory = { 18: Resnet.resnet18, 34: Resnet.resnet34, 50: Resnet.resnet50, 101: Resnet.resnet101, 152: Resnet.resnet152 } def __init__(self, backbone='resnet', depth=50, upfactors=[2, 2, 2, 2]): super(DepthNet, self).__init__() self.backbone = backbone self.depth = depth self.pretrained = False self.inchannels = [256, 512, 1024, 2048] self.midchannels = [256, 256, 256, 512] self.upfactors = upfactors self.outchannels = 1 # Build model if self.backbone == 'resnet': if self.depth not in DepthNet.__factory: raise KeyError("Unsupported depth:", self.depth) self.encoder = DepthNet.__factory[depth](pretrained=self.pretrained) elif self.backbone == 'resnext101_32x8d': self.encoder = Resnext_torch.resnext101_32x8d(pretrained=self.pretrained) else: self.encoder = Resnext_torch.resnext101(pretrained=self.pretrained) def forward(self, x): x = self.encoder(x) # 1/32, 1/16, 1/8, 1/4 return x class FTB(nn.Module): def __init__(self, inchannels, midchannels=512): super(FTB, self).__init__() self.in1 = inchannels self.mid = midchannels self.conv1 = nn.Conv2d(in_channels=self.in1, out_channels=self.mid, kernel_size=3, padding=1, stride=1, bias=True) # NN.BatchNorm2d self.conv_branch = nn.Sequential(nn.ReLU(inplace=True), \ nn.Conv2d(in_channels=self.mid, out_channels=self.mid, kernel_size=3, padding=1, stride=1, bias=True), \ nn.BatchNorm2d(num_features=self.mid), \ nn.ReLU(inplace=True), \ nn.Conv2d(in_channels=self.mid, out_channels=self.mid, kernel_size=3, padding=1, stride=1, bias=True)) self.relu = nn.ReLU(inplace=True) self.init_params() def forward(self, x): x = self.conv1(x) x = x + self.conv_branch(x) x = self.relu(x) return x def init_params(self): for m in self.modules(): if isinstance(m, nn.Conv2d): init.normal_(m.weight, std=0.01) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.ConvTranspose2d): # init.kaiming_normal_(m.weight, mode='fan_out') init.normal_(m.weight, std=0.01) # init.xavier_normal_(m.weight) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.BatchNorm2d): # NN.BatchNorm2d init.constant_(m.weight, 1) init.constant_(m.bias, 0) elif isinstance(m, nn.Linear): init.normal_(m.weight, std=0.01) if m.bias is not None: init.constant_(m.bias, 0) class ATA(nn.Module): def __init__(self, inchannels, reduction=8): super(ATA, self).__init__() self.inchannels = inchannels self.avg_pool = nn.AdaptiveAvgPool2d(1) self.fc = nn.Sequential(nn.Linear(self.inchannels * 2, self.inchannels // reduction), nn.ReLU(inplace=True), nn.Linear(self.inchannels // reduction, self.inchannels), nn.Sigmoid()) self.init_params() def forward(self, low_x, high_x): n, c, _, _ = low_x.size() x = torch.cat([low_x, high_x], 1) x = self.avg_pool(x) x = x.view(n, -1) x = self.fc(x).view(n, c, 1, 1) x = low_x * x + high_x return x def init_params(self): for m in self.modules(): if isinstance(m, nn.Conv2d): # init.kaiming_normal_(m.weight, mode='fan_out') # init.normal(m.weight, std=0.01) init.xavier_normal_(m.weight) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.ConvTranspose2d): # init.kaiming_normal_(m.weight, mode='fan_out') # init.normal_(m.weight, std=0.01) init.xavier_normal_(m.weight) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.BatchNorm2d): # NN.BatchNorm2d init.constant_(m.weight, 1) init.constant_(m.bias, 0) elif isinstance(m, nn.Linear): init.normal_(m.weight, std=0.01) if m.bias is not None: init.constant_(m.bias, 0) class FFM(nn.Module): def __init__(self, inchannels, midchannels, outchannels, upfactor=2): super(FFM, self).__init__() self.inchannels = inchannels self.midchannels = midchannels self.outchannels = outchannels self.upfactor = upfactor self.ftb1 = FTB(inchannels=self.inchannels, midchannels=self.midchannels) # self.ata = ATA(inchannels = self.midchannels) self.ftb2 = FTB(inchannels=self.midchannels, midchannels=self.outchannels) self.upsample = nn.Upsample(scale_factor=self.upfactor, mode='bilinear', align_corners=True) self.init_params() def forward(self, low_x, high_x): x = self.ftb1(low_x) x = x + high_x x = self.ftb2(x) x = self.upsample(x) return x def init_params(self): for m in self.modules(): if isinstance(m, nn.Conv2d): # init.kaiming_normal_(m.weight, mode='fan_out') init.normal_(m.weight, std=0.01) # init.xavier_normal_(m.weight) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.ConvTranspose2d): # init.kaiming_normal_(m.weight, mode='fan_out') init.normal_(m.weight, std=0.01) # init.xavier_normal_(m.weight) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.BatchNorm2d): # NN.Batchnorm2d init.constant_(m.weight, 1) init.constant_(m.bias, 0) elif isinstance(m, nn.Linear): init.normal_(m.weight, std=0.01) if m.bias is not None: init.constant_(m.bias, 0) class AO(nn.Module): # Adaptive output module def __init__(self, inchannels, outchannels, upfactor=2): super(AO, self).__init__() self.inchannels = inchannels self.outchannels = outchannels self.upfactor = upfactor self.adapt_conv = nn.Sequential( nn.Conv2d(in_channels=self.inchannels, out_channels=self.inchannels // 2, kernel_size=3, padding=1, stride=1, bias=True), \ nn.BatchNorm2d(num_features=self.inchannels // 2), \ nn.ReLU(inplace=True), \ nn.Conv2d(in_channels=self.inchannels // 2, out_channels=self.outchannels, kernel_size=3, padding=1, stride=1, bias=True), \ nn.Upsample(scale_factor=self.upfactor, mode='bilinear', align_corners=True)) self.init_params() def forward(self, x): x = self.adapt_conv(x) return x def init_params(self): for m in self.modules(): if isinstance(m, nn.Conv2d): # init.kaiming_normal_(m.weight, mode='fan_out') init.normal_(m.weight, std=0.01) # init.xavier_normal_(m.weight) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.ConvTranspose2d): # init.kaiming_normal_(m.weight, mode='fan_out') init.normal_(m.weight, std=0.01) # init.xavier_normal_(m.weight) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.BatchNorm2d): # NN.Batchnorm2d init.constant_(m.weight, 1) init.constant_(m.bias, 0) elif isinstance(m, nn.Linear): init.normal_(m.weight, std=0.01) if m.bias is not None: init.constant_(m.bias, 0) # ============================================================================================================== class ResidualConv(nn.Module): def __init__(self, inchannels): super(ResidualConv, self).__init__() # NN.BatchNorm2d self.conv = nn.Sequential( # nn.BatchNorm2d(num_features=inchannels), nn.ReLU(inplace=False), # nn.Conv2d(in_channels=inchannels, out_channels=inchannels, kernel_size=3, padding=1, stride=1, groups=inchannels,bias=True), # nn.Conv2d(in_channels=inchannels, out_channels=inchannels, kernel_size=1, padding=0, stride=1, groups=1,bias=True) nn.Conv2d(in_channels=inchannels, out_channels=inchannels / 2, kernel_size=3, padding=1, stride=1, bias=False), nn.BatchNorm2d(num_features=inchannels / 2), nn.ReLU(inplace=False), nn.Conv2d(in_channels=inchannels / 2, out_channels=inchannels, kernel_size=3, padding=1, stride=1, bias=False) ) self.init_params() def forward(self, x): x = self.conv(x) + x return x def init_params(self): for m in self.modules(): if isinstance(m, nn.Conv2d): # init.kaiming_normal_(m.weight, mode='fan_out') init.normal_(m.weight, std=0.01) # init.xavier_normal_(m.weight) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.ConvTranspose2d): # init.kaiming_normal_(m.weight, mode='fan_out') init.normal_(m.weight, std=0.01) # init.xavier_normal_(m.weight) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.BatchNorm2d): # NN.BatchNorm2d init.constant_(m.weight, 1) init.constant_(m.bias, 0) elif isinstance(m, nn.Linear): init.normal_(m.weight, std=0.01) if m.bias is not None: init.constant_(m.bias, 0) class FeatureFusion(nn.Module): def __init__(self, inchannels, outchannels): super(FeatureFusion, self).__init__() self.conv = ResidualConv(inchannels=inchannels) # NN.BatchNorm2d self.up = nn.Sequential(ResidualConv(inchannels=inchannels), nn.ConvTranspose2d(in_channels=inchannels, out_channels=outchannels, kernel_size=3, stride=2, padding=1, output_padding=1), nn.BatchNorm2d(num_features=outchannels), nn.ReLU(inplace=True)) def forward(self, lowfeat, highfeat): return self.up(highfeat + self.conv(lowfeat)) def init_params(self): for m in self.modules(): if isinstance(m, nn.Conv2d): # init.kaiming_normal_(m.weight, mode='fan_out') init.normal_(m.weight, std=0.01) # init.xavier_normal_(m.weight) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.ConvTranspose2d): # init.kaiming_normal_(m.weight, mode='fan_out') init.normal_(m.weight, std=0.01) # init.xavier_normal_(m.weight) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.BatchNorm2d): # NN.BatchNorm2d init.constant_(m.weight, 1) init.constant_(m.bias, 0) elif isinstance(m, nn.Linear): init.normal_(m.weight, std=0.01) if m.bias is not None: init.constant_(m.bias, 0) class SenceUnderstand(nn.Module): def __init__(self, channels): super(SenceUnderstand, self).__init__() self.channels = channels self.conv1 = nn.Sequential(nn.Conv2d(in_channels=512, out_channels=512, kernel_size=3, padding=1), nn.ReLU(inplace=True)) self.pool = nn.AdaptiveAvgPool2d(8) self.fc = nn.Sequential(nn.Linear(512 * 8 * 8, self.channels), nn.ReLU(inplace=True)) self.conv2 = nn.Sequential( nn.Conv2d(in_channels=self.channels, out_channels=self.channels, kernel_size=1, padding=0), nn.ReLU(inplace=True)) self.initial_params() def forward(self, x): n, c, h, w = x.size() x = self.conv1(x) x = self.pool(x) x = x.view(n, -1) x = self.fc(x) x = x.view(n, self.channels, 1, 1) x = self.conv2(x) x = x.repeat(1, 1, h, w) return x def initial_params(self, dev=0.01): for m in self.modules(): if isinstance(m, nn.Conv2d): # print torch.sum(m.weight) m.weight.data.normal_(0, dev) if m.bias is not None: m.bias.data.fill_(0) elif isinstance(m, nn.ConvTranspose2d): # print torch.sum(m.weight) m.weight.data.normal_(0, dev) if m.bias is not None: m.bias.data.fill_(0) elif isinstance(m, nn.Linear): m.weight.data.normal_(0, dev) if __name__ == '__main__': net = DepthNet(depth=50, pretrained=True) print(net) inputs = torch.ones(4,3,128,128) out = net(inputs) print(out.size())
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
import torchsparse.nn.functional as spf from torchsparse.point_tensor import PointTensor from torchsparse.utils.kernel_region import * from torchsparse.utils.helpers import * __all__ = ['initial_voxelize', 'point_to_voxel', 'voxel_to_point'] # z: PointTensor # return: SparseTensor def initial_voxelize(z, init_res, after_res): new_float_coord = torch.cat( [(z.C[:, :3] * init_res) / after_res, z.C[:, -1].view(-1, 1)], 1) pc_hash = spf.sphash(torch.floor(new_float_coord).int()) sparse_hash = torch.unique(pc_hash) idx_query = spf.sphashquery(pc_hash, sparse_hash) counts = spf.spcount(idx_query.int(), len(sparse_hash)) inserted_coords = spf.spvoxelize(torch.floor(new_float_coord), idx_query, counts) inserted_coords = torch.round(inserted_coords).int() inserted_feat = spf.spvoxelize(z.F, idx_query, counts) new_tensor = SparseTensor(inserted_feat, inserted_coords, 1) new_tensor.check() z.additional_features['idx_query'][1] = idx_query z.additional_features['counts'][1] = counts z.C = new_float_coord return new_tensor # x: SparseTensor, z: PointTensor # return: SparseTensor def point_to_voxel(x, z): if z.additional_features is None or z.additional_features.get('idx_query') is None\ or z.additional_features['idx_query'].get(x.s) is None: #pc_hash = hash_gpu(torch.floor(z.C).int()) pc_hash = spf.sphash( torch.cat([ torch.floor(z.C[:, :3] / x.s).int() * x.s, z.C[:, -1].int().view(-1, 1) ], 1)) sparse_hash = spf.sphash(x.C) idx_query = spf.sphashquery(pc_hash, sparse_hash) counts = spf.spcount(idx_query.int(), x.C.shape[0]) z.additional_features['idx_query'][x.s] = idx_query z.additional_features['counts'][x.s] = counts else: idx_query = z.additional_features['idx_query'][x.s] counts = z.additional_features['counts'][x.s] inserted_feat = spf.spvoxelize(z.F, idx_query, counts) new_tensor = SparseTensor(inserted_feat, x.C, x.s) new_tensor.coord_maps = x.coord_maps new_tensor.kernel_maps = x.kernel_maps return new_tensor # x: SparseTensor, z: PointTensor # return: PointTensor def voxel_to_point(x, z, nearest=False): if z.idx_query is None or z.weights is None or z.idx_query.get( x.s) is None or z.weights.get(x.s) is None: kr = KernelRegion(2, x.s, 1) off = kr.get_kernel_offset().to(z.F.device) #old_hash = kernel_hash_gpu(torch.floor(z.C).int(), off) old_hash = spf.sphash( torch.cat([ torch.floor(z.C[:, :3] / x.s).int() * x.s, z.C[:, -1].int().view(-1, 1) ], 1), off) pc_hash = spf.sphash(x.C.to(z.F.device)) idx_query = spf.sphashquery(old_hash, pc_hash) weights = spf.calc_ti_weights(z.C, idx_query, scale=x.s).transpose(0, 1).contiguous() idx_query = idx_query.transpose(0, 1).contiguous() if nearest: weights[:, 1:] = 0. idx_query[:, 1:] = -1 new_feat = spf.spdevoxelize(x.F, idx_query, weights) new_tensor = PointTensor(new_feat, z.C, idx_query=z.idx_query, weights=z.weights) new_tensor.additional_features = z.additional_features new_tensor.idx_query[x.s] = idx_query new_tensor.weights[x.s] = weights z.idx_query[x.s] = idx_query z.weights[x.s] = weights else: new_feat = spf.spdevoxelize(x.F, z.idx_query.get(x.s), z.weights.get(x.s)) new_tensor = PointTensor(new_feat, z.C, idx_query=z.idx_query, weights=z.weights) new_tensor.additional_features = z.additional_features return new_tensor
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
import cv2 import os import argparse import numpy as np import torch import matplotlib.pyplot as plt import torchvision.transforms as transforms from lib.multi_depth_model_woauxi import RelDepthModel from lib.net_tools import load_ckpt def parse_args(): parser = argparse.ArgumentParser( description='Configs for LeReS') parser.add_argument('--load_ckpt', default='./res50.pth', help='Checkpoint path to load') parser.add_argument('--backbone', default='resnext101', help='Checkpoint path to load') args = parser.parse_args() return args def scale_torch(img): """ Scale the image and output it in torch.tensor. :param img: input rgb is in shape [H, W, C], input depth/disp is in shape [H, W] :param scale: the scale factor. float :return: img. [C, H, W] """ if len(img.shape) == 2: img = img[np.newaxis, :, :] if img.shape[2] == 3: transform = transforms.Compose([transforms.ToTensor(), transforms.Normalize((0.485, 0.456, 0.406) , (0.229, 0.224, 0.225) )]) img = transform(img) else: img = img.astype(np.float32) img = torch.from_numpy(img) return img if __name__ == '__main__': args = parse_args() # create depth model depth_model = RelDepthModel(backbone=args.backbone) depth_model.eval() # load checkpoint load_ckpt(args, depth_model, None, None) depth_model.cuda() image_dir = os.path.dirname(os.path.dirname(__file__)) + '/test_images/' imgs_list = os.listdir(image_dir) imgs_list.sort() imgs_path = [os.path.join(image_dir, i) for i in imgs_list if i != 'outputs'] image_dir_out = image_dir + '/outputs' os.makedirs(image_dir_out, exist_ok=True) for i, v in enumerate(imgs_path): print('processing (%04d)-th image... %s' % (i, v)) rgb = cv2.imread(v) rgb_c = rgb[:, :, ::-1].copy() gt_depth = None A_resize = cv2.resize(rgb_c, (448, 448)) rgb_half = cv2.resize(rgb, (rgb.shape[1]//2, rgb.shape[0]//2), interpolation=cv2.INTER_LINEAR) img_torch = scale_torch(A_resize)[None, :, :, :] pred_depth = depth_model.inference(img_torch).cpu().numpy().squeeze() pred_depth_ori = cv2.resize(pred_depth, (rgb.shape[1], rgb.shape[0])) # if GT depth is available, uncomment the following part to recover the metric depth #pred_depth_metric = recover_metric_depth(pred_depth_ori, gt_depth) img_name = v.split('/')[-1] cv2.imwrite(os.path.join(image_dir_out, img_name), rgb) # save depth plt.imsave(os.path.join(image_dir_out, img_name[:-4]+'-depth.png'), pred_depth_ori, cmap='rainbow') cv2.imwrite(os.path.join(image_dir_out, img_name[:-4]+'-depth_raw.png'), (pred_depth_ori/pred_depth_ori.max() * 60000).astype(np.uint16))
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
import os import torch import torch.nn.functional as F import matplotlib.pyplot as plt from skimage.io import imread # Util function for loading point clouds| import numpy as np from plyfile import PlyData, PlyElement # Data structures and functions for rendering from pytorch3d.structures import Pointclouds from pytorch3d.vis.plotly_vis import AxisArgs, plot_batch_individually, plot_scene from pytorch3d.renderer import ( look_at_view_transform, FoVOrthographicCameras, PerspectiveCameras, PointsRasterizationSettings, PointsRenderer, PulsarPointsRenderer, PointsRasterizer, AlphaCompositor, NormWeightedCompositor, look_at_rotation, FoVPerspectiveCameras, ) import imageio device = torch.device("cuda:0") def load_pcd_color(path): #pointcloud = np.load(path) pointcloud = PlyData.read(path).elements[0].data verts = np.array([[data[0], data[1], data[2]] for data in pointcloud]) rgb = np.array([[data[3], data[4], data[5]] for data in pointcloud]) / 256.0 verts[:, 1] = -verts[:, 1] verts[:, 0] = -verts[:, 0] verts /= verts.max() verts = verts - verts.mean(axis=0) verts = torch.Tensor(verts).to(device) rgb = torch.Tensor(rgb).to(device) point_cloud = Pointclouds(points=[verts], features=[rgb]) return point_cloud def load_pcd_color2(path): #pointcloud = np.load(path) # Load point cloud pointcloud = np.load(path) verts = torch.Tensor(pointcloud['verts']).to(device) rgb = torch.Tensor(pointcloud['rgb']).to(device) point_cloud = Pointclouds(points=[verts], features=[rgb]) return point_cloud def rotate_pcd(point_cloud, angle): rotate_matrix = np.array([[np.cos(angle), 0, np.sin(angle)], [0, 1, 0] [-np.sin(angle), 0, np.cos(angle)]]) #cnt = point_cloud.mean(axis=) def render_single(point_cloud, azim=0): # Initialize a camera. R, T = look_at_view_transform(0.5, 10, azim=azim) #cameras = FoVOrthographicCameras(device=device, R=R, T=T, znear=0.01) cameras = FoVPerspectiveCameras(fov=50.0, device=device, R=R, T=T) # Define the settings for rasterization and shading. Here we set the output image to be of size # 512x512. As we are rendering images for visualization purposes only we will set faces_per_pixel=1 # and blur_radius=0.0. Refer to raster_points.py for explanations of these parameters. raster_settings = PointsRasterizationSettings( image_size=512, radius=0.008, points_per_pixel=50 ) # Create a points renderer by compositing points using an alpha compositor (nearer points # are weighted more heavily). See [1] for an explanation. rasterizer = PointsRasterizer(cameras=cameras, raster_settings=raster_settings) renderer = PointsRenderer( rasterizer=rasterizer, compositor=AlphaCompositor() ) images = renderer(point_cloud) # plt.figure(figsize=(10, 10)) # plt.imshow(images[0, ..., :3].cpu().numpy()) # plt.grid("off") # plt.axis("off") # plt.show() img_out = images[0, ...].cpu().numpy() img_out = (img_out * 256).astype(np.uint8) return img_out def render_batches(point_cloud): # Initialize a camera. batch_size = 10 point_clouds = point_cloud.extend(batch_size) azim = torch.linspace(-180, 180, batch_size) R, T = look_at_view_transform(-1, 0, azim=azim) #cameras = FoVOrthographicCameras(device=device, R=R, T=T, znear=0.01) cameras = FoVPerspectiveCameras(fov=50.0, device=device, R=R, T=T) # Define the settings for rasterization and shading. Here we set the output image to be of size # 512x512. As we are rendering images for visualization purposes only we will set faces_per_pixel=1 # and blur_radius=0.0. Refer to raster_points.py for explanations of these parameters. raster_settings = PointsRasterizationSettings( image_size=512, radius=0.008, points_per_pixel=50 ) # Create a points renderer by compositing points using an alpha compositor (nearer points # are weighted more heavily). See [1] for an explanation. rasterizer = PointsRasterizer(cameras=cameras, raster_settings=raster_settings) renderer = PointsRenderer( rasterizer=rasterizer, compositor=AlphaCompositor() ) images = renderer(point_clouds) plt.figure(figsize=(10, 10)) plt.imshow(images[0, ..., :3].cpu().numpy()) plt.grid("off") plt.axis("off") plt.show() def render_create_GIF(point_cloud, filename): # We will save images periodically and compose them into a GIF. filename_output = filename + ".gif" writer = imageio.get_writer(filename_output, mode='I', duration=0.01) for i in range(-180, 180, 2): image = render_single(point_cloud, i) writer.append_data(image) writer.close() if __name__ == '__main__': # path = '/mnt/data/WeiYin/publications/cvpr2021/first_page_fig/first_page_fig_results/8-rgb-recovershift.ply' path = '/home/gk-ai/code/mesh710.ply' point_cloud = load_pcd_color(path) name = path.split('/')[-1][:-4] #point_cloud = load_pcd_color2('/home/yvan/DeepLearning/Depth/MultiDepth/A-othertools/Render_PCD/data/PittsburghBridge/pointcloud.npz') #render_single(point_cloud) render_create_GIF(point_cloud, name)
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
import cv2 import os import argparse import numpy as np import torch import matplotlib.pyplot as plt import torchvision.transforms as transforms from lib.test_utils import refine_focal, refine_shift from lib.multi_depth_model_woauxi import RelDepthModel from lib.net_tools import load_ckpt from lib.spvcnn_classsification import SPVCNN_CLASSIFICATION from lib.test_utils import reconstruct_depth def parse_args(): parser = argparse.ArgumentParser( description='Configs for LeReS') parser.add_argument('--load_ckpt', default='./res50.pth', help='Checkpoint path to load') parser.add_argument('--backbone', default='resnext101', help='Checkpoint path to load') args = parser.parse_args() return args def scale_torch(img): """ Scale the image and output it in torch.tensor. :param img: input rgb is in shape [H, W, C], input depth/disp is in shape [H, W] :param scale: the scale factor. float :return: img. [C, H, W] """ if len(img.shape) == 2: img = img[np.newaxis, :, :] if img.shape[2] == 3: transform = transforms.Compose([transforms.ToTensor(), transforms.Normalize((0.485, 0.456, 0.406) , (0.229, 0.224, 0.225) )]) img = transform(img) else: img = img.astype(np.float32) img = torch.from_numpy(img) return img def make_shift_focallength_models(): shift_model = SPVCNN_CLASSIFICATION(input_channel=3, num_classes=1, cr=1.0, pres=0.01, vres=0.01 ) focal_model = SPVCNN_CLASSIFICATION(input_channel=5, num_classes=1, cr=1.0, pres=0.01, vres=0.01 ) shift_model.eval() focal_model.eval() return shift_model, focal_model def reconstruct3D_from_depth(rgb, pred_depth, shift_model, focal_model): cam_u0 = rgb.shape[1] / 2.0 cam_v0 = rgb.shape[0] / 2.0 pred_depth_norm = pred_depth - pred_depth.min() + 0.5 dmax = np.percentile(pred_depth_norm, 98) pred_depth_norm = pred_depth_norm / dmax # proposed focal length, FOV is 60', Note that 60~80' are acceptable. proposed_scaled_focal = (rgb.shape[0] // 2 / np.tan((60/2.0)*np.pi/180)) # recover focal focal_scale_1 = refine_focal(pred_depth_norm, proposed_scaled_focal, focal_model, u0=cam_u0, v0=cam_v0) predicted_focal_1 = proposed_scaled_focal / focal_scale_1.item() # recover shift shift_1 = refine_shift(pred_depth_norm, shift_model, predicted_focal_1, cam_u0, cam_v0) shift_1 = shift_1 if shift_1.item() < 0.6 else torch.tensor([0.6]) depth_scale_1 = pred_depth_norm - shift_1.item() # recover focal focal_scale_2 = refine_focal(depth_scale_1, predicted_focal_1, focal_model, u0=cam_u0, v0=cam_v0) predicted_focal_2 = predicted_focal_1 / focal_scale_2.item() return shift_1, predicted_focal_2, depth_scale_1 if __name__ == '__main__': args = parse_args() # create depth model depth_model = RelDepthModel(backbone=args.backbone) depth_model.eval() # create shift and focal length model shift_model, focal_model = make_shift_focallength_models() # load checkpoint load_ckpt(args, depth_model, shift_model, focal_model) depth_model.cuda() shift_model.cuda() focal_model.cuda() image_dir = os.path.dirname(os.path.dirname(__file__)) + '/test_images/' imgs_list = os.listdir(image_dir) imgs_list.sort() imgs_path = [os.path.join(image_dir, i) for i in imgs_list if i != 'outputs'] image_dir_out = image_dir + '/outputs' os.makedirs(image_dir_out, exist_ok=True) for i, v in enumerate(imgs_path): print('processing (%04d)-th image... %s' % (i, v)) rgb = cv2.imread(v) rgb_c = rgb[:, :, ::-1].copy() gt_depth = None A_resize = cv2.resize(rgb_c, (448, 448)) rgb_half = cv2.resize(rgb, (rgb.shape[1]//2, rgb.shape[0]//2), interpolation=cv2.INTER_LINEAR) img_torch = scale_torch(A_resize)[None, :, :, :] pred_depth = depth_model.inference(img_torch).cpu().numpy().squeeze() pred_depth_ori = cv2.resize(pred_depth, (rgb.shape[1], rgb.shape[0])) # recover focal length, shift, and scale-invariant depth shift, focal_length, depth_scaleinv = reconstruct3D_from_depth(rgb, pred_depth_ori, shift_model, focal_model) disp = 1 / depth_scaleinv disp = (disp / disp.max() * 60000).astype(np.uint16) # if GT depth is available, uncomment the following part to recover the metric depth #pred_depth_metric = recover_metric_depth(pred_depth_ori, gt_depth) img_name = v.split('/')[-1] cv2.imwrite(os.path.join(image_dir_out, img_name), rgb) # save depth plt.imsave(os.path.join(image_dir_out, img_name[:-4]+'-depth.png'), pred_depth_ori, cmap='rainbow') cv2.imwrite(os.path.join(image_dir_out, img_name[:-4]+'-depth_raw.png'), (pred_depth_ori/pred_depth_ori.max() * 60000).astype(np.uint16)) # save disp cv2.imwrite(os.path.join(image_dir_out, img_name[:-4]+'.png'), disp) # reconstruct point cloud from the depth reconstruct_depth(depth_scaleinv, rgb[:, :, ::-1], image_dir_out, img_name[:-4]+'-pcd', focal=focal_length)
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
export PYTHONPATH=../../Train:${PYTHONPATH} python ../tools/train.py \ --dataroot datasets \ --backbone resnet50 \ --dataset_list demo \ --batchsize 2 \ --base_lr 0.001 \ --use_tfboard \ --thread 4 \ --loss_mode _ranking-edge_pairwise-normal-regress-edge_msgil-normal_meanstd-tanh_pairwise-normal-regress-plane_ranking-edge-auxi_meanstd-tanh-auxi_ \ --epoch 2 \ --lr_scheduler_multiepochs 1 \ --val_step 50 \ --snapshot_iters 50 \ --log_interval 5
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
export PYTHONPATH=../../Train:${PYTHONPATH} export CUDA_VISIBLE_DEVICES=0,1,2,3 python ../tools/train.py \ --dataroot datasets \ --backbone resnet50 \ --dataset_list taskonomy DiverseDepth HRWSI Holopix50k \ --batchsize 16 \ --base_lr 0.001 \ --use_tfboard \ --thread 4 \ --loss_mode _ranking-edge_pairwise-normal-regress-edge_msgil-normal_meanstd-tanh_pairwise-normal-regress-plane_ranking-edge-auxi_meanstd-tanh-auxi_ \ --epoch 50 \ --lr_scheduler_multiepochs 10 25 40 \ --val_step 5000 \ --snapshot_iters 5000 \ --log_interval 10
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
export PYTHONPATH=../../Train:${PYTHONPATH} export CUDA_VISIBLE_DEVICES=0 TIME=`date +%Y-%m-%d_%H-%M-%S` LOG="./$TIME.txt" python ../tools/test_multiauxiv2_nyu.py \ --dataroot ./datasets \ --batchsize 1 \ --load_ckpt path_to_ckpt.pth \ $1 2>&1 | tee $LOG
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
import torch import torch.nn as nn class MSGIL_NORM_Loss(nn.Module): """ Our proposed GT normalized Multi-scale Gradient Loss Fuction. """ def __init__(self, scale=4, valid_threshold=-1e-8, max_threshold=1e8): super(MSGIL_NORM_Loss, self).__init__() self.scales_num = scale self.valid_threshold = valid_threshold self.max_threshold = max_threshold self.EPSILON = 1e-6 def one_scale_gradient_loss(self, pred_scale, gt, mask): mask_float = mask.to(dtype=pred_scale.dtype, device=pred_scale.device) d_diff = pred_scale - gt v_mask = torch.mul(mask_float[:, :, :-2, :], mask_float[:, :, 2:, :]) v_gradient = torch.abs(d_diff[:, :, :-2, :] - d_diff[:, :, 2:, :]) v_gradient = torch.mul(v_gradient, v_mask) h_gradient = torch.abs(d_diff[:, :, :, :-2] - d_diff[:, :, :, 2:]) h_mask = torch.mul(mask_float[:, :, :, :-2], mask_float[:, :, :, 2:]) h_gradient = torch.mul(h_gradient, h_mask) valid_num = torch.sum(h_mask) + torch.sum(v_mask) gradient_loss = torch.sum(h_gradient) + torch.sum(v_gradient) gradient_loss = gradient_loss / (valid_num + 1e-8) return gradient_loss def transform(self, gt): # Get mean and standard deviation data_mean = [] data_std_dev = [] for i in range(gt.shape[0]): gt_i = gt[i] mask = gt_i > 0 depth_valid = gt_i[mask] if depth_valid.shape[0] < 10: data_mean.append(torch.tensor(0).cuda()) data_std_dev.append(torch.tensor(1).cuda()) continue size = depth_valid.shape[0] depth_valid_sort, _ = torch.sort(depth_valid, 0) depth_valid_mask = depth_valid_sort[int(size*0.1): -int(size*0.1)] data_mean.append(depth_valid_mask.mean()) data_std_dev.append(depth_valid_mask.std()) data_mean = torch.stack(data_mean, dim=0).cuda() data_std_dev = torch.stack(data_std_dev, dim=0).cuda() return data_mean, data_std_dev def forward(self, pred, gt): mask = gt > self.valid_threshold grad_term = 0.0 gt_mean, gt_std = self.transform(gt) gt_trans = (gt - gt_mean[:, None, None, None]) / (gt_std[:, None, None, None] + 1e-8) for i in range(self.scales_num): step = pow(2, i) d_gt = gt_trans[:, :, ::step, ::step] d_pred = pred[:, :, ::step, ::step] d_mask = mask[:, :, ::step, ::step] grad_term += self.one_scale_gradient_loss(d_pred, d_gt, d_mask) return grad_term if __name__ == '__main__': msgi_loss = MSGIL_NORM_Loss() pred_depth = torch.rand([2, 1, 385, 513]).cuda() gt_depth = torch.rand([2, 1, 385, 513]).cuda() loss = msgi_loss(pred_depth, gt_depth) print(loss)
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
import torch import torch.nn as nn class MEADSTD_TANH_NORM_Loss(nn.Module): """ loss = MAE((d-u)/s - d') + MAE(tanh(0.01*(d-u)/s) - tanh(0.01*d')) """ def __init__(self, valid_threshold=-1e-8, max_threshold=1e8): super(MEADSTD_TANH_NORM_Loss, self).__init__() self.valid_threshold = valid_threshold self.max_threshold = max_threshold #self.thres1 = 0.9 def transform(self, gt): # Get mean and standard deviation data_mean = [] data_std_dev = [] for i in range(gt.shape[0]): gt_i = gt[i] mask = gt_i > 0 depth_valid = gt_i[mask] if depth_valid.shape[0] < 10: data_mean.append(torch.tensor(0).cuda()) data_std_dev.append(torch.tensor(1).cuda()) continue size = depth_valid.shape[0] depth_valid_sort, _ = torch.sort(depth_valid, 0) depth_valid_mask = depth_valid_sort[int(size*0.1): -int(size*0.1)] data_mean.append(depth_valid_mask.mean()) data_std_dev.append(depth_valid_mask.std()) data_mean = torch.stack(data_mean, dim=0).cuda() data_std_dev = torch.stack(data_std_dev, dim=0).cuda() return data_mean, data_std_dev def forward(self, pred, gt): """ Calculate loss. """ mask = (gt > self.valid_threshold) & (gt < self.max_threshold) # [b, c, h, w] mask_sum = torch.sum(mask, dim=(1, 2, 3)) # mask invalid batches mask_batch = mask_sum > 100 if True not in mask_batch: return torch.tensor(0.0, dtype=torch.float).cuda() mask_maskbatch = mask[mask_batch] pred_maskbatch = pred[mask_batch] gt_maskbatch = gt[mask_batch] gt_mean, gt_std = self.transform(gt_maskbatch) gt_trans = (gt_maskbatch - gt_mean[:, None, None, None]) / (gt_std[:, None, None, None] + 1e-8) B, C, H, W = gt_maskbatch.shape loss = 0 loss_tanh = 0 for i in range(B): mask_i = mask_maskbatch[i, ...] pred_depth_i = pred_maskbatch[i, ...][mask_i] gt_trans_i = gt_trans[i, ...][mask_i] depth_diff = torch.abs(gt_trans_i - pred_depth_i) loss += torch.mean(depth_diff) tanh_norm_gt = torch.tanh(0.01*gt_trans_i) tanh_norm_pred = torch.tanh(0.01*pred_depth_i) loss_tanh += torch.mean(torch.abs(tanh_norm_gt - tanh_norm_pred)) loss_out = loss/B + loss_tanh/B return loss_out.float() if __name__ == '__main__': ilnr_loss = MEADSTD_TANH_NORM_Loss() pred_depth = torch.rand([3, 1, 385, 513]).cuda() gt_depth = torch.rand([3, 1, 385, 513]).cuda() loss = ilnr_loss(pred_depth, gt_depth) print(loss)
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
import torch from torch import nn import numpy as np import torch.nn.functional as F """ Sampling strategies: RS (Random Sampling), EGS (Edge-Guided Sampling), and IGS (Instance-Guided Sampling) """ ########### # RANDOM SAMPLING # input: # inputs[i,:], targets[i, :], masks[i, :], self.mask_value, self.point_pairs # return: # inputs_A, inputs_B, targets_A, targets_B, consistent_masks_A, consistent_masks_B ########### def randomSampling(inputs, targets, masks, threshold, sample_num): # find A-B point pairs from predictions inputs_index = torch.masked_select(inputs, targets.gt(threshold)) num_effect_pixels = len(inputs_index) shuffle_effect_pixels = torch.randperm(num_effect_pixels).cuda() inputs_A = inputs_index[shuffle_effect_pixels[0:sample_num*2:2]] inputs_B = inputs_index[shuffle_effect_pixels[1:sample_num*2:2]] # find corresponding pairs from GT target_index = torch.masked_select(targets, targets.gt(threshold)) targets_A = target_index[shuffle_effect_pixels[0:sample_num*2:2]] targets_B = target_index[shuffle_effect_pixels[1:sample_num*2:2]] # only compute the losses of point pairs with valid GT consistent_masks_index = torch.masked_select(masks, targets.gt(threshold)) consistent_masks_A = consistent_masks_index[shuffle_effect_pixels[0:sample_num*2:2]] consistent_masks_B = consistent_masks_index[shuffle_effect_pixels[1:sample_num*2:2]] # The amount of A and B should be the same!! if len(targets_A) > len(targets_B): targets_A = targets_A[:-1] inputs_A = inputs_A[:-1] consistent_masks_A = consistent_masks_A[:-1] return inputs_A, inputs_B, targets_A, targets_B, consistent_masks_A, consistent_masks_B ########### # EDGE-GUIDED SAMPLING # input: # inputs[i,:], targets[i, :], masks[i, :], edges_img[i], thetas_img[i], masks[i, :], h, w # return: # inputs_A, inputs_B, targets_A, targets_B, masks_A, masks_B ########### def ind2sub(idx, cols): r = idx / cols c = idx - r * cols return r, c def sub2ind(r, c, cols): idx = r * cols + c return idx def edgeGuidedSampling(inputs, targets, edges_img, thetas_img, masks, h, w): # find edges edges_max = edges_img.max() edges_mask = edges_img.ge(edges_max*0.1) edges_loc = edges_mask.nonzero() inputs_edge = torch.masked_select(inputs, edges_mask) targets_edge = torch.masked_select(targets, edges_mask) thetas_edge = torch.masked_select(thetas_img, edges_mask) minlen = inputs_edge.size()[0] # find anchor points (i.e, edge points) sample_num = minlen index_anchors = torch.randint(0, minlen, (sample_num,), dtype=torch.long).cuda() anchors = torch.gather(inputs_edge, 0, index_anchors) theta_anchors = torch.gather(thetas_edge, 0, index_anchors) row_anchors, col_anchors = ind2sub(edges_loc[index_anchors].squeeze(1), w) ## compute the coordinates of 4-points, distances are from [2, 30] distance_matrix = torch.randint(2, 31, (4,sample_num)).cuda() pos_or_neg = torch.ones(4, sample_num).cuda() pos_or_neg[:2,:] = -pos_or_neg[:2,:] distance_matrix = distance_matrix.float() * pos_or_neg col = col_anchors.unsqueeze(0).expand(4, sample_num).long() + torch.round(distance_matrix.double() * torch.cos(theta_anchors).unsqueeze(0)).long() row = row_anchors.unsqueeze(0).expand(4, sample_num).long() + torch.round(distance_matrix.double() * torch.sin(theta_anchors).unsqueeze(0)).long() # constrain 0=<c<=w, 0<=r<=h # Note: index should minus 1 col[col<0] = 0 col[col>w-1] = w-1 row[row<0] = 0 row[row>h-1] = h-1 # a-b, b-c, c-d a = sub2ind(row[0,:], col[0,:], w) b = sub2ind(row[1,:], col[1,:], w) c = sub2ind(row[2,:], col[2,:], w) d = sub2ind(row[3,:], col[3,:], w) A = torch.cat((a,b,c), 0) B = torch.cat((b,c,d), 0) inputs_A = torch.gather(inputs, 0, A.long()) inputs_B = torch.gather(inputs, 0, B.long()) targets_A = torch.gather(targets, 0, A.long()) targets_B = torch.gather(targets, 0, B.long()) masks_A = torch.gather(masks, 0, A.long()) masks_B = torch.gather(masks, 0, B.long()) return inputs_A, inputs_B, targets_A, targets_B, masks_A, masks_B, sample_num ###################################################### # EdgeguidedRankingLoss (with regularization term) # Please comment regularization_loss if you don't want to use multi-scale gradient matching term ##################################################### class EdgeguidedRankingLoss(nn.Module): def __init__(self, point_pairs=10000, sigma=0.03, alpha=1.0, mask_value=-1e-8): super(EdgeguidedRankingLoss, self).__init__() self.point_pairs = point_pairs # number of point pairs self.sigma = sigma # used for determining the ordinal relationship between a selected pair self.alpha = alpha # used for balancing the effect of = and (<,>) self.mask_value = mask_value #self.regularization_loss = GradientLoss(scales=4) def getEdge(self, images): n,c,h,w = images.size() a = torch.Tensor([[-1, 0, 1], [-2, 0, 2], [-1, 0, 1]]).cuda().view((1,1,3,3)).repeat(1, 1, 1, 1) b = torch.Tensor([[1, 2, 1], [0, 0, 0], [-1, -2, -1]]).cuda().view((1,1,3,3)).repeat(1, 1, 1, 1) if c == 3: gradient_x = F.conv2d(images[:,0,:,:].unsqueeze(1), a) gradient_y = F.conv2d(images[:,0,:,:].unsqueeze(1), b) else: gradient_x = F.conv2d(images, a) gradient_y = F.conv2d(images, b) edges = torch.sqrt(torch.pow(gradient_x,2)+ torch.pow(gradient_y,2)) edges = F.pad(edges, (1,1,1,1), "constant", 0) thetas = torch.atan2(gradient_y, gradient_x) thetas = F.pad(thetas, (1,1,1,1), "constant", 0) return edges, thetas def forward(self, inputs, targets, images, masks=None): if masks == None: masks = targets > self.mask_value # Comment this line if you don't want to use the multi-scale gradient matching term !!! # regularization_loss = self.regularization_loss(inputs.squeeze(1), targets.squeeze(1), masks.squeeze(1)) # find edges from RGB edges_img, thetas_img = self.getEdge(images) #============================= n,c,h,w = targets.size() if n != 1: inputs = inputs.view(n, -1).double() targets = targets.view(n, -1).double() masks = masks.view(n, -1).double() edges_img = edges_img.view(n, -1).double() thetas_img = thetas_img.view(n, -1).double() else: inputs = inputs.contiguous().view(1, -1).double() targets = targets.contiguous().view(1, -1).double() masks = masks.contiguous().view(1, -1).double() edges_img = edges_img.contiguous().view(1, -1).double() thetas_img = thetas_img.contiguous().view(1, -1).double() # initialization loss = torch.DoubleTensor([0.0]).cuda() for i in range(n): # Edge-Guided sampling inputs_A, inputs_B, targets_A, targets_B, masks_A, masks_B, sample_num = edgeGuidedSampling(inputs[i,:], targets[i, :], edges_img[i], thetas_img[i], masks[i, :], h, w) # Random Sampling random_sample_num = sample_num random_inputs_A, random_inputs_B, random_targets_A, random_targets_B, random_masks_A, random_masks_B = randomSampling(inputs[i,:], targets[i, :], masks[i, :], self.mask_value, random_sample_num) # Combine EGS + RS inputs_A = torch.cat((inputs_A, random_inputs_A), 0) inputs_B = torch.cat((inputs_B, random_inputs_B), 0) targets_A = torch.cat((targets_A, random_targets_A), 0) targets_B = torch.cat((targets_B, random_targets_B), 0) masks_A = torch.cat((masks_A, random_masks_A), 0) masks_B = torch.cat((masks_B, random_masks_B), 0) #GT ordinal relationship target_ratio = torch.div(targets_A+1e-6, targets_B+1e-6) mask_eq = target_ratio.lt(1.0 + self.sigma) * target_ratio.gt(1.0/(1.0+self.sigma)) labels = torch.zeros_like(target_ratio) labels[target_ratio.ge(1.0 + self.sigma)] = 1 labels[target_ratio.le(1.0/(1.0+self.sigma))] = -1 # consider forward-backward consistency checking, i.e, only compute losses of point pairs with valid GT consistency_mask = masks_A * masks_B equal_loss = (inputs_A - inputs_B).pow(2) * mask_eq.double() * consistency_mask unequal_loss = torch.log(1 + torch.exp((-inputs_A + inputs_B) * labels)) * (~mask_eq).double() * consistency_mask # Please comment the regularization term if you don't want to use the multi-scale gradient matching loss !!! loss = loss + self.alpha * equal_loss.mean() + 1.0 * unequal_loss.mean() #+ 0.2 * regularization_loss.double() return loss[0].float()/n if __name__ == '__main__': import cv2 rank_loss = EdgeguidedRankingLoss() pred_depth = np.random.randn(2, 1, 480, 640) gt_depth = np.random.randn(2, 1, 480, 640) # gt_depth = cv2.imread('/hardware/yifanliu/SUNRGBD/sunrgbd-meta-data/sunrgbd_test_depth/2.png', -1) # gt_depth = gt_depth[None, :, :, None] # pred_depth = gt_depth[:, :, ::-1, :] gt_depth = torch.tensor(np.asarray(gt_depth, np.float32)).cuda() pred_depth = torch.tensor(np.asarray(pred_depth, np.float32)).cuda() loss = rank_loss(pred_depth, gt_depth) print(loss)
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
import torch import torch.nn as nn import numpy as np class PWNPlanesLoss(nn.Module): """ Virtual Normal Loss Function. """ def __init__(self, focal_x, focal_y, input_size, delta_cos=0.867, delta_diff_x=0.007, delta_diff_y=0.007, sample_groups=5000, xyz_mode = 'uvd'): """ Virtual normal planes loss, which constrain points to be on the same 3D plane. :para focal_x: folcal length fx :para focal_y: folcal length fy :para input_size: input image size :para delta_cos: a threshold for the angle among three point, three points should not be on the same plane :para delta_diff_x: a threshold for the distance among three points along the x axis :para delta_diff_y: a threshold for the distance among three points along the y axis :para sample_groups: sample groups number, each group with 3 points can construct a plane :para xyz_mode: using (u, v, d) or (x, y, z) to construct the virtual planes """ super(PWNPlanesLoss, self).__init__() self.fx = torch.tensor([focal_x], dtype=torch.float32).cuda() self.fy = torch.tensor([focal_y], dtype=torch.float32).cuda() self.input_size = input_size self.u0 = torch.tensor(input_size[1] // 2, dtype=torch.float32).cuda() self.v0 = torch.tensor(input_size[0] // 2, dtype=torch.float32).cuda() self.init_image_coor() self.delta_cos = delta_cos self.delta_diff_x = delta_diff_x self.delta_diff_y = delta_diff_y self.sample_groups = sample_groups self.xyz_mode = xyz_mode def init_image_coor(self): x_row = np.arange(0, self.input_size[1]) x = np.tile(x_row, (self.input_size[0], 1)) x = x[np.newaxis, :, :] x = x.astype(np.float32) x = torch.from_numpy(x.copy()).cuda() self.u_u0 = x - self.u0 y_col = np.arange(0, self.input_size[0]) # y_col = np.arange(0, height) y = np.tile(y_col, (self.input_size[1], 1)).T y = y[np.newaxis, :, :] y = y.astype(np.float32) y = torch.from_numpy(y.copy()).cuda() self.v_v0 = y - self.v0 def transfer_uvz(self, depth): max_uv = self.u_u0.max() u = self.u_u0.repeat((depth.shape[0], 1, 1, 1)) / max_uv v = self.v_v0.repeat((depth.shape[0], 1, 1, 1)) / max_uv z = depth pw = torch.cat([u, v, z], 1).permute(0, 2, 3, 1) # [b, h, w, c] return pw def transfer_xyz(self, depth): x = self.u_u0 * torch.abs(depth) / self.fx y = self.v_v0 * torch.abs(depth) / self.fy z = depth pw = torch.cat([x, y, z], 1).permute(0, 2, 3, 1) # [b, h, w, c] return pw def select_index(self, mask_kp): x, _, h, w = mask_kp.shape select_size = int(3 * self.sample_groups) p1_x = [] p1_y = [] p2_x = [] p2_y = [] p3_x = [] p3_y = [] valid_batch = torch.ones((x, 1), dtype=torch.bool) for i in range(x): mask_kp_i = mask_kp[i, 0, :, :] valid_points = torch.nonzero(mask_kp_i) if valid_points.shape[0] < select_size * 0.6: valid_points = torch.nonzero(~mask_kp_i.to(torch.uint8)) valid_batch[i, :] = False elif valid_points.shape[0] < select_size: repeat_idx = torch.randperm(valid_points.shape[0])[:select_size - valid_points.shape[0]] valid_repeat = valid_points[repeat_idx] valid_points = torch.cat((valid_points, valid_repeat), 0) else: valid_points = valid_points """ if valid_points.shape[0] <= select_size: valid_points = torch.nonzero(~mask_kp_i.to(torch.uint8)) valid_batch[i, :] = False """ select_indx = torch.randperm(valid_points.size(0)) p1 = valid_points[select_indx[0:select_size:3]] p2 = valid_points[select_indx[1:select_size:3]] p3 = valid_points[select_indx[2:select_size:3]] p1_x.append(p1[:, 1]) p1_y.append(p1[:, 0]) p2_x.append(p2[:, 1]) p2_y.append(p2[:, 0]) p3_x.append(p3[:, 1]) p3_y.append(p3[:, 0]) p123 = {'p1_x': torch.stack(p1_x), 'p1_y': torch.stack(p1_y), 'p2_x': torch.stack(p2_x), 'p2_y': torch.stack(p2_y), 'p3_x': torch.stack(p3_x), 'p3_y': torch.stack(p3_y), 'valid_batch': valid_batch} return p123 def form_pw_groups(self, p123, pw): """ Form 3D points groups, with 3 points in each grouup. :param p123: points index :param pw: 3D points, # [1, h, w, c] :return: """ p1_x = p123['p1_x'] p1_y = p123['p1_y'] p2_x = p123['p2_x'] p2_y = p123['p2_y'] p3_x = p123['p3_x'] p3_y = p123['p3_y'] batch_list = np.arange(0, p1_x.shape[0])[:, np.newaxis] pw = pw.repeat((p1_x.shape[0], 1, 1, 1)) pw1 = pw[batch_list, p1_y, p1_x, :] pw2 = pw[batch_list, p2_y, p2_x, :] pw3 = pw[batch_list, p3_y, p3_x, :] # [B, N, 3(x,y,z), 3(p1,p2,p3)] pw_groups = torch.cat([pw1[:, :, :, np.newaxis], pw2[:, :, :, np.newaxis], pw3[:, :, :, np.newaxis]], 3) return pw_groups def filter_mask(self, pw_pred): """ :param pw_pred: constructed 3d vector (x, y, disp), [B, N, 3(x,y,z), 3(p1,p2,p3)] """ xy12 = pw_pred[:, :, 0:2, 1] - pw_pred[:, :, 0:2, 0] xy13 = pw_pred[:, :, 0:2, 2] - pw_pred[:, :, 0:2, 0] xy23 = pw_pred[:, :, 0:2, 2] - pw_pred[:, :, 0:2, 1] # Ignore linear xy_diff = torch.cat([xy12[:, :, :, np.newaxis], xy13[:, :, :, np.newaxis], xy23[:, :, :, np.newaxis]], 3) # [b, n, 2(xy), 3] m_batchsize, groups, coords, index = xy_diff.shape proj_query = xy_diff.view(m_batchsize * groups, -1, index).permute(0, 2, 1) # [bn, 3(p123), 2(xy)] proj_key = xy_diff.view(m_batchsize * groups, -1, index) # [bn, 2(xy), 3(p123)] q_norm = proj_query.norm(2, dim=2) # [bn, 3(p123)] nm = torch.bmm(q_norm.view(m_batchsize * groups, index, 1), q_norm.view(m_batchsize * groups, 1, index)) # [] energy = torch.bmm(proj_query, proj_key) # transpose check [bn, 3(p123), 3(p123)] norm_energy = energy / (nm + 1e-8) norm_energy = norm_energy.view(m_batchsize * groups, -1) # [bn, 9(p123)] mask_cos = torch.sum((norm_energy > self.delta_cos) + (norm_energy < -self.delta_cos), 1) > 3 # igonre mask_cos = mask_cos.view(m_batchsize, groups) # [b, n] # igonre #ignore near mask_x = torch.sum(torch.abs(xy_diff[:, :, 0, :]) < self.delta_diff_x, 2) > 0 mask_y = torch.sum(torch.abs(xy_diff[:, :, 1, :]) < self.delta_diff_y, 2) > 0 mask_near = mask_x & mask_y mask_valid_pts = ~(mask_cos | mask_near) return mask_valid_pts def select_points_groups(self, pred_depth, mask_kp): p123 = self.select_index(mask_kp) # p1_x: [x, N] uvz_pred = self.transfer_uvz(pred_depth) #[1, h, w, 3(xyz)] uvz_groups_pred = self.form_pw_groups(p123, uvz_pred) # [x, N, 3(x,y,z), 3(p1,p2,p3)] # mask:[b, n] mask_valid_pts = (self.filter_mask(uvz_groups_pred)).to(torch.bool) # [x, n] mask_valid_batch = p123['valid_batch'].repeat(1, mask_valid_pts.shape[1]) # [x, n] mask_valid = mask_valid_pts & mask_valid_batch.cuda() # [x, n] if self.xyz_mode == 'uvd': pw_groups_pred = uvz_groups_pred else: xyz_pred = self.transfer_xyz(pred_depth) # [1, h, w, 3(xyz)] pw_groups_pred = self.form_pw_groups(p123, xyz_pred) # [x, N, 3(x,y,z), 3(p1,p2,p3)] return pw_groups_pred, mask_valid def constrain_a_plane_loss(self, pw_groups_pre_i, mask_valid_i): """ pw_groups_pre: selected points groups for the i-th plane, """ if torch.sum(mask_valid_i) < 2: return [0.0, 0] pw_groups_pred_i = pw_groups_pre_i[mask_valid_i] # [n, 3, 3] p12 = pw_groups_pred_i[:, :, 1] - pw_groups_pred_i[:, :, 0] p13 = pw_groups_pred_i[:, :, 2] - pw_groups_pred_i[:, :, 0] virtual_normal = torch.cross(p12, p13, dim=1) # [n, 3] norm = torch.norm(virtual_normal, 2, dim=1, keepdim=True) virtual_normal = virtual_normal / (norm + 1e-8) # re-orient normals consistently orient_mask = torch.sum(torch.squeeze(virtual_normal) * torch.squeeze(pw_groups_pred_i[:, :, 0]), dim=1) > 0 virtual_normal[orient_mask] *= -1 #direct = virtual_normal[:, 2] / torch.abs(virtual_normal[:, 2]) #virtual_normal = virtual_normal / direct[:, None] # [n, 3] aver_normal = torch.sum(virtual_normal, dim=0) aver_norm = torch.norm(aver_normal, 2, dim=0, keepdim=True) aver_normal = aver_normal / (aver_norm + 1e-5) # [3] cos_diff = 1.0 - torch.sum(virtual_normal * aver_normal, dim=1) loss = torch.sum(cos_diff, dim=0) valid_num = cos_diff.numel() return loss, valid_num def forward(self, gt_depth, pred_depth, mask, focal_length=None): """ Virtual normal loss. :param pred_depth: predicted depth map, [B,C,H,W] :param mask: mask for planes, each plane is noted with a value, [B, C, H, W] :param focal_length: focal length """ B, _, _, _ = pred_depth.shape loss = torch.tensor(0.0).cuda() valid_planes_num = 0 for i in range(B): self.fx = focal_length[i] if focal_length is not None else 256.0 self.fy = focal_length[i] if focal_length is not None else 256.0 pred_depth_i = pred_depth[i, :] mask_i = mask[i, :][None, :, :] unique_planes = torch.unique(mask_i) planes = [mask_i == m for m in unique_planes if m != 0] #[x, 1, h, w] x is the planes number if len(planes) == 0: continue mask_planes = torch.stack(planes, dim=0) #torch.cat(planes, dim=0) # pw_groups_pred, mask_valid = self.select_points_groups(pred_depth_i[None, :, :, :], mask_planes) # [x, N, 3(x,y,z), 3(p1,p2,p3)] for j in range(unique_planes.numel()-1): mask_valid_j = mask_valid[j, :] pw_groups_pred_j = pw_groups_pred[j, :] loss_tmp, valid_angles = self.constrain_a_plane_loss(pw_groups_pred_j, mask_valid_j) valid_planes_num += valid_angles loss += loss_tmp loss /= (valid_planes_num + 1e-8) return loss if __name__ == '__main__': import cv2 vnl_loss = PWN_Planes_Loss(500.0, 500.0, (385, 513), xyz_mode='uvd') pred_depth = torch.rand([2, 1, 385, 513]).cuda() gt_depth = torch.rand([2, 1, 385, 513]).cuda() gt_depth[:, :, 3:20, 40:60] = 0 mask_kp1 = pred_depth > 0.9 mask_kp2 = pred_depth < 0.5 mask = torch.zeros_like(gt_depth, dtype=torch.uint8) mask = 1*mask_kp1 + 2* mask_kp2 #gt_depth = cv2.imread('/hardware/yifanliu/SUNRGBD/sunrgbd-meta-data/sunrgbd_test_depth/2.png', -1) #gt_depth = gt_depth[None, :, :, None] #pred_depth = gt_depth[:, :, ::-1, :] loss = vnl_loss(gt_depth, gt_depth, mask) print(loss)
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
import torch import numpy as np import torch.nn as nn def init_image_coor(height, width): x_row = np.arange(0, width) x = np.tile(x_row, (height, 1)) x = x[np.newaxis, :, :] x = x.astype(np.float32) x = torch.from_numpy(x.copy()).cuda() u_u0 = x - width/2.0 y_col = np.arange(0, height) # y_col = np.arange(0, height) y = np.tile(y_col, (width, 1)).T y = y[np.newaxis, :, :] y = y.astype(np.float32) y = torch.from_numpy(y.copy()).cuda() v_v0 = y - height/2.0 return u_u0, v_v0 def depth_to_xyz(depth, focal_length): b, c, h, w = depth.shape u_u0, v_v0 = init_image_coor(h, w) x = u_u0 * depth / focal_length y = v_v0 * depth / focal_length z = depth pw = torch.cat([x, y, z], 1).permute(0, 2, 3, 1) # [b, h, w, c] return pw def get_surface_normal(xyz, patch_size=5): # xyz: [1, h, w, 3] x, y, z = torch.unbind(xyz, dim=3) x = torch.unsqueeze(x, 0) y = torch.unsqueeze(y, 0) z = torch.unsqueeze(z, 0) xx = x * x yy = y * y zz = z * z xy = x * y xz = x * z yz = y * z patch_weight = torch.ones((1, 1, patch_size, patch_size), requires_grad=False).cuda() xx_patch = nn.functional.conv2d(xx, weight=patch_weight, padding=int(patch_size / 2)) yy_patch = nn.functional.conv2d(yy, weight=patch_weight, padding=int(patch_size / 2)) zz_patch = nn.functional.conv2d(zz, weight=patch_weight, padding=int(patch_size / 2)) xy_patch = nn.functional.conv2d(xy, weight=patch_weight, padding=int(patch_size / 2)) xz_patch = nn.functional.conv2d(xz, weight=patch_weight, padding=int(patch_size / 2)) yz_patch = nn.functional.conv2d(yz, weight=patch_weight, padding=int(patch_size / 2)) ATA = torch.stack([xx_patch, xy_patch, xz_patch, xy_patch, yy_patch, yz_patch, xz_patch, yz_patch, zz_patch], dim=4) ATA = torch.squeeze(ATA) ATA = torch.reshape(ATA, (ATA.size(0), ATA.size(1), 3, 3)) eps_identity = 1e-6 * torch.eye(3, device=ATA.device, dtype=ATA.dtype)[None, None, :, :].repeat([ATA.size(0), ATA.size(1), 1, 1]) ATA = ATA + eps_identity x_patch = nn.functional.conv2d(x, weight=patch_weight, padding=int(patch_size / 2)) y_patch = nn.functional.conv2d(y, weight=patch_weight, padding=int(patch_size / 2)) z_patch = nn.functional.conv2d(z, weight=patch_weight, padding=int(patch_size / 2)) AT1 = torch.stack([x_patch, y_patch, z_patch], dim=4) AT1 = torch.squeeze(AT1) AT1 = torch.unsqueeze(AT1, 3) patch_num = 4 patch_x = int(AT1.size(1) / patch_num) patch_y = int(AT1.size(0) / patch_num) n_img = torch.randn(AT1.shape).cuda() overlap = patch_size // 2 + 1 for x in range(int(patch_num)): for y in range(int(patch_num)): left_flg = 0 if x == 0 else 1 right_flg = 0 if x == patch_num -1 else 1 top_flg = 0 if y == 0 else 1 btm_flg = 0 if y == patch_num - 1 else 1 at1 = AT1[y * patch_y - top_flg * overlap:(y + 1) * patch_y + btm_flg * overlap, x * patch_x - left_flg * overlap:(x + 1) * patch_x + right_flg * overlap] ata = ATA[y * patch_y - top_flg * overlap:(y + 1) * patch_y + btm_flg * overlap, x * patch_x - left_flg * overlap:(x + 1) * patch_x + right_flg * overlap] n_img_tmp, _ = torch.solve(at1, ata) n_img_tmp_select = n_img_tmp[top_flg * overlap:patch_y + top_flg * overlap, left_flg * overlap:patch_x + left_flg * overlap, :, :] n_img[y * patch_y:y * patch_y + patch_y, x * patch_x:x * patch_x + patch_x, :, :] = n_img_tmp_select n_img_L2 = torch.sqrt(torch.sum(n_img ** 2, dim=2, keepdim=True)) n_img_norm = n_img / n_img_L2 # re-orient normals consistently orient_mask = torch.sum(torch.squeeze(n_img_norm) * torch.squeeze(xyz), dim=2) > 0 n_img_norm[orient_mask] *= -1 return n_img_norm def get_surface_normalv2(xyz, patch_size=5): """ xyz: xyz coordinates patch: [p1, p2, p3, p4, p5, p6, p7, p8, p9] surface_normal = [(p9-p1) x (p3-p7)] + [(p6-p4) - (p8-p2)] return: normal [h, w, 3, b] """ b, h, w, c = xyz.shape half_patch = patch_size // 2 xyz_pad = torch.zeros((b, h + patch_size - 1, w + patch_size - 1, c), dtype=xyz.dtype, device=xyz.device) xyz_pad[:, half_patch:-half_patch, half_patch:-half_patch, :] = xyz # xyz_left_top = xyz_pad[:, :h, :w, :] # p1 # xyz_right_bottom = xyz_pad[:, -h:, -w:, :]# p9 # xyz_left_bottom = xyz_pad[:, -h:, :w, :] # p7 # xyz_right_top = xyz_pad[:, :h, -w:, :] # p3 # xyz_cross1 = xyz_left_top - xyz_right_bottom # p1p9 # xyz_cross2 = xyz_left_bottom - xyz_right_top # p7p3 xyz_left = xyz_pad[:, half_patch:half_patch + h, :w, :] # p4 xyz_right = xyz_pad[:, half_patch:half_patch + h, -w:, :] # p6 xyz_top = xyz_pad[:, :h, half_patch:half_patch + w, :] # p2 xyz_bottom = xyz_pad[:, -h:, half_patch:half_patch + w, :] # p8 xyz_horizon = xyz_left - xyz_right # p4p6 xyz_vertical = xyz_top - xyz_bottom # p2p8 xyz_left_in = xyz_pad[:, half_patch:half_patch + h, 1:w+1, :] # p4 xyz_right_in = xyz_pad[:, half_patch:half_patch + h, patch_size-1:patch_size-1+w, :] # p6 xyz_top_in = xyz_pad[:, 1:h+1, half_patch:half_patch + w, :] # p2 xyz_bottom_in = xyz_pad[:, patch_size-1:patch_size-1+h, half_patch:half_patch + w, :] # p8 xyz_horizon_in = xyz_left_in - xyz_right_in # p4p6 xyz_vertical_in = xyz_top_in - xyz_bottom_in # p2p8 n_img_1 = torch.cross(xyz_horizon_in, xyz_vertical_in, dim=3) n_img_2 = torch.cross(xyz_horizon, xyz_vertical, dim=3) # re-orient normals consistently orient_mask = torch.sum(n_img_1 * xyz, dim=3) > 0 n_img_1[orient_mask] *= -1 orient_mask = torch.sum(n_img_2 * xyz, dim=3) > 0 n_img_2[orient_mask] *= -1 n_img1_L2 = torch.sqrt(torch.sum(n_img_1 ** 2, dim=3, keepdim=True)) n_img1_norm = n_img_1 / (n_img1_L2 + 1e-8) n_img2_L2 = torch.sqrt(torch.sum(n_img_2 ** 2, dim=3, keepdim=True)) n_img2_norm = n_img_2 / (n_img2_L2 + 1e-8) # average 2 norms n_img_aver = n_img1_norm + n_img2_norm n_img_aver_L2 = torch.sqrt(torch.sum(n_img_aver ** 2, dim=3, keepdim=True)) n_img_aver_norm = n_img_aver / (n_img_aver_L2 + 1e-8) # re-orient normals consistently orient_mask = torch.sum(n_img_aver_norm * xyz, dim=3) > 0 n_img_aver_norm[orient_mask] *= -1 n_img_aver_norm_out = n_img_aver_norm.permute((1, 2, 3, 0)) # [h, w, c, b] # a = torch.sum(n_img1_norm_out*n_img2_norm_out, dim=2).cpu().numpy().squeeze() # plt.imshow(np.abs(a), cmap='rainbow') # plt.show() return n_img_aver_norm_out#n_img1_norm.permute((1, 2, 3, 0)) def surface_normal_from_depth(depth, focal_length, valid_mask=None): # para depth: depth map, [b, c, h, w] b, c, h, w = depth.shape focal_length = focal_length[:, None, None, None] depth_filter = nn.functional.avg_pool2d(depth, kernel_size=3, stride=1, padding=1) depth_filter = nn.functional.avg_pool2d(depth_filter, kernel_size=3, stride=1, padding=1) xyz = depth_to_xyz(depth_filter, focal_length) sn_batch = [] for i in range(b): xyz_i = xyz[i, :][None, :, :, :] normal = get_surface_normalv2(xyz_i) sn_batch.append(normal) sn_batch = torch.cat(sn_batch, dim=3).permute((3, 2, 0, 1)) # [b, c, h, w] mask_invalid = (~valid_mask).repeat(1, 3, 1, 1) sn_batch[mask_invalid] = 0.0 return sn_batch def vis_normal(normal): """ Visualize surface normal. Transfer surface normal value from [-1, 1] to [0, 255] @para normal: surface normal, [h, w, 3], numpy.array """ n_img_L2 = np.sqrt(np.sum(normal ** 2, axis=2, keepdims=True)) n_img_norm = normal / (n_img_L2 + 1e-8) normal_vis = n_img_norm * 127 normal_vis += 128 normal_vis = normal_vis.astype(np.uint8) return normal_vis def vis_normal2(normals): ''' Montage of normal maps. Vectors are unit length and backfaces thresholded. ''' x = normals[:, :, 0] # horizontal; pos right y = normals[:, :, 1] # depth; pos far z = normals[:, :, 2] # vertical; pos up backfacing = (z > 0) norm = np.sqrt(np.sum(normals**2, axis=2)) zero = (norm < 1e-5) x += 1.0; x *= 0.5 y += 1.0; y *= 0.5 z = np.abs(z) x[zero] = 0.0 y[zero] = 0.0 z[zero] = 0.0 normals[:, :, 0] = x # horizontal; pos right normals[:, :, 1] = y # depth; pos far normals[:, :, 2] = z # vertical; pos up return normals if __name__ == '__main__': import cv2, os
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
#!/usr/bin/env python # coding: utf-8 """ https://github.com/CSAILVision/semantic-segmentation-pytorch """ import os import sys import torch import torch.nn as nn import math import torch.utils.model_zoo as model_zoo from lib.configs.config import cfg try: from urllib import urlretrieve except ImportError: from urllib.request import urlretrieve __all__ = ['resnext101_32x8d'] model_urls = { 'resnext50_32x4d': 'https://download.pytorch.org/models/resnext50_32x4d-7cdf4587.pth', 'resnext101_32x8d': 'https://download.pytorch.org/models/resnext101_32x8d-8ba56ff5.pth', #'resnext101': 'http://sceneparsing.csail.mit.edu/model/pretrained_resnet/resnext101-imagenet.pth' } def conv3x3(in_planes, out_planes, stride=1, groups=1, dilation=1): """3x3 convolution with padding""" return nn.Conv2d(in_planes, out_planes, kernel_size=3, stride=stride, padding=dilation, groups=groups, bias=False, dilation=dilation) def conv1x1(in_planes, out_planes, stride=1): """1x1 convolution""" return nn.Conv2d(in_planes, out_planes, kernel_size=1, stride=stride, bias=False) class BasicBlock(nn.Module): expansion = 1 def __init__(self, inplanes, planes, stride=1, downsample=None, groups=1, base_width=64, dilation=1, norm_layer=None): super(BasicBlock, self).__init__() if norm_layer is None: norm_layer = nn.BatchNorm2d if groups != 1 or base_width != 64: raise ValueError('BasicBlock only supports groups=1 and base_width=64') if dilation > 1: raise NotImplementedError("Dilation > 1 not supported in BasicBlock") # Both self.conv1 and self.downsample layers downsample the input when stride != 1 self.conv1 = conv3x3(inplanes, planes, stride) self.bn1 = norm_layer(planes) self.relu = nn.ReLU(inplace=True) self.conv2 = conv3x3(planes, planes) self.bn2 = norm_layer(planes) self.downsample = downsample self.stride = stride def forward(self, x): identity = x out = self.conv1(x) out = self.bn1(out) out = self.relu(out) out = self.conv2(out) out = self.bn2(out) if self.downsample is not None: identity = self.downsample(x) out += identity out = self.relu(out) return out class Bottleneck(nn.Module): # Bottleneck in torchvision places the stride for downsampling at 3x3 convolution(self.conv2) # while original implementation places the stride at the first 1x1 convolution(self.conv1) # according to "Deep residual learning for image recognition"https://arxiv.org/abs/1512.03385. # This variant is also known as ResNet V1.5 and improves accuracy according to # https://ngc.nvidia.com/catalog/model-scripts/nvidia:resnet_50_v1_5_for_pytorch. expansion = 4 def __init__(self, inplanes, planes, stride=1, downsample=None, groups=1, base_width=64, dilation=1, norm_layer=None): super(Bottleneck, self).__init__() if norm_layer is None: norm_layer = nn.BatchNorm2d width = int(planes * (base_width / 64.)) * groups # Both self.conv2 and self.downsample layers downsample the input when stride != 1 self.conv1 = conv1x1(inplanes, width) self.bn1 = norm_layer(width) self.conv2 = conv3x3(width, width, stride, groups, dilation) self.bn2 = norm_layer(width) self.conv3 = conv1x1(width, planes * self.expansion) self.bn3 = norm_layer(planes * self.expansion) self.relu = nn.ReLU(inplace=True) self.downsample = downsample self.stride = stride def forward(self, x): identity = x out = self.conv1(x) out = self.bn1(out) out = self.relu(out) out = self.conv2(out) out = self.bn2(out) out = self.relu(out) out = self.conv3(out) out = self.bn3(out) if self.downsample is not None: identity = self.downsample(x) out += identity out = self.relu(out) return out class ResNet(nn.Module): def __init__(self, block, layers, num_classes=1000, zero_init_residual=False, groups=1, width_per_group=64, replace_stride_with_dilation=None, norm_layer=None): super(ResNet, self).__init__() if norm_layer is None: norm_layer = nn.BatchNorm2d self._norm_layer = norm_layer self.inplanes = 64 self.dilation = 1 if replace_stride_with_dilation is None: # each element in the tuple indicates if we should replace # the 2x2 stride with a dilated convolution instead replace_stride_with_dilation = [False, False, False] if len(replace_stride_with_dilation) != 3: raise ValueError("replace_stride_with_dilation should be None " "or a 3-element tuple, got {}".format(replace_stride_with_dilation)) self.groups = groups self.base_width = width_per_group self.conv1 = nn.Conv2d(3, self.inplanes, kernel_size=7, stride=2, padding=3, bias=False) self.bn1 = norm_layer(self.inplanes) self.relu = nn.ReLU(inplace=True) self.maxpool = nn.MaxPool2d(kernel_size=3, stride=2, padding=1) self.layer1 = self._make_layer(block, 64, layers[0]) self.layer2 = self._make_layer(block, 128, layers[1], stride=2, dilate=replace_stride_with_dilation[0]) self.layer3 = self._make_layer(block, 256, layers[2], stride=2, dilate=replace_stride_with_dilation[1]) self.layer4 = self._make_layer(block, 512, layers[3], stride=2, dilate=replace_stride_with_dilation[2]) #self.avgpool = nn.AdaptiveAvgPool2d((1, 1)) #self.fc = nn.Linear(512 * block.expansion, num_classes) for m in self.modules(): if isinstance(m, nn.Conv2d): nn.init.kaiming_normal_(m.weight, mode='fan_out', nonlinearity='relu') elif isinstance(m, (nn.BatchNorm2d, nn.GroupNorm)): nn.init.constant_(m.weight, 1) nn.init.constant_(m.bias, 0) # Zero-initialize the last BN in each residual branch, # so that the residual branch starts with zeros, and each residual block behaves like an identity. # This improves the model by 0.2~0.3% according to https://arxiv.org/abs/1706.02677 if zero_init_residual: for m in self.modules(): if isinstance(m, Bottleneck): nn.init.constant_(m.bn3.weight, 0) elif isinstance(m, BasicBlock): nn.init.constant_(m.bn2.weight, 0) def _make_layer(self, block, planes, blocks, stride=1, dilate=False): norm_layer = self._norm_layer downsample = None previous_dilation = self.dilation if dilate: self.dilation *= stride stride = 1 if stride != 1 or self.inplanes != planes * block.expansion: downsample = nn.Sequential( conv1x1(self.inplanes, planes * block.expansion, stride), norm_layer(planes * block.expansion), ) layers = [] layers.append(block(self.inplanes, planes, stride, downsample, self.groups, self.base_width, previous_dilation, norm_layer)) self.inplanes = planes * block.expansion for _ in range(1, blocks): layers.append(block(self.inplanes, planes, groups=self.groups, base_width=self.base_width, dilation=self.dilation, norm_layer=norm_layer)) return nn.Sequential(*layers) def _forward_impl(self, x): # See note [TorchScript super()] features = [] x = self.conv1(x) x = self.bn1(x) x = self.relu(x) x = self.maxpool(x) x = self.layer1(x) features.append(x) x = self.layer2(x) features.append(x) x = self.layer3(x) features.append(x) x = self.layer4(x) features.append(x) #x = self.avgpool(x) #x = torch.flatten(x, 1) #x = self.fc(x) return features def forward(self, x): return self._forward_impl(x) def resnext101_32x8d(pretrained=True, **kwargs): """Constructs a ResNet-152 model. Args: pretrained (bool): If True, returns a model pre-trained on ImageNet """ kwargs['groups'] = 32 kwargs['width_per_group'] = 8 model = ResNet(Bottleneck, [3, 4, 23, 3], **kwargs) if pretrained: pretrained_dict = model_zoo.load_url(model_urls['resnext101_32x8d'], cfg.ROOT_DIR + '/' + cfg.MODEL.MODEL_REPOSITORY) #pretrained_model = torchvision.models.resnet152(pretrained=True) #pretrained_model = gcv.models.resnet152(pretrained=True) #pretrained_dict = pretrained_model.state_dict() model_dict = model.state_dict() pretrained_dict = {k:v for k, v in pretrained_dict.items() if k in model_dict} model_dict.update(pretrained_dict) model.load_state_dict(model_dict) return model if __name__ == '__main__': import torch model = resnext101_32x8d(True).cuda() rgb = torch.rand((2, 3, 256, 256)).cuda() out = model(rgb) print(len(out)) """ def load_url(url, model_dir='./pretrained', map_location=None): if not os.path.exists(model_dir): os.makedirs(model_dir) filename = url.split('/')[-1] cached_file = os.path.join(model_dir, filename) if not os.path.exists(cached_file): sys.stderr.write('Downloading: "{}" to {}\n'.format(url, cached_file)) urlretrieve(url, cached_file) return torch.load(cached_file, map_location=map_location) def conv3x3(in_planes, out_planes, stride=1): "3x3 convolution with padding" return nn.Conv2d(in_planes, out_planes, kernel_size=3, stride=stride, padding=1, bias=False) class GroupBottleneck(nn.Module): expansion = 2 def __init__(self, inplanes, planes, stride=1, groups=1, downsample=None): super(GroupBottleneck, self).__init__() self.conv1 = nn.Conv2d(inplanes, planes, kernel_size=1, bias=False) self.bn1 = nn.BatchNorm2d(planes) self.conv2 = nn.Conv2d(planes, planes, kernel_size=3, stride=stride, padding=1, groups=groups, bias=False) self.bn2 = nn.BatchNorm2d(planes) self.conv3 = nn.Conv2d(planes, planes * 2, kernel_size=1, bias=False) self.bn3 = nn.BatchNorm2d(planes * 2) self.relu = nn.ReLU(inplace=True) self.downsample = downsample self.stride = stride def forward(self, x): residual = x out = self.conv1(x) out = self.bn1(out) out = self.relu(out) out = self.conv2(out) out = self.bn2(out) out = self.relu(out) out = self.conv3(out) out = self.bn3(out) if self.downsample is not None: residual = self.downsample(x) out += residual out = self.relu(out) return out class ResNeXt(nn.Module): def __init__(self, block, layers, groups=32, num_classes=1000): self.inplanes = 128 super(ResNeXt, self).__init__() self.conv1 = conv3x3(3, 64, stride=2) self.bn1 = nn.BatchNorm2d(64) self.relu1 = nn.ReLU(inplace=True) self.conv2 = conv3x3(64, 64) self.bn2 = nn.BatchNorm2d(64) self.relu2 = nn.ReLU(inplace=True) self.conv3 = conv3x3(64, 128) self.bn3 = nn.BatchNorm2d(128) self.relu3 = nn.ReLU(inplace=True) self.maxpool = nn.MaxPool2d(kernel_size=3, stride=2, padding=1) self.layer1 = self._make_layer(block, 128, layers[0], groups=groups) self.layer2 = self._make_layer(block, 256, layers[1], stride=2, groups=groups) self.layer3 = self._make_layer(block, 512, layers[2], stride=2, groups=groups) self.layer4 = self._make_layer(block, 1024, layers[3], stride=2, groups=groups) #self.avgpool = nn.AvgPool2d(7, stride=1) #self.fc = nn.Linear(1024 * block.expansion, num_classes) for m in self.modules(): if isinstance(m, nn.Conv2d): n = m.kernel_size[0] * m.kernel_size[1] * m.out_channels // m.groups m.weight.data.normal_(0, math.sqrt(2. / n)) elif isinstance(m, nn.BatchNorm2d): m.weight.data.fill_(1) m.bias.data.zero_() def _make_layer(self, block, planes, blocks, stride=1, groups=1): downsample = None if stride != 1 or self.inplanes != planes * block.expansion: downsample = nn.Sequential( nn.Conv2d(self.inplanes, planes * block.expansion, kernel_size=1, stride=stride, bias=False), nn.BatchNorm2d(planes * block.expansion), ) layers = [] layers.append(block(self.inplanes, planes, stride, groups, downsample)) self.inplanes = planes * block.expansion for i in range(1, blocks): layers.append(block(self.inplanes, planes, groups=groups)) return nn.Sequential(*layers) def forward(self, x): features = [] x = self.relu1(self.bn1(self.conv1(x))) x = self.relu2(self.bn2(self.conv2(x))) x = self.relu3(self.bn3(self.conv3(x))) x = self.maxpool(x) x = self.layer1(x) features.append(x) x = self.layer2(x) features.append(x) x = self.layer3(x) features.append(x) x = self.layer4(x) features.append(x) return features def resnext101(pretrained=True, **kwargs): ''' Constructs a resnext-101 model. #Args: pretrained (bool): If True, returns a model pre-trained on Places ''' model = ResNeXt(GroupBottleneck, [3, 4, 23, 3], **kwargs) if pretrained: model.load_state_dict(load_url(), strict=False) #model.load_state_dict(torch.load('./pretrained/resnet101-imagenet.pth', map_location=None), strict=False) return model """
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
import torch import torch.nn.functional from . import network_auxi as network from lib.configs.config import cfg from lib.utils.net_tools import * from lib.models.PWN_planes import PWNPlanesLoss from lib.models.PWN_edges import EdgeguidedNormalRegressionLoss from lib.models.ranking_loss import EdgeguidedRankingLoss from lib.models.ILNR_loss import MEADSTD_TANH_NORM_Loss from lib.models.MSGIL_loss import MSGIL_NORM_Loss class RelDepthModel(nn.Module): def __init__(self): super(RelDepthModel, self).__init__() self.depth_model = DepthModel() self.losses = ModelLoss() def forward(self, data, is_train=True): # Input data is a_real, predicted data is b_fake, groundtruth is b_real self.inputs = data['rgb'].cuda() self.logit, self.auxi = self.depth_model(self.inputs) if is_train: self.losses_dict = self.losses.criterion(self.logit, self.auxi, data) else: self.losses_dict = {'total_loss': torch.tensor(0.0, dtype=torch.float).cuda()} return {'decoder': self.logit, 'auxi': self.auxi, 'losses': self.losses_dict} def inference(self, data): with torch.no_grad(): out = self.forward(data, is_train=False) pred_depth = out['decoder'] pred_disp = out['auxi'] pred_depth_out = pred_depth return {'pred_depth': pred_depth_out, 'pred_disp': pred_disp} class ModelLoss(nn.Module): def __init__(self): super(ModelLoss, self).__init__() ################Loss for the main branch, i.e. on the depth map################# # Geometry Loss self.pn_plane = PWNPlanesLoss(focal_x=cfg.DATASET.FOCAL_X, focal_y=cfg.DATASET.FOCAL_Y, input_size=cfg.DATASET.CROP_SIZE, sample_groups=5000, xyz_mode='xyz') self.pn_edge = EdgeguidedNormalRegressionLoss(mask_value=-1e-8, max_threshold=10.1) # self.surface_normal_loss = SurfaceNormalLoss() # the scale can be adjusted self.msg_normal_loss = MSGIL_NORM_Loss(scale=4, valid_threshold=-1e-8) # Scale shift invariant. SSIMAEL_Loss is MIDAS loss. MEADSTD_TANH_NORM_Loss is our normalization loss. self.meanstd_tanh_loss = MEADSTD_TANH_NORM_Loss(valid_threshold=-1e-8) self.ranking_edge_loss = EdgeguidedRankingLoss(mask_value=-1e-8) ################Loss for the auxi branch, i.e. on the disp map################# # the scale can be adjusted self.msg_normal_auxiloss = MSGIL_NORM_Loss(scale=4, valid_threshold=-1e-8) # Scale shift invariant. SSIMAEL_Loss is MIDAS loss. MEADSTD_TANH_NORM_Loss is our normalization loss. self.meanstd_tanh_auxiloss = MEADSTD_TANH_NORM_Loss(valid_threshold=-1e-8) self.ranking_edge_auxiloss = EdgeguidedRankingLoss(mask_value=-1e-8) def criterion(self, pred_logit, auxi, data): loss1 = self.decoder_loss(pred_logit, data) loss2 = self.auxi_loss(auxi, data) loss = {} loss.update(loss1) loss.update(loss2) loss['total_loss'] = loss1['total_loss'] + loss2['total_loss'] return loss def auxi_loss(self, auxi, data): loss = {} if 'disp' not in data: return {'total_loss': torch.tensor(0.0).cuda()} gt_disp = data['disp'].to(device=auxi.device) mask_mid_quality = data['quality_flg'] >= 2 gt_disp_mid = gt_disp[mask_mid_quality] auxi_mid = auxi[mask_mid_quality] if '_ranking-edge-auxi_' in cfg.TRAIN.LOSS_MODE.lower(): loss['ranking-edge_auxiloss'] = self.ranking_edge_auxiloss(auxi, gt_disp, data['rgb']) if '_msgil-normal-auxi_' in cfg.TRAIN.LOSS_MODE.lower(): loss['msg_normal_auxiloss'] = (self.msg_normal_auxiloss(auxi_mid, gt_disp_mid) * 0.5).float() if '_meanstd-tanh-auxi_' in cfg.TRAIN.LOSS_MODE.lower(): loss['meanstd-tanh_auxiloss'] = self.meanstd_tanh_auxiloss(auxi_mid, gt_disp_mid) total_loss = sum(loss.values()) loss['total_loss'] = total_loss * cfg.TRAIN.LOSS_AUXI_WEIGHT return loss def decoder_loss(self, pred_logit, data): pred_depth = pred_logit gt_depth = data['depth'].to(device=pred_depth.device) # High-quality data, except webstereo data mask_high_quality = data['quality_flg'] ==3 mask_mid_quality = data['quality_flg'] >= 2 # gt_depth_high = gt_depth[mask_high_quality] # pred_depth_high = pred_depth[mask_high_quality] gt_depth_mid = gt_depth[mask_mid_quality] pred_depth_mid = pred_depth[mask_mid_quality] #gt_depth_filter = data['mask_highquality']] #pred_depth_filter = pred_depth[data['mask_highquality']] #focal_length_filter = data['focal_length'][data['mask_highquality']] # if gt_depth_high.ndim == 3: # gt_depth_high = gt_depth_high[None, :, :, :] # pred_depth_high = pred_depth_high[None, :, :, :] if gt_depth_mid.ndim == 3: gt_depth_mid = gt_depth_mid[None, :, :, :] pred_depth_mid = pred_depth_mid[None, :, :, :] loss = {} if '_pairwise-normal-regress-edge_' in cfg.TRAIN.LOSS_MODE.lower() or \ '_pairwise-normal-regress-plane_' in cfg.TRAIN.LOSS_MODE.lower(): pred_ssinv = recover_scale_shift_depth(pred_depth, gt_depth, min_threshold=-1e-8, max_threshold=10.1) else: pred_ssinv = None # Geometry Loss if '_pairwise-normal-regress-plane_' in cfg.TRAIN.LOSS_MODE.lower(): focal_length = data['focal_length'] if 'focal_length' in data else None loss['pairwise-normal-regress-plane_loss'] = self.pn_plane(gt_depth, pred_ssinv, data['planes'], focal_length) if '_pairwise-normal-regress-edge_' in cfg.TRAIN.LOSS_MODE.lower(): if mask_high_quality.sum(): loss['pairwise-normal-regress-edge_loss'] = self.pn_edge(pred_ssinv[mask_high_quality], gt_depth[mask_high_quality], data['rgb'][mask_high_quality], focal_length=data['focal_length'][mask_high_quality]) else: loss['pairwise-normal-regress-edge_loss'] = pred_ssinv.sum() * 0. # Scale-shift Invariant Loss if '_meanstd-tanh_' in cfg.TRAIN.LOSS_MODE.lower(): if mask_mid_quality.sum(): loss_ssi = self.meanstd_tanh_loss(pred_depth_mid, gt_depth_mid) loss['meanstd-tanh_loss'] = loss_ssi else: loss['meanstd-tanh_loss'] = pred_depth.sum() * 0. if '_ranking-edge_' in cfg.TRAIN.LOSS_MODE.lower(): loss['ranking-edge_loss'] = self.ranking_edge_loss(pred_depth, gt_depth, data['rgb']) # Multi-scale Gradient Loss if '_msgil-normal_' in cfg.TRAIN.LOSS_MODE.lower(): if mask_mid_quality.sum(): loss['msg_normal_loss'] = (self.msg_normal_loss(pred_depth_mid, gt_depth_mid) * 0.5).float() else: loss['msg_normal_loss'] = pred_depth.sum() * 0. total_loss = sum(loss.values()) loss['total_loss'] = total_loss return loss class ModelOptimizer(object): def __init__(self, model): super(ModelOptimizer, self).__init__() encoder_params = [] encoder_params_names = [] decoder_params = [] decoder_params_names = [] nograd_param_names = [] for key, value in model.named_parameters(): if value.requires_grad: if 'res' in key: encoder_params.append(value) encoder_params_names.append(key) else: decoder_params.append(value) decoder_params_names.append(key) else: nograd_param_names.append(key) lr_encoder = cfg.TRAIN.BASE_LR lr_decoder = cfg.TRAIN.BASE_LR * cfg.TRAIN.SCALE_DECODER_LR weight_decay = 0.0005 net_params = [ {'params': encoder_params, 'lr': lr_encoder, 'weight_decay': weight_decay}, {'params': decoder_params, 'lr': lr_decoder, 'weight_decay': weight_decay}, ] self.optimizer = torch.optim.SGD(net_params, momentum=0.9) self.model = model def optim(self, loss): self.optimizer.zero_grad() loss_all = loss['total_loss'] loss_all.backward() torch.nn.utils.clip_grad_norm_(self.model.parameters(), 10) self.optimizer.step() class DepthModel(nn.Module): def __init__(self): super(DepthModel, self).__init__() backbone = network.__name__.split('.')[-1] + '.' + cfg.MODEL.ENCODER self.encoder_modules = get_func(backbone)() self.decoder_modules = network.Decoder() self.auxi_modules = network.AuxiNetV2() def forward(self, x): lateral_out = self.encoder_modules(x) out_logit, auxi_input = self.decoder_modules(lateral_out) out_auxi = self.auxi_modules(auxi_input) return out_logit, out_auxi def recover_scale_shift_depth(pred, gt, min_threshold=1e-8, max_threshold=1e8): b, c, h, w = pred.shape mask = (gt > min_threshold) & (gt < max_threshold) # [b, c, h, w] EPS = 1e-6 * torch.eye(2, dtype=pred.dtype, device=pred.device) scale_shift_batch = [] ones_img = torch.ones((1, h, w), dtype=pred.dtype, device=pred.device) for i in range(b): mask_i = mask[i, ...] pred_valid_i = pred[i, ...][mask_i] ones_i = ones_img[mask_i] pred_valid_ones_i = torch.stack((pred_valid_i, ones_i), dim=0) # [c+1, n] A_i = torch.matmul(pred_valid_ones_i, pred_valid_ones_i.permute(1, 0)) # [2, 2] A_inverse = torch.inverse(A_i + EPS) gt_i = gt[i, ...][mask_i] B_i = torch.matmul(pred_valid_ones_i, gt_i)[:, None] # [2, 1] scale_shift_i = torch.matmul(A_inverse, B_i) # [2, 1] scale_shift_batch.append(scale_shift_i) scale_shift_batch = torch.stack(scale_shift_batch, dim=0) # [b, 2, 1] ones = torch.ones_like(pred) pred_ones = torch.cat((pred, ones), dim=1) # [b, 2, h, w] pred_scale_shift = torch.matmul(pred_ones.permute(0, 2, 3, 1).reshape(b, h * w, 2), scale_shift_batch) # [b, h*w, 1] pred_scale_shift = pred_scale_shift.permute(0, 2, 1).reshape((b, c, h, w)) return pred_scale_shift
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
import torch.nn as nn import torch.utils.model_zoo as model_zoo import torchvision from lib.configs.config import cfg import torch.nn as NN __all__ = ['ResNet', 'resnet18', 'resnet34', 'resnet50', 'resnet101', 'resnet152'] model_urls = { 'resnet18': 'https://download.pytorch.org/models/resnet18-5c106cde.pth', 'resnet34': 'https://download.pytorch.org/models/resnet34-333f7ec4.pth', 'resnet50': 'https://download.pytorch.org/models/resnet50-19c8e357.pth', 'resnet101': 'https://download.pytorch.org/models/resnet101-5d3b4d8f.pth', 'resnet152': 'https://download.pytorch.org/models/resnet152-b121ed2d.pth', } def conv3x3(in_planes, out_planes, stride=1): """3x3 convolution with padding""" return nn.Conv2d(in_planes, out_planes, kernel_size=3, stride=stride, padding=1, bias=False) class BasicBlock(nn.Module): expansion = 1 def __init__(self, inplanes, planes, stride=1, downsample=None): super(BasicBlock, self).__init__() self.conv1 = conv3x3(inplanes, planes, stride) self.bn1 = NN.BatchNorm2d(planes) #NN.BatchNorm2d self.relu = nn.ReLU(inplace=True) self.conv2 = conv3x3(planes, planes) self.bn2 = NN.BatchNorm2d(planes) #NN.BatchNorm2d self.downsample = downsample self.stride = stride def forward(self, x): residual = x out = self.conv1(x) out = self.bn1(out) out = self.relu(out) out = self.conv2(out) out = self.bn2(out) if self.downsample is not None: residual = self.downsample(x) out += residual out = self.relu(out) return out class Bottleneck(nn.Module): expansion = 4 def __init__(self, inplanes, planes, stride=1, downsample=None): super(Bottleneck, self).__init__() self.conv1 = nn.Conv2d(inplanes, planes, kernel_size=1, bias=False) self.bn1 = NN.BatchNorm2d(planes) #NN.BatchNorm2d self.conv2 = nn.Conv2d(planes, planes, kernel_size=3, stride=stride, padding=1, bias=False) self.bn2 = NN.BatchNorm2d(planes) #NN.BatchNorm2d self.conv3 = nn.Conv2d(planes, planes * self.expansion, kernel_size=1, bias=False) self.bn3 = NN.BatchNorm2d(planes * self.expansion) #NN.BatchNorm2d self.relu = nn.ReLU(inplace=True) self.downsample = downsample self.stride = stride def forward(self, x): residual = x out = self.conv1(x) out = self.bn1(out) out = self.relu(out) out = self.conv2(out) out = self.bn2(out) out = self.relu(out) out = self.conv3(out) out = self.bn3(out) if self.downsample is not None: residual = self.downsample(x) out += residual out = self.relu(out) return out class ResNet(nn.Module): def __init__(self, block, layers, num_classes=1000): self.inplanes = 64 super(ResNet, self).__init__() self.conv1 = nn.Conv2d(3, 64, kernel_size=7, stride=2, padding=3, bias=False) self.bn1 = NN.BatchNorm2d(64) #NN.BatchNorm2d self.relu = nn.ReLU(inplace=True) self.maxpool = nn.MaxPool2d(kernel_size=3, stride=2, padding=1) self.layer1 = self._make_layer(block, 64, layers[0]) self.layer2 = self._make_layer(block, 128, layers[1], stride=2) self.layer3 = self._make_layer(block, 256, layers[2], stride=2) self.layer4 = self._make_layer(block, 512, layers[3], stride=2) #self.avgpool = nn.AvgPool2d(7, stride=1) #self.fc = nn.Linear(512 * block.expansion, num_classes) for m in self.modules(): if isinstance(m, nn.Conv2d): nn.init.kaiming_normal_(m.weight, mode='fan_out', nonlinearity='relu') elif isinstance(m, nn.BatchNorm2d): nn.init.constant_(m.weight, 1) nn.init.constant_(m.bias, 0) def _make_layer(self, block, planes, blocks, stride=1): downsample = None if stride != 1 or self.inplanes != planes * block.expansion: downsample = nn.Sequential( nn.Conv2d(self.inplanes, planes * block.expansion, kernel_size=1, stride=stride, bias=False), NN.BatchNorm2d(planes * block.expansion), #NN.BatchNorm2d ) layers = [] layers.append(block(self.inplanes, planes, stride, downsample)) self.inplanes = planes * block.expansion for i in range(1, blocks): layers.append(block(self.inplanes, planes)) return nn.Sequential(*layers) def forward(self, x): features = [] x = self.conv1(x) x = self.bn1(x) x = self.relu(x) x = self.maxpool(x) x = self.layer1(x) features.append(x) x = self.layer2(x) features.append(x) x = self.layer3(x) features.append(x) x = self.layer4(x) features.append(x) return features def resnet18(pretrained=True, **kwargs): """Constructs a ResNet-18 model. Args: pretrained (bool): If True, returns a model pre-trained on ImageNet """ model = ResNet(BasicBlock, [2, 2, 2, 2], **kwargs) if pretrained: pretrained_dict = model_zoo.load_url(model_urls['resnet18'], cfg.ROOT_DIR + '/' + cfg.MODEL.MODEL_REPOSITORY) #pretrained_model = torchvision.models.resnet18(pretrained=True) #pretrained_dict = pretrained_model.state_dict() model_dict = model.state_dict() pretrained_dict = {k:v for k, v in pretrained_dict.items() if k in model_dict} model_dict.update(pretrained_dict) model.load_state_dict(model_dict) return model def resnet34(pretrained=True, **kwargs): """Constructs a ResNet-34 model. Args: pretrained (bool): If True, returns a model pre-trained on ImageNet """ model = ResNet(BasicBlock, [3, 4, 6, 3], **kwargs) if pretrained: pretrained_dict = model_zoo.load_url(model_urls['resnet34'], cfg.ROOT_DIR + '/' + cfg.MODEL.MODEL_REPOSITORY) #pretrained_model = torchvision.models.resnet34(pretrained=True) #pretrained_dict = pretrained_model.state_dict() model_dict = model.state_dict() pretrained_dict = {k:v for k, v in pretrained_dict.items() if k in model_dict} model_dict.update(pretrained_dict) model.load_state_dict(model_dict) return model def resnet50(pretrained=True, **kwargs): """Constructs a ResNet-50 model. Args: pretrained (bool): If True, returns a model pre-trained on ImageNet """ model = ResNet(Bottleneck, [3, 4, 6, 3], **kwargs) if pretrained: pretrained_dict = model_zoo.load_url(model_urls['resnet50'], cfg.ROOT_DIR + '/' + cfg.MODEL.MODEL_REPOSITORY) #pretrained_model = torchvision.models.resnet50(pretrained=True) #pretrained_model = gcv.models.resnet50(pretrained=True) #pretrained_dict = pretrained_model.state_dict() model_dict = model.state_dict() pretrained_dict = {k:v for k, v in pretrained_dict.items() if k in model_dict} model_dict.update(pretrained_dict) model.load_state_dict(model_dict) return model def resnet101(pretrained=True, **kwargs): """Constructs a ResNet-101 model. Args: pretrained (bool): If True, returns a model pre-trained on ImageNet """ model = ResNet(Bottleneck, [3, 4, 23, 3], **kwargs) if pretrained: pretrained_dict = model_zoo.load_url(model_urls['resnet101'], cfg.ROOT_DIR + '/' + cfg.MODEL.MODEL_REPOSITORY) #pretrained_model = torchvision.models.resnet101(pretrained=True) #pretrained_model = gcv.models.resnet101(pretrained=True) #pretrained_dict = pretrained_model.state_dict() model_dict = model.state_dict() pretrained_dict = {k:v for k, v in pretrained_dict.items() if k in model_dict} model_dict.update(pretrained_dict) model.load_state_dict(model_dict) return model def resnet152(pretrained=True, **kwargs): """Constructs a ResNet-152 model. Args: pretrained (bool): If True, returns a model pre-trained on ImageNet """ model = ResNet(Bottleneck, [3, 8, 36, 3], **kwargs) if pretrained: pretrained_dict = model_zoo.load_url(model_urls['resnet152'], cfg.ROOT_DIR + '/' + cfg.MODEL.MODEL_REPOSITORY) #pretrained_model = torchvision.models.resnet152(pretrained=True) #pretrained_model = gcv.models.resnet152(pretrained=True) #pretrained_dict = pretrained_model.state_dict() model_dict = model.state_dict() pretrained_dict = {k:v for k, v in pretrained_dict.items() if k in model_dict} model_dict.update(pretrained_dict) model.load_state_dict(model_dict) return model if __name__ == '__main__': import torch model = resnet50(True).cuda() rgb = torch.rand((2, 3, 256, 256)).cuda() out = model(rgb) print(len(out))
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
import torch from torch import nn import numpy as np import torch.nn.functional as F from lib.models.Surface_normal import surface_normal_from_depth, vis_normal """ Sampling strategies: RS (Random Sampling), EGS (Edge-Guided Sampling), and IGS (Instance-Guided Sampling) """ ########### # RANDOM SAMPLING # input: # inputs[i,:], targets[i, :], masks[i, :], self.mask_value, self.point_pairs # return: # inputs_A, inputs_B, targets_A, targets_B, consistent_masks_A, consistent_masks_B ########### def randomSamplingNormal(inputs, targets, masks, sample_num): # find A-B point pairs from predictions num_effect_pixels = torch.sum(masks) shuffle_effect_pixels = torch.randperm(num_effect_pixels).cuda() valid_inputs = inputs[:, masks] valid_targes = targets[:, masks] inputs_A = valid_inputs[:, shuffle_effect_pixels[0:sample_num*2:2]] inputs_B = valid_inputs[:, shuffle_effect_pixels[1:sample_num*2:2]] # find corresponding pairs from GT targets_A = valid_targes[:, shuffle_effect_pixels[0:sample_num*2:2]] targets_B = valid_targes[:, shuffle_effect_pixels[1:sample_num*2:2]] if inputs_A.shape[1] != inputs_B.shape[1]: num_min = min(targets_A.shape[1], targets_B.shape[1]) inputs_A = inputs_A[:, :num_min] inputs_B = inputs_B[:, :num_min] targets_A = targets_A[:, :num_min] targets_B = targets_B[:, :num_min] return inputs_A, inputs_B, targets_A, targets_B ########### # EDGE-GUIDED SAMPLING # input: # inputs[i,:], targets[i, :], masks[i, :], edges_img[i], thetas_img[i], masks[i, :], h, w # return: # inputs_A, inputs_B, targets_A, targets_B, masks_A, masks_B ########### def ind2sub(idx, cols): r = idx / cols c = idx - r * cols return r, c def sub2ind(r, c, cols): idx = r * cols + c return idx def edgeGuidedSampling(inputs, targets, edges_img, thetas_img, masks, h, w): # find edges edges_max = edges_img.max() edges_min = edges_img.min() edges_mask = edges_img.ge(edges_max*0.1) edges_loc = edges_mask.nonzero() thetas_edge = torch.masked_select(thetas_img, edges_mask) minlen = thetas_edge.size()[0] # find anchor points (i.e, edge points) sample_num = minlen index_anchors = torch.randint(0, minlen, (sample_num,), dtype=torch.long).cuda() theta_anchors = torch.gather(thetas_edge, 0, index_anchors) row_anchors, col_anchors = ind2sub(edges_loc[index_anchors].squeeze(1), w) ## compute the coordinates of 4-points, distances are from [2, 30] distance_matrix = torch.randint(3, 20, (4,sample_num)).cuda() pos_or_neg = torch.ones(4,sample_num).cuda() pos_or_neg[:2,:] = -pos_or_neg[:2,:] distance_matrix = distance_matrix.float() * pos_or_neg col = col_anchors.unsqueeze(0).expand(4, sample_num).long() + torch.round(distance_matrix.double() * torch.cos(theta_anchors).unsqueeze(0)).long() row = row_anchors.unsqueeze(0).expand(4, sample_num).long() + torch.round(distance_matrix.double() * torch.sin(theta_anchors).unsqueeze(0)).long() # constrain 0=<c<=w, 0<=r<=h # Note: index should minus 1 col[col<0] = 0 col[col>w-1] = w-1 row[row<0] = 0 row[row>h-1] = h-1 # a-b, b-c, c-d a = sub2ind(row[0,:], col[0,:], w) b = sub2ind(row[1,:], col[1,:], w) c = sub2ind(row[2,:], col[2,:], w) d = sub2ind(row[3,:], col[3,:], w) A = torch.cat((a,b,c), 0) B = torch.cat((b,c,d), 0) inputs_A = inputs[:, A] inputs_B = inputs[:, B] targets_A = targets[:, A] targets_B = targets[:, B] masks_A = torch.gather(masks, 0, A.long()) masks_B = torch.gather(masks, 0, B.long()) return inputs_A, inputs_B, targets_A, targets_B, masks_A, masks_B, sample_num, row, col class EdgeguidedNormalRegressionLoss(nn.Module): def __init__(self, point_pairs=10000, cos_theta1=0.3, cos_theta2=0.95, cos_theta3=0.5, cos_theta4=0.86, mask_value=-1e-8, max_threshold=10.1): super(EdgeguidedNormalRegressionLoss, self).__init__() self.point_pairs = point_pairs # number of point pairs self.mask_value = mask_value self.max_threshold = max_threshold self.cos_theta1 = cos_theta1 # 75 degree self.cos_theta2 = cos_theta2 # 10 degree self.cos_theta3 = cos_theta3 # 60 degree self.cos_theta4 = cos_theta4 # 30 degree self.kernel = torch.tensor(np.array([[1, 1, 1], [1, 1, 1], [1, 1, 1]], dtype=np.float32), requires_grad=False)[None, None, :, :].cuda() def scale_shift_pred_depth(self, pred, gt): b, c, h, w = pred.shape mask = (gt > self.mask_value) & (gt < self.max_threshold) # [b, c, h, w] EPS = 1e-6 * torch.eye(2, dtype=pred.dtype, device=pred.device) scale_shift_batch = [] ones_img = torch.ones((1, h, w), dtype=pred.dtype, device=pred.device) for i in range(b): mask_i = mask[i, ...] pred_valid_i = pred[i, ...][mask_i] ones_i = ones_img[mask_i] pred_valid_ones_i = torch.stack((pred_valid_i, ones_i), dim=0) # [c+1, n] A_i = torch.matmul(pred_valid_ones_i, pred_valid_ones_i.permute(1, 0)) # [2, 2] A_inverse = torch.inverse(A_i + EPS) gt_i = gt[i, ...][mask_i] B_i = torch.matmul(pred_valid_ones_i, gt_i)[:, None] # [2, 1] scale_shift_i = torch.matmul(A_inverse, B_i) # [2, 1] scale_shift_batch.append(scale_shift_i) scale_shift_batch = torch.stack(scale_shift_batch, dim=0) # [b, 2, 1] ones = torch.ones_like(pred) pred_ones = torch.cat((pred, ones), dim=1) # [b, 2, h, w] pred_scale_shift = torch.matmul(pred_ones.permute(0, 2, 3, 1).reshape(b, h * w, 2), scale_shift_batch) # [b, h*w, 1] pred_scale_shift = pred_scale_shift.permute(0, 2, 1).reshape((b, c, h, w)) return pred_scale_shift def getEdge(self, images): n,c,h,w = images.size() a = torch.Tensor([[-1, 0, 1], [-2, 0, 2], [-1, 0, 1]]).cuda().view((1,1,3,3)).repeat(1, 1, 1, 1) b = torch.Tensor([[1, 2, 1], [0, 0, 0], [-1, -2, -1]]).cuda().view((1,1,3,3)).repeat(1, 1, 1, 1) if c == 3: gradient_x = F.conv2d(images[:,0,:,:].unsqueeze(1), a) gradient_y = F.conv2d(images[:,0,:,:].unsqueeze(1), b) else: gradient_x = F.conv2d(images, a) gradient_y = F.conv2d(images, b) edges = torch.sqrt(torch.pow(gradient_x,2)+ torch.pow(gradient_y,2)) edges = F.pad(edges, (1,1,1,1), "constant", 0) thetas = torch.atan2(gradient_y, gradient_x) thetas = F.pad(thetas, (1,1,1,1), "constant", 0) return edges, thetas def getNormalEdge(self, normals): n,c,h,w = normals.size() a = torch.Tensor([[-1, 0, 1], [-2, 0, 2], [-1, 0, 1]]).cuda().view((1,1,3,3)).repeat(3, 1, 1, 1) b = torch.Tensor([[1, 2, 1], [0, 0, 0], [-1, -2, -1]]).cuda().view((1,1,3,3)).repeat(3, 1, 1, 1) gradient_x = torch.abs(F.conv2d(normals, a, groups=c)) gradient_y = torch.abs(F.conv2d(normals, b, groups=c)) gradient_x = gradient_x.mean(dim=1, keepdim=True) gradient_y = gradient_y.mean(dim=1, keepdim=True) edges = torch.sqrt(torch.pow(gradient_x,2)+ torch.pow(gradient_y,2)) edges = F.pad(edges, (1,1,1,1), "constant", 0) thetas = torch.atan2(gradient_y, gradient_x) thetas = F.pad(thetas, (1,1,1,1), "constant", 0) return edges, thetas def forward(self, pred_depths, gt_depths, images, focal_length): """ inputs and targets: surface normal image images: rgb images """ masks = gt_depths > self.mask_value #pred_depths_ss = self.scale_shift_pred_depth(pred_depths, gt_depths) inputs = surface_normal_from_depth(pred_depths, focal_length, valid_mask=masks) targets = surface_normal_from_depth(gt_depths, focal_length, valid_mask=masks) # find edges from RGB edges_img, thetas_img = self.getEdge(images) # find edges from normals edges_normal, thetas_normal = self.getNormalEdge(targets) mask_img_border = torch.ones_like(edges_normal) # normals on the borders mask_img_border[:, :, 5:-5, 5:-5] = 0 edges_normal[mask_img_border.bool()] = 0 # find edges from depth edges_depth, _ = self.getEdge(gt_depths) edges_depth_mask = edges_depth.ge(edges_depth.max() * 0.1) edges_mask_dilate = torch.clamp(torch.nn.functional.conv2d(edges_depth_mask.float(), self.kernel, padding=(1, 1)), 0, 1).bool() edges_normal[edges_mask_dilate] = 0 edges_img[edges_mask_dilate] = 0 #============================= n,c,h,w = targets.size() inputs = inputs.contiguous().view(n, c, -1).double() targets = targets.contiguous().view(n, c, -1).double() masks = masks.contiguous().view(n, -1) edges_img = edges_img.contiguous().view(n, -1).double() thetas_img = thetas_img.contiguous().view(n, -1).double() edges_normal = edges_normal.view(n, -1).double() thetas_normal = thetas_normal.view(n, -1).double() # initialization loss = torch.DoubleTensor([0.0]).cuda() for i in range(n): # Edge-Guided sampling inputs_A, inputs_B, targets_A, targets_B, masks_A, masks_B, sample_num, row_img, col_img = edgeGuidedSampling(inputs[i,:], targets[i, :], edges_img[i], thetas_img[i], masks[i, :], h, w) normal_inputs_A, normal_inputs_B, normal_targets_A, normal_targets_B, normal_masks_A, normal_masks_B, normal_sample_num, row_normal, col_normal = edgeGuidedSampling(inputs[i,:], targets[i, :], edges_normal[i], thetas_normal[i], masks[i, :], h, w) # Combine EGS + EGNS inputs_A = torch.cat((inputs_A, normal_inputs_A), 1) inputs_B = torch.cat((inputs_B, normal_inputs_B), 1) targets_A = torch.cat((targets_A, normal_targets_A), 1) targets_B = torch.cat((targets_B, normal_targets_B), 1) masks_A = torch.cat((masks_A, normal_masks_A), 0) masks_B = torch.cat((masks_B, normal_masks_B), 0) # consider forward-backward consistency checking, i.e, only compute losses of point pairs with valid GT consistency_mask = masks_A & masks_B #GT ordinal relationship target_cos = torch.abs(torch.sum(targets_A * targets_B, dim=0)) input_cos = torch.abs(torch.sum(inputs_A * inputs_B, dim=0)) # ranking regression #loss += torch.mean(torch.abs(target_cos[consistency_mask] - input_cos[consistency_mask])) # Ranking for samples mask_cos75 = target_cos < self.cos_theta1 mask_cos10 = target_cos > self.cos_theta2 # Regression for samples loss += torch.sum(torch.abs(target_cos[mask_cos75 & consistency_mask] - input_cos[mask_cos75 & consistency_mask])) / (torch.sum(mask_cos75 & consistency_mask)+1e-8) loss += torch.sum(torch.abs(target_cos[mask_cos10 & consistency_mask] - input_cos[mask_cos10 & consistency_mask])) / (torch.sum(mask_cos10 & consistency_mask)+1e-8) # Random Sampling regression random_sample_num = torch.sum(mask_cos10 & consistency_mask) + torch.sum(torch.sum(mask_cos75 & consistency_mask)) random_inputs_A, random_inputs_B, random_targets_A, random_targets_B = randomSamplingNormal(inputs[i,:], targets[i, :], masks[i, :], random_sample_num) #GT ordinal relationship random_target_cos = torch.abs(torch.sum(random_targets_A * random_targets_B, dim=0)) random_input_cos = torch.abs(torch.sum(random_inputs_A * random_inputs_B, dim=0)) loss += torch.sum(torch.abs(random_target_cos - random_input_cos)) / (random_target_cos.shape[0] + 1e-8) if loss[0] != 0: return loss[0].float() / n else: return pred_depths.sum() * 0.0 if __name__ == '__main__': import cv2 rank_loss = EdgeguidedNormalRegressionLoss() pred_depth = np.random.randn(2, 1, 480, 640) gt_depth = np.random.randn(2, 1, 480, 640) # gt_depth = cv2.imread('/hardware/yifanliu/SUNRGBD/sunrgbd-meta-data/sunrgbd_test_depth/2.png', -1) # gt_depth = gt_depth[None, :, :, None] # pred_depth = gt_depth[:, :, ::-1, :] gt_depth = torch.tensor(np.asarray(gt_depth, np.float32)).cuda() pred_depth = torch.tensor(np.asarray(pred_depth, np.float32)).cuda() loss = rank_loss(pred_depth, gt_depth) print(loss)
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
#!/usr/bin/env python2 # coding: utf-8 """ This network structure follows Ke Xian's work, "Structure-guided Ranking Loss for Single Image Depth Prediction". """ import torch import torch.nn as nn import torch.nn.init as init import torch.nn.functional as F from lib.configs.config import cfg from lib.models import Resnet, Resnext_torch def resnet18_stride32(): return DepthNet(backbone='resnet', depth=18, upfactors=[2, 2, 2, 2]) def resnet34_stride32(): return DepthNet(backbone='resnet', depth=34, upfactors=[2, 2, 2, 2]) def resnet50_stride32(): return DepthNet(backbone='resnet', depth=50, upfactors=[2, 2, 2, 2]) def resnet101_stride32(): return DepthNet(backbone='resnet', depth=101, upfactors=[2, 2, 2, 2]) def resnet152_stride32(): return DepthNet(backbone='resnet', depth=152, upfactors=[2, 2, 2, 2]) def resnext101_stride32x8d(): return DepthNet(backbone='resnext101_32x8d', depth=101, upfactors=[2, 2, 2, 2]) def mobilenetv2(): return DepthNet(backbone='mobilenetv2', depth=00, upfactors=[2, 2, 2, 2]) class AuxiBlock(nn.Module): def __init__(self, dim_in, dim_out): super().__init__() self.dim_in = dim_in self.dim_out = dim_out self.conv1 = nn.Conv2d(self.dim_in, self.dim_out, 1, stride=1, padding=0, bias=False) self.conv2 = nn.Conv2d(self.dim_out, self.dim_out, 3, stride=1, padding=1, dilation=1, bias=True) self.bn1 = nn.BatchNorm2d(self.dim_out, momentum=0.5) self.bn2 = nn.BatchNorm2d(self.dim_out, momentum=0.5) self.relu = nn.ReLU(inplace=True) def forward(self, top, lateral): if lateral.shape[2] != top.shape[2]: h, w = lateral.size(2), lateral.size(3) top = F.interpolate(input=top, size=(h, w), mode='bilinear',align_corners=True) out = torch.cat((lateral, top), dim=1) out = self.relu(self.bn1(self.conv1(out))) out = self.relu(self.bn2(self.conv2(out))) return out class AuxiNetV2(nn.Module): def __init__(self): super().__init__() self.inchannels = cfg.MODEL.RESNET_BOTTLENECK_DIM[1:] # [256, 512, 1024, 2048] self.midchannels = cfg.MODEL.LATERAL_OUT[::-1] # [256, 256, 256, 512] self.auxi_block1 = AuxiBlock(self.midchannels[2]+self.midchannels[3], 128) self.auxi_block2 = AuxiBlock(128 + self.midchannels[2], 128) self.auxi_block3 = AuxiBlock(128 + self.midchannels[2], 128) self.auxi_block4 = AuxiBlock(128 + self.midchannels[1], 128) self.auxi_block5 = AuxiBlock(128 + self.midchannels[0], 128) self.out_conv = AO(128, 1, 2) self._init_weights() def _init_weights(self): def init_func(m): if isinstance(m, nn.Conv2d): init.normal_(m.weight, std=0.01) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.ConvTranspose2d): init.normal_(m.weight, std=0.01) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.BatchNorm2d): # NN.BatchNorm2d init.constant_(m.weight, 1) init.constant_(m.bias, 0) elif isinstance(m, nn.Linear): init.normal_(m.weight, std=0.01) if m.bias is not None: init.constant_(m.bias, 0) def init_model_weight(m): for child_m in m.children(): if not isinstance(child_m, nn.ModuleList): child_m.apply(init_func) init_model_weight(self) def forward(self, auxi_in): out = self.auxi_block1(auxi_in[0], auxi_in[1]) # 1/32 out = self.auxi_block2(out, auxi_in[2]) # 1/16 out = self.auxi_block3(out, auxi_in[3]) # 1/8 out = self.auxi_block4(out, auxi_in[4]) # 1/4 out = self.auxi_block5(out, auxi_in[5]) # 1/2 out = self.out_conv(out) return out class AuxiNet(nn.Module): def __init__(self): super().__init__() self.inchannels = cfg.MODEL.RESNET_BOTTLENECK_DIM[1:] # [256, 512, 1024, 2048] self.midchannels = cfg.MODEL.LATERAL_OUT[::-1] # [256, 256, 256, 512] self.auxi_block1 = AuxiBlock(self.midchannels[2]+self.midchannels[3], 256) self.auxi_block2 = AuxiBlock(256 + self.midchannels[2], 256) self.auxi_block3 = AuxiBlock(256 + self.midchannels[2], 256) self.auxi_block4 = AuxiBlock(256 + self.midchannels[1], 256) self.auxi_block5 = AuxiBlock(256 + self.midchannels[0], 256) self.out_conv = AO(256, 1, 2) self._init_weights() def _init_weights(self): def init_func(m): if isinstance(m, nn.Conv2d): init.normal_(m.weight, std=0.01) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.ConvTranspose2d): init.normal_(m.weight, std=0.01) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.BatchNorm2d): # NN.BatchNorm2d init.constant_(m.weight, 1) init.constant_(m.bias, 0) elif isinstance(m, nn.Linear): init.normal_(m.weight, std=0.01) if m.bias is not None: init.constant_(m.bias, 0) def init_model_weight(m): for child_m in m.children(): if not isinstance(child_m, nn.ModuleList): child_m.apply(init_func) init_model_weight(self) def forward(self, auxi_in): out = self.auxi_block1(auxi_in[0], auxi_in[1]) # 1/32 out = self.auxi_block2(out, auxi_in[2]) # 1/16 out = self.auxi_block3(out, auxi_in[3]) # 1/8 out = self.auxi_block4(out, auxi_in[4]) # 1/4 out = self.auxi_block5(out, auxi_in[5]) # 1/2 out = self.out_conv(out) return out class Decoder(nn.Module): def __init__(self): super(Decoder, self).__init__() self.inchannels = cfg.MODEL.RESNET_BOTTLENECK_DIM[1:] # [256, 512, 1024, 2048] self.midchannels = cfg.MODEL.LATERAL_OUT[::-1] # [256, 256, 256, 512] self.upfactors = [2,2,2,2] self.outchannels = cfg.MODEL.DECODER_OUTPUT_C # 1 self.conv = FTB(inchannels=self.inchannels[3], midchannels=self.midchannels[3]) self.conv1 = nn.Conv2d(in_channels=self.midchannels[3], out_channels=self.midchannels[2], kernel_size=3, padding=1, stride=1, bias=True) self.upsample = nn.Upsample(scale_factor=self.upfactors[3], mode='bilinear', align_corners=True) self.ffm2 = FFM(inchannels=self.inchannels[2], midchannels=self.midchannels[2], outchannels = self.midchannels[2], upfactor=self.upfactors[2]) self.ffm1 = FFM(inchannels=self.inchannels[1], midchannels=self.midchannels[1], outchannels = self.midchannels[1], upfactor=self.upfactors[1]) self.ffm0 = FFM(inchannels=self.inchannels[0], midchannels=self.midchannels[0], outchannels = self.midchannels[0], upfactor=self.upfactors[0]) #self.outconv = nn.Conv2d(in_channels=self.inchannels[0], out_channels=self.outchannels, kernel_size=3, padding=1, stride=1, bias=True) self.outconv = AO(inchannels=self.midchannels[0], outchannels=self.outchannels, upfactor=2) self._init_params() def _init_params(self): for m in self.modules(): if isinstance(m, nn.Conv2d): init.normal_(m.weight, std=0.01) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.ConvTranspose2d): init.normal_(m.weight, std=0.01) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.BatchNorm2d): #NN.BatchNorm2d init.constant_(m.weight, 1) init.constant_(m.bias, 0) elif isinstance(m, nn.Linear): init.normal_(m.weight, std=0.01) if m.bias is not None: init.constant_(m.bias, 0) def forward(self, features): # features' shape: # 1/32, 1/16, 1/8, 1/4 # _,_,h,w = features[3].size() x_32x = self.conv(features[3]) # 1/32 x_32 = self.conv1(x_32x) x_16 = self.upsample(x_32) # 1/16 x_8 = self.ffm2(features[2], x_16) # 1/8 #print('ffm2:', x.size()) x_4 = self.ffm1(features[1], x_8) # 1/4 #print('ffm1:', x.size()) x_2 = self.ffm0(features[0], x_4) # 1/2 #print('ffm0:', x.size()) #----------------------------------------- x = self.outconv(x_2) # original size auxi_input = [x_32x, x_32, x_16, x_8, x_4, x_2] return x, auxi_input class DepthNet(nn.Module): __factory = { 18: Resnet.resnet18, 34: Resnet.resnet34, 50: Resnet.resnet50, 101: Resnet.resnet101, 152: Resnet.resnet152 } def __init__(self, backbone='resnet', depth=50, upfactors=[2, 2, 2, 2]): super(DepthNet, self).__init__() self.backbone = backbone self.depth = depth self.pretrained = cfg.MODEL.LOAD_IMAGENET_PRETRAINED_WEIGHTS # True self.inchannels = cfg.MODEL.RESNET_BOTTLENECK_DIM[1:] # [256, 512, 1024, 2048] self.midchannels = cfg.MODEL.LATERAL_OUT[::-1] # [256, 256, 256, 512] self.upfactors = upfactors self.outchannels = cfg.MODEL.DECODER_OUTPUT_C # 1 # Build model if self.backbone == 'resnet': if self.depth not in DepthNet.__factory: raise KeyError("Unsupported depth:", self.depth) self.encoder = DepthNet.__factory[depth](pretrained=self.pretrained) elif self.backbone == 'resnext101_32x8d': self.encoder = Resnext_torch.resnext101_32x8d(pretrained=self.pretrained) elif self.backbone == 'mobilenetv2': self.encoder = MobileNet_torch.mobilenet_v2(pretrained=self.pretrained) else: self.encoder = Resnext_torch.resnext101(pretrained=self.pretrained) def forward(self, x): x = self.encoder(x) # 1/32, 1/16, 1/8, 1/4 return x class FTB(nn.Module): def __init__(self, inchannels, midchannels=512): super(FTB, self).__init__() self.in1 = inchannels self.mid = midchannels self.conv1 = nn.Conv2d(in_channels=self.in1, out_channels=self.mid, kernel_size=3, padding=1, stride=1, bias=True) # NN.BatchNorm2d # self.sample_conv = nn.Sequential(nn.Conv2d(in_channels=self.mid, out_channels=self.mid, kernel_size=3, padding=1, stride=1, bias=True), # nn.ReLU(inplace=True), # nn.BatchNorm2d(num_features=self.mid), # nn.Conv2d(in_channels=self.mid, out_channels= self.mid, kernel_size=3, padding=1, stride=1, bias=True)) self.conv_branch = nn.Sequential(nn.ReLU(inplace=True), \ nn.Conv2d(in_channels=self.mid, out_channels=self.mid, kernel_size=3, padding=1, stride=1, bias=True), \ nn.BatchNorm2d(num_features=self.mid), \ nn.ReLU(inplace=True), \ nn.Conv2d(in_channels=self.mid, out_channels=self.mid, kernel_size=3, padding=1, stride=1, bias=True)) self.relu = nn.ReLU(inplace=True) self.init_params() def forward(self, x): x = self.conv1(x) x = x + self.conv_branch(x) x = self.relu(x) return x def init_params(self): for m in self.modules(): if isinstance(m, nn.Conv2d): init.normal_(m.weight, std=0.01) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.ConvTranspose2d): # init.kaiming_normal_(m.weight, mode='fan_out') init.normal_(m.weight, std=0.01) # init.xavier_normal_(m.weight) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.BatchNorm2d): # NN.BatchNorm2d init.constant_(m.weight, 1) init.constant_(m.bias, 0) elif isinstance(m, nn.Linear): init.normal_(m.weight, std=0.01) if m.bias is not None: init.constant_(m.bias, 0) class ATA(nn.Module): def __init__(self, inchannels, reduction=8): super(ATA, self).__init__() self.inchannels = inchannels self.avg_pool = nn.AdaptiveAvgPool2d(1) self.fc = nn.Sequential(nn.Linear(self.inchannels * 2, self.inchannels // reduction), nn.ReLU(inplace=True), nn.Linear(self.inchannels // reduction, self.inchannels), nn.Sigmoid()) self.init_params() def forward(self, low_x, high_x): n, c, _, _ = low_x.size() x = torch.cat([low_x, high_x], 1) x = self.avg_pool(x) x = x.view(n, -1) x = self.fc(x).view(n, c, 1, 1) x = low_x * x + high_x return x def init_params(self): for m in self.modules(): if isinstance(m, nn.Conv2d): # init.kaiming_normal_(m.weight, mode='fan_out') # init.normal(m.weight, std=0.01) init.xavier_normal_(m.weight) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.ConvTranspose2d): # init.kaiming_normal_(m.weight, mode='fan_out') # init.normal_(m.weight, std=0.01) init.xavier_normal_(m.weight) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.BatchNorm2d): # NN.BatchNorm2d init.constant_(m.weight, 1) init.constant_(m.bias, 0) elif isinstance(m, nn.Linear): init.normal_(m.weight, std=0.01) if m.bias is not None: init.constant_(m.bias, 0) class FFM(nn.Module): def __init__(self, inchannels, midchannels, outchannels, upfactor=2): super(FFM, self).__init__() self.inchannels = inchannels self.midchannels = midchannels self.outchannels = outchannels self.upfactor = upfactor self.ftb1 = FTB(inchannels=self.inchannels, midchannels=self.midchannels) # self.ata = ATA(inchannels = self.midchannels) self.ftb2 = FTB(inchannels=self.midchannels, midchannels=self.outchannels) self.upsample = nn.Upsample(scale_factor=self.upfactor, mode='bilinear', align_corners=True) self.init_params() def forward(self, low_x, high_x): x = self.ftb1(low_x) x = x + high_x x = self.ftb2(x) x = self.upsample(x) return x def init_params(self): for m in self.modules(): if isinstance(m, nn.Conv2d): # init.kaiming_normal_(m.weight, mode='fan_out') init.normal_(m.weight, std=0.01) # init.xavier_normal_(m.weight) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.ConvTranspose2d): # init.kaiming_normal_(m.weight, mode='fan_out') init.normal_(m.weight, std=0.01) # init.xavier_normal_(m.weight) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.BatchNorm2d): # NN.Batchnorm2d init.constant_(m.weight, 1) init.constant_(m.bias, 0) elif isinstance(m, nn.Linear): init.normal_(m.weight, std=0.01) if m.bias is not None: init.constant_(m.bias, 0) class AO(nn.Module): # Adaptive output module def __init__(self, inchannels, outchannels, upfactor=2): super(AO, self).__init__() self.inchannels = inchannels self.outchannels = outchannels self.upfactor = upfactor self.adapt_conv = nn.Sequential( nn.Conv2d(in_channels=self.inchannels, out_channels=self.inchannels // 2, kernel_size=3, padding=1, stride=1, bias=True), \ nn.BatchNorm2d(num_features=self.inchannels // 2), \ nn.ReLU(inplace=True), \ nn.Conv2d(in_channels=self.inchannels // 2, out_channels=self.outchannels, kernel_size=3, padding=1, stride=1, bias=True), \ nn.Upsample(scale_factor=self.upfactor, mode='bilinear', align_corners=True)) self.init_params() def forward(self, x): x = self.adapt_conv(x) return x def init_params(self): for m in self.modules(): if isinstance(m, nn.Conv2d): # init.kaiming_normal_(m.weight, mode='fan_out') init.normal_(m.weight, std=0.01) # init.xavier_normal_(m.weight) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.ConvTranspose2d): # init.kaiming_normal_(m.weight, mode='fan_out') init.normal_(m.weight, std=0.01) # init.xavier_normal_(m.weight) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.BatchNorm2d): # NN.Batchnorm2d init.constant_(m.weight, 1) init.constant_(m.bias, 0) elif isinstance(m, nn.Linear): init.normal_(m.weight, std=0.01) if m.bias is not None: init.constant_(m.bias, 0) class ASPP(nn.Module): def __init__(self, inchannels=256, planes=128, rates=[1, 6, 12, 18]): super(ASPP, self).__init__() self.inchannels = inchannels self.planes = planes self.rates = rates self.kernel_sizes = [] self.paddings = [] for rate in self.rates: if rate == 1: self.kernel_sizes.append(1) self.paddings.append(0) else: self.kernel_sizes.append(3) self.paddings.append(rate) self.atrous_0 = nn.Sequential( nn.Conv2d(in_channels=self.inchannels, out_channels=self.planes, kernel_size=self.kernel_sizes[0], stride=1, padding=self.paddings[0], dilation=self.rates[0], bias=True), nn.ReLU(inplace=True), nn.BatchNorm2d(num_features=self.planes) ) self.atrous_1 = nn.Sequential( nn.Conv2d(in_channels=self.inchannels, out_channels=self.planes, kernel_size=self.kernel_sizes[1], stride=1, padding=self.paddings[1], dilation=self.rates[1], bias=True), nn.ReLU(inplace=True), nn.BatchNorm2d(num_features=self.planes), ) self.atrous_2 = nn.Sequential( nn.Conv2d(in_channels=self.inchannels, out_channels=self.planes, kernel_size=self.kernel_sizes[2], stride=1, padding=self.paddings[2], dilation=self.rates[2], bias=True), nn.ReLU(inplace=True), nn.BatchNorm2d(num_features=self.planes), ) self.atrous_3 = nn.Sequential( nn.Conv2d(in_channels=self.inchannels, out_channels=self.planes, kernel_size=self.kernel_sizes[3], stride=1, padding=self.paddings[3], dilation=self.rates[3], bias=True), nn.ReLU(inplace=True), nn.BatchNorm2d(num_features=self.planes), ) # self.conv = nn.Conv2d(in_channels=self.planes * 4, out_channels=self.inchannels, kernel_size=3, padding=1, stride=1, bias=True) def forward(self, x): x = torch.cat([self.atrous_0(x), self.atrous_1(x), self.atrous_2(x), self.atrous_3(x)], 1) # x = self.conv(x) return x # ============================================================================================================== class ResidualConv(nn.Module): def __init__(self, inchannels): super(ResidualConv, self).__init__() # NN.BatchNorm2d self.conv = nn.Sequential( # nn.BatchNorm2d(num_features=inchannels), nn.ReLU(inplace=False), # nn.Conv2d(in_channels=inchannels, out_channels=inchannels, kernel_size=3, padding=1, stride=1, groups=inchannels,bias=True), # nn.Conv2d(in_channels=inchannels, out_channels=inchannels, kernel_size=1, padding=0, stride=1, groups=1,bias=True) nn.Conv2d(in_channels=inchannels, out_channels=inchannels / 2, kernel_size=3, padding=1, stride=1, bias=False), nn.BatchNorm2d(num_features=inchannels / 2), nn.ReLU(inplace=False), nn.Conv2d(in_channels=inchannels / 2, out_channels=inchannels, kernel_size=3, padding=1, stride=1, bias=False) ) self.init_params() def forward(self, x): x = self.conv(x) + x return x def init_params(self): for m in self.modules(): if isinstance(m, nn.Conv2d): # init.kaiming_normal_(m.weight, mode='fan_out') init.normal_(m.weight, std=0.01) # init.xavier_normal_(m.weight) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.ConvTranspose2d): # init.kaiming_normal_(m.weight, mode='fan_out') init.normal_(m.weight, std=0.01) # init.xavier_normal_(m.weight) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.BatchNorm2d): # NN.BatchNorm2d init.constant_(m.weight, 1) init.constant_(m.bias, 0) elif isinstance(m, nn.Linear): init.normal_(m.weight, std=0.01) if m.bias is not None: init.constant_(m.bias, 0) class FeatureFusion(nn.Module): def __init__(self, inchannels, outchannels): super(FeatureFusion, self).__init__() self.conv = ResidualConv(inchannels=inchannels) # NN.BatchNorm2d self.up = nn.Sequential(ResidualConv(inchannels=inchannels), nn.ConvTranspose2d(in_channels=inchannels, out_channels=outchannels, kernel_size=3, stride=2, padding=1, output_padding=1), nn.BatchNorm2d(num_features=outchannels), nn.ReLU(inplace=True)) def forward(self, lowfeat, highfeat): return self.up(highfeat + self.conv(lowfeat)) def init_params(self): for m in self.modules(): if isinstance(m, nn.Conv2d): # init.kaiming_normal_(m.weight, mode='fan_out') init.normal_(m.weight, std=0.01) # init.xavier_normal_(m.weight) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.ConvTranspose2d): # init.kaiming_normal_(m.weight, mode='fan_out') init.normal_(m.weight, std=0.01) # init.xavier_normal_(m.weight) if m.bias is not None: init.constant_(m.bias, 0) elif isinstance(m, nn.BatchNorm2d): # NN.BatchNorm2d init.constant_(m.weight, 1) init.constant_(m.bias, 0) elif isinstance(m, nn.Linear): init.normal_(m.weight, std=0.01) if m.bias is not None: init.constant_(m.bias, 0) class SenceUnderstand(nn.Module): def __init__(self, channels): super(SenceUnderstand, self).__init__() self.channels = channels self.conv1 = nn.Sequential(nn.Conv2d(in_channels=512, out_channels=512, kernel_size=3, padding=1), nn.ReLU(inplace=True)) self.pool = nn.AdaptiveAvgPool2d(8) self.fc = nn.Sequential(nn.Linear(512 * 8 * 8, self.channels), nn.ReLU(inplace=True)) self.conv2 = nn.Sequential( nn.Conv2d(in_channels=self.channels, out_channels=self.channels, kernel_size=1, padding=0), nn.ReLU(inplace=True)) self.initial_params() def forward(self, x): n, c, h, w = x.size() x = self.conv1(x) x = self.pool(x) x = x.view(n, -1) x = self.fc(x) x = x.view(n, self.channels, 1, 1) x = self.conv2(x) x = x.repeat(1, 1, h, w) return x def initial_params(self, dev=0.01): for m in self.modules(): if isinstance(m, nn.Conv2d): # print torch.sum(m.weight) m.weight.data.normal_(0, dev) if m.bias is not None: m.bias.data.fill_(0) elif isinstance(m, nn.ConvTranspose2d): # print torch.sum(m.weight) m.weight.data.normal_(0, dev) if m.bias is not None: m.bias.data.fill_(0) elif isinstance(m, nn.Linear): m.weight.data.normal_(0, dev) if __name__ == '__main__': net = DepthNet(depth=50, pretrained=True) print(net) inputs = torch.ones(4,3,128,128) out = net(inputs) print(out.size())
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
from __future__ import absolute_import from __future__ import division from __future__ import print_function from __future__ import unicode_literals from multiprocessing.sharedctypes import Value import os import six import yaml import copy import numpy as np from ast import literal_eval from lib.utils.collections import AttrDict from lib.utils.misc import get_run_name __C = AttrDict() # Consumers can get config by: cfg = __C # Root directory of project __C.ROOT_DIR = os.path.dirname(os.path.dirname(os.path.dirname(os.path.abspath(__file__)))) # ---------------------------------------------------------------------------- # # Data configurations # ---------------------------------------------------------------------------- # __C.DATASET = AttrDict() __C.DATASET.NAME = 'diversedepth' __C.DATASET.RGB_PIXEL_MEANS = (0.485, 0.456, 0.406) # (102.9801, 115.9465, 122.7717) __C.DATASET.RGB_PIXEL_VARS = (0.229, 0.224, 0.225) # (1, 1, 1) # Scale the depth map #__C.DATASET.DEPTH_SCALE = 10.0 __C.DATASET.CROP_SIZE = (448, 448) # (height, width) # Camera Parameters __C.DATASET.FOCAL_X = 256.0 __C.DATASET.FOCAL_Y = 256.0 # ---------------------------------------------------------------------------- # # Models configurations # ---------------------------------------------------------------------------- # __C.MODEL = AttrDict() __C.MODEL.INIT_TYPE = 'xavier' # Configure the model type for the encoder, e.g.ResNeXt50_32x4d_body_stride16 __C.MODEL.ENCODER = 'resnet50_stride32' __C.MODEL.MODEL_REPOSITORY = 'datasets/pretrained_model' __C.MODEL.PRETRAINED_WEIGHTS = 'resnext50_32x4d.pth' __C.MODEL.LOAD_IMAGENET_PRETRAINED_WEIGHTS = True # Configure resnext __C.MODEL.RESNET_BOTTLENECK_DIM = [64, 256, 512, 1024, 2048] __C.MODEL.RESNET_BLOCK_DIM = [64, 64, 128, 256, 512] # Configure the decoder __C.MODEL.FCN_DIM_IN = [512, 256, 256, 256, 256, 256] __C.MODEL.FCN_DIM_OUT = [256, 256, 256, 256, 256] __C.MODEL.LATERAL_OUT = [512, 256, 256, 256] # Configure input and output channel of the model __C.MODEL.ENCODER_INPUT_C = 3 __C.MODEL.DECODER_OUTPUT_C = 1 # Configure weight for different losses __C.MODEL.FREEZE_BACKBONE_BN = False #__C.MODEL.USE_SYNCBN = True __C.MODEL.DEVICE = "cuda" # ---------------------------------------------------------------------------- # # Training configurations # ---------------------------------------------------------------------------- # __C.TRAIN = AttrDict() # Load run name, which is the combination of running time and host name __C.TRAIN.RUN_NAME = get_run_name() __C.TRAIN.OUTPUT_DIR = './outputs' # Dir for checkpoint and logs __C.TRAIN.LOG_DIR = os.path.join(__C.TRAIN.OUTPUT_DIR, cfg.TRAIN.RUN_NAME) # Differ the learning rate between encoder and decoder __C.TRAIN.SCALE_DECODER_LR = 1 __C.TRAIN.BASE_LR = 0.001 __C.TRAIN.MAX_ITER = 0 # Set training epoches, end at the last epoch of list __C.TRAIN.EPOCH = 50 __C.TRAIN.MAX_ITER = 0 __C.TRAIN.LR_SCHEDULER_MULTISTEPS = [30000, 120000, 200000] __C.TRAIN.LR_SCHEDULER_GAMMA = 0.1 __C.TRAIN.WARMUP_FACTOR = 1.0 / 3 __C.TRAIN.WARMUP_ITERS = 500 # Need to change __C.TRAIN.WARMUP_METHOD = "linear" # Snapshot (model checkpoint) period __C.TRAIN.SNAPSHOT_ITERS = 5000 __C.TRAIN.VAL_STEP = 5000 __C.TRAIN.BATCHSIZE = 4 __C.TRAIN.GPU_NUM = 1 # Steps for LOG interval __C.TRAIN.LOG_INTERVAL = 10 __C.TRAIN.LOAD_CKPT = None # Configs for loss __C.TRAIN.LOSS_MODE = '_vnl_ssil_ranking_' __C.TRAIN.LOSS_AUXI_WEIGHT = 0.5 #__C.TRAIN.DIFF_LOSS_WEIGHT = 5 __C.TRAIN.OPTIM = 'SGD' def print_configs(cfg): import logging logger = logging.getLogger(__name__) message = '' message += '----------------- Configs ---------------\n' for k, kv in cfg.items(): if isinstance(kv, AttrDict): name1 = '.'.join(['cfg', k]) message += '{:>50}: \n'.format(name1) for k_, v_ in kv.items(): name2 = '.'.join([name1, k_]) message += '{:>50}: {:<30}\n'.format(str(name2), str(v_)) else: message += '{:>50}: {:<30}\n'.format(k, kv) message += '----------------- End -------------------' logger.info(message) def merge_cfg_from_file(train_args): """Load a yaml config file and merge it into the global config.""" # cfg_filename = train_args.cfg_file # cfg_file = os.path.join(__C.ROOT_DIR, cfg_filename + '.yaml') # with open(cfg_file, 'r') as f: # yaml_cfg = AttrDict(yaml.safe_load(f)) # _merge_a_into_b(yaml_cfg, __C) # __C.DATASET.DEPTH_MIN_LOG = np.log10(__C.DATASET.DEPTH_MIN) # # Modify some configs # __C.DATASET.DEPTH_BIN_INTERVAL = (np.log10(__C.DATASET.DEPTH_MAX) - np.log10( # __C.DATASET.DEPTH_MIN)) / __C.MODEL.DECODER_OUTPUT_C # # The boundary of each bin # __C.DATASET.DEPTH_BIN_BORDER = np.array([__C.DATASET.DEPTH_MIN_LOG + __C.DATASET.DEPTH_BIN_INTERVAL * (i + 0.5) # for i in range(__C.MODEL.DECODER_OUTPUT_C)]) # __C.DATASET.WCE_LOSS_WEIGHT = [[np.exp(-0.2 * (i - j) ** 2) for i in range(__C.MODEL.DECODER_OUTPUT_C)] # for j in np.arange(__C.MODEL.DECODER_OUTPUT_C)] if train_args.backbone == 'resnet50': __C.MODEL.ENCODER = 'resnet50_stride32' __C.MODEL.PRETRAINED_WEIGHTS = 'resnext50_32x4d.pth' elif train_args.backbone == 'resnext101': __C.MODEL.ENCODER = 'resnext101_stride32x8d' __C.MODEL.PRETRAINED_WEIGHTS = 'resnext101_stride32x8d.pth' else: raise ValueError for k, v in vars(train_args).items(): if k.upper() in __C.TRAIN.keys(): __C.TRAIN[k.upper()] = getattr(train_args, k) __C.TRAIN.LOG_DIR = os.path.join(__C.TRAIN.OUTPUT_DIR, cfg.TRAIN.RUN_NAME) def _merge_a_into_b(a, b, stack=None): """Merge config dictionary a into config dictionary b, clobbering the options in b whenever they are also specified in a. """ assert isinstance(a, AttrDict), 'Argument `a` must be an AttrDict' assert isinstance(b, AttrDict), 'Argument `b` must be an AttrDict' for k, v_ in a.items(): full_key = '.'.join(stack) + '.' + k if stack is not None else k # a must specify keys that are in b if k not in b: # if _key_is_deprecated(full_key): # continue # elif _key_is_renamed(full_key): # _raise_key_rename_error(full_key) # else: raise KeyError('Non-existent config key: {}'.format(full_key)) v = copy.deepcopy(v_) v = _decode_cfg_value(v) v = _check_and_coerce_cfg_value_type(v, b[k], k, full_key) # Recursively merge dicts if isinstance(v, AttrDict): try: stack_push = [k] if stack is None else stack + [k] _merge_a_into_b(v, b[k], stack=stack_push) except BaseException: raise else: b[k] = v def _decode_cfg_value(v): """Decodes a raw config value (e.g., from a yaml config files or command line argument) into a Python object. """ # Configs parsed from raw yaml will contain dictionary keys that need to be # converted to AttrDict objects if isinstance(v, dict): return AttrDict(v) # All remaining processing is only applied to strings if not isinstance(v, six.string_types): return v # Try to interpret `v` as a: # string, number, tuple, list, dict, boolean, or None try: v = literal_eval(v) # The following two excepts allow v to pass through when it represents a # string. # # Longer explanation: # The type of v is always a string (before calling literal_eval), but # sometimes it *represents* a string and other times a data structure, like # a list. In the case that v represents a string, what we got back from the # yaml parser is 'foo' *without quotes* (so, not '"foo"'). literal_eval is # ok with '"foo"', but will raise a ValueError if given 'foo'. In other # cases, like paths (v = 'foo/bar' and not v = '"foo/bar"'), literal_eval # will raise a SyntaxError. except ValueError: pass except SyntaxError: pass return v def _check_and_coerce_cfg_value_type(value_a, value_b, key, full_key): """Checks that `value_a`, which is intended to replace `value_b` is of the right type. The type is correct if it matches exactly or is one of a few cases in which the type can be easily coerced. """ # The types must match (with some exceptions) type_b = type(value_b) type_a = type(value_a) if type_a is type_b: return value_a # Exceptions: numpy arrays, strings, tuple<->list if isinstance(value_b, np.ndarray): value_a = np.array(value_a, dtype=value_b.dtype) elif isinstance(value_b, six.string_types): value_a = str(value_a) elif isinstance(value_a, tuple) and isinstance(value_b, list): value_a = list(value_a) elif isinstance(value_a, list) and isinstance(value_b, tuple): value_a = tuple(value_a) else: raise ValueError( 'Type mismatch ({} vs. {}) with values ({} vs. {}) for config ' 'key: {}'.format(type_b, type_a, value_b, value_a, full_key) ) return value_a
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
import importlib import os import dill import logging import cv2 import numpy as np import torch import torch.nn as nn import matplotlib.pyplot as plt from collections import OrderedDict from lib.configs.config import cfg logger = logging.getLogger(__name__) def get_func(func_name): """Helper to return a function object by name. func_name must identify a function in this module or the path to a function relative to the base 'modeling' module. """ if func_name == '': return None try: parts = func_name.split('.') # Refers to a function in this module if len(parts) == 1: return globals()[parts[0]] # Otherwise, assume we're referencing a module under modeling module_name = 'lib.models.' + '.'.join(parts[:-1]) module = importlib.import_module(module_name) return getattr(module, parts[-1]) except Exception: logger.error('Failed to f1ind function: %s', func_name) raise def load_ckpt(args, model, optimizer=None, scheduler=None, val_err=[]): """ Load checkpoint. """ if os.path.isfile(args.load_ckpt): logger.info("loading checkpoint %s", args.load_ckpt) checkpoint = torch.load(args.load_ckpt, map_location=lambda storage, loc: storage, pickle_module=dill) model_state_dict_keys = model.state_dict().keys() checkpoint_state_dict_noprefix = strip_prefix_if_present(checkpoint['model_state_dict'], "module.") if all(key.startswith('module.') for key in model_state_dict_keys): model.module.load_state_dict(checkpoint_state_dict_noprefix) else: model.load_state_dict(checkpoint_state_dict_noprefix) if args.resume: #args.batchsize = checkpoint['batch_size'] args.start_step = checkpoint['step'] args.start_epoch = checkpoint['epoch'] optimizer.load_state_dict(checkpoint['optimizer']) scheduler.load_state_dict(checkpoint['scheduler']) scheduler.__setattr__('last_epoch', checkpoint['step']) if 'val_err' in checkpoint: # For backward compatibility val_err[0] = checkpoint['val_err'] del checkpoint torch.cuda.empty_cache() def strip_prefix_if_present(state_dict, prefix): keys = sorted(state_dict.keys()) if not all(key.startswith(prefix) for key in keys): return state_dict stripped_state_dict = OrderedDict() for key, value in state_dict.items(): stripped_state_dict[key.replace(prefix, "")] = value return stripped_state_dict def save_ckpt(args, step, epoch, model, optimizer, scheduler, val_err={}): """Save checkpoint""" ckpt_dir = os.path.join(cfg.TRAIN.LOG_DIR, 'ckpt') if not os.path.exists(ckpt_dir): os.makedirs(ckpt_dir) save_name = os.path.join(ckpt_dir, 'epoch%d_step%d.pth' %(epoch, step)) if isinstance(model, nn.DataParallel): model = model.module torch.save({ 'step': step, 'epoch': epoch, 'batch_size': args.batchsize, 'scheduler': scheduler.state_dict(), 'val_err': val_err, 'model_state_dict': model.state_dict(), 'optimizer': optimizer.state_dict()}, save_name, pickle_module=dill) logger.info('save model: %s', save_name) # save image to the disk def save_images(data, pred, scale=60000.): rgb = data['A_raw'] gt = data['B_raw'] if type(rgb).__module__ != np.__name__: rgb = rgb.cpu().numpy() rgb = np.squeeze(rgb) rgb = rgb[:, :, ::-1] if type(gt).__module__ != np.__name__: gt = gt.cpu().numpy() gt = np.squeeze(gt) if type(pred).__module__ != np.__name__: pred = pred.cpu().numpy() pred = np.squeeze(pred) model_name = (cfg.DATA.LOAD_MODEL_NAME.split('/')[-1]).split('.')[0] image_dir = os.path.join(cfg.TRAIN.OUTPUT_ROOT_DIR, '../evaluation', model_name) if not os.path.exists(image_dir): os.makedirs(image_dir) if 'kitti' in cfg.DATASET: name = data['A_paths'][0].split('/')[-4] + '-' + data['A_paths'][0].split('/')[-1].split('.')[0] else: name = data['A_paths'][0].split('/')[-1].split('.')[0] rgb_name = '%s_%s.png' % (name, 'rgb') gt_name = '%s_%s.png' % (name, 'gt') gt_raw_name = '%s_%s.png' % (name, 'gt-raw') pred_name = '%s_%s.png' % (name, 'pred') pred_raw_name = '%s_%s.png' % (name, 'pred-raw') plt.imsave(os.path.join(image_dir, rgb_name), rgb) if len(data['B_raw'].shape) != 2: plt.imsave(os.path.join(image_dir, gt_name), gt, cmap='rainbow') gt_scale = gt * scale gt_scale = gt_scale.astype('uint16') cv2.imwrite(os.path.join(image_dir, gt_raw_name), gt_scale) plt.imsave(os.path.join(image_dir, pred_name), pred, cmap='rainbow') pred_raw = pred * scale pred_raw = pred_raw.astype('uint16') cv2.imwrite(os.path.join(image_dir, pred_raw_name), pred_raw)
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
"""Utilities for training.""" from __future__ import absolute_import from __future__ import division from __future__ import print_function from __future__ import unicode_literals from collections import defaultdict, OrderedDict import datetime from lib.configs.config import cfg from lib.utils.logging import log_stats from lib.utils.logging import SmoothedValue from lib.utils.timer import Timer class TrainingStats(object): """Track vital training statistics.""" def __init__(self, args, log_period=20, tensorboard_logger=None): # Output logging period in SGD iterations self.args = args self.log_period = log_period self.tblogger = tensorboard_logger self.tb_ignored_keys = ['iter', 'eta', 'epoch', 'time'] self.iter_timer = Timer() # Window size for smoothing tracked values (with median filtering) self.filter_size = log_period def create_smoothed_value(): return SmoothedValue(self.filter_size) self.smoothed_losses = defaultdict(create_smoothed_value) self.smoothed_metrics = defaultdict(create_smoothed_value) self.smoothed_total_loss = SmoothedValue(self.filter_size) def IterTic(self): self.iter_timer.tic() def IterToc(self): return self.iter_timer.toc(average=False) def ResetIterTimer(self): self.iter_timer.reset() def UpdateIterStats(self, loss): """Update tracked iteration statistics.""" total_loss = 0 for k in loss: # all losses except the total loss: loss['all'] if k != 'total_loss': self.smoothed_losses[k].AddValue(float(loss[k])) total_loss += loss['total_loss'] self.smoothed_total_loss.AddValue(float(total_loss)) def LogIterStats(self, cur_iter, cur_epoch, optimizer, val_err={}): """Log the tracked statistics.""" if (cur_iter % self.log_period == 0): stats = self.GetStats(cur_iter, cur_epoch, optimizer, val_err) log_stats(stats, self.args) if self.tblogger: self.tb_log_stats(stats, cur_iter) def tb_log_stats(self, stats, cur_iter): """Log the tracked statistics to tensorboard""" for k in stats: if k not in self.tb_ignored_keys: v = stats[k] if isinstance(v, dict): self.tb_log_stats(v, cur_iter) else: self.tblogger.add_scalar(k, v, cur_iter) def GetStats(self, cur_iter, cur_epoch, optimizer, val_err = {}): eta_seconds = self.iter_timer.average_time * ( cfg.TRAIN.MAX_ITER - cur_iter ) eta = str(datetime.timedelta(seconds=int(eta_seconds))) stats = OrderedDict( iter=cur_iter, # 1-indexed time=self.iter_timer.average_time, eta=eta, total_loss=self.smoothed_total_loss.GetMedianValue(), epoch=cur_epoch, ) optimizer_state_dict = optimizer.state_dict() lr = {} for i in range(len(optimizer_state_dict['param_groups'])): lr_name = 'group%d_lr' % i lr[lr_name] = optimizer_state_dict['param_groups'][i]['lr'] stats['lr'] = OrderedDict(lr) for k, v in self.smoothed_losses.items(): stats[k] = OrderedDict([(k, v.GetMedianValue())]) stats['val_err'] = OrderedDict(val_err) return stats
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
import os import socket from datetime import datetime def get_run_name(): """ A unique name for each run """ return datetime.now().strftime( '%b%d-%H-%M-%S') + '_' + socket.gethostname() IMG_EXTENSIONS = ['.jpg', '.jpeg', '.png', '.ppm', '.bmp', '.pgm'] def is_image_file(filename): """Checks if a file is an image. Args: filename (string): path to a file Returns: bool: True if the filename ends with a known image extension """ filename_lower = filename.lower() return any(filename_lower.endswith(ext) for ext in IMG_EXTENSIONS) def get_imagelist_from_dir(dirpath): images = [] for f in os.listdir(dirpath): if is_image_file(f): images.append(os.path.join(dirpath, f)) return images
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
""" This file contains primitives for multi-gpu communication. This is useful when doing distributed training. """ import pickle import torch import torch.distributed as dist def get_world_size(): if not dist.is_available(): return 1 if not dist.is_initialized(): return 1 return dist.get_world_size() def get_rank(): if not dist.is_available(): return 0 if not dist.is_initialized(): return 0 return dist.get_rank() def is_main_process(): return get_rank() == 0 def synchronize(): """ Helper function to synchronize (barrier) among all processes when using distributed training """ if not dist.is_available(): return if not dist.is_initialized(): return world_size = dist.get_world_size() if world_size == 1: return dist.barrier() def all_gather(data): """ Run all_gather on arbitrary picklable data (not necessarily tensors) Args: data: any picklable object Returns: list[data]: list of data gathered from each rank """ world_size = get_world_size() if world_size == 1: return [data] # serialized to a Tensor buffer = pickle.dumps(data) storage = torch.ByteStorage.from_buffer(buffer) tensor = torch.ByteTensor(storage).to("cuda") # obtain Tensor size of each rank local_size = torch.IntTensor([tensor.numel()]).to("cuda") size_list = [torch.IntTensor([0]).to("cuda") for _ in range(world_size)] dist.all_gather(size_list, local_size) size_list = [int(size.item()) for size in size_list] max_size = max(size_list) # receiving Tensor from all ranks # we pad the tensor because torch all_gather does not support # gathering tensors of different shapes tensor_list = [] for _ in size_list: tensor_list.append(torch.ByteTensor(size=(max_size,)).to("cuda")) if local_size != max_size: padding = torch.ByteTensor(size=(max_size - local_size,)).to("cuda") tensor = torch.cat((tensor, padding), dim=0) dist.all_gather(tensor_list, tensor) data_list = [] for size, tensor in zip(size_list, tensor_list): buffer = tensor.cpu().numpy().tobytes()[:size] data_list.append(pickle.loads(buffer)) return data_list def reduce_dict(input_dict, average=True): """ Args: input_dict (dict): all the values will be reduced average (bool): whether to do average or sum Reduce the values in the dictionary from all processes so that process with rank 0 has the averaged results. Returns a dict with the same fields as input_dict, after reduction. """ world_size = get_world_size() if world_size < 2: return input_dict with torch.no_grad(): names = [] values = [] # sort the keys so that they are consistent across processes for k in sorted(input_dict.keys()): names.append(k) values.append(input_dict[k]) values = torch.stack(values, dim=0) dist.reduce(values, dst=0) if dist.get_rank() == 0 and average: # only main process gets accumulated, so only divide by # world_size in this case values /= world_size reduced_dict = {k: v for k, v in zip(names, values)} return reduced_dict def is_pytorch_1_1_0_or_later(): return [int(_) for _ in torch.__version__.split("+")[0].split(".")[:3]] >= [1, 1, 0]
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
"""Utilities for logging.""" from __future__ import absolute_import from __future__ import division from __future__ import print_function from __future__ import unicode_literals from collections import deque import logging import numpy as np import sys import os from lib.configs.config import cfg def log_stats(stats, args): logger = logging.getLogger(__name__) """Log training statistics to terminal""" lines = "[Step %d/%d] [Epoch %d/%d] [%s]\n" % ( stats['iter'], cfg.TRAIN.MAX_ITER, stats['epoch'], args.epoch, args.dataset) lines += "\t\tloss: %.3f, time: %.6f, eta: %s\n" % ( stats['total_loss'], stats['time'], stats['eta']) for k in stats: if 'loss' in k and 'total_loss' not in k: lines += "\t\t" + ", ".join("%s: %.3f" % (k, v) for k, v in stats[k].items()) + ", " # validate criteria lines += "\t\t" + ", ".join("%s: %.6f" % (k, v) for k, v in stats['val_err'].items()) + ", " lines += '\n' # lr in different groups lines += "\t\t" + ", ".join("%s: %.6f" % (k, v) for k, v in stats['lr'].items()) + ", " lines += '\n' logger.info(lines[:-1]) # remove last new linen_pxl class SmoothedValue(object): """Track a series of values and provide access to smoothed values over a window or the global series average. """ def __init__(self, window_size): self.deque = deque(maxlen=window_size) self.series = [] self.total = 0.0 self.count = 0 def AddValue(self, value, size=1): self.deque.append(value) self.series.append(value) self.count += size self.total += value def GetMedianValue(self): return np.median(self.deque) def GetAverageValue(self): return np.mean(self.deque) def GetGlobalAverageValue(self): return self.total / self.count def ClearValue(self): self.count = 0 self.total = 0 def setup_logging(name): FORMAT = '%(levelname)s %(filename)s:%(lineno)4d: %(message)s' # Manually clear root loggers to prevent any module that may have called # logging.basicConfig() from blocking our logging setup logging.root.handlers = [] logging.basicConfig(level=logging.INFO, format=FORMAT, stream=sys.stdout) logger = logging.getLogger(name) return logger def setup_distributed_logger(name, save_dir, distributed_rank, filename="log.txt"): logger = logging.getLogger(name) logger.setLevel(logging.DEBUG) # don't log results for the non-master process if distributed_rank > 0: return logger ch = logging.StreamHandler(stream=sys.stdout) ch.setLevel(logging.DEBUG) formatter = logging.Formatter("%(asctime)s %(name)s %(levelname)s: %(message)s") ch.setFormatter(formatter) logger.addHandler(ch) if save_dir: fh = logging.FileHandler(os.path.join(save_dir, filename)) fh.setLevel(logging.DEBUG) fh.setFormatter(formatter) logger.addHandler(fh) return logger
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
import torch from bisect import bisect_right def make_lr_scheduler(cfg, optimizer): return WarmupMultiStepLR( optimizer, cfg.TRAIN.LR_SCHEDULER_MULTISTEPS, cfg.TRAIN.LR_SCHEDULER_GAMMA, warmup_factor=cfg.TRAIN.WARMUP_FACTOR, warmup_iters=cfg.TRAIN.WARMUP_ITERS, warmup_method=cfg.TRAIN.WARMUP_METHOD, ) class WarmupMultiStepLR(torch.optim.lr_scheduler._LRScheduler): def __init__( self, optimizer, milestones, gamma=0.1, warmup_factor=1.0 / 3, warmup_iters=500, warmup_method="linear", last_epoch=-1, ): if not list(milestones) == sorted(milestones): raise ValueError( "Milestones should be a list of" " increasing integers. Got {}", milestones, ) if warmup_method not in ("constant", "linear"): raise ValueError( "Only 'constant' or 'linear' warmup_method accepted" "got {}".format(warmup_method) ) self.milestones = milestones self.gamma = gamma self.warmup_factor = warmup_factor self.warmup_iters = warmup_iters self.warmup_method = warmup_method super(WarmupMultiStepLR, self).__init__(optimizer, last_epoch) def get_lr(self): warmup_factor = 1 if self.last_epoch < self.warmup_iters: if self.warmup_method == "constant": warmup_factor = self.warmup_factor elif self.warmup_method == "linear": alpha = float(self.last_epoch) / self.warmup_iters warmup_factor = self.warmup_factor * (1 - alpha) + alpha return [ base_lr * warmup_factor * self.gamma ** bisect_right(self.milestones, self.last_epoch) for base_lr in self.base_lrs ]
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
from __future__ import absolute_import from __future__ import division from __future__ import print_function from __future__ import unicode_literals import time class Timer(object): """A simple timer.""" def __init__(self): self.reset() def tic(self): # using time.time instead of time.clock because time time.clock # does not normalize for multithreading self.start_time = time.time() def toc(self, average=True): self.diff = time.time() - self.start_time self.total_time += self.diff self.calls += 1 self.average_time = self.total_time / self.calls if average: return self.average_time else: return self.diff def reset(self): self.total_time = 0. self.calls = 0 self.start_time = 0. self.diff = 0. self.average_time = 0.
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
"""A simple attribute dictionary used for representing configuration options.""" from __future__ import absolute_import from __future__ import division from __future__ import print_function from __future__ import unicode_literals class AttrDict(dict): IMMUTABLE = '__immutable__' def __init__(self, *args, **kwargs): super(AttrDict, self).__init__(*args, **kwargs) self.__dict__[AttrDict.IMMUTABLE] = False def __getattr__(self, name): if name in self.__dict__: return self.__dict__[name] elif name in self: return self[name] else: raise AttributeError(name) def __setattr__(self, name, value): if not self.__dict__[AttrDict.IMMUTABLE]: if name in self.__dict__: self.__dict__[name] = value else: self[name] = value else: raise AttributeError( 'Attempted to set "{}" to "{}", but AttrDict is immutable'. format(name, value) ) def immutable(self, is_immutable): """Set immutability to is_immutable and recursively apply the setting to all nested AttrDicts. """ self.__dict__[AttrDict.IMMUTABLE] = is_immutable # Recursively set immutable state for v in self.__dict__.values(): if isinstance(v, AttrDict): v.immutable(is_immutable) for v in self.values(): if isinstance(v, AttrDict): v.immutable(is_immutable) def is_immutable(self): return self.__dict__[AttrDict.IMMUTABLE]
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
import logging import torch import numpy as np logger = logging.getLogger(__name__) def recover_metric_depth(pred, gt, mask0=None): if type(pred).__module__ == torch.__name__: pred = pred.cpu().numpy() if type(gt).__module__ == torch.__name__: gt = gt.cpu().numpy() gt = gt.squeeze() pred = pred.squeeze() mask = (gt > 1e-8) #& (pred > 1e-8) if mask0 is not None and mask0.sum() > 0: if type(mask0).__module__ == torch.__name__: mask0 = mask0.cpu().numpy() mask0 = mask0.squeeze() mask0 = mask0 > 0 mask = mask & mask0 gt_mask = gt[mask] pred_mask = pred[mask] a, b = np.polyfit(pred_mask, gt_mask, deg=1) if a > 0: pred_metric = a * pred + b else: pred_mean = np.mean(pred_mask) gt_mean = np.mean(gt_mask) pred_metric = pred * (gt_mean / pred_mean) return pred_metric def validate_rel_depth_err(pred, gt, smoothed_criteria, mask=None, scale=10.): if type(pred).__module__ == torch.__name__: pred = pred.cpu().numpy() if type(gt).__module__ == torch.__name__: gt = gt.cpu().numpy() gt = np.squeeze(gt) pred = np.squeeze(pred) if mask is not None: gt = gt[mask[0]:mask[1], mask[2]:mask[3]] pred = pred[mask[0]:mask[1], mask[2]:mask[3]] if pred.shape != gt.shape: logger.info('The shapes of dt and gt are not same!') return -1 mask2 = gt > 0 gt = gt[mask2] pred = pred[mask2] # invalid evaluation image if gt.size < 10: return smoothed_criteria # Scale matching #pred = recover_metric_depth(pred, gt) n_pxl = gt.size gt_scale = gt * scale pred_scale = pred * scale # Mean Absolute Relative Error rel = np.abs(gt_scale - pred_scale) / gt_scale # compute errors abs_rel_sum = np.sum(rel) smoothed_criteria['err_absRel'].AddValue(np.float64(abs_rel_sum), n_pxl) # WHDR error whdr_err_sum, eval_num = weighted_human_disagreement_rate(gt_scale, pred_scale) smoothed_criteria['err_whdr'].AddValue(np.float64(whdr_err_sum), eval_num) return smoothed_criteria def evaluate_rel_err(pred, gt, smoothed_criteria, mask_invalid=None, scale=10.0 ): if type(pred).__module__ != np.__name__: pred = pred.cpu().numpy() if type(gt).__module__ != np.__name__: gt = gt.cpu().numpy() pred = np.squeeze(pred) gt = np.squeeze(gt) if pred.shape != gt.shape: logger.info('The shapes of dt and gt are not same!') return -1 if mask_invalid is not None: gt = gt[~mask_invalid] pred = pred[~mask_invalid] mask = (gt > 1e-9) & (pred > 1e-9) gt = gt[mask] pred = pred[mask] n_pxl = gt.size gt_scale = gt * scale pred_scale = pred * scale # invalid evaluation image if gt_scale.size < 10: print('Valid pixel size:', gt_scale.size, 'Invalid evaluation!!!!') return smoothed_criteria #Mean Absolute Relative Error rel = np.abs(gt - pred) / gt# compute errors abs_rel_sum = np.sum(rel) smoothed_criteria['err_absRel'].AddValue(np.float64(abs_rel_sum), n_pxl) #Square Mean Relative Error s_rel = ((gt_scale - pred_scale) * (gt_scale - pred_scale)) / (gt_scale * gt_scale)# compute errors squa_rel_sum = np.sum(s_rel) smoothed_criteria['err_squaRel'].AddValue(np.float64(squa_rel_sum), n_pxl) #Root Mean Square error square = (gt_scale - pred_scale) ** 2 rms_squa_sum = np.sum(square) smoothed_criteria['err_rms'].AddValue(np.float64(rms_squa_sum), n_pxl) #Log Root Mean Square error log_square = (np.log(gt_scale) - np.log(pred_scale)) **2 log_rms_sum = np.sum(log_square) smoothed_criteria['err_logRms'].AddValue(np.float64(log_rms_sum), n_pxl) # Scale invariant error diff_log = np.log(pred_scale) - np.log(gt_scale) diff_log_sum = np.sum(diff_log) smoothed_criteria['err_silog'].AddValue(np.float64(diff_log_sum), n_pxl) diff_log_2 = diff_log ** 2 diff_log_2_sum = np.sum(diff_log_2) smoothed_criteria['err_silog2'].AddValue(np.float64(diff_log_2_sum), n_pxl) # Mean log10 error log10_sum = np.sum(np.abs(np.log10(gt) - np.log10(pred))) smoothed_criteria['err_log10'].AddValue(np.float64(log10_sum), n_pxl) #Delta gt_pred = gt_scale / pred_scale pred_gt = pred_scale / gt_scale gt_pred = np.reshape(gt_pred, (1, -1)) pred_gt = np.reshape(pred_gt, (1, -1)) gt_pred_gt = np.concatenate((gt_pred, pred_gt), axis=0) ratio_max = np.amax(gt_pred_gt, axis=0) delta_1_sum = np.sum(ratio_max < 1.25) smoothed_criteria['err_delta1'].AddValue(np.float64(delta_1_sum), n_pxl) delta_2_sum = np.sum(ratio_max < 1.25**2) smoothed_criteria['err_delta2'].AddValue(np.float64(delta_2_sum), n_pxl) delta_3_sum = np.sum(ratio_max < 1.25**3) smoothed_criteria['err_delta3'].AddValue(np.float64(delta_3_sum), n_pxl) # WHDR error whdr_err_sum, eval_num = weighted_human_disagreement_rate(gt_scale, pred_scale) smoothed_criteria['err_whdr'].AddValue(np.float64(whdr_err_sum), eval_num) return smoothed_criteria def weighted_human_disagreement_rate(gt, pred): p12_index = select_index(gt) gt_reshape = np.reshape(gt, gt.size) pred_reshape = np.reshape(pred, pred.size) mask = gt > 0 gt_p1 = gt_reshape[mask][p12_index['p1']] gt_p2 = gt_reshape[mask][p12_index['p2']] pred_p1 = pred_reshape[mask][p12_index['p1']] pred_p2 = pred_reshape[mask][p12_index['p2']] p12_rank_gt = np.zeros_like(gt_p1) p12_rank_gt[gt_p1 > gt_p2] = 1 p12_rank_gt[gt_p1 < gt_p2] = -1 p12_rank_pred = np.zeros_like(gt_p1) p12_rank_pred[pred_p1 > pred_p2] = 1 p12_rank_pred[pred_p1 < pred_p2] = -1 err = np.sum(p12_rank_gt != p12_rank_pred) valid_pixels = gt_p1.size return err, valid_pixels def select_index(gt_depth, select_size=10000): valid_size = np.sum(gt_depth>0) try: p = np.random.choice(valid_size, select_size*2, replace=False) except: p = np.random.choice(valid_size, select_size*2*2, replace=True) np.random.shuffle(p) p1 = p[0:select_size*2:2] p2 = p[1:select_size*2:2] p12_index = {'p1': p1, 'p2': p2} return p12_index
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }
import importlib import math import logging import numpy as np import torch.utils.data import torch.distributed as dist logger = logging.getLogger(__name__) # class MultipleDataLoaderDistributed(): # def __init__(self, opt, sample_ratio=0.1): # self.opt = opt # self.multi_datasets, self.dataset_indices_list = create_multiple_dataset(opt) # self.datasizes = [len(dataset) for dataset in self.multi_datasets] # self.merged_dataset = torch.utils.data.ConcatDataset(self.multi_datasets) # #self.custom_multi_sampler_dist = CustomerMultiDataSamples(self.dataset_indices_list, sample_ratio, self.opt) # self.custom_multi_sampler_dist = CustomerMultiDataSampler(opt, self.merged_dataset, opt.world_size, opt.phase) # self.curr_sample_size = self.custom_multi_sampler_dist.num_samples # self.dist_sample_size = self.custom_multi_sampler_dist.num_dist_samples # self.dataloader = torch.utils.data.DataLoader( # dataset=self.merged_dataset, # batch_size=opt.batchsize, # num_workers=opt.thread, # sampler=self.custom_multi_sampler_dist, # drop_last=True) # # def load_data(self): # return self # # def __len__(self): # return np.sum(self.datasizes) # # def __iter__(self): # for i, data in enumerate(self.dataloader): # if i * self.opt.batchsize >= float("inf"): # break # yield data def MultipleDataLoaderDistributed(opt, sample_ratio=1): opt = opt #multi_datasets, dataset_indices_list = create_multiple_dataset(opt) multi_datasets = create_multiple_dataset(opt) #multi_datasizes = [len(dataset) for dataset in multi_datasets] merged_dataset = torch.utils.data.ConcatDataset(multi_datasets) #custom_multi_sampler_dist = CustomerMultiDataSamples(dataset_indices_list, sample_ratio, opt) custom_multi_sampler_dist = CustomerMultiDataSampler(opt, merged_dataset, opt.world_size, opt.phase) curr_sample_size = custom_multi_sampler_dist.num_samples dist_sample_size = custom_multi_sampler_dist.num_dist_samples dataloader = torch.utils.data.DataLoader( dataset=merged_dataset, batch_size=opt.batchsize, num_workers=opt.thread, sampler=custom_multi_sampler_dist, drop_last=True) return dataloader, curr_sample_size class CustomerMultiDataSampler(torch.utils.data.Sampler): """ Construct a sample method. Sample former ratio_samples of datasets randomly. """ def __init__(self, args, multi_dataset, num_replicas, split, sample_ratio=1.0): self.args = args self.num_replicas = num_replicas self.phase = split self.rank = args.global_rank #self.logger = logger self.multi_dataset = multi_dataset self.create_samplers() self.num_indices = np.array([len(i) for i in self.extended_indices_list]) #self.num_samples = self.num_indices.astype(np.uint32) self.num_samples = (self.num_indices * sample_ratio).astype(np.uint32) self.max_indices = np.array([max(i) for i in self.extended_indices_list]) self.total_sampled_size = np.sum(self.num_samples) self.num_dist_samples = int( math.ceil(self.total_sampled_size * 1.0 / self.num_replicas) ) self.total_dist_size = self.num_dist_samples * self.num_replicas logstr = ",".join(["%s sampled data size: %d" % (args.dataset_list[i], self.num_samples[i]) for i in range(self.num_indices.size)] ) logger.info(logstr) def __iter__(self): self.create_samplers() cum_sum = np.cumsum(np.append([0], self.max_indices)) indices_array = [[self.extended_indices_list[data_i][i] + cum_sum[data_i] for i in range(int(num))]for data_i, num in enumerate(self.num_samples)] if "train" in self.phase: # data list is mapped to the order [A, B, C, A, B, C....] indices_array = np.array(indices_array).transpose(1, 0).reshape(-1) else: indices_array = np.concatenate(indices_array[:]) # add extra samples to make it evenly divisible diff_size = int(self.total_dist_size - self.total_sampled_size) if diff_size > 0: extended_indices_dist = np.append(indices_array, indices_array[:diff_size]) else: extended_indices_dist = indices_array assert extended_indices_dist.size == self.total_dist_size # subsample offset = self.num_dist_samples * self.rank rank_indices = extended_indices_dist[offset : offset + self.num_dist_samples] assert rank_indices.size == self.num_dist_samples for id in rank_indices: yield id def __len__(self): return self.total_sampled_size def create_samplers(self): self.extended_indices_list = [] dataset_indices_lists = [] indices_len = [] datasets_num = len(self.multi_dataset.datasets) for dataset_i in self.multi_dataset.datasets: # The list of indices of each dataset dataset_indices_lists.append(np.random.permutation(np.arange(len(dataset_i.curriculum_list)))) indices_len.append(len(dataset_i.curriculum_list)) # the max size of all datasets max_len = np.max(indices_len) if "train" == self.phase: for data_list in dataset_indices_lists: cp = max_len // data_list.size size_i = data_list.size tmp = data_list for i in range(cp-1): tmp = np.concatenate((tmp, np.random.permutation(data_list)), axis=None) tmp = np.concatenate((tmp, np.random.choice(data_list, max_len % size_i, replace=False)), axis=None) self.extended_indices_list.append(list(tmp)) else: self.extended_indices_list = dataset_indices_lists logstr = "\n".join(["Split %s, %s: %d -(extend to)-> %d" % (self.phase, self.args.dataset_list[i], len(dataset_indices_lists[i]), len(self.extended_indices_list[i])) for i in range(datasets_num)] ) logger.info(logstr) # class CustomerMultiDataSamples(torch.utils.data.Sampler): # """ # Construct a sample method. Sample former ratio_samples of datasets randomly. # """ # def __init__(self, multi_data_indices, ratio_samples, opt, rank=None, num_replicas=None): # logger = logging.getLogger(__name__) # self.multi_data_indices = multi_data_indices # self.num_indices = np.array([len(i) for i in self.multi_data_indices]) # self.num_samples = (self.num_indices * ratio_samples).astype(np.uint32) # self.max_indices = np.array([max(i) for i in self.multi_data_indices]) # self.total_sampled_size = np.sum(self.num_samples) # self.phase = opt.phase # if num_replicas is None: # if not dist.is_available(): # raise RuntimeError("Requires distributed package to be available") # num_replicas = dist.get_world_size() # self.num_replicas = num_replicas # if rank is None: # if not dist.is_available(): # raise RuntimeError("Requires distributed package to be available") # rank = dist.get_rank() # self.rank = rank # self.num_dist_samples = int(math.ceil(self.total_sampled_size * 1.0 / self.num_replicas)) # self.total_dist_size = self.num_dist_samples * self.num_replicas # logger.info('Sample %02f, sampled dataset sizes are %s' % (ratio_samples, ','.join(map(str, self.num_samples)))) # def __iter__(self): # cum_sum = np.cumsum(np.append([0], self.max_indices)) # if 'train' in self.phase: # indices_array = [[self.multi_data_indices[idx][i] + cum_sum[idx] for i in torch.randperm(int(num))] for # idx, num in # enumerate(self.num_samples)] # else: # indices_array = [[self.multi_data_indices[idx][i] + cum_sum[idx] for i in range(int(num))] for # idx, num in enumerate(self.num_samples)] # if 'train' in self.phase: # # data list is reshaped in [A, B, C, A, B, C....] # indices_array = np.array(indices_array).transpose(1, 0).reshape(-1) # else: # indices_array = np.concatenate(indices_array[:]) # # add extra samples to make it evenly divisible # diff_size = int(self.total_dist_size - self.total_sampled_size) # if diff_size > 0: # extended_indices_dist = np.append(indices_array, indices_array[:diff_size]) # else: # extended_indices_dist = indices_array # assert extended_indices_dist.size == self.total_dist_size # # subsample # offset = self.num_dist_samples * self.rank # rank_indices = extended_indices_dist[offset: offset + self.num_dist_samples] # assert rank_indices.size == self.num_dist_samples # return iter(rank_indices) # def create_dataset(opt): # logger = logging.getLogger(__name__) # dataset = find_dataset_lib(opt.dataset)() # dataset.initialize(opt) # logger.info("%s is created." % opt.dataset) # return dataset def create_multiple_dataset(opt): all_datasets = [] dataset_indices_lists = [] indices_len = [] for name in opt.dataset_list: dataset = find_dataset_lib(opt.dataset)(opt, name) #dataset.initialize(opt, name) logger.info("%s : %s is loaded, the data size is %d" % (opt.phase, name, len(dataset))) all_datasets.append(dataset) assert dataset.curriculum_list is not None, "Curriculum is None!!!" dataset_indices_lists.append(dataset.curriculum_list) indices_len.append(len(dataset.curriculum_list)) assert len(dataset.curriculum_list) == dataset.data_size, "Curriculum list size not equal the data size!!!" max_len = np.max(indices_len) # if 'train' in opt.phase: # extended_indices_list = [i * (max_len // len(i)) + list(np.random.choice(i, max_len % len(i), replace=False)) for i in dataset_indices_lists] # #extended_indices_list = [i + list(np.random.choice(i, max_len-len(i))) for i in dataset_indices_lists] # else: # extended_indices_list = dataset_indices_lists logger.info("%s are merged!" % opt.dataset_list) return all_datasets#, extended_indices_list def find_dataset_lib(dataset_name): """ Give the option --dataset [datasetname], import "data/datasetname_dataset.py" :param dataset_name: --dataset :return: "data/datasetname_dataset.py" """ logger = logging.getLogger(__name__) dataset_filename = "data." + dataset_name + "_dataset" datasetlib = importlib.import_module(dataset_filename) dataset = None target_dataset_name = dataset_name.replace('_', '') + 'dataset' for name, cls in datasetlib.__dict__.items(): if name.lower() == target_dataset_name.lower(): dataset = cls if dataset is None: logger.info("In %s.py, there should be a class name that matches %s in lowercase." % ( dataset_filename, target_dataset_name)) exit(0) return dataset
{ "repo_name": "aim-uofa/AdelaiDepth", "stars": "926", "repo_language": "Python", "file_name": "train.py", "mime_type": "text/x-script.python" }